diff --git a/src/blender_addon/io_mesh_msh2/__init__.py b/src/blender_addon/io_mesh_msh2/__init__.py
new file mode 100644
index 0000000..228e766
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/__init__.py
@@ -0,0 +1,228 @@
+# ##### BEGIN GPL LICENSE BLOCK #####
+#
+#  This program is free software; you can redistribute it and/or
+#  modify it under the terms of the GNU General Public License version 2
+#  as published by the Free Software Foundation.
+#
+#  This program is distributed in the hope that it will be useful,
+#  but WITHOUT ANY WARRANTY; without even the implied warranty of
+#  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+#  GNU General Public License for more details.
+#
+#  You should have received a copy of the GNU General Public License
+#  along with this program; if not, write to the Free Software Foundation,
+#  Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+#
+
+
+from .msh2 import msh2
+
+
+msh     = msh2.MSH2(None)
+bl_info = {
+    "name": "Zero Editor MSH2 format",
+    "author": "Maxim Stewart",
+    "version": (0, 0, 1),
+    "blender": (2, 74, 0),
+    "location": "File > Import-Export",
+    "description": "Import-Export Zero Editor MSH2 models, meshs, and textures",
+    "warning": "",
+    "wiki_url": "https://schlechtwetterfront.github.io/ze_filetypes/msh.html",
+    "category": "Import-Export"}
+
+if "bpy" in locals():
+    import importlib
+    if "import_msh2" in locals():
+        importlib.reload(import_msh2)
+    if "export_msh2" in locals():
+        importlib.reload(export_msh2)
+
+
+import bpy
+from bpy.props import (
+        CollectionProperty,
+        BoolProperty,
+        FloatProperty,
+        StringProperty,
+        EnumProperty,
+        )
+from bpy_extras.io_utils import (
+        ImportHelper,
+        ExportHelper,
+        orientation_helper_factory,
+        path_reference_mode,
+        axis_conversion,
+        )
+
+from bpy.types import OperatorFileListElement
+
+# NOTE: NEED to see what ZERO Engine uses as forward
+IOOBJOrientationHelper = orientation_helper_factory("IOOBJOrientationHelper", axis_forward='-Z', axis_up='Y')
+
+
+class ImportMSH2(bpy.types.Operator, ImportHelper, IOOBJOrientationHelper):
+    """Load a MSH2 File"""
+    bl_idname  = "import_zero_editor_msh2.msh"
+    bl_label   = "Zero Editor Import MSH2"
+    bl_options = {'REGISTER', 'UNDO'}
+
+    filename_ext = ".msh"
+    filter_glob  = StringProperty(
+            default = "*.msh;*.tga",
+            options = {'HIDDEN'},
+            )
+
+    files = CollectionProperty(
+            name="File Path",
+            type=OperatorFileListElement,
+            )
+    directory = StringProperty(
+            subtype='DIR_PATH',
+            )
+
+
+    use_image_search = BoolProperty(
+            name="Image Search",
+            description="Search subdirs for any associated images "
+                        "(Warning, may be slow)",
+            default=True,
+            )
+
+    def execute(self, context):
+        keywords = self.as_keywords(ignore=("axis_forward",
+                                            "axis_up",
+                                            "filter_glob",
+                                            "split_mode",
+                                            ))
+
+        keywords["use_cycles"] = (context.scene.render.engine == 'CYCLES')
+        if bpy.data.is_saved and context.user_preferences.filepaths.use_relative_paths:
+            import os
+            keywords["relpath"] = os.path.dirname(bpy.data.filepath)
+
+        data = {**keywords}
+        msh.import_file(data["filepath"])
+        return {'FINISHED'}
+
+
+    # def draw(self, context):
+    #     layout = self.layout
+    #
+    #     row = layout.row(align=True)
+    #     row.prop(self, "use_smooth_groups")
+    #     row.prop(self, "use_edges")
+    #
+    #     box = layout.box()
+    #     row = box.row()
+    #     row.prop(self, "split_mode", expand=True)
+    #
+    #     row = box.row()
+    #     if self.split_mode == 'ON':
+    #         row.label(text="Split by:")
+    #         row.prop(self, "use_split_objects")
+    #         row.prop(self, "use_split_groups")
+    #     else:
+    #         row.prop(self, "use_groups_as_vgroups")
+    #
+    #     row = layout.split(percentage=0.67)
+    #     row.prop(self, "global_clamp_size")
+    #     layout.prop(self, "axis_forward")
+    #     layout.prop(self, "axis_up")
+    #
+    #     layout.prop(self, "use_image_search")
+
+
+class ExportMSH2(bpy.types.Operator, ExportHelper, IOOBJOrientationHelper):
+    """Save a MSH2 File"""
+
+    bl_idname  = "export_zero_editor_msh2.msh"
+    bl_label   = 'Zero Editor Export MSH2'
+
+    # # context group
+    filename_ext = ".msh"
+    filter_glob  = StringProperty(
+            default = "*.msh;*.tga",
+            options = {'HIDDEN'},
+            )
+
+    use_selection = BoolProperty(
+            name  = "Selection Only",
+            description = "Export selected objects only",
+            default = False,
+            )
+
+    use_animation = BoolProperty(
+            name="Animation",
+            description="Write out an OBJ for each frame",
+            default=False,
+            )
+
+    use_uvs = BoolProperty(
+            name="Include UVs",
+            description="Write out the active UV coordinates",
+            default=True,
+            )
+    use_materials = BoolProperty(
+            name="Write Materials",
+            description="Write out the MTL file",
+            default=True,
+            )
+    use_triangles = BoolProperty(
+            name="Triangulate Faces",
+            description="Convert all faces to triangles",
+            default=False,
+            )
+
+    def execute(self, context):
+        keywords = self.as_keywords(ignore=("axis_forward",
+                                            "axis_up",
+                                            "global_scale",
+                                            "check_existing",
+                                            "filter_glob",
+                                            ))
+        data = {**keywords}
+        # msh.export_file()
+        # print("")
+        # print("")
+        # print(context)
+        # print("")
+        # print("")
+        msh.export_file(data["filepath"])
+        return {'FINISHED'}
+
+
+
+
+
+classes = (
+    ImportMSH2,
+    ExportMSH2,
+)
+
+
+def menu_import(self, context):
+    self.layout.operator(ImportMSH2.bl_idname, text="Zero Editor MSH2 (.msh)")
+
+
+def menu_export(self, context):
+    self.layout.operator(ExportMSH2.bl_idname, text="Zero Editor MSH2 (.msh)")
+
+
+def register():
+    for cls in classes:
+        bpy.utils.register_class(cls)
+
+    bpy.types.INFO_MT_file_import.append(menu_import)
+    bpy.types.INFO_MT_file_export.append(menu_export)
+
+
+def unregister():
+    bpy.types.INFO_MT_file_import.remove(menu_import)
+    bpy.types.INFO_MT_file_export.remove(menu_export)
+
+    for cls in classes:
+        bpy.utils.unregister_class(cls)
+
+
+if __name__ == "__main__":
+    register()
diff --git a/src/blender_addon/io_mesh_msh2/cli.py b/src/blender_addon/io_mesh_msh2/cli.py
new file mode 100644
index 0000000..9632341
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/cli.py
@@ -0,0 +1,13 @@
+# from msh2.MSH2 import MSH2
+#
+# msh2 = MSH2(None)
+
+
+from msh2 import msh2
+
+
+msh     = msh2.MSH2(None)
+
+msh.import_file("../../msh/all_weap_inf_lightsabre.msh")
+
+# msh.export_file("all_weap_inf_lightsabre.msh")
diff --git a/src/blender_addon/io_mesh_msh2/export_msh2.py b/src/blender_addon/io_mesh_msh2/export_msh2.py
new file mode 100644
index 0000000..91e9f2f
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/export_msh2.py
@@ -0,0 +1,74 @@
+# ##### BEGIN GPL LICENSE BLOCK #####
+#
+#  This program is free software; you can redistribute it and/or
+#  modify it under the terms of the GNU General Public License version 2
+#  as published by the Free Software Foundation.
+#
+#  This program is distributed in the hope that it will be useful,
+#  but WITHOUT ANY WARRANTY; without even the implied warranty of
+#  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+#  GNU General Public License for more details.
+#
+#  You should have received a copy of the GNU General Public License
+#  along with this program; if not, write to the Free Software Foundation,
+#  Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+"""
+This script exports a MSH2 file from Blender.
+
+Usage:
+Run this script from "File->Export" menu and then MSH2 file.
+Note, This exports mesh objects and materials only, nurbs and curves are not supported.
+
+https://schlechtwetterfront.github.io/ze_filetypes/msh.html
+"""
+
+
+# def save(context,
+#          filepath,
+#          *,
+#          use_triangles=False,
+#          use_edges=True,
+#          use_normals=False,
+#          use_smooth_groups=False,
+#          use_smooth_groups_bitflags=False,
+#          use_uvs=True,
+#          use_materials=True,
+#          use_mesh_modifiers=True,
+#          use_mesh_modifiers_render=False,
+#          use_blen_objects=True,
+#          group_by_object=False,
+#          group_by_material=False,
+#          keep_vertex_order=False,
+#          use_vertex_groups=False,
+#          use_nurbs=True,
+#          use_selection=True,
+#          use_animation=False,
+#          global_matrix=None,
+#          path_mode='AUTO'
+#          ):
+#
+#     _write(context, filepath,
+#            EXPORT_TRI=use_triangles,
+#            EXPORT_EDGES=use_edges,
+#            EXPORT_SMOOTH_GROUPS=use_smooth_groups,
+#            EXPORT_SMOOTH_GROUPS_BITFLAGS=use_smooth_groups_bitflags,
+#            EXPORT_NORMALS=use_normals,
+#            EXPORT_UV=use_uvs,
+#            EXPORT_MTL=use_materials,
+#            EXPORT_APPLY_MODIFIERS=use_mesh_modifiers,
+#            EXPORT_APPLY_MODIFIERS_RENDER=use_mesh_modifiers_render,
+#            EXPORT_BLEN_OBS=use_blen_objects,
+#            EXPORT_GROUP_BY_OB=group_by_object,
+#            EXPORT_GROUP_BY_MAT=group_by_material,
+#            EXPORT_KEEP_VERT_ORDER=keep_vertex_order,
+#            EXPORT_POLYGROUPS=use_vertex_groups,
+#            EXPORT_CURVE_AS_NURBS=use_nurbs,
+#            EXPORT_SEL_ONLY=use_selection,
+#            EXPORT_ANIMATION=use_animation,
+#            EXPORT_GLOBAL_MATRIX=global_matrix,
+#            EXPORT_PATH_MODE=path_mode,
+#            )
+#
+#     return {'FINISHED'}
diff --git a/src/blender_addon/io_mesh_msh2/import_msh2.py b/src/blender_addon/io_mesh_msh2/import_msh2.py
new file mode 100644
index 0000000..516d22e
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/import_msh2.py
@@ -0,0 +1,48 @@
+# ##### BEGIN GPL LICENSE BLOCK #####
+#
+#  This program is free software; you can redistribute it and/or
+#  modify it under the terms of the GNU General Public License version 2
+#  as published by the Free Software Foundation.
+#
+#  This program is distributed in the hope that it will be useful,
+#  but WITHOUT ANY WARRANTY; without even the implied warranty of
+#  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+#  GNU General Public License for more details.
+#
+#  You should have received a copy of the GNU General Public License
+#  along with this program; if not, write to the Free Software Foundation,
+#  Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+"""
+This script imports a MSH2 files to Blender.
+
+Usage:
+Run this script from "File->Import" menu and then load the desired MSH2 file.
+Note, This loads mesh objects and materials only, nurbs and curves are not supported.
+
+https://schlechtwetterfront.github.io/ze_filetypes/msh.html
+"""
+
+
+
+# def load(context,
+#          filepath,
+#          *,
+#          global_clamp_size=0.0,
+#          use_smooth_groups=True,
+#          use_edges=True,
+#          use_split_objects=True,
+#          use_split_groups=True,
+#          use_image_search=True,
+#          use_groups_as_vgroups=False,
+#          use_cycles=True,
+#          relpath=None,
+#          global_matrix=None
+#          ):
+#     """
+#     Called by the user interface or another script.
+#     load_msh2(path) - should give acceptable results.
+#     This function passes the file and sends the data off
+#         to be split into objects and then converted into mesh objects
+#     """
diff --git a/src/blender_addon/io_mesh_msh2/msh2/Logger.py b/src/blender_addon/io_mesh_msh2/msh2/Logger.py
new file mode 100644
index 0000000..fed0b0e
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/msh2/Logger.py
@@ -0,0 +1,59 @@
+# Python imports
+import os, logging
+
+# Application imports
+
+
+class Logger:
+    def __init__(self, name = "NO_LOGGER_NAME_PASSED_ON_INIT"):
+        self.logger = self.create_logger(name)
+
+    def get_logger(self):
+        return self.logger
+
+    def create_logger(self, loggerName, createFile = True):
+        """
+            Create a new logging object and return it.
+            :note:
+                NOSET     # Don't know the actual log level of this... (defaulting or literally none?)
+                Log Levels (From least to most)
+                Type      Value
+                CRITICAL   50
+                ERROR      40
+                WARNING    30
+                INFO       20
+                DEBUG      10
+            :param loggerName: Sets the name of the logger object. (Used in log lines)
+            :param createFile: Whether we create a log file or just pump to terminal
+
+            :return: the logging object we created
+        """
+
+        globalLogLvl = logging.DEBUG    # Keep this at highest so that handlers can filter to their desired levels
+        chLogLevel   = logging.CRITICAL # Prety musch the only one we change ever
+        fhLogLevel   = logging.DEBUG
+        log          = logging.getLogger(loggerName)
+        log.setLevel(globalLogLvl)
+
+        # Set our log output styles
+        fFormatter   = logging.Formatter('[%(asctime)s] %(pathname)s:%(lineno)d %(levelname)s - %(message)s', '%m-%d %H:%M:%S')
+        cFormatter   = logging.Formatter('%(pathname)s:%(lineno)d] %(levelname)s - %(message)s')
+
+        ch = logging.StreamHandler()
+        ch.setLevel(level=chLogLevel)
+        ch.setFormatter(cFormatter)
+        log.addHandler(ch)
+
+        if createFile:
+            folder = "logs"
+            file   = folder + "/flask-application.log"
+
+            if not os.path.exists(folder):
+                os.mkdir(folder)
+
+            fh = logging.FileHandler(file)
+            fh.setLevel(level=fhLogLevel)
+            fh.setFormatter(fFormatter)
+            log.addHandler(fh)
+
+        return log
diff --git a/src/blender_addon/io_mesh_msh2/msh2/__init__.py b/src/blender_addon/io_mesh_msh2/msh2/__init__.py
new file mode 100644
index 0000000..b6e690f
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/msh2/__init__.py
@@ -0,0 +1 @@
+from . import *
diff --git a/src/blender_addon/io_mesh_msh2/msh2/__main__.py b/src/blender_addon/io_mesh_msh2/msh2/__main__.py
new file mode 100644
index 0000000..e69de29
diff --git a/src/blender_addon/io_mesh_msh2/msh2/msh2.py b/src/blender_addon/io_mesh_msh2/msh2/msh2.py
new file mode 100644
index 0000000..e179432
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/msh2/msh2.py
@@ -0,0 +1,37 @@
+# Python imports
+import faulthandler
+import traceback
+
+# Gtk imports
+
+# Application imports
+from . import msh2_unpack
+
+
+class MSH2():
+    """docstring for MSH2."""
+
+    def __init__(self, arg):
+        faulthandler.enable()  # For better debug info
+        self.arg        = arg
+        self.msh_config = {'do_logging': True, 'ignore_geo': False, 'triangulate': False}
+        self.msh        = None
+
+
+    def import_file(self, file_name):
+        try:
+            self.msh = msh2_unpack.MSHUnpack(file_name, self.msh_config).unpack()
+        except Exception as e:
+            traceback.print_exc()
+
+    def export_file(self, file_name):
+        try:
+            self.msh.save(file_name)
+        except Exception as e:
+            traceback.print_exc()
+
+    def export_file_to_binary_json(self, file_name):
+        try:
+            self.msh.save_json(file_name)
+        except Exception as e:
+            traceback.print_exc()
diff --git a/src/blender_addon/io_mesh_msh2/msh2/msh2_crc.py b/src/blender_addon/io_mesh_msh2/msh2/msh2_crc.py
new file mode 100644
index 0000000..2efca23
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/msh2/msh2_crc.py
@@ -0,0 +1,154 @@
+'''
+    ZeroEngine .msh model format CRC algorithm.
+
+    Refer to
+       schlechtwetterfront.github.io/ze_filetypes/msh.html
+   for more information regarding the file format.
+'''
+
+# Python imports
+from struct import pack
+
+# Gtk imports
+
+# Application imports
+
+
+class CRCError(Exception):
+    def __init__(self, val):
+        self.val = val
+
+    def __str__(self):
+        return '{0}'.format(self.val)
+
+# CRC lookup table.
+TABLE_32 = (
+    0x00000000, 0x04C11DB7, 0x09823B6E, 0x0D4326D9,
+    0x130476DC, 0x17C56B6B, 0x1A864DB2, 0x1E475005,
+    0x2608EDB8, 0x22C9F00F, 0x2F8AD6D6, 0x2B4BCB61,
+    0x350C9B64, 0x31CD86D3, 0x3C8EA00A, 0x384FBDBD,
+    0x4C11DB70, 0x48D0C6C7, 0x4593E01E, 0x4152FDA9,
+    0x5F15ADAC, 0x5BD4B01B, 0x569796C2, 0x52568B75,
+    0x6A1936C8, 0x6ED82B7F, 0x639B0DA6, 0x675A1011,
+    0x791D4014, 0x7DDC5DA3, 0x709F7B7A, 0x745E66CD,
+    0x9823B6E0, 0x9CE2AB57, 0x91A18D8E, 0x95609039,
+    0x8B27C03C, 0x8FE6DD8B, 0x82A5FB52, 0x8664E6E5,
+    0xBE2B5B58, 0xBAEA46EF, 0xB7A96036, 0xB3687D81,
+    0xAD2F2D84, 0xA9EE3033, 0xA4AD16EA, 0xA06C0B5D,
+    0xD4326D90, 0xD0F37027, 0xDDB056FE, 0xD9714B49,
+    0xC7361B4C, 0xC3F706FB, 0xCEB42022, 0xCA753D95,
+    0xF23A8028, 0xF6FB9D9F, 0xFBB8BB46, 0xFF79A6F1,
+    0xE13EF6F4, 0xE5FFEB43, 0xE8BCCD9A, 0xEC7DD02D,
+    0x34867077, 0x30476DC0, 0x3D044B19, 0x39C556AE,
+    0x278206AB, 0x23431B1C, 0x2E003DC5, 0x2AC12072,
+    0x128E9DCF, 0x164F8078, 0x1B0CA6A1, 0x1FCDBB16,
+    0x018AEB13, 0x054BF6A4, 0x0808D07D, 0x0CC9CDCA,
+    0x7897AB07, 0x7C56B6B0, 0x71159069, 0x75D48DDE,
+    0x6B93DDDB, 0x6F52C06C, 0x6211E6B5, 0x66D0FB02,
+    0x5E9F46BF, 0x5A5E5B08, 0x571D7DD1, 0x53DC6066,
+    0x4D9B3063, 0x495A2DD4, 0x44190B0D, 0x40D816BA,
+    0xACA5C697, 0xA864DB20, 0xA527FDF9, 0xA1E6E04E,
+    0xBFA1B04B, 0xBB60ADFC, 0xB6238B25, 0xB2E29692,
+    0x8AAD2B2F, 0x8E6C3698, 0x832F1041, 0x87EE0DF6,
+    0x99A95DF3, 0x9D684044, 0x902B669D, 0x94EA7B2A,
+    0xE0B41DE7, 0xE4750050, 0xE9362689, 0xEDF73B3E,
+    0xF3B06B3B, 0xF771768C, 0xFA325055, 0xFEF34DE2,
+    0xC6BCF05F, 0xC27DEDE8, 0xCF3ECB31, 0xCBFFD686,
+    0xD5B88683, 0xD1799B34, 0xDC3ABDED, 0xD8FBA05A,
+    0x690CE0EE, 0x6DCDFD59, 0x608EDB80, 0x644FC637,
+    0x7A089632, 0x7EC98B85, 0x738AAD5C, 0x774BB0EB,
+    0x4F040D56, 0x4BC510E1, 0x46863638, 0x42472B8F,
+    0x5C007B8A, 0x58C1663D, 0x558240E4, 0x51435D53,
+    0x251D3B9E, 0x21DC2629, 0x2C9F00F0, 0x285E1D47,
+    0x36194D42, 0x32D850F5, 0x3F9B762C, 0x3B5A6B9B,
+    0x0315D626, 0x07D4CB91, 0x0A97ED48, 0x0E56F0FF,
+    0x1011A0FA, 0x14D0BD4D, 0x19939B94, 0x1D528623,
+    0xF12F560E, 0xF5EE4BB9, 0xF8AD6D60, 0xFC6C70D7,
+    0xE22B20D2, 0xE6EA3D65, 0xEBA91BBC, 0xEF68060B,
+    0xD727BBB6, 0xD3E6A601, 0xDEA580D8, 0xDA649D6F,
+    0xC423CD6A, 0xC0E2D0DD, 0xCDA1F604, 0xC960EBB3,
+    0xBD3E8D7E, 0xB9FF90C9, 0xB4BCB610, 0xB07DABA7,
+    0xAE3AFBA2, 0xAAFBE615, 0xA7B8C0CC, 0xA379DD7B,
+    0x9B3660C6, 0x9FF77D71, 0x92B45BA8, 0x9675461F,
+    0x8832161A, 0x8CF30BAD, 0x81B02D74, 0x857130C3,
+    0x5D8A9099, 0x594B8D2E, 0x5408ABF7, 0x50C9B640,
+    0x4E8EE645, 0x4A4FFBF2, 0x470CDD2B, 0x43CDC09C,
+    0x7B827D21, 0x7F436096, 0x7200464F, 0x76C15BF8,
+    0x68860BFD, 0x6C47164A, 0x61043093, 0x65C52D24,
+    0x119B4BE9, 0x155A565E, 0x18197087, 0x1CD86D30,
+    0x029F3D35, 0x065E2082, 0x0B1D065B, 0x0FDC1BEC,
+    0x3793A651, 0x3352BBE6, 0x3E119D3F, 0x3AD08088,
+    0x2497D08D, 0x2056CD3A, 0x2D15EBE3, 0x29D4F654,
+    0xC5A92679, 0xC1683BCE, 0xCC2B1D17, 0xC8EA00A0,
+    0xD6AD50A5, 0xD26C4D12, 0xDF2F6BCB, 0xDBEE767C,
+    0xE3A1CBC1, 0xE760D676, 0xEA23F0AF, 0xEEE2ED18,
+    0xF0A5BD1D, 0xF464A0AA, 0xF9278673, 0xFDE69BC4,
+    0x89B8FD09, 0x8D79E0BE, 0x803AC667, 0x84FBDBD0,
+    0x9ABC8BD5, 0x9E7D9662, 0x933EB0BB, 0x97FFAD0C,
+    0xAFB010B1, 0xAB710D06, 0xA6322BDF, 0xA2F33668,
+    0xBCB4666D, 0xB8757BDA, 0xB5365D03, 0xB1F740B4
+)
+
+# Used to calculate the lowercase CRC.
+TOLOWER = (
+    0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
+    0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
+    0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17,
+    0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f,
+    0x20, 0x21, 0x22, 0x23, 0x24, 0x25, 0x26, 0x27,
+    0x28, 0x29, 0x2a, 0x2b, 0x2c, 0x2d, 0x2e, 0x2f,
+    0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37,
+    0x38, 0x39, 0x3a, 0x3b, 0x3c, 0x3d, 0x3e, 0x3f,
+    0x40, 0x61, 0x62, 0x63, 0x64, 0x65, 0x66, 0x67,
+    0x68, 0x69, 0x6a, 0x6b, 0x6c, 0x6d, 0x6e, 0x6f,
+    0x70, 0x71, 0x72, 0x73, 0x74, 0x75, 0x76, 0x77,
+    0x78, 0x79, 0x7a, 0x5b, 0x5c, 0x5d, 0x5e, 0x5f,
+    0x60, 0x61, 0x62, 0x63, 0x64, 0x65, 0x66, 0x67,
+    0x68, 0x69, 0x6a, 0x6b, 0x6c, 0x6d, 0x6e, 0x6f,
+    0x70, 0x71, 0x72, 0x73, 0x74, 0x75, 0x76, 0x77,
+    0x78, 0x79, 0x7a, 0x7b, 0x7c, 0x7d, 0x7e, 0x7f,
+    0x80, 0x81, 0x82, 0x83, 0x84, 0x85, 0x86, 0x87,
+    0x88, 0x89, 0x8a, 0x8b, 0x8c, 0x8d, 0x8e, 0x8f,
+    0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97,
+    0x98, 0x99, 0x9a, 0x9b, 0x9c, 0x9d, 0x9e, 0x9f,
+    0xa0, 0xa1, 0xa2, 0xa3, 0xa4, 0xa5, 0xa6, 0xa7,
+    0xa8, 0xa9, 0xaa, 0xab, 0xac, 0xad, 0xae, 0xaf,
+    0xb0, 0xb1, 0xb2, 0xb3, 0xb4, 0xb5, 0xb6, 0xb7,
+    0xb8, 0xb9, 0xba, 0xbb, 0xbc, 0xbd, 0xbe, 0xbf,
+    0xc0, 0xc1, 0xc2, 0xc3, 0xc4, 0xc5, 0xc6, 0xc7,
+    0xc8, 0xc9, 0xca, 0xcb, 0xcc, 0xcd, 0xce, 0xcf,
+    0xd0, 0xd1, 0xd2, 0xd3, 0xd4, 0xd5, 0xd6, 0xd7,
+    0xd8, 0xd9, 0xda, 0xdb, 0xdc, 0xdd, 0xde, 0xdf,
+    0xe0, 0xe1, 0xe2, 0xe3, 0xe4, 0xe5, 0xe6, 0xe7,
+    0xe8, 0xe9, 0xea, 0xeb, 0xec, 0xed, 0xee, 0xef,
+    0xf0, 0xf1, 0xf2, 0xf3, 0xf4, 0xf5, 0xf6, 0xf7,
+    0xf8, 0xf9, 0xfa, 0xfb, 0xfc, 0xfd, 0xfe, 0xff
+)
+
+
+def return_lowest_bits(n):
+    '''Simulate unsigned behavior.'''
+    return n & 0xFFFFFFFF
+
+
+def crc(string):
+    '''Calculate the Zero CRC from string and return it as number.'''
+    crc_ = 0
+    crc_ = return_lowest_bits(~crc_)
+    if string:
+        for char in string:
+            ind  = (crc_ >> 24)
+            ind  = ind ^ TOLOWER[ord(char)]
+            crc_ = return_lowest_bits(crc_ << 8) ^ TABLE_32[ind]
+    return return_lowest_bits(~crc_)
+
+
+def strcrc(string):
+    '''Calculate the Zero CRC and return it in a structure usable in .msh files.'''
+    return pack('<I', crc(string))
+
+
+def compare_crc_adv(possible_strings, crc_):
+    for string in possible_strings:
+        if crc_ == strcrc(string):
+            return string
diff --git a/src/blender_addon/io_mesh_msh2/msh2/msh2_data.py b/src/blender_addon/io_mesh_msh2/msh2/msh2_data.py
new file mode 100644
index 0000000..eadf0d5
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/msh2/msh2_data.py
@@ -0,0 +1,2765 @@
+# -*- coding: utf-8 -*-
+'''
+    ZeroEngine .msh model format.
+
+    Refer to
+       schlechtwetterfront.github.io/ze_filetypes/msh.html
+   for more information regarding the file format.
+'''
+import os
+import itertools
+import struct
+import math
+# import logging
+
+
+from .Logger import Logger
+logging = Logger("Msh2").get_logger()
+
+try:
+    import bson
+    json = bson
+except Exception as e:
+    import json
+
+
+from . import msh2_crc
+
+
+
+
+MODEL_TYPES = {'null': 0,
+               'geodynamic': 1,
+               'cloth': 2,
+               'bone': 3,
+               'geobone': 3,
+               'geostatic': 4,
+               'geoshadow': 6}
+
+MODEL_TYPES_INT = ['null',
+                   'geodynamic',
+                   'cloth',
+                   'bone',
+                   'geostatic',
+                   '',
+                   'geoshadow']
+
+
+class MSH2Error(Exception):
+    def __init__(self, value):
+        self.parameter = value
+
+    def __str__(self):
+        return repr(self.parameter)
+
+
+class Packer(object):
+    def pad_string(self, string):
+        '''Pads the given string with \x00s to fill a multiple of 4 length.'''
+        if string == b'':
+            return b''
+        i = 0
+        while len(string) >= i:
+            i += 4
+        return string.ljust(i, b'\x00')
+
+    def null_terminate(self, string):
+        '''Null-terminates the given string.'''
+        return string + b'\x00'
+
+    def pack_long_chunk(self, header, number):
+        '''Chunk with only one long int.'''
+        data = [header.encode("ascii")]
+        data.append(struct.pack('<L', 4))
+        data.append(struct.pack('<L', number))
+        return b''.join(data)
+
+    def pack_string_chunk(self, header, string):
+        '''String Chunk(NAME, TX0D...) packer.'''
+        data = [header.encode("ascii")]
+        comp_str = self.pad_string(string)
+        data.append(struct.pack('<L', len(comp_str)))
+        data.append(comp_str)
+        return b''.join(data)
+
+    def sum_seq(self, seq, start=0, end=None):
+        '''Sums the sequence items from start to end.
+        If end is None it will sum all items from start.'''
+        if end:
+            tosum = seq[start:end]
+        else:
+            tosum = seq[start:]
+        tosum = [len(item) for item in tosum]
+        return sum(tosum)
+
+
+class Msh(Packer):
+    # is_shadowvolume bool
+    # info Info
+    # materials Material[]
+    # models Model[]
+    # animation Animation
+    def __init__(self):
+        self.info             = None
+        self.has_shadowvolume = False
+        self.models           = []
+        self.materials        = []
+        self.animation        = None
+        self.classname        = 'Msh'
+        self.modulepath       = ''
+
+    def dump(self, filepath):
+        '''Dumps .msh file information into a text file.'''
+        with open(filepath, 'w') as fh:
+            self.info.dump(fh)
+            self.materials.dump(fh)
+            self.models.dump(fh)
+        return True
+
+    def save(self, filepath):
+        with open(filepath, 'wb') as fh:
+            fh.write(self.pack())
+
+    def save_json(self, filepath):
+        '''Saves the .msh in JSON format.'''
+        data = {
+            'info':             self.info.get_json(),
+            'models':           self.models.get_json(),
+            'materials':        self.materials.get_json(),
+            'has_shadowvolume': self.has_shadowvolume,
+            'animation':        None,
+        }
+        with open(filepath, 'wb') as fh:
+            # fh.write(json.dumps(data, indent=4, separators=(',', ': ')))
+            fh.write(json.dumps(data))
+        return True
+
+    def save_segmented_json(self, folder, name=None):
+        # If no name argument was passed assume that a full path was passed.
+        if not name:
+            folder, name = os.path.dirname(folder), os.path.basename(folder)
+            name = name.split('.')[0]
+        if not os.path.isdir(folder):
+            os.mkdir(folder)
+        with open(os.path.join(folder, name + '.txt'), 'w') as fh:
+            fh.write(json.dumps({'has_shadowvolume': self.has_shadowvolume}))
+        with open(os.path.join(folder, name + ' nfo.txt'), 'w') as fh:
+            # fh.write(json.dumps(self.info.get_json(), indent=4, separators=(',', ': ')))
+            fh.write(json.dumps(self.info.get_json()))
+        for model in self.models:
+            model.save_segmented_json(folder, name)
+        for material in self.materials:
+            with open(os.path.join(folder, '{0} mtl {1}.txt'.format(name, material.name)), 'wb') as fh:
+                fh.write(json.dumps(material.get_json()))
+                # fh.write(json.dumps(material.get_json(), indent=4, separators=(',', ': ')))
+
+    @classmethod
+    def load_segmented_json(cls, folder, name):
+        model_start    = '{0} mdl '.format(name)
+        material_start = '{0} mtl '.format(name)
+        msh            = cls()
+        info_data      = b''
+        with open(os.path.join(folder, '{0}.txt'.format(name)), 'r') as fh:
+            msh.has_shadowvolume = json.loads(fh.read())['has_shadowvolume']
+        with open(os.path.join(folder, '{0} nfo.txt'.format(name)), 'r') as fh:
+            info_data = json.loads(fh.read())
+        msh.info = SceneInfo.from_json(info_data)
+        materials = MaterialCollection(msh)
+        models = ModelCollection(msh)
+        for filename in os.listdir(folder):
+            if filename.startswith(model_start) and (not ' seg ' in filename):
+                models.add(Model.load_segmented_json(folder, filename.split('.')[0]))
+            elif filename.startswith(material_start):
+                with open(os.path.join(folder, filename), 'r') as fh:
+                    materials.add(Material.from_json(json.loads(fh.read())))
+        msh.models = models
+        # Re-order models so that parents appear before their children.
+        models_map = {}
+        models = []
+        for model in msh.models:
+            if model.parent_name:
+                if not models_map.get(model.parent_name, None):
+                    models_map[model.parent_name] = [model]
+                else:
+                    models_map[model.parent_name].append(model)
+            else:
+                models.append(model)
+        new_models = []
+        for model in models:
+            new_models.extend(msh.get_children_ordered(model, models_map))
+        msh.models.replace(new_models)
+        msh.materials = materials
+        msh.animation = Animation(None, 'empty')
+        msh.set_indices()
+        return msh
+
+    def get_children_ordered(self, model, children_map):
+        models = []
+        models.append(model)
+        children = children_map.get(model.name, [])
+        for child in children:
+            models.extend(self.get_children_ordered(child, children_map))
+        return models
+
+    @classmethod
+    def load_json(cls, filepath):
+        data = b''
+        with open(filepath, 'rb') as fh:
+            data = fh.read()
+
+        data                 = json.loads(data)
+        msh                  = cls()
+        msh.info             = SceneInfo.from_json(data['info'], msh)
+        msh.models           = ModelCollection.from_json(data['models'], msh)
+        msh.materials        = MaterialCollection.from_json(data['materials'], msh)
+        msh.has_shadowvolume = data['has_shadowvolume']
+        msh.animation        = Animation(None, 'empty')
+        msh.set_indices()
+        return msh
+
+    def set_indices(self):
+        '''Set material and model indices (ie after json load).'''
+        for index, material in enumerate(self.materials):
+            material.index = index
+        for index, model in enumerate(self.models):
+            model.index = index
+            for seg in model.segments:
+                seg.material = self.get_mat_by_name(seg.mat_name)
+
+    def get_mat_by_name(self, name):
+        '''Get Material object by name.'''
+        dct = self.materials.get_matname_dict()
+        return dct[name]
+
+    def get_mat_by_index(self, index):
+        '''Get Material object by index into the colection.'''
+        return self.materials[index]
+
+    def pack_CL1L(self):
+        data = [b'CL1L']
+        data.append(struct.pack('<L', 0))
+        return b''.join(data)
+
+    def pack(self):
+        '''Packs data to .msh file structure and returns the data as a string.'''
+        data = [b'HEDR', 'size']
+        # First pack the MSH2 header with all its children chunks.
+        msh2_data = [b'MSH2', 'size']
+        msh2_data.append(self.info.pack())
+        msh2_data.append(self.materials.pack())
+        msh2_data.append(self.models.pack())
+        #msh2_data[1] = struct.pack('<L', len(msh2_data[2]) + len(msh2_data[3]) + len(msh2_data[4]))
+        msh2_data[1] = struct.pack('<L', self.sum_seq(msh2_data, 2))
+        # Finished MSH2.
+        data.append(b''.join(msh2_data))
+        # HEDR only has MSH2 and the animation chunks as children(and sometimes SHVO).
+        # We don't pack SHVO here so on to animation chunks.
+        data.append(self.animation.pack())
+        data.append(self.pack_CL1L())
+        # sum length of msh2 data + length of animation chunks.
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+    def repack(self):
+        '''Will use stored binary data of cloth and shadow chunks instead
+        of recalculating it(not possible at the moment).'''
+        data = [b'HEDR', 'size']
+        # First pack the MSH2 header with all its children chunks.
+        msh2_data = [b'MSH2', 'size']
+        msh2_data.append(self.info.pack())
+        msh2_data.append(self.materials.pack())
+        msh2_data.append(self.models.repack())
+        #msh2_data[1] = struct.pack('<L', len(msh2_data[2]) + len(msh2_data[3]) + len(msh2_data[4]))
+        msh2_data[1] = struct.pack('<L', self.sum_seq(msh2_data, 2))
+        # Finished MSH2.
+        data.append(b''.join(msh2_data))
+        # HEDR only have MSH2 and the animation chunks as children(and sometimes SHVO).
+        # We don't pack SHVO here so on to animation chunks.
+        if self.animation:
+            data.append(self.animation.pack())
+        data.append(self.pack_CL1L())
+        # sum length of msh2 data + length of animation chunks.
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+
+class SceneInfo(Packer):
+    def __init__(self, msh=None):
+        # Reference to Msh.
+        self.msh         = msh
+        self.name        = b''
+        self.classname   = 'SceneInfo'
+        self.frame_range = 0, 100
+        self.fps         = 29.97
+        self.scale       = 1.0, 1.0, 1.0
+        self.bbox        = BBox()
+
+    def dump(self, fileh=None):
+        '''Dump information to open filehandler fileh.'''
+        if fileh:
+            fileh.write('--- SceneInfo ---\n')
+            fileh.write('\tSceneName:  {0}\n'.format(self.name))
+            fileh.write('\tFrameRange: {0}-{1}\n'.format(*self.frame_range))
+            fileh.write('\tFPS:        {0}\n'.format(self.fps))
+
+    def get_json(self):
+        data = {
+            'name':        self.name,
+            'frame_range': self.frame_range,
+            'fps':         self.fps,
+            'scale':       self.scale,
+            'bbox':        self.bbox.get_json()
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, msh=None):
+        info             = SceneInfo()
+        info.msh         = msh
+        info.name        = data['name']
+        info.frame_range = data['frame_range']
+        info.fps         = data['fps']
+        info.scale       = data['scale']
+        info.bbox        = BBox.from_json(data['bbox'])
+        return info
+
+    def pack(self):
+        '''Packs the scene information data.'''
+        data = [b'SINF']
+        data.append('size_ind')
+        data.append(self.pack_NAME())
+        data.append(self.pack_FRAM())
+        data.append(self.bbox.pack())
+        data[1] = struct.pack('<L', len(data[2]) + len(data[3]) + len(data[4]))
+        return b''.join(data)
+
+    def pack_NAME(self):
+        '''Packs the scene name.'''
+        return self.pack_string_chunk('NAME', self.name)
+
+    def pack_FRAM(self):
+        '''Packs frame range and FPS into the FRAM chunk.'''
+        data = [b'FRAM']
+        data.append(struct.pack('<L', 12))
+        data.append(struct.pack('<L', self.frame_range[0]))
+        data.append(struct.pack('<L', self.frame_range[1]))
+        data.append(struct.pack('<f', self.fps))
+        return b''.join(data)
+
+
+class Material(Packer):
+    # name: string
+    # index: int
+    # tex_0: string.tga
+    # tex_1: string.tga
+    # tex_2: string.tga
+    # tex_3: string.tga
+    # attr_0: int(0-255)
+    # attr_1: int(0-255)
+    # attr_2: int(0-255)
+    # attr_3: int(0-255)
+    # diff_color: (red, green, blue, alpha) floats
+    # ambt_color: (red, green, blue, alpha) floats
+    # spec_color: (red, green, blue, alpha) floats
+    # gloss: float
+    def __init__(self, coll=None):
+        # Reference to MaterialCollection
+        self.collection = coll
+        self.name       = b''
+        self.classname  = 'Material'
+        self.index = 0
+        self.tex0  = None
+        self.tex1  = None
+        self.tex2  = None
+        self.tex3  = None
+        self.flags = [['specular', False, 128],
+                      ['additive', False, 64],
+                      ['perpixel', False, 32],
+                      ['hard',     False, 16],
+                      ['double',   False, 8],
+                      ['single',   False, 4],
+                      ['glow',     False, 2],
+                      ['emissive', False, 1]]
+        self.render_type = 0
+        self.data0       = 0
+        self.data1       = 0
+        self.diff_color  = Color()
+        self.ambt_color  = Color()
+        self.spec_color  = Color()
+        self.gloss       = 70.0
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t--- Material ---\n')
+        fh.write('\t\tName:  {0}\n'.format(self.name))
+        fh.write('\t\tTex0:  {0}\n'.format(self.tex0))
+        fh.write('\t\tTex1:  {0}\n'.format(self.tex1))
+        fh.write('\t\tTex2:  {0}\n'.format(self.tex2))
+        fh.write('\t\tTex3:  {0}\n'.format(self.tex3))
+        fh.write('\t\tFlags\n')
+        for flag in self.flags:
+            fh.write('\t\t\t{0}: {1}\n'.format(flag[0], flag[1]))
+        fh.write('\n')
+        fh.write('\t\tRenderType: {0}\n'.format(self.render_type))
+        fh.write('\t\tData0:      {0}\n'.format(self.data0))
+        fh.write('\t\tData1:      {0}\n'.format(self.data1))
+        fh.write('\t\tDiffuse:    {0}\n'.format(self.diff_color))
+        fh.write('\t\tSpecular:   {0}\n'.format(self.spec_color))
+        fh.write('\t\tAmbient:    {0}\n'.format(self.ambt_color))
+        fh.write('\t\tGloss:      {0}\n'.format(self.gloss))
+
+    def get_json(self):
+        data = {
+            'name':        self.name,
+            'index':       self.index,
+            'tex0':        self.tex0,
+            'tex1':        self.tex1,
+            'tex2':        self.tex2,
+            'tex3':        self.tex3,
+            'flags':       self.flags,
+            'render_type': self.render_type,
+            'data0':       self.data0,
+            'data1':       self.data1,
+            'diffuse':     self.diff_color.get_json(),
+            'specular':    self.spec_color.get_json(),
+            'ambient':     self.ambt_color.get_json(),
+            'gloss':       self.gloss,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        material             = Material()
+        material.collection  = collection
+        material.name        = data['name']
+        material.index       = data['index']
+        material.tex0        = data['tex0']
+        material.tex1        = data['tex1']
+        material.tex2        = data['tex2']
+        material.tex3        = data['tex3']
+        material.flags       = data['flags']
+        material.render_type = data['render_type']
+        material.data0       = data['data0']
+        material.data1       = data['data1']
+        material.diff_color  = Color.from_json(data['diffuse'])
+        material.spec_color  = Color.from_json(data['specular'])
+        material.ambt_color  = Color.from_json(data['ambient'])
+        material.gloss       = data['gloss']
+        return material
+
+    @property
+    def ATRB(self):
+        '''Sum ATRB byte value.'''
+        val = 0
+        for flag in self.flags:
+            if flag[1]:
+                val += flag[2]
+        return val
+
+    def pack(self):
+        '''Packs the material into a MATD chunk.'''
+        data = [b'MATD']
+        data.append('size_indicator')
+        data.append(self.pack_NAME())
+        data.append(self.pack_DATA())
+        data.append(self.pack_ATRB())
+        data.append(self.pack_textures())
+        data[1] = struct.pack('<L', len(data[2]) + len(data[3]) + len(data[4]) + len(data[5]))
+        return b''.join(data)
+
+    def flags_from_int(self, val):
+        '''Unpacks an int indicating the material flags into the
+        single flags.'''
+        # Decodes an int into flags.
+        place0 = val
+        flags = [('specular', True, 128),
+                 ('additive', True, 64),
+                 ('perpixel', True, 32),
+                 ('hard',     True, 16),
+                 ('double',   True, 8),
+                 ('single',   True, 4),
+                 ('glow',     True, 2),
+                 ('emissive', True, 1)]
+        new = place0
+        for index, flag in enumerate(flags):
+            new -= flag[2]
+            if new < 0:
+                flags[index] = flag[0], False, flag[2]
+                new += flag[2]
+        return flags
+
+    def pack_NAME(self):
+        '''Packs the materials name.'''
+        return self.pack_string_chunk('NAME', self.name)
+
+    def pack_DATA(self):
+        '''Packs the material's shader/color data.'''
+        data = [b'DATA']
+        data.append(struct.pack('<L', 52))
+        data.append(self.diff_color.pack('f'))
+        data.append(self.spec_color.pack('f'))
+        data.append(self.ambt_color.pack('f'))
+        data.append(struct.pack('<f', self.gloss))
+        return b''.join(data)
+
+    def pack_ATRB(self):
+        '''Packs the material render attributes.'''
+        data = [b'ATRB']
+        data.append(struct.pack('<L', 4))
+        data.append(struct.pack('<B', self.ATRB))
+        data.append(struct.pack('<B', self.render_type))
+        data.append(struct.pack('<B', self.data0))
+        data.append(struct.pack('<B', self.data1))
+        return b''.join(data)
+
+    def pack_textures(self):
+        '''Packs up to 4 textures in TX0D/TX1D/TX2D/TX3D chunks.'''
+        data = []
+        if self.tex0:
+            data.append(self.pack_string_chunk('TX0D', self.tex0))
+        if self.tex1:
+            data.append(self.pack_string_chunk('TX1D', self.tex1))
+        if self.tex2:
+            data.append(self.pack_string_chunk('TX2D', self.tex2))
+        if self.tex3:
+            data.append(self.pack_string_chunk('TX3D', self.tex3))
+        return b''.join(data)
+
+
+class MaterialCollection(Packer):
+    def __init__(self, msh=None, materials=[]):
+        # Reference to Msh.
+        self.msh       = msh
+        self.classname = 'MaterialCollection'
+        self.materials = materials
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('--- MaterialCollection ---\n')
+        fh.write('\tNumMaterials: {0}\n'.format(len(self.materials)))
+        for mat in self.materials:
+            mat.dump(fh)
+
+    def get_json(self):
+        data = {
+            'materials': [mat.get_json() for mat in self.materials],
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, msh=None):
+        coll = MaterialCollection()
+        coll.msh = msh
+        for material_data in data['materials']:
+            coll.materials.append(Material.from_json(material_data))
+        return coll
+
+    def add(self, material):
+        '''Add Material to the collection and set
+        collection attribute.'''
+        material.collection = self
+        self.materials.append(material)
+
+    def remove(self, index):
+        '''Remove material at index index.'''
+        del self.materials[index]
+
+    def replace(self, materials):
+        '''Replace internal materials list.'''
+        self.materials = materials
+
+    def get_matname_dict(self):
+        '''Returns dict of 'materialname': material pairs.'''
+        matnamedict = {}
+        for mat in self.materials:
+            matnamedict[mat.name] = mat
+        return matnamedict
+
+    def assign_indices(self):
+        '''Assigns index attribute for every material.'''
+        for index, mat in enumerate(self.materials):
+            mat.index = index
+
+    def __str__(self):
+        return str(self.materials)
+
+    def __repr__(self):
+        return str(self.materials)
+
+    def __getitem__(self, key):
+        return self.materials[key]
+
+    def __len__(self):
+        return len(self.materials)
+
+    def pack(self):
+        '''Packs the material list + materials.'''
+        data = [b'MATL', 'size']
+        data.append(struct.pack('<L', len(self.materials)))
+        for material in self.materials:
+            data.append(material.pack())
+        data[1] = struct.pack('<L', self.sum_seq(data, 3) + 4)
+        return b''.join(data)
+
+
+class Model(Packer):
+    collprim_by_index = {0: 'Sphere',
+                         1: 'Sphere',
+                         2: 'Cylinder',
+                         4: 'Cube'}
+    collprim_by_name = {'Sphere': 0,
+                        'Cylinder': 2,
+                        'Cube': 4}
+
+    def __init__(self, collection=None):
+        # Ref to ModelCollection.
+        self.collection       = collection
+        self.name             = 'model'
+        self.classname        = 'Model'
+        self.parent_name      = None
+        self.index            = 0
+        self.model_type       = 'geostatic'
+        self.vis              = 0
+        self.segments         = SegmentCollection(self)
+        self.collprim         = False
+        self.cloth_collprim   = False
+        self.primitive        = 4, 0.0, 0.0, 0.0
+        self.deformers        = []
+        self.deformer_indices = []
+        self.bbox             = BBox()
+        self.transform        = Transform()
+        self.bone             = None
+        self.msh              = None
+
+    def get_json(self):
+        data = {
+            'name':          self.name,
+            'parent':        self.parent_name,
+            'model_type':    self.model_type,
+            'visible':       not self.vis,  # vis == hidden
+            'segments':      self.segments.get_json(),
+            'collprim':      self.collprim,
+            'primitive':     self.primitive,
+            'num_deformers': len(self.deformers),
+            'deformers':     self.deformers,
+            'bbox':          self.bbox.get_json(),
+            'transform':     self.transform.get_json(),
+        }
+        return data
+
+    def save_segmented_json(self, folder, name):
+        data = self.get_json()
+        del data['segments']
+        with open(os.path.join(folder, '{0} mdl {1}.txt'.format(name, self.name)), 'w') as fh:
+            fh.write(json.dumps(data))
+            # fh.write(json.dumps(data, indent=4, separators=(',', ': ')))
+        for index, segment in enumerate(self.segments):
+            with open(os.path.join(folder, '{0} mdl {1} seg {2:0>3}.txt'.format(name, self.name, index)), 'w') as fh:
+                # fh.write(json.dumps(segment.get_json(), indent=4, separators=(',', ': ')))
+                fh.write(json.dumps(segment.get_json()))
+
+    @classmethod
+    def load_segmented_json(cls, folder, name):
+        logging.debug('LOADING SEGMENTED MODEL %s %s', folder, name)
+        with open(os.path.join(folder, '{0}.txt'.format(name)), 'r') as fh:
+            model = Model.from_json(json.loads(fh.read()))
+        seg_start = '{0} seg '.format(name)
+        segments = SegmentCollection(model)
+        for filename in os.listdir(folder):
+            if filename.startswith(seg_start):
+                with open(os.path.join(folder, filename), 'r') as fh:
+                    data = json.loads(fh.read())
+                if data['type'] == 'SegmentGeometry':
+                    segments.add(SegmentGeometry.from_json(data))
+                elif data['type'] == 'ClothGeometry':
+                    segments.add(ClothGeometry.from_json(data))
+                elif data['type'] == 'ShadowGeometry':
+                    segments.add(ShadowGeometry.from_json(data))
+        model.segments = segments
+        return model
+
+    @staticmethod
+    def from_json(data, collection=None):
+        model             = Model()
+        model.collection  = collection
+        model.name        = data['name']
+        model.parent_name = data['parent']
+        model.model_type  = data['model_type']
+        model.vis         = data.get('visible', False)
+        model.vis         = data.get('vis', model.vis)  # Older format used that.
+
+        # In case this is loaded from a segmented json.
+        if data.get('segments', None):
+            model.segments = SegmentCollection.from_json(data['segments'], model)
+
+        model.collprim  = data['collprim']
+        model.primitive = data['primitive']
+        model.deformers = data['deformers']
+        model.bbox      = BBox.from_json(data['bbox'])
+        model.transform = Transform.from_json(data['transform'])
+        return model
+
+    def get_collprim_name(self):
+        return self.collprim_by_index[self.primitive[0]]
+
+    def get_collprim_index(self, name):
+        return self.collprim_by_name[name]
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t--- Model ---\n')
+        fh.write('\t\tName:    {0}\n'.format(self.name))
+        fh.write('\t\tParent:  {0}\n'.format(self.parent_name))
+        fh.write('\t\tType:    {0}\n'.format(self.model_type))
+        fh.write('\t\tVisible: {0}\n'.format(self.vis))
+        fh.write('\t\tPos:     {0}, {1}, {2}\n'.format(*self.transform.translation))
+        fh.write('\t\tRot:     {0}, {1}, {2}, {3}\n'.format(*self.transform.rotation))
+        fh.write('\t\tScl:     {0}, {1}, {2}\n'.format(*self.transform.scale))
+        if self.collprim:
+            fh.write('\t\tCollprim: {0}, {1}, {2}, {3}\n'.format(*self.primitive))
+        if 'geo' in self.model_type or self.model_type == 'cloth':
+            self.segments.dump(fh)
+        if self.deformers:
+            fh.write('\t\tDeformers:\n')
+            for deform in self.deformers:
+                fh.write('\t\t\t{0}\n'.format(deform))
+
+    def set_deformers_from_indices(self):
+        '''Sets deformers attribute to actual model names.'''
+        try:
+            for ind in self.deformer_indices:
+                self.deformers.append(self.collection[ind - 1].name)
+        except IndexError:
+            raise MSH2Error('Check C:\dump.dump!')
+
+    def pack(self):
+        '''Packs the MODL chunk. This should be used to retrieve the model in packed form.'''
+        data = [b'MODL', 'sizeind']
+        data.append(self.pack_MTYP())
+        data.append(self.pack_MNDX())
+        data.append(self.pack_NAME())
+        if self.parent_name:
+            data.append(self.pack_PRNT())
+        data.append(self.pack_FLGS())
+        data.append(self.transform.pack())
+        if 'geo' in self.model_type or self.model_type == 'cloth':
+            data.append(self.pack_GEOM())
+            if self.collprim:
+                data.append(self.pack_SWCI())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+    def pack_MTYP(self):
+        '''Packs the model type chunk.'''
+        return self.pack_long_chunk('MTYP', MODEL_TYPES[self.model_type])
+
+    def pack_MNDX(self):
+        '''Packs the model index chunk.'''
+        return self.pack_long_chunk('MNDX', self.index)
+
+    def pack_NAME(self):
+        '''Packs the model's name.'''
+        return self.pack_string_chunk('NAME', self.name)
+
+    def pack_PRNT(self):
+        '''Packs the model's parent's name.'''
+        return self.pack_string_chunk('PRNT', self.parent_name)
+
+    def pack_FLGS(self):
+        '''Packs the visibility.'''
+        return self.pack_long_chunk('FLGS', self.vis)
+
+    def pack_GEOM(self):
+        data = [b'GEOM']
+        data.append('size_indic')
+        data.append(self.bbox.pack())
+        data.append(self.segments.pack())
+        if self.deformers:
+            data.append(self.pack_ENVL())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+    def pack_ENVL(self):
+        data = [b'ENVL']
+        data.append(struct.pack('<L', len(self.deformers) * 4 + 4))
+        data.append(struct.pack('<L', len(self.deformers)))
+        for deformer in self.deformers:
+            index = self.collection.get_index(deformer)
+            data.append(struct.pack('<L', index))
+        return b''.join(data)
+
+    def pack_SWCI(self):
+        '''Packs the collision primitive chunk.'''
+        data = [b'SWCI']
+        data.append(struct.pack('<L', 16))
+        data.append(struct.pack('<Lfff', *self.primitive))
+        return b''.join(data)
+
+    def repack(self):
+        '''Repacks the MODL chunk. This should be used to retrieve the model in packed form.'''
+        data = [b'MODL', 'sizeind']
+        data.append(self.pack_MTYP())
+        data.append(self.pack_MNDX())
+        data.append(self.pack_NAME())
+        if self.parent_name:
+            data.append(self.pack_PRNT())
+        data.append(self.pack_FLGS())
+        data.append(self.transform.pack())
+        if 'geo' in self.model_type or self.model_type == 'cloth':
+            data.append(self.repack_GEOM())
+            if self.collprim:
+                data.append(self.pack_SWCI())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+    def repack_GEOM(self):
+        data = [b'GEOM']
+        data.append('size')
+        data.append(self.bbox.pack())
+        data.append(self.segments.repack())
+        if self.deformers:
+            data.append(self.pack_ENVL())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+    def get_vertex_by_index(self, vertex_index):
+        '''Get a Vertex from an index that is not relative to a segment.
+           Basically combines all vertices of all segments into one list to array into.'''
+        offset = 0
+        for segment in self.segments:
+            if vertex_index < len(segment.vertices) + offset:
+                    return segment.vertices[vertex_index - offset]
+            offset += len(segment.vertices)
+
+
+class ModelCollection(object):
+    def __init__(self, msh=None, models=None):
+        # Ref to Msh.
+        if msh:
+            self.msh = msh
+        else:
+            self.msh = None
+        self.classname = 'ModelCollection'
+        if models:
+            self.models = models
+        else:
+            self.models = []
+        self.msh = None
+
+    def get_json(self):
+        data = {
+            'models': [m.get_json() for m in self.models]
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, msh=None):
+        coll = ModelCollection()
+        coll.msh = msh
+        for model_data in data['models']:
+            coll.models.append(Model.from_json(model_data, coll))
+        return coll
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fh.'''
+        fh.write('--- ModelCollection ---\n')
+        fh.write('\tNumModels: {0}\n'.format(len(self.models)))
+        for model in self.models:
+            model.dump(fh)
+
+    def add(self, model):
+        '''Add Model object and set its collection attribute.'''
+        model.collection = self
+        self.models.append(model)
+
+    def remove(self, index):
+        del self.models[index]
+
+    def remove_multi(self, models):
+        '''Compares names between internal list and
+        models. If name of internal Model equals one in
+        models, remove the Model.'''
+        for index, model in enumerate(self.models):
+            if model.name in models:
+                del self.models[index]
+
+    def replace(self, new_models):
+        '''Replace internal model list with new_models.'''
+        self.models = new_models
+
+    def assign_indices(self):
+        '''Assign index attribute for every Model.'''
+        for index, model in enumerate(self.models):
+            model.index = index + 1
+
+    def assign_parents(self):
+        '''Assign collection attribute for every Model.'''
+        for model in self.models:
+            model.collection = self
+
+    def assign_cloth_collisions(self):
+        '''Assign collision data to every cloth that has collisions referenced.'''
+        cloth_collision_primitives = {}
+        for model in self.models:
+            if model.cloth_collprim:
+                cloth_collision_primitives[model.name] = model
+
+        for model in self.models:
+            for segment in model.segments:
+                if isinstance(segment, ClothGeometry):
+                    for collision in segment.collisions:
+                        collision.primitive_type = cloth_collision_primitives[collision.name].primitive[0]
+                        collision.primitive_data = cloth_collision_primitives[collision.name].primitive[1:]
+
+    def get_index(self, modelname):
+        '''Get model.index for model with name modelname.'''
+        for model in self.models:
+            if model.name == modelname:
+                logging.debug('ModelCollection.get_index: {0} - {1}'.format(model.name, model.index))
+                return model.index
+        return 0
+
+    def by_name(self, name):
+        '''Get model by name.'''
+        for model in self.models:
+            if model.name == name:
+                return model
+
+    def get_names_list(self):
+        '''Get list of model names.'''
+        return [mdl.name for mdl in self.models]
+
+    def __str__(self):
+        return str(self.models)
+
+    def __repr__(self):
+        return str(self.models)
+
+    def __getitem__(self, key):
+        return self.models[key]
+
+    def __len__(self):
+        return len(self.models)
+
+    def pack(self):
+        data = [model.pack() for model in self.models]
+        return b''.join(data)
+
+    def repack(self):
+        data = [model.repack() for model in self.models]
+        return b''.join(data)
+
+
+class SegmentCollection(object):
+    def __init__(self, model=None, segments=None):
+        # Reference to Model.
+        if model:
+            self.model = model
+        else:
+            self.model = None
+        self.classname = 'SegmentCollection'
+        if segments:
+            self.segments = segments
+        else:
+            self.segments = []
+        self.msh = None
+
+    def get_json(self):
+        data = {
+            'segments': [seg.get_json() for seg in self.segments],
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, model=None):
+        coll = SegmentCollection()
+        coll.model = model
+        for segment_data in data['segments']:
+            if segment_data['type'] == 'SegmentGeometry':
+                coll.segments.append(SegmentGeometry.from_json(segment_data, coll))
+            elif segment_data['type'] == 'ClothGeometry':
+                coll.segments.append(ClothGeometry.from_json(segment_data, coll))
+            elif segment_data['type'] == 'ShadowGeometry':
+                coll.segments.append(ShadowGeometry.from_json(segment_data, coll))
+        return coll
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t\t--- SegmentCollection ---\n')
+        for seg in self.segments:
+            seg.dump(fh)
+
+    def num_vertices(self):
+        numv = 0
+        for segm in self.segments:
+            numv += len(segm.vertices)
+        return numv
+
+    def add(self, segment):
+        '''Adds SegmentGeometry, ClothGeometry or ShadowGeometry
+        to the collection and sets the collection attribute.'''
+        segment.collection = self
+        self.segments.append(segment)
+
+    def remove(self, index):
+        '''Removes Geometry at index index.'''
+        del self.segments[index]
+
+    def split(self, seg_index, poly_mat_inds, mat_names):
+        '''Splits the segment with index == seg_index.
+        poly_mat_inds is a list where the index represents
+        the index of the face/polygon and the content of the
+        list item represents the material index.
+        mat_names is a list of material names.
+        This function splits the segment into multiple
+        segments(one per material). The result segments
+        will be used as the .segments of this SegmentCollection.'''
+        polies_per_material = self._polies_per_material(poly_mat_inds)
+        # Segment to split.
+        segm = self.segments[seg_index]
+        segments = []
+        # Loop through materials.
+        for mat_index, mat_poly_indices in enumerate(polies_per_material):
+            if not mat_poly_indices:
+                continue
+            seg = SegmentGeometry(self)
+            facecoll = FaceCollection(seg)
+            vertcoll = VertexCollection(seg)
+            vertcoll.set_flags_from_vertcoll(segm.vertices)
+            # Loop through face indices.
+            for local_face_index, face_index in enumerate(mat_poly_indices):
+                master_face = segm.faces[face_index]
+                new_face = Face()
+                for vert_index in master_face.vertices:
+                    # Add the vertex. As the vertex now holds UV, weights etc
+                    # its not necessary anymore to do all the checking if
+                    # the UV etc lists should be split, too.
+                    vertcoll.add(segm.vertices[vert_index])
+                    # Add last item in vertex collection to face.
+                    new_face.add(len(vertcoll) - 1)
+                facecoll.add(new_face)
+            seg.vertices = vertcoll
+            seg.faces = facecoll
+            seg.mat_name = mat_names[mat_index]
+            seg.mat = self.msh.get_mat_by_name(segm.mat_name)
+            segments.append(seg)
+        self.segment = []
+        self.segments = segments
+
+    def assign_materials(self, material_coll):
+        '''Assign material object from material name.'''
+        mat_name_dict = material_coll.get_matname_dict()
+        for segment in self.segments:
+            segment.material = mat_name_dict[segment.mat_name]
+
+    def _polies_per_material(self, poly_inds):
+        '''Creates a list where each item represents a material and holds
+        all polygon indices mapped to that material.'''
+        largest_index = self._mat_largest_ind(poly_inds)
+        # Create sub-lists for every material.
+        list_ = [[] for n in range(largest_index + 1)]
+        for index, el in enumerate(poly_inds):
+            # Now add the polygon indices to the according mat list.
+            list_[el].append(index)
+        return list_
+
+    def _mat_largest_ind(self, inds):
+        '''Largest material index. Equals number of materials.'''
+        int_ = 0
+        for el in inds:
+            if el > int_:
+                int_ = el
+        return int_
+
+    def __str__(self):
+        return str(self.segments)
+
+    def __repr__(self):
+        return str(self.segments)
+
+    def __getitem__(self, key):
+        return self.segments[key]
+
+    def __len__(self):
+        return len(self.segments)
+
+    def pack(self):
+        data = []
+        logging.debug(type(self.segments))
+        logging.debug(self.segments)
+        for segment in self.segments:
+            data.append(segment.pack())
+        return b''.join(data)
+
+    def repack(self):
+        data = [bsegment.repack() for segment in self.segments]
+        return b''.join(data)
+
+
+class SegmentGeometry(Packer):
+    # mat_name: string
+    # mat_index: int
+    # vert_list: list (Vertex)
+    # face_list: list (Face)
+    def __init__(self, collection=None):
+        #Reference to SegmentCollection.
+        self.collection = collection
+        self.classname  = 'SegmentGeometry'
+        self.mat_name   = None
+        self.material   = None
+        self.vertices   = None
+        self.faces      = None
+        self.msh        = None
+        self.index_map  = None
+
+    def get_json(self):
+        data = {
+            'type':         self.classname,
+            'material':     self.material.name.decode().encode('utf-8'),
+            'num_vertices': len(self.vertices),
+            'vertices':     self.vertices.get_json(),
+            'num_faces':    len(self.faces),
+            'faces':        self.faces.get_json(),
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        geo            = SegmentGeometry()
+        geo.collection = collection
+        geo.mat_name   = data['material'].decode().encode('utf-8')
+        geo.vertices   = VertexCollection.from_json(data['vertices'], geo)
+        geo.faces      = FaceCollection.from_json(data['faces'], geo)
+        return geo
+
+    def clear_doubles(self):
+        '''Clears Vertices appearing more than once.'''
+        self.index_map   = dict()
+        new_vertices     = []
+        # Use a set to quickly check if we have a duplicate.
+        new_vertices_set = set()
+        len_new_verts    = 0
+
+        num_cleared_vertices = 0
+
+        for index, vert in enumerate(self.vertices):
+            if vert in new_vertices_set:
+                index_original = new_vertices.index(vert)
+                # Insert into indices map.
+                self.index_map[index] = index_original
+
+                num_cleared_vertices += 1
+            else:
+                new_vertices.append(vert)
+                new_vertices_set.add(vert)
+                self.index_map[index] = len_new_verts
+                len_new_verts += 1
+        self.vertices.vertices = new_vertices
+
+        logging.debug('Cleared %s doubles.', num_cleared_vertices)
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t\t\t--- SegmentGeometry ---\n')
+        fh.write('\t\t\t\tMaterial:    {0}\n'.format(self.material))
+        fh.write('\t\t\t\tVertices:    {0}\n'.format(len(self.vertices)))
+        fh.write('\t\t\t\tFaces:       {0}\n'.format(len(self.faces or '')))
+        fh.write('\t\t\t\tUVed:        {0}\n'.format(self.vertices.uved))
+        fh.write('\t\t\t\tColored:     {0}\n'.format(self.vertices.colored))
+        fh.write('\t\t\t\tWeighted:    {0}\n'.format(self.vertices.weighted))
+        fh.write(str(self.index_map))
+
+    def pack_MATI(self):
+        return self.pack_long_chunk('MATI', self.material.index)
+
+    def pack(self):
+        '''Packs the SEGM chunk. This should be used to retrieve the segment in packed form.'''
+        data = [b'SEGM']
+        data.append('size')
+        data.append(self.pack_MATI())
+        data.append(self.vertices.pack())
+        data.append(self.faces.pack())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+    def repack(self):
+        return self.pack()
+
+
+class ShadowGeometry(Packer):
+    def __init__(self, collection=None):
+        self.collection = collection
+        self.classname  = 'ShadowGeometry'
+        self.data       = ''
+        self.positions  = []
+        self.edges      = []
+
+    def get_json(self):
+        data = {
+            'type':          self.classname,
+            'num_positions': len(self.positions),
+            'positions':     self.positions,
+            'num_edges':     len(self.edges),
+            'edges':         self.edges,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        geo = ShadowGeometry()
+        geo.collection = collection
+        geo.positions = data['positions']
+        geo.edges = data['edges']
+        return geo
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t\t\t--- ShadowGeometry ---\n')
+        fh.write('\t\t\t\tNo data available.\n')
+
+    def repack(self):
+        data = [b'SHDW', 'size', self.data]
+        data[1] = struct.pack('<L', len(self.data))
+        return b''.join(data)
+
+    def pack(self):
+        data = [b'SHDW', 'size']
+        data.append(struct.pack('<L', len(self.positions)))
+        for pos in self.positions:
+            data.append(struct.pack('<fff', *pos))
+        data.append(struct.pack('<L', len(self.edges)))
+        for edge in self.edges:
+            data.append(struct.pack('<HHHH', *edge))
+        data[1] = struct.pack('<L', 4 + 4 + 6 * len(self.edges) + 12 * len(self.positions))
+        return b''.join(data)
+
+
+class ClothCollision(Packer):
+    def __init__(self, cloth_geo=None):
+        self.cloth  = cloth_geo
+        self.name   = ''
+        self.parent = ''
+        # 0: Sphere, 1: Cylinder
+        self.primitive_type = 0
+        self.primitive_data = 4, 4, 4
+
+    def get_json(self):
+        data = {
+            'name':   self.name,
+            'parent': self.parent,
+            'primitive_type': self.primitive_type,
+            'primitive_data': self.primitive_data,
+        }
+        return data
+
+    @classmethod
+    def from_json(cls, data, cloth=None):
+        cc                = cls()
+        cc.cloth          = cloth
+        cc.name           = data['name']
+        cc.parent         = data['parent']
+        cc.primitive_type = data['primitive_type']
+        cc.primitive_data = data['primitive_data']
+        return cc
+
+    def pack(self):
+        data = [self.name   + '\x00',
+                self.parent + '\x00',
+                struct.pack('<L',    self.primitive_type),
+                struct.pack('<fff', *self.primitive_data)]
+        return b''.join(data)
+
+
+class ClothGeometry(Packer):
+    def __init__(self, collection=None):
+        self.collection          = collection
+        self.classname           = 'ClothGeometry'
+        self.texture             = b'no_texture'
+        self.vertices            = None
+        self.faces               = None
+        self.stretch             = b''
+        self.stretch_constraints = set()
+        self.cross               = b''
+        self.cross_constraints   = set()
+        self.bend                = b''
+        self.bend_constraints    = set()
+        self.collision           = b''
+        self.collisions          = []
+
+    def get_json(self):
+        data = {
+            'type':         self.classname,
+            'texture':      self.texture,
+            'num_vertices': len(self.vertices),
+            'vertices':     self.vertices.get_json(),
+            'num_faces':    len(self.faces),
+            'faces':        self.faces.get_json(),
+            'stretch':      self.stretch_constraints,
+            'cross':        self.cross_constraints,
+            'bend':         self.bend_constraints,
+            'collisions': [c.get_json() for c in self.collisions],
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        geo            = ClothGeometry()
+        geo.collection = collection
+        geo.vertices   = ClothVertexCollection.from_json(data['vertices'], geo)
+        geo.faces      = FaceCollection.from_json(data['faces'], geo)
+        geo.stretch_constraints = data['stretch']
+        geo.cross_constraints   = data['cross']
+        geo.bend_constraints    = data['bend']
+        geo.collisions          = [ClothCollision.from_json(collision, geo) for collision in data['collisions']]
+        return geo
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t\t\t--- ClothGeometry ---\n')
+        fh.write('\t\t\t\tVertices:    {0}\n'.format(len(self.vertices)))
+        fh.write('\t\t\t\tFaces:       {0}\n'.format(len(self.faces)))
+
+    def assign_parents(self):
+        '''Assign segment attribute for every collection.'''
+        self.vertices.segment = self
+        self.faces.segment = self
+
+    def create_constraints(self):
+        ''' Creates constraints between faces and vertices so the cloth
+            simulation can keep the cloth's shape
+        '''
+        def is_fixed(idx):
+            return self.vertices[idx].is_fixed
+
+        # Note that the Pandemic exporter does _not_ constrain fixed points to each other (which
+        # really doesn't make any sense). So we don't do it either
+        for face in self.faces:
+            # p1 ┌────┐ p2
+            #    │    │
+            #    │    │
+            # p4 └────┘ p3
+
+            last_vert_idx = face.vertices[-1]
+
+            # Stretch constraints, along the boundary of the polygon
+            # p1-p2, p2-p3, p3-p4, p4-p1
+            # This allows for any amount of sides to the polygon
+            for vert_idx in face.vertices:
+                both_fixed = is_fixed(vert_idx) and is_fixed(last_vert_idx)
+
+                if both_fixed:
+                    continue
+
+                # Check both possible orders, we only want one connection between two vertices
+                a_b_exists = (last_vert_idx, vert_idx) in self.stretch_constraints
+                b_a_exists = (vert_idx, last_vert_idx) in self.stretch_constraints
+
+                if not (a_b_exists or b_a_exists):
+                    self.stretch_constraints.add((last_vert_idx, vert_idx))
+
+                last_vert_idx = vert_idx
+
+            # Cross constraints, diagonally across _quads_
+            # p1-p3, p2-p4
+            # Only works for quads currently
+            if len(face.vertices) == 4:
+                pair_1 = (face.vertices[0], face.vertices[2])
+                pair_2 = (face.vertices[1], face.vertices[3])
+
+                # Only add constraint if either or both vertices are dynamic
+                if not (is_fixed(pair_1[0]) and is_fixed(pair_1[1])):
+                    self.cross_constraints.add(pair_1)
+
+                if not (is_fixed(pair_2[0]) and is_fixed(pair_2[1])):
+                    self.cross_constraints.add(pair_2)
+
+            # Bend constraints
+            # Supposed to keep the overall shape of the cloth from overbending
+            #
+            # p1   p2     p3
+            # ┌─────┬─────┐
+            # │     │     │
+            # │ p8  │ p9  │ p4
+            # ├─────┼─────┤
+            # │     │     │
+            # │     │     │
+            # └─────┴─────┘
+            # p7    p6    p5
+            #
+            # p1-p3, p3-p5, p5-p7, p7-p1, p8-p4, p2-p6
+            # Connects all faces in this pattern
+            for face2 in self.faces:
+                if face is face2:
+                    continue
+
+                # Vertices shared between the current two faces
+                shared_vertices = [v for v in face2.vertices if v in face.vertices]
+
+                if not shared_vertices:
+                    continue
+
+                shared_vertex = shared_vertices[0]
+
+                # get_connections gets all vertices in a face that connect to the given one. So in
+                # the drawing above if we pass p8 to get_connections of the top-left face we will
+                # get [p1, p9]
+                # Shared vertices will be filtered out, so p1 remains
+                connections1 = []
+                for connection_vertex in face.get_connections(shared_vertex):
+                    if connection_vertex not in shared_vertices:
+                        connections1.append(connection_vertex)
+
+                # Same as above, assuming we pass p8 of the bottom-left face we will get [p9, p7]
+                # Shared vertices will be filtered out, so p7 remains
+                connections2 = []
+                for connection_vertex in face2.get_connections(shared_vertex):
+                    if connection_vertex not in shared_vertices:
+                        connections2.append(connection_vertex)
+
+                # Zip the two resulting lists ([p1] and [p7]) creating pair p1-p7
+                for vert_idx_1, vert_idx_2 in zip(connections1, connections2):
+                    # Again, a constraint between two fixed points does not make sense. In this case
+                    # we need to consider the case of fixed-dynamic _spanning_ a fixed point needs
+                    # to be considered, too (e.g. p1-p7 where p1 and p8 are fixed). These should be
+                    # kept
+                    both_fixed = is_fixed(vert_idx_1) and is_fixed(vert_idx_2)
+
+                    if both_fixed:
+                        continue
+
+                    a_b_exists = (vert_idx_1, vert_idx_2) in self.bend_constraints
+                    b_a_exists = (vert_idx_2, vert_idx_1) in self.bend_constraints
+
+                    if not (a_b_exists or b_a_exists):
+                        self.bend_constraints.add((vert_idx_1, vert_idx_2))
+
+    def pack_stretch(self):
+        data = [b'SPRS', struct.pack('<LL', 4 + 4 * len(self.stretch_constraints), len(self.stretch_constraints))]
+        for item in self.stretch_constraints:
+            data.append(struct.pack('<HH', *item))
+        return b''.join(data)
+
+    def repack_stretch(self):
+        data = [b'SPRS', 'size']
+        # Just append the data we read when this .msh was loaded.
+        data.append(self.stretch)
+        data[1] = struct.pack('<L', len(self.stretch))
+        return b''.join(data)
+
+    def pack_cross(self):
+        data = [b'CPRS', struct.pack('<LL', 4 + 4 * len(self.cross_constraints), len(self.cross_constraints))]
+        for item in self.cross_constraints:
+            data.append(struct.pack('<HH', *item))
+        return b''.join(data)
+
+    def repack_cross(self):
+        data = [b'CPRS', 'size']
+        data.append(self.cross)
+        data[1] = struct.pack('<L', len(self.cross))
+        return b''.join(data)
+
+    def pack_bend(self):
+        data = [b'BPRS', struct.pack('<LL', 4 + 4 * len(self.bend_constraints), len(self.bend_constraints))]
+        for item in self.bend_constraints:
+            data.append(struct.pack('<HH', *item))
+        return b''.join(data)
+
+    def repack_bend(self):
+        data = [b'BPRS', 'size']
+        data.append(self.bend)
+        data[1] = struct.pack('<L', len(self.cross))
+        return b''.join(data)
+
+    def pack_collision(self):
+        data = [b'COLL', 'size', struct.pack('<L', len(self.collisions))]
+        # Length of size indicator = 4.
+        size = 4
+        for coll in self.collisions:
+            data.append(coll.pack())
+            size += len(data[-1])
+        # Make the length of the chunk a multiple of 4.
+        while size % 4 != 0:
+            size += 1
+            data.append('\x00')
+        data[1] = struct.pack('<L', size)
+        return b''.join(data)
+
+    def repack_collision(self):
+        data = [b'COLL', 'size']
+        data.append(self.collision)
+        data[1] = struct.pack('<L', len(self.collision))
+        return b''.join(data)
+
+    def pack(self):
+        data = [b'CLTH', 'size']
+        if self.texture:
+            data.append(self.pack_string_chunk('CTEX', self.texture))
+        else:
+            data.append(self.pack_string_chunk('CTEX', 'no_texture'))
+        data.append(self.vertices.pack_pos())
+        data.append(self.vertices.pack_uvs())
+        data.append(self.vertices.pack_fixed())
+        data.append(self.vertices.pack_weights())
+        data.append(self.faces.pack_cloth())
+        data.append(self.pack_stretch())
+        data.append(self.pack_cross())
+        data.append(self.pack_bend())
+        data.append(self.pack_collision())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+    def repack(self):
+        data = [b'CLTH', 'size']
+        if self.texture:
+            data.append(self.pack_string_chunk('CTEX', self.texture))
+        else:
+            data.append(self.pack_string_chunk('CTEX', 'no_texture'))
+        data.append(self.vertices.pack_pos())
+        data.append(self.vertices.pack_uvs())
+        data.append(self.vertices.pack_fixed())
+        data.append(self.vertices.pack_weights())
+        data.append(self.faces.pack_cloth())
+        data.append(self.repack_stretch())
+        data.append(self.repack_cross())
+        data.append(self.repack_bend())
+        data.append(self.repack_collision())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return b''.join(data)
+
+
+class Face(object):
+    '''Keeps the indices of the vertices forming this face.'''
+    # Params:
+    #   - vertices: a list of indices forming this face.
+    #   - coll: the FaceCollection.
+    def __init__(self, vertices=None, coll=None):
+        # List of vertex indices(ints).
+        if vertices:
+            self.vertices = vertices
+        else:
+            self.vertices = None
+        # Reference to the FaceCollection.
+        if coll:
+            self.collection = coll
+        else:
+            self.collection = None
+        self.classname = 'Face'
+
+
+    def get_json(self):
+        data = {
+            'vertices': self.vertices,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        face            = Face()
+        face.collection = collection
+        face.vertices   = data['vertices']
+        return face
+
+    def get_connections(self, vertex):
+        ''' Get all vertices that connect to the given vertex in this face'''
+        index = self.vertices.index(vertex)
+
+        connections = []
+
+        # Get the vertex before the given one Underflow -> take last one
+        if index - 1 < 0:
+            connections.append(self.vertices[-1])
+        else:
+            connections.append(self.vertices[index - 1])
+
+        # Get the vertex after the given one Overflow -> take first one
+        if index + 1 == len(self.vertices):
+            connections.append(self.vertices[0])
+        else:
+            connections.append(self.vertices[index + 1])
+
+        return connections
+
+    def replace(self, verts):
+        '''Replaces the local vertices list with a new one.'''
+        self.vertices = verts
+
+    def reverse_order(self):
+        '''Reverses the triangle order. Only works with tris.'''
+        self.vertices = self.vertices[0], self.vertices[2], self.vertices[1]
+
+    def add(self, vert_index):
+        '''Adds a vertex index to the local vertices.'''
+        if not self.vertices:
+            self.vertices = [vert_index]
+            return
+        self.vertices.append(vert_index)
+
+    def i(self, index):
+        '''Returns the vertex index at index index of the local vertices.'''
+        return self.vertices[index]
+
+    def SIindices(self):
+        '''Returns the face in CCW order for XSI importing.'''
+        if self.sides == 4:
+            return self.i(0), self.i(1), self.i(3), self.i(2)
+        else:
+            return self.i(0), self.i(1), self.i(2)
+
+    @property
+    def sides(self):
+        '''Returns the number of sides/vertices this face is constructed of.'''
+        return len(self.vertices)
+
+    def pack(self):
+        '''Packs the vertex indices for the STRP chunk.'''
+        index_map = None
+        if self.collection:
+            if self.collection.segment:
+                index_map = self.collection.segment.index_map
+
+        if (self.sides == 4) and (index_map is not None):
+            logging.debug(f"Vertex indices for the STRP index_map chunk are: {self.sides}...")
+            return struct.pack('<HHHH', index_map[self.vertices[0]] + 0x8000,
+                               index_map[self.vertices[1]] + 0x8000,
+                               index_map[self.vertices[2]],
+                               index_map[self.vertices[3]])
+        elif (self.sides == 3) and (index_map is not None):
+            logging.debug(f"Vertex indices for the STRP index_map chunk are: {self.sides}...")
+            return struct.pack('<HHH', index_map[self.vertices[0]] + 0x8000,
+                               index_map[self.vertices[1]] + 0x8000,
+                               index_map[self.vertices[2]])
+        elif (self.sides == 4) and (index_map is None):
+            logging.debug(f"Vertex indices for the STRP chunk are: {self.sides}...")
+            return struct.pack('<HHHH', self.vertices[0] + 0x8000,
+                               self.vertices[1] + 0x8000,
+                               self.vertices[2],
+                               self.vertices[3])
+        elif (self.sides == 3) and (index_map is None):
+            logging.debug(f"Vertex indices for the STRP chunk are: {self.sides}...")
+            return struct.pack('<HHH', self.vertices[0] + 0x8000,
+                               self.vertices[1] + 0x8000,
+                               self.vertices[2])
+        else:
+            logging.debug("Vertex indices for the STRP chunk are empty...")
+            return b''
+
+    def pack_tris(self):
+        '''Packs the vertex indices as tris for the CMSH chunk.'''
+        # index_map = self.collection.segment.index_map
+        # if (self.sides == 4) and (index_map is not None):
+        #     return (struct.pack('<LLL', index_map[self.vertices[0]],
+        #             index_map[self.vertices[1]],
+        #             index_map[self.vertices[2]]),
+        #             struct.pack('<LLL', index_map[self.vertices[0]],
+        #                         index_map[self.vertices[2]],
+        #                         index_map[self.vertices[3]]))
+        # elif (self.sides == 3) and (index_map is not None):
+        #     return (struct.pack('<LLL', index_map[self.vertices[0]],
+        #                         index_map[self.vertices[1]],
+        #                         index_map[self.vertices[2]]),)
+        # elif (self.sides == 4) and (index_map is None):
+        #     return (struct.pack('<LLL', self.vertices[0],
+        #             self.vertices[1],
+        #             self.vertices[2]),
+        #             struct.pack('<LLL', self.vertices[0],
+        #                         self.vertices[2],
+        #                         self.vertices[3]))
+        # elif (self.sides == 3) and (index_map is None):
+        #     return (struct.pack('<LLL', self.vertices[0],
+        #                         self.vertices[1],
+        #                         self.vertices[2]),)
+        # else:
+        #     return ()
+
+        # Make sure everything returned has a length for correct size calculation.
+        if self.sides == 4:
+            return (struct.pack('<LLL', self.vertices[0],
+                                        self.vertices[1],
+                                        self.vertices[2]),
+                    struct.pack('<LLL', self.vertices[0],
+                                        self.vertices[2],
+                                        self.vertices[3]))
+        elif self.sides == 3:
+            return (struct.pack('<LLL', self.vertices[0],
+                                        self.vertices[1],
+                                        self.vertices[2]), )
+        else:
+            return ()
+
+    def get_edges(self):
+        '''Returns unique edges.'''
+        if self.sides == 4:
+            return ((self.vertices[0], self.vertices[1]),
+                    (self.vertices[1], self.vertices[2]),
+                    (self.vertices[2], self.vertices[3]),
+                    (self.vertices[3], self.vertices[0]))
+        elif self.sides == 3:
+            return ((self.vertices[0], self.vertices[1]),
+                    (self.vertices[1], self.vertices[2]),
+                    (self.vertices[2], self.vertices[3]))
+        else:
+            return []
+
+    def __repr__(self):
+        return 'Face({0})'.format(str(self.vertices))
+
+    def __str__(self):
+        return 'Face({0})'.format(str(self.vertices))
+
+
+class FaceCollection(object):
+    def __init__(self, segm=None):
+        # List of Face objects.
+        self.faces = []
+        # Ref to parent(SegmentGeometry).
+        if segm:
+            self.segment = segm
+        else:
+            self.segment = None
+        self.classname = 'FaceCollection'
+
+    def get_json(self):
+        data = {
+            'faces': [face.get_json() for face in self.faces],
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, segment=None):
+        coll         = FaceCollection()
+        coll.segment = segment
+        coll.faces   = [Face.from_json(face_data, coll) for face_data in data['faces']]
+        return coll
+
+    def get_faces(self):
+        '''Returns faces as vertex indices.'''
+        faces = []
+        for face in self.faces:
+            faces.extend([vertex for vertex in face.vertices])
+        return faces
+
+    def de_ngonize(self, only_tris=False):
+        '''Makes all n-gons to tris or quads. only_tris defines if the algorithm should try to fit quads in, too.'''
+        if only_tris:
+            return self._triangulate_ngons()
+        new_faces = []
+        for ndx, face in enumerate(self.faces):
+            # If the face has more than 4 sides, cut it into multiple faces.
+            # Only 3 and 4 sided faces are supported.
+            if face.sides > 4:
+                nface = Face(self)
+                numtris = face.sides - 2
+                numquads = numtris / 2.0
+                # 4.0 == int(4.0) but 4.5 != int(4.5).
+                # So, if it's possible to cut the current face into multiple quads, do it.
+                # Otherwise triangulate it.
+                if int(numquads) == numquads:
+                    for n in range(int(numquads)):
+                        nface = Face(self)
+                        nface.vertices = face.vertices[n * 2:n * 2 + 4]
+                        new_faces.append(nface)
+                else:
+                    for n in range(int(numtris)):
+                        # Reverse every 2nd tri so every tri is CCW.
+                        if n / 2 != n / 2.0:
+                            nface = Face(self)
+                            nface.vertices = face.vertices[n:n + 3]
+                            nface.reverse_order()
+                            new_faces.append(nface)
+                            continue
+                        nface = Face(self)
+                        nface.vertices = face.vertices[n:n + 3]
+                        new_faces.append(nface)
+            else:
+                new_faces.append(face)
+        self.faces = new_faces
+
+    def _triangulate_ngons(self):
+        '''Triangulates n-gons of every face and sets the faces to the newly calculated ones.'''
+        new_faces = []
+        for ndx, face in enumerate(self.faces):
+            if face.sides > 3:
+                nface = Face(self)
+                numtris = face.sides - 2
+                # Just triangulate every face with more than 4 sides.
+                for n in range(int(numtris)):
+                    # Reverse every 2nd tri so every tri is CCW.
+                    if n / 2 != n / 2.0:
+                            nface = Face(self)
+                            nface.vertices = face.vertices[n:n + 3]
+                            nface.reverse_order()
+                            new_faces.append(nface)
+                            continue
+                    nface = Face(self)
+                    nface.vertices = face.vertices[n:n + 3]
+                    new_faces.append(nface)
+            else:
+                new_faces.append(face)
+        self.faces = new_faces
+
+    def add(self, face):
+        '''Adds a face to the collection.'''
+        face.collection = self
+        if not self.faces:
+            self.faces = [face]
+            return
+        self.faces.append(face)
+
+    def pack(self):
+        '''Packs vertex indices for every face into the STRP chunk.'''
+        data = [b'STRP', 'size', 'numitems']
+        faces = 0
+        for face in self.faces:
+            faces += face.sides
+            if face.sides == 4 or face.sides == 3:
+                data.append(face.pack())
+        data[1] = struct.pack('<L', faces * 2 + 4)
+        data[2] = struct.pack('<L', faces)
+        return b''.join(data)
+
+    def pack_cloth(self):
+        '''Packs triangles of every face into the cloth CMSH chunk.'''
+        data = [b'CMSH', 'size', 'num']
+        num = 0
+        for face in self.faces:
+            facetris = face.pack_tris()
+            num += len(facetris)
+            data.extend(facetris)
+        # Number of tris * number of points * size of float + size indicator size.
+        data[1] = struct.pack('<L', num * 3 * 4 + 4)
+        data[2] = struct.pack('<L', num)
+        return b''.join(data)
+
+    def stretch_edges(self):
+        '''Gets edges for SPRS cloth chunk.'''
+        edges = []
+        for face in self.faces:
+            face_edges = face.get_edges()
+            for edge in face_edges:
+                if not edge in edges and not (edge[1], edge[0]) in edges:
+                    edges.append(edge)
+        for index, edge in enumerate(edges):
+            if self.segment.vertices[edge[0]].is_fixed and self.segment.vertices[edge[1]].is_fixed:
+                edges.pop(index)
+        return edges
+
+    def cross_edges(self):
+        '''Gets edges for CPRS cloth chunk.'''
+        edges = []
+        for face in self.faces:
+            if face.sides == 4:
+                # Append edges which cross the quad.
+                edges.append((face.i(0), face.i(2)))
+                edges.append((face.i(1), face.i(3)))
+        return edges
+
+    def bend_edges(self):
+        '''Get edges for BPRS cloth chunk.'''
+        return ()
+
+    def __str__(self):
+        return str(self.faces)
+
+    def __repr__(self):
+        return str(self.faces)
+
+    def __getitem__(self, key):
+        return self.faces[key]
+
+    def __len__(self):
+        return len(self.faces)
+
+
+class Vertex(object):
+    def __init__(self, pos=(0, 0, 0), normal=None, coll=None):
+        # Reference to parent(VertexCollection).
+        self.collection = coll
+        self.classname  = 'Vertex'
+        self.index      = 0
+        self.x          = pos[0]
+        self.y          = pos[1]
+        self.z          = pos[2]
+
+        if normal:
+            self.nx = normal[0]
+            self.ny = normal[1]
+            self.nz = normal[2]
+        else:
+            self.nx = 1.0
+            self.ny = 1.0
+            self.nz = 1.0
+
+        self.u, self.v = 0.0, 0.0
+        self.color = Color()
+        self.deformers = ['none', 'none', 'none', 'none']
+        self.deformer_indices = [0, 0, 0, 0]
+        self.weights = [1.0, 0.0, 0.0, 0.0]
+
+    def get_json(self):
+        data = {
+            'position':  self.pos,
+            'uv':        self.uv,
+            'normal':    self.normal,
+            'deformers': self.deformers,
+            'weights':   self.weights,
+            'color':     self.color.get_json()
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, coll=None):
+        vert            = Vertex()
+        vert.collection = coll
+        vert.pos        = data['position']
+        vert.normal     = data['normal']
+        vert.uv         = data['uv']
+        vert.color      = Color.from_json(data['color'])
+        vert.deformers  = data['deformers']
+        vert.weights    = data['weights']
+        return vert
+
+    def dump(self, fh):
+        fh.write('\t\tVERTEX\n')
+        fh.write('\t\t\tPos: {0:3}, {1:3}, {2:3}\n'.format(*self.pos))
+        fh.write('\t\t\tUV:  {0:3}, {1:3}\n'.format(*self.uv))
+
+    def __hash__(self):
+        return hash((self.x, self.y, self.z, self.u, self.v, self.nx, self.ny, self.nz))
+
+    def __eq__(self, other):
+        if (self.x == other.x) and (self.y == other.y) and (self.z == other.z):
+            if (self.u == other.u) and (self.v == other.v):
+                if (self.nx == other.nx) and (self.ny == other.ny) and (self.nz == other.nz):
+                    return True
+        return False
+
+    def __repr__(self):
+        return 'Vertex({0}, {1}, {2})'.format(*self.pos)
+
+    @property
+    def pos(self):
+        return self.x, self.y, self.z
+
+    @pos.setter
+    def pos(self, value):
+        self.x, self.y, self.z = value
+
+    @property
+    def uv(self):
+        return self.u, self.v
+
+    @uv.setter
+    def uv(self, value):
+        self.u, self.v = value
+
+    @property
+    def normal(self):
+        return self.nx, self.ny, self.nz
+
+    @normal.setter
+    def normal(self, value):
+        self.nx, self.ny, self.nz = value
+
+    def translate(self, vector3):
+        self.x += vector3[0]
+        self.y += vector3[1]
+        self.z += vector3[2]
+
+    def pack_pos(self):
+        return struct.pack('<fff', *self.pos)
+
+    def pack_normal(self):
+        return struct.pack('<fff', *self.normal)
+
+    def pack_uvs(self):
+        return struct.pack('<ff', *self.uv)
+
+    def pack_weights(self):
+        data = []
+        for index, weight in itertools.izip(self.deformer_indices, self.weights):
+            data.append(struct.pack('<Lf', index, weight))
+        return b''.join(data)
+
+    def pack_color(self):
+        return self.color.pack_bgra('B')
+
+
+class VertexCollection(object):
+    def __init__(self, segm=None):
+        # Ref to parent SegmentGeometry.
+        if segm:
+            self.segment = segm
+        else:
+            self.segment = None
+
+        self.vertices  = []
+        self.classname = 'VertexCollection'
+        self.colored   = False
+        self.weighted  = False
+        self.uved      = False
+
+    def get_json(self):
+        data = {
+            'vertices': [v.get_json() for v in self.vertices],
+            'colored':  self.colored,
+            'weighted': self.weighted,
+            'uved':     self.uved,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, segment=None):
+        coll = VertexCollection()
+        coll.segment = segment
+
+        for vdata in data['vertices']:
+            coll.vertices.append(Vertex.from_json(vdata, coll))
+
+        coll.colored  = data['colored']
+        coll.weighted = data['weighted']
+        coll.uved     = data['uved']
+        return coll
+
+    def dump(self, fh):
+        for v in self.vertices:
+            v.dump(fh)
+
+    def set_flags_from_vertcoll(self, vertcoll):
+        '''Transfers flags from the given VertexCollection vertcoll to this one.'''
+        self.colored = vertcoll.colored
+        self.weighted = vertcoll.weighted
+        self.uved = vertcoll.uved
+
+    def get_positions(self):
+        '''Yield all positions.'''
+        for vertex in self.vertices:
+            yield vertex.pos
+
+    def pack_positions(self):
+        data = [b'POSL']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 3 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_pos())
+        return b''.join(data)
+
+    def get_normals(self):
+        '''Yield all normals.'''
+        for vertex in self.vertices:
+            yield vertex.normal
+
+    def pack_normals(self):
+        data = [b'NRML']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 3 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_normal())
+        return b''.join(data)
+
+    def get_uvs(self):
+        '''Yield all UVs.'''
+        for vertex in self.vertices:
+            yield vertex.uv
+
+    def get_uv_list(self):
+        return [vertex.uv for vertex in self.vertices]
+
+    def pack_uvs(self):
+        data = [b'UV0L']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 2 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_uvs())
+        return b''.join(data)
+
+    def set_uvs(self, uv_list):
+        for uv, vertex in itertools.izip(uv_list, self.vertices):
+            vertex.u = uv[0]
+            vertex.v = uv[1]
+
+    def get_colors(self):
+        '''Yield all color values.'''
+        for vertex in self.vertices:
+            yield vertex.color.get()
+
+    def set_colors(self, color_list):
+        for color, vertex in itertools.izip(color_list, self.vertices):
+            vertex.color = color
+
+    def pack_colors(self):
+        data = [b'CLRL']
+        data.append(struct.pack('<L', len(self.vertices) * 4 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_color())
+        return b''.join(data)
+
+    def get_weights(self):
+        weights = []
+        for vertex in self.vertices:
+            weights.append(vertex.deformers[0])
+            weights.append(vertex.weights[0])
+            weights.append(vertex.deformers[1])
+            weights.append(vertex.weights[1])
+            weights.append(vertex.deformers[2])
+            weights.append(vertex.weights[2])
+            weights.append(vertex.deformers[3])
+            weights.append(vertex.weights[3])
+        return weights
+
+    def set_weights(self, weights, deformers, indices):
+        for weight, deformer_tuple, index_tpl, vertex in itertools.izip(weights, deformers, indices, self.vertices):
+            vertex.weights          = weight
+            vertex.deformers        = deformer_tuple
+            vertex.deformer_indices = index_tpl
+
+    def pack_weights(self):
+        data = [b'WGHT']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 8 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_weights())
+        return b''.join(data)
+
+    def pack(self):
+        data = [self.pack_positions(),
+                self.pack_normals()]
+        if self.uved:
+            data.append(self.pack_uvs())
+        if self.colored:
+            data.append(self.pack_colors())
+        if self.weighted:
+            data.append(self.pack_weights())
+        return b''.join(data)
+
+    def add(self, vertex):
+        '''Adds a vertex to the collection and sets
+        its collection property.'''
+        vertex.collection = self
+        self.vertices.append(vertex)
+
+    def __str__(self):
+        return str(self.vertices)
+
+    def __repr__(self):
+        return str(self.vertices)
+
+    def __getitem__(self, key):
+        return self.vertices[key]
+
+    def __len__(self):
+        return len(self.vertices)
+
+
+class ClothVertex(object):
+    def __init__(self, pos, coll=None):
+        if coll:
+            self.collection = coll
+        else:
+            self.collection = None
+        self.classname = 'ClothVertex'
+        self.index = 0
+        self.x = pos[0]
+        self.y = pos[1]
+        self.z = pos[2]
+        self.u, self.v = 0.0, 0.0
+        self.deformer = ''
+        self.is_fixed = False
+
+    def get_json(self):
+        data = {
+            'position': self.pos,
+            'uv': self.uv,
+            'deformer': self.deformer,
+            'is_fixed': self.is_fixed,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        v = ClothVertex()
+        v.collection = collection
+        v.pos = data['position']
+        v.uv = data['uv']
+        v.deformer = data['deformer']
+        v.is_fixed = data['is_fixed']
+        return v
+
+    @property
+    def pos(self):
+        return self.x, self.y, self.z
+
+    @pos.setter
+    def pos(self, value):
+        self.x, self.y, self.z = value
+
+    @property
+    def uv(self):
+        return self.u, self.v
+
+    @uv.setter
+    def uv(self, value):
+        self.u, self.v = value
+
+    def pack_pos(self):
+        '''Returns x, y, z packed into 3 floats.'''
+        return struct.pack('<fff', *self.pos)
+
+    def pack_uvs(self):
+        '''Returns u, v packed into 2 floats.'''
+        return struct.pack('<ff', *self.uv)
+
+
+class ClothVertexCollection(Packer):
+    def __init__(self, segm=None, verts=None):
+        if segm:
+            self.segment = segm
+        else:
+            self.segment = None
+        if verts:
+            self.vertices = verts
+        else:
+            self.vertices = []
+        self.classname = 'ClothVertexCollection'
+        self.uved = True
+
+    def get_json(self):
+        data = {
+            'vertices': [v.get_json() for v in self.vertices],
+            'uved': self.uved,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, segment=None):
+        coll = ClothVertexCollection()
+        coll.segment = segment
+        coll.uved = data['uved']
+        coll.vertices = [ClothVertex.from_json(vdata, coll) for vdata in data['vertices']]
+        return coll
+
+    def fixed(self):
+        return [point for point in self.vertices if point.is_fixed]
+
+    def fixed_indices(self):
+        return [index for index, point in enumerate(self.vertices) if point.is_fixed]
+
+    def get_deformers(self):
+        return [point.deformer for point in self.vertices if point.deformer]
+
+    def add(self, vert):
+        '''Adds a vertex to the collection and sets its collection property.'''
+        vert.collection = self
+        self.vertices.append(vert)
+
+    def pack_pos(self):
+        '''Packs vertex positions into CPOS chunk.'''
+        data = [b'CPOS']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 3 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vert in self.vertices:
+            data.append(vert.pack_pos())
+        return b''.join(data)
+
+    def pack_uvs(self):
+        data = [b'CUV0']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 2 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vert in self.vertices:
+            data.append(vert.pack_uvs())
+        return b''.join(data)
+
+    def pack_fixed(self):
+        data = [b'FIDX', 'size', 'num']
+        num = 0
+        for index, vert in enumerate(self.vertices):
+            if vert.is_fixed:
+                data.append(struct.pack('<L', index))
+                num += 1
+        data[1] = struct.pack('<L', num * 4 + 4)
+        data[2] = struct.pack('<L', num)
+        return b''.join(data)
+
+    def pack_weights(self):
+        data = [b'FWGT', 'size', 'num']
+        num = 0
+        data2 = []
+        for index, vert in enumerate(self.vertices):
+            if vert.is_fixed and vert.deformer:
+                data2.append(self.null_terminate(vert.deformer))
+                num += 1
+        data.append(b''.join(data2))
+        data[1] = struct.pack('<L', len(data[3]) + 4)
+        data[2] = struct.pack('<L', num)
+        return b''.join(data)
+
+    def __str__(self):
+        return str(self.vertices)
+
+    def __repr__(self):
+        return str(self.vertices)
+
+    def __getitem__(self, key):
+        return self.vertices[key]
+
+    def __len__(self):
+        return len(self.vertices)
+
+
+class Animation(Packer):
+    # Params:
+    #   - parent: Parent class(Msh)
+    #   - empty: Empty animation?
+    #       'empty' = empty animation
+    #       'maybe_empty' = check .bones and .cycle before packing
+    def __init__(self, msh=None, empty=None):
+        # Ref to Msh.
+        self.msh = msh
+        self.bones = None
+        self.cycle = None
+        self.cycles = []
+        self.classname = 'Animation'
+        if empty == 'empty':
+            # If the animation export is disabled, replace pack function.
+            self.pack = self.pack_empty
+        elif empty == 'maybe_empty':
+            self.pack = self.pack_check
+
+    @property
+    def empty(self):
+        '''Checks if this animation has any bones or cycle.'''
+        if self.bones and self.cycle:
+            return False
+        return True
+
+    def pack_check(self):
+        if self.bones and self.cycle:
+            return self.pack()
+        else:
+            return self.pack_empty()
+
+    def pack(self):
+        data = []
+        data.append(self.bones.pack_SKL2())
+        data.append(self.bones.pack_BLN2())
+        data.append('ANM2')
+        data.append('size')
+        data.append(self.cycle.pack())
+        data.append(self.bones.pack_KFR3())
+        data[3] = struct.pack('<L', self.sum_seq(data, 4))
+        return b''.join(data)
+
+    def pack_empty(self):
+        return b''
+
+
+class Cycle(object):
+    # animation: parent Animation
+    # name: string
+    # fps: float
+    # style: int
+    # frames: tuple2 (frame_start, frame_end)
+    def __init__(self, animation=None):
+        # Ref to Animation.
+        self.animation = animation
+        self.name      = b'fullanimation'
+        self.classname = 'AnimCycle'
+        self.fps       = 30
+        self.style     = 0
+        self.frames    = (1, 100)
+
+    def numframes(self):
+        return self.frames[1] - (self.frames[0] - 1)
+
+    def animname(self):
+        return self.name.ljust(64, '\x00')
+
+    def pack(self):
+        data = [b'CYCL', struct.pack('<L', 84), struct.pack('<L', 1)]
+        data.append(self.animname())
+        data.append(struct.pack('<f',   self.fps))
+        data.append(struct.pack('<L',   self.style))
+        data.append(struct.pack('<LL', *self.frames))
+        return b''.join(data)
+
+
+class Bone(object):
+    # Params:
+    #   - collection: class(BoneCollection)
+    def __init__(self, collection=None):
+        # Parent BoneCollection.
+        self.collection = collection
+        self.classname  = 'Bone'
+        # Name of the bone(and it's accompanying Model).
+        self.name = ''
+        # CRC checksum of the bone.
+        self.CRC  = ''  # msh2_crc.crc(self.name)
+        # The purpose of the following parameters is unclear.
+        self.bone_type     = 0
+        self.constrain     = 1.0
+        self.bone1len      = 0.0
+        self.bone2len      = 0.0
+        self.blend_factor  = 0
+        self.keyframe_type = 0
+        # List of position frames(x, y, z).
+        self.pos_keyframes = None
+        self.pos_keyframe_indices = None
+        # List of rotation frames(x, y, z, w).
+        self.rot_keyframes = None
+        self.rot_keyframe_indices = None
+
+    def dump(self, fh):
+        w = fh.write
+        w('BONE - {0}\n'.format(self.name))
+        w('\tRotation:\n')
+        for rot in self.rot_keyframes:
+            w('\t\t{0}\n'.format(rot))
+        w('\tTransform:\n')
+        for pos in self.pos_keyframes:
+            w('\t\t{0}\n'.format(pos))
+
+    def recrc(self):
+        '''Calculates a Zero CRC from the name.'''
+        self.CRC = msh2_crc.strcrc(self.name)
+
+    def set_name_from_crc(self):
+        '''Tries to reverse-engineer the CRC into a name
+        via comparing to the CRCs of all models in this .msh.'''
+        if not self.CRC:
+            raise MSH2Error('Bone doesnt have a CRC applied for reverse-engineering.')
+        names = self.collection.get_check_names_list()
+        name  = msh2_crc.compare_crc_adv(names, self.CRC)
+        if name:
+            self.name = name
+            self.collection.remove_check_name(name)
+
+    def pack_SKL2(self):
+        '''Packs attributes for the SKL2 chunk.'''
+        data = [self.CRC,
+                struct.pack('<L', self.bone_type),
+                struct.pack('<f', self.constrain),
+                struct.pack('<L', self.bone1len),
+                struct.pack('<L', self.bone2len)]
+        return b''.join(data)
+
+    def pack_BLN2(self):
+        '''Packs attributes for the BLN2 chunk.'''
+        data = [self.CRC,
+                struct.pack('<L', self.blend_factor)]
+        return b''.join(data)
+
+    def pack_KFR3(self):
+        '''Packs position and rotation frames for the KFR3 chunk.'''
+        data = [self.CRC,
+                struct.pack('<L', self.keyframe_type),
+                struct.pack('<L', len(self.pos_keyframes)),
+                struct.pack('<L', len(self.rot_keyframes))]
+        for ndx, frame in enumerate(self.pos_keyframes):
+            data.append(struct.pack('<L', ndx + self.collection.animation.cycle.frames[0]))
+            data.append(struct.pack('<fff',   *frame))
+        for ndx, frame in enumerate(self.rot_keyframes):
+            data.append(struct.pack('<L', ndx + self.collection.animation.cycle.frames[0]))
+            data.append(struct.pack('<ffff',  *frame))
+        return b''.join(data)
+
+
+class BoneCollection(Packer):
+    # Params:
+    #   - animation: class(Animation)
+    def __init__(self, animation=None):
+        if animation:
+            self.animation = animation
+        else:
+            self.animation = None
+
+        self.classname   = 'BoneCollection'
+        self.bones       = []
+        self.check_names = None
+
+    def add(self, bone):
+        '''Adds bone to the collection and sets its
+        collection attribute.'''
+        bone.collection = self
+        self.bones.append(bone)
+
+    def remove(self, index):
+        '''Remove bone at index index.'''
+        del self.bones[index]
+
+    def replace(self, bones):
+        '''Replace internal bones list with bones.'''
+        self.bones = bones
+
+    def get_by_name(self, name):
+        '''Get bone by name.'''
+        for bone in self.bones:
+            if name == bone.name:
+                return bone
+
+    def get_check_names_list(self):
+        '''Returns list of all bone names.
+        This list will be reduced if the name of a bone is found
+        to maximize performance. It's used to calculate the name
+        of a bone by comparing the CRC in the .msh file and a
+        newly generated CRC of every bone in this list.'''
+        if not self.check_names:
+            self.check_names = self.animation.msh.models.get_names_list()
+        return self.check_names
+
+    def remove_check_name(self, name):
+        '''If the name of a bone is matched with a CRC, remove
+        the name from the list to reduce iteration time.'''
+        self.check_names.remove(name)
+
+    def __str__(self):
+        return str(self.bones)
+
+    def __repr__(self):
+        return str(self.bones)
+
+    def __getitem__(self, key):
+        return self.bones[key]
+
+    def __len__(self):
+        return len(self.bones)
+
+    def pack_SKL2(self):
+        data = [b'SKL2']
+        data.append(struct.pack('<L', len(self.bones) * 20 + 4))
+        data.append(struct.pack('<L', len(self.bones)))
+        for bone in self.bones:
+            data.append(bone.pack_SKL2())
+        return b''.join(data)
+
+    def pack_BLN2(self):
+        data = [b'BLN2']
+        data.append(struct.pack('<L', len(self.bones) * 8 + 4))
+        data.append(struct.pack('<L', len(self.bones)))
+        for bone in self.bones:
+            data.append(bone.pack_BLN2())
+        return b''.join(data)
+
+    def pack_KFR3(self):
+        data = [b'KFR3', 'size']
+        data.append(struct.pack('<L', len(self.bones)))
+        for bone in self.bones:
+            data.append(bone.pack_KFR3())
+        data[1] = struct.pack('<L', self.sum_seq(data, 3) + 4)
+        return b''.join(data)
+
+
+class Color(object):
+    def __init__(self, color=None):
+        if color:
+            self.red   = color[0]
+            self.green = color[1]
+            self.blue  = color[2]
+            self.alpha = color[3]
+        else:
+            self.red   = 128
+            self.green = 128
+            self.blue  = 128
+            self.alpha = 255
+        self.classname = 'Color'
+
+    def get_json(self):
+        data = {
+            'rgba': self.rgba,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data):
+        col = Color()
+        col.rgba = data['rgba']
+        return col
+
+    @property
+    def rgba(self):
+        return self.red, self.green, self.blue, self.alpha
+
+    @rgba.setter
+    def rgba(self, value):
+        self.red, self.green, self.blue, self.alpha = value
+
+    def get_f(self):
+        if isinstance(self.red, float):
+            return self.red, self.green, self.blue, self.alpha
+        else:
+            return ((self.red / 255.), (self.green / 255.),
+                    (self.blue / 255.), (self.alpha / 255.))
+
+    def get_b(self):
+        if isinstance(self.red, float):
+            return (int(self.red * 255), int(self.green * 255),
+                    int(self.blue * 255), int(self.alpha * 255))
+        else:
+            return self.red, self.green, self.blue, self.alpha
+
+    def get(self):
+        return self.red, self.green, self.blue, self.alpha
+
+    def set(self, r, g, b, a=255):
+        self.red   = r
+        self.green = g
+        self.blue  = b
+        self.alpha = a
+
+    def __str__(self):
+        return '{0}, {1}, {2}, {3}'.format(self.red, self.green, self.blue, self.alpha)
+
+    def __repr__(self):
+        return self.__str__()
+
+    def pack(self, mode='B'):
+        '''Packs color channels, default type is B(bool).
+        No converting is done, so if you pass f for mode
+        but the values are from 0-255 you will get that
+        value as float.'''
+        return struct.pack('<{0}'.format(mode * 4),
+                           self.red,
+                           self.green,
+                           self.blue,
+                           self.alpha)
+
+    def pack_bgra(self, mode='B'):
+        '''Same as pack but packs into BGRA ordering.'''
+        return struct.pack('<{0}'.format(mode * 4),
+                           self.blue,
+                           self.green,
+                           self.red,
+                           self.alpha)
+
+
+
+
+class Transform(object):
+    def __init__(self, tra=None, rot=None, sca=None):
+        if rot:
+            self.rotation = rot
+        else:
+            self.rotation = 0.0, 0.0, 0.0, 1.0
+        if tra:
+            self.translation = tra
+        else:
+            self.translation = 0.0, 0.0, 0.0
+        if sca:
+            self.scale = sca
+        else:
+            self.scale = 1.0, 1.0, 1.0
+        self.classname = 'Transform'
+
+    def get_json(self):
+        data = {
+            'position': self.translation,
+            'rotation': self.euler_angles(),
+            'scale':    self.scale,
+        }
+        return data
+
+    @classmethod
+    def from_json(cls, data):
+        tr = cls()
+        tr.translation = data['position']
+        tr.rotation    = tr.euler_to_quaternion(data['rotation'])
+        tr.scale       = data['scale']
+        return tr
+
+    def __str__(self):
+        return 'Pos({0}), Rot({1}), Scl({2})'.format(', '.join([str(i) for i in self.translation]),
+                                                     ', '.join([str(i) for i in self.rotation]),
+                                                     ', '.join([str(i) for i in self.scale]))
+
+    def __repr__(self):
+        return 'Pos({0}), Rot({1}), Scl({2})'.format(', '.join([str(i) for i in self.translation]),
+                                                     ', '.join([str(i) for i in self.rotation]),
+                                                     ', '.join([str(i) for i in self.scale]))
+
+    def pack(self):
+        data = [b'TRAN', struct.pack('<L', 40)]
+        data.append(struct.pack('<fff',  *self.scale))
+        data.append(struct.pack('<ffff', *self.rotation))
+        data.append(struct.pack('<fff',  *self.translation))
+        return b''.join(data)
+
+    def euler_angles(self):
+        '''Returns the internal Quaternion in Euler Angles(radians).'''
+        test = self.rotation[0] * self.rotation[1] + self.rotation[2] * self.rotation[3]
+
+        if test > 0.499:
+            heading  = 2 * math.atan2(self.rotation[0], self.rotation[3])
+            attitude = math.pi / 2
+            bank     = 0
+            return math.degrees(heading), math.degrees(attitude), math.degrees(bank)
+        elif test < -0.499:
+            heading  = -2 * math.atan2(self.rotation[0], self.rotation[3])
+            attitude = -1 * math.pi / 2
+            bank     = 0
+            return math.degrees(heading), math.degrees(attitude), math.degrees(bank)
+
+        sqx     = self.rotation[0] * self.rotation[0]
+        sqy     = self.rotation[1] * self.rotation[1]
+        sqz     = self.rotation[2] * self.rotation[2]
+        heading = math.atan2((2 * self.rotation[1] * self.rotation[3] -
+                              2 * self.rotation[0] * self.rotation[2]),
+                              1 - 2 * sqy - 2 * sqz)
+        attitude = math.asin(2 * test)
+        bank = math.atan2((2 * self.rotation[0] * self.rotation[3] -
+                           2 * self.rotation[1] * self.rotation[2]),
+                           1 - 2 * sqx - 2 * sqz)
+        return math.degrees(heading), math.degrees(attitude), math.degrees(bank)
+
+    def euler_to_quaternion(self, euler):
+        c1   = math.cos(math.radians(euler[0] / 2))
+        s1   = math.sin(math.radians(euler[0] / 2))
+        c2   = math.cos(math.radians(euler[1] / 2))
+        s2   = math.sin(math.radians(euler[1] / 2))
+        c3   = math.cos(math.radians(euler[2] / 2))
+        s3   = math.sin(math.radians(euler[2] / 2))
+        c1c2 = c1 * c2
+        s1s2 = s1 * s2
+        w    = c1c2 * c3 - s1s2 * s3
+        x    = c1c2 * s3 + s1s2 * c3
+        y    = s1 * c2 * c3 + c1 * s2 * s3
+        z    = c1 * s2 * c3 - s1 * c2 * s3
+        self.rotation = x, y, z, w
+        return x, y, z, w
+
+    def reversed_quaternion(self):
+        '''Returns the Quaternion as W, X, Y, Z.'''
+        return self.rotation[3], self.rotation[0], self.rotation[1], self.rotation[2]
+
+
+class BBox(Transform):
+    def __init__(self):
+        self.rotation  = 0.0, 0.0, 0.0, 1.0
+        self.extents   = 4.0, 4.0, 4.0
+        self.center    = 0.0, 0.0, 0.0
+        self.radius    = 6.92
+        self.classname = 'BBox'
+
+    def get_json(self):
+        data = {
+            'rotation': self.euler_angles(),
+            'extents':  self.extents,
+            'center':   self.center,
+            'radius':   self.radius,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data):
+        b = BBox()
+        b.rotation = b.euler_to_quaternion(data['rotation'])
+        b.extents  = data['extents']
+        b.center   = data['center']
+        b.radius   = data['radius']
+        return b
+
+    def pack(self):
+        data = [b'BBOX', struct.pack('<L', 44)]
+        data.append(struct.pack('<ffff', *self.rotation))
+        data.append(struct.pack('<fff',  *self.center))
+        data.append(struct.pack('<fff',  *self.extents))
+        data.append(struct.pack('<f',     self.radius))
+        return b''.join(data)
diff --git a/src/blender_addon/io_mesh_msh2/msh2/msh2_unpack.py b/src/blender_addon/io_mesh_msh2/msh2/msh2_unpack.py
new file mode 100644
index 0000000..76776dd
--- /dev/null
+++ b/src/blender_addon/io_mesh_msh2/msh2/msh2_unpack.py
@@ -0,0 +1,593 @@
+'''
+    ZeroEngine .msh model format parser.
+
+    Refer to
+       schlechtwetterfront.github.io/ze_filetypes/msh.html
+   for more information regarding the file format.
+'''
+from . import msh2_data as msh2
+from struct import unpack as unpack
+import logging
+
+from .Logger import Logger
+logging = Logger("Msh").get_logger()
+
+
+
+STR_CODEC = 'utf-8'
+CHUNK_LIST = ['HEDR', 'SHVO', 'MSH2',
+              'SINF', 'FRAM', 'CAMR',
+              'MATL', 'DATA', 'MATD', 'ATRB', 'TX0D', 'TX1D', 'TX2D', 'TX3D',
+              'MODL', 'MTYP', 'MNDX', 'PRNT', 'FLGS', 'TRAN', 'ENVL', 'SWCI',
+              'GEOM', 'SEGM', 'SHDW', 'MATI', 'POSL', 'NRML', 'UV0L', 'UV1L',
+              'UV2L', 'CLRL', 'CLRB', 'WGHT', 'NDXL', 'NDXT', 'STRP',
+              'CLTH', 'CTEX', 'CPOS', 'CUV0', 'FIDX', 'FWGT', 'SPRS', 'CPRS',
+              'BPRS', 'COLL',
+              'SKL2', 'BLN2', 'ANM2', 'CYCL', 'KFR3',
+              'NAME', 'BBOX', 'CL1L']
+
+
+class UnpackError(Exception):
+    def __init__(self, val):
+        self.val = val
+
+    def __str__(self):
+        return str(self.val)
+
+
+class Unpacker(object):
+    def unpack_header(self, data):
+        return data[:4].decode(), unpack('<L', data[4:])[0]
+
+    def unpack_str(self, data):
+        pass
+
+    # def log(self, text):
+    #     logging.debug(text)
+
+    # def dont_log(self, *text):
+    #     pass
+
+    def long(self, data):
+        return unpack('<L', data)[0]
+
+    def short(self, data):
+        return unpack('<H', data)[0]
+
+    def float(self, data):
+        return unpack('<f', data)[0]
+
+
+class BBoxUnpacker(Unpacker):
+    def __init__(self, data):
+        self.bbox = msh2.BBox()
+        self.data = data
+
+    def unpack(self):
+        self.bbox.rotation = unpack('<ffff', self.data[:16])
+        self.bbox.center = unpack('<fff', self.data[16:28])
+        self.bbox.extents = unpack('<fff', self.data[28:40])
+        self.bbox.radius = unpack('<f', self.data[40:])[0]
+        return self.bbox
+
+
+class MSHUnpack(Unpacker):
+    def __init__(self, mshfile, config={'do_logging': False,
+                                        'ignore_geo': False,
+                                        'triangulate': False}):
+        self.mshfile = mshfile
+        self.msh = msh2.Msh()
+        self.msh.animation = msh2.Animation(self.msh, 'maybe_empty')
+        self.config = config
+        # if not config['do_logging']:
+        #     self.log = self.dont_log
+
+    def unpack(self):
+        with open(self.mshfile, 'rb') as mf:
+            # HEDR
+            bin, self.size = self.unpack_header(mf.read(8))
+            # MSH2 or SHVO
+            bin, self.msh2size = self.unpack_header(mf.read(8))
+            if bin == 'SHVO':
+                logging.debug('Skipping SHVO chunk.')
+                # Read the 4 content bytes of SHVO.
+                mf.read(4)
+                # that's definitely MSH2
+                bin, self.msh2size = self.unpack_header(mf.read(8))
+            mdlcoll = msh2.ModelCollection(self.msh)
+            self.msh.models = mdlcoll
+            while True:
+                hdr, size = self.unpack_header(mf.read(8))
+                logging.debug('Header, Size: {0}, {1}'.format(hdr, size))
+                if hdr == 'SINF':
+                    si = InfoUnpacker(self, size, mf)
+                    self.msh.info = si.unpack()
+                elif hdr == 'MATL':
+                    num_materials = unpack('<L', mf.read(4))[0]
+                    matcoll = msh2.MaterialCollection(self.msh)
+                    for n in range(num_materials):
+                        mat, matsize = self.unpack_header(mf.read(8))
+                        logging.debug('Material, Size: {0}, {1}'.format(mat, matsize))
+                        mat = MaterialUnpacker(self, matsize, mf)
+                        matcoll.add(mat.unpack())
+                    matcoll.assign_indices()
+                    self.msh.materials = matcoll
+                elif hdr == 'MODL':
+                    mdl = ModelUnpacker(self, size, mf)
+                    mdlcoll.add(mdl.unpack())
+                elif hdr == 'CAMR':
+                    mf.read(size)
+                elif hdr == 'LGHT':
+                    mf.read(size)
+                elif hdr == 'SKL2':
+                    numbones = unpack('<L', mf.read(4))[0]
+                    bonecoll = msh2.BoneCollection(self.msh.animation)
+                    for n in range(numbones):
+                        bone = msh2.Bone(bonecoll)
+                        bone.CRC = mf.read(4)
+                        bone.set_name_from_crc()
+                        bone.bone_type = unpack('<L', mf.read(4))[0]
+                        bone.constrain = unpack('<f', mf.read(4))[0]
+                        bone.bone1len = unpack('<f', mf.read(4))[0]
+                        bone.bone2len = unpack('<f', mf.read(4))[0]
+                        bonecoll.add(bone)
+                    self.msh.animation.bones = bonecoll
+                elif hdr == 'BLN2':
+                    # Ignore BLN2 as this only has one attribute(blend_factor).
+                    # It's not clear which type this is and it's not important.
+                    mf.read(size)
+                elif hdr == 'ANM2':
+                    # Continue as this is only a header.
+                    continue
+                elif hdr == 'CYCL':
+                    num_cycles = unpack('<L', mf.read(4))[0]
+                    cycles = []
+                    for n in range(num_cycles):
+                        cycle = msh2.Cycle(self.msh.animation)
+                        cycle.name = mf.read(64).strip(b'\x00')
+                        cycle.fps = unpack('<f', mf.read(4))[0]
+                        cycle.style = unpack('<L', mf.read(4))[0]
+                        cycle.frames = unpack('<LL', mf.read(8))
+                        cycles.append(cycle)
+                    self.msh.animation.cycles = cycles
+                    self.msh.animation.cycle = cycles[0]
+                elif hdr == 'KFR3':
+                    numbones = unpack('<L', mf.read(4))[0]
+                    for n in range(numbones):
+                        # Ingore the crc, usually the same order as before.
+                        mf.read(4)
+                        bone = self.msh.animation.bones[n]
+                        bone.keyframe_type = unpack('<L', mf.read(4))[0]
+                        numtran, numrot = unpack('<LL', mf.read(8))
+                        tran = []
+                        translation_frame_indices = []
+                        rot = []
+                        rotation_frame_indices = []
+                        for i in range(numtran):
+                            # Ignore the frame index.
+                            translation_frame_indices.append(unpack('<L', mf.read(4))[0])
+                            # Add X, Y, Z position tuple.
+                            tran.append(unpack('<fff', mf.read(12)))
+                        for i in range(numrot):
+                            # Again, ignore the frame index.
+                            rotation_frame_indices.append(unpack('<L', mf.read(4))[0])
+                            # X, Y, Z, W quaternion translation tuple.
+                            rot.append(unpack('<ffff', mf.read(16)))
+                        bone.pos_keyframes = tran
+                        bone.pos_keyframe_indices = translation_frame_indices
+                        bone.rot_keyframes = rot
+                        bone.rot_keyframe_indices = rotation_frame_indices
+                elif hdr == 'CL1L':
+                    break
+                else:
+                    logging.debug('Unrecognized chunk {0} in MSHUnpack.'.format(hdr))
+                    raise UnpackError('Unrecognized chunk {0} in MSHUnpack (can be a valid chunk but doesnt fit into this unpack level).'.format(hdr))
+                    break
+        for model in self.msh.models:
+            model.set_deformers_from_indices()
+        return self.msh
+
+
+class ModelUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.size = size
+        self.fh = fh
+        self.mdl = msh2.Model(up.msh)
+        self.up = up
+
+    def unpack(self):
+        logging.debug('Unpacking Model at {0}.'.format(self.fh.tell() - 8))
+        while True:
+            hdr, size = self.unpack_header(self.fh.read(8))
+            logging.debug('Model: Header, Size: {0}, {1}'.format(hdr, size))
+            if hdr == 'MTYP':
+                self.mdl.model_type = msh2.MODEL_TYPES_INT[unpack('<L', self.fh.read(4))[0]]
+            # RepSharpshooters MshEx exports MTYP as MYTP. Should work since the format update.
+            elif hdr == 'MYTP':
+                logging.info('Found RepSharpshooter MshEx type .msh. Continuing the import.')
+                self.mdl.model_type = msh2.MODEL_TYPES_INT[unpack('<L', self.fh.read(4))[0]]
+            elif hdr == 'NAME':
+                self.mdl.name = self.fh.read(size).strip(b'\x00')
+            elif hdr == 'MNDX':
+                self.mdl.index = unpack('<L', self.fh.read(4))[0]
+            elif hdr == 'PRNT':
+                self.mdl.parent_name = self.fh.read(size).decode().encode(STR_CODEC).strip(b'\x00')
+            elif hdr == 'FLGS':
+                self.mdl.vis = unpack('<L', self.fh.read(4))[0]
+            elif hdr == 'TRAN':
+                scl = unpack('<fff', self.fh.read(12))
+                rot = unpack('<ffff', self.fh.read(16))
+                tra = unpack('<fff', self.fh.read(12))
+                self.mdl.transform = msh2.Transform(tra, rot, scl)
+            elif hdr == 'GEOM':
+                if self.up.config['ignore_geo']:
+                    self.fh.read(size)
+                    continue
+                # If this is a bone(MTYP 3) then set model type to geobone as
+                # it has geometry, too.
+                if self.mdl.model_type == 'bone':
+                    self.mdl.model_type = 'geobone'
+                # Ignore the bbox header and size indicator. We dont need it.
+                self.fh.read(8)
+                bb = BBoxUnpacker(self.fh.read(44))
+                self.mdl.bbox = bb.unpack()
+                self.mdl.segments = msh2.SegmentCollection(self.mdl)
+                while True:
+                    soc, ssize = self.unpack_header(self.fh.read(8))
+                    logging.debug('Model Segments: Header, Size: {0}, {1}'.format(soc, ssize))
+                    if soc == 'SEGM':
+                        segm = GeometryUnpacker(self, ssize, self.fh)
+                        self.mdl.segments.add(segm.unpack())
+                    elif soc == 'CLTH':
+                        segm = ClothUnpacker(self, ssize, self.fh)
+                        self.mdl.segments.add(segm.unpack())
+                    elif soc == 'ENVL':
+                        num = unpack('<L', self.fh.read(4))[0]
+                        inds = []
+                        for n in range(num):
+                            inds.append(unpack('<L', self.fh.read(4))[0])
+                        self.mdl.deformer_indices = inds
+                    else:
+                        logging.debug('Unrecognized chunk {0} in ModelUnpack(Geometry).'.format(soc))
+                        self.fh.seek(self.fh.tell() - 8)
+                        break
+            elif hdr == 'SWCI':
+                self.mdl.collprim = True
+                prim_data = unpack('<Lfff', self.fh.read(16))
+                self.mdl.primitive = (prim_data[0], prim_data[1],
+                                      prim_data[2], prim_data[3])
+            else:
+                logging.debug('Unrecognized chunk {0} in ModelUnpack.'.format(hdr))
+                # Return to the position before the header.
+                self.fh.seek(self.fh.tell() - 8)
+                break
+        return self.mdl
+
+
+class ClothUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.up = up
+        self.size = size
+        self.fh = fh
+        self.seg = msh2.ClothGeometry(up.mdl)
+
+    def unpack(self):
+        logging.debug('----  Unpacking Cloth  ----')
+        fixed = []
+        while True:
+            hdr, size = self.unpack_header(self.fh.read(8))
+            logging.debug('Cloth: Header, Size: {0}, {1}'.format(hdr, size))
+            if hdr == 'CTEX':
+                self.seg.texture = self.fh.read(size).decode().encode(STR_CODEC).strip(b'\x00')
+            elif hdr == 'CPOS':
+                vertcoll = msh2.ClothVertexCollection(self.seg)
+                num = unpack('<L', self.fh.read(4))[0]
+                for n in range(num):
+                    pos = unpack('<fff', self.fh.read(12))
+                    vert = msh2.ClothVertex(pos)
+                    vertcoll.add(vert)
+                self.seg.vertices = vertcoll
+            elif hdr == 'CUV0':
+                num = unpack('<L', self.fh.read(4))[0]
+                for n in range(num):
+                    self.seg.vertices[n].uv = unpack('<ff', self.fh.read(8))
+            elif hdr == 'FIDX':
+                num = unpack('<L', self.fh.read(4))[0]
+                for n in range(num):
+                    index = unpack('<L', self.fh.read(4))[0]
+                    fixed.append(index)
+                    self.seg.vertices[index].is_fixed = True
+            elif hdr == 'FWGT':
+                self.fh.read(4)  # Number of points.
+                weights = self.fh.read(size - 4).split(b'\x00')
+                logging.debug('Cloth Deformers: {0}'.format(weights))
+                logging.debug('Cloth Fixed Points: {0}'.format(len(fixed)))
+                weights.remove('')
+                if len(weights) > 0:
+                    for index, vertindex in enumerate(fixed):
+                        self.seg.vertices[vertindex].deformer = weights[index]
+            elif hdr == 'CMSH':
+                num = unpack('<L', self.fh.read(4))[0]
+                facecoll = msh2.FaceCollection(self.seg)
+                for n in range(num):
+                    face = msh2.Face()
+                    face.vertices = unpack('<LLL', self.fh.read(12))
+                    facecoll.add(face)
+                self.seg.faces = facecoll
+            elif hdr == 'SPRS':
+                num_constraints = self.long(self.fh.read(4))
+                s_constraints = []
+                for n in range(num_constraints):
+                    s_constraints.append(unpack('<HH', self.fh.read(4)))
+                self.seg.stretch_constraints = s_constraints
+            elif hdr == 'CPRS':
+                num_constraints = self.long(self.fh.read(4))
+                c_constraints = []
+                for n in range(num_constraints):
+                    c_constraints.append(unpack('<HH', self.fh.read(4)))
+                self.seg.cross_constraints = c_constraints
+            elif hdr == 'BPRS':
+                num_constraints = self.long(self.fh.read(4))
+                b_constraints = []
+                for n in range(num_constraints):
+                    b_constraints.append(unpack('<HH', self.fh.read(4)))
+                self.seg.bend_constraints = b_constraints
+            elif hdr == 'COLL':
+                num_colls = self.long(self.fh.read(4))
+                for n in range(num_colls):
+                    collision = msh2.ClothCollision()
+                    collision.cloth = self.seg
+                    name = []
+                    while 1:
+                        char = self.fh.read(1)
+                        if char == b'\x00':
+                            break
+                        name.append(char)
+                    collision.name = ''.join(name)
+                    parent = []
+                    while 1:
+                        char = self.fh.read(1)
+                        if char == b'\x00':
+                            break
+                        parent.append(char)
+                    collision.parent = ''.join(parent)
+                    collision.primitive_type = unpack('<L', self.fh.read(4))[0]
+                    collision.primitive_data = unpack('<fff', self.fh.read(12))
+                    self.seg.collisions.append(collision)
+                # COLL chunk seems to be padded with \x00 at the end to get an even size indicator.
+                while True:
+                    if self.fh.read(1) == b'\x00':
+                        continue
+                    else:
+                        self.fh.seek(self.fh.tell() - 1)
+                        break
+            else:
+                logging.debug('Unrecognized chunk {0} in ClothUnpack.'.format(hdr))
+                # Return to the position before the header.
+                self.fh.seek(self.fh.tell() - 8)
+                break
+        return self.seg
+
+
+class GeometryUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.up = up
+        self.size = size
+        self.fh = fh
+        # Either SegmentGeometry or ShadowGeometry.
+        # Usually it's SegmentGeometry so we'll set it as default.
+        # Cloth doesn't have the SEGM chunk we read before we got here.
+        self.seg = msh2.SegmentGeometry(up.mdl)
+
+    def unpack(self):
+        # Now we have to check which type of segment it is.
+        # Most common will be static meshes, then maybe shadows, then enveloped.
+        # Enveloped and static meshes share most of the chunks, however,
+        # shadows meshes only have one chunk.
+        logging.debug('----  Unpacking Geometry  ----')
+        self.up.up.last_chunk = None
+        while True:
+            # The SEGM header is already gone so read the next one.
+            hdr, size = self.unpack_header(self.fh.read(8))
+            logging.debug('Geo: Header, Size: {0}, {1}'.format(hdr, size))
+            if hdr == 'SHDW':
+                self.up.up.last_chunk = 'SHDW'
+                self.seg = msh2.ShadowGeometry(self.up.mdl)
+                # self.seg.data = self.fh.read(size)
+                num_pos = self.long(self.fh.read(4))
+                positions = []
+                for n in range(num_pos):
+                    positions.append((self.float(self.fh.read(4)), self.float(self.fh.read(4)), self.float(self.fh.read(4))))
+                num_edges = self.long(self.fh.read(4))
+                edges = []
+                for n in range(num_edges):
+                    edge = self.short(self.fh.read(2)), self.short(self.fh.read(2)), self.short(self.fh.read(2)), self.short(self.fh.read(2))
+                    edges.append(edge)
+                self.seg.positions = positions
+                self.seg.edges = edges
+            elif hdr == 'MATI':
+                self.up.up.last_chunk = 'MATI'
+                # 1st up: ModelUnpacker, 2nd up: MSHUnpack
+                self.seg.material = self.up.up.msh.get_mat_by_index(unpack('<L', self.fh.read(4))[0])
+                self.seg.mat_name = self.seg.material.name
+            elif hdr == 'POSL':
+                self.up.up.last_chunk = 'POSL'
+                num_positions = unpack('<L', self.fh.read(4))[0]
+                vertcoll = msh2.VertexCollection(self.seg)
+                for n in range(num_positions):
+                    pos = self.fh.read(12)
+                    pos = unpack('<fff', pos)
+                    vert = msh2.Vertex(pos)
+                    vertcoll.add(vert)
+                self.seg.vertices = vertcoll
+            elif hdr == 'NRML':
+                self.up.up.last_chunk = 'NRML'
+                num_normals = unpack('<L', self.fh.read(4))[0]
+                for n in range(num_normals):
+                    self.seg.vertices[n].normal = unpack('<fff', self.fh.read(12))
+            elif hdr == 'UV0L':
+                self.up.up.last_chunk = 'UV0L'
+                num_uvs = unpack('<L', self.fh.read(4))[0]
+                for n in range(num_uvs):
+                    self.seg.vertices[n].uv = unpack('<ff', self.fh.read(8))
+                self.seg.vertices.uved = True
+            elif hdr in ('UV1L', 'UV2L', 'UV3L'):
+                # Never seen UV2L + but just to be sure.
+                self.fh.read(size)
+            elif hdr == 'CLRL':
+                self.up.up.last_chunk = 'CLRL'
+                num_colors = unpack('<L', self.fh.read(4))[0]
+                for n in range(num_colors):
+                    bgra_color = unpack('<BBBB', self.fh.read(4))
+                    self.seg.vertices[n].color = msh2.Color((bgra_color[2], bgra_color[1], bgra_color[0], bgra_color[3]))
+                self.seg.vertices.colored = True
+            elif hdr == 'CLRB':
+                self.up.up.last_chunk = 'CLRB'
+                bgra_color = unpack('<BBBB', self.fh.read(4))
+                color = (bgra_color[2], bgra_color[1], bgra_color[0], bgra_color[3])
+                for vert in self.seg.vertices:
+                    vert.color = msh2.Color(color)
+                self.seg.vertices.colored = True
+            elif hdr == 'WGHT':
+                last_chunk = 'WGHT'
+                num = unpack('<L', self.fh.read(4))[0]
+                for n in range(num):
+                    indices = []
+                    vals = []
+                    for i in range(4):
+                        indices.append(unpack('<L', self.fh.read(4))[0])
+                        vals.append(unpack('<f', self.fh.read(4))[0])
+                    self.seg.vertices[n].deformer_indices = indices
+                    self.seg.vertices[n].weights = vals
+                self.seg.vertices.weighted = True
+            elif hdr == 'STRP':
+                last_chunk = 'STRP'
+                num = unpack('<L', self.fh.read(4))[0]
+                facecoll = msh2.FaceCollection(self.seg)
+                num_begins = 0
+                for n in range(num):
+                    val = unpack('<H', self.fh.read(2))[0]
+                    if (val - 0x8000) > -1:
+                        if num_begins == 0:
+                            num_begins += 1
+                            face = msh2.Face()
+                            facecoll.add(face)
+                        elif num_begins == 1:
+                            num_begins += 1
+                            if face.sides > 2:
+                                face = msh2.Face()
+                                facecoll.add(face)
+                                num_begins = 0
+                        elif num_begins == 2:
+                            num_begins = 1
+                            face = msh2.Face()
+                            facecoll.add(face)
+                        face.add(val - 0x8000)
+                    else:
+                        face.add(val)
+                facecoll.de_ngonize(self.up.up.config['triangulate'])
+                self.seg.faces = facecoll
+            elif hdr == 'NDXL':
+                last_chunk = 'NDXL'
+                self.fh.read(size)
+            elif hdr == 'NDXT':
+                last_chunk = 'NDXT'
+
+                # If the faces are already set (for example from the STRP chunk)
+                # then ignore this as it's usually deprecated.
+                if self.seg.faces:
+                    continue
+
+                num_triangles = unpack('<L', self.fh.read(4))[0]
+
+                logging.debug('Sizes: %d == %d', num_triangles * 6 + 4, size)
+
+                faces = msh2.FaceCollection(self.seg)
+
+                for n in range(num_triangles):
+                    face = msh2.Face(list(unpack('<HHH', self.fh.read(2 * 3))))
+                    faces.add(face)
+
+                self.seg.faces = faces
+
+                # Skip any bytes left (which seems to happen in some .msh files),
+                used_bytes = len(faces) * 6 + 4
+                if used_bytes < size:
+                    self.fh.read(size - used_bytes)
+            else:
+                if hdr not in CHUNK_LIST:
+                    if last_chunk == 'STRP':
+                        logging.debug('Fixing STRP chunk import.')
+                        self.fh.seek(self.fh.tell() - 8)
+                        self.fh.read(2)
+                        continue
+                logging.debug('Unrecognized chunk {0} in GeometryUnpack.'.format(hdr))
+                # Return to the position before the header.
+                self.fh.seek(self.fh.tell() - 8)
+                break
+        return self.seg
+
+
+class MaterialUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.size = size
+        self.fh = fh
+        self.mat = msh2.Material(up.msh)
+
+    def unpack(self):
+        logging.debug('----  Unpacking Material  ----')
+        # NAME chunk.
+        bin, size = self.unpack_header(self.fh.read(8))
+        self.mat.name = self.fh.read(size).strip(b'\x00')
+        # DATA chunk.
+        bin, size = self.unpack_header(self.fh.read(8))
+        logging.debug('header, size: {0}, {1}'.format(bin, size))
+        self.mat.diff_color = msh2.Color(unpack('<ffff', self.fh.read(16)))
+        self.mat.spec_color = msh2.Color(unpack('<ffff', self.fh.read(16)))
+        self.mat.ambt_color = msh2.Color(unpack('<ffff', self.fh.read(16)))
+        self.mat.gloss = unpack('<f', self.fh.read(4))[0]
+        # ATRB chunk.
+        bin, size = self.unpack_header(self.fh.read(8))
+        logging.debug('header, size: {0}, {1}'.format(bin, size))
+        self.mat.flags = self.mat.flags_from_int(unpack('<B', self.fh.read(1))[0])
+        self.mat.render_type, self.mat.data0, self.mat.data1 = unpack('<BBB', self.fh.read(3))
+        # Textures.
+        for n in range(4):
+            hdr, size = self.unpack_header(self.fh.read(8))
+            logging.debug('TX header, size: {0}, {1}'.format(hdr, size))
+            if hdr[:2] == 'TX':
+                if hdr[2] == '0':
+                    self.mat.tex0 = self.fh.read(size).decode().encode(STR_CODEC).strip(b'\x00')
+                elif hdr[2] == '1':
+                    self.mat.tex1 = self.fh.read(size).decode().encode(STR_CODEC).strip(b'\x00')
+                elif hdr[2] == '2':
+                    self.mat.tex2 = self.fh.read(size).decode().encode(STR_CODEC).strip(b'\x00')
+                elif hdr[2] == '3':
+                    self.mat.tex3 = self.fh.read(size).decode().encode(STR_CODEC).strip(b'\x00')
+            else:
+                logging.debug('Unrecognized chunk {0} in MaterialUnpacker.'.format(hdr))
+                self.fh.seek(self.fh.tell() - 8)
+                break
+        return self.mat
+
+
+class InfoUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.size = size
+        self.fh = fh
+        self.info = msh2.SceneInfo(up.msh)
+
+    def unpack(self):
+        logging.debug('----  Unpacking Scene Info  ----')
+        # Name chunk.
+        bin, size = self.unpack_header(self.fh.read(8))
+        self.info.name = self.fh.read(size).decode().encode(STR_CODEC).strip(b'\x00')
+        # FRAM chunk.
+        bin, size = self.unpack_header(self.fh.read(8))
+        self.info.frame_range = unpack('<LL', self.fh.read(8))
+        self.info.fps = unpack('<f', self.fh.read(4))[0]
+        # BBOX chunk.
+        self.fh.read(8)  # Just read those, size is always the same.
+        bb = BBoxUnpacker(self.fh.read(44))
+        self.info.bbox = bb.unpack()
+        return self.info
diff --git a/src/clear_pycache_dirs.sh b/src/clear_pycache_dirs.sh
new file mode 100755
index 0000000..7987a3d
--- /dev/null
+++ b/src/clear_pycache_dirs.sh
@@ -0,0 +1,12 @@
+#!/bin/bash
+
+# set -o xtrace       ## To debug scripts
+# set -o errexit      ## To exit on error
+# set -o errunset     ## To exit if a variable is referenced but not set
+
+
+function main() {
+    find . -name "__pycache__" -exec rm -rf $1 {} \;
+    find . -name "*.pyc" -exec rm -rf $1 {} \;
+}
+main
diff --git a/src_research_readme/Notes.txt b/src_research_readme/Notes.txt
new file mode 100644
index 0000000..576bf62
--- /dev/null
+++ b/src_research_readme/Notes.txt
@@ -0,0 +1,4 @@
+https://git.rwth-aachen.de/carstenf/OpenGL/blob/master/QtMeshViewer/Source/SettingsManager.cpp
+
+
+https://schlechtwetterfront.github.io/ze_filetypes/msh.html
\ No newline at end of file
diff --git a/src_research_readme/mesh-info-pages/index.html b/src_research_readme/mesh-info-pages/index.html
new file mode 100644
index 0000000..1c2a526
--- /dev/null
+++ b/src_research_readme/mesh-info-pages/index.html
@@ -0,0 +1,4005 @@
+<!DOCTYPE html>
+<html lang="en"><head>
+<meta http-equiv="content-type" content="text/html; charset=UTF-8">
+		<meta charset="utf-8">
+		<meta name="viewport" content="width=device-width, initial-scale=1.0">
+
+		
+		<title>.msh Format</title>
+		
+
+		<meta name="description" content="">
+		<meta name="keywords" content="programming, code">
+
+		<link rel="shortcut icon" type="image/png" href="https://schlechtwetterfront.github.io/images/personal_logo_small.png">
+		<link rel="stylesheet" href="msh%20Format_files/subpage-style.css" type="text/css">
+	</head>
+	<body class="page-fileformats">
+
+		<div class="container-fluid page__header">
+			
+				<header class="page__title container">
+	<h1>.msh Format</h1>
+</header>
+			
+		</div>
+
+		<div class="container">
+
+			
+	<nav class="menu">
+    <ul class="menu__nav blocks">
+        
+        
+        
+            <li class="menu__category"><h5 class="category-title">Navigation</h5></li>
+            
+            <li class="menu__link"><a href="#overview">Overview</a></li>
+            
+            <li class="menu__link"><a href="https://schlechtwetterfront.github.io/ze_filetypes/index.html">Back</a></li>
+            
+        
+        
+
+
+	
+		<li class="menu__category"><h5 class="category-title">Example</h5></li>
+		
+	
+	<li class="menu__link"><a href="#ExampleChunk" alt="ExampleChunk">ExampleChunk</a></li>
+
+	
+		<li class="menu__category"><h5 class="category-title">General Chunks</h5></li>
+		
+	
+	<li class="menu__link"><a href="#HEDR" alt="HEDR">HEDR</a></li>
+
+	
+	<li class="menu__link"><a href="#SHVO" alt="SHVO">SHVO</a></li>
+
+	
+	<li class="menu__link"><a href="#MSH2" alt="MSH2">MSH2</a></li>
+
+	
+	<li class="menu__link"><a href="#FINF" alt="FINF">FINF</a></li>
+
+	
+	<li class="menu__link"><a href="#SINF" alt="SINF">SINF</a></li>
+
+	
+	<li class="menu__link"><a href="#FRAM" alt="FRAM">FRAM</a></li>
+
+	
+	<li class="menu__link"><a href="#CAMR" alt="CAMR">CAMR</a></li>
+
+	
+		<li class="menu__category"><h5 class="category-title">Materials</h5></li>
+		
+	
+	<li class="menu__link"><a href="#MATL" alt="MATL (Materials)">MATL (Materials)</a></li>
+
+	
+	<li class="menu__link"><a href="#MATD" alt="MATD (Material)">MATD (Material)</a></li>
+
+	
+	<li class="menu__link"><a href="#MATD.DATA" alt="MATD.DATA">MATD.DATA</a></li>
+
+	
+	<li class="menu__link"><a href="#ATRB" alt="ATRB">ATRB</a></li>
+
+	
+	<li class="menu__link"><a href="#TX0D" alt="TX0D">TX0D</a></li>
+
+	
+	<li class="menu__link"><a href="#PRFX" alt="PRFX">PRFX</a></li>
+
+	
+		<li class="menu__category"><h5 class="category-title">Models</h5></li>
+		
+	
+	<li class="menu__link"><a href="#MODL" alt="MODL (Model)">MODL (Model)</a></li>
+
+	
+	<li class="menu__link"><a href="#MTYP" alt="MTYP">MTYP</a></li>
+
+	
+	<li class="menu__link"><a href="#MNDX" alt="MNDX">MNDX</a></li>
+
+	
+	<li class="menu__link"><a href="#PRNT" alt="PRNT">PRNT</a></li>
+
+	
+	<li class="menu__link"><a href="#FLGS" alt="FLGS">FLGS</a></li>
+
+	
+	<li class="menu__link"><a href="#TRAN" alt="TRAN">TRAN</a></li>
+
+	
+	<li class="menu__link"><a href="#SWCI" alt="SWCI">SWCI</a></li>
+
+	
+		<li class="menu__category"><h5 class="category-title">Geometry</h5></li>
+		
+	
+	<li class="menu__link"><a href="#GEOM" alt="GEOM (Geometry)">GEOM (Geometry)</a></li>
+
+	
+	<li class="menu__link"><a href="#ENVL" alt="ENVL (Envelope)">ENVL (Envelope)</a></li>
+
+	
+	<li class="menu__link"><a href="#SEGM" alt="SEGM">SEGM</a></li>
+
+	
+	<li class="menu__link"><a href="#SHDW" alt="SHDW">SHDW</a></li>
+
+	
+	<li class="menu__link"><a href="#MATI" alt="MATI">MATI</a></li>
+
+	
+	<li class="menu__link"><a href="#POSL" alt="POSL">POSL</a></li>
+
+	
+	<li class="menu__link"><a href="#NRML" alt="NRML">NRML</a></li>
+
+	
+	<li class="menu__link"><a href="#UV0L" alt="UV0L">UV0L</a></li>
+
+	
+	<li class="menu__link"><a href="#CLRL" alt="CLRL">CLRL</a></li>
+
+	
+	<li class="menu__link"><a href="#CLRB" alt="CLRB">CLRB</a></li>
+
+	
+	<li class="menu__link"><a href="#WGHT" alt="WGHT">WGHT</a></li>
+
+	
+	<li class="menu__link"><a href="#NDXL" alt="NDXL">NDXL</a></li>
+
+	
+	<li class="menu__link"><a href="#NDXT" alt="NDXT">NDXT</a></li>
+
+	
+	<li class="menu__link"><a href="#STRP" alt="STRP">STRP</a></li>
+
+	
+	<li class="menu__link"><a href="#VLTB" alt="VLTB">VLTB</a></li>
+
+	
+	<li class="menu__link"><a href="#VLTL" alt="VLTL">VLTL</a></li>
+
+	
+		<li class="menu__category"><h5 class="category-title">Cloth</h5></li>
+		
+	
+	<li class="menu__link"><a href="#CLTH" alt="CLTH (Cloth)">CLTH (Cloth)</a></li>
+
+	
+	<li class="menu__link"><a href="#CTEX" alt="CTEX">CTEX</a></li>
+
+	
+	<li class="menu__link"><a href="#CPOS" alt="CPOS">CPOS</a></li>
+
+	
+	<li class="menu__link"><a href="#CUV0" alt="CUV0">CUV0</a></li>
+
+	
+	<li class="menu__link"><a href="#FIDX" alt="FIDX">FIDX</a></li>
+
+	
+	<li class="menu__link"><a href="#FWGT" alt="FWGT">FWGT</a></li>
+
+	
+	<li class="menu__link"><a href="#CMSH" alt="CMSH">CMSH</a></li>
+
+	
+	<li class="menu__link"><a href="#SPRS" alt="SPRS">SPRS</a></li>
+
+	
+	<li class="menu__link"><a href="#CPRS" alt="CPRS">CPRS</a></li>
+
+	
+	<li class="menu__link"><a href="#BPRS" alt="BPRS">BPRS</a></li>
+
+	
+	<li class="menu__link"><a href="#COLL" alt="COLL">COLL</a></li>
+
+	
+		<li class="menu__category"><h5 class="category-title">Animation</h5></li>
+		
+	
+	<li class="menu__link"><a href="#SKL2" alt="SKL2 (Skeleton)">SKL2 (Skeleton)</a></li>
+
+	
+	<li class="menu__link"><a href="#BLN2" alt="BLN2">BLN2</a></li>
+
+	
+	<li class="menu__link"><a href="#ANM2" alt="ANM2 (Animation)">ANM2 (Animation)</a></li>
+
+	
+	<li class="menu__link"><a href="#CYCL" alt="CYCL">CYCL</a></li>
+
+	
+	<li class="menu__link"><a href="#KFR3" alt="KFR3">KFR3</a></li>
+
+	
+		<li class="menu__category"><h5 class="category-title">Other</h5></li>
+		
+	
+	<li class="menu__link"><a href="#CL1L" alt="CL1L">CL1L</a></li>
+
+	
+	<li class="menu__link"><a href="#NAME" alt="NAME">NAME</a></li>
+
+	
+	<li class="menu__link"><a href="#BBOX" alt="BBOX">BBOX</a></li>
+
+	
+		<li class="menu__category"><h5 class="category-title">Deprecated</h5></li>
+		
+	
+	<li class="menu__link"><a href="#LGTP" alt="LGTP">LGTP</a></li>
+
+	
+	<li class="menu__link"><a href="#LGTI" alt="LGTI">LGTI</a></li>
+
+	
+	<li class="menu__link"><a href="#LGTS" alt="LGTS">LGTS</a></li>
+
+	
+	<li class="menu__link"><a href="#FOGD" alt="FOGD">FOGD</a></li>
+
+
+    </ul>
+</nav>
+
+
+			
+			<div class="content">
+				
+				
+
+				
+	
+						
+							<section class="block block-overview">
+
+<h2 id="overview">Overview</h2>
+
+<p>This page lists all .MSH file chunks.
+In the .MSH file these chunks are organized in a hierarchy with <a class="chunk" href="#hedr">HEDR</a>
+(header) being the first chunk and branching out from there
+(as visualized in the sidebar navigation).</p>
+<p>Some of these chunks are exclusive to certain versions of the engine
+(Star Wars: The Clone Wars and before, Star Wars: Battlefront and Star Wars: Battlefront II)
+or deprecated completely. Most notably Cloth Simulation (<a class="chunk" href="#clth">CLTH</a> and children)
+being limited to Star Wars: Battlefront II.</p>
+
+</section>
+						
+				
+
+	<section class="block">
+		<h2 class="title" id="chunk-hierarchy">Chunk Hierarchy</h2>
+		<div class="hierarchy">
+		
+			<header class="has-children">
+				<a href="#HEDR" alt="HEDR" class="title chunk">HEDR</a>
+			</header>
+			
+			<div class="children">
+				
+					
+			<header class="">
+				<a href="#SHVO" alt="SHVO" class="title chunk">SHVO</a>
+			</header>
+			
+		
+			<header class="has-children">
+				<a href="#MSH2" alt="MSH2" class="title chunk">MSH2</a>
+			</header>
+			
+			<div class="children">
+				
+					
+			<header class="has-children">
+				<a href="#SINF" alt="SINF" class="title chunk">SINF</a>
+			</header>
+			
+			<div class="children">
+				
+					
+						
+							<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+						
+					
+						
+							<a href="#FRAM" alt="FRAM" class="chunk">FRAM</a>
+						
+					
+						
+							<a href="#BBOX" alt="BBOX" class="chunk">BBOX</a>
+						
+					
+				
+			</div>
+			
+		
+			<header class="has-children">
+				<a href="#CAMR" alt="CAMR" class="title chunk">CAMR</a>
+			</header>
+			
+			<div class="children">
+				
+					
+						
+							<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+						
+					
+						
+							<a href="#DATA" alt="DATA" class="chunk">DATA</a>
+						
+					
+				
+			</div>
+			
+		
+			<header class="has-children">
+				<a href="#MATL" alt="MATL (Materials)" class="title chunk">MATL</a>
+			</header>
+			
+			<div class="children">
+				
+					
+			<header class="has-children">
+				<a href="#MATD" alt="MATD (Material)" class="title chunk">MATD</a>
+			</header>
+			
+			<div class="children">
+				
+					
+						
+							<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+						
+					
+						
+							<a href="#MATD.DATA" alt="MATD.DATA" class="chunk">MATD.DATA</a>
+						
+					
+						
+							<a href="#ATRB" alt="ATRB" class="chunk">ATRB</a>
+						
+					
+						
+							<a href="#TX0D" alt="TX0D" class="chunk">TX0D</a>
+						
+					
+				
+			</div>
+			
+		
+				
+			</div>
+			
+		
+			<header class="has-children">
+				<a href="#MODL" alt="MODL (Model)" class="title chunk">MODL</a>
+			</header>
+			
+			<div class="children">
+				
+					
+			<header class="">
+				<a href="#NAME" alt="NAME" class="title chunk">NAME</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#MTYP" alt="MTYP" class="title chunk">MTYP</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#MNDX" alt="MNDX" class="title chunk">MNDX</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#PRNT" alt="PRNT" class="title chunk">PRNT</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#FLGS" alt="FLGS" class="title chunk">FLGS</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#TRAN" alt="TRAN" class="title chunk">TRAN</a>
+			</header>
+			
+		
+			<header class="has-children">
+				<a href="#GEOM" alt="GEOM (Geometry)" class="title chunk">GEOM</a>
+			</header>
+			
+			<div class="children">
+				
+					
+			<header class="">
+				<a href="#BBOX" alt="BBOX" class="title chunk">BBOX</a>
+			</header>
+			
+		
+			<header class="has-children">
+				<a href="#SEGM" alt="SEGM" class="title chunk">SEGM</a>
+			</header>
+			
+			<div class="children">
+				
+					
+			<header class="">
+				<a href="#SHDW" alt="SHDW" class="title chunk">SHDW</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#MATI" alt="MATI" class="title chunk">MATI</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#POSL" alt="POSL" class="title chunk">POSL</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#CLRL" alt="CLRL" class="title chunk">CLRL</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#CLRB" alt="CLRB" class="title chunk">CLRB</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#WGHT" alt="WGHT" class="title chunk">WGHT</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#NRML" alt="NRML" class="title chunk">NRML</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#UV0L" alt="UV0L" class="title chunk">UV0L</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#NDXL" alt="NDXL" class="title chunk">NDXL</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#NDXT" alt="NDXT" class="title chunk">NDXT</a>
+			</header>
+			
+		
+			<header class="has-children">
+				<a href="#STRP" alt="STRP" class="title chunk">STRP</a>
+			</header>
+			
+			<div class="children">
+				
+					
+						
+							<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+						
+					
+						
+							<a href="#FRAM" alt="FRAM" class="chunk">FRAM</a>
+						
+					
+						
+							<a href="#BBOX" alt="BBOX" class="chunk">BBOX</a>
+						
+					
+				
+			</div>
+			
+		
+				
+			</div>
+			
+		
+			<header class="has-children">
+				<a href="#CLTH" alt="CLTH (Cloth)" class="title chunk">CLTH</a>
+			</header>
+			
+			<div class="children">
+				
+					
+						
+							<a href="#CTEX" alt="CTEX" class="chunk">CTEX</a>
+						
+					
+						
+							<a href="#CPOS" alt="CPOS" class="chunk">CPOS</a>
+						
+					
+						
+							<a href="#CUV0" alt="CUV0" class="chunk">CUV0</a>
+						
+					
+						
+							<a href="#FIDX" alt="FIDX" class="chunk">FIDX</a>
+						
+					
+						
+							<a href="#FWGT" alt="FWGT" class="chunk">FWGT</a>
+						
+					
+						
+							<a href="#CMSH" alt="CMSH" class="chunk">CMSH</a>
+						
+					
+						
+							<a href="#SPRS" alt="SPRS" class="chunk">SPRS</a>
+						
+					
+						
+							<a href="#CPRS" alt="CPRS" class="chunk">CPRS</a>
+						
+					
+						
+							<a href="#BPRS" alt="BPRS" class="chunk">BPRS</a>
+						
+					
+						
+							<a href="#COLL" alt="COLL" class="chunk">COLL</a>
+						
+					
+				
+			</div>
+			
+		
+			<header class="">
+				<a href="#ENVL" alt="ENVL (Envelope)" class="title chunk">ENVL</a>
+			</header>
+			
+		
+				
+			</div>
+			
+		
+			<header class="">
+				<a href="#SWCI" alt="SWCI" class="title chunk">SWCI</a>
+			</header>
+			
+		
+				
+			</div>
+			
+		
+				
+			</div>
+			
+		
+			<header class="">
+				<a href="#BLN2" alt="BLN2" class="title chunk">BLN2</a>
+			</header>
+			
+		
+			<header class="">
+				<a href="#SKL2" alt="SKL2 (Skeleton)" class="title chunk">SKL2</a>
+			</header>
+			
+		
+			<header class="has-children">
+				<a href="#ANM2" alt="ANM2 (Animation)" class="title chunk">ANM2</a>
+			</header>
+			
+			<div class="children">
+				
+					
+						
+							<a href="#CYCL" alt="CYCL" class="chunk">CYCL</a>
+						
+					
+						
+							<a href="#KFR3" alt="KFR3" class="chunk">KFR3</a>
+						
+					
+				
+			</div>
+			
+		
+			<header class="">
+				<a href="#CL1L" alt="CL1L" class="title chunk">CL1L</a>
+			</header>
+			
+		
+				
+			</div>
+			
+		
+		</div>
+	</section>
+
+	
+		<section class="chunk block">
+			<h2 class="title" id="ExampleChunk">ExampleChunk</h2>
+			
+			<p>This is an example chunk.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#PARENT CHUNK" alt="PARENT CHUNK" class="chunk">PARENT CHUNK</a>
+					</td>
+					<td>
+					
+						<a href="#ALL" alt="ALL" class="chunk">ALL</a>
+					
+						<a href="#POSSIBLE" alt="POSSIBLE" class="chunk">POSSIBLE</a>
+					
+						<a href="#CHILDREN" alt="CHILDREN" class="chunk">CHILDREN</a>
+					
+					</td>
+					<td>
+						Number of appearances or if it's optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			<p class="see-also">
+				See also:
+				<a href="#" alt="A list of links for further reading.">A list of links for further reading.</a>
+			</p>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="byte">byte[4]</td>
+					<td>4</td>
+					<td><p>Header/chunk name. Every chunk has this.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Length indicator. Stores the length in bytes <em>excluding</em> the header and the size indicator. Every chunk has this indicator.</p></td>
+				</tr>
+				
+				<tr>
+					<td></td>
+					<td>~</td>
+					<td><p>The rest of the data.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="HEDR">HEDR</h2>
+			
+			<p>.msh file header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						-
+					</td>
+					<td>
+					
+						<a href="#SHVO" alt="SHVO" class="chunk">SHVO</a>
+					
+						<a href="#MSH2" alt="MSH2" class="chunk">MSH2</a>
+					
+						<a href="#BLN2" alt="BLN2" class="chunk">BLN2</a>
+					
+						<a href="#SKL2" alt="SKL2" class="chunk">SKL2</a>
+					
+						<a href="#ANM2" alt="ANM2" class="chunk">ANM2</a>
+					
+						<a href="#CL1L" alt="CL1L" class="chunk">CL1L</a>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="SHVO">SHVO</h2>
+			
+			<p>Indicates a shadow volume.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#HEDR" alt="HEDR" class="chunk">HEDR</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>0 or 1 (if .msh has a shadow volume).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="MSH2">MSH2</h2>
+			
+			<p>.msh file mesh header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#HEDR" alt="HEDR" class="chunk">HEDR</a>
+					</td>
+					<td>
+					
+						<a href="#SINF" alt="SINF" class="chunk">SINF</a>
+					
+						<a href="#CAMR" alt="CAMR" class="chunk">CAMR</a>
+					
+						<a href="#MATL" alt="MATL" class="chunk">MATL</a>
+					
+						<a href="#MODL" alt="MODL" class="chunk">MODL</a>
+					
+					</td>
+					<td>
+						Once
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="FINF">FINF</h2>
+			
+			<p>Possibly deprecated. File information. PROJ: project name. USER: user name. TIME: time.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MSH2" alt="MSH2" class="chunk">MSH2</a>
+					</td>
+					<td>
+					
+						<a href="#PROJ" alt="PROJ" class="chunk">PROJ</a>
+					
+						<a href="#USER" alt="USER" class="chunk">USER</a>
+					
+						<a href="#TIME" alt="TIME" class="chunk">TIME</a>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="string">ASCII string</td>
+					<td>4 * X</td>
+					<td><p>File information.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="SINF">SINF</h2>
+			
+			<p>Scene information header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MSH2" alt="MSH2" class="chunk">MSH2</a>
+					</td>
+					<td>
+					
+						<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+					
+						<a href="#FRAM" alt="FRAM" class="chunk">FRAM</a>
+					
+						<a href="#BBOX" alt="BBOX" class="chunk">BBOX</a>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="FRAM">FRAM</h2>
+			
+			<p>Scene frame information.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SINF" alt="SINF" class="chunk">SINF</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Start of frame range.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>End of frame range.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Frames per second (usually ~30).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CAMR">CAMR</h2>
+			
+			<p>Scene camera header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MSH2" alt="MSH2" class="chunk">MSH2</a>
+					</td>
+					<td>
+					
+						<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+					
+						<a href="#DATA" alt="DATA" class="chunk">DATA</a>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="MATL">MATL (Materials)</h2>
+			
+			<p>Material list header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MSH2" alt="MSH2" class="chunk">MSH2</a>
+					</td>
+					<td>
+					
+						<a href="#MATD" alt="MATD" class="chunk">MATD</a>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Count of materials (MATD) in this list.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="MATD">MATD (Material)</h2>
+			
+			<p>Material header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MATL" alt="MATL" class="chunk">MATL</a>
+					</td>
+					<td>
+					
+						<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+					
+						<a href="#MATD.DATA" alt="MATD.DATA" class="chunk">MATD.DATA</a>
+					
+						<a href="#ATRB" alt="ATRB" class="chunk">ATRB</a>
+					
+						<a href="#TX0D" alt="TX0D" class="chunk">TX0D</a>
+					
+					</td>
+					<td>
+						One or more.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="MATD.DATA">MATD.DATA</h2>
+			
+			<p>Material colors and specular sharpness (gloss). Colors are stored in 0-1 range.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MATD" alt="MATD" class="chunk">MATD</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="float">float [4]</td>
+					<td>16</td>
+					<td><p>Diffuse RGBA color.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [4]</td>
+					<td>16</td>
+					<td><p>Specular RGBA color.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [4]</td>
+					<td>16</td>
+					<td><p>Ambient RGBA color.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Specular sharpness (gloss).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="ATRB">ATRB</h2>
+			
+			<p>Material flags (glow and other special rendertypes).</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MATD" alt="MATD" class="chunk">MATD</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			<p class="see-also">
+				See also:
+				<a href="https://schlechtwetterfront.github.io/ze_filetypes/render_types.html" alt="ZeroEngine Render Types">ZeroEngine Render Types</a><span>, </span><a href="http://www.gametoast.com/viewtopic.php?p=279620#p279620" alt="Inside Edit Flags (GT)">Inside Edit Flags (GT)</a><span>, </span><a href="http://gametoast.com/viewtopic.php?t=24851&amp;f=27&amp;start=31" alt="GameToast ATRB discussion">GameToast ATRB discussion</a><span>, </span><a href="https://schlechtwetterfront.github.io/ze_filetypes/index.html#atrb-calculator" alt="Flag Calculator">Flag Calculator</a>
+			</p>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Sum of all flag values.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Render Type number.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Data0 Value. Range: 0-255</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Data1 Value. Range: 0-255</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="TX0D">TX0D</h2>
+			
+			<p>Texture name with extension (not full path). For multiple textures the name of the chunk will change to TX1D, TX2D, TX3D.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MATD" alt="MATD" class="chunk">MATD</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="string">ASCII string</td>
+					<td>~</td>
+					<td><p>Texture name.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="PRFX">PRFX</h2>
+			
+			<p>Possibly deprecated. Material prefix.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MATD" alt="MATD" class="chunk">MATD</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="string">ASCII string</td>
+					<td>4 * X</td>
+					<td><p>Prefix.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="MODL">MODL (Model)</h2>
+			
+			<p>Model header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MSH2" alt="MSH2" class="chunk">MSH2</a>
+					</td>
+					<td>
+					
+						<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+					
+						<a href="#MTYP" alt="MTYP" class="chunk">MTYP</a>
+					
+						<a href="#MNDX" alt="MNDX" class="chunk">MNDX</a>
+					
+						<a href="#PRNT" alt="PRNT" class="chunk">PRNT</a>
+					
+						<a href="#FLGS" alt="FLGS" class="chunk">FLGS</a>
+					
+						<a href="#TRAN" alt="TRAN" class="chunk">TRAN</a>
+					
+						<a href="#GEOM" alt="GEOM" class="chunk">GEOM</a>
+					
+						<a href="#SWCI" alt="SWCI" class="chunk">SWCI</a>
+					
+					</td>
+					<td>
+						One or more.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="MTYP">MTYP</h2>
+			
+			<p>Model type.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MODL" alt="MODL" class="chunk">MODL</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Model type.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="MNDX">MNDX</h2>
+			
+			<p>0-based Model index.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MODL" alt="MODL" class="chunk">MODL</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Model index.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="PRNT">PRNT</h2>
+			
+			<p>Name of the parent model, padded with 00's to fill up to a multiple-of-4 size.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MODL" alt="MODL" class="chunk">MODL</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="string">ASCII string</td>
+					<td>~</td>
+					<td><p>Parent model name.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="FLGS">FLGS</h2>
+			
+			<p>Model display flags.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MODL" alt="MODL" class="chunk">MODL</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Render Flags.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="TRAN">TRAN</h2>
+			
+			<p>Matrix transform. Scale can get ignored in-game.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MODL" alt="MODL" class="chunk">MODL</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="float">float [3]</td>
+					<td>12</td>
+					<td><p>Scale factor in XYZ.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [4]</td>
+					<td>16</td>
+					<td><p>Quaternion Rotation in XYZW.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [3]</td>
+					<td>12</td>
+					<td><p>Translation in XYZ.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="SWCI">SWCI</h2>
+			
+			<p>Collision primitive.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MODL" alt="MODL" class="chunk">MODL</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Primitive type (0: sphere, 1: sphere, 2: cylinder, 4: cube).</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Data (sphere: radius, cylinder: radius, cube: x_length.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Data (sphere: -, cylinder: height, cube: y_length.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Data (sphere: -, cylinder: -, cube: z_length.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="GEOM">GEOM (Geometry)</h2>
+			
+			<p>Geometry header. Will be used for static/dynamic geometry and shadow volumes.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#MODL" alt="MODL" class="chunk">MODL</a>
+					</td>
+					<td>
+					
+						<a href="#BBOX" alt="BBOX" class="chunk">BBOX</a>
+					
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					
+						<a href="#ENVL" alt="ENVL" class="chunk">ENVL</a>
+					
+					</td>
+					<td>
+						Optional (depends on model type).
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="ENVL">ENVL (Envelope)</h2>
+			
+			<p>List of indices into <a class="chunk" href="#MODL">MODL</a>. This model is enveloped to those indices' models.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#GEOM" alt="GEOM" class="chunk">GEOM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of indices into <a class="chunk" href="#MODL">MODL</a>.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int []</td>
+					<td>4 each</td>
+					<td><p>Index into <a class="chunk" href="#MODL">MODL</a>.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="SEGM">SEGM</h2>
+			
+			<p>Geometry segment header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#GEOM" alt="GEOM" class="chunk">GEOM</a>
+					</td>
+					<td>
+					
+						<a href="#SHDW" alt="SHDW" class="chunk">SHDW</a>
+					
+						<a href="#MATI" alt="MATI" class="chunk">MATI</a>
+					
+						<a href="#POSL" alt="POSL" class="chunk">POSL</a>
+					
+						<a href="#CLRL" alt="CLRL" class="chunk">CLRL</a>
+					
+						<a href="#CLRB" alt="CLRB" class="chunk">CLRB</a>
+					
+						<a href="#WGHT" alt="WGHT" class="chunk">WGHT</a>
+					
+						<a href="#NRML" alt="NRML" class="chunk">NRML</a>
+					
+						<a href="#UV0L" alt="UV0L" class="chunk">UV0L</a>
+					
+						<a href="#NDXL" alt="NDXL" class="chunk">NDXL</a>
+					
+						<a href="#NDXT" alt="NDXT" class="chunk">NDXT</a>
+					
+						<a href="#STRP" alt="STRP" class="chunk">STRP</a>
+					
+					</td>
+					<td>
+						One or more.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="SHDW">SHDW</h2>
+			
+			<p>Shadow mesh geometry.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						If the model is a shadow mesh, once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of vertex positions.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [3][]</td>
+					<td>12 each</td>
+					<td><p>Vertex positions (XYZ).</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of edges.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">short int [4][]</td>
+					<td>8 each</td>
+					<td><p>Edge. The following 4 entries form one edge.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">&gt; short int</td>
+					<td>2</td>
+					<td><p>Vertex index of this edge entry. Refers to the vertex list above.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">&gt; short int</td>
+					<td>2</td>
+					<td><p>Reference into an edge. Defines the target vertex (the local
+ edge vertex of the referenced edge) to which the edge should be dran 
+from the local vertex.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">&gt; short int</td>
+					<td>2</td>
+					<td><p>Second reference into an edge. In all example .msh files 
+I've seen this always refers to the same vertex as the first edge 
+reference.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">&gt; short int</td>
+					<td>2</td>
+					<td><p>MAX_VALUE of short integers (65535). Indicates the end of this edge.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="MATI">MATI</h2>
+			
+			<p>Material index (index into MATL).</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once?
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Material index.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="POSL">POSL</h2>
+			
+			<p>List of vertex coordinates.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once (unless shadow mesh).
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of coordinates stored in this list.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [3][]</td>
+					<td>12 each</td>
+					<td><p>XYZ coordinates for each vertex.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="NRML">NRML</h2>
+			
+			<p>List of normals.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once (unless shadow mesh).
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of normal vectors stored in this list.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [3][]</td>
+					<td>12 each</td>
+					<td><p>UVW vector for each vertex.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="UV0L">UV0L</h2>
+			
+			<p>List of UV coordinates.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of UV coordinates stored in this list.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [2][]</td>
+					<td>8 each</td>
+					<td><p>UV coordinate for each vertex.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CLRL">CLRL</h2>
+			
+			<p>List of vertex colors.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of colors stored in this list.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte [4][]</td>
+					<td>4 each</td>
+					<td><p>RGBA color (0-255).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CLRB">CLRB</h2>
+			
+			<p>One vertex color for the whole segment.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="byte">byte [4]</td>
+					<td>4</td>
+					<td><p>RGBA color (0-255).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="WGHT">WGHT</h2>
+			
+			<p>List of bone-weight percentage pairs. Always 4 pairs per vertex.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of bone weights stored in this list.</p></td>
+				</tr>
+				
+				<tr>
+					<td></td>
+					<td></td>
+					<td><p>The following appears 4 times per vertex (to allow for soft weighting).</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Index into <a class="chunk" href="#ENVL">ENVL</a> (which then indexes into <a class="chunk" href="#MODL">MODL</a>).</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Weight value (0-1).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="NDXL">NDXL</h2>
+			
+			<p>Polygons.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional/deprecated.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="NDXT">NDXT</h2>
+			
+			<p>Triangles.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional/deprecated.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="STRP">STRP</h2>
+			
+			<p>List of triangles strips. The start of a strip is indicated by 2 
+entries with a high bit set (0x8000 or 32768 added). Triangles are 
+listed CW, CCW, CW, CCW... NOTE: In some meshes this chunk has a 
+trailing short which is not calculated into the length/size of this 
+chunk or the # of indices. This short can be ignored. If added to the 
+last polygon it will break it as it always seems to be 0.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+						<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+					
+						<a href="#FRAM" alt="FRAM" class="chunk">FRAM</a>
+					
+						<a href="#BBOX" alt="BBOX" class="chunk">BBOX</a>
+					
+					</td>
+					<td>
+						Once (unless shadow mesh).
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of indices into <a class="chunk" href="#POSL">POSL</a>.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">short int []</td>
+					<td>2 each</td>
+					<td><p>Index into <a class="chunk" href="#POSL">POSL</a>. The indices will form polygons.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="VLTB">VLTB</h2>
+			
+			<p>Possibly deprecated. Baked vertex light.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Red.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Green.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Blue.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Alpha.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="VLTL">VLTL</h2>
+			
+			<p>Possibly deprecated. Unique baked vertex lights for vertices.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#SEGM" alt="SEGM" class="chunk">SEGM</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of colors to come.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Red.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Green.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Blue.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="byte">byte</td>
+					<td>1</td>
+					<td><p>Alpha.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CLTH">CLTH (Cloth)</h2>
+			
+			<p>Cloth header. Replaces <a class="chunk" href="#SEGM">SEGM</a>.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#GEOM" alt="GEOM" class="chunk">GEOM</a>
+					</td>
+					<td>
+					
+						<a href="#CTEX" alt="CTEX" class="chunk">CTEX</a>
+					
+						<a href="#CPOS" alt="CPOS" class="chunk">CPOS</a>
+					
+						<a href="#CUV0" alt="CUV0" class="chunk">CUV0</a>
+					
+						<a href="#FIDX" alt="FIDX" class="chunk">FIDX</a>
+					
+						<a href="#FWGT" alt="FWGT" class="chunk">FWGT</a>
+					
+						<a href="#CMSH" alt="CMSH" class="chunk">CMSH</a>
+					
+						<a href="#SPRS" alt="SPRS" class="chunk">SPRS</a>
+					
+						<a href="#CPRS" alt="CPRS" class="chunk">CPRS</a>
+					
+						<a href="#BPRS" alt="BPRS" class="chunk">BPRS</a>
+					
+						<a href="#COLL" alt="COLL" class="chunk">COLL</a>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CTEX">CTEX</h2>
+			
+			<p>Texture name with extension.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="string">ASCII string</td>
+					<td>~</td>
+					<td><p>Texture name.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CPOS">CPOS</h2>
+			
+			<p>List of vertex coordinates.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of vertex positions.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [3][]</td>
+					<td>12 each</td>
+					<td><p>XYZ coordinates.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CUV0">CUV0</h2>
+			
+			<p>List of UV coordinates.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional?
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of UV coordinates.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [2][]</td>
+					<td>8 each</td>
+					<td><p>UV coordinate.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="FIDX">FIDX</h2>
+			
+			<p>List of fixed points.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional?
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of points.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int ]</td>
+					<td>4 each</td>
+					<td><p>Index into <a class="chunk" href="#CPOS">CPOS</a>.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="FWGT">FWGT</h2>
+			
+			<p>Index of <a class="chunk" href="#FIDX">FIDX</a> weighted to a bone by name.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional?
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of points.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="string">ASCII string</td>
+					<td>~</td>
+					<td><p>Name of the bone the corresponding <a class="chunk" href="#FIDX">FIDX</a> is moving with.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CMSH">CMSH</h2>
+			
+			<p>Cloth triangles.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of points.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int [3][]</td>
+					<td>16 each</td>
+					<td><p>Triangle points defined CCW.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="SPRS">SPRS</h2>
+			
+			<p>Stretch constraint data. Keeps cloth size by storing relations between points (like edges around a quad).</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional?
+					</td>
+				</tr>
+			</tbody></table>
+			
+			<p class="see-also">
+				See also:
+				<a href="http://www.gametoast.com/viewtopic.php?p=472300#p472300" alt="Constraint discussion (GT)">Constraint discussion (GT)</a>
+			</p>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of items.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">short int [2][]</td>
+					<td>4 each</td>
+					<td><p>Two points sharing an edge.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CPRS">CPRS</h2>
+			
+			<p>Cross constraint data. Keeps individual pieces of the cloth from 
+shearing (cross relations between points). Think of the edges as sticky 
+tape, glueing the points together.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional?
+					</td>
+				</tr>
+			</tbody></table>
+			
+			<p class="see-also">
+				See also:
+				<a href="http://www.gametoast.com/viewtopic.php?p=472300#p472300" alt="Constraint discussion (GT)">Constraint discussion (GT)</a>
+			</p>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of items.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">short int [2][]</td>
+					<td>4 each</td>
+					<td><p>Two points sharing a quad.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="BPRS">BPRS</h2>
+			
+			<p>Bend constraint data. Keeps the cloth's shape (relations between 
+border-points of the cloth mesh, disables bending along those edges).</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional?
+					</td>
+				</tr>
+			</tbody></table>
+			
+			<p class="see-also">
+				See also:
+				<a href="http://www.gametoast.com/viewtopic.php?p=472300#p472300" alt="Constraint discussion (GT)">Constraint discussion (GT)</a>
+			</p>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of items.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="short">short int [2][]</td>
+					<td>4 each</td>
+					<td><p>Two border-points sharing a 'straight' edge over the complete cloth.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="COLL">COLL</h2>
+			
+			<p>Cloth collision. Note that this chunk is padded with 00's until it has a multiple of 4 chunk size.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#CLTH" alt="CLTH" class="chunk">CLTH</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional?
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of collisions.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="string">ASCII string</td>
+					<td>~</td>
+					<td><p>Collision object name.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="string">ASCII string</td>
+					<td>~</td>
+					<td><p>Object name this collision moves with.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Primitive type (0: sphere, 1: cylinder, 2: cube).</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Data (sphere: radius, cylinder: radius, cube: x_length / 2).</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Data (sphere: radius, cylinder: height, cube: y_length / 2).</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Data (sphere: radius, cylinder: -, cube: z_length / 2).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="SKL2">SKL2 (Skeleton)</h2>
+			
+			<p>Skeleton/chain. Lists some bone properties for every item in the chain. The values don't seem to make a big difference.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#HEDR" alt="HEDR" class="chunk">HEDR</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of bones in this skeleton.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="crc">CRC checksum</td>
+					<td>4</td>
+					<td><p><a href="https://schlechtwetterfront.github.io/ze_filetypes/index.html">CRC checksum</a> of the bone.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Type (bone?). Usual value: 0.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Constrain. Usual value: -1 or 1.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Bone length 1. Usual value: 0.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Bone length 2. Usual value: 0.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="BLN2">BLN2</h2>
+			
+			<p>Blend factors for the chain items (bones). Purpose unknown. Blend factor usually is 0/nothing (if float). </p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#HEDR" alt="HEDR" class="chunk">HEDR</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of bones.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="crc">CRC checksum</td>
+					<td>4</td>
+					<td><p><a href="https://schlechtwetterfront.github.io/ze_filetypes/index.html">CRC checksum</a> of the bone.</p></td>
+				</tr>
+				
+				<tr>
+					<td>?</td>
+					<td>4</td>
+					<td><p>Blend factor. Usual value: 0.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="ANM2">ANM2 (Animation)</h2>
+			
+			<p>Animation header.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#HEDR" alt="HEDR" class="chunk">HEDR</a>
+					</td>
+					<td>
+					
+						<a href="#CYCL" alt="CYCL" class="chunk">CYCL</a>
+					
+						<a href="#KFR3" alt="KFR3" class="chunk">KFR3</a>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CYCL">CYCL</h2>
+			
+			<p>Animation cycles. Can contain multiple animations.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#ANM2" alt="ANM2" class="chunk">ANM2</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of animations.</p></td>
+				</tr>
+				
+				<tr>
+					<td></td>
+					<td></td>
+					<td><p>The following can appear multiple times.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="string">ASCII string</td>
+					<td>64</td>
+					<td><p>Aimation name.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Frame rate.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Play Style.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>First frame.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Last frame.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="KFR3">KFR3</h2>
+			
+			<p>All the frames and their local translation and rotation. Frame 
+indices don't have to be consecutive. They can skip frames (like 
+keyframes).</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						<a href="#ANM2" alt="ANM2" class="chunk">ANM2</a>
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Number of bones in this animation.</p></td>
+				</tr>
+				
+				<tr>
+					<td></td>
+					<td></td>
+					<td><p>The following will appear once per chain item.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="crc">&gt; CRC checksum</td>
+					<td>4</td>
+					<td><p><a href="https://schlechtwetterfront.github.io/ze_filetypes/index.html">CRC checksum</a>.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">&gt; long int</td>
+					<td>4</td>
+					<td><p>Keyframe type.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">&gt; long int</td>
+					<td>4</td>
+					<td><p>Number of translation frames.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">&gt; long int</td>
+					<td>4</td>
+					<td><p>Number of rotation frames.</p></td>
+				</tr>
+				
+				<tr>
+					<td></td>
+					<td></td>
+					<td><p>Translation frames will be listed first.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">&gt;&gt; long int</td>
+					<td>4</td>
+					<td><p>Translation frame index.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">&gt;&gt; float [3][]</td>
+					<td>12</td>
+					<td><p>Translation in XYZ.</p></td>
+				</tr>
+				
+				<tr>
+					<td></td>
+					<td></td>
+					<td><p>Rotation frames will be listed second.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">&gt;&gt; long int</td>
+					<td>4</td>
+					<td><p>Rotation frame index.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">&gt;&gt; float [4][]</td>
+					<td>16</td>
+					<td><p>Quaternion rotation in XYZW.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="CL1L">CL1L</h2>
+			
+			<p>Closing chunk, indicates the end of the .msh file.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						-
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="NAME">NAME</h2>
+			
+			<p>Name, padded with 00's to fill up a multiple-of-4 size.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						-
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="string">ASCII string</td>
+					<td>4 * X</td>
+					<td><p>Name.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="BBOX">BBOX</h2>
+			
+			<p>Bounding box. <a class="chunk" href="#SINF">SINF</a>'s BBox will determine the blue/green selection box in ZeroEdit.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						-
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Once.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="float">float [4]</td>
+					<td>16</td>
+					<td><p>Quaternion Rotation in XYZW.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [3]</td>
+					<td>12</td>
+					<td><p>Center of the BBox.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float [3]</td>
+					<td>12</td>
+					<td><p>Extents of the BBox (width/2, height/2, depth/2).</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Bounding sphere radius.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="LGTP">LGTP</h2>
+			
+			<p>Possibly deprecated. Point Light.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						-
+					</td>
+					<td>
+					
+						<a href="#PRFX" alt="PRFX" class="chunk">PRFX</a>
+					
+						<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+					
+						<a href="#DATA" alt="DATA" class="chunk">DATA</a>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Red.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Green.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Blue.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Alpha.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>X.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Y.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Z.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Falloff start.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Falloff end.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Flags (1: CastShadows).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="LGTI">LGTI</h2>
+			
+			<p>Possibly deprecated. Infinite Light.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						-
+					</td>
+					<td>
+					
+						<a href="#PRFX" alt="PRFX" class="chunk">PRFX</a>
+					
+						<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+					
+						<a href="#DATA" alt="DATA" class="chunk">DATA</a>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Red.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Green.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Blue.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Alpha.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>X.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Y.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Z.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Falloff start.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Falloff end.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Flags (1: CastShadows).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="LGTS">LGTS</h2>
+			
+			<p>Possibly deprecated. Spot Light.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						-
+					</td>
+					<td>
+					
+						<a href="#PRFX" alt="PRFX" class="chunk">PRFX</a>
+					
+						<a href="#NAME" alt="NAME" class="chunk">NAME</a>
+					
+						<a href="#DATA" alt="DATA" class="chunk">DATA</a>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Red.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Green.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Blue.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Alpha.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>X.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Y.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Z.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Interest X.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Interest Y.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Interest Z.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Falloff start.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Falloff end.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Cone Angle.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Spread Angle.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="long">long int</td>
+					<td>4</td>
+					<td><p>Flags (1: CastShadows).</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+		<section class="chunk block">
+			<h2 class="title" id="FOGD">FOGD</h2>
+			
+			<p>Possibly deprecated. Fog data.</p>
+			<table class="hierarchy">
+				<thead>
+					<tr>
+						<th>Parent</th>
+						<th>Children</th>
+						<th>Appearance</th>
+					</tr>
+				</thead>
+				<tbody><tr>
+					<td>
+						-
+					</td>
+					<td>
+					
+					</td>
+					<td>
+						Optional.
+					</td>
+				</tr>
+			</tbody></table>
+			
+			
+			
+			<table class="structure">
+				<thead>
+					<tr class="title"><th>Structure</th></tr>
+					<tr>
+						<th>Data Type</th><th>Size</th><th>Description</th>
+					</tr>
+				</thead>
+				
+				<tbody><tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Red.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Green.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Blue.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Alpha.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Near plane.</p></td>
+				</tr>
+				
+				<tr>
+					<td class="float">float</td>
+					<td>4</td>
+					<td><p>Far plane.</p></td>
+				</tr>
+				
+			</tbody></table>
+			
+		</section>
+	
+
+			</div>
+			
+
+			
+				<footer>
+</footer>
+			
+
+		</div>
+
+	
+</body></html>
\ No newline at end of file
diff --git a/src_research_readme/mesh-info-pages/msh Format_files/subpage-style.css b/src_research_readme/mesh-info-pages/msh Format_files/subpage-style.css
new file mode 100644
index 0000000..5fc669a
--- /dev/null
+++ b/src_research_readme/mesh-info-pages/msh Format_files/subpage-style.css	
@@ -0,0 +1,559 @@
+h1, h2, h3, h4, h5, h6,
+.heading-1, .heading-2, .heading-3, .heading-4, .heading-5, .heading-6 {
+  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Oxygen-Sans, Ubuntu, Cantarell, "Helvetica Neue", sans-serif;
+  color: #222;
+  margin-top: 0;
+  font-weight: 400;
+  text-rendering: optimizeLegibility;
+  line-height: 1; }
+
+h1, .heading-1 {
+  font-size: 3.333rem;
+  margin-bottom: 1.333rem;
+  padding-bottom: .666rem; }
+
+h2, .heading-2 {
+  font-size: 2.899rem;
+  margin-bottom: 1rem;
+  padding-bottom: .666rem; }
+
+h3, .heading-3 {
+  font-size: 2.133rem;
+  margin-bottom: .666rem;
+  padding-bottom: .4rem; }
+
+h4, .heading-4 {
+  font-size: 1.666rem;
+  margin-bottom: .666rem;
+  padding-bottom: .333rem; }
+
+h5, .heading-5 {
+  font-size: 1.133rem;
+  margin-bottom: 0.333rem;
+  padding-bottom: .333rem; }
+
+h6, .heading-6 {
+  font-size: .799rem;
+  margin-bottom: 0.333rem;
+  padding-bottom: .333rem; }
+
+h2, h3, h4, h5, h6 {
+  border-bottom: 1px solid rgba(0, 0, 0, 0.15); }
+
+h2 {
+  margin-bottom: 1rem;
+  padding-bottom: .616161rem; }
+
+p {
+  text-align: justify;
+  margin-bottom: 1rem;
+  margin-top: 0; }
+
+small {
+  font-size: 65%; }
+
+h1, h2, h3, h4, h5, h6, p {
+  hyphens: auto; }
+
+.anchor {
+  font-size: 50%;
+  padding-right: .3em;
+  padding-left: .3em;
+  display: none; }
+
+h1:hover .anchor, h2:hover .anchor, h3:hover .anchor, h4:hover .anchor, h5:hover .anchor, h6:hover .anchor {
+  display: inline; }
+
+ul, ol {
+  margin: 0 0 1rem; }
+  ul li, ol li {
+    text-align: justify; }
+    ul li p, ol li p {
+      margin-bottom: 0; }
+
+ul {
+  padding-left: 1.6rem; }
+
+dl {
+  margin: 0; }
+  dl dt {
+    font-weight: bold; }
+  dl dd {
+    margin-left: 1.6rem; }
+
+ol {
+  counter-reset: item;
+  padding: 0; }
+  ol > li {
+    counter-increment: item;
+    list-style-type: none;
+    text-indent: -1.6rem;
+    padding-left: 1.6rem; }
+    ol > li:before {
+      content: counter(item) ".";
+      display: inline-block;
+      text-align: right;
+      width: 1.3rem;
+      padding-right: .3rem;
+      font-weight: bold; }
+    ol > li.fancy-block:before {
+      background: black;
+      color: white; }
+
+ul.collapsed {
+  list-style: none;
+  padding: 0; }
+  ul.collapsed li {
+    display: inline-block; }
+
+ul.blocks, ol.blocks {
+  list-style: none;
+  padding: 0; }
+
+pre, code {
+  font-family: Monaco, Consolas, monospace;
+  text-align: left;
+  white-space: pre;
+  word-spacing: normal;
+  tab-size: 4; }
+
+pre,
+:not(pre) > code {
+  background: rgba(0, 0, 0, 0.066); }
+
+pre {
+  border-radius: .199em;
+  margin: .5em 0;
+  padding: 1em; }
+
+:not(pre) > code {
+  padding: .15em .2em .05em;
+  border-radius: .333em; }
+
+h1 > code, h2 > code, h3 > code, h4 > code, h5 > code, h6 > code {
+  background: none; }
+
+table {
+  width: 100%;
+  margin-bottom: 1rem;
+  border-collapse: collapse; }
+  table thead {
+    border-bottom: 2px solid rgba(0, 0, 0, 0.15); }
+    table thead .title {
+      text-transform: uppercase; }
+  table tbody tr:nth-child(odd) {
+    background: rgba(0, 0, 0, 0.033); }
+  table td, table th {
+    padding: .1rem .666rem;
+    text-align: left;
+    vertical-align: top; }
+    table td p, table th p {
+      margin: 0; }
+
+.tags {
+  display: flex;
+  justify-content: space-between;
+  flex-direction: row-reverse;
+  flex-wrap: wrap; }
+  .tags .tag {
+    padding: .33em .66em;
+    background: rgba(0, 0, 0, 0.1);
+    border-radius: .3333em;
+    font-size: 65%; }
+
+.page__title {
+  padding: 1.666rem 0; }
+  .page__title h1 {
+    margin: 0; }
+
+.page__header {
+  border-bottom: 1px solid rgba(0, 0, 0, 0.15); }
+
+.menu {
+  flex: 0 0 280px;
+  display: flex;
+  flex-direction: column;
+  justify-content: flex-start;
+  align-items: stretch; }
+  @media screen and (min-width: 768px) {
+    .menu {
+      padding: 0 .66rem 0 0; } }
+  @media screen and (max-width: 991px) {
+    .menu {
+      flex: 1 1 auto; } }
+  .menu a.home {
+    display: flex;
+    flex-direction: column;
+    align-items: stretch; }
+  .menu .hr {
+    text-align: center; }
+  .menu__nav {
+    display: flex;
+    flex-direction: column;
+    justify-content: center;
+    flex-wrap: wrap; }
+  .menu__category {
+    padding: .666rem 0 .222rem;
+    margin-top: .333rem;
+    border-bottom: 1px solid rgba(0, 0, 0, 0.15); }
+    .menu__category .category-title {
+      margin-bottom: 0;
+      text-align: center;
+      font-weight: 700;
+      border: none; }
+
+.container {
+  margin: 0 auto;
+  display: flex;
+  flex-direction: row; }
+  @media screen and (min-width: 1200px) {
+    .container {
+      width: 1160px; } }
+  @media screen and (max-width: 1199px) {
+    .container {
+      width: 952px; } }
+  @media screen and (max-width: 991px) {
+    .container {
+      width: 85%;
+      flex-direction: column; } }
+  @media screen and (max-width: 767px) {
+    .container {
+      width: 90%;
+      flex-direction: column; } }
+  @media screen and (max-width: 991px) {
+    .container {
+      flex-direction: column;
+      margin-top: 2rem; } }
+  .container .content {
+    flex: 5;
+    padding-top: 8px; }
+    @media screen and (min-width: 768px) {
+      .container .content {
+        padding-left: 1rem; } }
+    .container .content .content-header {
+      height: 92px; }
+      .container .content .content-header .content-title {
+        margin-bottom: 0; }
+    .container .content .block {
+      margin-bottom: 3rem; }
+
+input, textarea, select, option {
+  color: #444; }
+
+input, select {
+  padding: 0 .666rem;
+  height: 1.8rem;
+  font-size: 1rem;
+  line-height: 1;
+  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Oxygen-Sans, Ubuntu, Cantarell, "Helvetica Neue", sans-serif;
+  margin: 0;
+  border: 1px solid rgba(0, 0, 0, 0.15);
+  border-radius: .199rem;
+  transition: all .1s; }
+  input:hover, select:hover {
+    border-color: rgba(0, 0, 0, 0.333); }
+  input:active, input:focus, select:active, select:focus {
+    outline: 0;
+    border-color: #0070d4;
+    box-shadow: 0 0 4px 1px rgba(0, 112, 212, 0.333); }
+  input[type=checkbox], select[type=checkbox] {
+    height: auto;
+    position: relative;
+    cursor: pointer;
+    -webkit-appearance: none;
+    appearance: none;
+    background: rgba(0, 0, 0, 0.15);
+    border-radius: .15em;
+    padding: .333em; }
+    input[type=checkbox]:checked:before, select[type=checkbox]:checked:before {
+      display: inline-block;
+      position: absolute;
+      top: -.333rem;
+      left: -.063rem;
+      content: '\002714';
+      color: black;
+      font-weight: bold;
+      font-size: 1.1rem; }
+  input[type=number], select[type=number] {
+    padding-right: .333rem; }
+
+select option {
+  font-size: 1rem;
+  line-height: 1;
+  height: 1rem;
+  border: none; }
+  select option:hover {
+    background: rgba(0, 0, 0, 0.3); }
+
+label {
+  font-weight: bold;
+  padding: 0;
+  cursor: pointer; }
+  label > input {
+    margin: 0 .5rem; }
+
+button {
+  font-size: 1rem;
+  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Oxygen-Sans, Ubuntu, Cantarell, "Helvetica Neue", sans-serif;
+  padding: .333rem .666rem;
+  margin: .1rem .15rem;
+  background: rgba(0, 0, 0, 0.1);
+  border-radius: .15rem;
+  border: 1px solid rgba(255, 255, 255, 0.1);
+  cursor: pointer;
+  transition: all .1s; }
+  button:hover {
+    border-color: rgba(0, 0, 0, 0.15);
+    box-shadow: 0 2px 6px 1px rgba(0, 0, 0, 0.066); }
+  button:active {
+    background: rgba(0, 0, 0, 0.13);
+    box-shadow: none; }
+  button:first-child {
+    margin-left: 0; }
+
+.calculator input, .calculator select {
+  font-family: Monaco, Consolas, monospace;
+  text-align: right; }
+
+.calculator > * {
+  margin-bottom: 1rem; }
+
+.calculator .flags {
+  display: flex;
+  flex-direction: row;
+  flex-wrap: wrap;
+  margin-bottom: 1rem; }
+  .calculator .flags .flag {
+    flex: 0 0 50%; }
+    @media screen and (max-width: 767px) {
+      .calculator .flags .flag {
+        flex: 100%; } }
+
+.calculator .flag-values {
+  display: flex;
+  justify-content: space-between;
+  align-items: center;
+  flex-wrap: wrap;
+  margin-bottom: 1rem; }
+  .calculator .flag-values input {
+    max-width: 4em; }
+
+.calculator .render-type label {
+  flex: 1;
+  display: inline-block; }
+  @media screen and (max-width: 767px) {
+    .calculator .render-type label {
+      flex: 100%; } }
+
+.calculator .render-type input {
+  flex: 0 0 4em;
+  align-self: flex-end;
+  margin-right: .666rem; }
+
+.calculator .render-type select {
+  flex: 1;
+  align-self: flex-end;
+  margin-right: .666rem; }
+
+.calculator .data-values label {
+  flex: 1;
+  display: inline-block; }
+  @media screen and (max-width: 767px) {
+    .calculator .data-values label {
+      flex: 100%; } }
+
+.calculator .data-values input, .calculator .data-values select {
+  flex: 0 0 4em;
+  align-self: flex-end;
+  margin-right: .666rem; }
+
+.calculator .inputs {
+  display: flex;
+  flex-direction: row;
+  align-items: flex-start;
+  flex-wrap: wrap;
+  width: 100%; }
+  .calculator .inputs > * {
+    flex: 0 0 50%;
+    display: flex;
+    flex-direction: row;
+    align-items: center;
+    margin-bottom: .1rem; }
+    @media screen and (max-width: 767px) {
+      .calculator .inputs > * {
+        flex: 100%; } }
+
+.calculator .chunk {
+  display: flex;
+  flex-wrap: wrap;
+  flex-direction: column;
+  align-items: stretch; }
+  .calculator .chunk > * {
+    display: flex;
+    align-items: center; }
+  .calculator .chunk #chunk {
+    text-align: center; }
+
+* {
+  box-sizing: border-box; }
+
+body {
+  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Oxygen-Sans, Ubuntu, Cantarell, "Helvetica Neue", sans-serif;
+  color: #444;
+  font-size: 15px;
+  line-height: 1.65;
+  margin: 0;
+  overflow-y: scroll;
+  background: white; }
+
+img {
+  max-width: 100%;
+  height: auto; }
+
+hr {
+  width: 100%;
+  border-color: rgba(0, 0, 0, 0.15);
+  border-style: dashed;
+  margin: .399em 0 .6em; }
+
+.theme-dark hr, .footer-theme-dark hr {
+  border-color: rgba(255, 255, 255, 0.1); }
+
+.solid {
+  border-style: solid; }
+
+.side-hr {
+  flex: 1;
+  border-top: 1px solid rgba(0, 0, 0, 0.15);
+  border-bottom: 1px solid rgba(0, 0, 0, 0.15); }
+
+.side-hr:first-child {
+  margin-right: 1em; }
+
+.side-hr:last-child {
+  margin-left: 1em; }
+
+.side-hr.bright {
+  border-color: rgba(0, 0, 0, 0.05); }
+
+.side-hr.bright {
+  border-color: rgba(255, 255, 255, 0.1); }
+
+a:not(.button) {
+  color: #0070d4;
+  padding-bottom: .1em; }
+  a:not(.button):hover {
+    color: #0061c7;
+    text-decoration: underline; }
+
+a, a:hover, a:focus, button, button:hover, button:focus {
+  text-decoration: none;
+  outline: 0; }
+
+a.no-style, a.no-style:hover {
+  border: none;
+  padding: 0;
+  margin: 0;
+  text-transform: none;
+  display: block;
+  width: 100%;
+  color: initial; }
+
+a.chunk {
+  font-family: Monaco, Consolas, monospace;
+  border-bottom: 0;
+  padding: .066rem .3rem;
+  background: rgba(0, 0, 0, 0.05); }
+  a.chunk:hover {
+    background: rgba(0, 0, 0, 0.075); }
+
+span.chunk {
+  font-family: Monaco, Consolas, monospace;
+  border-bottom: 0;
+  padding: .066rem .3rem;
+  background: rgba(0, 0, 0, 0.05); }
+
+nav a, .navigation a {
+  display: block;
+  padding: .099rem .666rem; }
+  nav a:hover, .navigation a:hover {
+    background: rgba(0, 0, 0, 0.033);
+    text-decoration: none !important; }
+
+*::selection {
+  background-color: #2090f4;
+  color: white; }
+
+*::-moz-selection {
+  background-color: #2090f4;
+  color: white; }
+
+.no-select {
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+  cursor: default; }
+
+.long, .float, .short, .byte, .string, .crc {
+  font-family: Monaco, Consolas, monospace; }
+
+.long, .short, .float {
+  color: red; }
+
+.string {
+  color: lightgreen; }
+
+.byte {
+  color: orange; }
+
+.crc {
+  color: orange; }
+
+table.structure tr td:first-child {
+  white-space: nowrap; }
+
+table.structure tr td:nth-child(2) {
+  font-family: Monaco, Consolas, monospace;
+  white-space: nowrap; }
+
+table.structure tr td:nth-child(1), table.structure tr th:nth-child(1) {
+  width: 16%; }
+
+table.structure tr td:nth-child(2), table.structure tr th:nth-child(2) {
+  text-align: right;
+  width: 8%; }
+
+table.hierarchy tr td:nth-child(1), table.hierarchy tr th:nth-child(1) {
+  width: 15%; }
+
+table.hierarchy tr td:nth-child(2), table.hierarchy tr th:nth-child(2) {
+  width: 50%; }
+
+table.hierarchy tr td:nth-child(3), table.hierarchy tr th:nth-child(3) {
+  width: 35%; }
+
+table.render-type tr td:first-child, table.render-type tr td:nth-child(2) {
+  font-family: Monaco, Consolas, monospace; }
+
+table.render-type tr td:first-child, table.render-type tr th:first-child,
+table.render-type tr td:nth-child(2), table.render-type tr th:nth-child(2) {
+  text-align: right;
+  width: 5%; }
+
+table.render-type tr td:nth-child(3), table.render-type tr th:nth-child(3) {
+  width: 45%; }
+
+table.render-type tr td:nth-child(4), table.render-type tr th:nth-child(4) {
+  width: 45%; }
+
+.hierarchy .children {
+  padding-left: 3rem;
+  border-left: 1px dotted rgba(0, 0, 0, 0.15); }
+
+.hierarchy header:not(.has-children) {
+  display: inline-block; }
+
+.block-msh2txt table td:first-child, .block-msh2txt table td:nth-child(2) {
+  font-family: monospace;
+  width: 20%; }
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Core/zetcore.py b/src_research_readme/zero-edit-tool-python-base/Application/Core/zetcore.py
new file mode 100644
index 0000000..9fe789c
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Core/zetcore.py
@@ -0,0 +1,275 @@
+'''
+    Some misc functionality.
+'''
+import json
+import softimage
+import os
+from datetime import datetime as dt
+import logging
+
+
+def get_current_version(versionpath):
+    major = 0
+    minor = 0
+    build = 0000
+    with open(versionpath, 'r') as fh:
+        for index, line in enumerate(fh):
+            major, minor, build = line.split('.')
+            break
+    return major, minor, build
+
+
+class Timer():
+    def __init__(self, text):
+        self.text = text
+        self.start_time = None
+        self.result_time = None
+
+    def __enter__(self):
+        self.start_time = dt.now()
+
+    def __exit__(self, type_, value, traceback):
+        self.result_time = dt.now() - self.start_time
+        logging.info(self.text, self.result_time.seconds, self.result_time.microseconds)
+
+
+class CheckSel(object):
+    def __init__(self, app, models, root, progbar):
+        self.xsi = app
+        self.models = models
+        self.probs = []
+        self.pb = progbar
+        self.root = root
+
+    def build_UI(self):
+        for prop in self.root.Properties:
+            if prop.Name == 'CSR':
+                self.xsi.DeleteObj('CSR')
+        ps = self.xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'CSR')
+        lay = ps.PPGLayout
+        lay.Language = "pythonscript"
+        for p in self.probs:
+            lay.AddTab(p['name'])
+            lay.AddGroup('Warnings for {0}'.format(p['name']), 1)
+            if p['type']:
+                lay.AddStaticText('Bad model type: {0}'.format(p['type']))
+            if p['sides']:
+                lay.AddStaticText('Bad Faces')
+                gp = ps.AddGridParameter('badpoly_{0}'.format(p['name']))
+                bp = gp.Value
+                bp.RowCount = len(p['sides'])
+                bp.ColumnCount = 2
+                bp.SetColumnLabel(0, 'Poly Index')
+                bp.SetColumnLabel(1, 'Vertex Count')
+                for index, el in enumerate(p['sides']):
+                    bp.SetRowLabel(index, index)
+                    bp.SetRowValues(index, el)
+                grid = lay.AddItem(gp.Name)
+                grid.SetAttribute('NoLabel', True)
+                grid.SetAttribute('ColumnWidths', '25:80:100')
+            if p['badcls']:
+                lay.AddStaticText('Bad Clusters')
+                gpc = ps.AddGridParameter('badcls_{0}'.format(p['name']))
+                bc = gpc.Value
+                bc.RowCount = len(p['badcls'])
+                bc.ColumnCount = 2
+                bc.SetColumnLabel(0, 'Cluster')
+                bc.SetColumnLabel(1, 'Problem')
+                for index, el in enumerate(p['badcls']):
+                    bc.SetRowLabel(index, index)
+                    bc.SetRowValues(index, el)
+                gridc = lay.AddItem(gpc.Name)
+                gridc.SetAttribute('NoLabel', True)
+                gridc.SetAttribute('ColumnWidths', '25:80:250')
+            if p['unncls']:
+                lay.AddStaticText('Unnecessary Clusters')
+                gpu = ps.AddGridParameter('unncls_{0}'.format(p['name']))
+                bu = gpu.Value
+                bu.RowCount = len(p['unncls'])
+                bu.ColumnCount = 2
+                bu.SetColumnLabel(0, 'Cluster')
+                bu.SetColumnLabel(1, 'Problem')
+                for index, el in enumerate(p['unncls']):
+                    bu.SetRowLabel(index, index)
+                    bu.SetRowValues(index, el)
+                gridu = lay.AddItem(gpu.Name)
+                gridu.SetAttribute('NoLabel', True)
+                gridu.SetAttribute('ColumnWidths', '25:80:250')
+            lay.EndGroup()
+        self.xsi.InspectObj(ps, '', 'CheckSel Report', 4, False)
+        for prop in self.root.Properties:
+            if prop.Name == 'CSR':
+                self.xsi.DeleteObj('CSR')
+
+    def check(self):
+        mdlnum = len(self.models)
+        self.pb.set(mdlnum, 'Checking models({0}...'.format(mdlnum))
+        self.pb.show()
+        for index, model in enumerate(self.models):
+            self.pb.setc('Checking {0}({1}/{2})...'.format(model.Name, index + 1, mdlnum))
+            probs = {'type': '', 'sides': '', 'badcls': '', 'unncls': ''}
+            if model.Type not in ('null', 'polymsh', 'bone', 'root', 'eff', 'Texture Support'):
+                probs['type'] = model.Type
+            if model.Type in ('null', 'bone', 'root', 'eff'):
+                continue
+            if model.Type == 'Texture Support':
+                probs['type'] = '{0}(might cause problems, freeze to remove it)'.format(model.Type)
+            if model.Type == 'polymsh':
+                geo = model.ActivePrimitive.GetGeometry2(0)
+                # Check sides per poly. More than 4 sides aren't supported.
+                facets = geo.Facets
+                bad_polies = []
+                for facet in facets:
+                    if facet.Points.Count > 4:
+                        bad_polies.append((facet.Index, facet.Points.Count))
+                probs['sides'] = bad_polies
+                # Check clusters.
+                bad = []
+                unnecessary = []
+                # Weight clusters.
+                pnt = geo.Clusters.Filter('pnt')
+                envs = 0
+                for cls in pnt:
+                    for prop in cls.Properties:
+                        if prop.Type == 'envweights':
+                            envs += 1
+                        elif 'ZEC' in prop.Name:
+                            continue
+                        else:
+                            unnecessary.append(('{0}|{1}'.format(cls.Name, prop.Name), 'Unnecessary(not weights)'))
+                if envs > 1:
+                    bad.append(('Weights', 'Only first weight property will be used.'))
+                # Sample clusters.
+                smp = geo.Clusters.Filter('sample')
+                uvs = 0
+                vcs = 0
+                for cls in smp:
+                    for prop in cls.Properties:
+                        if prop.Type == 'uvspace':
+                            uvs += 1
+                        elif prop.Type == 'vertexcolor':
+                            vcs += 1
+                        else:
+                            unnecessary.append((prop.Name, 'Unnecessary(not UVs/Vert Colors)'))
+                if uvs > 1:
+                    bad.append(('UVs', 'Only first UV property will be used.'))
+                if vcs > 1:
+                    bad.append(('Vertex Colors', 'Only first Vert Color property will be used.'))
+                # Polygon clusters.
+                poly = geo.Clusters.Filter('poly')
+                for cls in poly:
+                    if cls.Material.name == model.Material.Name:
+                        unnecessary.append((cls.Name, 'Unnecessary(same material)'))
+                probs['badcls'] = bad
+                probs['unncls'] = unnecessary
+            if probs['type'] or probs['sides'] or probs['badcls'] or probs['unncls']:
+                probs['name'] = model.Name
+                self.probs.append(probs)
+        self.pb.hide()
+
+
+class ExportStats(object):
+    def __init__(self):
+        self.models = 0
+        self.mats = 0
+        self.start = None
+        self.end = None
+        self.verts = 0
+        self.faces = 0
+        self.result = None
+
+    def secs(self):
+        if self.result:
+            return self.result.seconds
+        self.result = self.end - self.start
+        return self.result.seconds
+
+    def micros(self):
+        if self.result:
+            return self.result.microseconds
+        self.result = self.end - self.start
+        return self.result.seconds
+
+def get_import_log_path():
+    path = os.path.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'import_log.log')
+    if os.path.exists(path):
+        return path
+    return None
+
+
+def get_export_log_path():
+    path = os.path.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'export_log.log')
+    if os.path.exists(path):
+        return path
+    return None
+
+
+def load_settings(settings_name='export', ppg=None):
+    if ppg:
+        return settings_from_ppg(settings_name, ppg)
+    path = os.path.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'Resources', settings_name)
+    try:
+        with open(path, 'r') as f:
+            return json.load(f)
+    except IOError:
+        print 'Could not load settings from {0}.'.format(path)
+        settings = get_default_settings(settings_name)
+        save_settings(settings_name, settings)
+        return settings
+
+
+def save_settings(settings_name, settings):
+    path = os.path.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'Resources', settings_name)
+    print path
+    with open(path, 'w') as f:
+        f.write(json.dumps(settings, f))
+
+
+def settings_from_ppg(settings_name, ppg):
+    settings = get_default_settings(settings_name)
+    params = ppg.Parameters
+    for key in settings.keys():
+        settings[key] = params(key).Value
+    return settings
+
+
+def get_default_settings(settings_name):
+    if settings_name == 'export':
+        sett = {
+            'path': 'C:',
+            'overwrite': False,
+            'anim': False,
+            'basepose': False,
+            'rootname': False,
+            'batch': False,
+            'show_finished_dialog': True,
+        }
+        return sett
+    elif settings_name == 'import':
+        sett = {
+            'path': 'C:',
+            'texpath': 'C:',
+            'btexpath': False,
+            'framerange': True,
+            'applyonly': False,
+            'log': False,
+            'triangulate': True,
+            'nullsize': 0.2,
+            'ignoregeo': False,
+            'ignoreanim': False,
+            'wirecol': False,
+            'Rbone': 0.452,
+            'Gbone': 0.918,
+            'Bbone': 0.4,
+            'Rroot': 0.2,
+            'Groot': 0.3,
+            'Broot': 0.8,
+            'Reff': 0.5,
+            'Geff': 0.23,
+            'Beff': 0.1,
+            'hideeffs': False,
+            'hideroots': False,
+            'weld': True,
+            'show_finished_dialog': True,
+        }
+        return sett
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Core/zetexport.py b/src_research_readme/zero-edit-tool-python-base/Application/Core/zetexport.py
new file mode 100644
index 0000000..9b599f6
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Core/zetexport.py
@@ -0,0 +1,999 @@
+'''
+    Export.
+'''
+
+# TODO: FLGS:
+#   - Hidden: |= 1
+#   - DynamicallyLit |= 2
+#   - RetainNormal |= 4
+#   - RenderAfterShadows |= 8
+#   - DontFlatten |= 16
+#   - PS2Optimize |= 32
+
+
+import softimage
+import zetcore
+import andecore
+reload(zetcore)
+reload(softimage)
+reload(andecore)
+import logging
+reload(logging)
+import sys
+import os
+from datetime import datetime
+import msh2
+reload(msh2)
+from win32com.client import constants as const
+from pythoncom import com_error
+STR_CODEC = 'utf-8'
+
+
+class BoneConverter(object):
+    '''Converts an animated object to a msh2 bone.'''
+    def __init__(self, si_mdl, anim, is_basepose):
+        self.anim = anim
+        self.mdl = si_mdl
+        self.bone = msh2.Bone(self.anim.anim)
+        self.is_basepose = is_basepose
+
+    def convert(self):
+        '''Gathers animation data for a bone.'''
+        self.bone.name = self.mdl.Name.encode(STR_CODEC)
+        self.bone.recrc()
+        pos = []
+        rot = []
+        pc = self.anim.get_playcontrol()
+        curr = pc.Parameters('Current').Value
+        if self.is_basepose:
+            tran = self.mdl.Kinematics.Local.GetTransform2(curr)
+            pos.append((tran.PosX, tran.PosY, tran.PosZ))
+            quat = tran.Rotation.Quaternion
+            rot.append((quat.X, quat.Y, quat.Z, quat.W))
+            tran = self.mdl.Kinematics.Local.GetTransform2(curr + 1)
+            pos.append((tran.PosX, tran.PosY, tran.PosZ))
+            quat = tran.Rotation.Quaternion
+            rot.append((quat.X, quat.Y, quat.Z, quat.W))
+            self.bone.pos_keyframes = pos
+            self.bone.rot_keyframes = rot
+            return self.bone
+
+        for n in range(int(self.anim.anim.cycle.frames[0]), int(self.anim.anim.cycle.frames[1]) + 1):
+            tran = self.mdl.Kinematics.Local.GetTransform2(n)
+            pos.append((tran.PosX, tran.PosY, tran.PosZ))
+            quat = tran.Rotation.Quaternion
+            rot.append((quat.X, quat.Y, quat.Z, quat.W))
+        self.bone.pos_keyframes = pos
+        self.bone.rot_keyframes = rot
+        return self.bone
+
+
+class AnimationConverter(softimage.SIScene):
+    '''Gathers animation for all objects and converts it into msh2 animation.'''
+    def __init__(self, export):
+        self.export = export
+        self.anim = msh2.Animation(self.export.msh)
+
+    def is_animated(self, bone):
+        '''Check all relevant parameters if they are animated.'''
+        if bone.posx.IsAnimated() or \
+           bone.posy.IsAnimated() or \
+           bone.posz.IsAnimated() or \
+           bone.rotx.IsAnimated() or \
+           bone.roty.IsAnimated() or \
+           bone.rotz.IsAnimated() or \
+           bone.sclx.IsAnimated() or \
+           bone.scly.IsAnimated() or \
+           bone.sclz.IsAnimated():
+            return True
+        return False
+
+    def convert(self):
+        '''Gathers animation data for all animated objects.'''
+        self.export.pb.set(1, 'Preparing Animation...')
+        cycle = msh2.Cycle(self.anim)
+        pc = self.get_playcontrol()
+        cycle.frames = pc.Parameters('In').Value, pc.Parameters('Out').Value
+        self.anim.cycle = cycle
+        bonecoll = msh2.BoneCollection(self.anim)
+        basepose = self.export.ppg_params.get('basepose')
+        nummodels = len(self.export.si_models)
+        self.export.pb.inc()
+        self.export.pb.set(nummodels, 'Iterating Models...')
+        for index, model in enumerate(self.export.si_models):
+            self.export.pb.setc('Analyzing {0}({1}/{2})'.format(model.Name,
+                                                                index,
+                                                                nummodels))
+            # Originally this was used but it also reported constrained objects as animated: model.IsNodeAnimated()
+            if self.is_animated(model):
+                logging.info('Processing bone "%s".', model.Name)
+                boneconv = BoneConverter(model, self, basepose)
+                bonecoll.add(boneconv.convert())
+                logging.info('Finished processing bone.')
+                self.export.pb.setc('Building Bone {0}({1}/{2})'.format(model.Name,
+                                                                        index,
+                                                                        nummodels))
+            self.export.pb.inc()
+        self.anim.bones = bonecoll
+        return self.anim
+
+
+class SceneInfoConverter(softimage.SIScene):
+    '''Converts general scene information into msh2 scene information.'''
+    def __init__(self, export):
+        self.export = export
+        self.parent = None
+        self.sinfo = msh2.SceneInfo(self.export.msh)
+
+    def calculate_global_bbox(self):
+        '''Calculates a global bounding box for all objects.'''
+        from math import sqrt
+        # GetBBox returns XYZ coordinates for the lower and upper bounds of
+        # the bounding box.
+        minx, miny, minz, maxx, maxy, maxz = self.export.xsi.GetBBox(self.export.si_models)
+        # Add the positive values of every axis to get the distance between
+        # the 2 points. Half them to get the extents from the center.
+        width = (abs(minx) + abs(maxx)) / 2
+        height = (abs(miny) + abs(maxy)) / 2
+        depth = (abs(minz) + abs(maxz)) / 2
+        # Now calculate the bounding sphere(encompass all points).
+        radius = sqrt(width * width + height * height + depth * depth)
+        # Now the center.
+        cx = minx + (maxx - minx) / 2
+        cy = miny + (maxy - miny) / 2
+        cz = minz + (maxz - minz) / 2
+        self.sinfo.bbox.extents = width, height, depth
+        self.sinfo.bbox.radius = radius
+        self.sinfo.bbox.center = cx, cy, cz
+
+    def convert(self):
+        '''Gathers the scene information.'''
+        self.sinfo.name = self.get_name().encode(STR_CODEC) + '_ZETExported'
+        # get the playcontrol object which contains frame range and fps.
+        playcontrol = self.get_playcontrol()
+        self.sinfo.frame_range = (playcontrol.Parameters('In').Value,
+                                  playcontrol.Parameters('Out').Value)
+        self.sinfo.fps = playcontrol.Parameters('Rate').Value
+        self.calculate_global_bbox()
+        return self.sinfo
+
+
+class ModelConverter(softimage.SIModel):
+    '''Converts a XSI polymsh to a msh2 mesh.'''
+    def __init__(self, si_mdl, export, immediate_conversion=False):
+        # Set some stuff.
+        self.export = export
+        self.si_model = si_mdl
+        # Get geometry right at the beginning. It will be used often later.
+        self.geo = si_mdl.ActivePrimitive.GetGeometry2(0)
+        self.msh2_model = msh2.Model()
+        self.msh2_model.msh = self.export.msh
+        if immediate_conversion:
+            self.convert()
+
+    def get_short_name(self):
+        return self.si_model.Name.split('.')[-1].encode(STR_CODEC)
+
+    def is_shadow(self):
+        '''Checks if this model is a shadow mesh.'''
+        return False
+
+    def is_collprim(self):
+        '''Checks if this model is a collision primitive.'''
+        if self.si_model.Name.lower().startswith('p_'):
+            return True
+        return False
+
+    def is_cloth_collprim(self):
+        '''Checks if this model is a cloth collision primitive.'''
+        if self.si_model.Name.lower().startswith('c_'):
+            return True
+        return False
+
+    def is_cloth(self):
+        '''Checks if this model is a simulated cloth.'''
+        if self.get_cloth_prop():
+            return True
+        return False
+
+    def get_cloth_prop(self):
+        '''Gets the cloth property of this model.'''
+        for prop in self.si_model.Properties:
+            if 'zecloth' in prop.Name.lower():
+                return prop
+
+    def get_msh2_model_type(self, model):
+        '''Gets the msh2 model type, returns a string indicating the type.'''
+        if model.Type in ('root', 'eff'):
+            return 'null'
+        elif model.Type == 'null':
+            if self.export.model_deformers:
+                if self.si_model.Name in self.export.model_deformers:
+                    return 'bone'
+            return 'null'
+        elif model.Type == 'bone':
+            return 'bone'
+        elif model.Type == 'polymsh':
+            # If its a poly mesh, check some other things.
+            if self.is_cloth():
+                return 'cloth'
+            # Is it a bone with geometry?
+            if 'bone' in model.Name:
+                return 'geobone'
+            elif self.is_weighted():
+                return 'geodynamic'
+            elif self.is_shadow():
+                return 'geoshadow'
+            else:
+                return 'geostatic'
+        elif model.Type == 'Texture Support':
+            self.export.dontexport.append(model.Name)
+            return 'null'
+        else:
+            self.export.abort('Object "{0}" has unsupported model type "{1}".'.format(model.Name, model.Type))
+
+    def get_vertices(self):
+        '''Creates a Vertex Collection and fills it with normals and positions,
+        returns the collection.'''
+        coll = msh2.VertexCollection()
+
+        # Vertex positions in a one-dimensional array.
+        # positions_and_normals = self.export.xsi.ZET_GetVertexPositionsWithNormals(self.geo, True)
+        # n = 0
+        # while n < len(positions_and_normals):
+        #     position = positions_and_normals[n], positions_and_normals[n + 1], positions_and_normals[n + 2]
+        #     normal = positions_and_normals[n + 3], positions_and_normals[n + 4], positions_and_normals[n + 5]
+        #     n += 6
+        #     coll.add(msh2.Vertex(position, normal))
+
+        # Vertex positions in a one-dimensional array.
+        vert_pos_list = self.export.xsi.CGA_GetNodeVertexPositions(self.geo, True)
+        # Normal vectors in a one-dimensional array.
+        normals_list = self.export.xsi.CGA_GetNodeNormals(self.geo)
+        n = 0
+        while n < len(vert_pos_list):
+            coord = vert_pos_list[n], vert_pos_list[n + 1], vert_pos_list[n + 2]
+            normal = normals_list[n], normals_list[n + 1], normals_list[n + 2]
+            n += 3
+            coll.add(msh2.Vertex(coord, normal))
+
+        logging.info('Processed %s vertices.', len(coll))
+        self.export.stats.verts += len(coll)
+        return coll
+
+    def get_uvs(self):
+        '''Gets UV coordinates, returns a list of UV coordinate tuples.'''
+        uv_list = self.export.xsi.ZET_GetUVs(self.geo, 0)
+        uvs = []
+        n = 0
+        while n < len(uv_list):
+            coord = uv_list[n], uv_list[n + 1]
+            uvs.append(coord)
+            # UVs are stored as UVWs in Softimage so ignore the W value.
+            n += 3
+        return uvs
+
+    def set_vert_colors(self, vertex_collection):
+        colors = self.export.xsi.CGA_GetVertexColors0(self.geo)
+
+        for index, vertex in enumerate(vertex_collection):
+            vertex.color = msh2.Color((colors[index * 4] * 255,
+                                       colors[index * 4 + 1] * 255,
+                                       colors[index * 4 + 2] * 255,
+                                       colors[index * 4 + 3] * 255,
+                                      ))
+
+
+    def get_vert_colors(self):
+        '''Gets RGBA vertex colors, returns them as a Color object.'''
+        col_list = self.export.xsi.CGA_GetVertexColors0(self.geo)
+        colors = []
+        n = 0
+        while n < len(col_list):
+            color = msh2.Color((col_list[n] * 255,
+                                col_list[n + 1] * 255,
+                                col_list[n + 2] * 255,
+                                col_list[n + 3] * 255))
+            colors.append(color)
+            n += 4
+        return colors
+
+    def set_weights(self, vertex_collection):
+        weights, deformer_names = self.export.xsi.ZET_GetWeights(self.geo)
+
+        logging.debug('# of verts: %s, # of weights: %s', len(vertex_collection), len(weights) / len(deformer_names))
+
+        for n in xrange(len(weights) / len(deformer_names)):
+            vertex = vertex_collection[n]
+
+            weight_values = [.0] * 4
+            deformers = [''] * 4
+            deformer_indices = [0] * 4
+
+            number_of_deformers = 0
+            for index, deformer in enumerate(deformer_names):
+                if weights[n * 3 + index] > 0 and number_of_deformers < 4:
+                    weight_values[number_of_deformers] = weights[n * 3 + index] / 100
+                    deformers[number_of_deformers] = deformer
+                    deformer_indices[number_of_deformers] = index
+                    number_of_deformers += 1
+
+            vertex.weights = weight_values
+            vertex.deformers = deformers
+            vertex.deformer_indices = deformer_indices
+        
+
+    def get_weights(self):
+        '''Gets weights and deformers, returns a list of four weight value
+        tuples and four deformer names tuples.'''
+        _, weight_list, def_list = self.export.xsi.CGA_GetWeightsZE(self.geo)
+        # Nodes per point: point 0: node_index, point 1: node_index etc...
+        nodes_per_point = self.export.xsi.CGA_GetNodesPerPoint(self.geo)
+        # Temporary lists.
+        wght_lst_temp = []
+        def_lst_tmp = []
+        ndx_lst_tmp = []
+        count = 0
+        for chunk in andecore.chunks(weight_list, len(def_list)):
+            count += 1
+            # Create a placeholder for the weight values
+            lst = 4 * [0.0]
+            # Placeholder for deformer references.
+            lst2 = 4 * ['deformername']
+            # Placeholder for deformer indices.
+            lst3 = 4 * [0]
+            n = 0
+            for ndx, el in enumerate(chunk):
+                if el != 0.0 and n < 4:
+                    # Assign weight value if not zero and
+                    # not exceeded maximum weights(4).
+                    lst[n] = el / 100
+                    # Assign deformer name.
+                    lst2[n] = def_list[ndx]
+                    # Assign deformer indices.
+                    lst3[n] = ndx
+                    n += 1
+            wght_lst_temp.append(lst)
+            def_lst_tmp.append(lst2)
+            ndx_lst_tmp.append(lst3)
+        weights_list = len(nodes_per_point) * ['empty']
+        deformer_list = len(nodes_per_point) * ['empty']
+        index_list = len(nodes_per_point) * ['empty']
+        for ndx, el in enumerate(nodes_per_point):
+            weights_list[ndx] = wght_lst_temp[el]
+            deformer_list[ndx] = def_lst_tmp[el]
+            index_list[ndx] = ndx_lst_tmp[el]
+        return weights_list, deformer_list, index_list
+
+    def get_deformers(self):
+        '''Gets a lost fof all deformers for this model.'''
+        _, deformers = self.export.xsi.ZET_GetWeights(self.geo)
+        return [deformer.encode(STR_CODEC) for deformer in deformers]
+
+    def get_faces(self):
+        '''Creates a FaceCollection and fills it with Faces, returns the
+        collection.'''
+        coll = msh2.FaceCollection()
+        # node_indices, vert_count = self.export.xsi.ZET_GetPolyVertexIndicesAndCounts(self.geo)
+        node_indices = self.export.xsi.CGA_GetNodeIndices(self.geo)
+        vert_count = self.export.xsi.CGA_GetPolygonVerticesCount(self.geo)
+        fc = 0
+        for el in vert_count:
+            face = msh2.Face()
+            face.vertices = []
+            for n in xrange(el):
+                face.vertices.append(node_indices[fc + n])
+            if el == 4:
+                p2 = face.vertices[2]
+                face.vertices[2] = face.vertices[3]
+                face.vertices[3] = p2
+            elif el == 5:
+                p2 = face.vertices[2]
+                face.vertices[2] = face.vertices[3]
+                face.vertices[3] = p2
+            fc += el
+            coll.add(face)
+        logging.info('Processed %s faces.', len(coll))
+        self.export.stats.faces += len(coll)
+        return coll
+
+    def process_geometry(self):
+        '''Processes the SI polymsh geometry into one segment and returns it.'''
+        seg = msh2.SegmentGeometry()
+        seg.mat_name = self.export.get_main_material_name(self.si_model)
+        seg.material = self.export.msh.get_mat_by_name(seg.mat_name)
+        seg.vertices = self.get_vertices()
+        seg.vertices.segment = seg
+        seg.faces = self.get_faces()
+        seg.faces.segment = seg
+        if self.is_uved():
+            seg.vertices.uved = True
+            seg.vertices.set_uvs(self.get_uvs())
+        if self.is_colored():
+            seg.vertices.colored = True
+            self.set_vert_colors(seg.vertices)
+            # seg.vertices.set_colors(self.get_vert_colors())
+        if self.is_weighted():
+            seg.vertices.weighted = True
+            # self.set_weights(seg.vertices)
+            seg.vertices.set_weights(*self.get_weights())
+        return seg
+
+    def clear_multiverts(self, collection):
+        '''Removes vertices that have the same position, normals and UVs.'''
+        with zetcore.Timer('Cleared multiverts in %ss %sms.'):
+            for segment in collection:
+                if isinstance(segment, msh2.SegmentGeometry):
+                    segment.clear_doubles()
+
+    def get_segments(self):
+        '''Creates segments from the main geometry and returns them in
+        a SegmentCollection.'''
+        # First get the geometry for the complete mesh.
+        geometry = self.process_geometry()
+        coll = msh2.SegmentCollection(self.msh2_model)
+        coll.model = self.msh2_model
+        coll.msh = self.msh2_model.msh
+        geometry.collection = coll
+        # Then split it up into chunks for more than one material per model.
+        poly_mat_indices = self.export.xsi.ZET_GetPolyMaterialIndices(self.geo)
+        mat_names = self.export.xsi.ZET_GetMaterialNames(self.geo)
+        coll.add(geometry)
+        # If the model only has one material just export this one chunk.
+        if len(mat_names) == 1:
+            self.clear_multiverts(coll)
+            return coll
+        # Otherwise split the geometry.
+        coll.split(0, poly_mat_indices, mat_names)
+        coll.assign_materials(self.export.msh.materials)
+
+        self.clear_multiverts(coll)
+        return coll
+
+    def process_bbox(self):
+        '''Calculates a bounding box for this model.'''
+        bbox = self.geo.GetBoundingBox(self.si_model.Kinematics.Local.Transform)
+        bsphere = self.geo.GetBoundingSphere(const.siVolumeCenterMethodBBoxCenter,
+                                             self.si_model.Kinematics.Local.Transform)
+        self.msh2_model.bbox.extents = (bbox[3] / 2 * self.msh2_model.transform.scale[0],
+                                        bbox[4] / 2 * self.msh2_model.transform.scale[1],
+                                        bbox[5] / 2 * self.msh2_model.transform.scale[2])
+        self.msh2_model.bbox.center = bbox[0], bbox[1], bbox[2]
+        self.msh2_model.bbox.radius = bsphere[3]
+
+    def process_c_collision_primitive(self):
+        '''Processes cloth collision primitive data for this model.'''
+        logging.info('Processing cloth collision primitive.')
+        self.msh2_model.cloth_collprim = True
+
+        sm = self.si_model
+        mm = self.msh2_model
+        try:
+            radius = self.export.xsi.GetValue('{0}.polymsh.geom.sphere.radius'.format(sm.FullName)) * mm.transform.scale[0]
+            mm.primitive = (0, radius, radius, radius)
+        except com_error:
+            try:
+                radius = self.export.xsi.GetValue('{0}.polymsh.geom.cylinder.radius'.format(sm.FullName)) * mm.transform.scale[0]
+                height = self.export.xsi.GetValue('{0}.polymsh.geom.cylinder.height'.format(sm.FullName)) * mm.transform.scale[0]
+                mm.primitive = (1, radius, height, 0)
+            except com_error:
+                try:
+                    length = self.export.xsi.GetValue('{0}.polymsh.geom.cube.length'.format(sm.FullName))
+                    mm.primitive = (2, length * mm.transform.scale[0] * .5, length * mm.transform.scale[1] * .5, length * mm.transform.scale[2] * .5)
+                except com_error:
+                    self.msh2_model.cloth_collprim = False
+                    self.export.abort('Could not find valid Primitive (sphere/cube/cylinder) for Cloth Collision Primitive "{0}".'.format(sm.Name))
+                    return
+        mm.transform.scale = 1.0, 1.0, 1.0
+
+    def process_collision_prim(self):
+        '''Processes collision primitive data for this model.'''
+        self.msh2_model.collprim = True
+        sm = self.si_model
+        mm = self.msh2_model
+        if sm.Parent:
+            parent_transform = sm.Parent.Kinematics.Local.Transform
+        else:
+            parent_transform = self.export.xsi.ActiveSceneRoot.Kinematics.Local.Transform
+        try:
+            radius = self.export.xsi.GetValue('{0}.polymsh.geom.sphere.radius'.format(sm.FullName))
+            mm.primitive = (0, radius, radius, radius)
+        except com_error:
+            try:
+                radius = self.export.xsi.GetValue('{0}.polymsh.geom.cylinder.radius'.format(sm.FullName))
+                height = self.export.xsi.GetValue('{0}.polymsh.geom.cylinder.height'.format(sm.FullName))
+                mm.primitive = (2, radius, height, 0)
+            except com_error:
+                try:
+                    length = self.export.xsi.GetValue('{0}.polymsh.geom.cube.length'.format(sm.FullName))
+                    mm.primitive = (4, length * mm.transform.scale[0] * .5 * parent_transform.SclX,
+                                       length * mm.transform.scale[1] * .5 * parent_transform.SclY,
+                                       length * mm.transform.scale[2] * .5 * parent_transform.SclZ)
+                except com_error:
+                    self.msh2_model.cloth_collprim = False
+                    self.export.abort('Could not find valid Primitive (sphere/cube/cylinder) for Collision Primitive "{0}".'.format(sm.Name))
+                    return
+        mm.transform.scale = 1.0, 1.0, 1.0
+
+    def get_fixed(self):
+        '''Get the elements of the fixed points cluster.'''
+        for cls in self.geo.Clusters:
+            if 'ZEFixed' in cls.Name:
+                return cls.Elements.Array
+        return []
+
+    def get_cloth_weights(self):
+        '''Get weights for all fixed points.'''
+        for cls in self.geo.Clusters.Filter('pnt'):
+            for prop in cls.Properties:
+                if prop.Type == 'envweights':
+                    weights = prop.Elements.Array
+        ret_weights = []
+        for n in xrange(len(weights[0])):
+            for i in xrange(len(weights)):
+                if weights[i][n] > 49.0:
+                    ret_weights.append(i)
+                    break
+        return ret_weights
+
+    def get_cloth_deformers(self):
+        '''Get all deformers for cloth.'''
+        env = self.si_model.Envelopes(0)
+        defs = []
+        for deformer in env.Deformers:
+            defs.append(deformer.Name)
+        return defs
+
+    def get_cloth_geo(self):
+        '''Gather the geometry for cloth.'''
+        facecoll = msh2.FaceCollection()
+        vertcoll = msh2.ClothVertexCollection()
+        if not self.is_uved():
+            self.export.abort('{0} doesnt have UVs(necessary for Cloth).'.format(self.si_model.Name))
+        fixed = self.get_fixed()
+        # Two dimensional: [0][0] = first deformer, weight for first point in cluster.
+        #                  [1][0] = second deformer, first point.
+        #                  [2][2] = third deformer, third point in cluster.
+        weights = [0] * self.geo.Points.Count
+        # One dimensional.
+        deformers = ['']
+        if self.is_weighted():
+            weights = self.get_cloth_weights()
+            deformers = self.get_cloth_deformers()
+            logging.info('Retrieved cloth deformers: %s (%s)', deformers, len(deformers))
+
+        vertex_indices, poly_lengths = self.export.xsi.ZET_GetPolyVertexIndicesAndCounts(self.geo)
+
+        offset = 0
+        for poly_length in poly_lengths:
+            face = msh2.Face(vertex_indices[offset:offset + poly_length])
+            offset += poly_length
+            facecoll.add(face)
+
+        positions = self.export.xsi.ZET_GetVertexPositions(self.geo, False)
+        vertex_to_node_indices = self.export.xsi.ZET_GetVertexToNodeIndices(self.geo)
+        uvs = self.export.xsi.ZET_GetUVs(self.geo, 0)
+        
+        for n in xrange(len(vertex_to_node_indices)):
+            vert = msh2.ClothVertex((positions[n * 3],
+                                     positions[n * 3 + 1],
+                                     positions[n * 3 + 2],))
+            node_index = vertex_to_node_indices[n]
+            vert.uv = uvs[node_index * 3], uvs[node_index * 3 + 1]
+            if n in fixed:
+                vert.is_fixed = True
+            vert.deformer = deformers[weights[n]].encode(STR_CODEC)
+            vertcoll.add(vert)
+        logging.info('Processed %s vertices.', len(vertcoll))
+        return facecoll, vertcoll
+
+    def get_cloth_tex(self):
+        '''Get texture name for cloth.'''
+        for ps in self.si_model.Properties:
+            if 'ZEC' in ps.Name:
+                return ps.Parameters('texture').Value.encode(STR_CODEC)
+
+    def get_cloth_collisions(self, geo):
+        '''Gather all cloth collisions for this model.'''
+        collision_names = []
+        collisions = []
+        for ps in self.si_model.Properties:
+            if 'ZEC' in ps.Name:
+                collision_names = ps.Parameters('collisions').Value
+                if collision_names:
+                    collision_names = collision_names.encode(STR_CODEC).split(',')
+                break
+        for collision_name in collision_names:
+            # Split name by periods to remove possible Softimage Model names (ie MyModel.MyObject).
+            short_collision_name = collision_name.encode(STR_CODEC)
+            if '.' in short_collision_name:
+                short_collision_name = short_collision_name.split('.')[-1]
+            if not short_collision_name.lower().startswith('c_'):
+                self.export.abort('Cloth collision names should start with "c_" ({0}).'.format(short_collision_name))
+            collision = msh2.ClothCollision(geo)
+            collision.name = short_collision_name
+            try:
+                collision.parent = self.export.xsi.Dictionary.GetObject(collision_name, False).Parent.Name.encode(STR_CODEC)
+            except AttributeError as e:
+                logging.exception(e)
+                self.export.abort('Could not find cloth collision "{0}" for "{1}".'.format(collision_name, self.msh2_model.name))
+            collisions.append(collision)
+        return collisions
+
+    def get_cloth(self):
+        '''Get the cloth data for this model.'''
+        coll = msh2.SegmentCollection(self.msh2_model)
+        clothgeo = msh2.ClothGeometry(coll)
+        with zetcore.Timer('Cloth geometry in %ss %sms.'):
+            clothgeo.faces, clothgeo.vertices = self.get_cloth_geo()
+        clothgeo.assign_parents()
+        clothgeo.texture = self.get_cloth_tex()
+        with zetcore.Timer('Cloth constraints in %ss %sms.'):
+            clothgeo.create_constraints()
+
+        with zetcore.Timer('Cloth collisions in %ss %sms.'):
+            clothgeo.collisions = self.get_cloth_collisions(clothgeo)
+
+        coll.add(clothgeo)
+        return coll
+
+    def convert(self):
+        '''Converts the SI model into a msh2 model, accessible via
+        ModelConverter.msh2_model.'''
+        # I'm using strings to store relationships and deformers because I might not
+        # know every model yet and so I cant reference it.
+        self.msh2_model.name = self.get_short_name()
+        # Check if the model is the root(selected) model. If it is, ignore it's parent.
+        if self.si_model != self.export.si_root:
+            self.msh2_model.parent_name = self.si_model.Parent.Name.encode(STR_CODEC)
+        # 1 = hidden, 0 = not hidden, so cast the bool to an int and reverse it.
+        self.msh2_model.vis = int(not self.get_vis(self.si_model))
+        self.msh2_model.transform = msh2.Transform(*self.get_transform_quat(self.si_model))
+        self.msh2_model.model_type = self.get_msh2_model_type(self.si_model)
+        if 'geo' in self.msh2_model.model_type:
+            logging.info('Is geometry.')
+            self.msh2_model.segments = None
+            with zetcore.Timer('Segments in %ss %sms.'):
+                self.msh2_model.segments = self.get_segments()
+            self.process_bbox()
+        if self.msh2_model.model_type == 'cloth':
+            logging.info('Is cloth.')
+            self.msh2_model.segments = None
+            with zetcore.Timer('Cloth Segment in %ss %sms.'):
+                self.msh2_model.segments = self.get_cloth()
+            if self.is_weighted():
+                self.msh2_model.deformers = self.get_deformers()
+                self.export.add_deformers(self.msh2_model.deformers)
+        if self.msh2_model.model_type == 'geodynamic':
+            logging.info('Is geodynamic.')
+            self.msh2_model.deformers = self.get_deformers()
+            self.export.add_deformers(self.msh2_model.deformers)
+        if self.is_collprim():
+            logging.info('Is collision primitive.')
+            with zetcore.Timer('CollPrim in %ss %sms.'):
+                self.process_collision_prim()
+        elif self.is_cloth_collprim():
+            logging.info('Is cloth collision primitive.')
+            with zetcore.Timer('ClothCollPrim in %ss %sms.'):
+                self.process_c_collision_primitive()
+        # Reset scale because we're using vertex world coordinates.
+        # And do it after process_collision_prim because it needs the scale.
+        self.msh2_model.transform.scale = 1.0, 1.0, 1.0
+        if self.msh2_model.model_type == 'geoshadow':
+            self.export.abort('Shadowmeshes arent supported.')
+        return self.msh2_model
+
+
+class MaterialConverter(softimage.SIMaterial):
+    '''Converts a XSI Material to a msh2 material.'''
+    def __init__(self, si_mat, export, index, immediate_conversion=False):
+        self.export = export
+        self.si_material = si_mat
+        self.msh2_material = msh2.Material()
+        self.msh2_material.index = index
+        if immediate_conversion:
+            self.convert()
+
+    def get_mat_prop(self):
+        '''Returns the material property if it can find it.'''
+        # Retrieves the material property containing ZE specific data.
+        for prop in self.si_material.Properties:
+            if 'ZeroEngine' in prop.Name:
+                return prop
+
+    def flags_from_int(self, val):
+        '''Unpacks an int indicating the material flags into the
+        single flags.'''
+        # Decodes an int into flags.
+        place0 = val
+        flags = [('specular', True, 128),
+                 ('additive', True, 64),
+                 ('perpixel', True, 32),
+                 ('hard', True, 16),
+                 ('double', True, 8),
+                 ('single', True, 4),
+                 ('glow', True, 2),
+                 ('emissive', True, 1)]
+        new = place0
+        for index, flag in enumerate(flags):
+            new -= flag[2]
+            if new < 0:
+                flags[index] = flag[0], False, flag[2]
+                new += flag[2]
+        return flags
+
+    def process_shader_data(self):
+        '''Gets data like color, texture and glossyness from the shader.'''
+        for shader in self.si_material.Shaders:
+            # First get the diffuse parameter of the shader(diffuse input)
+            diff_param = shader.Parameters('diffuse')
+            # If the parameter has a source(a connection to something)
+            if diff_param.Source:
+                # This is some sort of hack. Gives me access to the Image.
+                diff_src_img = diff_param.Source.Parent
+                # Get the image clip of the image. Image Clips holds File name etc.
+                # Image only holds image data(pixels, width etc).
+                clip = diff_src_img.ImageClips(0)
+                # Then get the clip source(texture).
+                self.msh2_material.tex0 = self.get_clip_source_name(clip)
+            try:
+                self.msh2_material.diff_color = msh2.Color(self.get_shader_color(shader, 'diffuse'))
+                self.msh2_material.diff_color.alpha = 1.0
+                self.msh2_material.ambt_color = msh2.Color(self.get_shader_color(shader, 'ambient'))
+                self.msh2_material.ambt_color.alpha = 1.0
+            except AttributeError as ae:
+                self.export.abort(str(ae) + '\nMaterial {0} is not of type Phong or Lambert.'.format(self.si_material.name))
+            try:
+                self.msh2_material.spec_color = msh2.Color(self.get_shader_color(shader, 'specular'))
+                self.msh2_material.spec_color.alpha = 1.0
+                self.msh2_material.gloss = shader.Parameters('shiny').Value
+            except AttributeError as ae:
+                self.msh2_material.spec_color = msh2.Color((0.0, 0.0, 0.0, 1.0))
+                self.msh2_material.gloss = 0
+        return True
+
+    def process_msh_material_data(self, prop):
+        '''Retrieves MSH material flags.'''
+        # Add all flag values.
+        # Thats faster than looping through them with ifs.
+        # Even if we have to decode that int later.
+        value = 0
+        value += int(prop.emissive.Value)
+        value += 2 * int(prop.glow.Value)
+        value += 4 * int(prop.transparency.Value)
+        value += 16 * int(prop.hardedged.Value)
+        value += 32 * int(prop.perpixel.Value)
+        value += 64 * int(prop.additive.Value)
+        value += 128 * int(prop.specular.Value)
+        # Decode the value.
+        self.msh2_material.flags = self.flags_from_int(value)
+        # Get some misc values from the property.
+        self.msh2_material.render_type = prop.rendertype.Value
+        self.msh2_material.data0 = prop.data0.Value
+        self.msh2_material.data1 = prop.data1.Value
+        self.msh2_material.tex1 = prop.tex1.Value.encode(STR_CODEC)
+        self.msh2_material.tex2 = prop.tex2.Value.encode(STR_CODEC)
+        self.msh2_material.tex3 = prop.tex3.Value.encode(STR_CODEC)
+
+    def convert(self):
+        '''Converts the XSI material to a msh2 material, accessible via
+        MaterialConverter.msh2_material.'''
+        # First get the material property
+        self.msh2_material.name = self.si_material.Name.encode(STR_CODEC)
+        self.process_shader_data()
+        prop = self.get_mat_prop()
+        if prop:
+            self.process_msh_material_data(prop)
+        return self.msh2_material
+
+
+# Inherit from SIGeneral which contains general functions
+#  for working with XSI.
+class Export(softimage.SIGeneral):
+    '''Main export class. Handles selection and data.'''
+    def __init__(self, app, config=None):
+        self.xsi = app
+        self.ADDONPATH = self.xsi.InstallationPath(const.siUserAddonPath)
+        self.notifications = None
+        self.model_deformers = None
+        self.stats = zetcore.ExportStats()
+        self.dontexport = []
+        # pb = progress bar
+        self.pb = softimage.SIProgressBar()
+        if config:
+            self.ppg_params = config
+        else:
+            return
+            self.ppg_params = zetcore.load_settings('export', PPG.Inspected(0))
+        logpath = os.path.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'export_log.log')
+        logging.basicConfig(format='%(levelname)s (%(lineno)d, %(funcName)s): %(message)s',
+                            filename=logpath,
+                            filemode='w',
+                            level=logging.DEBUG)
+
+    def export_msg(self):
+        '''Displays a message after export.'''
+        if not self.ppg_params.get('show_finished_dialog'):
+            return
+        notifs = ['\n\n']
+        if self.notifications:
+            for notif in self.notifications:
+                notifs.append(notif)
+                notifs.append('\n')
+        self.msg('Exported {0} materials and {1} models with {2} verts and {3} faces in {4} seconds and {5} microseconds.{6}'.format(self.stats.mats,
+                                                                                                                                     self.stats.models,
+                                                                                                                                     self.stats.verts,
+                                                                                                                                     self.stats.faces,
+                                                                                                                                     self.stats.secs(),
+                                                                                                                                     self.stats.micros(),
+                                                                                                                                     ''.join(notifs)))
+
+    def log(self, text):
+        self.export_log.append(text)
+
+    def log_hier(self):
+        text = ['Hierarchy:\n']
+        for mdl in self.msh.models:
+            text.append('\t{0}\n'.format(mdl.name))
+        self.msg(''.join(text))
+
+    def notify(self, text):
+        '''Adds a notification to the after-export message.'''
+        if self.notifications:
+            self.notifications.append(text)
+        else:
+            self.notifications = [text]
+
+    def add_deformers(self, defs):
+        if self.model_deformers:
+            for deformer in defs:
+                if deformer not in self.model_deformers:
+                    self.model_deformers.append(deformer)
+        else:
+            self.model_deformers = defs
+
+    def abort(self, text=''):
+        '''Aborts the export with an optional text message.'''
+        if text:
+            self.msg('Export aborted:\n{0}.'.format(text))
+            sys.exit()
+        self.msg('Export aborted.')
+        sys.exit()
+
+    def check_filepath(self):
+        '''Checks if the filepath exists and if there is a file. Asks to
+        overwrite the file.'''
+        path = self.ppg_params.get('path')
+        if bool(self.ppg_params.get('rootname')):
+            splitpath = path.split('\\')
+            splitpath[-1] = self.si_root.Name.encode(STR_CODEC) + '.msh'
+            path = '\\'.join(splitpath)
+        filepath = ''
+        splitpath = path.split('\\')
+        filepath_items = ['...', splitpath[-3], splitpath[-2], splitpath[-1]]
+        filepath = '\\'.join(filepath_items)
+        if os.path.isfile(path) and not self.ppg_params.get('overwrite'):
+            if self.msg('{0} already exists, overwrite?'.format(filepath), const.siMsgYesNo) != 6:
+                self.abort()
+
+    def export(self):
+        '''Prepares export.'''
+        self.stats.start = datetime.now()
+        self.pb.inc()
+        zetcore.save_settings('export', self.ppg_params)
+        self.si_root = self.xsi.Selection(0)
+        if not self.si_root:
+            self.abort('No models selected.')
+        if self.ppg_params.get('batch'):
+            direct_children = self.si_root.Children
+            for child in direct_children:
+                self.si_root = child
+                self.si_models = self.get_all_children(child)
+                self.si_materials = self.unique_materials(self.si_models)
+                self.do_export()
+            self.stats.end = datetime.now()
+            self.export_msg()
+            return
+        self.si_models = self.get_all_children(self.si_root)
+        self.si_materials = self.unique_materials(self.si_models)
+        self.do_export()
+        self.stats.end = datetime.now()
+        self.export_msg()
+        return
+
+    def do_export(self):
+        '''Main export routine. Exports and writes a .msh file.'''
+        self.check_filepath()
+        logging.info('==========================================')
+        logging.info('Starting export at {0}.'.format(datetime.now()))
+        logging.info('.msh file path: {0}'.format(self.ppg_params.get('path')))
+        self.msh = None
+        self.msh = msh2.Msh()
+
+        # Convert materials from XSI to msh2.
+        self.pb.set(len(self.si_materials), 'Processing materials...')
+        self.pb.show()
+        self.msh.materials = msh2.MaterialCollection(self.msh)
+        self.msh.materials.replace([])
+        with zetcore.Timer('Materials in %ss %sms.'):
+            for ndx, material in enumerate(self.si_materials):
+                logging.info('Processing material "{0}".'.format(material.Name))
+                self.pb.setc('Processing Material {0}... {1}/{2}'.format(material.Name,
+                                                                         ndx + 1,
+                                                                         len(self.si_materials)))
+                conv = MaterialConverter(material, self, ndx)
+                self.msh.materials.add(conv.convert())
+                logging.info('Finished processing.')
+                self.pb.inc()
+            self.msh.materials.assign_indices()
+        self.stats.mats += len(self.msh.materials)
+
+        # Now Models.
+        self.pb.set(len(self.si_models), 'Processing models...')
+        self.msh.models = None
+        self.msh.models = msh2.ModelCollection(self.msh)
+        self.msh.models.replace([])
+        with zetcore.Timer('Models in %ss %sms.'):
+            for ndx, model in enumerate(self.si_models):
+                self.pb.setc('Processing Model {0}... {1}/{2}'.format(model.Name,
+                                                                      ndx + 1,
+                                                                      len(self.si_models)))
+                logging.info('Processing model "{0}".'.format(model.Name))
+                with zetcore.Timer('Model in %ss %sms.'):
+                    conv = ModelConverter(model, self)
+                    self.msh.models.add(conv.convert())
+                logging.info('Finished processing.')
+                self.pb.inc()
+            self.msh.models.assign_indices()
+            self.msh.models.assign_parents()
+
+        self.msh.models.remove_multi(self.dontexport)
+
+        with zetcore.Timer('Assigned cloth collisions in %ss %sms.'):
+            self.msh.models.assign_cloth_collisions()
+        self.stats.models += len(self.msh.models)
+
+        # Scene Info.
+        self.pb.set(1, 'Getting Scene Info...')
+        logging.info('Processing Scene Info.')
+        scnnfo = SceneInfoConverter(self)
+        scnnfo.parent = self.msh
+        self.msh.info = scnnfo.convert()
+        logging.info('Finished processing Scene Info.')
+        self.pb.inc()
+
+        # Animation.
+        self.pb.set(2, 'Processing Animation...')
+        with zetcore.Timer('Processed animation in %ss %sms.'):
+            if self.ppg_params.get('anim'):
+                logging.info('Processing animation.')
+                anim = AnimationConverter(self)
+                self.msh.animation = anim.convert()
+            else:
+                logging.info('Setting empty animation.')
+                self.msh.animation = msh2.Animation(None, 'empty')
+        self.pb.inc()
+        # Make nulls which are used as envelopes bones.
+        if self.model_deformers:
+            logging.info('Setting model type to "bone" for {0}.'.format(self.model_deformers))
+            for mdl in self.msh.models:
+                if mdl.name in self.model_deformers:
+                    mdl.model_type = 'bone'
+        self.pb.inc()
+
+        if not self.write_msh(self.msh.pack()):
+            self.msg('Failed {0}.'.format(self.si_root.Name))
+
+    def write_msh(self, data):
+        path = self.ppg_params.get('path')
+        if bool(self.ppg_params.get('rootname')):
+            splitpath = path.split('\\')
+            splitpath[-1] = self.si_root.Name.encode(STR_CODEC) + '.msh'
+            path = '\\'.join(splitpath)
+        try:
+            with open(path, 'wb') as fh:
+                fh.write(data)
+            return True
+        except IOError as ioe:
+            self.msg(str(ioe))
+            return False
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Core/zetimport.py b/src_research_readme/zero-edit-tool-python-base/Application/Core/zetimport.py
new file mode 100644
index 0000000..31c21a9
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Core/zetimport.py
@@ -0,0 +1,956 @@
+'''
+    Import.
+'''
+import os
+import sys
+from pythoncom import com_error
+from datetime import datetime as dt
+import win32com
+from win32com.client import constants as const
+from msh2_crc import CRCError
+import logging
+import softimage
+import zetcore
+import msh2
+import msh2_unpack
+reload(logging)
+reload(softimage)
+reload(zetcore)
+reload(msh2)
+reload(msh2_unpack)
+
+xsimath = win32com.client.Dispatch('XSI.Math')
+xsifact = win32com.client.Dispatch('XSI.Factory')
+
+STR_CODEC = 'utf-8'
+
+
+class MshImportError(Exception):
+
+    def __init__(self, msg):
+        self.msg = msg
+
+    def __str__(self):
+        return str(self.msg)
+
+
+class MaterialBuilder(object):
+
+    def __init__(self, imp, msh):
+        self.msh = msh
+        self.imp = imp
+        self.xsi = self.imp.xsi
+        self.pb = self.imp.pb
+
+    def build(self):
+        logging.info('Building {0} materials.'.format(len(self.msh.materials)))
+        coll = self.msh.materials
+        if len(coll) < 1:
+            logging.debug('No materials in collection.')
+            return ()
+        matlib = self.xsi.ActiveProject.ActiveScene.ActiveMaterialLibrary
+        materials = {}
+        for mat in coll:
+            logging.info('Building Material {0}.'.format(mat.name))
+            simat = matlib.CreateMaterial('Phong', mat.name)
+            # Colors.
+            shader = simat.Shaders(0)
+            col = shader.Parameters('diffuse').Value
+            col.Red = mat.diff_color.red
+            col.Green = mat.diff_color.green
+            col.Blue = mat.diff_color.blue
+            col.Alpha = mat.diff_color.alpha
+
+            col = shader.Parameters('ambient').Value
+            col.Red = mat.ambt_color.red
+            col.Green = mat.ambt_color.green
+            col.Blue = mat.ambt_color.blue
+            col.Alpha = mat.ambt_color.alpha
+
+            col = shader.Parameters('specular').Value
+            col.Red = mat.spec_color.red
+            col.Green = mat.spec_color.green
+            col.Blue = mat.spec_color.blue
+            col.Alpha = mat.spec_color.alpha
+
+            shader.Parameters('shiny').Value = mat.gloss
+
+            # Image.
+            if mat.tex0:
+                if self.imp.config.get('btexpath'):
+                    imgfolder = self.imp.config.get('texpath')
+                else:
+                    imgfolder = os.path.dirname(self.imp.config.get('path'))
+                imgshader = self.xsi.CreateShaderFromPreset('$XSI_DSPRESETS\\Shaders\\Texture\\Image.Preset', simat)
+                imgpath = os.path.join(imgfolder, mat.tex0)
+                img_clip = self.xsi.SICreateImageClip2(imgpath)
+                self.xsi.SIConnectShaderToCnxPoint(img_clip, imgshader.tex, False)
+                self.xsi.SIConnectShaderToCnxPoint(imgshader, simat.Shaders(0).Parameters('diffuse'), False)
+            # ZEFlags.
+            simat2 = self.get_si_mat(mat)
+            if simat2:
+                self.add_flag_prop(simat2, mat)
+            materials[mat.name] = simat
+            logging.info('Finished building {0}.'.format(mat.name))
+        logging.info('Finished building materials.')
+        return materials
+
+    def get_si_mat(self, mat):
+        name = mat.name
+        mats = self.imp.material_name_dict()
+        try:
+            mat = mats[name]
+            return mat
+        except KeyError:
+            logging.exception('Couldnt find material {0}.'.format(name))
+            return None
+
+    def add_flag_prop(self, simat, mat):
+        pset = simat.AddProperty('CustomProperty', False, 'ZeroEngine Flags')
+        pset.AddParameter3('tex1', const.siString, mat.tex1)
+        pset.AddParameter3('tex2', const.siString, mat.tex2)
+        pset.AddParameter3('tex3', const.siString, mat.tex3)
+
+        if mat.flags[4][1]:
+            transp = 2
+        elif mat.flags[5][1]:
+            transp = 1
+        else:
+            transp = 0
+        pset.AddParameter3('emissive', const.siBool, mat.flags[7][1], '', '', 0)
+        pset.AddParameter3('glow', const.siBool, mat.flags[6][1], '', '', 0)
+        pset.AddParameter3('transparency', const.siInt4, transp, 0, 2, 0)
+        pset.AddParameter3('hardedged', const.siBool, mat.flags[3][1], '', '', 0)
+        pset.AddParameter3('perpixel', const.siBool, mat.flags[2][1], '', '', 0)
+        pset.AddParameter3('additive', const.siBool, mat.flags[1][1], '', '', 0)
+        pset.AddParameter3('specular', const.siBool, mat.flags[0][1], '', '', 0)
+        pset.AddParameter3('rendertype', const.siInt4, mat.render_type, 0, 31, 0)
+        pset.AddParameter3('data0', const.siInt4, mat.data0, 0, 255, 0)
+        pset.AddParameter3('data1', const.siInt4, mat.data1, 0, 255, 0)
+
+        lay = pset.PPGLayout
+
+        lay.AddGroup('ZeroEngine Material Flags', 1)
+        lay.AddGroup('Additional Textures', 1)
+        lay.AddItem('tex1', 'Texture 1')
+        lay.AddItem('tex2', 'Texture 2')
+        lay.AddItem('tex3', 'Texture 3')
+        lay.EndGroup()
+        lay.AddGroup('Flags', 1)
+        lay.AddItem('emissive', 'Emissive')
+        lay.AddItem('glow', 'Glow')
+        lay.AddItem('transparency', 'Transparency')
+        lay.AddItem('hardedged', 'Hardedged Transparency')
+        lay.AddItem('perpixel', 'Per-Pixel Lighting')
+        lay.AddItem('additive', 'Additive Transparency')
+        lay.AddItem('specular', 'Specular')
+        lay.AddItem('rendertype', 'RenderType')
+        lay.AddItem('data0', 'Data0')
+        lay.AddItem('data1', 'Data1')
+        lay.EndGroup()
+        lay.EndGroup()
+
+
+class ChainItemBuilder(softimage.SIModel):
+    prim_types = {0: 'Sphere',
+                  1: 'Sphere',
+                  2: 'Cylinder',
+                  4: 'Cube'}
+    cloth_prim_types = {0: 'Sphere',
+                        1: 'Cylinder',
+                        2: 'Cube'}
+
+    def __init__(self, model, chainbuilder):
+        self.model = model
+        # Will be set in build() after the model is built.
+        self.si_model = None
+        self.chainbuilder = chainbuilder
+        self.xsi = self.chainbuilder.xsi
+        self.imp = self.chainbuilder.imp
+        self.geo = None
+        if self.imp.config.get('ignoregeo'):
+            self.build_geo = self.build_null
+            self.build_prim = self.build_null
+            self.build_shadow = self.build_null
+
+    def build(self):
+        '''Builds an object depending on the model type.'''
+        time_start = dt.now()
+        if self.model.model_type == 'null' or self.model.model_type == 'bone':
+            self.build_null()
+        elif self.model.model_type == 'geoshadow':
+            self.build_shadow()
+        elif 'geo' in self.model.model_type:
+            if self.model.collprim:
+                self.build_prim()
+            elif self.model.name.startswith('c_') and self.get_c_prim_data():
+                self.build_c_prim()
+            else:
+                self.build_geo()
+        elif self.model.model_type == 'cloth':
+            self.build_cloth()
+        else:
+            raise MshImportError('Unsupported model type {0} on {1}.'.format(self.model.model_type,
+                                                                             self.model.name))
+        time = dt.now() - time_start
+        logging.info('Finished building %s in %ss %sms.', self.model.name, time.seconds, time.microseconds)
+        return self.si_model
+
+    def build_cloth(self):
+        '''Build enveloped geometry with special cloth properties.'''
+        logging.info('Building %s as cloth(originally %s).', self.model.name, self.model.model_type)
+
+        vertex_positions = self.get_vertex_positions()
+
+        faces = self.get_faces()
+
+        if self.model.parent_name:
+            parent = self.chainbuilder.name_dict[self.model.parent_name]
+        else:
+            parent = self.xsi.ActiveSceneRoot
+        if not parent:
+            logging.error(
+                'Cant find parent %s for %s.',
+                self.model.parent_name,
+                self.model.name
+            )
+        try:
+            self.si_model = parent.AddPolygonMesh(vertex_positions,
+                                                  faces,
+                                                  self.model.name)
+        except com_error:
+            logging.exception(
+                'verts: %s, faces: %s, name: %s.',
+                vertex_positions,
+                faces,
+                self.model.name
+            )
+            self.imp.abort_checklog()
+
+        self.geo = self.si_model.ActivePrimitive.GetGeometry2(0)
+
+        self.process_uvs()
+
+        self.set_transform()
+        self.set_vis()
+
+        import utils
+        cloth_prop = utils.add_cloth_property(self.si_model)
+        cloth_prop.Parameters('collisions').Value = ','.join([c.name for c in self.model.segments[0].collisions])
+        cloth_prop.Parameters('texture').Value = self.model.segments[0].texture
+        self.geo.AddCluster(const.siVertexCluster, 'ZEFixedPoints', self.model.segments[0].vertices.fixed_indices())
+
+    def build_shadow(self):
+        '''Build a null instead of a shadow mesh.'''
+        logging.info('Building {0} as shadow(originally {1}).'.format(self.model.name, self.model.model_type))
+        self.si_model = self.xsi.GetPrim('Null', '{0}(shadow)'.format(self.model.name), self.model.parent_name)
+        self.set_transform()
+        self.set_vis()
+
+    def get_c_prim_data(self):
+        '''Gets the corresponding COLL data for this model.'''
+        for model in self.imp.msh.models:
+            if model.model_type == 'cloth':
+                cloth_geo = model.segments[0]
+                for collision in cloth_geo.collisions:
+                    if collision.name == self.model.name:
+                        return collision
+
+    def build_c_prim(self):
+        '''Builds primitive objectives from cloth collisions.'''
+        logging.info('Building {0} as cloth prim(originally {1}).'.format(self.model.name, self.model.model_type))
+
+        # Find a cloth which has this cloth primitive as cloth collision so we can retrieve the necessary primitive data.
+        my_collision = self.get_c_prim_data()
+
+        self.si_model = self.xsi.CreatePrim(self.cloth_prim_types[my_collision.primitive_type],
+                                            'MeshSurface',
+                                            self.model.name,
+                                            self.model.parent_name)
+        self.set_transform()
+        self.set_vis()
+        # self.add_prim_property()
+        if my_collision.primitive_type == 0:
+            self.si_model.radius = my_collision.primitive_data[0]
+            self.set_cloth_prim_scale(my_collision)
+        elif my_collision.primitive_type == 1:
+            self.si_model.radius = my_collision.primitive_data[0]
+            self.si_model.height = my_collision.primitive_data[1]
+            self.set_cloth_prim_scale(my_collision)
+        elif my_collision.primitive_type == 2:
+            self.si_model.length = 1.0  # my_collision.primitive_data[0]
+            self.set_cloth_prim_scale(my_collision)
+        else:
+            logging.error('{0} is unknown prim type({1}).'.format(self.model.name, self.model.primitive[0]))
+
+    def build_prim(self):
+        '''Build primitive objects from collision primitives.'''
+        logging.info('Building %s as prim(originally %s).', self.model.name, self.model.model_type)
+        if self.model.primitive[0] == 3:
+            logging.error('Primitive %s is of type 3. Invalid. Building null instead.', self.model.name)
+            self.imp.notify('Primitive {0} is of type 3. Invalid. Building null instead.'.format(self.model.name))
+            self.build_null()
+            return
+        self.si_model = self.xsi.CreatePrim(self.prim_types[self.model.primitive[0]],
+                                            'MeshSurface',
+                                            self.model.name,
+                                            self.model.parent_name)
+        self.set_transform()
+        self.set_vis()
+        self.add_prim_property()
+        if self.model.primitive[0] == 0:
+            self.si_model.radius = self.model.primitive[1]
+            self.set_prim_scale()
+        elif self.model.primitive[0] == 1:
+            self.si_model.radius = self.model.primitive[1]
+            self.set_prim_scale()
+        elif self.model.primitive[0] == 2:
+            self.si_model.radius = self.model.primitive[1]
+            self.si_model.height = self.model.primitive[2]
+            self.set_prim_scale()
+        elif self.model.primitive[0] == 4:
+            self.si_model.length = 1.0
+            self.set_prim_scale()
+        else:
+            logging.error('{0} is unknown prim type({1}).'.format(self.model.name, self.model.primitive[0]))
+
+    def add_prim_property(self):
+        property_set = self.si_model.AddProperty('CustomProperty', False, 'collprim')
+        property_set.AddParameter3('type', const.siInt4, self.model.primitive[0])
+
+    def set_prim_scale(self):
+        transform = self.si_model.Kinematics.Global.Transform
+        if self.model.primitive[0] == 4:
+            transform.SetScalingFromValues(self.model.primitive[1] * 2,
+                                           self.model.primitive[2] * 2,
+                                           self.model.primitive[3] * 2)
+        self.si_model.Kinematics.Global.Transform = transform
+
+    def set_cloth_prim_scale(self, collision):
+        transform = self.si_model.Kinematics.Global.Transform
+        if collision.primitive_type == 2:
+            transform.SetScalingFromValues(collision.primitive_data[0] * 2,
+                                           collision.primitive_data[1] * 2,
+                                           collision.primitive_data[2] * 2)
+        self.si_model.Kinematics.Global.Transform = transform
+
+    def build_geo(self):
+        logging.info('Building {0} as polymesh(originally {1}).'.format(self.model.name, self.model.model_type))
+
+        vertex_positions = self.get_vertex_positions()
+
+        faces = self.get_faces()
+
+        if self.model.parent_name:
+            parent = self.chainbuilder.name_dict[self.model.parent_name]
+        else:
+            parent = self.xsi.ActiveSceneRoot
+        if not parent:
+            logging.error('Cant find parent {0} for {1}.'.format(self.model.parent_name,
+                                                                 self.model.name))
+        if len(vertex_positions) == 0:
+            logging.info('Building {0} as null (originally {1}) because no geometry information was found.'.format(self.model.name, self.model.model_type))
+            self.build_null()
+            return
+        try:
+            with zetcore.Timer('Built polygon mesh in %ss %sms.'):
+                self.si_model = parent.AddPolygonMesh(vertex_positions,
+                                                      faces,
+                                                      self.model.name)
+        except com_error:
+            logging.exception('verts: {0}, faces: {1}, name: {2}.'.format(vertex_positions,
+                                                                          faces, self.model.name))
+            self.imp.abort_checklog()
+        self.geo = self.si_model.ActivePrimitive.GetGeometry2(0)
+
+        # if self.model.vis == 1:
+        #     self.xsi.ToggleVisibility(self.si_model, None, None)
+
+        self.process_normals()
+        self.process_uvs()
+        self.process_colors()
+
+        with zetcore.Timer('Creating segments in %ss %sms.'):
+            if len(self.model.segments) > 1:
+                logging.debug('Model {0} has {1} segments, creating poly clusters.'.format(self.model.name, len(self.model.segments)))
+                self.create_poly_clusters()
+            else:
+                self.xsi.SIAssignMaterial(self.si_model,
+                                          self.chainbuilder.materials[self.model.segments[0].material.name])
+
+        self.set_transform()
+        self.set_vis()
+
+    def process_normals(self):
+        '''Applies normals to the SI model.'''
+        with zetcore.Timer('Processing normals in %ss %sms.'):
+            normal_cluster = self.geo.AddCluster(const.siSampledPointCluster)
+            normal_cluster.AddProperty('User Normal Property', False, 'ZETools-NormalsProperty')
+            self.set_normals(0, self.make_normals())
+
+    def process_uvs(self):
+        '''Applies UVs to the SI model if it is UVed.'''
+        is_uved = False
+        for segment in self.model.segments:
+            if segment.vertices.uved:
+                is_uved = True
+                break
+        if is_uved:
+            with zetcore.Timer('Making UVs in %ss %sms.'):
+                uvs = self.make_uvs_persample()
+                self.xsi.CreateProjection(self.si_model)
+                # Freeze object to hide the projections. Is quite expensive.
+                self.xsi.FreezeObj(self.si_model)
+                self.set_uvs(0, uvs)
+        else:
+            logging.debug('Model %s has no UVs.', self.model.name)
+
+    def process_colors(self):
+        '''Applies vertex colors to the SI model if it is colored.'''
+        is_colored = False
+        with zetcore.Timer('Processing vertex colors in %ss %sms.'):
+            for segment in self.model.segments:
+                if segment.vertices.colored:
+                    is_colored = True
+                    break
+            if is_colored:
+                colors = self.make_colors_persample()
+                self.xsi.CreateVertexColorSupport('', 'Vertex_Color', [self.si_model])
+                self.set_vertex_colors(0, colors)
+            else:
+                logging.debug('Model {0} is not colored.'.format(self.model.name))
+
+    def make_normals(self):
+        '''Creates Normal data for every sample using the corresponding Vertex and returns the data as list.'''
+        node_to_vertex_index_list = self.xsi.ZET_GetNodeToVertexIndices(self.geo)
+
+        # Create a list of 3 lists for X, Y and Z vectors.
+        normals = [[0.0] * len(node_to_vertex_index_list) for _ in range(3)]
+
+        for node_index, vertex_index in enumerate(node_to_vertex_index_list):
+            vertex = self.model.get_vertex_by_index(vertex_index)
+            normals[0][node_index] = vertex.nx
+            normals[1][node_index] = vertex.ny
+            normals[2][node_index] = vertex.nz
+        return normals
+
+    def make_colors_persample(self):
+        '''Creates Normal data for every sample using the corresponding Vertex and returns the data as list.'''
+        node_to_vertex_index_list = self.xsi.ZET_GetNodeToVertexIndices(self.geo)
+
+        # Create a list of 3 lists for X, Y and Z vectors.
+        colors = [[0.0] * len(node_to_vertex_index_list) for _ in range(4)]
+
+        for node_index, vertex_index in enumerate(node_to_vertex_index_list):
+            vertex = self.model.get_vertex_by_index(vertex_index)
+            r, g, b, a = vertex.color.get_f()
+            colors[0][node_index] = r
+            colors[1][node_index] = g
+            colors[2][node_index] = b
+            colors[3][node_index] = a
+        return colors
+
+    def create_poly_clusters(self):
+        offset = 0
+        cls_debug = []
+        for seg in self.model.segments:
+            cls = self.geo.AddCluster('poly', 'zeimport_poly', range(offset, len(seg.faces) + offset))
+            self.xsi.SIAssignMaterial(cls, self.chainbuilder.materials[seg.material.name])
+            cls_debug.append(cls.Name)
+            offset += len(seg.faces)
+        logging.debug('Created {0} poly clusters({1}).'.format(len(cls_debug), ', '.join(cls_debug)))
+
+    def get_vertex_positions(self):
+        v_pos = []
+
+        with zetcore.Timer('Retrieved vertices in %ss %sms.'):
+            for segment in self.model.segments:
+                for vert in segment.vertices:
+                    v_pos.extend(vert.pos)
+            logging.debug('Retrieved {0} vertex positions.'.format(len(v_pos) / 3))
+
+        return v_pos
+
+    def get_faces(self):
+        faces = []
+        offset = 0
+        numfaces = 0
+
+        with zetcore.Timer('Retrieved faces in %ss %sms.'):
+            for segment in self.model.segments:
+                for face in segment.faces:
+                    numfaces += 1
+                    faces.append(face.sides)
+                    sii = face.SIindices()
+                    if len(sii) == 4:
+                        sii = (sii[0] + offset, sii[1] + offset,
+                               sii[2] + offset, sii[3] + offset)
+                    else:
+                        sii = sii[0] + offset, sii[1] + offset, sii[2] + offset
+                    faces.extend(sii)
+                offset += len(segment.vertices)
+
+        return faces
+
+    def make_uvs_persample(self):
+        '''Creates UV data for every sample using the corresponding Vertex and returns the data as list.'''
+        node_to_vertex_index_list = self.xsi.ZET_GetNodeToVertexIndices(self.geo)
+
+        # Create a list of 3 lists because Softimage stores U, V and W data.
+        uvs = [[0.0] * len(node_to_vertex_index_list) for _ in range(3)]
+
+        for node_index, vertex_index in enumerate(node_to_vertex_index_list):
+            vertex = self.model.get_vertex_by_index(vertex_index)
+            uvs[0][node_index] = vertex.u
+            uvs[1][node_index] = vertex.v
+        return uvs
+
+    def make_uvs(self):
+        '''Creates UVs if the number of points equals the number of
+        samples.'''
+        uvs = [[], []]
+        for seg in self.model.segments:
+            for v in seg.vertices:
+                uvs[0].append(v.u)
+                uvs[1].append(v.v)
+        uvs.append([0.0] * self.model.segments.num_vertices())
+
+        return uvs
+
+    def build_null(self):
+        logging.info('Building {0} as null(originally {1}).'.format(self.model.name, self.model.model_type))
+        self.si_model = self.xsi.GetPrim('Null', self.model.name, self.model.parent_name)
+        # Set Null display size.
+        self.si_model.Parameters('Size').Value = float(self.imp.config.get('nullsize'))
+        if self.imp.config.get('wirecol'):
+            if 'eff' in self.model.name:
+                r, g, b = self.imp.config.get('Reff'), self.imp.config.get('Geff'), self.imp.config.get('Beff')
+                wirecol = self.chainbuilder.scn.wirecol(r, g, b)
+                display = self.si_model.Properties('Display')
+                if display.IsA(const.siSharedPSet):
+                    display = self.xsi.MakeLocal(display, const.siNodePropagation)[0]
+                display.wirecol.Value = wirecol
+            elif 'root' in self.model.name:
+                r, g, b = self.imp.config.get('Rroot'), self.imp.config.get('Groot'), self.imp.config.get('Broot')
+                wirecol = self.chainbuilder.scn.wirecol(r, g, b)
+                display = self.si_model.Properties('Display')
+                if display.IsA(const.siSharedPSet):
+                    display = self.xsi.MakeLocal(display, const.siNodePropagation)[0]
+                display.wirecol.Value = wirecol
+            elif 'bone' in self.model.name:
+                r, g, b = self.imp.config.get('Rbone'), self.imp.config.get('Gbone'), self.imp.config.get('Bbone')
+                wirecol = self.chainbuilder.scn.wirecol(r, g, b)
+                display = self.si_model.Properties('Display')
+                if display.IsA(const.siSharedPSet):
+                    display = self.xsi.MakeLocal(display, const.siNodePropagation)[0]
+                display.wirecol.Value = wirecol
+        if self.imp.config.get('hideeffs'):
+            if 'eff' in self.model.name.lower():
+                if self.model.vis != 1:
+                    self.xsi.ToggleVisibility(self.si_model, None, None)
+        if self.imp.config.get('hideroots'):
+            if 'root' in self.model.name.lower():
+                if self.model.vis != 1:
+                    self.xsi.ToggleVisibility(self.si_model, None, None)
+        self.set_vis()
+        self.set_transform()
+
+    def set_vis(self):
+        if self.model.vis == 1:
+            self.xsi.ToggleVisibility(self.si_model, None, None)
+
+    def set_transform(self):
+        # Collision primitives that are children of other collision primitives
+        # require special treatment.
+        if ('geo' in self.model.model_type) and self.model.collprim and self.si_model.Parent.FullName.startswith('p_'):
+            parent_transform = self.si_model.Parent.Kinematics.Local.Transform
+            parent = self.imp.msh.models.by_name(self.model.parent_name)
+
+            # Set local transform.
+            transform = self.si_model.Kinematics.Local.Transform
+
+            quat = xsimath.CreateQuaternion()
+            quat.Set(*self.model.transform.reversed_quaternion())
+            transform.SetRotationFromQuaternion(quat)
+
+            if parent.primitive[0] == 4:
+                # Divide by parent scale to offset special scaling for cube primitives.
+                pos = (
+                    self.model.transform.translation[0] / parent_transform.SclX,
+                    self.model.transform.translation[1] / parent_transform.SclY,
+                    self.model.transform.translation[2] / parent_transform.SclZ,
+                )
+                transform.SetTranslationFromValues(*pos)
+            else:
+                transform.SetTranslationFromValues(*self.model.transform.translation)
+
+            self.si_model.Kinematics.Local.Transform = transform
+
+            # Set scale globally to ignore parent scaling..
+            transform = self.si_model.Kinematics.Global.Transform
+
+            transform.SetScalingFromValues(*self.model.transform.scale)
+
+            self.si_model.Kinematics.Global.Transform = transform
+
+            logging.debug(
+                'Collprim > collprim transform: %s, Euler: %s',
+                self.model.transform,
+                self.model.transform.euler_angles()
+            )
+            logging.debug('''Set global transform for {0} to:
+\t\t\t\t\t\t\tPosition: {1}, {2}, {3};
+\t\t\t\t\t\t\tRotation: {4}, {5}, {6};
+\t\t\t\t\t\t\tScale:    {7}, {8}, {9}.'''.format(self.si_model.Name,
+                                                 transform.PosX, transform.PosY, transform.PosZ,
+                                                 transform.RotX, transform.RotY, transform.RotZ,
+                                                 transform.SclX, transform.SclY, transform.SclZ))
+        else:
+            transform = self.si_model.Kinematics.Local.Transform
+
+            transform.SetTranslationFromValues(*self.model.transform.translation)
+
+            quat = xsimath.CreateQuaternion()
+            quat.Set(*self.model.transform.reversed_quaternion())
+            transform.SetRotationFromQuaternion(quat)
+
+            transform.SetScalingFromValues(*self.model.transform.scale)
+
+            self.si_model.Kinematics.Local.Transform = transform
+            logging.debug('Model transform: %s', self.model.transform)
+            logging.debug('''Set local transform for {0} to:
+\t\t\t\t\t\t\tPosition: {1}, {2}, {3};
+\t\t\t\t\t\t\tRotation: {4}, {5}, {6};
+\t\t\t\t\t\t\tScale:    {7}, {8}, {9}.'''.format(self.si_model.Name,
+                                                 transform.PosX, transform.PosY, transform.PosZ,
+                                                 transform.RotX, transform.RotY, transform.RotZ,
+                                                 transform.SclX, transform.SclY, transform.SclZ))
+
+
+class ChainBuilder(object):
+
+    def __init__(self, imp, msh, materials=None):
+        self.msh = msh
+        # imp = Import. Can't use import, can I?
+        self.imp = imp
+        self.xsi = self.imp.xsi
+        self.pb = self.imp.pb
+        self.materials = materials
+        self.scn = softimage.SIScene()
+        self.name_dict = {}
+
+    def build(self):
+        logging.info('Starting chain builder({0} Models).'.format(len(self.msh.models)))
+        coll = self.msh.models
+        lencoll = len(coll)
+        self.pb.set(lencoll, 'Building chain...')
+        chain = []
+        for ind, model in enumerate(coll):
+            self.pb.setc('Building {0}({1}/{2})...'.format(model.name,
+                                                           ind, lencoll))
+            builder = ChainItemBuilder(model, self)
+            item = builder.build()
+            self.name_dict[model.name] = item
+            chain.append(item)
+            self.pb.inc()
+        logging.info('Finished chain builder.')
+        return chain
+
+
+class AnimationImport(object):
+
+    def __init__(self, imp, chain, bones):
+        # imp = Import. Can't use import, can I?
+        self.imp = imp
+        self.chain = chain
+        self.bonecoll = bones
+        self.pb = self.imp.pb
+
+    def import_(self):
+        logging.info('Starting animation import.')
+        if not self.bonecoll:
+            logging.debug('No BoneCollection in Animation.')
+            return
+        if not self.chain:
+            logging.debug('No chain.')
+            return
+        lencoll = len(self.chain)
+        self.pb.set(lencoll, 'Applying animation...')
+        logging.info('Animating cycle "{0}".'.format(self.bonecoll.animation.cycle.name))
+        for ind, link in enumerate(self.chain):
+            self.pb.setc('Animating {0}({1}/{2})...'.format(link.Name,
+                                                            ind, lencoll))
+            logging.info('Animating {0}.'.format(link.Name))
+            bone = self.bonecoll.get_by_name(link.Name)
+            if not bone:
+                logging.debug('No msh2 Bone for {0}, continuing.'.format(link.Name))
+                continue
+            start_frame = self.bonecoll.animation.cycle.frames[0]
+            # Position:
+            keys_x = []
+            keys_y = []
+            keys_z = []
+            for frame, position in zip(bone.pos_keyframe_indices, bone.pos_keyframes):
+                keys_x.append(frame + start_frame)
+                keys_x.append(position[0])
+                keys_y.append(frame + start_frame)
+                keys_y.append(position[1])
+                keys_z.append(frame + start_frame)
+                keys_z.append(position[2])
+            # Animate every angle independently.
+            link.posx.AddFCurve(None, const.siLinearInterpolation, None, keys_x)
+            link.posy.AddFCurve(None, const.siLinearInterpolation, None, keys_y)
+            link.posz.AddFCurve(None, const.siLinearInterpolation, None, keys_z)
+            # Rotation:
+            keys_x = []
+            keys_y = []
+            keys_z = []
+            for frame, rotation in zip(bone.rot_keyframe_indices, bone.rot_keyframes):
+                quat = xsimath.CreateQuaternion()
+                quat.Set(rotation[3], rotation[0], rotation[1], rotation[2])
+                # Get radians rotation values from quaternion.
+                x, y, z = quat.GetXYZAngleValues2()
+                keys_x.append(frame + start_frame)
+                keys_x.append(xsimath.RadiansToDegrees(x))
+                keys_y.append(frame + start_frame)
+                keys_y.append(xsimath.RadiansToDegrees(y))
+                keys_z.append(frame + start_frame)
+                keys_z.append(xsimath.RadiansToDegrees(z))
+            # Animate every angle independently.
+            link.rotx.AddFCurve(None, const.siLinearInterpolation, None, keys_x)
+            link.roty.AddFCurve(None, const.siLinearInterpolation, None, keys_y)
+            link.rotz.AddFCurve(None, const.siLinearInterpolation, None, keys_z)
+            self.pb.inc()
+            logging.info('Finished animating {0}.'.format(link.Name))
+        logging.info('Finished animation import.')
+
+
+class Enveloper(object):
+
+    def __init__(self, imp, msh, chain):
+        self.imp = imp
+        self.msh = msh
+        self.chain = chain
+        self.xsi = self.imp.xsi
+        # Model deformers and unique cloth vertex deformers combined.
+        self.deformers = []
+
+    def envelope(self):
+        logging.info('Starting enveloping.')
+        for item in self.chain:
+            logging.info('Enveloping {0}.'.format(item.Name))
+            model = self.msh.models.by_name(item.Name)
+            if not model:
+                logging.debug('No msh2 Model found for {0}, continuing.'.format(item.Name))
+                continue
+            if (model.model_type == 'cloth') and (model.deformers):
+                logging.debug('Model is cloth, trying some stuff.')
+                deformers_original = model.deformers[:]
+                deformers_original.extend(model.segments[0].vertices.get_deformers())
+                deformer_set = set()
+                set_add = deformer_set.add
+                self.deformers = [deformer for deformer in deformers_original if not (deformer in deformer_set or set_add(deformer))]
+                deformer_objects = self.imp.get_objects_by_name(self.deformers)
+                coll = xsifact.CreateObject('XSI.Collection')
+                logging.info('Applying envelope with deformers "{0}".'.format(','.join(self.deformers)))
+                coll.AddItems(deformer_objects)
+                item.ApplyEnvelope(coll)
+                weights = self.make_cloth_weights(model)
+                simd = softimage.SIModel(item)
+                simd.set_weights(0, weights)
+                logging.info('Finished enveloping {0}.'.format(item.Name))
+                continue
+            if not model.deformers:
+                logging.debug('No deformers for msh2 Model {0}, continuing.'.format(model.name))
+                continue
+            deformers_objects = self.imp.get_objects_by_name(model.deformers)
+            coll = xsifact.CreateObject('XSI.Collection')
+            logging.info('Applying envelope with deformers "{0}".'.format(', '.join(model.deformers)))
+            coll.AddItems(deformers_objects)
+            item.ApplyEnvelope(coll)
+            weights = self.make_weights(model)
+            simd = softimage.SIModel(item)
+            simd.set_weights(0, weights)
+            logging.info('Finished enveloping {0}.'.format(item.Name))
+        logging.info('Finished enveloping.')
+
+    def make_cloth_weights(self, model):
+        weights = []
+        num_deformers = len(self.deformers)
+        segment = model.segments[0]
+        for n in xrange(num_deformers):
+            weights.append([0.0] * len(segment.vertices))
+        for vind, vert in enumerate(segment.vertices):
+            if vert.deformer:
+                deformer_index = self.deformers.index(vert.deformer)
+                logging.debug('Vert: {0} - {1} - {2}'.format(vind, vert.deformer, deformer_index))
+                weights[deformer_index][vind] = 100
+            else:
+                weights[0][vind] = 100
+        logging.debug('Created weights for {0} cloth points.'.format(len(weights[0])))
+        return weights
+
+    def make_weights(self, model):
+        weights = []
+        num_deformers = len(model.deformers)
+        offset = 0
+        for n in xrange(num_deformers):
+            weights.append([0.0] * model.segments.num_vertices())
+        for seg in model.segments:
+            for vind, vert in enumerate(seg.vertices):
+                for weight, deformer_ind in zip(vert.weights, vert.deformer_indices):
+                    if weight > 0.0:
+                        weights[deformer_ind][vind + offset] = weight * 100
+            offset += len(seg.vertices)
+        logging.debug('Created weights for {0} points.'.format(len(weights[0])))
+        return weights
+
+
+class Import(softimage.SIGeneral):
+
+    def __init__(self, app, config=None):
+        self.msh = None
+        self.xsi = app
+        self.config = config
+        self.notifications = None
+        self.stats = None
+        self.pb = softimage.SIProgressBar()
+        logpath = os.path.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'import_log.log')
+        logging.basicConfig(format='%(levelname)s (%(lineno)d, %(funcName)s): %(message)s',
+                            filename=logpath,
+                            filemode='w',
+                            level=logging.DEBUG)
+
+    def notify(self, text):
+        if self.notifications:
+            self.notifications.append(str(text))
+        else:
+            self.notifications = [str(text)]
+
+    def join_notifs(self):
+        if self.notifications:
+            return '\n'.join(self.notifications)
+        else:
+            return ''
+
+    def check_filepath(self):
+        path = self.config.get('path')
+        if os.path.isfile(path):
+            return True
+
+    def import_msg(self):
+        if self.config.get('show_finished_dialog'):
+            self.msg('Imported {0} models in {1}s, {2}ms.\n\n{3}'.format(len(self.chain), self.stats[0], self.stats[1], self.join_notifs()))
+
+    def abort(self, text=None):
+        if text:
+            self.msg('Import aborted:\n{0}.'.format(text))
+            sys.exit()
+        self.msg('Import aborted.')
+        sys.exit()
+
+    def abort_checklog(self):
+        path = self.xsi.InstallationPath(const.siUserAddonPath)
+        path = os.path.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'import_log.log')
+        if os.path.isfile(path):
+            if self.msg('Encountered an error. Check {0} for more info.\nOpen log now?'.format(path), const.siMsgYesNo) == 6:
+                os.startfile(path)
+        else:
+            self.msg('Encountered an error but cannot find log file.')
+        sys.exit()
+
+    def store_flags(self):
+        zetcore.save_settings('import', self.config)
+
+    def import_(self):
+        '''Prepares the import.'''
+        self.store_flags()
+        self.pb.set(1, 'Preparing...')
+        self.pb.show()
+        if not self.check_filepath():
+            self.abort('File {0} does not exist..'.format(self.config.get('path')))
+        self.pb.inc()
+        self.do_import()
+        self.import_msg()
+        self.pb.hide()
+        return
+
+    def do_import(self):
+        '''Actual import function.'''
+        # Disable logging temporarily.
+        logging.info('==========================================')
+        logging.info('Starting import at {0}.'.format(dt.now()))
+        logging.info('.msh file path: {0}'.format(self.config.get('path')))
+        prefs = self.xsi.Preferences
+        originalcmd = prefs.GetPreferenceValue('scripting.cmdlog')
+        originalins = prefs.GetPreferenceValue('Interaction.autoinspect')
+        prefs.SetPreferenceValue('scripting.cmdlog', False)
+        prefs.SetPreferenceValue('Interaction.autoinspect', False)
+        # Cut path for better display.
+        short_path = self.config.get('path').split('\\')
+        short_path = short_path[-3], short_path[-2], short_path[-2], short_path[-1]
+        short_path_fin = '...{0}'.format('\\'.join(short_path))
+        self.pb.set(1, 'Unpacking {0}...'.format(short_path_fin))
+        start = dt.now()
+        unpacker_config = {'do_logging': self.config.get('log'),
+                           'ignore_geo': self.config.get('ignoregeo'),
+                           'triangulate': self.config.get('triangulate'),
+                           'modulepath': os.path.join(self.xsi.InstallationPath(const.siUserAddonPath), 'XSIZETools\\Application\\Modules')}
+        unpacker = msh2_unpack.MSHUnpack(self.config.get('path'), unpacker_config)
+        try:
+            logging.info('Starting unpack.')
+
+            with zetcore.Timer('Finished unpack in %s s %s ms.'):
+                self.msh = unpacker.unpack()
+        except (CRCError, msh2_unpack.UnpackError):
+            logging.exception('')
+            self.abort_checklog()
+        self.pb.inc()
+        if self.config.get('applyonly'):
+            logging.info('Applyonly set, setting chain from selection.')
+            if not self.xsi.Selection(0):
+                self.abort('Aborted. No selection. Select the root of the hierarchy.')
+            self.chain = self.get_all_children(self.xsi.Selection(0))
+            logging.info('Selection item count: {0}, msh2 Model count: {1}.'.format(len(self.chain),
+                                                                                    len(self.msh.models)))
+        else:
+            with zetcore.Timer('Built chain in %s s %s ms.'):
+                if not self.config.get('ignoregeo'):
+                    logging.info('Ignore Geo is unchecked, building with geo.')
+                    matbuilder = MaterialBuilder(self, self.msh)
+                    materials = matbuilder.build()
+                    builder = ChainBuilder(self, self.msh, materials)
+                else:
+                    builder = ChainBuilder(self, self.msh)
+                try:
+                    self.chain = builder.build()
+                except MshImportError:
+                    logging.exception('')
+                    self.abort_checklog()
+
+            with zetcore.Timer('Enveloped in %s s %s ms.'):
+                enveloper = Enveloper(self, self.msh, self.chain)
+                enveloper.envelope()
+
+            if self.config.get('weld') and not self.config.get('ignoregeo'):
+                for item in self.chain:
+                    if not item.Type == 'polymsh':
+                        continue
+                    self.xsi.ApplyTopoOp('WeldEdges', item)
+                    self.xsi.SetValue('{0}.polymsh.weldedgesop.distance'.format(item.Name), 0.02)
+        if not self.msh.animation.empty and not self.config.get('ignoreanim'):
+            with zetcore.Timer('Animated in %s s %s ms.'):
+                anim = AnimationImport(self, self.chain, self.msh.animation.bones)
+                anim.import_()
+        if self.config.get('framerange'):
+            scn = softimage.SIScene()
+            pc = scn.get_playcontrol()
+            pc.Parameters('In').Value = self.msh.info.frame_range[0]
+            pc.Parameters('Out').Value = self.msh.info.frame_range[1]
+        end = dt.now()
+        res = end - start
+        self.stats = res.seconds, res.microseconds
+        logging.info('Imported in %ss %sms.', res.seconds, res.microseconds)
+        # Enable logging.
+        prefs.SetPreferenceValue('scripting.cmdlog', originalcmd)
+        prefs.SetPreferenceValue('Interaction.autoinspect', originalins)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Logic/cloth.py b/src_research_readme/zero-edit-tool-python-base/Application/Logic/cloth.py
new file mode 100644
index 0000000..c8a72a5
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Logic/cloth.py
@@ -0,0 +1,100 @@
+'''
+    UI functionality for the cloth dialog.
+'''
+xsi = Application
+from win32com.client import constants as const
+import win32com.client
+import softimage
+sigen = softimage.SIGeneral()
+ADDONPATH = xsi.InstallationPath(const.siUserAddonPath)
+
+
+def del_prop_OnClicked():
+    ppg = PPG.Inspected(0)
+    remove_fixed(PPG.Inspected(0))
+    xsi.DeleteObj(ppg)
+    PPG.Close()
+
+
+def pick_fixed_OnClicked():
+    ppg = PPG.Inspected(0)
+    xsi.SelectObj(ppg.Parent)
+    xsi.SetPointSelectionFilter()
+    picked = xsi.PickElement('point', 'Pick Points', 'Pick Points')
+    remove_fixed(PPG.Inspected(0))
+    xsi.CreateClusterFromSubComponent(picked[2], 'ZEFixedPoints')
+
+
+def remove_fixed_OnClicked():
+    remove_fixed(PPG.Inspected(0))
+
+
+def add_fixed_OnClicked():
+    xsi.SetPointSelectionFilter()
+    picked = xsi.PickElement('point', 'Pick Points', 'Pick Points')
+    fixed = get_fixed_cluster(PPG.Inspected(0).Parent)
+    if fixed:
+        xsi.SIAddToCluster(fixed, picked[2])
+        return
+    xsi.CreateClusterFromSubComponent(picked[2], 'ZEFixedPoints')
+
+
+def pick_coll_OnClicked():
+    picked = xsi.PickElement('object', 'Pick Collision Object(s)', 'Pick Collision Object(s)')
+    ppg = PPG.Inspected(0)
+    ppg.Parameters('collisions').Value = ','.join(element.FullName for element in picked[2])
+
+
+def remove_coll_OnClicked():
+    ppg = PPG.Inspected(0)
+    ppg.Parameters('collisions').Value = ''
+
+
+def add_coll_OnClicked():
+    ppg = PPG.Inspected(0)
+    ppg.Parameters('collisions').Value = ','.join(element.FullName for element in xsi.Selection)
+
+
+def select_coll_OnClicked():
+    ppg = PPG.Inspected(0)
+    if ppg.Parameters('collisions').Value:
+        collisions = ppg.Parameters('collisions').Value.split(',')
+        xsi.SelectObj(collisions)
+
+####################################################################
+
+
+def remove_fixed(ppg):
+    if not ppg.Parent.ActivePrimitive.GetGeometry2(0):
+        return
+
+    fixed = get_fixed_cluster(ppg.Parent)
+    if fixed:
+        xsi.DeleteObj(fixed)
+
+
+def find_model(objName):
+    xsifact = win32com.client.Dispatch("XSI.Factory")
+    oColl = xsifact.CreateObject("XSI.Collection")
+    oColl.items = objName
+    if oColl.Count > 0:
+        return oColl(0)
+    else:
+        return False
+
+
+def get_fixed_cluster(model):
+    geo = model.ActivePrimitive.GetGeometry2(0)
+    for cls in geo.Clusters:
+        if 'ZEFixed' in cls.Name:
+            return cls
+
+
+def get_cloth_prop(model):
+    try:
+        if model:
+            for prop in model.Properties:
+                if 'ZECLoth' in prop.Name:
+                    return prop
+    except:
+        return False
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Logic/exporter.py b/src_research_readme/zero-edit-tool-python-base/Application/Logic/exporter.py
new file mode 100644
index 0000000..679f93d
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Logic/exporter.py
@@ -0,0 +1,122 @@
+'''
+    UI functionality for the export dialog.
+'''
+from win32com.client import constants as const
+import win32com.client
+import softimage
+import zetcore
+import zetexport
+reload(zetcore)
+reload(softimage)
+reload(zetexport)
+xsi = Application
+addonpath = xsi.InstallationPath(const.siUserAddonPath)
+sigen = softimage.SIGeneral()
+
+
+def store_flags_OnClicked():
+    settings = zetcore.load_settings('export', PPG.Inspected(0))
+    zetcore.save_settings('export', settings)
+    sigen.msg('Stored.')
+    return
+
+
+def exportbutton_OnClicked():
+    settings = zetcore.load_settings('export', PPG.Inspected(0))
+    export = zetexport.Export(xsi, settings)
+    try:
+        export.export()
+    except SystemExit:
+        return
+    except Exception as e:
+        if sigen.msg('Encountered an error while exporting, copy error to clipboard?', const.siMsgYesNo) == 6:
+            import win32clipboard, traceback
+            log_path = zetcore.get_export_log_path()
+            lines = []
+            if log_path:
+                with open(log_path, 'r') as file_handle:
+                    lines = file_handle.readlines()[-15:]
+            message = ['Last 15 log lines:', '\n']
+            message.extend(['\t{0}'.format(line.strip('\n')) for line in lines])
+            message.extend(('\n', 'Traceback:', '\n'))
+            message.extend(['\t{0}'.format(element) for element in traceback.format_exc().split('\n')])
+            message = '\n'.join(message)
+
+            win32clipboard.OpenClipboard()
+            win32clipboard.EmptyClipboard()
+            win32clipboard.SetClipboardText(message, win32clipboard.CF_TEXT)
+            win32clipboard.CloseClipboard()
+        else:
+            raise
+    return
+
+
+def check_sel_OnClicked():
+    mdls = sigen.get_all_children(xsi.Selection(0))
+    if not mdls:
+        sigen.msg('No models selected.')
+        return
+    checksel = zetcore.CheckSel(xsi, mdls, xsi.ActiveSceneRoot, softimage.SIProgressBar())
+    checksel.check()
+    checksel.build_UI()
+
+
+def help_OnClicked():
+    ps = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'Export Help')
+    lay = ps.PPGLayout
+    lay.Language = "pythonscript"
+    agr = lay.AddGroup
+    egr = lay.EndGroup
+    text = lay.AddStaticText
+    agr('Auto-Overwrite', 1)
+    text('Overwrites output files if they already exist.')
+    egr()
+    agr('Root model name for .msh filename')
+    text('''Usees the name of the hierarchy root as filename.
+Has to be enabled when using Batch Export.''')
+    egr()
+    agr('Batch Export', 1)
+    text('''Loops through all direct children of the current
+selection and exports each one with all its children. Root
+model name for .msh filename has to be enabled for this.''')
+    egr()
+    agr('Animation')
+    text('''Exports animation from the current frame range.
+Current frame as Basepose only exports the selected frame
+and the following to minimize file size. Export Animation
+has to be enabled.''')
+    egr()
+    agr('Buttons')
+    text('''Check Sel iterates through the current hierarchy and analyses
+every model for problems which could break the export and smaller
+problems like unnecessary clusters.
+Store Flags stores the current config(path, checked boxes etc).
+Export should be self-explanatory.''')
+    egr()
+    xsi.InspectObj(ps, '', 'Export Help', 4, False)
+    for prop in xsi.ActiveSceneRoot.Properties:
+        if prop.Name == 'Export_Help':
+            xsi.DeleteObj('Export_Help')
+
+
+def basepose_OnChanged():
+    ppg = PPG.Inspected(0)
+    if ppg.Parameters('basepose').Value:
+        ppg.Parameters('anim').Value = True
+
+
+def anim_OnChanged():
+    ppg = PPG.Inspected(0)
+    if not ppg.Parameters('anim').Value:
+        ppg.Parameters('basepose').Value = False
+
+
+def batch_OnChanged():
+    ppg = PPG.Inspected(0)
+    if ppg.Parameters('batch').Value:
+        ppg.Parameters('rootname').Value = True
+
+
+def EClose_OnClicked():
+    PPG.Close()
+    xsi.DeleteObj('MSHExport')
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Logic/importer.py b/src_research_readme/zero-edit-tool-python-base/Application/Logic/importer.py
new file mode 100644
index 0000000..720d37a
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Logic/importer.py
@@ -0,0 +1,115 @@
+'''
+    UI functionality for the import dialog.
+'''
+import softimage
+import zetcore
+import zetimport
+reload(softimage)
+reload(zetcore)
+reload(zetimport)
+from win32com.client import constants as const
+xsi = Application
+ADDONPATH = xsi.InstallationPath(const.siUserAddonPath)
+sigen = softimage.SIGeneral()
+
+
+def store_flags_OnClicked():
+    settings = zetcore.load_settings('import', PPG.Inspected(0))
+    zetcore.save_settings('import', settings)
+    sigen.msg('Stored.')
+    return
+
+
+def btexpath_OnChanged():
+    ppg = PPG.Inspected(0)
+    checked = ppg.Parameters('btexpath').Value
+    texpath = ppg.Parameters('texpath')
+    texpath.SetCapabilityFlag(2, not checked)
+
+
+def help_OnClicked():
+    ps = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'ImportHelp')
+    lay = ps.PPGLayout
+    lay.Language = "pythonscript"
+    agr = lay.AddGroup
+    egr = lay.EndGroup
+    text = lay.AddStaticText
+    agr('Import')
+    text('Imports null-chain and animations from an animation .msh.')
+    egr()
+    agr('Texture Folder')
+    text('''Sets the texture paths to that folder. If the box is unchecked the paths
+will be set to the path of the .msh file.''')
+    egr()
+    agr('Set Frame Range')
+    text('''Automatically sets the frame range from the animated frames in the
+.msh file.''')
+    egr()
+    agr('Apply animation')
+    text('''Only applies the unpacked animation to the selected hierarchy. Doesn't
+import geometry/models or materials.''')
+    egr()
+    agr('Null Display Size')
+    text('''Sets the display size of Nulls. Improves cleanness of the null
+chain after import.''')
+    egr()
+    agr('Ignore Geometry')
+    text('''Ignore geometry on import.''')
+    egr()
+    agr('Ignore Geometry')
+    text('''Ignore animation on import.''')
+    egr()
+    agr('Color Nulls')
+    text('''Colors nulls according to type(bone, root, eff).''')
+    egr()
+    agr('Hide Effs/Roots')
+    text('''Hides nulls of the specified type on import.
+Type is defined from certain strings appearing in the name:
+bone_l_leg is a bone, even if it's no animated/weighted to.''')
+    egr()
+    agr('Weld Boundary Edges')
+    text('''Applies a Weld Op to all geo models with a value of 0.01. The Operator
+will persist after the import.''')
+    egr()
+    xsi.InspectObj(ps, '', 'ImportHelp', 4, False)
+    for prop in xsi.ActiveSceneRoot.Properties:
+        if prop.Name == 'ImportHelp':
+            xsi.DeleteObj('ImportHelp')
+
+
+def importbutton_OnClicked():
+    settings = zetcore.load_settings('import', PPG.Inspected(0))
+    import_ = zetimport.Import(xsi, settings)
+    try:
+        import_.import_()
+    except SystemExit:
+        return
+    except Exception as e:
+        if sigen.msg('Encountered an error while importing, copy error to clipboard?', const.siMsgYesNo) == 6:
+            import win32clipboard, traceback
+            log_path = zetcore.get_import_log_path()
+            lines = []
+            if log_path:
+                with open(log_path, 'r') as file_handle:
+                    lines = file_handle.readlines()[-15:]
+            message = ['Last 15 log lines:', '\n']
+            message.extend(['\t{0}'.format(line.strip('\n')) for line in lines])
+            message.extend(('\n', 'Traceback:', '\n'))
+            message.extend(['\t{0}'.format(element) for element in traceback.format_exc().split('\n')])
+            message = '\n'.join(message)
+
+            win32clipboard.OpenClipboard()
+            win32clipboard.EmptyClipboard()
+            try:
+                win32clipboard.SetClipboardText(message, win32clipboard.CF_TEXT)
+            except TypeError:
+                win32clipboard.SetClipboardText(message)
+            win32clipboard.CloseClipboard()
+        else:
+            raise
+    return
+
+
+def EClose_OnClicked():
+    PPG.Close()
+    xsi.DeleteObj('MSHImport')
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Logic/material_manager.py b/src_research_readme/zero-edit-tool-python-base/Application/Logic/material_manager.py
new file mode 100644
index 0000000..b9349a5
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Logic/material_manager.py
@@ -0,0 +1,256 @@
+'''
+    UI functionality for the material manager.
+'''
+from win32com.client import constants as const
+import win32com.client
+xsi = Application
+addonpath = xsi.InstallationPath(const.siUserAddonPath)
+PROJECTPATH = xsi.InstallationPath(const.siProjectPath)
+
+
+def close_mat_OnClicked():
+    PPG.Close()
+    xsi.DeleteObj('MaterialEdit')
+
+
+def help_mat_OnClicked():
+    ps = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'MatManagerHelp')
+    lay = ps.PPGLayout
+    lay.Language = 'pythonscript'
+    agr = lay.AddGroup
+    egr = lay.EndGroup
+    text = lay.AddStaticText
+    agr('Create', 1)
+    text('''Create a phong material(the only supported material type)
+with the specified name(line edit to the left of this button.''')
+    egr()
+    agr('Edit', 1)
+    text('''Inspect the first selected material ZE flags and options can be
+found here, too.''')
+    egr()
+    agr('ZEify / De-ZEify', 1)
+    text('''Adds/Removes Zero Engine flags and material settings to the
+selected material(s).''')
+    egr()
+    agr('Remove', 1)
+    text('''Removes the selected material(s).''')
+    egr()
+    agr('Assign Tex', 1)
+    text('''A shortcut to assign a texture to the diffuse slot of
+the selected material. This will launch a file browser.''')
+    egr()
+    agr('Assign / Unassign', 1)
+    text('''Assigns/unassigns the first selected material to the
+currently selected models.''')
+    egr()
+    xsi.InspectObj(ps, '', 'MatManagerHelp', 4, False)
+    for prop in xsi.ActiveSceneRoot.Properties:
+        if prop.Name == 'MatManagerHelp':
+            xsi.DeleteObj('MatManagerHelp')
+
+
+def del_mat_OnClicked():
+    materials = get_scene_materials()
+    ppg = PPG.Inspected(0)
+    sel = ppg.Parameters('materials').Value
+    split = sel.split(';')
+    lay = ppg.PPGLayout
+    listbox = lay.Item('materials')
+    items = listbox.UIItems
+    items2 = list(items[:])
+    for matname in split:
+        for mat in materials:
+            if mat.Name == matname:
+                xsi.DeleteObj(mat)
+                break
+    refresh()
+    PPG.Refresh()
+
+
+def create_mat_OnClicked():
+    ppg = PPG.Inspected(0)
+    name = ppg.Parameters('mat_name').Value
+    args = '$XSI_DSPRESETS\\Shaders\\Material\\Phong', name, '', '', False, ''
+    xsi.SICreateMaterial(*args)
+    refresh()
+
+
+def edit_mat_OnClicked():
+    materials = get_scene_materials()
+    ppg = PPG.Inspected(0)
+    sel = ppg.Parameters('materials').Value
+    split = sel.split(';')
+    for mat in materials:
+        if mat.Name == split[0]:
+            xsi.InspectObj(mat)
+
+
+def add_flags_OnClicked():
+    materials = get_scene_materials()
+    ppg = PPG.Inspected(0)
+    sel = ppg.Parameters('materials').Value
+    split = sel.split(';')
+    for matname in split:
+        for mat in materials:
+            if mat.Name == matname:
+                if not get_msh_material_property(mat):
+                    add_msh_material_flags(mat)
+                    break
+    refresh()
+
+
+def del_flags_OnClicked():
+    materials = get_scene_materials()
+    ppg = PPG.Inspected(0)
+    sel = ppg.Parameters('materials').Value
+    split = sel.split(';')
+    for matname in split:
+        for mat in materials:
+            if mat.Name == matname:
+                prop = get_msh_material_property(mat)
+                if prop:
+                    xsi.DeleteObj(prop)
+                break
+    refresh()
+
+
+def unassign_mat_OnClicked():
+    if xsi.Selection.Count == 0:
+        msg_box('No objects selected.')
+        return
+    xsi.SIUnAssignMaterial(xsi.Selection)
+
+
+def assign_mat_OnClicked():
+    materials = get_scene_materials()
+    ppg = PPG.Inspected(0)
+    sel = ppg.Parameters('materials').Value
+    split = sel.split(';')
+    mat2assign = None
+    for mat in materials:
+        if mat.Name == split[0]:
+            mat2assign = mat
+            break
+    if xsi.Selection.Count == 0:
+        msg_box('No objects selected.')
+        return
+    for item in xsi.Selection:
+        if item.Type == 'polySubComponent':
+            cls = item.SubComponent.CreateCluster('matpolycls')
+            xsi.SIAssignMaterial(cls, mat2assign)
+        elif item.Type == 'poly':
+            xsi.SIAssignMaterial(item, mat2assign)
+        elif item.Type == 'polymsh':
+            xsi.SIAssignMaterial(item, mat2assign)
+    refresh()
+
+
+def assign_tex_OnClicked():
+    materials = get_scene_materials()
+    ppg = PPG.Inspected(0)
+    sel = ppg.Parameters('materials').Value
+    split = sel.split(';')
+    mats = []
+    for matname in split:
+        for mat in materials:
+            if mat.Name == matname:
+                mats.append(mat)
+                break
+    xsiui = win32com.client.Dispatch('XSI.UIToolkit')
+    fb = xsiui.FileBrowser
+    fb.DialogTitle = 'Select a .tga file'
+    fb.InitialDirectory = PROJECTPATH
+    fb.Filter = 'TARGA (*.tga)|*.tga||'
+    fb.ShowOpen()
+    img_filepath = fb.FilePathName
+    if img_filepath:
+        for mat in mats:
+            shader = xsi.CreateShaderFromPreset('$XSI_DSPRESETS\\Shaders\\Texture\\Image.Preset', mat)
+            img_clip = xsi.SICreateImageClip2(img_filepath)
+            xsi.SIConnectShaderToCnxPoint(img_clip, shader.tex, False)
+            xsi.SIConnectShaderToCnxPoint(shader, mat.Shaders(0).Parameters('diffuse'), False)
+##############################################################################
+######################   HELPER FUNCTIONS   ##################################
+
+
+def refresh():
+    mats = get_scene_materials('variants')
+    PPG.Inspected(0).PPGLayout.Item('materials').UIItems = mats
+    PPG.Refresh()
+
+
+def msg_box(message):
+    XSIUIToolkit.MsgBox(message, 0, 'XSIZETools')
+    return True
+
+
+def get_msh_material_property(material):
+    for prop in material.Properties:
+        if 'ZeroEngine_Flags' in prop.Name:
+            return prop
+
+
+def add_msh_material_flags(mat):
+    pset = mat.AddProperty('CustomProperty', False, 'ZeroEngine Flags')
+    pset.AddParameter3('tex1', const.siString)
+    pset.AddParameter3('tex2', const.siString)
+    pset.AddParameter3('tex3', const.siString)
+
+    pset.AddParameter3('emissive', const.siBool, 0, '', '', 0)
+    pset.AddParameter3('glow', const.siBool, 0, '', '', 0)
+    pset.AddParameter3('transparency', const.siInt4, 0, 0, 2, 0)
+    pset.AddParameter3('hardedged', const.siBool, 0, '', '', 0)
+    pset.AddParameter3('perpixel', const.siBool, 0, '', '', 0)
+    pset.AddParameter3('additive', const.siBool, 0, '', '', 0)
+    pset.AddParameter3('specular', const.siBool, 0, '', '', 0)
+    pset.AddParameter3('rendertype', const.siInt4, 0, 0, 31, 0)
+    pset.AddParameter3('data0', const.siInt4, 0, 0, 255, 0)
+    pset.AddParameter3('data1', const.siInt4, 0, 0, 255, 0)
+
+    lay = pset.PPGLayout
+
+    lay.AddGroup('ZeroEngine Material Flags', 1)
+    lay.AddGroup('Additional Textures', 1)
+    lay.AddItem('tex1', 'Texture 1')
+    lay.AddItem('tex2', 'Texture 2')
+    lay.AddItem('tex3', 'Texture 3')
+    lay.EndGroup()
+    lay.AddGroup('Flags', 1)
+    lay.AddItem('emissive', 'Emissive')
+    lay.AddItem('glow', 'Glow')
+    lay.AddItem('transparency', 'Transparency')
+    lay.AddItem('hardedged', 'Hardedged Transparency')
+    lay.AddItem('perpixel', 'Per-Pixel Lighting')
+    lay.AddItem('additive', 'Additive Transparency')
+    lay.AddItem('specular', 'Specular')
+    lay.AddItem('rendertype', 'RenderType')
+    lay.AddItem('data0', 'Data0')
+    lay.AddItem('data1', 'Data1')
+    lay.EndGroup()
+    lay.EndGroup()
+
+
+def get_scene_materials(listtype='list'):
+    mats = []
+    matlibs = xsi.ActiveProject.ActiveScene.MaterialLibraries
+    for lib in matlibs:
+        for mat in lib.Items:
+            mats.append(mat)
+    if listtype == 'variants':
+        newmats = []
+        for index, mat in enumerate(mats):
+            name = [mat.Name]
+            prop = get_msh_material_property(mat)
+            usedby = mat.UsedBy
+            if usedby.Count > 0:
+                if prop:
+                    name.append(' - ZE | {0}'.format(usedby.Count))
+                else:
+                    name.append(' - {0}'.format(usedby.Count))
+            else:
+                if prop:
+                    name.append(' - ZE')
+            newmats.append(''.join(name))
+            newmats.append(mat.Name)
+        return newmats
+    return mats
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Logic/misc.py b/src_research_readme/zero-edit-tool-python-base/Application/Logic/misc.py
new file mode 100644
index 0000000..83c6671
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Logic/misc.py
@@ -0,0 +1,31 @@
+'''
+    UI functionality for several misc dialogs.
+'''
+from win32com.client import constants as const
+import webbrowser
+xsi = Application
+
+
+def close_csr_OnClicked():
+    PPG.Close()
+    xsi.DeleteObj('CSR')
+
+
+def ERClose_OnClicked():
+    PPG.Close()
+    xsi.DeleteObj('ExportReport')
+
+
+def launch_gt_OnClicked():
+    url = 'http://gametoast.com/viewtopic.php?f=36&t=26664'
+    webbrowser.open_new_tab(url)
+
+
+def launch_website_OnClicked():
+    url = 'http://schlechtwetterfront.github.io/xsizetools/'
+    webbrowser.open_new_tab(url)
+
+
+def Close_OnClicked():
+    PPG.Close()
+    xsi.DeleteObj('ZETH')
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Logic/mshjson.py b/src_research_readme/zero-edit-tool-python-base/Application/Logic/mshjson.py
new file mode 100644
index 0000000..c53427b
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Logic/mshjson.py
@@ -0,0 +1,46 @@
+'''
+    UI functionality for the msh2text dialog.
+'''
+xsi = Application
+import msh2
+reload(msh2)
+import msh2_unpack
+reload(msh2_unpack)
+import os
+
+TXTPATH = 'C:\\SWBF2_ModTools\\data_TST\\Worlds\\TST\\msh\\test\\abc.txt'
+MSHPATH = 'C:\\SWBF2_ModTools\\data_TST\\Worlds\\TST\\msh\\nab2_prop_fountain.msh'
+USE_HARD_PATHS = False
+
+
+def get_paths():
+    params = PPG.Inspected(0).Parameters
+    if USE_HARD_PATHS or params('dev').Value:
+        return MSHPATH, TXTPATH
+    return params('mshpath').Value, params('txtpath').Value
+
+
+def msh2txt_OnClicked():
+    mshpath, txtpath = get_paths()
+    if not mshpath or not txtpath:
+        return
+    unpacker = msh2_unpack.MSHUnpack(mshpath)
+    msh = unpacker.unpack()
+    if PPG.Inspected(0).Parameters('segmented').Value is True:
+        msh.save_segmented_json(os.path.dirname(txtpath), os.path.basename(txtpath.split('.')[0]))
+    else:
+        msh.save_json(txtpath)
+
+
+def txt2msh_OnClicked():
+    mshpath, txtpath = get_paths()
+    if not mshpath or not txtpath:
+        return
+    if PPG.Inspected(0).Parameters('segmented').Value is True:
+        msh = msh2.Msh.load_segmented_json(os.path.dirname(txtpath), os.path.basename(txtpath.split('.')[0]))
+    else:
+        msh = msh2.Msh.load_json(txtpath)
+    if PPG.Inspected(0).Parameters('dev').Value:
+        msh.save(mshpath + '.msh')
+    else:
+        msh.save(mshpath)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Logic/zetools.py b/src_research_readme/zero-edit-tool-python-base/Application/Logic/zetools.py
new file mode 100644
index 0000000..46e5db9
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Logic/zetools.py
@@ -0,0 +1,43 @@
+'''
+    Scripts UI functionality.
+'''
+from win32com.client import constants as const
+import softimage
+reload(softimage)
+xsi = Application
+addonpath = xsi.InstallationPath(const.siUserAddonPath)
+
+
+def makeaddon_OnClicked():
+    oPPG = PPG.Inspected(0)
+    addon_bone = oPPG.Parameters("addon_bone").Value
+    print addon_bone, type(addon_bone)
+    # Make sure the item is valid.
+    # If no bones were found the item will be set to '1'.
+    if addon_bone == '1':
+        return
+    addon_root_name = oPPG.Parameters("addon_root_name").Value
+    xsi.GetPrim("Null", addon_root_name)
+    xsi.MatchTransform(addon_root_name, addon_bone)
+
+
+def setmesh_OnClicked():
+    sel = xsi.Selection
+    if sel.Count > 0:
+        params = PPG.Inspected(0).Parameters
+        root_name = params("addon_root_name").Value
+        is_shadowvolume = params("addon_is_shadowvolume").Value
+        if softimage.Softimage.get_object(root_name):
+            if is_shadowvolume is True:
+                xsi.CopyPaste(sel[0], '', root_name)
+                selected_name = sel[0].Name
+                sel[0].Name = "sv_" + selected_name
+            elif is_shadowvolume is False:
+                for item in sel:
+                    xsi.CopyPaste(item, '', root_name)
+
+
+def groupbones_OnClicked():
+    bones = softimage.Softimage.get_objects('bone*')
+    if bones:
+        xsi.CreateGroup('Bones', bones)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/andecore.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/andecore.py
new file mode 100644
index 0000000..e5f2309
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/andecore.py
@@ -0,0 +1,9 @@
+'''
+    Misc utilities.
+'''
+
+
+def chunks(list_, n):
+    '''Yield n-sized chunks from list_.'''
+    for i in xrange(0, len(list_), n):
+        yield list_[i:i + n]
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2.py
new file mode 100644
index 0000000..f78284d
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2.py
@@ -0,0 +1,2767 @@
+# -*- coding: utf-8 -*-
+'''
+    ZeroEngine .msh model format.
+
+    Refer to
+       schlechtwetterfront.github.io/ze_filetypes/msh.html
+   for more information regarding the file format.
+'''
+import msh2_crc
+reload(msh2_crc)
+import itertools
+import struct
+import math
+import logging
+import json
+import os
+
+
+MODEL_TYPES = {'null': 0,
+               'geodynamic': 1,
+               'cloth': 2,
+               'bone': 3,
+               'geobone': 3,
+               'geostatic': 4,
+               'geoshadow': 6}
+
+MODEL_TYPES_INT = ['null',
+                   'geodynamic',
+                   'cloth',
+                   'bone',
+                   'geostatic',
+                   '',
+                   'geoshadow']
+
+
+class MSH2Error(Exception):
+    def __init__(self, value):
+        self.parameter = value
+
+    def __str__(self):
+        return repr(self.parameter)
+
+
+class Packer(object):
+    def pad_string(self, string):
+        '''Pads the given string with \x00s to fill a multiple of 4 length.'''
+        if string == '':
+            return ''
+        i = 0
+        while len(string) >= i:
+            i += 4
+        return string.ljust(i, '\x00')
+
+    def null_terminate(self, string):
+        '''Null-terminates the given string.'''
+        return string + '\x00'
+
+    def pack_long_chunk(self, header, number):
+        '''Chunk with only one long int.'''
+        data = [header]
+        data.append(struct.pack('<L', 4))
+        data.append(struct.pack('<L', number))
+        return ''.join(data)
+
+    def pack_string_chunk(self, header, string):
+        '''String Chunk(NAME, TX0D...) packer.'''
+        data = [header]
+        comp_str = self.pad_string(string.encode('ascii'))
+        data.append(struct.pack('<L', len(comp_str)))
+        data.append(comp_str)
+        return ''.join(data)
+
+    def sum_seq(self, seq, start=0, end=None):
+        '''Sums the sequence items from start to end.
+        If end is None it will sum all items from start.'''
+        if end:
+            tosum = seq[start:end]
+        else:
+            tosum = seq[start:]
+        tosum = [len(item) for item in tosum]
+        return sum(tosum)
+
+
+class Msh(Packer):
+    # is_shadowvolume bool
+    # info Info
+    # materials Material[]
+    # models Model[]
+    # animation Animation
+    def __init__(self):
+        self.info = None
+        self.has_shadowvolume = False
+        self.models = []
+        self.materials = []
+        self.animation = None
+        self.classname = 'Msh'
+        self.modulepath = ''
+
+    def dump(self, filepath):
+        '''Dumps .msh file information into a text file.'''
+        with open(filepath, 'w') as fh:
+            self.info.dump(fh)
+            self.materials.dump(fh)
+            self.models.dump(fh)
+        return True
+
+    def save(self, filepath):
+        with open(filepath, 'wb') as fh:
+            fh.write(self.pack())
+
+    def save_json(self, filepath):
+        '''Saves the .msh in JSON format.'''
+        data = {
+            'info': self.info.get_json(),
+            'models': self.models.get_json(),
+            'materials': self.materials.get_json(),
+            'has_shadowvolume': self.has_shadowvolume,
+            'animation': None,
+        }
+        with open(filepath, 'wb') as fh:
+            fh.write(json.dumps(data, indent=4, separators=(',', ': ')))
+        return True
+
+    def save_segmented_json(self, folder, name=None):
+        # If no name argument was passed assume that a full path was passed.
+        if not name:
+            folder, name = os.path.dirname(folder), os.path.basename(folder)
+            name = name.split('.')[0]
+        if not os.path.isdir(folder):
+            os.mkdir(folder)
+        with open(os.path.join(folder, name + '.txt'), 'w') as fh:
+            fh.write(json.dumps({'has_shadowvolume': self.has_shadowvolume}))
+        with open(os.path.join(folder, name + ' nfo.txt'), 'w') as fh:
+            fh.write(json.dumps(self.info.get_json(), indent=4, separators=(',', ': ')))
+        for model in self.models:
+            model.save_segmented_json(folder, name)
+        for material in self.materials:
+            with open(os.path.join(folder, '{0} mtl {1}.txt'.format(name, material.name)), 'wb') as fh:
+                fh.write(json.dumps(material.get_json(), indent=4, separators=(',', ': ')))
+
+    @classmethod
+    def load_segmented_json(cls, folder, name):
+        model_start = '{0} mdl '.format(name)
+        material_start = '{0} mtl '.format(name)
+        msh = cls()
+        info_data = ''
+        with open(os.path.join(folder, '{0}.txt'.format(name)), 'r') as fh:
+            msh.has_shadowvolume = json.loads(fh.read())['has_shadowvolume']
+        with open(os.path.join(folder, '{0} nfo.txt'.format(name)), 'r') as fh:
+            info_data = json.loads(fh.read())
+        msh.info = SceneInfo.from_json(info_data)
+        materials = MaterialCollection(msh)
+        models = ModelCollection(msh)
+        for filename in os.listdir(folder):
+            if filename.startswith(model_start) and (not ' seg ' in filename):
+                models.add(Model.load_segmented_json(folder, filename.split('.')[0]))
+            elif filename.startswith(material_start):
+                with open(os.path.join(folder, filename), 'r') as fh:
+                    materials.add(Material.from_json(json.loads(fh.read())))
+        msh.models = models
+        # Re-order models so that parents appear before their children.
+        models_map = {}
+        models = []
+        for model in msh.models:
+            if model.parent_name:
+                if not models_map.get(model.parent_name, None):
+                    models_map[model.parent_name] = [model]
+                else:
+                    models_map[model.parent_name].append(model)
+            else:
+                models.append(model)
+        new_models = []
+        for model in models:
+            new_models.extend(msh.get_children_ordered(model, models_map))
+        msh.models.replace(new_models)
+        msh.materials = materials
+        msh.animation = Animation(None, 'empty')
+        msh.set_indices()
+        return msh
+
+    def get_children_ordered(self, model, children_map):
+        models = []
+        models.append(model)
+        children = children_map.get(model.name, [])
+        for child in children:
+            models.extend(self.get_children_ordered(child, children_map))
+        return models
+
+    @classmethod
+    def load_json(cls, filepath):
+        data = ''
+        with open(filepath, 'rb') as fh:
+            data = fh.read()
+        data = json.loads(data)
+        msh = cls()
+        msh.info = SceneInfo.from_json(data['info'], msh)
+        msh.models = ModelCollection.from_json(data['models'], msh)
+        msh.materials = MaterialCollection.from_json(data['materials'], msh)
+        msh.has_shadowvolume = data['has_shadowvolume']
+        msh.animation = Animation(None, 'empty')
+        msh.set_indices()
+        return msh
+
+    def set_indices(self):
+        '''Set material and model indices (ie after json load).'''
+        for index, material in enumerate(self.materials):
+            material.index = index
+        for index, model in enumerate(self.models):
+            model.index = index
+            for seg in model.segments:
+                seg.material = self.get_mat_by_name(seg.mat_name)
+
+    def get_mat_by_name(self, name):
+        '''Get Material object by name.'''
+        dct = self.materials.get_matname_dict()
+        return dct[name]
+
+    def get_mat_by_index(self, index):
+        '''Get Material object by index into the colection.'''
+        return self.materials[index]
+
+    def pack_CL1L(self):
+        data = ['CL1L']
+        data.append(struct.pack('<L', 0))
+        return ''.join(data)
+
+    def pack(self):
+        '''Packs data to .msh file structure and returns the data as a string.'''
+        data = ['HEDR',
+                'hedr_len']
+        # First pack the MSH2 header with all its children chunks.
+        msh2_data = ['MSH2', 'len']
+        msh2_data.append(self.info.pack())
+        msh2_data.append(self.materials.pack())
+        msh2_data.append(self.models.pack())
+        #msh2_data[1] = struct.pack('<L', len(msh2_data[2]) + len(msh2_data[3]) + len(msh2_data[4]))
+        msh2_data[1] = struct.pack('<L', self.sum_seq(msh2_data, 2))
+        # Finished MSH2.
+        data.append(''.join(msh2_data))
+        # HEDR only has MSH2 and the animation chunks as children(and sometimes SHVO).
+        # We don't pack SHVO here so on to animation chunks.
+        data.append(self.animation.pack())
+        data.append(self.pack_CL1L())
+        # sum length of msh2 data + length of animation chunks.
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+    def repack(self):
+        '''Will use stored binary data of cloth and shadow chunks instead
+        of recalculating it(not possible at the moment).'''
+        data = ['HEDR',
+                'hedr_len']
+        # First pack the MSH2 header with all its children chunks.
+        msh2_data = ['MSH2', 'len']
+        msh2_data.append(self.info.pack())
+        msh2_data.append(self.materials.pack())
+        msh2_data.append(self.models.repack())
+        #msh2_data[1] = struct.pack('<L', len(msh2_data[2]) + len(msh2_data[3]) + len(msh2_data[4]))
+        msh2_data[1] = struct.pack('<L', self.sum_seq(msh2_data, 2))
+        # Finished MSH2.
+        data.append(''.join(msh2_data))
+        # HEDR only has MSH2 and the animation chunks as children(and sometimes SHVO).
+        # We don't pack SHVO here so on to animation chunks.
+        if self.animation:
+            data.append(self.animation.pack())
+        data.append(self.pack_CL1L())
+        # sum length of msh2 data + length of animation chunks.
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+
+class SceneInfo(Packer):
+    def __init__(self, msh=None):
+        # Reference to Msh.
+        if msh:
+            self.msh = msh
+        else:
+            self.msh = None
+        self.name = ''
+        self.classname = 'SceneInfo'
+        self.frame_range = 0, 100
+        self.fps = 29.97
+        self.scale = 1.0, 1.0, 1.0
+        self.bbox = BBox()
+
+    def dump(self, fileh=None):
+        '''Dump information to open filehandler fileh.'''
+        if fileh:
+            fileh.write('--- SceneInfo ---\n')
+            fileh.write('\tSceneName:  {0}\n'.format(self.name))
+            fileh.write('\tFrameRange: {0}-{1}\n'.format(*self.frame_range))
+            fileh.write('\tFPS:        {0}\n'.format(self.fps))
+
+    def get_json(self):
+        data = {
+            'name': self.name,
+            'frame_range': self.frame_range,
+            'fps': self.fps,
+            'scale': self.scale,
+            'bbox': self.bbox.get_json()
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, msh=None):
+        info = SceneInfo()
+        info.msh = msh
+        info.name = data['name']
+        info.frame_range = data['frame_range']
+        info.fps = data['fps']
+        info.scale = data['scale']
+        info.bbox = BBox.from_json(data['bbox'])
+        return info
+
+    def pack(self):
+        '''Packs the scene information data.'''
+        data = ['SINF']
+        data.append('size_ind')
+        data.append(self.pack_NAME())
+        data.append(self.pack_FRAM())
+        data.append(self.bbox.pack())
+        data[1] = struct.pack('<L', len(data[2]) + len(data[3]) + len(data[4]))
+        return ''.join(data)
+
+    def pack_NAME(self):
+        '''Packs the scene name.'''
+        return self.pack_string_chunk('NAME', self.name)
+
+    def pack_FRAM(self):
+        '''Packs frame range and FPS into the FRAM chunk.'''
+        data = ['FRAM']
+        data.append(struct.pack('<L', 12))
+        data.append(struct.pack('<L', self.frame_range[0]))
+        data.append(struct.pack('<L', self.frame_range[1]))
+        data.append(struct.pack('<f', self.fps))
+        return ''.join(data)
+
+
+class Material(Packer):
+    # name: string
+    # index: int
+    # tex_0: string.tga
+    # tex_1: string.tga
+    # tex_2: string.tga
+    # tex_3: string.tga
+    # attr_0: int(0-255)
+    # attr_1: int(0-255)
+    # attr_2: int(0-255)
+    # attr_3: int(0-255)
+    # diff_color: (red, green, blue, alpha) floats
+    # ambt_color: (red, green, blue, alpha) floats
+    # spec_color: (red, green, blue, alpha) floats
+    # gloss: float
+    def __init__(self, coll=None):
+        # Reference to MaterialCollection
+        if coll:
+            self.collection = coll
+        else:
+            self.collection = None
+        self.name = ''
+        self.classname = 'Material'
+        self.index = 0
+        self.tex0 = None
+        self.tex1 = None
+        self.tex2 = None
+        self.tex3 = None
+        self.flags = [['specular', False, 128],
+                      ['additive', False, 64],
+                      ['perpixel', False, 32],
+                      ['hard', False, 16],
+                      ['double', False, 8],
+                      ['single', False, 4],
+                      ['glow', False, 2],
+                      ['emissive', False, 1]]
+        self.render_type = 0
+        self.data0 = 0
+        self.data1 = 0
+        self.diff_color = Color()
+        self.ambt_color = Color()
+        self.spec_color = Color()
+        self.gloss = 70.0
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t--- Material ---\n')
+        fh.write('\t\tName:  {0}\n'.format(self.name))
+        fh.write('\t\tTex0:  {0}\n'.format(self.tex0))
+        fh.write('\t\tTex1:  {0}\n'.format(self.tex1))
+        fh.write('\t\tTex2:  {0}\n'.format(self.tex2))
+        fh.write('\t\tTex3:  {0}\n'.format(self.tex3))
+        fh.write('\t\tFlags\n')
+        for flag in self.flags:
+            fh.write('\t\t\t{0}: {1}\n'.format(flag[0], flag[1]))
+        fh.write('\n')
+        fh.write('\t\tRenderType: {0}\n'.format(self.render_type))
+        fh.write('\t\tData0:      {0}\n'.format(self.data0))
+        fh.write('\t\tData1:      {0}\n'.format(self.data1))
+        fh.write('\t\tDiffuse:    {0}\n'.format(self.diff_color))
+        fh.write('\t\tSpecular:   {0}\n'.format(self.spec_color))
+        fh.write('\t\tAmbient:    {0}\n'.format(self.ambt_color))
+        fh.write('\t\tGloss:      {0}\n'.format(self.gloss))
+
+    def get_json(self):
+        data = {
+            'name': self.name,
+            'index': self.index,
+            'tex0': self.tex0,
+            'tex1': self.tex1,
+            'tex2': self.tex2,
+            'tex3': self.tex3,
+            'flags': self.flags,
+            'render_type': self.render_type,
+            'data0': self.data0,
+            'data1': self.data1,
+            'diffuse': self.diff_color.get_json(),
+            'specular': self.spec_color.get_json(),
+            'ambient': self.ambt_color.get_json(),
+            'gloss': self.gloss,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        material = Material()
+        material.collection = collection
+        material.name = data['name']
+        material.index = data['index']
+        material.tex0 = data['tex0']
+        material.tex1 = data['tex1']
+        material.tex2 = data['tex2']
+        material.tex3 = data['tex3']
+        material.flags = data['flags']
+        material.render_type = data['render_type']
+        material.data0 = data['data0']
+        material.data1 = data['data1']
+        material.diff_color = Color.from_json(data['diffuse'])
+        material.spec_color = Color.from_json(data['specular'])
+        material.ambt_color = Color.from_json(data['ambient'])
+        material.gloss = data['gloss']
+        return material
+
+    @property
+    def ATRB(self):
+        '''Sum ATRB byte value.'''
+        val = 0
+        for flag in self.flags:
+            if flag[1]:
+                val += flag[2]
+        return val
+
+    def pack(self):
+        '''Packs the material into a MATD chunk.'''
+        data = ['MATD']
+        data.append('size_indicator')
+        data.append(self.pack_NAME())
+        data.append(self.pack_DATA())
+        data.append(self.pack_ATRB())
+        data.append(self.pack_textures())
+        data[1] = struct.pack('<L', len(data[2]) + len(data[3]) + len(data[4]) + len(data[5]))
+        return ''.join(data)
+
+    def flags_from_int(self, val):
+        '''Unpacks an int indicating the material flags into the
+        single flags.'''
+        # Decodes an int into flags.
+        place0 = val
+        flags = [('specular', True, 128),
+                 ('additive', True, 64),
+                 ('perpixel', True, 32),
+                 ('hard', True, 16),
+                 ('double', True, 8),
+                 ('single', True, 4),
+                 ('glow', True, 2),
+                 ('emissive', True, 1)]
+        new = place0
+        for index, flag in enumerate(flags):
+            new -= flag[2]
+            if new < 0:
+                flags[index] = flag[0], False, flag[2]
+                new += flag[2]
+        return flags
+
+    def pack_NAME(self):
+        '''Packs the materials name.'''
+        return self.pack_string_chunk('NAME', self.name)
+
+    def pack_DATA(self):
+        '''Packs the material's shader/color data.'''
+        data = ['DATA']
+        data.append(struct.pack('<L', 52))
+        data.append(self.diff_color.pack('f'))
+        data.append(self.spec_color.pack('f'))
+        data.append(self.ambt_color.pack('f'))
+        data.append(struct.pack('<f', self.gloss))
+        return ''.join(data)
+
+    def pack_ATRB(self):
+        '''Packs the material render attributes.'''
+        data = ['ATRB']
+        data.append(struct.pack('<L', 4))
+        data.append(struct.pack('<B', self.ATRB))
+        data.append(struct.pack('<B', self.render_type))
+        data.append(struct.pack('<B', self.data0))
+        data.append(struct.pack('<B', self.data1))
+        return ''.join(data)
+
+    def pack_textures(self):
+        '''Packs up to 4 textures in TX0D/TX1D/TX2D/TX3D chunks.'''
+        data = []
+        if self.tex0:
+            data.append(self.pack_string_chunk('TX0D', self.tex0))
+        if self.tex1:
+            data.append(self.pack_string_chunk('TX1D', self.tex1))
+        if self.tex2:
+            data.append(self.pack_string_chunk('TX2D', self.tex2))
+        if self.tex3:
+            data.append(self.pack_string_chunk('TX3D', self.tex3))
+        return ''.join(data)
+
+
+class MaterialCollection(Packer):
+    def __init__(self, msh=None, materials=None):
+        # Reference to Msh.
+        if msh:
+            self.msh = msh
+        else:
+            self.msh = None
+        self.classname = 'MaterialCollection'
+        if materials:
+            self.materials = materials
+        else:
+            self.materials = []
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('--- MaterialCollection ---\n')
+        fh.write('\tNumMaterials: {0}\n'.format(len(self.materials)))
+        for mat in self.materials:
+            mat.dump(fh)
+
+    def get_json(self):
+        data = {
+            'materials': [mat.get_json() for mat in self.materials],
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, msh=None):
+        coll = MaterialCollection()
+        coll.msh = msh
+        for material_data in data['materials']:
+            coll.materials.append(Material.from_json(material_data))
+        return coll
+
+    def add(self, material):
+        '''Add Material to the collection and set
+        collection attribute.'''
+        material.collection = self
+        self.materials.append(material)
+
+    def remove(self, index):
+        '''Remove material at index index.'''
+        del self.materials[index]
+
+    def replace(self, materials):
+        '''Replace internal materials list.'''
+        self.materials = materials
+
+    def get_matname_dict(self):
+        '''Returns dict of 'materialname': material pairs.'''
+        matnamedict = {}
+        for mat in self.materials:
+            matnamedict[mat.name] = mat
+        return matnamedict
+
+    def assign_indices(self):
+        '''Assigns index attribute for every material.'''
+        for index, mat in enumerate(self.materials):
+            mat.index = index
+
+    def __str__(self):
+        return str(self.materials)
+
+    def __repr__(self):
+        return str(self.materials)
+
+    def __getitem__(self, key):
+        return self.materials[key]
+
+    def __len__(self):
+        return len(self.materials)
+
+    def pack(self):
+        '''Packs the material list + materials.'''
+        data = ['MATL', 'size']
+        data.append(struct.pack('<L', len(self.materials)))
+        for material in self.materials:
+            data.append(material.pack())
+        data[1] = struct.pack('<L', self.sum_seq(data, 3) + 4)
+        return ''.join(data)
+
+
+class Model(Packer):
+    collprim_by_index = {0: 'Sphere',
+                         1: 'Sphere',
+                         2: 'Cylinder',
+                         4: 'Cube'}
+    collprim_by_name = {'Sphere': 0,
+                        'Cylinder': 2,
+                        'Cube': 4}
+
+    def __init__(self, collection=None):
+        # Ref to ModelCollection.
+        if collection:
+            self.collection = collection
+        else:
+            self.collection = None
+        self.name = 'model'
+        self.classname = 'Model'
+        self.parent_name = None
+        self.index = 0
+        self.model_type = 'geostatic'
+        self.vis = 0
+        self.segments = SegmentCollection(self)
+        self.collprim = False
+        self.cloth_collprim = False
+        self.primitive = 4, 0.0, 0.0, 0.0
+        self.deformers = []
+        self.deformer_indices = []
+        self.bbox = BBox()
+        self.transform = Transform()
+        self.bone = None
+        self.msh = None
+
+    def get_json(self):
+        data = {
+            'name': self.name,
+            'parent': self.parent_name,
+            'model_type': self.model_type,
+            'visible': not self.vis,  # vis == hidden
+            'segments': self.segments.get_json(),
+            'collprim': self.collprim,
+            'primitive': self.primitive,
+            'num_deformers': len(self.deformers),
+            'deformers': self.deformers,
+            'bbox': self.bbox.get_json(),
+            'transform': self.transform.get_json(),
+        }
+        return data
+
+    def save_segmented_json(self, folder, name):
+        data = self.get_json()
+        del data['segments']
+        with open(os.path.join(folder, '{0} mdl {1}.txt'.format(name, self.name)), 'w') as fh:
+            fh.write(json.dumps(data, indent=4, separators=(',', ': ')))
+        for index, segment in enumerate(self.segments):
+            with open(os.path.join(folder, '{0} mdl {1} seg {2:0>3}.txt'.format(name, self.name, index)), 'w') as fh:
+                fh.write(json.dumps(segment.get_json(), indent=4, separators=(',', ': ')))
+
+    @classmethod
+    def load_segmented_json(cls, folder, name):
+        logging.info('LOADING SEGMENTED MODEL %s %s', folder, name)
+        with open(os.path.join(folder, '{0}.txt'.format(name)), 'r') as fh:
+            model = Model.from_json(json.loads(fh.read()))
+        seg_start = '{0} seg '.format(name)
+        segments = SegmentCollection(model)
+        for filename in os.listdir(folder):
+            if filename.startswith(seg_start):
+                with open(os.path.join(folder, filename), 'r') as fh:
+                    data = json.loads(fh.read())
+                if data['type'] == 'SegmentGeometry':
+                    segments.add(SegmentGeometry.from_json(data))
+                elif data['type'] == 'ClothGeometry':
+                    segments.add(ClothGeometry.from_json(data))
+                elif data['type'] == 'ShadowGeometry':
+                    segments.add(ShadowGeometry.from_json(data))
+        model.segments = segments
+        return model
+
+    @staticmethod
+    def from_json(data, collection=None):
+        model = Model()
+        model.collection = collection
+        model.name = data['name']
+        model.parent_name = data['parent']
+        model.model_type = data['model_type']
+        model.vis = data.get('visible', False)
+        model.vis = data.get('vis', model.vis)  # Older format used that.
+        # In case this is loaded from a segmented json.
+        if data.get('segments', None):
+            model.segments = SegmentCollection.from_json(data['segments'], model)
+        model.collprim = data['collprim']
+        model.primitive = data['primitive']
+        model.deformers = data['deformers']
+        model.bbox = BBox.from_json(data['bbox'])
+        model.transform = Transform.from_json(data['transform'])
+        return model
+
+    def get_collprim_name(self):
+        return self.collprim_by_index[self.primitive[0]]
+
+    def get_collprim_index(self, name):
+        return self.collprim_by_name[name]
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t--- Model ---\n')
+        fh.write('\t\tName:    {0}\n'.format(self.name))
+        fh.write('\t\tParent:  {0}\n'.format(self.parent_name))
+        fh.write('\t\tType:    {0}\n'.format(self.model_type))
+        fh.write('\t\tVisible: {0}\n'.format(self.vis))
+        fh.write('\t\tPos:     {0}, {1}, {2}\n'.format(*self.transform.translation))
+        fh.write('\t\tRot:     {0}, {1}, {2}, {3}\n'.format(*self.transform.rotation))
+        fh.write('\t\tScl:     {0}, {1}, {2}\n'.format(*self.transform.scale))
+        if self.collprim:
+            fh.write('\t\tCollprim: {0}, {1}, {2}, {3}\n'.format(*self.primitive))
+        if 'geo' in self.model_type or self.model_type == 'cloth':
+            self.segments.dump(fh)
+        if self.deformers:
+            fh.write('\t\tDeformers:\n')
+            for deform in self.deformers:
+                fh.write('\t\t\t{0}\n'.format(deform))
+
+    def set_deformers_from_indices(self):
+        '''Sets deformers attribute to actual model names.'''
+        try:
+            for ind in self.deformer_indices:
+                self.deformers.append(self.collection[ind - 1].name)
+        except IndexError:
+            raise MSH2Error('Check C:\dump.dump!')
+
+    def pack(self):
+        '''Packs the MODL chunk. This should be used to retrieve the model in packed form.'''
+        data = ['MODL', 'sizeind']
+        data.append(self.pack_MTYP())
+        data.append(self.pack_MNDX())
+        data.append(self.pack_NAME())
+        if self.parent_name:
+            data.append(self.pack_PRNT())
+        data.append(self.pack_FLGS())
+        data.append(self.transform.pack())
+        if 'geo' in self.model_type or self.model_type == 'cloth':
+            data.append(self.pack_GEOM())
+            if self.collprim:
+                data.append(self.pack_SWCI())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+    def pack_MTYP(self):
+        '''Packs the model type chunk.'''
+        return self.pack_long_chunk('MTYP', MODEL_TYPES[self.model_type])
+
+    def pack_MNDX(self):
+        '''Packs the model index chunk.'''
+        return self.pack_long_chunk('MNDX', self.index)
+
+    def pack_NAME(self):
+        '''Packs the model's name.'''
+        return self.pack_string_chunk('NAME', self.name)
+
+    def pack_PRNT(self):
+        '''Packs the model's parent's name.'''
+        return self.pack_string_chunk('PRNT', self.parent_name)
+
+    def pack_FLGS(self):
+        '''Packs the visibility.'''
+        return self.pack_long_chunk('FLGS', self.vis)
+
+    def pack_GEOM(self):
+        data = ['GEOM']
+        data.append('size_indic')
+        data.append(self.bbox.pack())
+        data.append(self.segments.pack())
+        if self.deformers:
+            data.append(self.pack_ENVL())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+    def pack_ENVL(self):
+        data = ['ENVL']
+        data.append(struct.pack('<L', len(self.deformers) * 4 + 4))
+        data.append(struct.pack('<L', len(self.deformers)))
+        for deformer in self.deformers:
+            index = self.collection.get_index(deformer)
+            data.append(struct.pack('<L', index))
+        return ''.join(data)
+
+    def pack_SWCI(self):
+        '''Packs the collision primitive chunk.'''
+        data = ['SWCI']
+        data.append(struct.pack('<L', 16))
+        data.append(struct.pack('<Lfff', *self.primitive))
+        return ''.join(data)
+
+    def repack(self):
+        '''Repacks the MODL chunk. This should be used to retrieve the model in packed form.'''
+        data = ['MODL', 'sizeind']
+        data.append(self.pack_MTYP())
+        data.append(self.pack_MNDX())
+        data.append(self.pack_NAME())
+        if self.parent_name:
+            data.append(self.pack_PRNT())
+        data.append(self.pack_FLGS())
+        data.append(self.transform.pack())
+        if 'geo' in self.model_type or self.model_type == 'cloth':
+            data.append(self.repack_GEOM())
+            if self.collprim:
+                data.append(self.pack_SWCI())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+    def repack_GEOM(self):
+        data = ['GEOM']
+        data.append('size_indic')
+        data.append(self.bbox.pack())
+        data.append(self.segments.repack())
+        if self.deformers:
+            data.append(self.pack_ENVL())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+    def get_vertex_by_index(self, vertex_index):
+        '''Get a Vertex from an index that is not relative to a segment.
+           Basically combines all vertices of all segments into one list to array into.'''
+        offset = 0
+        for segment in self.segments:
+            if vertex_index < len(segment.vertices) + offset:
+                    return segment.vertices[vertex_index - offset]
+            offset += len(segment.vertices)
+
+
+class ModelCollection(object):
+    def __init__(self, msh=None, models=None):
+        # Ref to Msh.
+        if msh:
+            self.msh = msh
+        else:
+            self.msh = None
+        self.classname = 'ModelCollection'
+        if models:
+            self.models = models
+        else:
+            self.models = []
+        self.msh = None
+
+    def get_json(self):
+        data = {
+            'models': [m.get_json() for m in self.models]
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, msh=None):
+        coll = ModelCollection()
+        coll.msh = msh
+        for model_data in data['models']:
+            coll.models.append(Model.from_json(model_data, coll))
+        return coll
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fh.'''
+        fh.write('--- ModelCollection ---\n')
+        fh.write('\tNumModels: {0}\n'.format(len(self.models)))
+        for model in self.models:
+            model.dump(fh)
+
+    def add(self, model):
+        '''Add Model object and set its collection
+        attribute.'''
+        model.collection = self
+        self.models.append(model)
+
+    def remove(self, index):
+        del self.models[index]
+
+    def remove_multi(self, models):
+        '''Compares names between internal list and
+        models. If name of internal Model equals one in
+        models, remove the Model.'''
+        for index, model in enumerate(self.models):
+            if model.name in models:
+                del self.models[index]
+
+    def replace(self, new_models):
+        '''Replace internal model list with new_models.'''
+        self.models = new_models
+
+    def assign_indices(self):
+        '''Assign index attribute for every Model.'''
+        for index, model in enumerate(self.models):
+            model.index = index + 1
+
+    def assign_parents(self):
+        '''Assign collection attribute for every Model.'''
+        for model in self.models:
+            model.collection = self
+
+    def assign_cloth_collisions(self):
+        '''Assign collision data to every cloth that has collisions referenced.'''
+        cloth_collision_primitives = {}
+        for model in self.models:
+            if model.cloth_collprim:
+                cloth_collision_primitives[model.name] = model
+
+        for model in self.models:
+            for segment in model.segments:
+                if isinstance(segment, ClothGeometry):
+                    for collision in segment.collisions:
+                        collision.primitive_type = cloth_collision_primitives[collision.name].primitive[0]
+                        collision.primitive_data = cloth_collision_primitives[collision.name].primitive[1:]
+
+    def get_index(self, modelname):
+        '''Get model.index for model with name modelname.'''
+        for model in self.models:
+            if model.name == modelname:
+                logging.debug('ModelCollection.get_index: {0} - {1}'.format(model.name, model.index))
+                return model.index
+        return 0
+
+    def by_name(self, name):
+        '''Get model by name.'''
+        for model in self.models:
+            if model.name == name:
+                return model
+
+    def get_names_list(self):
+        '''Get list of model names.'''
+        return [mdl.name for mdl in self.models]
+
+    def __str__(self):
+        return str(self.models)
+
+    def __repr__(self):
+        return str(self.models)
+
+    def __getitem__(self, key):
+        return self.models[key]
+
+    def __len__(self):
+        return len(self.models)
+
+    def pack(self):
+        data = [model.pack() for model in self.models]
+        return ''.join(data)
+
+    def repack(self):
+        data = [model.repack() for model in self.models]
+        return ''.join(data)
+
+
+class SegmentCollection(object):
+    def __init__(self, model=None, segments=None):
+        # Reference to Model.
+        if model:
+            self.model = model
+        else:
+            self.model = None
+        self.classname = 'SegmentCollection'
+        if segments:
+            self.segments = segments
+        else:
+            self.segments = []
+        self.msh = None
+
+    def get_json(self):
+        data = {
+            'segments': [seg.get_json() for seg in self.segments],
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, model=None):
+        coll = SegmentCollection()
+        coll.model = model
+        for segment_data in data['segments']:
+            if segment_data['type'] == 'SegmentGeometry':
+                coll.segments.append(SegmentGeometry.from_json(segment_data, coll))
+            elif segment_data['type'] == 'ClothGeometry':
+                coll.segments.append(ClothGeometry.from_json(segment_data, coll))
+            elif segment_data['type'] == 'ShadowGeometry':
+                coll.segments.append(ShadowGeometry.from_json(segment_data, coll))
+        return coll
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t\t--- SegmentCollection ---\n')
+        for seg in self.segments:
+            seg.dump(fh)
+
+    def num_vertices(self):
+        numv = 0
+        for segm in self.segments:
+            numv += len(segm.vertices)
+        return numv
+
+    def add(self, segment):
+        '''Adds SegmentGeometry, ClothGeometry or ShadowGeometry
+        to the collection and sets the collection attribute.'''
+        segment.collection = self
+        self.segments.append(segment)
+
+    def remove(self, index):
+        '''Removes Geometry at index index.'''
+        del self.segments[index]
+
+    def split(self, seg_index, poly_mat_inds, mat_names):
+        '''Splits the segment with index == seg_index.
+        poly_mat_inds is a list where the index represents
+        the index of the face/polygon and the content of the
+        list item represents the material index.
+        mat_names is a list of material names.
+        This function splits the segment into multiple
+        segments(one per material). The result segments
+        will be used as the .segments of this SegmentCollection.'''
+        polies_per_material = self._polies_per_material(poly_mat_inds)
+        # Segment to split.
+        segm = self.segments[seg_index]
+        segments = []
+        # Loop through materials.
+        for mat_index, mat_poly_indices in enumerate(polies_per_material):
+            if not mat_poly_indices:
+                continue
+            seg = SegmentGeometry(self)
+            facecoll = FaceCollection(seg)
+            vertcoll = VertexCollection(seg)
+            vertcoll.set_flags_from_vertcoll(segm.vertices)
+            # Loop through face indices.
+            for local_face_index, face_index in enumerate(mat_poly_indices):
+                master_face = segm.faces[face_index]
+                new_face = Face()
+                for vert_index in master_face.vertices:
+                    # Add the vertex. As the vertex now holds UV, weights etc
+                    # its not necessary anymore to do all the checking if
+                    # the UV etc lists should be split, too.
+                    vertcoll.add(segm.vertices[vert_index])
+                    # Add last item in vertex collection to face.
+                    new_face.add(len(vertcoll) - 1)
+                facecoll.add(new_face)
+            seg.vertices = vertcoll
+            seg.faces = facecoll
+            seg.mat_name = mat_names[mat_index]
+            seg.mat = self.msh.get_mat_by_name(segm.mat_name)
+            segments.append(seg)
+        self.segment = []
+        self.segments = segments
+
+    def assign_materials(self, material_coll):
+        '''Assign material object from material name.'''
+        mat_name_dict = material_coll.get_matname_dict()
+        for segment in self.segments:
+            segment.material = mat_name_dict[segment.mat_name]
+
+    def _polies_per_material(self, poly_inds):
+        '''Creates a list where each item represents a material and holds
+        all polygon indices mapped to that material.'''
+        largest_index = self._mat_largest_ind(poly_inds)
+        # Create sub-lists for every material.
+        list_ = [[] for n in xrange(largest_index + 1)]
+        for index, el in enumerate(poly_inds):
+            # Now add the polygon indices to the according mat list.
+            list_[el].append(index)
+        return list_
+
+    def _mat_largest_ind(self, inds):
+        '''Largest material index. Equals number of materials.'''
+        int_ = 0
+        for el in inds:
+            if el > int_:
+                int_ = el
+        return int_
+
+    def __str__(self):
+        return str(self.segments)
+
+    def __repr__(self):
+        return str(self.segments)
+
+    def __getitem__(self, key):
+        return self.segments[key]
+
+    def __len__(self):
+        return len(self.segments)
+
+    def pack(self):
+        data = []
+        for segment in self.segments:
+            data.append(segment.pack())
+        return ''.join(data)
+
+    def repack(self):
+        data = [segment.repack() for segment in self.segments]
+        return ''.join(data)
+
+
+class SegmentGeometry(Packer):
+    # mat_name: string
+    # mat_index: int
+    # vert_list: list (Vertex)
+    # face_list: list (Face)
+    def __init__(self, collection=None):
+        #Reference to SegmentCollection.
+        if collection:
+            self.collection = collection
+        else:
+            self.collection = None
+        self.classname = 'SegmentGeometry'
+        self.mat_name = None
+        self.material = None
+        self.vertices = None
+        self.faces = None
+        self.msh = None
+        self.index_map = None
+
+    def get_json(self):
+        data = {
+            'type': self.classname,
+            'material': self.material.name.encode('utf-8'),
+            'num_vertices': len(self.vertices),
+            'vertices': self.vertices.get_json(),
+            'num_faces': len(self.faces),
+            'faces': self.faces.get_json(),
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        geo = SegmentGeometry()
+        geo.collection = collection
+        geo.mat_name = data['material'].encode('utf-8')
+        geo.vertices = VertexCollection.from_json(data['vertices'], geo)
+        geo.faces = FaceCollection.from_json(data['faces'], geo)
+        return geo
+
+    def clear_doubles(self):
+        '''Clears Vertices appearing more than once.'''
+        self.index_map = dict()
+        new_vertices = []
+        # Use a set to quickly check if we have a duplicate.
+        new_vertices_set = set()
+        len_new_verts = 0
+
+        num_cleared_vertices = 0
+
+        for index, vert in enumerate(self.vertices):
+            if vert in new_vertices_set:
+                index_original = new_vertices.index(vert)
+                # Insert into indices map.
+                self.index_map[index] = index_original
+
+                num_cleared_vertices += 1
+            else:
+                new_vertices.append(vert)
+                new_vertices_set.add(vert)
+                self.index_map[index] = len_new_verts
+                len_new_verts += 1
+        self.vertices.vertices = new_vertices
+
+        logging.info('Cleared %s doubles.', num_cleared_vertices)
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t\t\t--- SegmentGeometry ---\n')
+        fh.write('\t\t\t\tMaterial:    {0}\n'.format(self.material))
+        fh.write('\t\t\t\tVertices:    {0}\n'.format(len(self.vertices)))
+        fh.write('\t\t\t\tFaces:       {0}\n'.format(len(self.faces or '')))
+        fh.write('\t\t\t\tUVed:        {0}\n'.format(self.vertices.uved))
+        fh.write('\t\t\t\tColored:     {0}\n'.format(self.vertices.colored))
+        fh.write('\t\t\t\tWeighted:    {0}\n'.format(self.vertices.weighted))
+        fh.write(str(self.index_map))
+
+    def pack_MATI(self):
+        return self.pack_long_chunk('MATI', self.material.index)
+
+    def pack(self):
+        '''Packs the SEGM chunk. This should be used to retrieve the segment in packed form.'''
+        data = ['SEGM']
+        data.append('size')
+        data.append(self.pack_MATI())
+        data.append(self.vertices.pack())
+        data.append(self.faces.pack())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+    def repack(self):
+        return self.pack()
+
+
+class ShadowGeometry(Packer):
+    def __init__(self, collection=None):
+        if collection:
+            self.collection = collection
+        else:
+            self.collection = None
+        self.classname = 'ShadowGeometry'
+        self.data = ''
+        self.positions = []
+        self.edges = []
+
+    def get_json(self):
+        data = {
+            'type': self.classname,
+            'num_positions': len(self.positions),
+            'positions': self.positions,
+            'num_edges': len(self.edges),
+            'edges': self.edges,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        geo = ShadowGeometry()
+        geo.collection = collection
+        geo.positions = data['positions']
+        geo.edges = data['edges']
+        return geo
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t\t\t--- ShadowGeometry ---\n')
+        fh.write('\t\t\t\tNo data available.\n')
+
+    def repack(self):
+        data = ['SHDW', 'size', self.data]
+        data[1] = struct.pack('<L', len(self.data))
+        return ''.join(data)
+
+    def pack(self):
+        data = ['SHDW', 'size']
+        data.append(struct.pack('<L', len(self.positions)))
+        for pos in self.positions:
+            data.append(struct.pack('<fff', *pos))
+        data.append(struct.pack('<L', len(self.edges)))
+        for edge in self.edges:
+            data.append(struct.pack('<HHHH', *edge))
+        data[1] = struct.pack('<L', 4 + 4 + 6 * len(self.edges) + 12 * len(self.positions))
+        return ''.join(data)
+
+
+class ClothCollision(Packer):
+    def __init__(self, cloth_geo=None):
+        self.cloth = cloth_geo
+        self.name = ''
+        self.parent = ''
+        # 0: Sphere, 1: Cylinder
+        self.primitive_type = 0
+        self.primitive_data = 4, 4, 4
+
+    def get_json(self):
+        data = {
+            'name': self.name,
+            'parent': self.parent,
+            'primitive_type': self.primitive_type,
+            'primitive_data': self.primitive_data,
+        }
+        return data
+
+    @classmethod
+    def from_json(cls, data, cloth=None):
+        cc = cls()
+        cc.cloth = cloth
+        cc.name = data['name']
+        cc.parent = data['parent']
+        cc.primitive_type = data['primitive_type']
+        cc.primitive_data = data['primitive_data']
+        return cc
+
+    def pack(self):
+        data = [self.name + '\x00',
+                self.parent + '\x00',
+                struct.pack('<L', self.primitive_type),
+                struct.pack('<fff', *self.primitive_data)]
+        return ''.join(data)
+
+
+class ClothGeometry(Packer):
+    def __init__(self, collection=None):
+        if collection:
+            self.collection = collection
+        else:
+            self.collection = None
+        self.classname = 'ClothGeometry'
+        self.texture = 'no_texture'
+        self.vertices = None
+        self.faces = None
+        self.stretch = ''
+        self.stretch_constraints = set()
+        self.cross = ''
+        self.cross_constraints = set()
+        self.bend = ''
+        self.bend_constraints = set()
+        self.collision = ''
+        self.collisions = []
+
+    def get_json(self):
+        data = {
+            'type': self.classname,
+            'texture': self.texture,
+            'num_vertices': len(self.vertices),
+            'vertices': self.vertices.get_json(),
+            'num_faces': len(self.faces),
+            'faces': self.faces.get_json(),
+            'stretch': self.stretch_constraints,
+            'cross': self.cross_constraints,
+            'bend': self.bend_constraints,
+            'collisions': [c.get_json() for c in self.collisions],
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        geo = ClothGeometry()
+        geo.collection = collection
+        geo.vertices = ClothVertexCollection.from_json(data['vertices'], geo)
+        geo.faces = FaceCollection.from_json(data['faces'], geo)
+        geo.stretch_constraints = data['stretch']
+        geo.cross_constraints = data['cross']
+        geo.bend_constraints = data['bend']
+        geo.collisions = [ClothCollision.from_json(collision, geo) for collision in data['collisions']]
+        return geo
+
+    def dump(self, fh):
+        '''Dump information to open filehandler fileh.'''
+        fh.write('\t\t\t--- ClothGeometry ---\n')
+        fh.write('\t\t\t\tVertices:    {0}\n'.format(len(self.vertices)))
+        fh.write('\t\t\t\tFaces:       {0}\n'.format(len(self.faces)))
+
+    def assign_parents(self):
+        '''Assign segment attribute for every collection.'''
+        self.vertices.segment = self
+        self.faces.segment = self
+
+    def create_constraints(self):
+        ''' Creates constraints between faces and vertices so the cloth simulation can keep the
+            cloth's shape
+        '''
+        def is_fixed(idx):
+            return self.vertices[idx].is_fixed
+
+        # Note that the Pandemic exporter does _not_ constrain fixed points to each other (which
+        # really doesn't make any sense). So we don't do it either
+        for face in self.faces:
+            # p1 ┌────┐ p2
+            #    │    │
+            #    │    │
+            # p4 └────┘ p3
+
+            last_vert_idx = face.vertices[-1]
+
+            # Stretch constraints, along the boundary of the polygon
+            # p1-p2, p2-p3, p3-p4, p4-p1
+            # This allows for any amount of sides to the polygon
+            for vert_idx in face.vertices:
+                both_fixed = is_fixed(vert_idx) and is_fixed(last_vert_idx)
+
+                if both_fixed:
+                    continue
+
+                # Check both possible orders, we only want one connection between two vertices
+                a_b_exists = (last_vert_idx, vert_idx) in self.stretch_constraints
+                b_a_exists = (vert_idx, last_vert_idx) in self.stretch_constraints
+
+                if not (a_b_exists or b_a_exists):
+                    self.stretch_constraints.add((last_vert_idx, vert_idx))
+
+                last_vert_idx = vert_idx
+
+            # Cross constraints, diagonally across _quads_
+            # p1-p3, p2-p4
+            # Only works for quads currently
+            if len(face.vertices) == 4:
+                pair_1 = (face.vertices[0], face.vertices[2])
+                pair_2 = (face.vertices[1], face.vertices[3])
+
+                # Only add constraint if either or both vertices are dynamic
+                if not (is_fixed(pair_1[0]) and is_fixed(pair_1[1])):
+                    self.cross_constraints.add(pair_1)
+
+                if not (is_fixed(pair_2[0]) and is_fixed(pair_2[1])):
+                    self.cross_constraints.add(pair_2)
+
+            # Bend constraints
+            # Supposed to keep the overall shape of the cloth from overbending
+            #
+            # p1   p2     p3
+            # ┌─────┬─────┐
+            # │     │     │
+            # │ p8  │ p9  │ p4
+            # ├─────┼─────┤
+            # │     │     │
+            # │     │     │
+            # └─────┴─────┘
+            # p7    p6    p5
+            #
+            # p1-p3, p3-p5, p5-p7, p7-p1, p8-p4, p2-p6
+            # Connects all faces in this pattern
+            for face2 in self.faces:
+                if face is face2:
+                    continue
+
+                # Vertices shared between the current two faces
+                shared_vertices = [v for v in face2.vertices if v in face.vertices]
+
+                if not shared_vertices:
+                    continue
+
+                shared_vertex = shared_vertices[0]
+
+                # get_connections gets all vertices in a face that connect to the given one. So in
+                # the drawing above if we pass p8 to get_connections of the top-left face we will
+                # get [p1, p9]
+                # Shared vertices will be filtered out, so p1 remains
+                connections1 = []
+                for connection_vertex in face.get_connections(shared_vertex):
+                    if connection_vertex not in shared_vertices:
+                        connections1.append(connection_vertex)
+
+                # Same as above, assuming we pass p8 of the bottom-left face we will get [p9, p7]
+                # Shared vertices will be filtered out, so p7 remains
+                connections2 = []
+                for connection_vertex in face2.get_connections(shared_vertex):
+                    if connection_vertex not in shared_vertices:
+                        connections2.append(connection_vertex)
+
+                # Zip the two resulting lists ([p1] and [p7]) creating pair p1-p7
+                for vert_idx_1, vert_idx_2 in zip(connections1, connections2):
+                    # Again, a constraint between two fixed points does not make sense. In this case
+                    # we need to consider the case of fixed-dynamic _spanning_ a fixed point needs
+                    # to be considered, too (e.g. p1-p7 where p1 and p8 are fixed). These should be
+                    # kept
+                    both_fixed = is_fixed(vert_idx_1) and is_fixed(vert_idx_2)
+
+                    if both_fixed:
+                        continue
+
+                    a_b_exists = (vert_idx_1, vert_idx_2) in self.bend_constraints
+                    b_a_exists = (vert_idx_2, vert_idx_1) in self.bend_constraints
+
+                    if not (a_b_exists or b_a_exists):
+                        self.bend_constraints.add((vert_idx_1, vert_idx_2))
+
+    def pack_stretch(self):
+        data = ['SPRS', struct.pack('<LL', 4 + 4 * len(self.stretch_constraints), len(self.stretch_constraints))]
+        for item in self.stretch_constraints:
+            data.append(struct.pack('<HH', *item))
+        return ''.join(data)
+
+    def repack_stretch(self):
+        data = ['SPRS', 'size']
+        # Just append the data we read when this .msh was loaded.
+        data.append(self.stretch)
+        data[1] = struct.pack('<L', len(self.stretch))
+        return ''.join(data)
+
+    def pack_cross(self):
+        data = ['CPRS', struct.pack('<LL', 4 + 4 * len(self.cross_constraints), len(self.cross_constraints))]
+        for item in self.cross_constraints:
+            data.append(struct.pack('<HH', *item))
+        return ''.join(data)
+
+    def repack_cross(self):
+        data = ['CPRS', 'size']
+        data.append(self.cross)
+        data[1] = struct.pack('<L', len(self.cross))
+        return ''.join(data)
+
+    def pack_bend(self):
+        data = ['BPRS', struct.pack('<LL', 4 + 4 * len(self.bend_constraints), len(self.bend_constraints))]
+        for item in self.bend_constraints:
+            data.append(struct.pack('<HH', *item))
+        return ''.join(data)
+
+    def repack_bend(self):
+        data = ['BPRS', 'size']
+        data.append(self.bend)
+        data[1] = struct.pack('<L', len(self.cross))
+        return ''.join(data)
+
+    def pack_collision(self):
+        data = ['COLL', 'size', struct.pack('<L', len(self.collisions))]
+        # Length of size indicator = 4.
+        size = 4
+        for coll in self.collisions:
+            data.append(coll.pack())
+            size += len(data[-1])
+        # Make the length of the chunk a multiple of 4.
+        while size % 4 != 0:
+            size += 1
+            data.append('\x00')
+        data[1] = struct.pack('<L', size)
+        return ''.join(data)
+
+    def repack_collision(self):
+        data = ['COLL', 'size']
+        data.append(self.collision)
+        data[1] = struct.pack('<L', len(self.collision))
+        return ''.join(data)
+
+    def pack(self):
+        data = ['CLTH', 'size']
+        if self.texture:
+            data.append(self.pack_string_chunk('CTEX', self.texture))
+        else:
+            data.append(self.pack_string_chunk('CTEX', 'no_texture'))
+        data.append(self.vertices.pack_pos())
+        data.append(self.vertices.pack_uvs())
+        data.append(self.vertices.pack_fixed())
+        data.append(self.vertices.pack_weights())
+        data.append(self.faces.pack_cloth())
+        data.append(self.pack_stretch())
+        data.append(self.pack_cross())
+        data.append(self.pack_bend())
+        data.append(self.pack_collision())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+    def repack(self):
+        data = ['CLTH', 'size']
+        if self.texture:
+            data.append(self.pack_string_chunk('CTEX', self.texture))
+        else:
+            data.append(self.pack_string_chunk('CTEX', 'no_texture'))
+        data.append(self.vertices.pack_pos())
+        data.append(self.vertices.pack_uvs())
+        data.append(self.vertices.pack_fixed())
+        data.append(self.vertices.pack_weights())
+        data.append(self.faces.pack_cloth())
+        data.append(self.repack_stretch())
+        data.append(self.repack_cross())
+        data.append(self.repack_bend())
+        data.append(self.repack_collision())
+        data[1] = struct.pack('<L', self.sum_seq(data, 2))
+        return ''.join(data)
+
+
+class Face(object):
+    '''Keeps the indices of the vertices forming this face.'''
+    # Params:
+    #   - vertices: a list of indices forming this face.
+    #   - coll: the FaceCollection.
+    def __init__(self, vertices=None, coll=None):
+        # List of vertex indices(ints).
+        if vertices:
+            self.vertices = vertices
+        else:
+            self.vertices = None
+        # Reference to the FaceCollection.
+        if coll:
+            self.collection = coll
+        else:
+            self.collection = None
+        self.classname = 'Face'
+
+
+    def get_json(self):
+        data = {
+            'vertices': self.vertices,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        face = Face()
+        face.collection = collection
+        face.vertices = data['vertices']
+        return face
+
+    def get_connections(self, vertex):
+        ''' Get all vertices that connect to the given vertex in this face
+        '''
+        index = self.vertices.index(vertex)
+
+        connections = []
+
+        # Get the vertex before the given one
+        # Underflow -> take last one
+        if index - 1 < 0:
+            connections.append(self.vertices[-1])
+        else:
+            connections.append(self.vertices[index - 1])
+
+        # Get the vertex after the given one
+        # Overflow -> take first one
+        if index + 1 == len(self.vertices):
+            connections.append(self.vertices[0])
+        else:
+            connections.append(self.vertices[index + 1])
+
+        return connections
+
+    def replace(self, verts):
+        '''Replaces the local vertices list with a new one.'''
+        self.vertices = verts
+
+    def reverse_order(self):
+        '''Reverses the triangle order. Only works with tris.'''
+        self.vertices = self.vertices[0], self.vertices[2], self.vertices[1]
+
+    def add(self, vert_index):
+        '''Adds a vertex index to the local vertices.'''
+        if not self.vertices:
+            self.vertices = [vert_index]
+            return
+        self.vertices.append(vert_index)
+
+    def i(self, index):
+        '''Returns the vertex index at index index of the local vertices.'''
+        return self.vertices[index]
+
+    def SIindices(self):
+        '''Returns the face in CCW order for XSI importing.'''
+        if self.sides == 4:
+            return self.i(0), self.i(1), self.i(3), self.i(2)
+        else:
+            return self.i(0), self.i(1), self.i(2)
+
+    @property
+    def sides(self):
+        '''Returns the number of sides/vertices this face is constructed of.'''
+        return len(self.vertices)
+
+    def pack(self):
+        '''Packs the vertex indices for the STRP chunk.'''
+        index_map = self.collection.segment.index_map
+        if (self.sides == 4) and (index_map is not None):
+            return struct.pack('<HHHH', index_map[self.vertices[0]] + 0x8000,
+                               index_map[self.vertices[1]] + 0x8000,
+                               index_map[self.vertices[2]],
+                               index_map[self.vertices[3]])
+        elif (self.sides == 3) and (index_map is not None):
+            return struct.pack('<HHH', index_map[self.vertices[0]] + 0x8000,
+                               index_map[self.vertices[1]] + 0x8000,
+                               index_map[self.vertices[2]])
+        elif (self.sides == 4) and (index_map is None):
+            return struct.pack('<HHHH', self.vertices[0] + 0x8000,
+                               self.vertices[1] + 0x8000,
+                               self.vertices[2],
+                               self.vertices[3])
+        elif (self.sides == 3) and (index_map is None):
+            return struct.pack('<HHH', self.vertices[0] + 0x8000,
+                               self.vertices[1] + 0x8000,
+                               self.vertices[2])
+        else:
+            return ''
+
+    def pack_tris(self):
+        '''Packs the vertex indices as tris for the CMSH chunk.'''
+        # index_map = self.collection.segment.index_map
+        # if (self.sides == 4) and (index_map is not None):
+        #     return (struct.pack('<LLL', index_map[self.vertices[0]],
+        #             index_map[self.vertices[1]],
+        #             index_map[self.vertices[2]]),
+        #             struct.pack('<LLL', index_map[self.vertices[0]],
+        #                         index_map[self.vertices[2]],
+        #                         index_map[self.vertices[3]]))
+        # elif (self.sides == 3) and (index_map is not None):
+        #     return (struct.pack('<LLL', index_map[self.vertices[0]],
+        #                         index_map[self.vertices[1]],
+        #                         index_map[self.vertices[2]]),)
+        # elif (self.sides == 4) and (index_map is None):
+        #     return (struct.pack('<LLL', self.vertices[0],
+        #             self.vertices[1],
+        #             self.vertices[2]),
+        #             struct.pack('<LLL', self.vertices[0],
+        #                         self.vertices[2],
+        #                         self.vertices[3]))
+        # elif (self.sides == 3) and (index_map is None):
+        #     return (struct.pack('<LLL', self.vertices[0],
+        #                         self.vertices[1],
+        #                         self.vertices[2]),)
+        # else:
+        #     return ()
+
+        # Make sure everything returned has a length for correct size calculation.
+        if self.sides == 4:
+            return (struct.pack('<LLL', self.vertices[0],
+                                        self.vertices[1],
+                                        self.vertices[2]),
+                    struct.pack('<LLL', self.vertices[0],
+                                        self.vertices[2],
+                                        self.vertices[3]))
+        elif self.sides == 3:
+            return (struct.pack('<LLL', self.vertices[0],
+                                        self.vertices[1],
+                                        self.vertices[2]), )
+        else:
+            return ()
+
+    def get_edges(self):
+        '''Returns unique edges.'''
+        if self.sides == 4:
+            return ((self.vertices[0], self.vertices[1]),
+                    (self.vertices[1], self.vertices[2]),
+                    (self.vertices[2], self.vertices[3]),
+                    (self.vertices[3], self.vertices[0]))
+        elif self.sides == 3:
+            return ((self.vertices[0], self.vertices[1]),
+                    (self.vertices[1], self.vertices[2]),
+                    (self.vertices[2], self.vertices[3]))
+        else:
+            return []
+
+    def __repr__(self):
+        return 'Face({0})'.format(str(self.vertices))
+
+    def __str__(self):
+        return 'Face({0})'.format(str(self.vertices))
+
+
+class FaceCollection(object):
+    def __init__(self, segm=None):
+        # List of Face objects.
+        self.faces = []
+        # Ref to parent(SegmentGeometry).
+        if segm:
+            self.segment = segm
+        else:
+            self.segment = None
+        self.classname = 'FaceCollection'
+
+    def get_json(self):
+        data = {
+            'faces': [face.get_json() for face in self.faces],
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, segment=None):
+        coll = FaceCollection()
+        coll.segment = segment
+        coll.faces = [Face.from_json(face_data, coll) for face_data in data['faces']]
+        return coll
+
+    def get_faces(self):
+        '''Returns faces as vertex indices.'''
+        faces = []
+        for face in self.faces:
+            faces.extend([vertex for vertex in face.vertices])
+        return faces
+
+    def de_ngonize(self, only_tris=False):
+        '''Makes all n-gons to tris or quads. only_tris defines
+        if the algorithm should try to fit quads in, too.'''
+        if only_tris:
+            return self._triangulate_ngons()
+        new_faces = []
+        for ndx, face in enumerate(self.faces):
+            # If the face has more than 4 sides, cut it into
+            # multiple faces. Only 3 and 4 sided faces are
+            # supported.
+            if face.sides > 4:
+                nface = Face(self)
+                numtris = face.sides - 2
+                numquads = numtris / 2.0
+                # 4.0 == int(4.0) but 4.5 != int(4.5).
+                # So, if it's possible to cut the current face
+                # into multiple quads, do it. Otherwise triangulate
+                # it.
+                if int(numquads) == numquads:
+                    for n in xrange(int(numquads)):
+                        nface = Face(self)
+                        nface.vertices = face.vertices[n * 2:n * 2 + 4]
+                        new_faces.append(nface)
+                else:
+                    for n in xrange(int(numtris)):
+                        # Reverse every 2nd tri so every tri is CCW.
+                        if n / 2 != n / 2.0:
+                            nface = Face(self)
+                            nface.vertices = face.vertices[n:n + 3]
+                            nface.reverse_order()
+                            new_faces.append(nface)
+                            continue
+                        nface = Face(self)
+                        nface.vertices = face.vertices[n:n + 3]
+                        new_faces.append(nface)
+            else:
+                new_faces.append(face)
+        self.faces = new_faces
+
+    def _triangulate_ngons(self):
+        '''Triangulates n-gons of every face and sets
+        the faces to the newly calculated ones.'''
+        new_faces = []
+        for ndx, face in enumerate(self.faces):
+            if face.sides > 3:
+                nface = Face(self)
+                numtris = face.sides - 2
+                # Just triangulate every face with more than 4 sides.
+                for n in xrange(int(numtris)):
+                    # Reverse every 2nd tri so every tri is CCW.
+                    if n / 2 != n / 2.0:
+                            nface = Face(self)
+                            nface.vertices = face.vertices[n:n + 3]
+                            nface.reverse_order()
+                            new_faces.append(nface)
+                            continue
+                    nface = Face(self)
+                    nface.vertices = face.vertices[n:n + 3]
+                    new_faces.append(nface)
+            else:
+                new_faces.append(face)
+        self.faces = new_faces
+
+    def add(self, face):
+        '''Adds a face to the collection.'''
+        face.collection = self
+        if not self.faces:
+            self.faces = [face]
+            return
+        self.faces.append(face)
+
+    def pack(self):
+        '''Packs vertex indices for every face into
+        the STRP chunk.'''
+        data = ['STRP', 'size', 'numitems']
+        faces = 0
+        for face in self.faces:
+            faces += face.sides
+            if face.sides == 4 or face.sides == 3:
+                data.append(face.pack())
+        data[1] = struct.pack('<L', faces * 2 + 4)
+        data[2] = struct.pack('<L', faces)
+        return ''.join(data)
+
+    def pack_cloth(self):
+        '''Packs triangles of every face into
+        the cloth CMSH chunk.'''
+        data = ['CMSH', 'size', 'num']
+        num = 0
+        for face in self.faces:
+            facetris = face.pack_tris()
+            num += len(facetris)
+            data.extend(facetris)
+        # Number of tris * number of points * size of float + size indicator size.
+        data[1] = struct.pack('<L', num * 3 * 4 + 4)
+        data[2] = struct.pack('<L', num)
+        return ''.join(data)
+
+    def stretch_edges(self):
+        '''Gets edges for SPRS cloth chunk.'''
+        edges = []
+        for face in self.faces:
+            face_edges = face.get_edges()
+            for edge in face_edges:
+                if not edge in edges and not (edge[1], edge[0]) in edges:
+                    edges.append(edge)
+        for index, edge in enumerate(edges):
+            if self.segment.vertices[edge[0]].is_fixed and self.segment.vertices[edge[1]].is_fixed:
+                edges.pop(index)
+        return edges
+
+    def cross_edges(self):
+        '''Gets edges for CPRS cloth chunk.'''
+        edges = []
+        for face in self.faces:
+            if face.sides == 4:
+                # Append edges which cross the quad.
+                edges.append((face.i(0), face.i(2)))
+                edges.append((face.i(1), face.i(3)))
+        return edges
+
+    def bend_edges(self):
+        '''Get edges for BPRS cloth chunk.'''
+        return ()
+
+    def __str__(self):
+        return str(self.faces)
+
+    def __repr__(self):
+        return str(self.faces)
+
+    def __getitem__(self, key):
+        return self.faces[key]
+
+    def __len__(self):
+        return len(self.faces)
+
+
+class Vertex(object):
+    def __init__(self, pos=(0, 0, 0), normal=None, coll=None):
+        # Reference to parent(VertexCollection).
+        if coll:
+            self.collection = coll
+        else:
+            self.collection = None
+        self.classname = 'Vertex'
+        self.index = 0
+        self.x = pos[0]
+        self.y = pos[1]
+        self.z = pos[2]
+        if normal:
+            self.nx = normal[0]
+            self.ny = normal[1]
+            self.nz = normal[2]
+        else:
+            self.nx = 1.0
+            self.ny = 1.0
+            self.nz = 1.0
+        self.u, self.v = 0.0, 0.0
+        self.color = Color()
+        self.deformers = ['none', 'none', 'none', 'none']
+        self.deformer_indices = [0, 0, 0, 0]
+        self.weights = [1.0, 0.0, 0.0, 0.0]
+
+    def get_json(self):
+        data = {
+            'position': self.pos,
+            'uv': self.uv,
+            'normal': self.normal,
+            'deformers': self.deformers,
+            'weights': self.weights,
+            'color': self.color.get_json()
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, coll=None):
+        vert = Vertex()
+        vert.collection = coll
+        vert.pos = data['position']
+        vert.normal = data['normal']
+        vert.uv = data['uv']
+        vert.color = Color.from_json(data['color'])
+        vert.deformers = data['deformers']
+        vert.weights = data['weights']
+        return vert
+
+    def dump(self, fh):
+        fh.write('\t\tVERTEX\n')
+        fh.write('\t\t\tPos: {0:3}, {1:3}, {2:3}\n'.format(*self.pos))
+        fh.write('\t\t\tUV:  {0:3}, {1:3}\n'.format(*self.uv))
+
+    def __hash__(self):
+        return hash((self.x, self.y, self.z, self.u, self.v, self.nx, self.ny, self.nz))
+
+    def __eq__(self, other):
+        if (self.x == other.x) and (self.y == other.y) and (self.z == other.z):
+            if (self.u == other.u) and (self.v == other.v):
+                if (self.nx == other.nx) and (self.ny == other.ny) and (self.nz == other.nz):
+                    return True
+        return False
+
+    def __repr__(self):
+        return 'Vertex({0}, {1}, {2})'.format(*self.pos)
+
+    @property
+    def pos(self):
+        return self.x, self.y, self.z
+
+    @pos.setter
+    def pos(self, value):
+        self.x, self.y, self.z = value
+
+    @property
+    def uv(self):
+        return self.u, self.v
+
+    @uv.setter
+    def uv(self, value):
+        self.u, self.v = value
+
+    @property
+    def normal(self):
+        return self.nx, self.ny, self.nz
+
+    @normal.setter
+    def normal(self, value):
+        self.nx, self.ny, self.nz = value
+
+    def translate(self, vector3):
+        self.x += vector3[0]
+        self.y += vector3[1]
+        self.z += vector3[2]
+
+    def pack_pos(self):
+        return struct.pack('<fff', *self.pos)
+
+    def pack_normal(self):
+        return struct.pack('<fff', *self.normal)
+
+    def pack_uvs(self):
+        return struct.pack('<ff', *self.uv)
+
+    def pack_weights(self):
+        data = []
+        for index, weight in itertools.izip(self.deformer_indices, self.weights):
+            data.append(struct.pack('<Lf', index, weight))
+        return ''.join(data)
+
+    def pack_color(self):
+        return self.color.pack_bgra('B')
+
+
+class VertexCollection(object):
+    def __init__(self, segm=None):
+        # Ref to parent SegmentGeometry.
+        if segm:
+            self.segment = segm
+        else:
+            self.segment = None
+        self.vertices = []
+        self.classname = 'VertexCollection'
+        self.colored = False
+        self.weighted = False
+        self.uved = False
+
+    def get_json(self):
+        data = {
+            'vertices': [v.get_json() for v in self.vertices],
+            'colored': self.colored,
+            'weighted': self.weighted,
+            'uved': self.uved,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, segment=None):
+        coll = VertexCollection()
+        coll.segment = segment
+        for vdata in data['vertices']:
+            coll.vertices.append(Vertex.from_json(vdata, coll))
+        coll.colored = data['colored']
+        coll.weighted = data['weighted']
+        coll.uved = data['uved']
+        return coll
+
+    def dump(self, fh):
+        for v in self.vertices:
+            v.dump(fh)
+
+    def set_flags_from_vertcoll(self, vertcoll):
+        '''Transfers flags from the given VertexCollection vertcoll
+        to this one.'''
+        self.colored = vertcoll.colored
+        self.weighted = vertcoll.weighted
+        self.uved = vertcoll.uved
+
+    def get_positions(self):
+        '''Yield all positions.'''
+        for vertex in self.vertices:
+            yield vertex.pos
+
+    def pack_positions(self):
+        data = ['POSL']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 3 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_pos())
+        return ''.join(data)
+
+    def get_normals(self):
+        '''Yield all normals.'''
+        for vertex in self.vertices:
+            yield vertex.normal
+
+    def pack_normals(self):
+        data = ['NRML']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 3 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_normal())
+        return ''.join(data)
+
+    def get_uvs(self):
+        '''Yield all UVs.'''
+        for vertex in self.vertices:
+            yield vertex.uv
+
+    def get_uv_list(self):
+        return [vertex.uv for vertex in self.vertices]
+
+    def pack_uvs(self):
+        data = ['UV0L']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 2 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_uvs())
+        return ''.join(data)
+
+    def set_uvs(self, uv_list):
+        for uv, vertex in itertools.izip(uv_list, self.vertices):
+            vertex.u = uv[0]
+            vertex.v = uv[1]
+
+    def get_colors(self):
+        '''Yield all color values.'''
+        for vertex in self.vertices:
+            yield vertex.color.get()
+
+    def set_colors(self, color_list):
+        for color, vertex in itertools.izip(color_list, self.vertices):
+            vertex.color = color
+
+    def pack_colors(self):
+        data = ['CLRL']
+        data.append(struct.pack('<L', len(self.vertices) * 4 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_color())
+        return ''.join(data)
+
+    def get_weights(self):
+        weights = []
+        for vertex in self.vertices:
+            weights.append(vertex.deformers[0])
+            weights.append(vertex.weights[0])
+            weights.append(vertex.deformers[1])
+            weights.append(vertex.weights[1])
+            weights.append(vertex.deformers[2])
+            weights.append(vertex.weights[2])
+            weights.append(vertex.deformers[3])
+            weights.append(vertex.weights[3])
+        return weights
+
+    def set_weights(self, weights, deformers, indices):
+        for weight, deformer_tuple, index_tpl, vertex in itertools.izip(weights, deformers, indices, self.vertices):
+            vertex.weights = weight
+            vertex.deformers = deformer_tuple
+            vertex.deformer_indices = index_tpl
+
+    def pack_weights(self):
+        data = ['WGHT']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 8 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vertex in self.vertices:
+            data.append(vertex.pack_weights())
+        return ''.join(data)
+
+    def pack(self):
+        data = [self.pack_positions(),
+                self.pack_normals()]
+        if self.uved:
+            data.append(self.pack_uvs())
+        if self.colored:
+            data.append(self.pack_colors())
+        if self.weighted:
+            data.append(self.pack_weights())
+        return ''.join(data)
+
+    def add(self, vertex):
+        '''Adds a vertex to the collection and sets
+        its collection property.'''
+        vertex.collection = self
+        self.vertices.append(vertex)
+
+    def __str__(self):
+        return str(self.vertices)
+
+    def __repr__(self):
+        return str(self.vertices)
+
+    def __getitem__(self, key):
+        return self.vertices[key]
+
+    def __len__(self):
+        return len(self.vertices)
+
+
+class ClothVertex(object):
+    def __init__(self, pos, coll=None):
+        if coll:
+            self.collection = coll
+        else:
+            self.collection = None
+        self.classname = 'ClothVertex'
+        self.index = 0
+        self.x = pos[0]
+        self.y = pos[1]
+        self.z = pos[2]
+        self.u, self.v = 0.0, 0.0
+        self.deformer = ''
+        self.is_fixed = False
+
+    def get_json(self):
+        data = {
+            'position': self.pos,
+            'uv': self.uv,
+            'deformer': self.deformer,
+            'is_fixed': self.is_fixed,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, collection=None):
+        v = ClothVertex()
+        v.collection = collection
+        v.pos = data['position']
+        v.uv = data['uv']
+        v.deformer = data['deformer']
+        v.is_fixed = data['is_fixed']
+        return v
+
+    @property
+    def pos(self):
+        return self.x, self.y, self.z
+
+    @pos.setter
+    def pos(self, value):
+        self.x, self.y, self.z = value
+
+    @property
+    def uv(self):
+        return self.u, self.v
+
+    @uv.setter
+    def uv(self, value):
+        self.u, self.v = value
+
+    def pack_pos(self):
+        '''Returns x, y, z packed into 3 floats.'''
+        return struct.pack('<fff', *self.pos)
+
+    def pack_uvs(self):
+        '''Returns u, v packed into 2 floats.'''
+        return struct.pack('<ff', *self.uv)
+
+
+class ClothVertexCollection(Packer):
+    def __init__(self, segm=None, verts=None):
+        if segm:
+            self.segment = segm
+        else:
+            self.segment = None
+        if verts:
+            self.vertices = verts
+        else:
+            self.vertices = []
+        self.classname = 'ClothVertexCollection'
+        self.uved = True
+
+    def get_json(self):
+        data = {
+            'vertices': [v.get_json() for v in self.vertices],
+            'uved': self.uved,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data, segment=None):
+        coll = ClothVertexCollection()
+        coll.segment = segment
+        coll.uved = data['uved']
+        coll.vertices = [ClothVertex.from_json(vdata, coll) for vdata in data['vertices']]
+        return coll
+
+    def fixed(self):
+        return [point for point in self.vertices if point.is_fixed]
+
+    def fixed_indices(self):
+        return [index for index, point in enumerate(self.vertices) if point.is_fixed]
+
+    def get_deformers(self):
+        return [point.deformer for point in self.vertices if point.deformer]
+
+    def add(self, vert):
+        '''Adds a vertex to the collection and sets its
+        collection property.'''
+        vert.collection = self
+        self.vertices.append(vert)
+
+    def pack_pos(self):
+        '''Packs vertex positions into CPOS chunk.'''
+        data = ['CPOS']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 3 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vert in self.vertices:
+            data.append(vert.pack_pos())
+        return ''.join(data)
+
+    def pack_uvs(self):
+        data = ['CUV0']
+        data.append(struct.pack('<L', len(self.vertices) * 4 * 2 + 4))
+        data.append(struct.pack('<L', len(self.vertices)))
+        for vert in self.vertices:
+            data.append(vert.pack_uvs())
+        return ''.join(data)
+
+    def pack_fixed(self):
+        data = ['FIDX', 'size', 'num']
+        num = 0
+        for index, vert in enumerate(self.vertices):
+            if vert.is_fixed:
+                data.append(struct.pack('<L', index))
+                num += 1
+        data[1] = struct.pack('<L', num * 4 + 4)
+        data[2] = struct.pack('<L', num)
+        return ''.join(data)
+
+    def pack_weights(self):
+        data = ['FWGT', 'size', 'num']
+        num = 0
+        data2 = []
+        for index, vert in enumerate(self.vertices):
+            if vert.is_fixed and vert.deformer:
+                data2.append(self.null_terminate(vert.deformer))
+                num += 1
+        data.append(''.join(data2))
+        data[1] = struct.pack('<L', len(data[3]) + 4)
+        data[2] = struct.pack('<L', num)
+        return ''.join(data)
+
+    def __str__(self):
+        return str(self.vertices)
+
+    def __repr__(self):
+        return str(self.vertices)
+
+    def __getitem__(self, key):
+        return self.vertices[key]
+
+    def __len__(self):
+        return len(self.vertices)
+
+
+class Animation(Packer):
+    # Params:
+    #   - parent: Parent class(Msh)
+    #   - empty: Empty animation?
+    #       'empty' = empty animation
+    #       'maybe_empty' = check .bones and .cycle before packing
+    def __init__(self, msh=None, empty=None):
+        # Ref to Msh.
+        self.msh = msh
+        self.bones = None
+        self.cycle = None
+        self.cycles = []
+        self.classname = 'Animation'
+        if empty == 'empty':
+            # If the animation export is disabled, replace pack function.
+            self.pack = self.pack_empty
+        elif empty == 'maybe_empty':
+            self.pack = self.pack_check
+
+    @property
+    def empty(self):
+        '''Checks if this animation has any bones or cycle.'''
+        if self.bones and self.cycle:
+            return False
+        return True
+
+    def pack_check(self):
+        if self.bones and self.cycle:
+            return self.pack()
+        else:
+            return self.pack_empty()
+
+    def pack(self):
+        data = []
+        data.append(self.bones.pack_SKL2())
+        data.append(self.bones.pack_BLN2())
+        data.append('ANM2')
+        data.append('size')
+        data.append(self.cycle.pack())
+        data.append(self.bones.pack_KFR3())
+        data[3] = struct.pack('<L', self.sum_seq(data, 4))
+        return ''.join(data)
+
+    def pack_empty(self):
+        return ''
+
+
+class Cycle(object):
+    # animation: parent Animation
+    # name: string
+    # fps: float
+    # style: int
+    # frames: tuple2 (frame_start, frame_end)
+    def __init__(self, animation=None):
+        # Ref to Animation.
+        self.animation = animation
+        self.name = 'fullanimation'
+        self.classname = 'AnimCycle'
+        self.fps = 30
+        self.style = 0
+        self.frames = (1, 100)
+
+    def numframes(self):
+        return self.frames[1] - (self.frames[0] - 1)
+
+    def animname(self):
+        return self.name.ljust(64, '\x00')
+
+    def pack(self):
+        data = ['CYCL', struct.pack('<L', 84), struct.pack('<L', 1)]
+        data.append(self.animname())
+        data.append(struct.pack('<f', self.fps))
+        data.append(struct.pack('<L', self.style))
+        data.append(struct.pack('<LL', *self.frames))
+        return ''.join(data)
+
+
+class Bone(object):
+    # Params:
+    #   - collection: class(BoneCollection)
+    def __init__(self, collection=None):
+        # Parent BoneCollection.
+        self.collection = collection
+        self.classname = 'Bone'
+        # Name of the bone(and it's accompanying Model).
+        self.name = ''
+        # CRC checksum of the bone.
+        self.CRC = ''  # msh2_crc.crc(self.name)
+        # The purpose of the following parameters is unclear.
+        self.bone_type = 0
+        self.constrain = 1.0
+        self.bone1len = 0.0
+        self.bone2len = 0.0
+        self.blend_factor = 0
+        self.keyframe_type = 0
+        # List of position frames(x, y, z).
+        self.pos_keyframes = None
+        self.pos_keyframe_indices = None
+        # List of rotation frames(x, y, z, w).
+        self.rot_keyframes = None
+        self.rot_keyframe_indices = None
+
+    def dump(self, fh):
+        w = fh.write
+        w('BONE - {0}\n'.format(self.name))
+        w('\tRotation:\n')
+        for rot in self.rot_keyframes:
+            w('\t\t{0}\n'.format(rot))
+        w('\tTransform:\n')
+        for pos in self.pos_keyframes:
+            w('\t\t{0}\n'.format(pos))
+
+    def recrc(self):
+        '''Calculates a Zero CRC from the name.'''
+        self.CRC = msh2_crc.strcrc(self.name)
+
+    def set_name_from_crc(self):
+        '''Tries to reverse-engineer the CRC into a name
+        via comparing to the CRCs of all models in this .msh.'''
+        if not self.CRC:
+            raise MSH2Error('Bone doesnt have a CRC applied for reverse-engineering.')
+        names = self.collection.get_check_names_list()
+        name = msh2_crc.compare_crc_adv(names, self.CRC)
+        if name:
+            self.name = name
+            self.collection.remove_check_name(name)
+
+    def pack_SKL2(self):
+        '''Packs attributes for the SKL2 chunk.'''
+        data = [self.CRC,
+                struct.pack('<L', self.bone_type),
+                struct.pack('<f', self.constrain),
+                struct.pack('<L', self.bone1len),
+                struct.pack('<L', self.bone2len)]
+        return ''.join(data)
+
+    def pack_BLN2(self):
+        '''Packs attributes for the BLN2 chunk.'''
+        data = [self.CRC,
+                struct.pack('<L', self.blend_factor)]
+        return ''.join(data)
+
+    def pack_KFR3(self):
+        '''Packs position and rotation frames for the KFR3 chunk.'''
+        data = [self.CRC,
+                struct.pack('<L', self.keyframe_type),
+                struct.pack('<L', len(self.pos_keyframes)),
+                struct.pack('<L', len(self.rot_keyframes))]
+        for ndx, frame in enumerate(self.pos_keyframes):
+            data.append(struct.pack('<L', ndx + self.collection.animation.cycle.frames[0]))
+            data.append(struct.pack('<fff', *frame))
+        for ndx, frame in enumerate(self.rot_keyframes):
+            data.append(struct.pack('<L', ndx + self.collection.animation.cycle.frames[0]))
+            data.append(struct.pack('<ffff', *frame))
+        return ''.join(data)
+
+
+class BoneCollection(Packer):
+    # Params:
+    #   - animation: class(Animation)
+    def __init__(self, animation=None):
+        if animation:
+            self.animation = animation
+        else:
+            self.animation = None
+        self.classname = 'BoneCollection'
+        self.bones = []
+        self.check_names = None
+
+    def add(self, bone):
+        '''Adds bone to the collection and sets its
+        collection attribute.'''
+        bone.collection = self
+        self.bones.append(bone)
+
+    def remove(self, index):
+        '''Remove bone at index index.'''
+        del self.bones[index]
+
+    def replace(self, bones):
+        '''Replace internal bones list with bones.'''
+        self.bones = bones
+
+    def get_by_name(self, name):
+        '''Get bone by name.'''
+        for bone in self.bones:
+            if name == bone.name:
+                return bone
+
+    def get_check_names_list(self):
+        '''Returns list of all bone names.
+        This list will be reduced if the name of a bone is found
+        to maximize performance. It's used to calculate the name
+        of a bone by comparing the CRC in the .msh file and a
+        newly generated CRC of every bone in this list.'''
+        if not self.check_names:
+            self.check_names = self.animation.msh.models.get_names_list()
+        return self.check_names
+
+    def remove_check_name(self, name):
+        '''If the name of a bone is matched with a CRC, remove
+        the name from the list to reduce iteration time.'''
+        self.check_names.remove(name)
+
+    def __str__(self):
+        return str(self.bones)
+
+    def __repr__(self):
+        return str(self.bones)
+
+    def __getitem__(self, key):
+        return self.bones[key]
+
+    def __len__(self):
+        return len(self.bones)
+
+    def pack_SKL2(self):
+        data = ['SKL2']
+        data.append(struct.pack('<L', len(self.bones) * 20 + 4))
+        data.append(struct.pack('<L', len(self.bones)))
+        for bone in self.bones:
+            data.append(bone.pack_SKL2())
+        return ''.join(data)
+
+    def pack_BLN2(self):
+        data = ['BLN2']
+        data.append(struct.pack('<L', len(self.bones) * 8 + 4))
+        data.append(struct.pack('<L', len(self.bones)))
+        for bone in self.bones:
+            data.append(bone.pack_BLN2())
+        return ''.join(data)
+
+    def pack_KFR3(self):
+        data = ['KFR3', 'size']
+        data.append(struct.pack('<L', len(self.bones)))
+        for bone in self.bones:
+            data.append(bone.pack_KFR3())
+        data[1] = struct.pack('<L', self.sum_seq(data, 3) + 4)
+        return ''.join(data)
+
+
+class Color(object):
+    def __init__(self, color=None):
+        if color:
+            self.red = color[0]
+            self.green = color[1]
+            self.blue = color[2]
+            self.alpha = color[3]
+        else:
+            self.red = 128
+            self.green = 128
+            self.blue = 128
+            self.alpha = 255
+        self.classname = 'Color'
+
+    def get_json(self):
+        data = {
+            'rgba': self.rgba,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data):
+        col = Color()
+        col.rgba = data['rgba']
+        return col
+
+    @property
+    def rgba(self):
+        return self.red, self.green, self.blue, self.alpha
+
+    @rgba.setter
+    def rgba(self, value):
+        self.red, self.green, self.blue, self.alpha = value
+
+    def get_f(self):
+        if isinstance(self.red, float):
+            return self.red, self.green, self.blue, self.alpha
+        else:
+            return ((self.red / 255.), (self.green / 255.),
+                    (self.blue / 255.), (self.alpha / 255.))
+
+    def get_b(self):
+        if isinstance(self.red, float):
+            return (int(self.red * 255), int(self.green * 255),
+                    int(self.blue * 255), int(self.alpha * 255))
+        else:
+            return self.red, self.green, self.blue, self.alpha
+
+    def get(self):
+        return self.red, self.green, self.blue, self.alpha
+
+    def set(self, r, g, b, a=255):
+        self.red = r
+        self.green = g
+        self.blue = b
+        self.alpha = a
+
+    def __str__(self):
+        return '{0}, {1}, {2}, {3}'.format(self.red, self.green, self.blue, self.alpha)
+
+    def __repr__(self):
+        return self.__str__()
+
+    def pack(self, mode='B'):
+        '''Packs color channels, default type is B(bool).
+        No converting is done, so if you pass f for mode
+        but the values are from 0-255 you will get that
+        value as float.'''
+        return struct.pack('<{0}'.format(mode * 4),
+                           self.red,
+                           self.green,
+                           self.blue,
+                           self.alpha)
+
+    def pack_bgra(self, mode='B'):
+        '''Same as pack but packs into BGRA ordering.'''
+        return struct.pack('<{0}'.format(mode * 4),
+                           self.blue,
+                           self.green,
+                           self.red,
+                           self.alpha)
+
+    
+
+
+class Transform(object):
+    def __init__(self, tra=None, rot=None, sca=None):
+        if rot:
+            self.rotation = rot
+        else:
+            self.rotation = 0.0, 0.0, 0.0, 1.0
+        if tra:
+            self.translation = tra
+        else:
+            self.translation = 0.0, 0.0, 0.0
+        if sca:
+            self.scale = sca
+        else:
+            self.scale = 1.0, 1.0, 1.0
+        self.classname = 'Transform'
+
+    def get_json(self):
+        data = {
+            'position': self.translation,
+            'rotation': self.euler_angles(),
+            'scale': self.scale,
+        }
+        return data
+
+    @classmethod
+    def from_json(cls, data):
+        tr = cls()
+        tr.translation = data['position']
+        tr.rotation = tr.euler_to_quaternion(data['rotation'])
+        tr.scale = data['scale']
+        return tr
+
+    def __str__(self):
+        return 'Pos({0}), Rot({1}), Scl({2})'.format(', '.join([str(i) for i in self.translation]),
+                                                     ', '.join([str(i) for i in self.rotation]),
+                                                     ', '.join([str(i) for i in self.scale]))
+
+    def __repr__(self):
+        return 'Pos({0}), Rot({1}), Scl({2})'.format(', '.join([str(i) for i in self.translation]),
+                                                     ', '.join([str(i) for i in self.rotation]),
+                                                     ', '.join([str(i) for i in self.scale]))
+
+    def pack(self):
+        data = ['TRAN', struct.pack('<L', 40)]
+        data.append(struct.pack('<fff', *self.scale))
+        data.append(struct.pack('<ffff', *self.rotation))
+        data.append(struct.pack('<fff', *self.translation))
+        return ''.join(data)
+
+    def euler_angles(self):
+        '''Returns the internal Quaternion in Euler Angles(radians).'''
+        test = self.rotation[0] * self.rotation[1] + self.rotation[2] * self.rotation[3]
+        if test > 0.499:
+            heading = 2 * math.atan2(self.rotation[0], self.rotation[3])
+            attitude = math.pi / 2
+            bank = 0
+            return math.degrees(heading), math.degrees(attitude), math.degrees(bank)
+        elif test < -0.499:
+            heading = -2 * math.atan2(self.rotation[0], self.rotation[3])
+            attitude = -1 * math.pi / 2
+            bank = 0
+            return math.degrees(heading), math.degrees(attitude), math.degrees(bank)
+        sqx = self.rotation[0] * self.rotation[0]
+        sqy = self.rotation[1] * self.rotation[1]
+        sqz = self.rotation[2] * self.rotation[2]
+        heading = math.atan2((2 * self.rotation[1] * self.rotation[3] -
+                             2 * self.rotation[0] * self.rotation[2]),
+                             1 - 2 * sqy - 2 * sqz)
+        attitude = math.asin(2 * test)
+        bank = math.atan2((2 * self.rotation[0] * self.rotation[3] -
+                          2 * self.rotation[1] * self.rotation[2]),
+                          1 - 2 * sqx - 2 * sqz)
+        return math.degrees(heading), math.degrees(attitude), math.degrees(bank)
+
+    def euler_to_quaternion(self, euler):
+        c1 = math.cos(math.radians(euler[0] / 2))
+        s1 = math.sin(math.radians(euler[0] / 2))
+        c2 = math.cos(math.radians(euler[1] / 2))
+        s2 = math.sin(math.radians(euler[1] / 2))
+        c3 = math.cos(math.radians(euler[2] / 2))
+        s3 = math.sin(math.radians(euler[2] / 2))
+        c1c2 = c1 * c2
+        s1s2 = s1 * s2
+        w = c1c2 * c3 - s1s2 * s3
+        x = c1c2 * s3 + s1s2 * c3
+        y = s1 * c2 * c3 + c1 * s2 * s3
+        z = c1 * s2 * c3 - s1 * c2 * s3
+        self.rotation = x, y, z, w
+        return x, y, z, w
+
+    def reversed_quaternion(self):
+        '''Returns the Quaternion as W, X, Y, Z.'''
+        return self.rotation[3], self.rotation[0], self.rotation[1], self.rotation[2]
+
+
+class BBox(Transform):
+    def __init__(self):
+        self.rotation = 0.0, 0.0, 0.0, 1.0
+        self.extents = 4.0, 4.0, 4.0
+        self.center = 0.0, 0.0, 0.0
+        self.radius = 6.92
+        self.classname = 'BBox'
+
+    def get_json(self):
+        data = {
+            'rotation': self.euler_angles(),
+            'extents': self.extents,
+            'center': self.center,
+            'radius': self.radius,
+        }
+        return data
+
+    @staticmethod
+    def from_json(data):
+        b = BBox()
+        b.rotation = b.euler_to_quaternion(data['rotation'])
+        b.extents = data['extents']
+        b.center = data['center']
+        b.radius = data['radius']
+        return b
+
+    def pack(self):
+        data = ['BBOX', struct.pack('<L', 44)]
+        data.append(struct.pack('<ffff', *self.rotation))
+        data.append(struct.pack('<fff', *self.center))
+        data.append(struct.pack('<fff', *self.extents))
+        data.append(struct.pack('<f', self.radius))
+        return ''.join(data)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2_crc.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2_crc.py
new file mode 100644
index 0000000..8f52103
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2_crc.py
@@ -0,0 +1,149 @@
+'''
+    ZeroEngine .msh model format CRC algorithm.
+
+    Refer to
+       schlechtwetterfront.github.io/ze_filetypes/msh.html
+   for more information regarding the file format.
+'''
+from struct import pack
+
+
+class CRCError(Exception):
+    def __init__(self, val):
+        self.val = val
+
+    def __str__(self):
+        return '{0}'.format(self.val)
+
+# CRC lookup table.
+TABLE_32 = (
+    0x00000000, 0x04C11DB7, 0x09823B6E, 0x0D4326D9,
+    0x130476DC, 0x17C56B6B, 0x1A864DB2, 0x1E475005,
+    0x2608EDB8, 0x22C9F00F, 0x2F8AD6D6, 0x2B4BCB61,
+    0x350C9B64, 0x31CD86D3, 0x3C8EA00A, 0x384FBDBD,
+    0x4C11DB70, 0x48D0C6C7, 0x4593E01E, 0x4152FDA9,
+    0x5F15ADAC, 0x5BD4B01B, 0x569796C2, 0x52568B75,
+    0x6A1936C8, 0x6ED82B7F, 0x639B0DA6, 0x675A1011,
+    0x791D4014, 0x7DDC5DA3, 0x709F7B7A, 0x745E66CD,
+    0x9823B6E0, 0x9CE2AB57, 0x91A18D8E, 0x95609039,
+    0x8B27C03C, 0x8FE6DD8B, 0x82A5FB52, 0x8664E6E5,
+    0xBE2B5B58, 0xBAEA46EF, 0xB7A96036, 0xB3687D81,
+    0xAD2F2D84, 0xA9EE3033, 0xA4AD16EA, 0xA06C0B5D,
+    0xD4326D90, 0xD0F37027, 0xDDB056FE, 0xD9714B49,
+    0xC7361B4C, 0xC3F706FB, 0xCEB42022, 0xCA753D95,
+    0xF23A8028, 0xF6FB9D9F, 0xFBB8BB46, 0xFF79A6F1,
+    0xE13EF6F4, 0xE5FFEB43, 0xE8BCCD9A, 0xEC7DD02D,
+    0x34867077, 0x30476DC0, 0x3D044B19, 0x39C556AE,
+    0x278206AB, 0x23431B1C, 0x2E003DC5, 0x2AC12072,
+    0x128E9DCF, 0x164F8078, 0x1B0CA6A1, 0x1FCDBB16,
+    0x018AEB13, 0x054BF6A4, 0x0808D07D, 0x0CC9CDCA,
+    0x7897AB07, 0x7C56B6B0, 0x71159069, 0x75D48DDE,
+    0x6B93DDDB, 0x6F52C06C, 0x6211E6B5, 0x66D0FB02,
+    0x5E9F46BF, 0x5A5E5B08, 0x571D7DD1, 0x53DC6066,
+    0x4D9B3063, 0x495A2DD4, 0x44190B0D, 0x40D816BA,
+    0xACA5C697, 0xA864DB20, 0xA527FDF9, 0xA1E6E04E,
+    0xBFA1B04B, 0xBB60ADFC, 0xB6238B25, 0xB2E29692,
+    0x8AAD2B2F, 0x8E6C3698, 0x832F1041, 0x87EE0DF6,
+    0x99A95DF3, 0x9D684044, 0x902B669D, 0x94EA7B2A,
+    0xE0B41DE7, 0xE4750050, 0xE9362689, 0xEDF73B3E,
+    0xF3B06B3B, 0xF771768C, 0xFA325055, 0xFEF34DE2,
+    0xC6BCF05F, 0xC27DEDE8, 0xCF3ECB31, 0xCBFFD686,
+    0xD5B88683, 0xD1799B34, 0xDC3ABDED, 0xD8FBA05A,
+    0x690CE0EE, 0x6DCDFD59, 0x608EDB80, 0x644FC637,
+    0x7A089632, 0x7EC98B85, 0x738AAD5C, 0x774BB0EB,
+    0x4F040D56, 0x4BC510E1, 0x46863638, 0x42472B8F,
+    0x5C007B8A, 0x58C1663D, 0x558240E4, 0x51435D53,
+    0x251D3B9E, 0x21DC2629, 0x2C9F00F0, 0x285E1D47,
+    0x36194D42, 0x32D850F5, 0x3F9B762C, 0x3B5A6B9B,
+    0x0315D626, 0x07D4CB91, 0x0A97ED48, 0x0E56F0FF,
+    0x1011A0FA, 0x14D0BD4D, 0x19939B94, 0x1D528623,
+    0xF12F560E, 0xF5EE4BB9, 0xF8AD6D60, 0xFC6C70D7,
+    0xE22B20D2, 0xE6EA3D65, 0xEBA91BBC, 0xEF68060B,
+    0xD727BBB6, 0xD3E6A601, 0xDEA580D8, 0xDA649D6F,
+    0xC423CD6A, 0xC0E2D0DD, 0xCDA1F604, 0xC960EBB3,
+    0xBD3E8D7E, 0xB9FF90C9, 0xB4BCB610, 0xB07DABA7,
+    0xAE3AFBA2, 0xAAFBE615, 0xA7B8C0CC, 0xA379DD7B,
+    0x9B3660C6, 0x9FF77D71, 0x92B45BA8, 0x9675461F,
+    0x8832161A, 0x8CF30BAD, 0x81B02D74, 0x857130C3,
+    0x5D8A9099, 0x594B8D2E, 0x5408ABF7, 0x50C9B640,
+    0x4E8EE645, 0x4A4FFBF2, 0x470CDD2B, 0x43CDC09C,
+    0x7B827D21, 0x7F436096, 0x7200464F, 0x76C15BF8,
+    0x68860BFD, 0x6C47164A, 0x61043093, 0x65C52D24,
+    0x119B4BE9, 0x155A565E, 0x18197087, 0x1CD86D30,
+    0x029F3D35, 0x065E2082, 0x0B1D065B, 0x0FDC1BEC,
+    0x3793A651, 0x3352BBE6, 0x3E119D3F, 0x3AD08088,
+    0x2497D08D, 0x2056CD3A, 0x2D15EBE3, 0x29D4F654,
+    0xC5A92679, 0xC1683BCE, 0xCC2B1D17, 0xC8EA00A0,
+    0xD6AD50A5, 0xD26C4D12, 0xDF2F6BCB, 0xDBEE767C,
+    0xE3A1CBC1, 0xE760D676, 0xEA23F0AF, 0xEEE2ED18,
+    0xF0A5BD1D, 0xF464A0AA, 0xF9278673, 0xFDE69BC4,
+    0x89B8FD09, 0x8D79E0BE, 0x803AC667, 0x84FBDBD0,
+    0x9ABC8BD5, 0x9E7D9662, 0x933EB0BB, 0x97FFAD0C,
+    0xAFB010B1, 0xAB710D06, 0xA6322BDF, 0xA2F33668,
+    0xBCB4666D, 0xB8757BDA, 0xB5365D03, 0xB1F740B4
+)
+
+# Used to calculate the lowercase CRC.
+TOLOWER = (
+    0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06, 0x07,
+    0x08, 0x09, 0x0a, 0x0b, 0x0c, 0x0d, 0x0e, 0x0f,
+    0x10, 0x11, 0x12, 0x13, 0x14, 0x15, 0x16, 0x17,
+    0x18, 0x19, 0x1a, 0x1b, 0x1c, 0x1d, 0x1e, 0x1f,
+    0x20, 0x21, 0x22, 0x23, 0x24, 0x25, 0x26, 0x27,
+    0x28, 0x29, 0x2a, 0x2b, 0x2c, 0x2d, 0x2e, 0x2f,
+    0x30, 0x31, 0x32, 0x33, 0x34, 0x35, 0x36, 0x37,
+    0x38, 0x39, 0x3a, 0x3b, 0x3c, 0x3d, 0x3e, 0x3f,
+    0x40, 0x61, 0x62, 0x63, 0x64, 0x65, 0x66, 0x67,
+    0x68, 0x69, 0x6a, 0x6b, 0x6c, 0x6d, 0x6e, 0x6f,
+    0x70, 0x71, 0x72, 0x73, 0x74, 0x75, 0x76, 0x77,
+    0x78, 0x79, 0x7a, 0x5b, 0x5c, 0x5d, 0x5e, 0x5f,
+    0x60, 0x61, 0x62, 0x63, 0x64, 0x65, 0x66, 0x67,
+    0x68, 0x69, 0x6a, 0x6b, 0x6c, 0x6d, 0x6e, 0x6f,
+    0x70, 0x71, 0x72, 0x73, 0x74, 0x75, 0x76, 0x77,
+    0x78, 0x79, 0x7a, 0x7b, 0x7c, 0x7d, 0x7e, 0x7f,
+    0x80, 0x81, 0x82, 0x83, 0x84, 0x85, 0x86, 0x87,
+    0x88, 0x89, 0x8a, 0x8b, 0x8c, 0x8d, 0x8e, 0x8f,
+    0x90, 0x91, 0x92, 0x93, 0x94, 0x95, 0x96, 0x97,
+    0x98, 0x99, 0x9a, 0x9b, 0x9c, 0x9d, 0x9e, 0x9f,
+    0xa0, 0xa1, 0xa2, 0xa3, 0xa4, 0xa5, 0xa6, 0xa7,
+    0xa8, 0xa9, 0xaa, 0xab, 0xac, 0xad, 0xae, 0xaf,
+    0xb0, 0xb1, 0xb2, 0xb3, 0xb4, 0xb5, 0xb6, 0xb7,
+    0xb8, 0xb9, 0xba, 0xbb, 0xbc, 0xbd, 0xbe, 0xbf,
+    0xc0, 0xc1, 0xc2, 0xc3, 0xc4, 0xc5, 0xc6, 0xc7,
+    0xc8, 0xc9, 0xca, 0xcb, 0xcc, 0xcd, 0xce, 0xcf,
+    0xd0, 0xd1, 0xd2, 0xd3, 0xd4, 0xd5, 0xd6, 0xd7,
+    0xd8, 0xd9, 0xda, 0xdb, 0xdc, 0xdd, 0xde, 0xdf,
+    0xe0, 0xe1, 0xe2, 0xe3, 0xe4, 0xe5, 0xe6, 0xe7,
+    0xe8, 0xe9, 0xea, 0xeb, 0xec, 0xed, 0xee, 0xef,
+    0xf0, 0xf1, 0xf2, 0xf3, 0xf4, 0xf5, 0xf6, 0xf7,
+    0xf8, 0xf9, 0xfa, 0xfb, 0xfc, 0xfd, 0xfe, 0xff
+)
+
+
+def return_lowest_bits(n):
+    '''Simulate unsigned behavior.'''
+    return n & 0xFFFFFFFF
+
+
+def crc(string):
+    '''Calculate the Zero CRC from string and return it as number.'''
+    crc_ = 0
+    crc_ = return_lowest_bits(~crc_)
+    if string:
+        for char in string:
+            ind = (crc_ >> 24)
+            ind = ind ^ TOLOWER[ord(char)]
+            crc_ = return_lowest_bits(crc_ << 8) ^ TABLE_32[ind]
+    return return_lowest_bits(~crc_)
+
+
+def strcrc(string):
+    '''Calculate the Zero CRC and return it in a structure
+    usable in .msh files.'''
+    return pack('<I', crc(string))
+
+
+def compare_crc_adv(possible_strings, crc_):
+    for string in possible_strings:
+        if crc_ == strcrc(string):
+            return string
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2_unpack.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2_unpack.py
new file mode 100644
index 0000000..8729c77
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/msh2_unpack.py
@@ -0,0 +1,596 @@
+'''
+    ZeroEngine .msh model format parser.
+
+    Refer to
+       schlechtwetterfront.github.io/ze_filetypes/msh.html
+   for more information regarding the file format.
+'''
+import msh2
+reload(msh2)
+from struct import unpack as unpack
+import logging
+
+STR_CODEC = 'utf-8'
+CHUNK_LIST = ['HEDR', 'SHVO', 'MSH2',
+              'SINF', 'FRAM', 'CAMR',
+              'MATL', 'DATA', 'MATD', 'ATRB', 'TX0D', 'TX1D', 'TX2D', 'TX3D',
+              'MODL', 'MTYP', 'MNDX', 'PRNT', 'FLGS', 'TRAN', 'ENVL', 'SWCI',
+              'GEOM', 'SEGM', 'SHDW', 'MATI', 'POSL', 'NRML', 'UV0L', 'UV1L',
+              'UV2L', 'CLRL', 'CLRB', 'WGHT', 'NDXL', 'NDXT', 'STRP',
+              'CLTH', 'CTEX', 'CPOS', 'CUV0', 'FIDX', 'FWGT', 'SPRS', 'CPRS',
+              'BPRS', 'COLL',
+              'SKL2', 'BLN2', 'ANM2', 'CYCL', 'KFR3',
+              'NAME', 'BBOX', 'CL1L']
+
+
+class UnpackError(Exception):
+    def __init__(self, val):
+        self.val = val
+
+    def __str__(self):
+        return str(self.val)
+
+
+class Unpacker(object):
+    def unpack_header(self, data):
+        return data[:4], unpack('<L', data[4:])[0]
+
+    def unpack_str(self, data):
+        pass
+
+    def log(self, text):
+        logging.debug(text)
+
+    def dont_log(self, *text):
+        pass
+
+    def long(self, data):
+        return unpack('<L', data)[0]
+
+    def short(self, data):
+        return unpack('<H', data)[0]
+
+    def float(self, data):
+        return unpack('<f', data)[0]
+
+
+class BBoxUnpacker(Unpacker):
+    def __init__(self, data):
+        self.bbox = msh2.BBox()
+        self.data = data
+
+    def unpack(self):
+        self.bbox.rotation = unpack('<ffff', self.data[:16])
+        self.bbox.center = unpack('<fff', self.data[16:28])
+        self.bbox.extents = unpack('<fff', self.data[28:40])
+        self.bbox.radius = unpack('<f', self.data[40:])[0]
+        return self.bbox
+
+
+class MSHUnpack(Unpacker):
+    def __init__(self, mshfile, config={'do_logging': False,
+                                        'ignore_geo': False,
+                                        'triangulate': False}):
+        self.mshfile = mshfile
+        self.msh = msh2.Msh()
+        self.msh.animation = msh2.Animation(self.msh, 'maybe_empty')
+        self.config = config
+        if not config['do_logging']:
+            self.log = self.dont_log
+
+    def unpack(self):
+        with open(self.mshfile, 'rb') as mf:
+            # HEDR
+            bin, self.size = self.unpack_header(mf.read(8))
+            # MSH2 or SHVO
+            bin, self.msh2size = self.unpack_header(mf.read(8))
+            if bin == 'SHVO':
+                self.log('Skipping SHVO chunk.')
+                # Read the 4 content bytes of SHVO.
+                mf.read(4)
+                # that's definitely MSH2
+                bin, self.msh2size = self.unpack_header(mf.read(8))
+            mdlcoll = msh2.ModelCollection(self.msh)
+            self.msh.models = mdlcoll
+            while True:
+                hdr, size = self.unpack_header(mf.read(8))
+                self.log('Header, Size: {0}, {1}'.format(hdr, size))
+                if hdr == 'SINF':
+                    si = InfoUnpacker(self, size, mf)
+                    self.msh.info = si.unpack()
+                elif hdr == 'MATL':
+                    num_materials = unpack('<L', mf.read(4))[0]
+                    matcoll = msh2.MaterialCollection(self.msh)
+                    for n in xrange(num_materials):
+                        mat, matsize = self.unpack_header(mf.read(8))
+                        self.log('Material, Size: {0}, {1}'.format(mat, matsize))
+                        mat = MaterialUnpacker(self, matsize, mf)
+                        matcoll.add(mat.unpack())
+                    matcoll.assign_indices()
+                    self.msh.materials = matcoll
+                elif hdr == 'MODL':
+                    mdl = ModelUnpacker(self, size, mf)
+                    mdlcoll.add(mdl.unpack())
+                elif hdr == 'CAMR':
+                    mf.read(size)
+                elif hdr == 'LGHT':
+                    mf.read(size)
+                elif hdr == 'SKL2':
+                    numbones = unpack('<L', mf.read(4))[0]
+                    bonecoll = msh2.BoneCollection(self.msh.animation)
+                    for n in xrange(numbones):
+                        bone = msh2.Bone(bonecoll)
+                        bone.CRC = mf.read(4)
+                        bone.set_name_from_crc()
+                        bone.bone_type = unpack('<L', mf.read(4))[0]
+                        bone.constrain = unpack('<f', mf.read(4))[0]
+                        bone.bone1len = unpack('<f', mf.read(4))[0]
+                        bone.bone2len = unpack('<f', mf.read(4))[0]
+                        bonecoll.add(bone)
+                    self.msh.animation.bones = bonecoll
+                elif hdr == 'BLN2':
+                    # Ignore BLN2 as this only has one attribute(blend_factor).
+                    # It's not clear which type this is and it's not important.
+                    mf.read(size)
+                elif hdr == 'ANM2':
+                    # Continue as this is only a header.
+                    continue
+                elif hdr == 'CYCL':
+                    num_cycles = unpack('<L', mf.read(4))[0]
+                    cycles = []
+                    for n in xrange(num_cycles):
+                        cycle = msh2.Cycle(self.msh.animation)
+                        cycle.name = mf.read(64).strip('\x00')
+                        cycle.fps = unpack('<f', mf.read(4))[0]
+                        cycle.style = unpack('<L', mf.read(4))[0]
+                        cycle.frames = unpack('<LL', mf.read(8))
+                        cycles.append(cycle)
+                    self.msh.animation.cycles = cycles
+                    self.msh.animation.cycle = cycles[0]
+                elif hdr == 'KFR3':
+                    numbones = unpack('<L', mf.read(4))[0]
+                    for n in xrange(numbones):
+                        # Ingore the crc, usually the same order as before.
+                        mf.read(4)
+                        bone = self.msh.animation.bones[n]
+                        bone.keyframe_type = unpack('<L', mf.read(4))[0]
+                        numtran, numrot = unpack('<LL', mf.read(8))
+                        tran = []
+                        translation_frame_indices = []
+                        rot = []
+                        rotation_frame_indices = []
+                        for i in xrange(numtran):
+                            # Ignore the frame index.
+                            translation_frame_indices.append(unpack('<L', mf.read(4))[0])
+                            # Add X, Y, Z position tuple.
+                            tran.append(unpack('<fff', mf.read(12)))
+                        for i in xrange(numrot):
+                            # Again, ignore the frame index.
+                            rotation_frame_indices.append(unpack('<L', mf.read(4))[0])
+                            # X, Y, Z, W quaternion translation tuple.
+                            rot.append(unpack('<ffff', mf.read(16)))
+                        bone.pos_keyframes = tran
+                        bone.pos_keyframe_indices = translation_frame_indices
+                        bone.rot_keyframes = rot
+                        bone.rot_keyframe_indices = rotation_frame_indices
+                elif hdr == 'CL1L':
+                    break
+                else:
+                    self.log('Unrecognized chunk {0} in MSHUnpack.'.format(hdr))
+                    raise UnpackError('Unrecognized chunk {0} in MSHUnpack (can be a valid chunk but doesnt fit into this unpack level).'.format(hdr))
+                    break
+        for model in self.msh.models:
+            model.set_deformers_from_indices()
+        return self.msh
+
+
+class ModelUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.size = size
+        self.fh = fh
+        self.mdl = msh2.Model(up.msh)
+        self.up = up
+        self.log = up.log
+
+    def unpack(self):
+        self.log('Unpacking Model at {0}.'.format(self.fh.tell() - 8))
+        while True:
+            hdr, size = self.unpack_header(self.fh.read(8))
+            self.log('Model: Header, Size: {0}, {1}'.format(hdr, size))
+            if hdr == 'MTYP':
+                self.mdl.model_type = msh2.MODEL_TYPES_INT[unpack('<L', self.fh.read(4))[0]]
+            # RepSharpshooters MshEx exports MTYP as MYTP. Should work since the format update.
+            elif hdr == 'MYTP':
+                logging.info('Found RepSharpshooter MshEx type .msh. Continuing the import.')
+                self.mdl.model_type = msh2.MODEL_TYPES_INT[unpack('<L', self.fh.read(4))[0]]
+            elif hdr == 'NAME':
+                self.mdl.name = self.fh.read(size).strip('\x00')
+            elif hdr == 'MNDX':
+                self.mdl.index = unpack('<L', self.fh.read(4))[0]
+            elif hdr == 'PRNT':
+                self.mdl.parent_name = self.fh.read(size).strip('\x00').encode(STR_CODEC)
+            elif hdr == 'FLGS':
+                self.mdl.vis = unpack('<L', self.fh.read(4))[0]
+            elif hdr == 'TRAN':
+                scl = unpack('<fff', self.fh.read(12))
+                rot = unpack('<ffff', self.fh.read(16))
+                tra = unpack('<fff', self.fh.read(12))
+                self.mdl.transform = msh2.Transform(tra, rot, scl)
+            elif hdr == 'GEOM':
+                if self.up.config['ignore_geo']:
+                    self.fh.read(size)
+                    continue
+                # If this is a bone(MTYP 3) then set model type to geobone as
+                # it has geometry, too.
+                if self.mdl.model_type == 'bone':
+                    self.mdl.model_type = 'geobone'
+                # Ignore the bbox header and size indicator. We dont need it.
+                self.fh.read(8)
+                bb = BBoxUnpacker(self.fh.read(44))
+                self.mdl.bbox = bb.unpack()
+                self.mdl.segments = msh2.SegmentCollection(self.mdl)
+                while True:
+                    soc, ssize = self.unpack_header(self.fh.read(8))
+                    self.log('Model Segments: Header, Size: {0}, {1}'.format(soc, ssize))
+                    if soc == 'SEGM':
+                        segm = GeometryUnpacker(self, ssize, self.fh)
+                        self.mdl.segments.add(segm.unpack())
+                    elif soc == 'CLTH':
+                        segm = ClothUnpacker(self, ssize, self.fh)
+                        self.mdl.segments.add(segm.unpack())
+                    elif soc == 'ENVL':
+                        num = unpack('<L', self.fh.read(4))[0]
+                        inds = []
+                        for n in xrange(num):
+                            inds.append(unpack('<L', self.fh.read(4))[0])
+                        self.mdl.deformer_indices = inds
+                    else:
+                        self.log('Unrecognized chunk {0} in ModelUnpack(Geometry).'.format(soc))
+                        self.fh.seek(self.fh.tell() - 8)
+                        break
+            elif hdr == 'SWCI':
+                self.mdl.collprim = True
+                prim_data = unpack('<Lfff', self.fh.read(16))
+                self.mdl.primitive = (prim_data[0], prim_data[1],
+                                      prim_data[2], prim_data[3])
+            else:
+                self.log('Unrecognized chunk {0} in ModelUnpack.'.format(hdr))
+                # Return to the position before the header.
+                self.fh.seek(self.fh.tell() - 8)
+                break
+        return self.mdl
+
+
+class ClothUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.up = up
+        self.size = size
+        self.fh = fh
+        self.seg = msh2.ClothGeometry(up.mdl)
+        self.log = up.log
+
+    def unpack(self):
+        self.log('Unpacking Cloth.')
+        fixed = []
+        while True:
+            hdr, size = self.unpack_header(self.fh.read(8))
+            logging.debug('Cloth: Header, Size: {0}, {1}'.format(hdr, size))
+            if hdr == 'CTEX':
+                self.seg.texture = self.fh.read(size).strip('\x00').encode(STR_CODEC)
+            elif hdr == 'CPOS':
+                vertcoll = msh2.ClothVertexCollection(self.seg)
+                num = unpack('<L', self.fh.read(4))[0]
+                for n in xrange(num):
+                    pos = unpack('<fff', self.fh.read(12))
+                    vert = msh2.ClothVertex(pos)
+                    vertcoll.add(vert)
+                self.seg.vertices = vertcoll
+            elif hdr == 'CUV0':
+                num = unpack('<L', self.fh.read(4))[0]
+                for n in xrange(num):
+                    self.seg.vertices[n].uv = unpack('<ff', self.fh.read(8))
+            elif hdr == 'FIDX':
+                num = unpack('<L', self.fh.read(4))[0]
+                for n in xrange(num):
+                    index = unpack('<L', self.fh.read(4))[0]
+                    fixed.append(index)
+                    self.seg.vertices[index].is_fixed = True
+            elif hdr == 'FWGT':
+                self.fh.read(4)  # Number of points.
+                weights = self.fh.read(size - 4).split('\x00')
+                logging.debug('Cloth Deformers: {0}'.format(weights))
+                logging.debug('Cloth Fixed Points: {0}'.format(len(fixed)))
+                weights.remove('')
+                if len(weights) > 0:
+                    for index, vertindex in enumerate(fixed):
+                        self.seg.vertices[vertindex].deformer = weights[index]
+            elif hdr == 'CMSH':
+                num = unpack('<L', self.fh.read(4))[0]
+                facecoll = msh2.FaceCollection(self.seg)
+                for n in xrange(num):
+                    face = msh2.Face()
+                    face.vertices = unpack('<LLL', self.fh.read(12))
+                    facecoll.add(face)
+                self.seg.faces = facecoll
+            elif hdr == 'SPRS':
+                num_constraints = self.long(self.fh.read(4))
+                s_constraints = []
+                for n in xrange(num_constraints):
+                    s_constraints.append(unpack('<HH', self.fh.read(4)))
+                self.seg.stretch_constraints = s_constraints
+            elif hdr == 'CPRS':
+                num_constraints = self.long(self.fh.read(4))
+                c_constraints = []
+                for n in xrange(num_constraints):
+                    c_constraints.append(unpack('<HH', self.fh.read(4)))
+                self.seg.cross_constraints = c_constraints
+            elif hdr == 'BPRS':
+                num_constraints = self.long(self.fh.read(4))
+                b_constraints = []
+                for n in xrange(num_constraints):
+                    b_constraints.append(unpack('<HH', self.fh.read(4)))
+                self.seg.bend_constraints = b_constraints
+            elif hdr == 'COLL':
+                num_colls = self.long(self.fh.read(4))
+                for n in xrange(num_colls):
+                    collision = msh2.ClothCollision()
+                    collision.cloth = self.seg
+                    name = []
+                    while 1:
+                        char = self.fh.read(1)
+                        if char == '\x00':
+                            break
+                        name.append(char)
+                    collision.name = ''.join(name)
+                    parent = []
+                    while 1:
+                        char = self.fh.read(1)
+                        if char == '\x00':
+                            break
+                        parent.append(char)
+                    collision.parent = ''.join(parent)
+                    collision.primitive_type = unpack('<L', self.fh.read(4))[0]
+                    collision.primitive_data = unpack('<fff', self.fh.read(12))
+                    self.seg.collisions.append(collision)
+                # COLL chunk seems to be padded with \x00 at the end to get an even size indicator.
+                while True:
+                    if self.fh.read(1) == '\x00':
+                        continue
+                    else:
+                        self.fh.seek(self.fh.tell() - 1)
+                        break
+            else:
+                self.log('Unrecognized chunk {0} in ClothUnpack.'.format(hdr))
+                # Return to the position before the header.
+                self.fh.seek(self.fh.tell() - 8)
+                break
+        return self.seg
+
+
+class GeometryUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.up = up
+        self.size = size
+        self.fh = fh
+        # Either SegmentGeometry or ShadowGeometry.
+        # Usually it's SegmentGeometry so we'll set it as default.
+        # Cloth doesn't have the SEGM chunk we read before we got here.
+        self.seg = msh2.SegmentGeometry(up.mdl)
+        self.log = up.log
+
+    def unpack(self):
+        # Now we have to check which type of segment it is.
+        # Most common will be static meshes, then maybe shadows,
+        # then enveloped.
+        # Enveloped and static meshes share most of the chunks,
+        # however, shadows meshes only have one chunk.
+        self.log('Unpacking Geometry.')
+        self.up.up.last_chunk = None
+        while True:
+            # The SEGM header is already gone so read the next one.
+            hdr, size = self.unpack_header(self.fh.read(8))
+            self.log('Geo: Header, Size: {0}, {1}'.format(hdr, size))
+            if hdr == 'SHDW':
+                self.up.up.last_chunk = 'SHDW'
+                self.seg = msh2.ShadowGeometry(self.up.mdl)
+                # self.seg.data = self.fh.read(size)
+                num_pos = self.long(self.fh.read(4))
+                positions = []
+                for n in xrange(num_pos):
+                    positions.append((self.float(self.fh.read(4)), self.float(self.fh.read(4)), self.float(self.fh.read(4))))
+                num_edges = self.long(self.fh.read(4))
+                edges = []
+                for n in xrange(num_edges):
+                    edge = self.short(self.fh.read(2)), self.short(self.fh.read(2)), self.short(self.fh.read(2)), self.short(self.fh.read(2))
+                    edges.append(edge)
+                self.seg.positions = positions
+                self.seg.edges = edges
+            elif hdr == 'MATI':
+                self.up.up.last_chunk = 'MATI'
+                # 1st up: ModelUnpacker, 2nd up: MSHUnpack
+                self.seg.material = self.up.up.msh.get_mat_by_index(unpack('<L', self.fh.read(4))[0])
+                self.seg.mat_name = self.seg.material.name
+            elif hdr == 'POSL':
+                self.up.up.last_chunk = 'POSL'
+                num_positions = unpack('<L', self.fh.read(4))[0]
+                vertcoll = msh2.VertexCollection(self.seg)
+                for n in xrange(num_positions):
+                    pos = self.fh.read(12)
+                    pos = unpack('<fff', pos)
+                    vert = msh2.Vertex(pos)
+                    vertcoll.add(vert)
+                self.seg.vertices = vertcoll
+            elif hdr == 'NRML':
+                self.up.up.last_chunk = 'NRML'
+                num_normals = unpack('<L', self.fh.read(4))[0]
+                for n in xrange(num_normals):
+                    self.seg.vertices[n].normal = unpack('<fff', self.fh.read(12))
+            elif hdr == 'UV0L':
+                self.up.up.last_chunk = 'UV0L'
+                num_uvs = unpack('<L', self.fh.read(4))[0]
+                for n in xrange(num_uvs):
+                    self.seg.vertices[n].uv = unpack('<ff', self.fh.read(8))
+                self.seg.vertices.uved = True
+            elif hdr in ('UV1L', 'UV2L', 'UV3L'):
+                # Never seen UV2L + but just to be sure.
+                self.fh.read(size)
+            elif hdr == 'CLRL':
+                self.up.up.last_chunk = 'CLRL'
+                num_colors = unpack('<L', self.fh.read(4))[0]
+                for n in xrange(num_colors):
+                    bgra_color = unpack('<BBBB', self.fh.read(4))
+                    self.seg.vertices[n].color = msh2.Color((bgra_color[2], bgra_color[1], bgra_color[0], bgra_color[3]))
+                self.seg.vertices.colored = True
+            elif hdr == 'CLRB':
+                self.up.up.last_chunk = 'CLRB'
+                bgra_color = unpack('<BBBB', self.fh.read(4))
+                color = (bgra_color[2], bgra_color[1], bgra_color[0], bgra_color[3])
+                for vert in self.seg.vertices:
+                    vert.color = msh2.Color(color)
+                self.seg.vertices.colored = True
+            elif hdr == 'WGHT':
+                last_chunk = 'WGHT'
+                num = unpack('<L', self.fh.read(4))[0]
+                for n in xrange(num):
+                    indices = []
+                    vals = []
+                    for i in xrange(4):
+                        indices.append(unpack('<L', self.fh.read(4))[0])
+                        vals.append(unpack('<f', self.fh.read(4))[0])
+                    self.seg.vertices[n].deformer_indices = indices
+                    self.seg.vertices[n].weights = vals
+                self.seg.vertices.weighted = True
+            elif hdr == 'STRP':
+                last_chunk = 'STRP'
+                num = unpack('<L', self.fh.read(4))[0]
+                facecoll = msh2.FaceCollection(self.seg)
+                num_begins = 0
+                for n in xrange(num):
+                    val = unpack('<H', self.fh.read(2))[0]
+                    if (val - 0x8000) > -1:
+                        if num_begins == 0:
+                            num_begins += 1
+                            face = msh2.Face()
+                            facecoll.add(face)
+                        elif num_begins == 1:
+                            num_begins += 1
+                            if face.sides > 2:
+                                face = msh2.Face()
+                                facecoll.add(face)
+                                num_begins = 0
+                        elif num_begins == 2:
+                            num_begins = 1
+                            face = msh2.Face()
+                            facecoll.add(face)
+                        face.add(val - 0x8000)
+                    else:
+                        face.add(val)
+                facecoll.de_ngonize(self.up.up.config['triangulate'])
+                self.seg.faces = facecoll
+            elif hdr == 'NDXL':
+                last_chunk = 'NDXL'
+                self.fh.read(size)
+            elif hdr == 'NDXT':
+                last_chunk = 'NDXT'
+
+                # If the faces are already set (for example from the STRP chunk)
+                # then ignore this as it's usually deprecated.
+                if self.seg.faces:
+                    continue
+
+                num_triangles = unpack('<L', self.fh.read(4))[0]
+
+                logging.info('Sizes: %d == %d', num_triangles * 6 + 4, size)
+
+                faces = msh2.FaceCollection(self.seg)
+
+                for n in range(num_triangles):
+                    face = msh2.Face(list(unpack('<HHH', self.fh.read(2 * 3))))
+                    faces.add(face)
+
+                self.seg.faces = faces
+
+                # If there are any bytes left (which seems to happen in some
+                # .msh files), skip them.
+                used_bytes = len(faces) * 6 + 4
+                if used_bytes < size:
+                    self.fh.read(size - used_bytes)
+            else:
+                if hdr not in CHUNK_LIST:
+                    if last_chunk == 'STRP':
+                        self.log('Fixing STRP chunk import.')
+                        self.fh.seek(self.fh.tell() - 8)
+                        self.fh.read(2)
+                        continue
+                self.log('Unrecognized chunk {0} in GeometryUnpack.'.format(hdr))
+                # Return to the position before the header.
+                self.fh.seek(self.fh.tell() - 8)
+                break
+        return self.seg
+
+
+class MaterialUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.size = size
+        self.fh = fh
+        self.mat = msh2.Material(up.msh)
+        self.log = up.log
+
+    def unpack(self):
+        self.log('Unpacking Material.')
+        # NAME chunk.
+        bin, size = self.unpack_header(self.fh.read(8))
+        bin, size
+        self.mat.name = self.fh.read(size).strip('\x00')
+        self.mat.name
+        # DATA chunk.
+        self.fh.read(8)
+        self.mat.diff_color = msh2.Color(unpack('<ffff', self.fh.read(16)))
+        self.mat.spec_color = msh2.Color(unpack('<ffff', self.fh.read(16)))
+        self.mat.ambt_color = msh2.Color(unpack('<ffff', self.fh.read(16)))
+        self.mat.gloss = unpack('<f', self.fh.read(4))[0]
+        # ATRB chunk.
+        self.fh.read(8)
+        self.mat.flags = self.mat.flags_from_int(unpack('<B', self.fh.read(1))[0])
+        self.mat.render_type, self.mat.data0, self.mat.data1 = unpack('<BBB', self.fh.read(3))
+        # Textures.
+        for n in xrange(4):
+            hdr, size = self.unpack_header(self.fh.read(8))
+            self.log('TX header, size: {0}, {1}'.format(hdr, size))
+            if hdr[:2] == 'TX':
+                if hdr[2] == '0':
+                    self.mat.tex0 = self.fh.read(size).strip('\x00').encode(STR_CODEC)
+                elif hdr[2] == '1':
+                    self.mat.tex1 = self.fh.read(size).strip('\x00').encode(STR_CODEC)
+                elif hdr[2] == '2':
+                    self.mat.tex2 = self.fh.read(size).strip('\x00').encode(STR_CODEC)
+                elif hdr[2] == '3':
+                    self.mat.tex3 = self.fh.read(size).strip('\x00').encode(STR_CODEC)
+            else:
+                self.log('Unrecognized chunk {0} in MaterialUnpacker.'.format(hdr))
+                self.fh.seek(self.fh.tell() - 8)
+                break
+        return self.mat
+
+
+class InfoUnpacker(Unpacker):
+    def __init__(self, up, size, fh):
+        self.size = size
+        self.fh = fh
+        self.info = msh2.SceneInfo(up.msh)
+        self.log = up.log
+
+    def unpack(self):
+        self.log('Unpacking Scene Info.')
+        # Name chunk.
+        bin, size = self.unpack_header(self.fh.read(8))
+        self.info.name = self.fh.read(size).strip('\x00').encode(STR_CODEC)
+        # FRAM chunk.
+        bin, size = self.unpack_header(self.fh.read(8))
+        self.info.frame_range = unpack('<LL', self.fh.read(8))
+        self.info.fps = unpack('<f', self.fh.read(4))[0]
+        # BBOX chunk.
+        self.fh.read(8)  # Just read those, size is always the same.
+        bb = BBoxUnpacker(self.fh.read(44))
+        self.info.bbox = bb.unpack()
+        return self.info
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/__init__.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/__init__.py
new file mode 100644
index 0000000..837f0df
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/__init__.py
@@ -0,0 +1,77 @@
+# -*- coding: utf-8 -*-
+
+#   __
+#  /__)  _  _     _   _ _/   _
+# / (   (- (/ (/ (- _)  /  _)
+#          /
+
+"""
+requests HTTP library
+~~~~~~~~~~~~~~~~~~~~~
+
+Requests is an HTTP library, written in Python, for human beings. Basic GET
+usage:
+
+   >>> import requests
+   >>> r = requests.get('http://python.org')
+   >>> r.status_code
+   200
+   >>> 'Python is a programming language' in r.content
+   True
+
+... or POST:
+
+   >>> payload = dict(key1='value1', key2='value2')
+   >>> r = requests.post("http://httpbin.org/post", data=payload)
+   >>> print r.text
+   {
+     ...
+     "form": {
+       "key2": "value2",
+       "key1": "value1"
+     },
+     ...
+   }
+
+The other HTTP methods are supported - see `requests.api`. Full documentation
+is at <http://python-requests.org>.
+
+:copyright: (c) 2013 by Kenneth Reitz.
+:license: Apache 2.0, see LICENSE for more details.
+
+"""
+
+__title__ = 'requests'
+__version__ = '2.0.0'
+__build__ = 0x020000
+__author__ = 'Kenneth Reitz'
+__license__ = 'Apache 2.0'
+__copyright__ = 'Copyright 2013 Kenneth Reitz'
+
+# Attempt to enable urllib3's SNI support, if possible
+try:
+    from .packages.urllib3.contrib import pyopenssl
+    pyopenssl.inject_into_urllib3()
+except ImportError:
+    pass
+
+from . import utils
+from .models import Request, Response, PreparedRequest
+from .api import request, get, head, post, patch, put, delete, options
+from .sessions import session, Session
+from .status_codes import codes
+from .exceptions import (
+    RequestException, Timeout, URLRequired,
+    TooManyRedirects, HTTPError, ConnectionError
+)
+
+# Set default logging handler to avoid "No handler found" warnings.
+import logging
+try:  # Python 2.7+
+    from logging import NullHandler
+except ImportError:
+    class NullHandler(logging.Handler):
+        def emit(self, record):
+            pass
+
+logging.getLogger(__name__).addHandler(NullHandler())
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/adapters.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/adapters.py
new file mode 100644
index 0000000..d557b74
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/adapters.py
@@ -0,0 +1,369 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.adapters
+~~~~~~~~~~~~~~~~~
+
+This module contains the transport adapters that Requests uses to define
+and maintain connections.
+"""
+
+import socket
+
+from .models import Response
+from .packages.urllib3.poolmanager import PoolManager, proxy_from_url
+from .packages.urllib3.response import HTTPResponse
+from .packages.urllib3.util import Timeout as TimeoutSauce
+from .compat import urlparse, basestring, urldefrag, unquote
+from .utils import (DEFAULT_CA_BUNDLE_PATH, get_encoding_from_headers,
+                    except_on_missing_scheme, get_auth_from_url)
+from .structures import CaseInsensitiveDict
+from .packages.urllib3.exceptions import MaxRetryError
+from .packages.urllib3.exceptions import TimeoutError
+from .packages.urllib3.exceptions import SSLError as _SSLError
+from .packages.urllib3.exceptions import HTTPError as _HTTPError
+from .cookies import extract_cookies_to_jar
+from .exceptions import ConnectionError, Timeout, SSLError
+from .auth import _basic_auth_str
+
+DEFAULT_POOLBLOCK = False
+DEFAULT_POOLSIZE = 10
+DEFAULT_RETRIES = 0
+
+
+class BaseAdapter(object):
+    """The Base Transport Adapter"""
+
+    def __init__(self):
+        super(BaseAdapter, self).__init__()
+
+    def send(self):
+        raise NotImplementedError
+
+    def close(self):
+        raise NotImplementedError
+
+
+class HTTPAdapter(BaseAdapter):
+    """The built-in HTTP Adapter for urllib3.
+
+    Provides a general-case interface for Requests sessions to contact HTTP and
+    HTTPS urls by implementing the Transport Adapter interface. This class will
+    usually be created by the :class:`Session <Session>` class under the
+    covers.
+
+    :param pool_connections: The number of urllib3 connection pools to cache.
+    :param pool_maxsize: The maximum number of connections to save in the pool.
+    :param max_retries: The maximum number of retries each connection should attempt.
+    :param pool_block: Whether the connection pool should block for connections.
+
+    Usage::
+
+      >>> import requests
+      >>> s = requests.Session()
+      >>> a = requests.adapters.HTTPAdapter()
+      >>> s.mount('http://', a)
+    """
+    __attrs__ = ['max_retries', 'config', '_pool_connections', '_pool_maxsize',
+                 '_pool_block']
+
+    def __init__(self, pool_connections=DEFAULT_POOLSIZE,
+                 pool_maxsize=DEFAULT_POOLSIZE, max_retries=DEFAULT_RETRIES,
+                 pool_block=DEFAULT_POOLBLOCK):
+        self.max_retries = max_retries
+        self.config = {}
+        self.proxy_manager = {}
+
+        super(HTTPAdapter, self).__init__()
+
+        self._pool_connections = pool_connections
+        self._pool_maxsize = pool_maxsize
+        self._pool_block = pool_block
+
+        self.init_poolmanager(pool_connections, pool_maxsize, block=pool_block)
+
+    def __getstate__(self):
+        return dict((attr, getattr(self, attr, None)) for attr in
+                    self.__attrs__)
+
+    def __setstate__(self, state):
+        for attr, value in state.items():
+            setattr(self, attr, value)
+
+        self.init_poolmanager(self._pool_connections, self._pool_maxsize,
+                              block=self._pool_block)
+
+    def init_poolmanager(self, connections, maxsize, block=DEFAULT_POOLBLOCK):
+        """Initializes a urllib3 PoolManager. This method should not be called
+        from user code, and is only exposed for use when subclassing the
+        :class:`HTTPAdapter <requests.adapters.HTTPAdapter>`.
+
+        :param connections: The number of urllib3 connection pools to cache.
+        :param maxsize: The maximum number of connections to save in the pool.
+        :param block: Block when no free connections are available.
+        """
+        # save these values for pickling
+        self._pool_connections = connections
+        self._pool_maxsize = maxsize
+        self._pool_block = block
+
+        self.poolmanager = PoolManager(num_pools=connections, maxsize=maxsize,
+                                       block=block)
+
+    def cert_verify(self, conn, url, verify, cert):
+        """Verify a SSL certificate. This method should not be called from user
+        code, and is only exposed for use when subclassing the
+        :class:`HTTPAdapter <requests.adapters.HTTPAdapter>`.
+
+        :param conn: The urllib3 connection object associated with the cert.
+        :param url: The requested URL.
+        :param verify: Whether we should actually verify the certificate.
+        :param cert: The SSL certificate to verify.
+        """
+        if url.lower().startswith('https') and verify:
+
+            cert_loc = None
+
+            # Allow self-specified cert location.
+            if verify is not True:
+                cert_loc = verify
+
+            if not cert_loc:
+                cert_loc = DEFAULT_CA_BUNDLE_PATH
+
+            if not cert_loc:
+                raise Exception("Could not find a suitable SSL CA certificate bundle.")
+
+            conn.cert_reqs = 'CERT_REQUIRED'
+            conn.ca_certs = cert_loc
+        else:
+            conn.cert_reqs = 'CERT_NONE'
+            conn.ca_certs = None
+
+        if cert:
+            if not isinstance(cert, basestring):
+                conn.cert_file = cert[0]
+                conn.key_file = cert[1]
+            else:
+                conn.cert_file = cert
+
+    def build_response(self, req, resp):
+        """Builds a :class:`Response <requests.Response>` object from a urllib3
+        response. This should not be called from user code, and is only exposed
+        for use when subclassing the
+        :class:`HTTPAdapter <requests.adapters.HTTPAdapter>`
+
+        :param req: The :class:`PreparedRequest <PreparedRequest>` used to generate the response.
+        :param resp: The urllib3 response object.
+        """
+        response = Response()
+
+        # Fallback to None if there's no status_code, for whatever reason.
+        response.status_code = getattr(resp, 'status', None)
+
+        # Make headers case-insensitive.
+        response.headers = CaseInsensitiveDict(getattr(resp, 'headers', {}))
+
+        # Set encoding.
+        response.encoding = get_encoding_from_headers(response.headers)
+        response.raw = resp
+        response.reason = response.raw.reason
+
+        if isinstance(req.url, bytes):
+            response.url = req.url.decode('utf-8')
+        else:
+            response.url = req.url
+
+        # Add new cookies from the server.
+        extract_cookies_to_jar(response.cookies, req, resp)
+
+        # Give the Response some context.
+        response.request = req
+        response.connection = self
+
+        return response
+
+    def get_connection(self, url, proxies=None):
+        """Returns a urllib3 connection for the given URL. This should not be
+        called from user code, and is only exposed for use when subclassing the
+        :class:`HTTPAdapter <requests.adapters.HTTPAdapter>`.
+
+        :param url: The URL to connect to.
+        :param proxies: (optional) A Requests-style dictionary of proxies used on this request.
+        """
+        proxies = proxies or {}
+        proxy = proxies.get(urlparse(url.lower()).scheme)
+
+        if proxy:
+            except_on_missing_scheme(proxy)
+            proxy_headers = self.proxy_headers(proxy)
+
+            if not proxy in self.proxy_manager:
+                self.proxy_manager[proxy] = proxy_from_url(
+                                                proxy,
+                                                proxy_headers=proxy_headers)
+
+            conn = self.proxy_manager[proxy].connection_from_url(url)
+        else:
+            conn = self.poolmanager.connection_from_url(url.lower())
+
+        return conn
+
+    def close(self):
+        """Disposes of any internal state.
+
+        Currently, this just closes the PoolManager, which closes pooled
+        connections.
+        """
+        self.poolmanager.clear()
+
+    def request_url(self, request, proxies):
+        """Obtain the url to use when making the final request.
+
+        If the message is being sent through a proxy, the full URL has to be
+        used. Otherwise, we should only use the path portion of the URL.
+
+        This should not be called from user code, and is only exposed for use
+        when subclassing the
+        :class:`HTTPAdapter <requests.adapters.HTTPAdapter>`.
+
+        :param request: The :class:`PreparedRequest <PreparedRequest>` being sent.
+        :param proxies: A dictionary of schemes to proxy URLs.
+        """
+        proxies = proxies or {}
+        proxy = proxies.get(urlparse(request.url).scheme)
+
+        if proxy:
+            url, _ = urldefrag(request.url)
+        else:
+            url = request.path_url
+
+        return url
+
+    def add_headers(self, request, **kwargs):
+        """Add any headers needed by the connection. As of v2.0 this does
+        nothing by default, but is left for overriding by users that subclass
+        the :class:`HTTPAdapter <requests.adapters.HTTPAdapter>`.
+
+        This should not be called from user code, and is only exposed for use
+        when subclassing the
+        :class:`HTTPAdapter <requests.adapters.HTTPAdapter>`.
+
+        :param request: The :class:`PreparedRequest <PreparedRequest>` to add headers to.
+        :param kwargs: The keyword arguments from the call to send().
+        """
+        pass
+
+    def proxy_headers(self, proxy):
+        """Returns a dictionary of the headers to add to any request sent
+        through a proxy. This works with urllib3 magic to ensure that they are
+        correctly sent to the proxy, rather than in a tunnelled request if
+        CONNECT is being used.
+
+        This should not be called from user code, and is only exposed for use
+        when subclassing the
+        :class:`HTTPAdapter <requests.adapters.HTTPAdapter>`.
+
+        :param proxies: The url of the proxy being used for this request.
+        :param kwargs: Optional additional keyword arguments.
+        """
+        headers = {}
+        username, password = get_auth_from_url(proxy)
+
+        if username and password:
+            # Proxy auth usernames and passwords will be urlencoded, we need
+            # to decode them.
+            username = unquote(username)
+            password = unquote(password)
+            headers['Proxy-Authorization'] = _basic_auth_str(username,
+                                                             password)
+
+        return headers
+
+    def send(self, request, stream=False, timeout=None, verify=True, cert=None, proxies=None):
+        """Sends PreparedRequest object. Returns Response object.
+
+        :param request: The :class:`PreparedRequest <PreparedRequest>` being sent.
+        :param stream: (optional) Whether to stream the request content.
+        :param timeout: (optional) The timeout on the request.
+        :param verify: (optional) Whether to verify SSL certificates.
+        :param vert: (optional) Any user-provided SSL certificate to be trusted.
+        :param proxies: (optional) The proxies dictionary to apply to the request.
+        """
+
+        conn = self.get_connection(request.url, proxies)
+
+        self.cert_verify(conn, request.url, verify, cert)
+        url = self.request_url(request, proxies)
+        self.add_headers(request)
+
+        chunked = not (request.body is None or 'Content-Length' in request.headers)
+
+        if stream:
+            timeout = TimeoutSauce(connect=timeout)
+        else:
+            timeout = TimeoutSauce(connect=timeout, read=timeout)
+
+        try:
+            if not chunked:
+                resp = conn.urlopen(
+                    method=request.method,
+                    url=url,
+                    body=request.body,
+                    headers=request.headers,
+                    redirect=False,
+                    assert_same_host=False,
+                    preload_content=False,
+                    decode_content=False,
+                    retries=self.max_retries,
+                    timeout=timeout
+                )
+
+            # Send the request.
+            else:
+                if hasattr(conn, 'proxy_pool'):
+                    conn = conn.proxy_pool
+
+                low_conn = conn._get_conn(timeout=timeout)
+                low_conn.putrequest(request.method, url, skip_accept_encoding=True)
+
+                for header, value in request.headers.items():
+                    low_conn.putheader(header, value)
+
+                low_conn.endheaders()
+
+                for i in request.body:
+                    low_conn.send(hex(len(i))[2:].encode('utf-8'))
+                    low_conn.send(b'\r\n')
+                    low_conn.send(i)
+                    low_conn.send(b'\r\n')
+                low_conn.send(b'0\r\n\r\n')
+
+                r = low_conn.getresponse()
+                resp = HTTPResponse.from_httplib(r,
+                    pool=conn,
+                    connection=low_conn,
+                    preload_content=False,
+                    decode_content=False
+                )
+
+        except socket.error as sockerr:
+            raise ConnectionError(sockerr)
+
+        except MaxRetryError as e:
+            raise ConnectionError(e)
+
+        except (_SSLError, _HTTPError) as e:
+            if isinstance(e, _SSLError):
+                raise SSLError(e)
+            elif isinstance(e, TimeoutError):
+                raise Timeout(e)
+            else:
+                raise
+
+        r = self.build_response(request, resp)
+
+        if not stream:
+            r.content
+
+        return r
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/api.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/api.py
new file mode 100644
index 0000000..baf43dd
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/api.py
@@ -0,0 +1,120 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.api
+~~~~~~~~~~~~
+
+This module implements the Requests API.
+
+:copyright: (c) 2012 by Kenneth Reitz.
+:license: Apache2, see LICENSE for more details.
+
+"""
+
+from . import sessions
+
+
+def request(method, url, **kwargs):
+    """Constructs and sends a :class:`Request <Request>`.
+    Returns :class:`Response <Response>` object.
+
+    :param method: method for the new :class:`Request` object.
+    :param url: URL for the new :class:`Request` object.
+    :param params: (optional) Dictionary or bytes to be sent in the query string for the :class:`Request`.
+    :param data: (optional) Dictionary, bytes, or file-like object to send in the body of the :class:`Request`.
+    :param headers: (optional) Dictionary of HTTP Headers to send with the :class:`Request`.
+    :param cookies: (optional) Dict or CookieJar object to send with the :class:`Request`.
+    :param files: (optional) Dictionary of 'name': file-like-objects (or {'name': ('filename', fileobj)}) for multipart encoding upload.
+    :param auth: (optional) Auth tuple to enable Basic/Digest/Custom HTTP Auth.
+    :param timeout: (optional) Float describing the timeout of the request.
+    :param allow_redirects: (optional) Boolean. Set to True if POST/PUT/DELETE redirect following is allowed.
+    :param proxies: (optional) Dictionary mapping protocol to the URL of the proxy.
+    :param verify: (optional) if ``True``, the SSL cert will be verified. A CA_BUNDLE path can also be provided.
+    :param stream: (optional) if ``False``, the response content will be immediately downloaded.
+    :param cert: (optional) if String, path to ssl client cert file (.pem). If Tuple, ('cert', 'key') pair.
+
+    Usage::
+
+      >>> import requests
+      >>> req = requests.request('GET', 'http://httpbin.org/get')
+      <Response [200]>
+    """
+
+    session = sessions.Session()
+    return session.request(method=method, url=url, **kwargs)
+
+
+def get(url, **kwargs):
+    """Sends a GET request. Returns :class:`Response` object.
+
+    :param url: URL for the new :class:`Request` object.
+    :param \*\*kwargs: Optional arguments that ``request`` takes.
+    """
+
+    kwargs.setdefault('allow_redirects', True)
+    return request('get', url, **kwargs)
+
+
+def options(url, **kwargs):
+    """Sends a OPTIONS request. Returns :class:`Response` object.
+
+    :param url: URL for the new :class:`Request` object.
+    :param \*\*kwargs: Optional arguments that ``request`` takes.
+    """
+
+    kwargs.setdefault('allow_redirects', True)
+    return request('options', url, **kwargs)
+
+
+def head(url, **kwargs):
+    """Sends a HEAD request. Returns :class:`Response` object.
+
+    :param url: URL for the new :class:`Request` object.
+    :param \*\*kwargs: Optional arguments that ``request`` takes.
+    """
+
+    kwargs.setdefault('allow_redirects', False)
+    return request('head', url, **kwargs)
+
+
+def post(url, data=None, **kwargs):
+    """Sends a POST request. Returns :class:`Response` object.
+
+    :param url: URL for the new :class:`Request` object.
+    :param data: (optional) Dictionary, bytes, or file-like object to send in the body of the :class:`Request`.
+    :param \*\*kwargs: Optional arguments that ``request`` takes.
+    """
+
+    return request('post', url, data=data, **kwargs)
+
+
+def put(url, data=None, **kwargs):
+    """Sends a PUT request. Returns :class:`Response` object.
+
+    :param url: URL for the new :class:`Request` object.
+    :param data: (optional) Dictionary, bytes, or file-like object to send in the body of the :class:`Request`.
+    :param \*\*kwargs: Optional arguments that ``request`` takes.
+    """
+
+    return request('put', url, data=data, **kwargs)
+
+
+def patch(url, data=None, **kwargs):
+    """Sends a PATCH request. Returns :class:`Response` object.
+
+    :param url: URL for the new :class:`Request` object.
+    :param data: (optional) Dictionary, bytes, or file-like object to send in the body of the :class:`Request`.
+    :param \*\*kwargs: Optional arguments that ``request`` takes.
+    """
+
+    return request('patch', url,  data=data, **kwargs)
+
+
+def delete(url, **kwargs):
+    """Sends a DELETE request. Returns :class:`Response` object.
+
+    :param url: URL for the new :class:`Request` object.
+    :param \*\*kwargs: Optional arguments that ``request`` takes.
+    """
+
+    return request('delete', url, **kwargs)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/auth.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/auth.py
new file mode 100644
index 0000000..30529e2
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/auth.py
@@ -0,0 +1,180 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.auth
+~~~~~~~~~~~~~
+
+This module contains the authentication handlers for Requests.
+"""
+
+import os
+import re
+import time
+import hashlib
+import logging
+
+from base64 import b64encode
+
+from .compat import urlparse, str
+from .utils import parse_dict_header
+
+log = logging.getLogger(__name__)
+
+CONTENT_TYPE_FORM_URLENCODED = 'application/x-www-form-urlencoded'
+CONTENT_TYPE_MULTI_PART = 'multipart/form-data'
+
+
+def _basic_auth_str(username, password):
+    """Returns a Basic Auth string."""
+
+    return 'Basic ' + b64encode(('%s:%s' % (username, password)).encode('latin1')).strip().decode('latin1')
+
+
+class AuthBase(object):
+    """Base class that all auth implementations derive from"""
+
+    def __call__(self, r):
+        raise NotImplementedError('Auth hooks must be callable.')
+
+
+class HTTPBasicAuth(AuthBase):
+    """Attaches HTTP Basic Authentication to the given Request object."""
+    def __init__(self, username, password):
+        self.username = username
+        self.password = password
+
+    def __call__(self, r):
+        r.headers['Authorization'] = _basic_auth_str(self.username, self.password)
+        return r
+
+
+class HTTPProxyAuth(HTTPBasicAuth):
+    """Attaches HTTP Proxy Authentication to a given Request object."""
+    def __call__(self, r):
+        r.headers['Proxy-Authorization'] = _basic_auth_str(self.username, self.password)
+        return r
+
+
+class HTTPDigestAuth(AuthBase):
+    """Attaches HTTP Digest Authentication to the given Request object."""
+    def __init__(self, username, password):
+        self.username = username
+        self.password = password
+        self.last_nonce = ''
+        self.nonce_count = 0
+        self.chal = {}
+
+    def build_digest_header(self, method, url):
+
+        realm = self.chal['realm']
+        nonce = self.chal['nonce']
+        qop = self.chal.get('qop')
+        algorithm = self.chal.get('algorithm')
+        opaque = self.chal.get('opaque')
+
+        if algorithm is None:
+            _algorithm = 'MD5'
+        else:
+            _algorithm = algorithm.upper()
+        # lambdas assume digest modules are imported at the top level
+        if _algorithm == 'MD5':
+            def md5_utf8(x):
+                if isinstance(x, str):
+                    x = x.encode('utf-8')
+                return hashlib.md5(x).hexdigest()
+            hash_utf8 = md5_utf8
+        elif _algorithm == 'SHA':
+            def sha_utf8(x):
+                if isinstance(x, str):
+                    x = x.encode('utf-8')
+                return hashlib.sha1(x).hexdigest()
+            hash_utf8 = sha_utf8
+        # XXX MD5-sess
+        KD = lambda s, d: hash_utf8("%s:%s" % (s, d))
+
+        if hash_utf8 is None:
+            return None
+
+        # XXX not implemented yet
+        entdig = None
+        p_parsed = urlparse(url)
+        path = p_parsed.path
+        if p_parsed.query:
+            path += '?' + p_parsed.query
+
+        A1 = '%s:%s:%s' % (self.username, realm, self.password)
+        A2 = '%s:%s' % (method, path)
+
+        if qop is None:
+            respdig = KD(hash_utf8(A1), "%s:%s" % (nonce, hash_utf8(A2)))
+        elif qop == 'auth' or 'auth' in qop.split(','):
+            if nonce == self.last_nonce:
+                self.nonce_count += 1
+            else:
+                self.nonce_count = 1
+
+            ncvalue = '%08x' % self.nonce_count
+            s = str(self.nonce_count).encode('utf-8')
+            s += nonce.encode('utf-8')
+            s += time.ctime().encode('utf-8')
+            s += os.urandom(8)
+
+            cnonce = (hashlib.sha1(s).hexdigest()[:16])
+            noncebit = "%s:%s:%s:%s:%s" % (nonce, ncvalue, cnonce, qop, hash_utf8(A2))
+            respdig = KD(hash_utf8(A1), noncebit)
+        else:
+            # XXX handle auth-int.
+            return None
+
+        self.last_nonce = nonce
+
+        # XXX should the partial digests be encoded too?
+        base = 'username="%s", realm="%s", nonce="%s", uri="%s", ' \
+               'response="%s"' % (self.username, realm, nonce, path, respdig)
+        if opaque:
+            base += ', opaque="%s"' % opaque
+        if algorithm:
+            base += ', algorithm="%s"' % algorithm
+        if entdig:
+            base += ', digest="%s"' % entdig
+        if qop:
+            base += ', qop=auth, nc=%s, cnonce="%s"' % (ncvalue, cnonce)
+
+        return 'Digest %s' % (base)
+
+    def handle_401(self, r, **kwargs):
+        """Takes the given response and tries digest-auth, if needed."""
+
+        num_401_calls = getattr(self, 'num_401_calls', 1)
+        s_auth = r.headers.get('www-authenticate', '')
+
+        if 'digest' in s_auth.lower() and num_401_calls < 2:
+
+            setattr(self, 'num_401_calls', num_401_calls + 1)
+            pat = re.compile(r'digest ', flags=re.IGNORECASE)
+            self.chal = parse_dict_header(pat.sub('', s_auth, count=1))
+
+            # Consume content and release the original connection
+            # to allow our new request to reuse the same one.
+            r.content
+            r.raw.release_conn()
+            prep = r.request.copy()
+            prep.prepare_cookies(r.cookies)
+
+            prep.headers['Authorization'] = self.build_digest_header(
+                prep.method, prep.url)
+            _r = r.connection.send(prep, **kwargs)
+            _r.history.append(r)
+            _r.request = prep
+
+            return _r
+
+        setattr(self, 'num_401_calls', 1)
+        return r
+
+    def __call__(self, r):
+        # If we have a saved nonce, skip the 401
+        if self.last_nonce:
+            r.headers['Authorization'] = self.build_digest_header(r.method, r.url)
+        r.register_hook('response', self.handle_401)
+        return r
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/cacert.pem b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/cacert.pem
new file mode 100644
index 0000000..504fdcc
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/cacert.pem
@@ -0,0 +1,3290 @@
+##
+## ca-bundle.crt -- Bundle of CA Root Certificates
+##
+## Certificate data from Mozilla as of: Wed Jan 18 00:04:16 2012
+##
+## This is a bundle of X.509 certificates of public Certificate Authorities
+## (CA). These were automatically extracted from Mozilla's root certificates
+## file (certdata.txt).  This file can be found in the mozilla source tree:
+## http://mxr.mozilla.org/mozilla/source/security/nss/lib/ckfw/builtins/certdata.txt?raw=1
+##
+## It contains the certificates in PEM format and therefore
+## can be directly used with curl / libcurl / php_curl, or with
+## an Apache+mod_ssl webserver for SSL client authentication.
+## Just configure this file as the SSLCACertificateFile.
+##
+
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is the Netscape security libraries.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1994-2000
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+# @(#) $RCSfile: certdata.txt,v $ $Revision: 1.81 $ $Date: 2012/01/17 22:02:37 $
+
+GTE CyberTrust Global Root
+==========================
+-----BEGIN CERTIFICATE-----
+MIICWjCCAcMCAgGlMA0GCSqGSIb3DQEBBAUAMHUxCzAJBgNVBAYTAlVTMRgwFgYDVQQKEw9HVEUg
+Q29ycG9yYXRpb24xJzAlBgNVBAsTHkdURSBDeWJlclRydXN0IFNvbHV0aW9ucywgSW5jLjEjMCEG
+A1UEAxMaR1RFIEN5YmVyVHJ1c3QgR2xvYmFsIFJvb3QwHhcNOTgwODEzMDAyOTAwWhcNMTgwODEz
+MjM1OTAwWjB1MQswCQYDVQQGEwJVUzEYMBYGA1UEChMPR1RFIENvcnBvcmF0aW9uMScwJQYDVQQL
+Ex5HVEUgQ3liZXJUcnVzdCBTb2x1dGlvbnMsIEluYy4xIzAhBgNVBAMTGkdURSBDeWJlclRydXN0
+IEdsb2JhbCBSb290MIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQCVD6C28FCc6HrHiM3dFw4u
+sJTQGz0O9pTAipTHBsiQl8i4ZBp6fmw8U+E3KHNgf7KXUwefU/ltWJTSr41tiGeA5u2ylc9yMcql
+HHK6XALnZELn+aks1joNrI1CqiQBOeacPwGFVw1Yh0X404Wqk2kmhXBIgD8SFcd5tB8FLztimQID
+AQABMA0GCSqGSIb3DQEBBAUAA4GBAG3rGwnpXtlR22ciYaQqPEh346B8pt5zohQDhT37qw4wxYMW
+M4ETCJ57NE7fQMh017l93PR2VX2bY1QY6fDq81yx2YtCHrnAlU66+tXifPVoYb+O7AWXX1uw16OF
+NMQkpw0PlZPvy5TYnh+dXIVtx6quTx8itc2VrbqnzPmrC3p/
+-----END CERTIFICATE-----
+
+Thawte Server CA
+================
+-----BEGIN CERTIFICATE-----
+MIIDEzCCAnygAwIBAgIBATANBgkqhkiG9w0BAQQFADCBxDELMAkGA1UEBhMCWkExFTATBgNVBAgT
+DFdlc3Rlcm4gQ2FwZTESMBAGA1UEBxMJQ2FwZSBUb3duMR0wGwYDVQQKExRUaGF3dGUgQ29uc3Vs
+dGluZyBjYzEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2aWNlcyBEaXZpc2lvbjEZMBcGA1UE
+AxMQVGhhd3RlIFNlcnZlciBDQTEmMCQGCSqGSIb3DQEJARYXc2VydmVyLWNlcnRzQHRoYXd0ZS5j
+b20wHhcNOTYwODAxMDAwMDAwWhcNMjAxMjMxMjM1OTU5WjCBxDELMAkGA1UEBhMCWkExFTATBgNV
+BAgTDFdlc3Rlcm4gQ2FwZTESMBAGA1UEBxMJQ2FwZSBUb3duMR0wGwYDVQQKExRUaGF3dGUgQ29u
+c3VsdGluZyBjYzEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2aWNlcyBEaXZpc2lvbjEZMBcG
+A1UEAxMQVGhhd3RlIFNlcnZlciBDQTEmMCQGCSqGSIb3DQEJARYXc2VydmVyLWNlcnRzQHRoYXd0
+ZS5jb20wgZ8wDQYJKoZIhvcNAQEBBQADgY0AMIGJAoGBANOkUG7I/1Zr5s9dtuoMaHVHoqrC2oQl
+/Kj0R1HahbUgdJSGHg91yekIYfUGbTBuFRkC6VLAYttNmZ7iagxEOM3+vuNkCXDF/rFrKbYvScg7
+1CcEJRCXL+eQbcAoQpnXTEPew/UhbVSfXcNY4cDk2VuwuNy0e982OsK1ZiIS1ocNAgMBAAGjEzAR
+MA8GA1UdEwEB/wQFMAMBAf8wDQYJKoZIhvcNAQEEBQADgYEAB/pMaVz7lcxG7oWDTSEwjsrZqG9J
+GubaUeNgcGyEYRGhGshIPllDfU+VPaGLtwtimHp1it2ITk6eQNuozDJ0uW8NxuOzRAvZim+aKZuZ
+GCg70eNAKJpaPNW15yAbi8qkq43pUdniTCxZqdq5snUb9kLy78fyGPmJvKP/iiMucEc=
+-----END CERTIFICATE-----
+
+Thawte Premium Server CA
+========================
+-----BEGIN CERTIFICATE-----
+MIIDJzCCApCgAwIBAgIBATANBgkqhkiG9w0BAQQFADCBzjELMAkGA1UEBhMCWkExFTATBgNVBAgT
+DFdlc3Rlcm4gQ2FwZTESMBAGA1UEBxMJQ2FwZSBUb3duMR0wGwYDVQQKExRUaGF3dGUgQ29uc3Vs
+dGluZyBjYzEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2aWNlcyBEaXZpc2lvbjEhMB8GA1UE
+AxMYVGhhd3RlIFByZW1pdW0gU2VydmVyIENBMSgwJgYJKoZIhvcNAQkBFhlwcmVtaXVtLXNlcnZl
+ckB0aGF3dGUuY29tMB4XDTk2MDgwMTAwMDAwMFoXDTIwMTIzMTIzNTk1OVowgc4xCzAJBgNVBAYT
+AlpBMRUwEwYDVQQIEwxXZXN0ZXJuIENhcGUxEjAQBgNVBAcTCUNhcGUgVG93bjEdMBsGA1UEChMU
+VGhhd3RlIENvbnN1bHRpbmcgY2MxKDAmBgNVBAsTH0NlcnRpZmljYXRpb24gU2VydmljZXMgRGl2
+aXNpb24xITAfBgNVBAMTGFRoYXd0ZSBQcmVtaXVtIFNlcnZlciBDQTEoMCYGCSqGSIb3DQEJARYZ
+cHJlbWl1bS1zZXJ2ZXJAdGhhd3RlLmNvbTCBnzANBgkqhkiG9w0BAQEFAAOBjQAwgYkCgYEA0jY2
+aovXwlue2oFBYo847kkEVdbQ7xwblRZH7xhINTpS9CtqBo87L+pW46+GjZ4X9560ZXUCTe/LCaIh
+Udib0GfQug2SBhRz1JPLlyoAnFxODLz6FVL88kRu2hFKbgifLy3j+ao6hnO2RlNYyIkFvYMRuHM/
+qgeN9EJN50CdHDcCAwEAAaMTMBEwDwYDVR0TAQH/BAUwAwEB/zANBgkqhkiG9w0BAQQFAAOBgQAm
+SCwWwlj66BZ0DKqqX1Q/8tfJeGBeXm43YyJ3Nn6yF8Q0ufUIhfzJATj/Tb7yFkJD57taRvvBxhEf
+8UqwKEbJw8RCfbz6q1lu1bdRiBHjpIUZa4JMpAwSremkrj/xw0llmozFyD4lt5SZu5IycQfwhl7t
+UCemDaYj+bvLpgcUQg==
+-----END CERTIFICATE-----
+
+Equifax Secure CA
+=================
+-----BEGIN CERTIFICATE-----
+MIIDIDCCAomgAwIBAgIENd70zzANBgkqhkiG9w0BAQUFADBOMQswCQYDVQQGEwJVUzEQMA4GA1UE
+ChMHRXF1aWZheDEtMCsGA1UECxMkRXF1aWZheCBTZWN1cmUgQ2VydGlmaWNhdGUgQXV0aG9yaXR5
+MB4XDTk4MDgyMjE2NDE1MVoXDTE4MDgyMjE2NDE1MVowTjELMAkGA1UEBhMCVVMxEDAOBgNVBAoT
+B0VxdWlmYXgxLTArBgNVBAsTJEVxdWlmYXggU2VjdXJlIENlcnRpZmljYXRlIEF1dGhvcml0eTCB
+nzANBgkqhkiG9w0BAQEFAAOBjQAwgYkCgYEAwV2xWGcIYu6gmi0fCG2RFGiYCh7+2gRvE4RiIcPR
+fM6fBeC4AfBONOziipUEZKzxa1NfBbPLZ4C/QgKO/t0BCezhABRP/PvwDN1Dulsr4R+AcJkVV5MW
+8Q+XarfCaCMczE1ZMKxRHjuvK9buY0V7xdlfUNLjUA86iOe/FP3gx7kCAwEAAaOCAQkwggEFMHAG
+A1UdHwRpMGcwZaBjoGGkXzBdMQswCQYDVQQGEwJVUzEQMA4GA1UEChMHRXF1aWZheDEtMCsGA1UE
+CxMkRXF1aWZheCBTZWN1cmUgQ2VydGlmaWNhdGUgQXV0aG9yaXR5MQ0wCwYDVQQDEwRDUkwxMBoG
+A1UdEAQTMBGBDzIwMTgwODIyMTY0MTUxWjALBgNVHQ8EBAMCAQYwHwYDVR0jBBgwFoAUSOZo+SvS
+spXXR9gjIBBPM5iQn9QwHQYDVR0OBBYEFEjmaPkr0rKV10fYIyAQTzOYkJ/UMAwGA1UdEwQFMAMB
+Af8wGgYJKoZIhvZ9B0EABA0wCxsFVjMuMGMDAgbAMA0GCSqGSIb3DQEBBQUAA4GBAFjOKer89961
+zgK5F7WF0bnj4JXMJTENAKaSbn+2kmOeUJXRmm/kEd5jhW6Y7qj/WsjTVbJmcVfewCHrPSqnI0kB
+BIZCe/zuf6IWUrVnZ9NA2zsmWLIodz2uFHdh1voqZiegDfqnc1zqcPGUIWVEX/r87yloqaKHee95
+70+sB3c4
+-----END CERTIFICATE-----
+
+Digital Signature Trust Co. Global CA 1
+=======================================
+-----BEGIN CERTIFICATE-----
+MIIDKTCCApKgAwIBAgIENnAVljANBgkqhkiG9w0BAQUFADBGMQswCQYDVQQGEwJVUzEkMCIGA1UE
+ChMbRGlnaXRhbCBTaWduYXR1cmUgVHJ1c3QgQ28uMREwDwYDVQQLEwhEU1RDQSBFMTAeFw05ODEy
+MTAxODEwMjNaFw0xODEyMTAxODQwMjNaMEYxCzAJBgNVBAYTAlVTMSQwIgYDVQQKExtEaWdpdGFs
+IFNpZ25hdHVyZSBUcnVzdCBDby4xETAPBgNVBAsTCERTVENBIEUxMIGdMA0GCSqGSIb3DQEBAQUA
+A4GLADCBhwKBgQCgbIGpzzQeJN3+hijM3oMv+V7UQtLodGBmE5gGHKlREmlvMVW5SXIACH7TpWJE
+NySZj9mDSI+ZbZUTu0M7LklOiDfBu1h//uG9+LthzfNHwJmm8fOR6Hh8AMthyUQncWlVSn5JTe2i
+o74CTADKAqjuAQIxZA9SLRN0dja1erQtcQIBA6OCASQwggEgMBEGCWCGSAGG+EIBAQQEAwIABzBo
+BgNVHR8EYTBfMF2gW6BZpFcwVTELMAkGA1UEBhMCVVMxJDAiBgNVBAoTG0RpZ2l0YWwgU2lnbmF0
+dXJlIFRydXN0IENvLjERMA8GA1UECxMIRFNUQ0EgRTExDTALBgNVBAMTBENSTDEwKwYDVR0QBCQw
+IoAPMTk5ODEyMTAxODEwMjNagQ8yMDE4MTIxMDE4MTAyM1owCwYDVR0PBAQDAgEGMB8GA1UdIwQY
+MBaAFGp5fpFpRhgTCgJ3pVlbYJglDqL4MB0GA1UdDgQWBBRqeX6RaUYYEwoCd6VZW2CYJQ6i+DAM
+BgNVHRMEBTADAQH/MBkGCSqGSIb2fQdBAAQMMAobBFY0LjADAgSQMA0GCSqGSIb3DQEBBQUAA4GB
+ACIS2Hod3IEGtgllsofIH160L+nEHvI8wbsEkBFKg05+k7lNQseSJqBcNJo4cvj9axY+IO6CizEq
+kzaFI4iKPANo08kJD038bKTaKHKTDomAsH3+gG9lbRgzl4vCa4nuYD3Im+9/KzJic5PLPON74nZ4
+RbyhkwS7hp86W0N6w4pl
+-----END CERTIFICATE-----
+
+Digital Signature Trust Co. Global CA 3
+=======================================
+-----BEGIN CERTIFICATE-----
+MIIDKTCCApKgAwIBAgIENm7TzjANBgkqhkiG9w0BAQUFADBGMQswCQYDVQQGEwJVUzEkMCIGA1UE
+ChMbRGlnaXRhbCBTaWduYXR1cmUgVHJ1c3QgQ28uMREwDwYDVQQLEwhEU1RDQSBFMjAeFw05ODEy
+MDkxOTE3MjZaFw0xODEyMDkxOTQ3MjZaMEYxCzAJBgNVBAYTAlVTMSQwIgYDVQQKExtEaWdpdGFs
+IFNpZ25hdHVyZSBUcnVzdCBDby4xETAPBgNVBAsTCERTVENBIEUyMIGdMA0GCSqGSIb3DQEBAQUA
+A4GLADCBhwKBgQC/k48Xku8zExjrEH9OFr//Bo8qhbxe+SSmJIi2A7fBw18DW9Fvrn5C6mYjuGOD
+VvsoLeE4i7TuqAHhzhy2iCoiRoX7n6dwqUcUP87eZfCocfdPJmyMvMa1795JJ/9IKn3oTQPMx7JS
+xhcxEzu1TdvIxPbDDyQq2gyd55FbgM2UnQIBA6OCASQwggEgMBEGCWCGSAGG+EIBAQQEAwIABzBo
+BgNVHR8EYTBfMF2gW6BZpFcwVTELMAkGA1UEBhMCVVMxJDAiBgNVBAoTG0RpZ2l0YWwgU2lnbmF0
+dXJlIFRydXN0IENvLjERMA8GA1UECxMIRFNUQ0EgRTIxDTALBgNVBAMTBENSTDEwKwYDVR0QBCQw
+IoAPMTk5ODEyMDkxOTE3MjZagQ8yMDE4MTIwOTE5MTcyNlowCwYDVR0PBAQDAgEGMB8GA1UdIwQY
+MBaAFB6CTShlgDzJQW6sNS5ay97u+DlbMB0GA1UdDgQWBBQegk0oZYA8yUFurDUuWsve7vg5WzAM
+BgNVHRMEBTADAQH/MBkGCSqGSIb2fQdBAAQMMAobBFY0LjADAgSQMA0GCSqGSIb3DQEBBQUAA4GB
+AEeNg61i8tuwnkUiBbmi1gMOOHLnnvx75pO2mqWilMg0HZHRxdf0CiUPPXiBng+xZ8SQTGPdXqfi
+up/1902lMXucKS1M/mQ+7LZT/uqb7YLbdHVLB3luHtgZg3Pe9T7Qtd7nS2h9Qy4qIOF+oHhEngj1
+mPnHfxsb1gYgAlihw6ID
+-----END CERTIFICATE-----
+
+Verisign Class 3 Public Primary Certification Authority
+=======================================================
+-----BEGIN CERTIFICATE-----
+MIICPDCCAaUCEHC65B0Q2Sk0tjjKewPMur8wDQYJKoZIhvcNAQECBQAwXzELMAkGA1UEBhMCVVMx
+FzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAzIFB1YmxpYyBQcmltYXJ5
+IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTk2MDEyOTAwMDAwMFoXDTI4MDgwMTIzNTk1OVow
+XzELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAz
+IFB1YmxpYyBQcmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIGfMA0GCSqGSIb3DQEBAQUA
+A4GNADCBiQKBgQDJXFme8huKARS0EN8EQNvjV69qRUCPhAwL0TPZ2RHP7gJYHyX3KqhEBarsAx94
+f56TuZoAqiN91qyFomNFx3InzPRMxnVx0jnvT0Lwdd8KkMaOIG+YD/isI19wKTakyYbnsZogy1Ol
+hec9vn2a/iRFM9x2Fe0PonFkTGUugWhFpwIDAQABMA0GCSqGSIb3DQEBAgUAA4GBALtMEivPLCYA
+TxQT3ab7/AoRhIzzKBxnki98tsX63/Dolbwdj2wsqFHMc9ikwFPwTtYmwHYBV4GSXiHx0bH/59Ah
+WM1pF+NEHJwZRDmJXNycAA9WjQKZ7aKQRUzkuxCkPfAyAw7xzvjoyVGM5mKf5p/AfbdynMk2Omuf
+Tqj/ZA1k
+-----END CERTIFICATE-----
+
+Verisign Class 3 Public Primary Certification Authority - G2
+============================================================
+-----BEGIN CERTIFICATE-----
+MIIDAjCCAmsCEH3Z/gfPqB63EHln+6eJNMYwDQYJKoZIhvcNAQEFBQAwgcExCzAJBgNVBAYTAlVT
+MRcwFQYDVQQKEw5WZXJpU2lnbiwgSW5jLjE8MDoGA1UECxMzQ2xhc3MgMyBQdWJsaWMgUHJpbWFy
+eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMTowOAYDVQQLEzEoYykgMTk5OCBWZXJpU2ln
+biwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVzZSBvbmx5MR8wHQYDVQQLExZWZXJpU2lnbiBUcnVz
+dCBOZXR3b3JrMB4XDTk4MDUxODAwMDAwMFoXDTI4MDgwMTIzNTk1OVowgcExCzAJBgNVBAYTAlVT
+MRcwFQYDVQQKEw5WZXJpU2lnbiwgSW5jLjE8MDoGA1UECxMzQ2xhc3MgMyBQdWJsaWMgUHJpbWFy
+eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMTowOAYDVQQLEzEoYykgMTk5OCBWZXJpU2ln
+biwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVzZSBvbmx5MR8wHQYDVQQLExZWZXJpU2lnbiBUcnVz
+dCBOZXR3b3JrMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCBiQKBgQDMXtERXVxp0KvTuWpMmR9ZmDCO
+FoUgRm1HP9SFIIThbbP4pO0M8RcPO/mn+SXXwc+EY/J8Y8+iR/LGWzOOZEAEaMGAuWQcRXfH2G71
+lSk8UOg013gfqLptQ5GVj0VXXn7F+8qkBOvqlzdUMG+7AUcyM83cV5tkaWH4mx0ciU9cZwIDAQAB
+MA0GCSqGSIb3DQEBBQUAA4GBAFFNzb5cy5gZnBWyATl4Lk0PZ3BwmcYQWpSkU01UbSuvDV1Ai2TT
+1+7eVmGSX6bEHRBhNtMsJzzoKQm5EWR0zLVznxxIqbxhAe7iF6YM40AIOw7n60RzKprxaZLvcRTD
+Oaxxp5EJb+RxBrO6WVcmeQD2+A2iMzAo1KpYoJ2daZH9
+-----END CERTIFICATE-----
+
+GlobalSign Root CA
+==================
+-----BEGIN CERTIFICATE-----
+MIIDdTCCAl2gAwIBAgILBAAAAAABFUtaw5QwDQYJKoZIhvcNAQEFBQAwVzELMAkGA1UEBhMCQkUx
+GTAXBgNVBAoTEEdsb2JhbFNpZ24gbnYtc2ExEDAOBgNVBAsTB1Jvb3QgQ0ExGzAZBgNVBAMTEkds
+b2JhbFNpZ24gUm9vdCBDQTAeFw05ODA5MDExMjAwMDBaFw0yODAxMjgxMjAwMDBaMFcxCzAJBgNV
+BAYTAkJFMRkwFwYDVQQKExBHbG9iYWxTaWduIG52LXNhMRAwDgYDVQQLEwdSb290IENBMRswGQYD
+VQQDExJHbG9iYWxTaWduIFJvb3QgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDa
+DuaZjc6j40+Kfvvxi4Mla+pIH/EqsLmVEQS98GPR4mdmzxzdzxtIK+6NiY6arymAZavpxy0Sy6sc
+THAHoT0KMM0VjU/43dSMUBUc71DuxC73/OlS8pF94G3VNTCOXkNz8kHp1Wrjsok6Vjk4bwY8iGlb
+Kk3Fp1S4bInMm/k8yuX9ifUSPJJ4ltbcdG6TRGHRjcdGsnUOhugZitVtbNV4FpWi6cgKOOvyJBNP
+c1STE4U6G7weNLWLBYy5d4ux2x8gkasJU26Qzns3dLlwR5EiUWMWea6xrkEmCMgZK9FGqkjWZCrX
+gzT/LCrBbBlDSgeF59N89iFo7+ryUp9/k5DPAgMBAAGjQjBAMA4GA1UdDwEB/wQEAwIBBjAPBgNV
+HRMBAf8EBTADAQH/MB0GA1UdDgQWBBRge2YaRQ2XyolQL30EzTSo//z9SzANBgkqhkiG9w0BAQUF
+AAOCAQEA1nPnfE920I2/7LqivjTFKDK1fPxsnCwrvQmeU79rXqoRSLblCKOzyj1hTdNGCbM+w6Dj
+Y1Ub8rrvrTnhQ7k4o+YviiY776BQVvnGCv04zcQLcFGUl5gE38NflNUVyRRBnMRddWQVDf9VMOyG
+j/8N7yy5Y0b2qvzfvGn9LhJIZJrglfCm7ymPAbEVtQwdpf5pLGkkeB6zpxxxYu7KyJesF12KwvhH
+hm4qxFYxldBniYUr+WymXUadDKqC5JlR3XC321Y9YeRq4VzW9v493kHMB65jUr9TU/Qr6cf9tveC
+X4XSQRjbgbMEHMUfpIBvFSDJ3gyICh3WZlXi/EjJKSZp4A==
+-----END CERTIFICATE-----
+
+GlobalSign Root CA - R2
+=======================
+-----BEGIN CERTIFICATE-----
+MIIDujCCAqKgAwIBAgILBAAAAAABD4Ym5g0wDQYJKoZIhvcNAQEFBQAwTDEgMB4GA1UECxMXR2xv
+YmFsU2lnbiBSb290IENBIC0gUjIxEzARBgNVBAoTCkdsb2JhbFNpZ24xEzARBgNVBAMTCkdsb2Jh
+bFNpZ24wHhcNMDYxMjE1MDgwMDAwWhcNMjExMjE1MDgwMDAwWjBMMSAwHgYDVQQLExdHbG9iYWxT
+aWduIFJvb3QgQ0EgLSBSMjETMBEGA1UEChMKR2xvYmFsU2lnbjETMBEGA1UEAxMKR2xvYmFsU2ln
+bjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAKbPJA6+Lm8omUVCxKs+IVSbC9N/hHD6
+ErPLv4dfxn+G07IwXNb9rfF73OX4YJYJkhD10FPe+3t+c4isUoh7SqbKSaZeqKeMWhG8eoLrvozp
+s6yWJQeXSpkqBy+0Hne/ig+1AnwblrjFuTosvNYSuetZfeLQBoZfXklqtTleiDTsvHgMCJiEbKjN
+S7SgfQx5TfC4LcshytVsW33hoCmEofnTlEnLJGKRILzdC9XZzPnqJworc5HGnRusyMvo4KD0L5CL
+TfuwNhv2GXqF4G3yYROIXJ/gkwpRl4pazq+r1feqCapgvdzZX99yqWATXgAByUr6P6TqBwMhAo6C
+ygPCm48CAwEAAaOBnDCBmTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4E
+FgQUm+IHV2ccHsBqBt5ZtJot39wZhi4wNgYDVR0fBC8wLTAroCmgJ4YlaHR0cDovL2NybC5nbG9i
+YWxzaWduLm5ldC9yb290LXIyLmNybDAfBgNVHSMEGDAWgBSb4gdXZxwewGoG3lm0mi3f3BmGLjAN
+BgkqhkiG9w0BAQUFAAOCAQEAmYFThxxol4aR7OBKuEQLq4GsJ0/WwbgcQ3izDJr86iw8bmEbTUsp
+9Z8FHSbBuOmDAGJFtqkIk7mpM0sYmsL4h4hO291xNBrBVNpGP+DTKqttVCL1OmLNIG+6KYnX3ZHu
+01yiPqFbQfXf5WRDLenVOavSot+3i9DAgBkcRcAtjOj4LaR0VknFBbVPFd5uRHg5h6h+u/N5GJG7
+9G+dwfCMNYxdAfvDbbnvRG15RjF+Cv6pgsH/76tuIMRQyV+dTZsXjAzlAcmgQWpzU/qlULRuJQ/7
+TBj0/VLZjmmx6BEP3ojY+x1J96relc8geMJgEtslQIxq/H5COEBkEveegeGTLg==
+-----END CERTIFICATE-----
+
+ValiCert Class 1 VA
+===================
+-----BEGIN CERTIFICATE-----
+MIIC5zCCAlACAQEwDQYJKoZIhvcNAQEFBQAwgbsxJDAiBgNVBAcTG1ZhbGlDZXJ0IFZhbGlkYXRp
+b24gTmV0d29yazEXMBUGA1UEChMOVmFsaUNlcnQsIEluYy4xNTAzBgNVBAsTLFZhbGlDZXJ0IENs
+YXNzIDEgUG9saWN5IFZhbGlkYXRpb24gQXV0aG9yaXR5MSEwHwYDVQQDExhodHRwOi8vd3d3LnZh
+bGljZXJ0LmNvbS8xIDAeBgkqhkiG9w0BCQEWEWluZm9AdmFsaWNlcnQuY29tMB4XDTk5MDYyNTIy
+MjM0OFoXDTE5MDYyNTIyMjM0OFowgbsxJDAiBgNVBAcTG1ZhbGlDZXJ0IFZhbGlkYXRpb24gTmV0
+d29yazEXMBUGA1UEChMOVmFsaUNlcnQsIEluYy4xNTAzBgNVBAsTLFZhbGlDZXJ0IENsYXNzIDEg
+UG9saWN5IFZhbGlkYXRpb24gQXV0aG9yaXR5MSEwHwYDVQQDExhodHRwOi8vd3d3LnZhbGljZXJ0
+LmNvbS8xIDAeBgkqhkiG9w0BCQEWEWluZm9AdmFsaWNlcnQuY29tMIGfMA0GCSqGSIb3DQEBAQUA
+A4GNADCBiQKBgQDYWYJ6ibiWuqYvaG9YLqdUHAZu9OqNSLwxlBfw8068srg1knaw0KWlAdcAAxIi
+GQj4/xEjm84H9b9pGib+TunRf50sQB1ZaG6m+FiwnRqP0z/x3BkGgagO4DrdyFNFCQbmD3DD+kCm
+DuJWBQ8YTfwggtFzVXSNdnKgHZ0dwN0/cQIDAQABMA0GCSqGSIb3DQEBBQUAA4GBAFBoPUn0LBwG
+lN+VYH+Wexf+T3GtZMjdd9LvWVXoP+iOBSoh8gfStadS/pyxtuJbdxdA6nLWI8sogTLDAHkY7FkX
+icnGah5xyf23dKUlRWnFSKsZ4UWKJWsZ7uW7EvV/96aNUcPwnXS3qT6gpf+2SQMT2iLM7XGCK5nP
+Orf1LXLI
+-----END CERTIFICATE-----
+
+ValiCert Class 2 VA
+===================
+-----BEGIN CERTIFICATE-----
+MIIC5zCCAlACAQEwDQYJKoZIhvcNAQEFBQAwgbsxJDAiBgNVBAcTG1ZhbGlDZXJ0IFZhbGlkYXRp
+b24gTmV0d29yazEXMBUGA1UEChMOVmFsaUNlcnQsIEluYy4xNTAzBgNVBAsTLFZhbGlDZXJ0IENs
+YXNzIDIgUG9saWN5IFZhbGlkYXRpb24gQXV0aG9yaXR5MSEwHwYDVQQDExhodHRwOi8vd3d3LnZh
+bGljZXJ0LmNvbS8xIDAeBgkqhkiG9w0BCQEWEWluZm9AdmFsaWNlcnQuY29tMB4XDTk5MDYyNjAw
+MTk1NFoXDTE5MDYyNjAwMTk1NFowgbsxJDAiBgNVBAcTG1ZhbGlDZXJ0IFZhbGlkYXRpb24gTmV0
+d29yazEXMBUGA1UEChMOVmFsaUNlcnQsIEluYy4xNTAzBgNVBAsTLFZhbGlDZXJ0IENsYXNzIDIg
+UG9saWN5IFZhbGlkYXRpb24gQXV0aG9yaXR5MSEwHwYDVQQDExhodHRwOi8vd3d3LnZhbGljZXJ0
+LmNvbS8xIDAeBgkqhkiG9w0BCQEWEWluZm9AdmFsaWNlcnQuY29tMIGfMA0GCSqGSIb3DQEBAQUA
+A4GNADCBiQKBgQDOOnHK5avIWZJV16vYdA757tn2VUdZZUcOBVXc65g2PFxTXdMwzzjsvUGJ7SVC
+CSRrCl6zfN1SLUzm1NZ9WlmpZdRJEy0kTRxQb7XBhVQ7/nHk01xC+YDgkRoKWzk2Z/M/VXwbP7Rf
+ZHM047QSv4dk+NoS/zcnwbNDu+97bi5p9wIDAQABMA0GCSqGSIb3DQEBBQUAA4GBADt/UG9vUJSZ
+SWI4OB9L+KXIPqeCgfYrx+jFzug6EILLGACOTb2oWH+heQC1u+mNr0HZDzTuIYEZoDJJKPTEjlbV
+UjP9UNV+mWwD5MlM/Mtsq2azSiGM5bUMMj4QssxsodyamEwCW/POuZ6lcg5Ktz885hZo+L7tdEy8
+W9ViH0Pd
+-----END CERTIFICATE-----
+
+RSA Root Certificate 1
+======================
+-----BEGIN CERTIFICATE-----
+MIIC5zCCAlACAQEwDQYJKoZIhvcNAQEFBQAwgbsxJDAiBgNVBAcTG1ZhbGlDZXJ0IFZhbGlkYXRp
+b24gTmV0d29yazEXMBUGA1UEChMOVmFsaUNlcnQsIEluYy4xNTAzBgNVBAsTLFZhbGlDZXJ0IENs
+YXNzIDMgUG9saWN5IFZhbGlkYXRpb24gQXV0aG9yaXR5MSEwHwYDVQQDExhodHRwOi8vd3d3LnZh
+bGljZXJ0LmNvbS8xIDAeBgkqhkiG9w0BCQEWEWluZm9AdmFsaWNlcnQuY29tMB4XDTk5MDYyNjAw
+MjIzM1oXDTE5MDYyNjAwMjIzM1owgbsxJDAiBgNVBAcTG1ZhbGlDZXJ0IFZhbGlkYXRpb24gTmV0
+d29yazEXMBUGA1UEChMOVmFsaUNlcnQsIEluYy4xNTAzBgNVBAsTLFZhbGlDZXJ0IENsYXNzIDMg
+UG9saWN5IFZhbGlkYXRpb24gQXV0aG9yaXR5MSEwHwYDVQQDExhodHRwOi8vd3d3LnZhbGljZXJ0
+LmNvbS8xIDAeBgkqhkiG9w0BCQEWEWluZm9AdmFsaWNlcnQuY29tMIGfMA0GCSqGSIb3DQEBAQUA
+A4GNADCBiQKBgQDjmFGWHOjVsQaBalfDcnWTq8+epvzzFlLWLU2fNUSoLgRNB0mKOCn1dzfnt6td
+3zZxFJmP3MKS8edgkpfs2Ejcv8ECIMYkpChMMFp2bbFc893enhBxoYjHW5tBbcqwuI4V7q0zK89H
+BFx1cQqYJJgpp0lZpd34t0NiYfPT4tBVPwIDAQABMA0GCSqGSIb3DQEBBQUAA4GBAFa7AliEZwgs
+3x/be0kz9dNnnfS0ChCzycUs4pJqcXgn8nCDQtM+z6lU9PHYkhaM0QTLS6vJn0WuPIqpsHEzXcjF
+V9+vqDWzf4mH6eglkrh/hXqu1rweN1gqZ8mRzyqBPu3GOd/APhmcGcwTTYJBtYze4D1gCCAPRX5r
+on+jjBXu
+-----END CERTIFICATE-----
+
+Verisign Class 3 Public Primary Certification Authority - G3
+============================================================
+-----BEGIN CERTIFICATE-----
+MIIEGjCCAwICEQCbfgZJoz5iudXukEhxKe9XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV
+UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
+cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
+IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh
+dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw
+CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy
+dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv
+cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDMgUHVibGljIFByaW1hcnkg
+Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
+ggEBAMu6nFL8eB8aHm8bN3O9+MlrlBIwT/A2R/XQkQr1F8ilYcEWQE37imGQ5XYgwREGfassbqb1
+EUGO+i2tKmFZpGcmTNDovFJbcCAEWNF6yaRpvIMXZK0Fi7zQWM6NjPXr8EJJC52XJ2cybuGukxUc
+cLwgTS8Y3pKI6GyFVxEa6X7jJhFUokWWVYPKMIno3Nij7SqAP395ZVc+FSBmCC+Vk7+qRy+oRpfw
+EuL+wgorUeZ25rdGt+INpsyow0xZVYnm6FNcHOqd8GIWC6fJXwzw3sJ2zq/3avL6QaaiMxTJ5Xpj
+055iN9WFZZ4O5lMkdBteHRJTW8cs54NJOxWuimi5V5cCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA
+ERSWwauSCPc/L8my/uRan2Te2yFPhpk0djZX3dAVL8WtfxUfN2JzPtTnX84XA9s1+ivbrmAJXx5f
+j267Cz3qWhMeDGBvtcC1IyIuBwvLqXTLR7sdwdela8wv0kL9Sd2nic9TutoAWii/gt/4uhMdUIaC
+/Y4wjylGsB49Ndo4YhYYSq3mtlFs3q9i6wHQHiT+eo8SGhJouPtmmRQURVyu565pF4ErWjfJXir0
+xuKhXFSbplQAz/DxwceYMBo7Nhbbo27q/a2ywtrvAkcTisDxszGtTxzhT5yvDwyd93gN2PQ1VoDa
+t20Xj50egWTh/sVFuq1ruQp6Tk9LhO5L8X3dEQ==
+-----END CERTIFICATE-----
+
+Verisign Class 4 Public Primary Certification Authority - G3
+============================================================
+-----BEGIN CERTIFICATE-----
+MIIEGjCCAwICEQDsoKeLbnVqAc/EfMwvlF7XMA0GCSqGSIb3DQEBBQUAMIHKMQswCQYDVQQGEwJV
+UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
+cmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
+IG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDQgUHVibGljIFByaW1hcnkgQ2VydGlmaWNh
+dGlvbiBBdXRob3JpdHkgLSBHMzAeFw05OTEwMDEwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMIHKMQsw
+CQYDVQQGEwJVUzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRy
+dXN0IE5ldHdvcmsxOjA4BgNVBAsTMShjKSAxOTk5IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhv
+cml6ZWQgdXNlIG9ubHkxRTBDBgNVBAMTPFZlcmlTaWduIENsYXNzIDQgUHVibGljIFByaW1hcnkg
+Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
+ggEBAK3LpRFpxlmr8Y+1GQ9Wzsy1HyDkniYlS+BzZYlZ3tCD5PUPtbut8XzoIfzk6AzufEUiGXaS
+tBO3IFsJ+mGuqPKljYXCKtbeZjbSmwL0qJJgfJxptI8kHtCGUvYynEFYHiK9zUVilQhu0GbdU6LM
+8BDcVHOLBKFGMzNcF0C5nk3T875Vg+ixiY5afJqWIpA7iCXy0lOIAgwLePLmNxdLMEYH5IBtptiW
+Lugs+BGzOA1mppvqySNb247i8xOOGlktqgLw7KSHZtzBP/XYufTsgsbSPZUd5cBPhMnZo0QoBmrX
+Razwa2rvTl/4EYIeOGM0ZlDUPpNz+jDDZq3/ky2X7wMCAwEAATANBgkqhkiG9w0BAQUFAAOCAQEA
+j/ola09b5KROJ1WrIhVZPMq1CtRK26vdoV9TxaBXOcLORyu+OshWv8LZJxA6sQU8wHcxuzrTBXtt
+mhwwjIDLk5Mqg6sFUYICABFna/OIYUdfA5PVWw3g8dShMjWFsjrbsIKr0csKvE+MW8VLADsfKoKm
+fjaF3H48ZwC15DtS4KjrXRX5xm3wrR0OhbepmnMUWluPQSjA1egtTaRezarZ7c7c2NU8Qh0XwRJd
+RTjDOPP8hS6DRkiy1yBfkjaP53kPmF6Z6PDQpLv1U70qzlmwr25/bLvSHgCwIe34QWKCudiyxLtG
+UPMxxY8BqHTr9Xgn2uf3ZkPznoM+IKrDNWCRzg==
+-----END CERTIFICATE-----
+
+Entrust.net Secure Server CA
+============================
+-----BEGIN CERTIFICATE-----
+MIIE2DCCBEGgAwIBAgIEN0rSQzANBgkqhkiG9w0BAQUFADCBwzELMAkGA1UEBhMCVVMxFDASBgNV
+BAoTC0VudHJ1c3QubmV0MTswOQYDVQQLEzJ3d3cuZW50cnVzdC5uZXQvQ1BTIGluY29ycC4gYnkg
+cmVmLiAobGltaXRzIGxpYWIuKTElMCMGA1UECxMcKGMpIDE5OTkgRW50cnVzdC5uZXQgTGltaXRl
+ZDE6MDgGA1UEAxMxRW50cnVzdC5uZXQgU2VjdXJlIFNlcnZlciBDZXJ0aWZpY2F0aW9uIEF1dGhv
+cml0eTAeFw05OTA1MjUxNjA5NDBaFw0xOTA1MjUxNjM5NDBaMIHDMQswCQYDVQQGEwJVUzEUMBIG
+A1UEChMLRW50cnVzdC5uZXQxOzA5BgNVBAsTMnd3dy5lbnRydXN0Lm5ldC9DUFMgaW5jb3JwLiBi
+eSByZWYuIChsaW1pdHMgbGlhYi4pMSUwIwYDVQQLExwoYykgMTk5OSBFbnRydXN0Lm5ldCBMaW1p
+dGVkMTowOAYDVQQDEzFFbnRydXN0Lm5ldCBTZWN1cmUgU2VydmVyIENlcnRpZmljYXRpb24gQXV0
+aG9yaXR5MIGdMA0GCSqGSIb3DQEBAQUAA4GLADCBhwKBgQDNKIM0VBuJ8w+vN5Ex/68xYMmo6LIQ
+aO2f55M28Qpku0f1BBc/I0dNxScZgSYMVHINiC3ZH5oSn7yzcdOAGT9HZnuMNSjSuQrfJNqc1lB5
+gXpa0zf3wkrYKZImZNHkmGw6AIr1NJtl+O3jEP/9uElY3KDegjlrgbEWGWG5VLbmQwIBA6OCAdcw
+ggHTMBEGCWCGSAGG+EIBAQQEAwIABzCCARkGA1UdHwSCARAwggEMMIHeoIHboIHYpIHVMIHSMQsw
+CQYDVQQGEwJVUzEUMBIGA1UEChMLRW50cnVzdC5uZXQxOzA5BgNVBAsTMnd3dy5lbnRydXN0Lm5l
+dC9DUFMgaW5jb3JwLiBieSByZWYuIChsaW1pdHMgbGlhYi4pMSUwIwYDVQQLExwoYykgMTk5OSBF
+bnRydXN0Lm5ldCBMaW1pdGVkMTowOAYDVQQDEzFFbnRydXN0Lm5ldCBTZWN1cmUgU2VydmVyIENl
+cnRpZmljYXRpb24gQXV0aG9yaXR5MQ0wCwYDVQQDEwRDUkwxMCmgJ6AlhiNodHRwOi8vd3d3LmVu
+dHJ1c3QubmV0L0NSTC9uZXQxLmNybDArBgNVHRAEJDAigA8xOTk5MDUyNTE2MDk0MFqBDzIwMTkw
+NTI1MTYwOTQwWjALBgNVHQ8EBAMCAQYwHwYDVR0jBBgwFoAU8BdiE1U9s/8KAGv7UISX8+1i0Bow
+HQYDVR0OBBYEFPAXYhNVPbP/CgBr+1CEl/PtYtAaMAwGA1UdEwQFMAMBAf8wGQYJKoZIhvZ9B0EA
+BAwwChsEVjQuMAMCBJAwDQYJKoZIhvcNAQEFBQADgYEAkNwwAvpkdMKnCqV8IY00F6j7Rw7/JXyN
+Ewr75Ji174z4xRAN95K+8cPV1ZVqBLssziY2ZcgxxufuP+NXdYR6Ee9GTxj005i7qIcyunL2POI9
+n9cd2cNgQ4xYDiKWL2KjLB+6rQXvqzJ4h6BUcxm1XAX5Uj5tLUUL9wqT6u0G+bI=
+-----END CERTIFICATE-----
+
+Entrust.net Premium 2048 Secure Server CA
+=========================================
+-----BEGIN CERTIFICATE-----
+MIIEXDCCA0SgAwIBAgIEOGO5ZjANBgkqhkiG9w0BAQUFADCBtDEUMBIGA1UEChMLRW50cnVzdC5u
+ZXQxQDA+BgNVBAsUN3d3dy5lbnRydXN0Lm5ldC9DUFNfMjA0OCBpbmNvcnAuIGJ5IHJlZi4gKGxp
+bWl0cyBsaWFiLikxJTAjBgNVBAsTHChjKSAxOTk5IEVudHJ1c3QubmV0IExpbWl0ZWQxMzAxBgNV
+BAMTKkVudHJ1c3QubmV0IENlcnRpZmljYXRpb24gQXV0aG9yaXR5ICgyMDQ4KTAeFw05OTEyMjQx
+NzUwNTFaFw0xOTEyMjQxODIwNTFaMIG0MRQwEgYDVQQKEwtFbnRydXN0Lm5ldDFAMD4GA1UECxQ3
+d3d3LmVudHJ1c3QubmV0L0NQU18yMDQ4IGluY29ycC4gYnkgcmVmLiAobGltaXRzIGxpYWIuKTEl
+MCMGA1UECxMcKGMpIDE5OTkgRW50cnVzdC5uZXQgTGltaXRlZDEzMDEGA1UEAxMqRW50cnVzdC5u
+ZXQgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgKDIwNDgpMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8A
+MIIBCgKCAQEArU1LqRKGsuqjIAcVFmQqK0vRvwtKTY7tgHalZ7d4QMBzQshowNtTK91euHaYNZOL
+Gp18EzoOH1u3Hs/lJBQesYGpjX24zGtLA/ECDNyrpUAkAH90lKGdCCmziAv1h3edVc3kw37XamSr
+hRSGlVuXMlBvPci6Zgzj/L24ScF2iUkZ/cCovYmjZy/Gn7xxGWC4LeksyZB2ZnuU4q941mVTXTzW
+nLLPKQP5L6RQstRIzgUyVYr9smRMDuSYB3Xbf9+5CFVghTAp+XtIpGmG4zU/HoZdenoVve8AjhUi
+VBcAkCaTvA5JaJG/+EfTnZVCwQ5N328mz8MYIWJmQ3DW1cAH4QIDAQABo3QwcjARBglghkgBhvhC
+AQEEBAMCAAcwHwYDVR0jBBgwFoAUVeSB0RGAvtiJuQijMfmhJAkWuXAwHQYDVR0OBBYEFFXkgdER
+gL7YibkIozH5oSQJFrlwMB0GCSqGSIb2fQdBAAQQMA4bCFY1LjA6NC4wAwIEkDANBgkqhkiG9w0B
+AQUFAAOCAQEAWUesIYSKF8mciVMeuoCFGsY8Tj6xnLZ8xpJdGGQC49MGCBFhfGPjK50xA3B20qMo
+oPS7mmNz7W3lKtvtFKkrxjYR0CvrB4ul2p5cGZ1WEvVUKcgF7bISKo30Axv/55IQh7A6tcOdBTcS
+o8f0FbnVpDkWm1M6I5HxqIKiaohowXkCIryqptau37AUX7iH0N18f3v/rxzP5tsHrV7bhZ3QKw0z
+2wTR5klAEyt2+z7pnIkPFc4YsIV4IU9rTw76NmfNB/L/CNDi3tm/Kq+4h4YhPATKt5Rof8886ZjX
+OP/swNlQ8C5LWK5Gb9Auw2DaclVyvUxFnmG6v4SBkgPR0ml8xQ==
+-----END CERTIFICATE-----
+
+Baltimore CyberTrust Root
+=========================
+-----BEGIN CERTIFICATE-----
+MIIDdzCCAl+gAwIBAgIEAgAAuTANBgkqhkiG9w0BAQUFADBaMQswCQYDVQQGEwJJRTESMBAGA1UE
+ChMJQmFsdGltb3JlMRMwEQYDVQQLEwpDeWJlclRydXN0MSIwIAYDVQQDExlCYWx0aW1vcmUgQ3li
+ZXJUcnVzdCBSb290MB4XDTAwMDUxMjE4NDYwMFoXDTI1MDUxMjIzNTkwMFowWjELMAkGA1UEBhMC
+SUUxEjAQBgNVBAoTCUJhbHRpbW9yZTETMBEGA1UECxMKQ3liZXJUcnVzdDEiMCAGA1UEAxMZQmFs
+dGltb3JlIEN5YmVyVHJ1c3QgUm9vdDCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAKME
+uyKrmD1X6CZymrV51Cni4eiVgLGw41uOKymaZN+hXe2wCQVt2yguzmKiYv60iNoS6zjrIZ3AQSsB
+UnuId9Mcj8e6uYi1agnnc+gRQKfRzMpijS3ljwumUNKoUMMo6vWrJYeKmpYcqWe4PwzV9/lSEy/C
+G9VwcPCPwBLKBsua4dnKM3p31vjsufFoREJIE9LAwqSuXmD+tqYF/LTdB1kC1FkYmGP1pWPgkAx9
+XbIGevOF6uvUA65ehD5f/xXtabz5OTZydc93Uk3zyZAsuT3lySNTPx8kmCFcB5kpvcY67Oduhjpr
+l3RjM71oGDHweI12v/yejl0qhqdNkNwnGjkCAwEAAaNFMEMwHQYDVR0OBBYEFOWdWTCCR1jMrPoI
+VDaGezq1BE3wMBIGA1UdEwEB/wQIMAYBAf8CAQMwDgYDVR0PAQH/BAQDAgEGMA0GCSqGSIb3DQEB
+BQUAA4IBAQCFDF2O5G9RaEIFoN27TyclhAO992T9Ldcw46QQF+vaKSm2eT929hkTI7gQCvlYpNRh
+cL0EYWoSihfVCr3FvDB81ukMJY2GQE/szKN+OMY3EU/t3WgxjkzSswF07r51XgdIGn9w/xZchMB5
+hbgF/X++ZRGjD8ACtPhSNzkE1akxehi/oCr0Epn3o0WC4zxe9Z2etciefC7IpJ5OCBRLbf1wbWsa
+Y71k5h+3zvDyny67G7fyUIhzksLi4xaNmjICq44Y3ekQEe5+NauQrz4wlHrQMz2nZQ/1/I6eYs9H
+RCwBXbsdtTLSR9I4LtD+gdwyah617jzV/OeBHRnDJELqYzmp
+-----END CERTIFICATE-----
+
+Equifax Secure Global eBusiness CA
+==================================
+-----BEGIN CERTIFICATE-----
+MIICkDCCAfmgAwIBAgIBATANBgkqhkiG9w0BAQQFADBaMQswCQYDVQQGEwJVUzEcMBoGA1UEChMT
+RXF1aWZheCBTZWN1cmUgSW5jLjEtMCsGA1UEAxMkRXF1aWZheCBTZWN1cmUgR2xvYmFsIGVCdXNp
+bmVzcyBDQS0xMB4XDTk5MDYyMTA0MDAwMFoXDTIwMDYyMTA0MDAwMFowWjELMAkGA1UEBhMCVVMx
+HDAaBgNVBAoTE0VxdWlmYXggU2VjdXJlIEluYy4xLTArBgNVBAMTJEVxdWlmYXggU2VjdXJlIEds
+b2JhbCBlQnVzaW5lc3MgQ0EtMTCBnzANBgkqhkiG9w0BAQEFAAOBjQAwgYkCgYEAuucXkAJlsTRV
+PEnCUdXfp9E3j9HngXNBUmCbnaEXJnitx7HoJpQytd4zjTov2/KaelpzmKNc6fuKcxtc58O/gGzN
+qfTWK8D3+ZmqY6KxRwIP1ORROhI8bIpaVIRw28HFkM9yRcuoWcDNM50/o5brhTMhHD4ePmBudpxn
+hcXIw2ECAwEAAaNmMGQwEQYJYIZIAYb4QgEBBAQDAgAHMA8GA1UdEwEB/wQFMAMBAf8wHwYDVR0j
+BBgwFoAUvqigdHJQa0S3ySPY+6j/s1draGwwHQYDVR0OBBYEFL6ooHRyUGtEt8kj2Puo/7NXa2hs
+MA0GCSqGSIb3DQEBBAUAA4GBADDiAVGqx+pf2rnQZQ8w1j7aDRRJbpGTJxQx78T3LUX47Me/okEN
+I7SS+RkAZ70Br83gcfxaz2TE4JaY0KNA4gGK7ycH8WUBikQtBmV1UsCGECAhX2xrD2yuCRyv8qIY
+NMR1pHMc8Y3c7635s3a0kr/clRAevsvIO1qEYBlWlKlV
+-----END CERTIFICATE-----
+
+Equifax Secure eBusiness CA 1
+=============================
+-----BEGIN CERTIFICATE-----
+MIICgjCCAeugAwIBAgIBBDANBgkqhkiG9w0BAQQFADBTMQswCQYDVQQGEwJVUzEcMBoGA1UEChMT
+RXF1aWZheCBTZWN1cmUgSW5jLjEmMCQGA1UEAxMdRXF1aWZheCBTZWN1cmUgZUJ1c2luZXNzIENB
+LTEwHhcNOTkwNjIxMDQwMDAwWhcNMjAwNjIxMDQwMDAwWjBTMQswCQYDVQQGEwJVUzEcMBoGA1UE
+ChMTRXF1aWZheCBTZWN1cmUgSW5jLjEmMCQGA1UEAxMdRXF1aWZheCBTZWN1cmUgZUJ1c2luZXNz
+IENBLTEwgZ8wDQYJKoZIhvcNAQEBBQADgY0AMIGJAoGBAM4vGbwXt3fek6lfWg0XTzQaDJj0ItlZ
+1MRoRvC0NcWFAyDGr0WlIVFFQesWWDYyb+JQYmT5/VGcqiTZ9J2DKocKIdMSODRsjQBuWqDZQu4a
+IZX5UkxVWsUPOE9G+m34LjXWHXzr4vCwdYDIqROsvojvOm6rXyo4YgKwEnv+j6YDAgMBAAGjZjBk
+MBEGCWCGSAGG+EIBAQQEAwIABzAPBgNVHRMBAf8EBTADAQH/MB8GA1UdIwQYMBaAFEp4MlIR21kW
+Nl7fwRQ2QGpHfEyhMB0GA1UdDgQWBBRKeDJSEdtZFjZe38EUNkBqR3xMoTANBgkqhkiG9w0BAQQF
+AAOBgQB1W6ibAxHm6VZMzfmpTMANmvPMZWnmJXbMWbfWVMMdzZmsGd20hdXgPfxiIKeES1hl8eL5
+lSE/9dR+WB5Hh1Q+WKG1tfgq73HnvMP2sUlG4tega+VWeponmHxGYhTnyfxuAxJ5gDgdSIKN/Bf+
+KpYrtWKmpj29f5JZzVoqgrI3eQ==
+-----END CERTIFICATE-----
+
+Equifax Secure eBusiness CA 2
+=============================
+-----BEGIN CERTIFICATE-----
+MIIDIDCCAomgAwIBAgIEN3DPtTANBgkqhkiG9w0BAQUFADBOMQswCQYDVQQGEwJVUzEXMBUGA1UE
+ChMORXF1aWZheCBTZWN1cmUxJjAkBgNVBAsTHUVxdWlmYXggU2VjdXJlIGVCdXNpbmVzcyBDQS0y
+MB4XDTk5MDYyMzEyMTQ0NVoXDTE5MDYyMzEyMTQ0NVowTjELMAkGA1UEBhMCVVMxFzAVBgNVBAoT
+DkVxdWlmYXggU2VjdXJlMSYwJAYDVQQLEx1FcXVpZmF4IFNlY3VyZSBlQnVzaW5lc3MgQ0EtMjCB
+nzANBgkqhkiG9w0BAQEFAAOBjQAwgYkCgYEA5Dk5kx5SBhsoNviyoynF7Y6yEb3+6+e0dMKP/wXn
+2Z0GvxLIPw7y1tEkshHe0XMJitSxLJgJDR5QRrKDpkWNYmi7hRsgcDKqQM2mll/EcTc/BPO3QSQ5
+BxoeLmFYoBIL5aXfxavqN3HMHMg3OrmXUqesxWoklE6ce8/AatbfIb0CAwEAAaOCAQkwggEFMHAG
+A1UdHwRpMGcwZaBjoGGkXzBdMQswCQYDVQQGEwJVUzEXMBUGA1UEChMORXF1aWZheCBTZWN1cmUx
+JjAkBgNVBAsTHUVxdWlmYXggU2VjdXJlIGVCdXNpbmVzcyBDQS0yMQ0wCwYDVQQDEwRDUkwxMBoG
+A1UdEAQTMBGBDzIwMTkwNjIzMTIxNDQ1WjALBgNVHQ8EBAMCAQYwHwYDVR0jBBgwFoAUUJ4L6q9e
+uSBIplBqy/3YIHqngnYwHQYDVR0OBBYEFFCeC+qvXrkgSKZQasv92CB6p4J2MAwGA1UdEwQFMAMB
+Af8wGgYJKoZIhvZ9B0EABA0wCxsFVjMuMGMDAgbAMA0GCSqGSIb3DQEBBQUAA4GBAAyGgq3oThr1
+jokn4jVYPSm0B482UJW/bsGe68SQsoWou7dC4A8HOd/7npCy0cE+U58DRLB+S/Rv5Hwf5+Kx5Lia
+78O9zt4LMjTZ3ijtM2vE1Nc9ElirfQkty3D1E4qUoSek1nDFbZS1yX2doNLGCEnZZpum0/QL3MUm
+V+GRMOrN
+-----END CERTIFICATE-----
+
+AddTrust Low-Value Services Root
+================================
+-----BEGIN CERTIFICATE-----
+MIIEGDCCAwCgAwIBAgIBATANBgkqhkiG9w0BAQUFADBlMQswCQYDVQQGEwJTRTEUMBIGA1UEChML
+QWRkVHJ1c3QgQUIxHTAbBgNVBAsTFEFkZFRydXN0IFRUUCBOZXR3b3JrMSEwHwYDVQQDExhBZGRU
+cnVzdCBDbGFzcyAxIENBIFJvb3QwHhcNMDAwNTMwMTAzODMxWhcNMjAwNTMwMTAzODMxWjBlMQsw
+CQYDVQQGEwJTRTEUMBIGA1UEChMLQWRkVHJ1c3QgQUIxHTAbBgNVBAsTFEFkZFRydXN0IFRUUCBO
+ZXR3b3JrMSEwHwYDVQQDExhBZGRUcnVzdCBDbGFzcyAxIENBIFJvb3QwggEiMA0GCSqGSIb3DQEB
+AQUAA4IBDwAwggEKAoIBAQCWltQhSWDia+hBBwzexODcEyPNwTXH+9ZOEQpnXvUGW2ulCDtbKRY6
+54eyNAbFvAWlA3yCyykQruGIgb3WntP+LVbBFc7jJp0VLhD7Bo8wBN6ntGO0/7Gcrjyvd7ZWxbWr
+oulpOj0OM3kyP3CCkplhbY0wCI9xP6ZIVxn4JdxLZlyldI+Yrsj5wAYi56xz36Uu+1LcsRVlIPo1
+Zmne3yzxbrww2ywkEtvrNTVokMsAsJchPXQhI2U0K7t4WaPW4XY5mqRJjox0r26kmqPZm9I4XJui
+GMx1I4S+6+JNM3GOGvDC+Mcdoq0Dlyz4zyXG9rgkMbFjXZJ/Y/AlyVMuH79NAgMBAAGjgdIwgc8w
+HQYDVR0OBBYEFJWxtPCUtr3H2tERCSG+wa9J/RB7MAsGA1UdDwQEAwIBBjAPBgNVHRMBAf8EBTAD
+AQH/MIGPBgNVHSMEgYcwgYSAFJWxtPCUtr3H2tERCSG+wa9J/RB7oWmkZzBlMQswCQYDVQQGEwJT
+RTEUMBIGA1UEChMLQWRkVHJ1c3QgQUIxHTAbBgNVBAsTFEFkZFRydXN0IFRUUCBOZXR3b3JrMSEw
+HwYDVQQDExhBZGRUcnVzdCBDbGFzcyAxIENBIFJvb3SCAQEwDQYJKoZIhvcNAQEFBQADggEBACxt
+ZBsfzQ3duQH6lmM0MkhHma6X7f1yFqZzR1r0693p9db7RcwpiURdv0Y5PejuvE1Uhh4dbOMXJ0Ph
+iVYrqW9yTkkz43J8KiOavD7/KCrto/8cI7pDVwlnTUtiBi34/2ydYB7YHEt9tTEv2dB8Xfjea4MY
+eDdXL+gzB2ffHsdrKpV2ro9Xo/D0UrSpUwjP4E/TelOL/bscVjby/rK25Xa71SJlpz/+0WatC7xr
+mYbvP33zGDLKe8bjq2RGlfgmadlVg3sslgf/WSxEo8bl6ancoWOAWiFeIc9TVPC6b4nbqKqVz4vj
+ccweGyBECMB6tkD9xOQ14R0WHNC8K47Wcdk=
+-----END CERTIFICATE-----
+
+AddTrust External Root
+======================
+-----BEGIN CERTIFICATE-----
+MIIENjCCAx6gAwIBAgIBATANBgkqhkiG9w0BAQUFADBvMQswCQYDVQQGEwJTRTEUMBIGA1UEChML
+QWRkVHJ1c3QgQUIxJjAkBgNVBAsTHUFkZFRydXN0IEV4dGVybmFsIFRUUCBOZXR3b3JrMSIwIAYD
+VQQDExlBZGRUcnVzdCBFeHRlcm5hbCBDQSBSb290MB4XDTAwMDUzMDEwNDgzOFoXDTIwMDUzMDEw
+NDgzOFowbzELMAkGA1UEBhMCU0UxFDASBgNVBAoTC0FkZFRydXN0IEFCMSYwJAYDVQQLEx1BZGRU
+cnVzdCBFeHRlcm5hbCBUVFAgTmV0d29yazEiMCAGA1UEAxMZQWRkVHJ1c3QgRXh0ZXJuYWwgQ0Eg
+Um9vdDCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBALf3GjPm8gAELTngTlvtH7xsD821
++iO2zt6bETOXpClMfZOfvUq8k+0DGuOPz+VtUFrWlymUWoCwSXrbLpX9uMq/NzgtHj6RQa1wVsfw
+Tz/oMp50ysiQVOnGXw94nZpAPA6sYapeFI+eh6FqUNzXmk6vBbOmcZSccbNQYArHE504B4YCqOmo
+aSYYkKtMsE8jqzpPhNjfzp/haW+710LXa0Tkx63ubUFfclpxCDezeWWkWaCUN/cALw3CknLa0Dhy
+2xSoRcRdKn23tNbE7qzNE0S3ySvdQwAl+mG5aWpYIxG3pzOPVnVZ9c0p10a3CitlttNCbxWyuHv7
+7+ldU9U0WicCAwEAAaOB3DCB2TAdBgNVHQ4EFgQUrb2YejS0Jvf6xCZU7wO94CTLVBowCwYDVR0P
+BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wgZkGA1UdIwSBkTCBjoAUrb2YejS0Jvf6xCZU7wO94CTL
+VBqhc6RxMG8xCzAJBgNVBAYTAlNFMRQwEgYDVQQKEwtBZGRUcnVzdCBBQjEmMCQGA1UECxMdQWRk
+VHJ1c3QgRXh0ZXJuYWwgVFRQIE5ldHdvcmsxIjAgBgNVBAMTGUFkZFRydXN0IEV4dGVybmFsIENB
+IFJvb3SCAQEwDQYJKoZIhvcNAQEFBQADggEBALCb4IUlwtYj4g+WBpKdQZic2YR5gdkeWxQHIzZl
+j7DYd7usQWxHYINRsPkyPef89iYTx4AWpb9a/IfPeHmJIZriTAcKhjW88t5RxNKWt9x+Tu5w/Rw5
+6wwCURQtjr0W4MHfRnXnJK3s9EK0hZNwEGe6nQY1ShjTK3rMUUKhemPR5ruhxSvCNr4TDea9Y355
+e6cJDUCrat2PisP29owaQgVR1EX1n6diIWgVIEM8med8vSTYqZEXc4g/VhsxOBi0cQ+azcgOno4u
+G+GMmIPLHzHxREzGBHNJdmAPx/i9F4BrLunMTA5amnkPIAou1Z5jJh5VkpTYghdae9C8x49OhgQ=
+-----END CERTIFICATE-----
+
+AddTrust Public Services Root
+=============================
+-----BEGIN CERTIFICATE-----
+MIIEFTCCAv2gAwIBAgIBATANBgkqhkiG9w0BAQUFADBkMQswCQYDVQQGEwJTRTEUMBIGA1UEChML
+QWRkVHJ1c3QgQUIxHTAbBgNVBAsTFEFkZFRydXN0IFRUUCBOZXR3b3JrMSAwHgYDVQQDExdBZGRU
+cnVzdCBQdWJsaWMgQ0EgUm9vdDAeFw0wMDA1MzAxMDQxNTBaFw0yMDA1MzAxMDQxNTBaMGQxCzAJ
+BgNVBAYTAlNFMRQwEgYDVQQKEwtBZGRUcnVzdCBBQjEdMBsGA1UECxMUQWRkVHJ1c3QgVFRQIE5l
+dHdvcmsxIDAeBgNVBAMTF0FkZFRydXN0IFB1YmxpYyBDQSBSb290MIIBIjANBgkqhkiG9w0BAQEF
+AAOCAQ8AMIIBCgKCAQEA6Rowj4OIFMEg2Dybjxt+A3S72mnTRqX4jsIMEZBRpS9mVEBV6tsfSlbu
+nyNu9DnLoblv8n75XYcmYZ4c+OLspoH4IcUkzBEMP9smcnrHAZcHF/nXGCwwfQ56HmIexkvA/X1i
+d9NEHif2P0tEs7c42TkfYNVRknMDtABp4/MUTu7R3AnPdzRGULD4EfL+OHn3Bzn+UZKXC1sIXzSG
+Aa2Il+tmzV7R/9x98oTaunet3IAIx6eH1lWfl2royBFkuucZKT8Rs3iQhCBSWxHveNCD9tVIkNAw
+HM+A+WD+eeSI8t0A65RF62WUaUC6wNW0uLp9BBGo6zEFlpROWCGOn9Bg/QIDAQABo4HRMIHOMB0G
+A1UdDgQWBBSBPjfYkrAfd59ctKtzquf2NGAv+jALBgNVHQ8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB
+/zCBjgYDVR0jBIGGMIGDgBSBPjfYkrAfd59ctKtzquf2NGAv+qFopGYwZDELMAkGA1UEBhMCU0Ux
+FDASBgNVBAoTC0FkZFRydXN0IEFCMR0wGwYDVQQLExRBZGRUcnVzdCBUVFAgTmV0d29yazEgMB4G
+A1UEAxMXQWRkVHJ1c3QgUHVibGljIENBIFJvb3SCAQEwDQYJKoZIhvcNAQEFBQADggEBAAP3FUr4
+JNojVhaTdt02KLmuG7jD8WS6IBh4lSknVwW8fCr0uVFV2ocC3g8WFzH4qnkuCRO7r7IgGRLlk/lL
++YPoRNWyQSW/iHVv/xD8SlTQX/D67zZzfRs2RcYhbbQVuE7PnFylPVoAjgbjPGsye/Kf8Lb93/Ao
+GEjwxrzQvzSAlsJKsW2Ox5BF3i9nrEUEo3rcVZLJR2bYGozH7ZxOmuASu7VqTITh4SINhwBk/ox9
+Yjllpu9CtoAlEmEBqCQTcAARJl/6NVDFSMwGR+gn2HCNX2TmoUQmXiLsks3/QppEIW1cxeMiHV9H
+EufOX1362KqxMy3ZdvJOOjMMK7MtkAY=
+-----END CERTIFICATE-----
+
+AddTrust Qualified Certificates Root
+====================================
+-----BEGIN CERTIFICATE-----
+MIIEHjCCAwagAwIBAgIBATANBgkqhkiG9w0BAQUFADBnMQswCQYDVQQGEwJTRTEUMBIGA1UEChML
+QWRkVHJ1c3QgQUIxHTAbBgNVBAsTFEFkZFRydXN0IFRUUCBOZXR3b3JrMSMwIQYDVQQDExpBZGRU
+cnVzdCBRdWFsaWZpZWQgQ0EgUm9vdDAeFw0wMDA1MzAxMDQ0NTBaFw0yMDA1MzAxMDQ0NTBaMGcx
+CzAJBgNVBAYTAlNFMRQwEgYDVQQKEwtBZGRUcnVzdCBBQjEdMBsGA1UECxMUQWRkVHJ1c3QgVFRQ
+IE5ldHdvcmsxIzAhBgNVBAMTGkFkZFRydXN0IFF1YWxpZmllZCBDQSBSb290MIIBIjANBgkqhkiG
+9w0BAQEFAAOCAQ8AMIIBCgKCAQEA5B6a/twJWoekn0e+EV+vhDTbYjx5eLfpMLXsDBwqxBb/4Oxx
+64r1EW7tTw2R0hIYLUkVAcKkIhPHEWT/IhKauY5cLwjPcWqzZwFZ8V1G87B4pfYOQnrjfxvM0PC3
+KP0q6p6zsLkEqv32x7SxuCqg+1jxGaBvcCV+PmlKfw8i2O+tCBGaKZnhqkRFmhJePp1tUvznoD1o
+L/BLcHwTOK28FSXx1s6rosAx1i+f4P8UWfyEk9mHfExUE+uf0S0R+Bg6Ot4l2ffTQO2kBhLEO+GR
+wVY18BTcZTYJbqukB8c10cIDMzZbdSZtQvESa0NvS3GU+jQd7RNuyoB/mC9suWXY6QIDAQABo4HU
+MIHRMB0GA1UdDgQWBBQ5lYtii1zJ1IC6WA+XPxUIQ8yYpzALBgNVHQ8EBAMCAQYwDwYDVR0TAQH/
+BAUwAwEB/zCBkQYDVR0jBIGJMIGGgBQ5lYtii1zJ1IC6WA+XPxUIQ8yYp6FrpGkwZzELMAkGA1UE
+BhMCU0UxFDASBgNVBAoTC0FkZFRydXN0IEFCMR0wGwYDVQQLExRBZGRUcnVzdCBUVFAgTmV0d29y
+azEjMCEGA1UEAxMaQWRkVHJ1c3QgUXVhbGlmaWVkIENBIFJvb3SCAQEwDQYJKoZIhvcNAQEFBQAD
+ggEBABmrder4i2VhlRO6aQTvhsoToMeqT2QbPxj2qC0sVY8FtzDqQmodwCVRLae/DLPt7wh/bDxG
+GuoYQ992zPlmhpwsaPXpF/gxsxjE1kh9I0xowX67ARRvxdlu3rsEQmr49lx95dr6h+sNNVJn0J6X
+dgWTP5XHAeZpVTh/EGGZyeNfpso+gmNIquIISD6q8rKFYqa0p9m9N5xotS1WfbC3P6CxB9bpT9ze
+RXEwMn8bLgn5v1Kh7sKAPgZcLlVAwRv1cEWw3F369nJad9Jjzc9YiQBCYz95OdBEsIJuQRno3eDB
+iFrRHnGTHyQwdOUeqN48Jzd/g66ed8/wMLH/S5noxqE=
+-----END CERTIFICATE-----
+
+Entrust Root Certification Authority
+====================================
+-----BEGIN CERTIFICATE-----
+MIIEkTCCA3mgAwIBAgIERWtQVDANBgkqhkiG9w0BAQUFADCBsDELMAkGA1UEBhMCVVMxFjAUBgNV
+BAoTDUVudHJ1c3QsIEluYy4xOTA3BgNVBAsTMHd3dy5lbnRydXN0Lm5ldC9DUFMgaXMgaW5jb3Jw
+b3JhdGVkIGJ5IHJlZmVyZW5jZTEfMB0GA1UECxMWKGMpIDIwMDYgRW50cnVzdCwgSW5jLjEtMCsG
+A1UEAxMkRW50cnVzdCBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTA2MTEyNzIwMjM0
+MloXDTI2MTEyNzIwNTM0MlowgbAxCzAJBgNVBAYTAlVTMRYwFAYDVQQKEw1FbnRydXN0LCBJbmMu
+MTkwNwYDVQQLEzB3d3cuZW50cnVzdC5uZXQvQ1BTIGlzIGluY29ycG9yYXRlZCBieSByZWZlcmVu
+Y2UxHzAdBgNVBAsTFihjKSAyMDA2IEVudHJ1c3QsIEluYy4xLTArBgNVBAMTJEVudHJ1c3QgUm9v
+dCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEB
+ALaVtkNC+sZtKm9I35RMOVcF7sN5EUFoNu3s/poBj6E4KPz3EEZmLk0eGrEaTsbRwJWIsMn/MYsz
+A9u3g3s+IIRe7bJWKKf44LlAcTfFy0cOlypowCKVYhXbR9n10Cv/gkvJrT7eTNuQgFA/CYqEAOww
+Cj0Yzfv9KlmaI5UXLEWeH25DeW0MXJj+SKfFI0dcXv1u5x609mhF0YaDW6KKjbHjKYD+JXGIrb68
+j6xSlkuqUY3kEzEZ6E5Nn9uss2rVvDlUccp6en+Q3X0dgNmBu1kmwhH+5pPi94DkZfs0Nw4pgHBN
+rziGLp5/V6+eF67rHMsoIV+2HNjnogQi+dPa2MsCAwEAAaOBsDCBrTAOBgNVHQ8BAf8EBAMCAQYw
+DwYDVR0TAQH/BAUwAwEB/zArBgNVHRAEJDAigA8yMDA2MTEyNzIwMjM0MlqBDzIwMjYxMTI3MjA1
+MzQyWjAfBgNVHSMEGDAWgBRokORnpKZTgMeGZqTx90tD+4S9bTAdBgNVHQ4EFgQUaJDkZ6SmU4DH
+hmak8fdLQ/uEvW0wHQYJKoZIhvZ9B0EABBAwDhsIVjcuMTo0LjADAgSQMA0GCSqGSIb3DQEBBQUA
+A4IBAQCT1DCw1wMgKtD5Y+iRDAUgqV8ZyntyTtSx29CW+1RaGSwMCPeyvIWonX9tO1KzKtvn1ISM
+Y/YPyyYBkVBs9F8U4pN0wBOeMDpQ47RgxRzwIkSNcUesyBrJ6ZuaAGAT/3B+XxFNSRuzFVJ7yVTa
+v52Vr2ua2J7p8eRDjeIRRDq/r72DQnNSi6q7pynP9WQcCk3RvKqsnyrQ/39/2n3qse0wJcGE2jTS
+W3iDVuycNsMm4hH2Z0kdkquM++v/eu6FSqdQgPCnXEqULl8FmTxSQeDNtGPPAUO6nIPcj2A781q0
+tHuu2guQOHXvgR1m0vdXcDazv/wor3ElhVsT/h5/WrQ8
+-----END CERTIFICATE-----
+
+RSA Security 2048 v3
+====================
+-----BEGIN CERTIFICATE-----
+MIIDYTCCAkmgAwIBAgIQCgEBAQAAAnwAAAAKAAAAAjANBgkqhkiG9w0BAQUFADA6MRkwFwYDVQQK
+ExBSU0EgU2VjdXJpdHkgSW5jMR0wGwYDVQQLExRSU0EgU2VjdXJpdHkgMjA0OCBWMzAeFw0wMTAy
+MjIyMDM5MjNaFw0yNjAyMjIyMDM5MjNaMDoxGTAXBgNVBAoTEFJTQSBTZWN1cml0eSBJbmMxHTAb
+BgNVBAsTFFJTQSBTZWN1cml0eSAyMDQ4IFYzMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKC
+AQEAt49VcdKA3XtpeafwGFAyPGJn9gqVB93mG/Oe2dJBVGutn3y+Gc37RqtBaB4Y6lXIL5F4iSj7
+Jylg/9+PjDvJSZu1pJTOAeo+tWN7fyb9Gd3AIb2E0S1PRsNO3Ng3OTsor8udGuorryGlwSMiuLgb
+WhOHV4PR8CDn6E8jQrAApX2J6elhc5SYcSa8LWrg903w8bYqODGBDSnhAMFRD0xS+ARaqn1y07iH
+KrtjEAMqs6FPDVpeRrc9DvV07Jmf+T0kgYim3WBU6JU2PcYJk5qjEoAAVZkZR73QpXzDuvsf9/UP
++Ky5tfQ3mBMY3oVbtwyCO4dvlTlYMNpuAWgXIszACwIDAQABo2MwYTAPBgNVHRMBAf8EBTADAQH/
+MA4GA1UdDwEB/wQEAwIBBjAfBgNVHSMEGDAWgBQHw1EwpKrpRa41JPr/JCwz0LGdjDAdBgNVHQ4E
+FgQUB8NRMKSq6UWuNST6/yQsM9CxnYwwDQYJKoZIhvcNAQEFBQADggEBAF8+hnZuuDU8TjYcHnmY
+v/3VEhF5Ug7uMYm83X/50cYVIeiKAVQNOvtUudZj1LGqlk2iQk3UUx+LEN5/Zb5gEydxiKRz44Rj
+0aRV4VCT5hsOedBnvEbIvz8XDZXmxpBp3ue0L96VfdASPz0+f00/FGj1EVDVwfSQpQgdMWD/YIwj
+VAqv/qFuxdF6Kmh4zx6CCiC0H63lhbJqaHVOrSU3lIW+vaHU6rcMSzyd6BIA8F+sDeGscGNz9395
+nzIlQnQFgCi/vcEkllgVsRch6YlL2weIZ/QVrXA+L02FO8K32/6YaCOJ4XQP3vTFhGMpG8zLB8kA
+pKnXwiJPZ9d37CAFYd4=
+-----END CERTIFICATE-----
+
+GeoTrust Global CA
+==================
+-----BEGIN CERTIFICATE-----
+MIIDVDCCAjygAwIBAgIDAjRWMA0GCSqGSIb3DQEBBQUAMEIxCzAJBgNVBAYTAlVTMRYwFAYDVQQK
+Ew1HZW9UcnVzdCBJbmMuMRswGQYDVQQDExJHZW9UcnVzdCBHbG9iYWwgQ0EwHhcNMDIwNTIxMDQw
+MDAwWhcNMjIwNTIxMDQwMDAwWjBCMQswCQYDVQQGEwJVUzEWMBQGA1UEChMNR2VvVHJ1c3QgSW5j
+LjEbMBkGA1UEAxMSR2VvVHJ1c3QgR2xvYmFsIENBMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIB
+CgKCAQEA2swYYzD99BcjGlZ+W988bDjkcbd4kdS8odhM+KhDtgPpTSEHCIjaWC9mOSm9BXiLnTjo
+BbdqfnGk5sRgprDvgOSJKA+eJdbtg/OtppHHmMlCGDUUna2YRpIuT8rxh0PBFpVXLVDviS2Aelet
+8u5fa9IAjbkU+BQVNdnARqN7csiRv8lVK83Qlz6cJmTM386DGXHKTubU1XupGc1V3sjs0l44U+Vc
+T4wt/lAjNvxm5suOpDkZALeVAjmRCw7+OC7RHQWa9k0+bw8HHa8sHo9gOeL6NlMTOdReJivbPagU
+vTLrGAMoUgRx5aszPeE4uwc2hGKceeoWMPRfwCvocWvk+QIDAQABo1MwUTAPBgNVHRMBAf8EBTAD
+AQH/MB0GA1UdDgQWBBTAephojYn7qwVkDBF9qn1luMrMTjAfBgNVHSMEGDAWgBTAephojYn7qwVk
+DBF9qn1luMrMTjANBgkqhkiG9w0BAQUFAAOCAQEANeMpauUvXVSOKVCUn5kaFOSPeCpilKInZ57Q
+zxpeR+nBsqTP3UEaBU6bS+5Kb1VSsyShNwrrZHYqLizz/Tt1kL/6cdjHPTfStQWVYrmm3ok9Nns4
+d0iXrKYgjy6myQzCsplFAMfOEVEiIuCl6rYVSAlk6l5PdPcFPseKUgzbFbS9bZvlxrFUaKnjaZC2
+mqUPuLk/IH2uSrW4nOQdtqvmlKXBx4Ot2/Unhw4EbNX/3aBd7YdStysVAq45pmp06drE57xNNB6p
+XE0zX5IJL4hmXXeXxx12E6nV5fEWCRE11azbJHFwLJhWC9kXtNHjUStedejV0NxPNO3CBWaAocvm
+Mw==
+-----END CERTIFICATE-----
+
+GeoTrust Global CA 2
+====================
+-----BEGIN CERTIFICATE-----
+MIIDZjCCAk6gAwIBAgIBATANBgkqhkiG9w0BAQUFADBEMQswCQYDVQQGEwJVUzEWMBQGA1UEChMN
+R2VvVHJ1c3QgSW5jLjEdMBsGA1UEAxMUR2VvVHJ1c3QgR2xvYmFsIENBIDIwHhcNMDQwMzA0MDUw
+MDAwWhcNMTkwMzA0MDUwMDAwWjBEMQswCQYDVQQGEwJVUzEWMBQGA1UEChMNR2VvVHJ1c3QgSW5j
+LjEdMBsGA1UEAxMUR2VvVHJ1c3QgR2xvYmFsIENBIDIwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw
+ggEKAoIBAQDvPE1APRDfO1MA4Wf+lGAVPoWI8YkNkMgoI5kF6CsgncbzYEbYwbLVjDHZ3CB5JIG/
+NTL8Y2nbsSpr7iFY8gjpeMtvy/wWUsiRxP89c96xPqfCfWbB9X5SJBri1WeR0IIQ13hLTytCOb1k
+LUCgsBDTOEhGiKEMuzozKmKY+wCdE1l/bztyqu6mD4b5BWHqZ38MN5aL5mkWRxHCJ1kDs6ZgwiFA
+Vvqgx306E+PsV8ez1q6diYD3Aecs9pYrEw15LNnA5IZ7S4wMcoKK+xfNAGw6EzywhIdLFnopsk/b
+HdQL82Y3vdj2V7teJHq4PIu5+pIaGoSe2HSPqht/XvT+RSIhAgMBAAGjYzBhMA8GA1UdEwEB/wQF
+MAMBAf8wHQYDVR0OBBYEFHE4NvICMVNHK266ZUapEBVYIAUJMB8GA1UdIwQYMBaAFHE4NvICMVNH
+K266ZUapEBVYIAUJMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQUFAAOCAQEAA/e1K6tdEPx7
+srJerJsOflN4WT5CBP51o62sgU7XAotexC3IUnbHLB/8gTKY0UvGkpMzNTEv/NgdRN3ggX+d6Yvh
+ZJFiCzkIjKx0nVnZellSlxG5FntvRdOW2TF9AjYPnDtuzywNA0ZF66D0f0hExghAzN4bcLUprbqL
+OzRldRtxIR0sFAqwlpW41uryZfspuk/qkZN0abby/+Ea0AzRdoXLiiW9l14sbxWZJue2Kf8i7MkC
+x1YAzUm5s2x7UwQa4qjJqhIFI8LO57sEAszAR6LkxCkvW0VXiVHuPOtSCP8HNR6fNWpHSlaY0VqF
+H4z1Ir+rzoPz4iIprn2DQKi6bA==
+-----END CERTIFICATE-----
+
+GeoTrust Universal CA
+=====================
+-----BEGIN CERTIFICATE-----
+MIIFaDCCA1CgAwIBAgIBATANBgkqhkiG9w0BAQUFADBFMQswCQYDVQQGEwJVUzEWMBQGA1UEChMN
+R2VvVHJ1c3QgSW5jLjEeMBwGA1UEAxMVR2VvVHJ1c3QgVW5pdmVyc2FsIENBMB4XDTA0MDMwNDA1
+MDAwMFoXDTI5MDMwNDA1MDAwMFowRTELMAkGA1UEBhMCVVMxFjAUBgNVBAoTDUdlb1RydXN0IElu
+Yy4xHjAcBgNVBAMTFUdlb1RydXN0IFVuaXZlcnNhbCBDQTCCAiIwDQYJKoZIhvcNAQEBBQADggIP
+ADCCAgoCggIBAKYVVaCjxuAfjJ0hUNfBvitbtaSeodlyWL0AG0y/YckUHUWCq8YdgNY96xCcOq9t
+JPi8cQGeBvV8Xx7BDlXKg5pZMK4ZyzBIle0iN430SppyZj6tlcDgFgDgEB8rMQ7XlFTTQjOgNB0e
+RXbdT8oYN+yFFXoZCPzVx5zw8qkuEKmS5j1YPakWaDwvdSEYfyh3peFhF7em6fgemdtzbvQKoiFs
+7tqqhZJmr/Z6a4LauiIINQ/PQvE1+mrufislzDoR5G2vc7J2Ha3QsnhnGqQ5HFELZ1aD/ThdDc7d
+8Lsrlh/eezJS/R27tQahsiFepdaVaH/wmZ7cRQg+59IJDTWU3YBOU5fXtQlEIGQWFwMCTFMNaN7V
+qnJNk22CDtucvc+081xdVHppCZbW2xHBjXWotM85yM48vCR85mLK4b19p71XZQvk/iXttmkQ3Cga
+Rr0BHdCXteGYO8A3ZNY9lO4L4fUorgtWv3GLIylBjobFS1J72HGrH4oVpjuDWtdYAVHGTEHZf9hB
+Z3KiKN9gg6meyHv8U3NyWfWTehd2Ds735VzZC1U0oqpbtWpU5xPKV+yXbfReBi9Fi1jUIxaS5BZu
+KGNZMN9QAZxjiRqf2xeUgnA3wySemkfWWspOqGmJch+RbNt+nhutxx9z3SxPGWX9f5NAEC7S8O08
+ni4oPmkmM8V7AgMBAAGjYzBhMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFNq7LqqwDLiIJlF0
+XG0D08DYj3rWMB8GA1UdIwQYMBaAFNq7LqqwDLiIJlF0XG0D08DYj3rWMA4GA1UdDwEB/wQEAwIB
+hjANBgkqhkiG9w0BAQUFAAOCAgEAMXjmx7XfuJRAyXHEqDXsRh3ChfMoWIawC/yOsjmPRFWrZIRc
+aanQmjg8+uUfNeVE44B5lGiku8SfPeE0zTBGi1QrlaXv9z+ZhP015s8xxtxqv6fXIwjhmF7DWgh2
+qaavdy+3YL1ERmrvl/9zlcGO6JP7/TG37FcREUWbMPEaiDnBTzynANXH/KttgCJwpQzgXQQpAvvL
+oJHRfNbDflDVnVi+QTjruXU8FdmbyUqDWcDaU/0zuzYYm4UPFd3uLax2k7nZAY1IEKj79TiG8dsK
+xr2EoyNB3tZ3b4XUhRxQ4K5RirqNPnbiucon8l+f725ZDQbYKxek0nxru18UGkiPGkzns0ccjkxF
+KyDuSN/n3QmOGKjaQI2SJhFTYXNd673nxE0pN2HrrDktZy4W1vUAg4WhzH92xH3kt0tm7wNFYGm2
+DFKWkoRepqO1pD4r2czYG0eq8kTaT/kD6PAUyz/zg97QwVTjt+gKN02LIFkDMBmhLMi9ER/frslK
+xfMnZmaGrGiR/9nmUxwPi1xpZQomyB40w11Re9epnAahNt3ViZS82eQtDF4JbAiXfKM9fJP/P6EU
+p8+1Xevb2xzEdt+Iub1FBZUbrvxGakyvSOPOrg/SfuvmbJxPgWp6ZKy7PtXny3YuxadIwVyQD8vI
+P/rmMuGNG2+k5o7Y+SlIis5z/iw=
+-----END CERTIFICATE-----
+
+GeoTrust Universal CA 2
+=======================
+-----BEGIN CERTIFICATE-----
+MIIFbDCCA1SgAwIBAgIBATANBgkqhkiG9w0BAQUFADBHMQswCQYDVQQGEwJVUzEWMBQGA1UEChMN
+R2VvVHJ1c3QgSW5jLjEgMB4GA1UEAxMXR2VvVHJ1c3QgVW5pdmVyc2FsIENBIDIwHhcNMDQwMzA0
+MDUwMDAwWhcNMjkwMzA0MDUwMDAwWjBHMQswCQYDVQQGEwJVUzEWMBQGA1UEChMNR2VvVHJ1c3Qg
+SW5jLjEgMB4GA1UEAxMXR2VvVHJ1c3QgVW5pdmVyc2FsIENBIDIwggIiMA0GCSqGSIb3DQEBAQUA
+A4ICDwAwggIKAoICAQCzVFLByT7y2dyxUxpZKeexw0Uo5dfR7cXFS6GqdHtXr0om/Nj1XqduGdt0
+DE81WzILAePb63p3NeqqWuDW6KFXlPCQo3RWlEQwAx5cTiuFJnSCegx2oG9NzkEtoBUGFF+3Qs17
+j1hhNNwqCPkuwwGmIkQcTAeC5lvO0Ep8BNMZcyfwqph/Lq9O64ceJHdqXbboW0W63MOhBW9Wjo8Q
+JqVJwy7XQYci4E+GymC16qFjwAGXEHm9ADwSbSsVsaxLse4YuU6W3Nx2/zu+z18DwPw76L5GG//a
+QMJS9/7jOvdqdzXQ2o3rXhhqMcceujwbKNZrVMaqW9eiLBsZzKIC9ptZvTdrhrVtgrrY6slWvKk2
+WP0+GfPtDCapkzj4T8FdIgbQl+rhrcZV4IErKIM6+vR7IVEAvlI4zs1meaj0gVbi0IMJR1FbUGrP
+20gaXT73y/Zl92zxlfgCOzJWgjl6W70viRu/obTo/3+NjN8D8WBOWBFM66M/ECuDmgFz2ZRthAAn
+ZqzwcEAJQpKtT5MNYQlRJNiS1QuUYbKHsu3/mjX/hVTK7URDrBs8FmtISgocQIgfksILAAX/8sgC
+SqSqqcyZlpwvWOB94b67B9xfBHJcMTTD7F8t4D1kkCLm0ey4Lt1ZrtmhN79UNdxzMk+MBB4zsslG
+8dhcyFVQyWi9qLo2CQIDAQABo2MwYTAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBR281Xh+qQ2
++/CfXGJx7Tz0RzgQKzAfBgNVHSMEGDAWgBR281Xh+qQ2+/CfXGJx7Tz0RzgQKzAOBgNVHQ8BAf8E
+BAMCAYYwDQYJKoZIhvcNAQEFBQADggIBAGbBxiPz2eAubl/oz66wsCVNK/g7WJtAJDday6sWSf+z
+dXkzoS9tcBc0kf5nfo/sm+VegqlVHy/c1FEHEv6sFj4sNcZj/NwQ6w2jqtB8zNHQL1EuxBRa3ugZ
+4T7GzKQp5y6EqgYweHZUcyiYWTjgAA1i00J9IZ+uPTqM1fp3DRgrFg5fNuH8KrUwJM/gYwx7WBr+
+mbpCErGR9Hxo4sjoryzqyX6uuyo9DRXcNJW2GHSoag/HtPQTxORb7QrSpJdMKu0vbBKJPfEncKpq
+A1Ihn0CoZ1Dy81of398j9tx4TuaYT1U6U+Pv8vSfx3zYWK8pIpe44L2RLrB27FcRz+8pRPPphXpg
+Y+RdM4kX2TGq2tbzGDVyz4crL2MjhF2EjD9XoIj8mZEoJmmZ1I+XRL6O1UixpCgp8RW04eWe3fiP
+pm8m1wk8OhwRDqZsN/etRIcsKMfYdIKz0G9KV7s1KSegi+ghp4dkNl3M2Basx7InQJJVOCiNUW7d
+FGdTbHFcJoRNdVq2fmBWqU2t+5sel/MN2dKXVHfaPRK34B7vCAas+YWH6aLcr34YEoP9VhdBLtUp
+gn2Z9DH2canPLAEnpQW5qrJITirvn5NSUZU8UnOOVkwXQMAJKOSLakhT2+zNVVXxxvjpoixMptEm
+X36vWkzaH6byHCx+rgIW0lbQL1dTR+iS
+-----END CERTIFICATE-----
+
+America Online Root Certification Authority 1
+=============================================
+-----BEGIN CERTIFICATE-----
+MIIDpDCCAoygAwIBAgIBATANBgkqhkiG9w0BAQUFADBjMQswCQYDVQQGEwJVUzEcMBoGA1UEChMT
+QW1lcmljYSBPbmxpbmUgSW5jLjE2MDQGA1UEAxMtQW1lcmljYSBPbmxpbmUgUm9vdCBDZXJ0aWZp
+Y2F0aW9uIEF1dGhvcml0eSAxMB4XDTAyMDUyODA2MDAwMFoXDTM3MTExOTIwNDMwMFowYzELMAkG
+A1UEBhMCVVMxHDAaBgNVBAoTE0FtZXJpY2EgT25saW5lIEluYy4xNjA0BgNVBAMTLUFtZXJpY2Eg
+T25saW5lIFJvb3QgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgMTCCASIwDQYJKoZIhvcNAQEBBQAD
+ggEPADCCAQoCggEBAKgv6KRpBgNHw+kqmP8ZonCaxlCyfqXfaE0bfA+2l2h9LaaLl+lkhsmj76CG
+v2BlnEtUiMJIxUo5vxTjWVXlGbR0yLQFOVwWpeKVBeASrlmLojNoWBym1BW32J/X3HGrfpq/m44z
+DyL9Hy7nBzbvYjnF3cu6JRQj3gzGPTzOggjmZj7aUTsWOqMFf6Dch9Wc/HKpoH145LcxVR5lu9Rh
+sCFg7RAycsWSJR74kEoYeEfffjA3PlAb2xzTa5qGUwew76wGePiEmf4hjUyAtgyC9mZweRrTT6PP
+8c9GsEsPPt2IYriMqQkoO3rHl+Ee5fSfwMCuJKDIodkP1nsmgmkyPacCAwEAAaNjMGEwDwYDVR0T
+AQH/BAUwAwEB/zAdBgNVHQ4EFgQUAK3Zo/Z59m50qX8zPYEX10zPM94wHwYDVR0jBBgwFoAUAK3Z
+o/Z59m50qX8zPYEX10zPM94wDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBBQUAA4IBAQB8itEf
+GDeC4Liwo+1WlchiYZwFos3CYiZhzRAW18y0ZTTQEYqtqKkFZu90821fnZmv9ov761KyBZiibyrF
+VL0lvV+uyIbqRizBs73B6UlwGBaXCBOMIOAbLjpHyx7kADCVW/RFo8AasAFOq73AI25jP4BKxQft
+3OJvx8Fi8eNy1gTIdGcL+oiroQHIb/AUr9KZzVGTfu0uOMe9zkZQPXLjeSWdm4grECDdpbgyn43g
+Kd8hdIaC2y+CMMbHNYaz+ZZfRtsMRf3zUMNvxsNIrUam4SdHCh0Om7bCd39j8uB9Gr784N/Xx6ds
+sPmuujz9dLQR6FgNgLzTqIA6me11zEZ7
+-----END CERTIFICATE-----
+
+America Online Root Certification Authority 2
+=============================================
+-----BEGIN CERTIFICATE-----
+MIIFpDCCA4ygAwIBAgIBATANBgkqhkiG9w0BAQUFADBjMQswCQYDVQQGEwJVUzEcMBoGA1UEChMT
+QW1lcmljYSBPbmxpbmUgSW5jLjE2MDQGA1UEAxMtQW1lcmljYSBPbmxpbmUgUm9vdCBDZXJ0aWZp
+Y2F0aW9uIEF1dGhvcml0eSAyMB4XDTAyMDUyODA2MDAwMFoXDTM3MDkyOTE0MDgwMFowYzELMAkG
+A1UEBhMCVVMxHDAaBgNVBAoTE0FtZXJpY2EgT25saW5lIEluYy4xNjA0BgNVBAMTLUFtZXJpY2Eg
+T25saW5lIFJvb3QgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgMjCCAiIwDQYJKoZIhvcNAQEBBQAD
+ggIPADCCAgoCggIBAMxBRR3pPU0Q9oyxQcngXssNt79Hc9PwVU3dxgz6sWYFas14tNwC206B89en
+fHG8dWOgXeMHDEjsJcQDIPT/DjsS/5uN4cbVG7RtIuOx238hZK+GvFciKtZHgVdEglZTvYYUAQv8
+f3SkWq7xuhG1m1hagLQ3eAkzfDJHA1zEpYNI9FdWboE2JxhP7JsowtS013wMPgwr38oE18aO6lhO
+qKSlGBxsRZijQdEt0sdtjRnxrXm3gT+9BoInLRBYBbV4Bbkv2wxrkJB+FFk4u5QkE+XRnRTf04JN
+RvCAOVIyD+OEsnpD8l7eXz8d3eOyG6ChKiMDbi4BFYdcpnV1x5dhvt6G3NRI270qv0pV2uh9UPu0
+gBe4lL8BPeraunzgWGcXuVjgiIZGZ2ydEEdYMtA1fHkqkKJaEBEjNa0vzORKW6fIJ/KD3l67Xnfn
+6KVuY8INXWHQjNJsWiEOyiijzirplcdIz5ZvHZIlyMbGwcEMBawmxNJ10uEqZ8A9W6Wa6897Gqid
+FEXlD6CaZd4vKL3Ob5Rmg0gp2OpljK+T2WSfVVcmv2/LNzGZo2C7HK2JNDJiuEMhBnIMoVxtRsX6
+Kc8w3onccVvdtjc+31D1uAclJuW8tf48ArO3+L5DwYcRlJ4jbBeKuIonDFRH8KmzwICMoCfrHRnj
+B453cMor9H124HhnAgMBAAGjYzBhMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFE1FwWg4u3Op
+aaEg5+31IqEjFNeeMB8GA1UdIwQYMBaAFE1FwWg4u3OpaaEg5+31IqEjFNeeMA4GA1UdDwEB/wQE
+AwIBhjANBgkqhkiG9w0BAQUFAAOCAgEAZ2sGuV9FOypLM7PmG2tZTiLMubekJcmnxPBUlgtk87FY
+T15R/LKXeydlwuXK5w0MJXti4/qftIe3RUavg6WXSIylvfEWK5t2LHo1YGwRgJfMqZJS5ivmae2p
++DYtLHe/YUjRYwu5W1LtGLBDQiKmsXeu3mnFzcccobGlHBD7GL4acN3Bkku+KVqdPzW+5X1R+FXg
+JXUjhx5c3LqdsKyzadsXg8n33gy8CNyRnqjQ1xU3c6U1uPx+xURABsPr+CKAXEfOAuMRn0T//Zoy
+zH1kUQ7rVyZ2OuMeIjzCpjbdGe+n/BLzJsBZMYVMnNjP36TMzCmT/5RtdlwTCJfy7aULTd3oyWgO
+ZtMADjMSW7yV5TKQqLPGbIOtd+6Lfn6xqavT4fG2wLHqiMDn05DpKJKUe2h7lyoKZy2FAjgQ5ANh
+1NolNscIWC2hp1GvMApJ9aZphwctREZ2jirlmjvXGKL8nDgQzMY70rUXOm/9riW99XJZZLF0Kjhf
+GEzfz3EEWjbUvy+ZnOjZurGV5gJLIaFb1cFPj65pbVPbAZO1XB4Y3WRayhgoPmMEEf0cjQAPuDff
+Z4qdZqkCapH/E8ovXYO8h5Ns3CRRFgQlZvqz2cK6Kb6aSDiCmfS/O0oxGfm/jiEzFMpPVF/7zvuP
+cX/9XhmgD0uRuMRUvAawRY8mkaKO/qk=
+-----END CERTIFICATE-----
+
+Visa eCommerce Root
+===================
+-----BEGIN CERTIFICATE-----
+MIIDojCCAoqgAwIBAgIQE4Y1TR0/BvLB+WUF1ZAcYjANBgkqhkiG9w0BAQUFADBrMQswCQYDVQQG
+EwJVUzENMAsGA1UEChMEVklTQTEvMC0GA1UECxMmVmlzYSBJbnRlcm5hdGlvbmFsIFNlcnZpY2Ug
+QXNzb2NpYXRpb24xHDAaBgNVBAMTE1Zpc2EgZUNvbW1lcmNlIFJvb3QwHhcNMDIwNjI2MDIxODM2
+WhcNMjIwNjI0MDAxNjEyWjBrMQswCQYDVQQGEwJVUzENMAsGA1UEChMEVklTQTEvMC0GA1UECxMm
+VmlzYSBJbnRlcm5hdGlvbmFsIFNlcnZpY2UgQXNzb2NpYXRpb24xHDAaBgNVBAMTE1Zpc2EgZUNv
+bW1lcmNlIFJvb3QwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCvV95WHm6h2mCxlCfL
+F9sHP4CFT8icttD0b0/Pmdjh28JIXDqsOTPHH2qLJj0rNfVIsZHBAk4ElpF7sDPwsRROEW+1QK8b
+RaVK7362rPKgH1g/EkZgPI2h4H3PVz4zHvtH8aoVlwdVZqW1LS7YgFmypw23RuwhY/81q6UCzyr0
+TP579ZRdhE2o8mCP2w4lPJ9zcc+U30rq299yOIzzlr3xF7zSujtFWsan9sYXiwGd/BmoKoMWuDpI
+/k4+oKsGGelT84ATB+0tvz8KPFUgOSwsAGl0lUq8ILKpeeUYiZGo3BxN77t+Nwtd/jmliFKMAGzs
+GHxBvfaLdXe6YJ2E5/4tAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEG
+MB0GA1UdDgQWBBQVOIMPPyw/cDMezUb+B4wg4NfDtzANBgkqhkiG9w0BAQUFAAOCAQEAX/FBfXxc
+CLkr4NWSR/pnXKUTwwMhmytMiUbPWU3J/qVAtmPN3XEolWcRzCSs00Rsca4BIGsDoo8Ytyk6feUW
+YFN4PMCvFYP3j1IzJL1kk5fui/fbGKhtcbP3LBfQdCVp9/5rPJS+TUtBjE7ic9DjkCJzQ83z7+pz
+zkWKsKZJ/0x9nXGIxHYdkFsd7v3M9+79YKWxehZx0RbQfBI8bGmX265fOZpwLwU8GUYEmSA20GBu
+YQa7FkKMcPcw++DbZqMAAb3mLNqRX6BGi01qnD093QVG/na/oAo85ADmJ7f/hC3euiInlhBx6yLt
+398znM/jra6O1I7mT1GvFpLgXPYHDw==
+-----END CERTIFICATE-----
+
+Certum Root CA
+==============
+-----BEGIN CERTIFICATE-----
+MIIDDDCCAfSgAwIBAgIDAQAgMA0GCSqGSIb3DQEBBQUAMD4xCzAJBgNVBAYTAlBMMRswGQYDVQQK
+ExJVbml6ZXRvIFNwLiB6IG8uby4xEjAQBgNVBAMTCUNlcnR1bSBDQTAeFw0wMjA2MTExMDQ2Mzla
+Fw0yNzA2MTExMDQ2MzlaMD4xCzAJBgNVBAYTAlBMMRswGQYDVQQKExJVbml6ZXRvIFNwLiB6IG8u
+by4xEjAQBgNVBAMTCUNlcnR1bSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAM6x
+wS7TT3zNJc4YPk/EjG+AanPIW1H4m9LcuwBcsaD8dQPugfCI7iNS6eYVM42sLQnFdvkrOYCJ5JdL
+kKWoePhzQ3ukYbDYWMzhbGZ+nPMJXlVjhNWo7/OxLjBos8Q82KxujZlakE403Daaj4GIULdtlkIJ
+89eVgw1BS7Bqa/j8D35in2fE7SZfECYPCE/wpFcozo+47UX2bu4lXapuOb7kky/ZR6By6/qmW6/K
+Uz/iDsaWVhFu9+lmqSbYf5VT7QqFiLpPKaVCjF62/IUgAKpoC6EahQGcxEZjgoi2IrHu/qpGWX7P
+NSzVttpd90gzFFS269lvzs2I1qsb2pY7HVkCAwEAAaMTMBEwDwYDVR0TAQH/BAUwAwEB/zANBgkq
+hkiG9w0BAQUFAAOCAQEAuI3O7+cUus/usESSbLQ5PqKEbq24IXfS1HeCh+YgQYHu4vgRt2PRFze+
+GXYkHAQaTOs9qmdvLdTN/mUxcMUbpgIKumB7bVjCmkn+YzILa+M6wKyrO7Do0wlRjBCDxjTgxSvg
+GrZgFCdsMneMvLJymM/NzD+5yCRCFNZX/OYmQ6kd5YCQzgNUKD73P9P4Te1qCjqTE5s7FCMTY5w/
+0YcneeVMUeMBrYVdGjux1XMQpNPyvG5k9VpWkKjHDkx0Dy5xO/fIR/RpbxXyEV6DHpx8Uq79AtoS
+qFlnGNu8cN2bsWntgM6JQEhqDjXKKWYVIZQs6GAqm4VKQPNriiTsBhYscw==
+-----END CERTIFICATE-----
+
+Comodo AAA Services root
+========================
+-----BEGIN CERTIFICATE-----
+MIIEMjCCAxqgAwIBAgIBATANBgkqhkiG9w0BAQUFADB7MQswCQYDVQQGEwJHQjEbMBkGA1UECAwS
+R3JlYXRlciBNYW5jaGVzdGVyMRAwDgYDVQQHDAdTYWxmb3JkMRowGAYDVQQKDBFDb21vZG8gQ0Eg
+TGltaXRlZDEhMB8GA1UEAwwYQUFBIENlcnRpZmljYXRlIFNlcnZpY2VzMB4XDTA0MDEwMTAwMDAw
+MFoXDTI4MTIzMTIzNTk1OVowezELMAkGA1UEBhMCR0IxGzAZBgNVBAgMEkdyZWF0ZXIgTWFuY2hl
+c3RlcjEQMA4GA1UEBwwHU2FsZm9yZDEaMBgGA1UECgwRQ29tb2RvIENBIExpbWl0ZWQxITAfBgNV
+BAMMGEFBQSBDZXJ0aWZpY2F0ZSBTZXJ2aWNlczCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
+ggEBAL5AnfRu4ep2hxxNRUSOvkbIgwadwSr+GB+O5AL686tdUIoWMQuaBtDFcCLNSS1UY8y2bmhG
+C1Pqy0wkwLxyTurxFa70VJoSCsN6sjNg4tqJVfMiWPPe3M/vg4aijJRPn2jymJBGhCfHdr/jzDUs
+i14HZGWCwEiwqJH5YZ92IFCokcdmtet4YgNW8IoaE+oxox6gmf049vYnMlhvB/VruPsUK6+3qszW
+Y19zjNoFmag4qMsXeDZRrOme9Hg6jc8P2ULimAyrL58OAd7vn5lJ8S3frHRNG5i1R8XlKdH5kBjH
+Ypy+g8cmez6KJcfA3Z3mNWgQIJ2P2N7Sw4ScDV7oL8kCAwEAAaOBwDCBvTAdBgNVHQ4EFgQUoBEK
+Iz6W8Qfs4q8p74Klf9AwpLQwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wewYDVR0f
+BHQwcjA4oDagNIYyaHR0cDovL2NybC5jb21vZG9jYS5jb20vQUFBQ2VydGlmaWNhdGVTZXJ2aWNl
+cy5jcmwwNqA0oDKGMGh0dHA6Ly9jcmwuY29tb2RvLm5ldC9BQUFDZXJ0aWZpY2F0ZVNlcnZpY2Vz
+LmNybDANBgkqhkiG9w0BAQUFAAOCAQEACFb8AvCb6P+k+tZ7xkSAzk/ExfYAWMymtrwUSWgEdujm
+7l3sAg9g1o1QGE8mTgHj5rCl7r+8dFRBv/38ErjHT1r0iWAFf2C3BUrz9vHCv8S5dIa2LX1rzNLz
+Rt0vxuBqw8M0Ayx9lt1awg6nCpnBBYurDC/zXDrPbDdVCYfeU0BsWO/8tqtlbgT2G9w84FoVxp7Z
+8VlIMCFlA2zs6SFz7JsDoeA3raAVGI/6ugLOpyypEBMs1OUIJqsil2D4kF501KKaU73yqWjgom7C
+12yxow+ev+to51byrvLjKzg6CYG1a4XXvi3tPxq3smPi9WIsgtRqAEFQ8TmDn5XpNpaYbg==
+-----END CERTIFICATE-----
+
+Comodo Secure Services root
+===========================
+-----BEGIN CERTIFICATE-----
+MIIEPzCCAyegAwIBAgIBATANBgkqhkiG9w0BAQUFADB+MQswCQYDVQQGEwJHQjEbMBkGA1UECAwS
+R3JlYXRlciBNYW5jaGVzdGVyMRAwDgYDVQQHDAdTYWxmb3JkMRowGAYDVQQKDBFDb21vZG8gQ0Eg
+TGltaXRlZDEkMCIGA1UEAwwbU2VjdXJlIENlcnRpZmljYXRlIFNlcnZpY2VzMB4XDTA0MDEwMTAw
+MDAwMFoXDTI4MTIzMTIzNTk1OVowfjELMAkGA1UEBhMCR0IxGzAZBgNVBAgMEkdyZWF0ZXIgTWFu
+Y2hlc3RlcjEQMA4GA1UEBwwHU2FsZm9yZDEaMBgGA1UECgwRQ29tb2RvIENBIExpbWl0ZWQxJDAi
+BgNVBAMMG1NlY3VyZSBDZXJ0aWZpY2F0ZSBTZXJ2aWNlczCCASIwDQYJKoZIhvcNAQEBBQADggEP
+ADCCAQoCggEBAMBxM4KK0HDrc4eCQNUd5MvJDkKQ+d40uaG6EfQlhfPMcm3ye5drswfxdySRXyWP
+9nQ95IDC+DwN879A6vfIUtFyb+/Iq0G4bi4XKpVpDM3SHpR7LZQdqnXXs5jLrLxkU0C8j6ysNstc
+rbvd4JQX7NFc0L/vpZXJkMWwrPsbQ996CF23uPJAGysnnlDOXmWCiIxe004MeuoIkbY2qitC++rC
+oznl2yY4rYsK7hljxxwk3wN42ubqwUcaCwtGCd0C/N7Lh1/XMGNooa7cMqG6vv5Eq2i2pRcV/b3V
+p6ea5EQz6YiO/O1R65NxTq0B50SOqy3LqP4BSUjwwN3HaNiS/j0CAwEAAaOBxzCBxDAdBgNVHQ4E
+FgQUPNiTiMLAggnMAZkGkyDpnnAJY08wDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8w
+gYEGA1UdHwR6MHgwO6A5oDeGNWh0dHA6Ly9jcmwuY29tb2RvY2EuY29tL1NlY3VyZUNlcnRpZmlj
+YXRlU2VydmljZXMuY3JsMDmgN6A1hjNodHRwOi8vY3JsLmNvbW9kby5uZXQvU2VjdXJlQ2VydGlm
+aWNhdGVTZXJ2aWNlcy5jcmwwDQYJKoZIhvcNAQEFBQADggEBAIcBbSMdflsXfcFhMs+P5/OKlFlm
+4J4oqF7Tt/Q05qo5spcWxYJvMqTpjOev/e/C6LlLqqP05tqNZSH7uoDrJiiFGv45jN5bBAS0VPmj
+Z55B+glSzAVIqMk/IQQezkhr/IXownuvf7fM+F86/TXGDe+X3EyrEeFryzHRbPtIgKvcnDe4IRRL
+DXE97IMzbtFuMhbsmMcWi1mmNKsFVy2T96oTy9IT4rcuO81rUBcJaD61JlfutuC23bkpgHl9j6Pw
+pCikFcSF9CfUa7/lXORlAnZUtOM3ZiTTGWHIUhDlizeauan5Hb/qmZJhlv8BzaFfDbxxvA6sCx1H
+RR3B7Hzs/Sk=
+-----END CERTIFICATE-----
+
+Comodo Trusted Services root
+============================
+-----BEGIN CERTIFICATE-----
+MIIEQzCCAyugAwIBAgIBATANBgkqhkiG9w0BAQUFADB/MQswCQYDVQQGEwJHQjEbMBkGA1UECAwS
+R3JlYXRlciBNYW5jaGVzdGVyMRAwDgYDVQQHDAdTYWxmb3JkMRowGAYDVQQKDBFDb21vZG8gQ0Eg
+TGltaXRlZDElMCMGA1UEAwwcVHJ1c3RlZCBDZXJ0aWZpY2F0ZSBTZXJ2aWNlczAeFw0wNDAxMDEw
+MDAwMDBaFw0yODEyMzEyMzU5NTlaMH8xCzAJBgNVBAYTAkdCMRswGQYDVQQIDBJHcmVhdGVyIE1h
+bmNoZXN0ZXIxEDAOBgNVBAcMB1NhbGZvcmQxGjAYBgNVBAoMEUNvbW9kbyBDQSBMaW1pdGVkMSUw
+IwYDVQQDDBxUcnVzdGVkIENlcnRpZmljYXRlIFNlcnZpY2VzMIIBIjANBgkqhkiG9w0BAQEFAAOC
+AQ8AMIIBCgKCAQEA33FvNlhTWvI2VFeAxHQIIO0Yfyod5jWaHiWsnOWWfnJSoBVC21ndZHoa0Lh7
+3TkVvFVIxO06AOoxEbrycXQaZ7jPM8yoMa+j49d/vzMtTGo87IvDktJTdyR0nAducPy9C1t2ul/y
+/9c3S0pgePfw+spwtOpZqqPOSC+pw7ILfhdyFgymBwwbOM/JYrc/oJOlh0Hyt3BAd9i+FHzjqMB6
+juljatEPmsbS9Is6FARW1O24zG71++IsWL1/T2sr92AkWCTOJu80kTrV44HQsvAEAtdbtz6SrGsS
+ivnkBbA7kUlcsutT6vifR4buv5XAwAaf0lteERv0xwQ1KdJVXOTt6wIDAQABo4HJMIHGMB0GA1Ud
+DgQWBBTFe1i97doladL3WRaoszLAeydb9DAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB
+/zCBgwYDVR0fBHwwejA8oDqgOIY2aHR0cDovL2NybC5jb21vZG9jYS5jb20vVHJ1c3RlZENlcnRp
+ZmljYXRlU2VydmljZXMuY3JsMDqgOKA2hjRodHRwOi8vY3JsLmNvbW9kby5uZXQvVHJ1c3RlZENl
+cnRpZmljYXRlU2VydmljZXMuY3JsMA0GCSqGSIb3DQEBBQUAA4IBAQDIk4E7ibSvuIQSTI3S8Ntw
+uleGFTQQuS9/HrCoiWChisJ3DFBKmwCL2Iv0QeLQg4pKHBQGsKNoBXAxMKdTmw7pSqBYaWcOrp32
+pSxBvzwGa+RZzG0Q8ZZvH9/0BAKkn0U+yNj6NkZEUD+Cl5EfKNsYEYwq5GWDVxISjBc/lDb+XbDA
+BHcTuPQV1T84zJQ6VdCsmPW6AF/ghhmBeC8owH7TzEIK9a5QoNE+xqFx7D+gIIxmOom0jtTYsU0l
+R+4viMi14QVFwL4Ucd56/Y57fU0IlqUSc/AtyjcndBInTMu2l+nZrghtWjlA3QVHdWpaIbOjGM9O
+9y5Xt5hwXsjEeLBi
+-----END CERTIFICATE-----
+
+QuoVadis Root CA
+================
+-----BEGIN CERTIFICATE-----
+MIIF0DCCBLigAwIBAgIEOrZQizANBgkqhkiG9w0BAQUFADB/MQswCQYDVQQGEwJCTTEZMBcGA1UE
+ChMQUXVvVmFkaXMgTGltaXRlZDElMCMGA1UECxMcUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0
+eTEuMCwGA1UEAxMlUXVvVmFkaXMgUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTAeFw0wMTAz
+MTkxODMzMzNaFw0yMTAzMTcxODMzMzNaMH8xCzAJBgNVBAYTAkJNMRkwFwYDVQQKExBRdW9WYWRp
+cyBMaW1pdGVkMSUwIwYDVQQLExxSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MS4wLAYDVQQD
+EyVRdW9WYWRpcyBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEF
+AAOCAQ8AMIIBCgKCAQEAv2G1lVO6V/z68mcLOhrfEYBklbTRvM16z/Ypli4kVEAkOPcahdxYTMuk
+J0KX0J+DisPkBgNbAKVRHnAEdOLB1Dqr1607BxgFjv2DrOpm2RgbaIr1VxqYuvXtdj182d6UajtL
+F8HVj71lODqV0D1VNk7feVcxKh7YWWVJWCCYfqtffp/p1k3sg3Spx2zY7ilKhSoGFPlU5tPaZQeL
+YzcS19Dsw3sgQUSj7cugF+FxZc4dZjH3dgEZyH0DWLaVSR2mEiboxgx24ONmy+pdpibu5cxfvWen
+AScOospUxbF6lR1xHkopigPcakXBpBlebzbNw6Kwt/5cOOJSvPhEQ+aQuwIDAQABo4ICUjCCAk4w
+PQYIKwYBBQUHAQEEMTAvMC0GCCsGAQUFBzABhiFodHRwczovL29jc3AucXVvdmFkaXNvZmZzaG9y
+ZS5jb20wDwYDVR0TAQH/BAUwAwEB/zCCARoGA1UdIASCAREwggENMIIBCQYJKwYBBAG+WAABMIH7
+MIHUBggrBgEFBQcCAjCBxxqBxFJlbGlhbmNlIG9uIHRoZSBRdW9WYWRpcyBSb290IENlcnRpZmlj
+YXRlIGJ5IGFueSBwYXJ0eSBhc3N1bWVzIGFjY2VwdGFuY2Ugb2YgdGhlIHRoZW4gYXBwbGljYWJs
+ZSBzdGFuZGFyZCB0ZXJtcyBhbmQgY29uZGl0aW9ucyBvZiB1c2UsIGNlcnRpZmljYXRpb24gcHJh
+Y3RpY2VzLCBhbmQgdGhlIFF1b1ZhZGlzIENlcnRpZmljYXRlIFBvbGljeS4wIgYIKwYBBQUHAgEW
+Fmh0dHA6Ly93d3cucXVvdmFkaXMuYm0wHQYDVR0OBBYEFItLbe3TKbkGGew5Oanwl4Rqy+/fMIGu
+BgNVHSMEgaYwgaOAFItLbe3TKbkGGew5Oanwl4Rqy+/foYGEpIGBMH8xCzAJBgNVBAYTAkJNMRkw
+FwYDVQQKExBRdW9WYWRpcyBMaW1pdGVkMSUwIwYDVQQLExxSb290IENlcnRpZmljYXRpb24gQXV0
+aG9yaXR5MS4wLAYDVQQDEyVRdW9WYWRpcyBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5ggQ6
+tlCLMA4GA1UdDwEB/wQEAwIBBjANBgkqhkiG9w0BAQUFAAOCAQEAitQUtf70mpKnGdSkfnIYj9lo
+fFIk3WdvOXrEql494liwTXCYhGHoG+NpGA7O+0dQoE7/8CQfvbLO9Sf87C9TqnN7Az10buYWnuul
+LsS/VidQK2K6vkscPFVcQR0kvoIgR13VRH56FmjffU1RcHhXHTMe/QKZnAzNCgVPx7uOpHX6Sm2x
+gI4JVrmcGmD+XcHXetwReNDWXcG31a0ymQM6isxUJTkxgXsTIlG6Rmyhu576BGxJJnSP0nPrzDCi
+5upZIof4l/UO/erMkqQWxFIY6iHOsfHmhIHluqmGKPJDWl0Snawe2ajlCmqnf6CHKc/yiU3U7MXi
+5nrQNiOKSnQ2+Q==
+-----END CERTIFICATE-----
+
+QuoVadis Root CA 2
+==================
+-----BEGIN CERTIFICATE-----
+MIIFtzCCA5+gAwIBAgICBQkwDQYJKoZIhvcNAQEFBQAwRTELMAkGA1UEBhMCQk0xGTAXBgNVBAoT
+EFF1b1ZhZGlzIExpbWl0ZWQxGzAZBgNVBAMTElF1b1ZhZGlzIFJvb3QgQ0EgMjAeFw0wNjExMjQx
+ODI3MDBaFw0zMTExMjQxODIzMzNaMEUxCzAJBgNVBAYTAkJNMRkwFwYDVQQKExBRdW9WYWRpcyBM
+aW1pdGVkMRswGQYDVQQDExJRdW9WYWRpcyBSb290IENBIDIwggIiMA0GCSqGSIb3DQEBAQUAA4IC
+DwAwggIKAoICAQCaGMpLlA0ALa8DKYrwD4HIrkwZhR0In6spRIXzL4GtMh6QRr+jhiYaHv5+HBg6
+XJxgFyo6dIMzMH1hVBHL7avg5tKifvVrbxi3Cgst/ek+7wrGsxDp3MJGF/hd/aTa/55JWpzmM+Yk
+lvc/ulsrHHo1wtZn/qtmUIttKGAr79dgw8eTvI02kfN/+NsRE8Scd3bBrrcCaoF6qUWD4gXmuVbB
+lDePSHFjIuwXZQeVikvfj8ZaCuWw419eaxGrDPmF60Tp+ARz8un+XJiM9XOva7R+zdRcAitMOeGy
+lZUtQofX1bOQQ7dsE/He3fbE+Ik/0XX1ksOR1YqI0JDs3G3eicJlcZaLDQP9nL9bFqyS2+r+eXyt
+66/3FsvbzSUr5R/7mp/iUcw6UwxI5g69ybR2BlLmEROFcmMDBOAENisgGQLodKcftslWZvB1Jdxn
+wQ5hYIizPtGo/KPaHbDRsSNU30R2be1B2MGyIrZTHN81Hdyhdyox5C315eXbyOD/5YDXC2Og/zOh
+D7osFRXql7PSorW+8oyWHhqPHWykYTe5hnMz15eWniN9gqRMgeKh0bpnX5UHoycR7hYQe7xFSkyy
+BNKr79X9DFHOUGoIMfmR2gyPZFwDwzqLID9ujWc9Otb+fVuIyV77zGHcizN300QyNQliBJIWENie
+J0f7OyHj+OsdWwIDAQABo4GwMIGtMA8GA1UdEwEB/wQFMAMBAf8wCwYDVR0PBAQDAgEGMB0GA1Ud
+DgQWBBQahGK8SEwzJQTU7tD2A8QZRtGUazBuBgNVHSMEZzBlgBQahGK8SEwzJQTU7tD2A8QZRtGU
+a6FJpEcwRTELMAkGA1UEBhMCQk0xGTAXBgNVBAoTEFF1b1ZhZGlzIExpbWl0ZWQxGzAZBgNVBAMT
+ElF1b1ZhZGlzIFJvb3QgQ0EgMoICBQkwDQYJKoZIhvcNAQEFBQADggIBAD4KFk2fBluornFdLwUv
+Z+YTRYPENvbzwCYMDbVHZF34tHLJRqUDGCdViXh9duqWNIAXINzng/iN/Ae42l9NLmeyhP3ZRPx3
+UIHmfLTJDQtyU/h2BwdBR5YM++CCJpNVjP4iH2BlfF/nJrP3MpCYUNQ3cVX2kiF495V5+vgtJodm
+VjB3pjd4M1IQWK4/YY7yarHvGH5KWWPKjaJW1acvvFYfzznB4vsKqBUsfU16Y8Zsl0Q80m/DShcK
++JDSV6IZUaUtl0HaB0+pUNqQjZRG4T7wlP0QADj1O+hA4bRuVhogzG9Yje0uRY/W6ZM/57Es3zrW
+IozchLsib9D45MY56QSIPMO661V6bYCZJPVsAfv4l7CUW+v90m/xd2gNNWQjrLhVoQPRTUIZ3Ph1
+WVaj+ahJefivDrkRoHy3au000LYmYjgahwz46P0u05B/B5EqHdZ+XIWDmbA4CD/pXvk1B+TJYm5X
+f6dQlfe6yJvmjqIBxdZmv3lh8zwc4bmCXF2gw+nYSL0ZohEUGW6yhhtoPkg3Goi3XZZenMfvJ2II
+4pEZXNLxId26F0KCl3GBUzGpn/Z9Yr9y4aOTHcyKJloJONDO1w2AFrR4pTqHTI2KpdVGl/IsELm8
+VCLAAVBpQ570su9t+Oza8eOx79+Rj1QqCyXBJhnEUhAFZdWCEOrCMc0u
+-----END CERTIFICATE-----
+
+QuoVadis Root CA 3
+==================
+-----BEGIN CERTIFICATE-----
+MIIGnTCCBIWgAwIBAgICBcYwDQYJKoZIhvcNAQEFBQAwRTELMAkGA1UEBhMCQk0xGTAXBgNVBAoT
+EFF1b1ZhZGlzIExpbWl0ZWQxGzAZBgNVBAMTElF1b1ZhZGlzIFJvb3QgQ0EgMzAeFw0wNjExMjQx
+OTExMjNaFw0zMTExMjQxOTA2NDRaMEUxCzAJBgNVBAYTAkJNMRkwFwYDVQQKExBRdW9WYWRpcyBM
+aW1pdGVkMRswGQYDVQQDExJRdW9WYWRpcyBSb290IENBIDMwggIiMA0GCSqGSIb3DQEBAQUAA4IC
+DwAwggIKAoICAQDMV0IWVJzmmNPTTe7+7cefQzlKZbPoFog02w1ZkXTPkrgEQK0CSzGrvI2RaNgg
+DhoB4hp7Thdd4oq3P5kazethq8Jlph+3t723j/z9cI8LoGe+AaJZz3HmDyl2/7FWeUUrH556VOij
+KTVopAFPD6QuN+8bv+OPEKhyq1hX51SGyMnzW9os2l2ObjyjPtr7guXd8lyyBTNvijbO0BNO/79K
+DDRMpsMhvVAEVeuxu537RR5kFd5VAYwCdrXLoT9CabwvvWhDFlaJKjdhkf2mrk7AyxRllDdLkgbv
+BNDInIjbC3uBr7E9KsRlOni27tyAsdLTmZw67mtaa7ONt9XOnMK+pUsvFrGeaDsGb659n/je7Mwp
+p5ijJUMv7/FfJuGITfhebtfZFG4ZM2mnO4SJk8RTVROhUXhA+LjJou57ulJCg54U7QVSWllWp5f8
+nT8KKdjcT5EOE7zelaTfi5m+rJsziO+1ga8bxiJTyPbH7pcUsMV8eFLI8M5ud2CEpukqdiDtWAEX
+MJPpGovgc2PZapKUSU60rUqFxKMiMPwJ7Wgic6aIDFUhWMXhOp8q3crhkODZc6tsgLjoC2SToJyM
+Gf+z0gzskSaHirOi4XCPLArlzW1oUevaPwV/izLmE1xr/l9A4iLItLRkT9a6fUg+qGkM17uGcclz
+uD87nSVL2v9A6wIDAQABo4IBlTCCAZEwDwYDVR0TAQH/BAUwAwEB/zCB4QYDVR0gBIHZMIHWMIHT
+BgkrBgEEAb5YAAMwgcUwgZMGCCsGAQUFBwICMIGGGoGDQW55IHVzZSBvZiB0aGlzIENlcnRpZmlj
+YXRlIGNvbnN0aXR1dGVzIGFjY2VwdGFuY2Ugb2YgdGhlIFF1b1ZhZGlzIFJvb3QgQ0EgMyBDZXJ0
+aWZpY2F0ZSBQb2xpY3kgLyBDZXJ0aWZpY2F0aW9uIFByYWN0aWNlIFN0YXRlbWVudC4wLQYIKwYB
+BQUHAgEWIWh0dHA6Ly93d3cucXVvdmFkaXNnbG9iYWwuY29tL2NwczALBgNVHQ8EBAMCAQYwHQYD
+VR0OBBYEFPLAE+CCQz777i9nMpY1XNu4ywLQMG4GA1UdIwRnMGWAFPLAE+CCQz777i9nMpY1XNu4
+ywLQoUmkRzBFMQswCQYDVQQGEwJCTTEZMBcGA1UEChMQUXVvVmFkaXMgTGltaXRlZDEbMBkGA1UE
+AxMSUXVvVmFkaXMgUm9vdCBDQSAzggIFxjANBgkqhkiG9w0BAQUFAAOCAgEAT62gLEz6wPJv92ZV
+qyM07ucp2sNbtrCD2dDQ4iH782CnO11gUyeim/YIIirnv6By5ZwkajGxkHon24QRiSemd1o417+s
+hvzuXYO8BsbRd2sPbSQvS3pspweWyuOEn62Iix2rFo1bZhfZFvSLgNLd+LJ2w/w4E6oM3kJpK27z
+POuAJ9v1pkQNn1pVWQvVDVJIxa6f8i+AxeoyUDUSly7B4f/xI4hROJ/yZlZ25w9Rl6VSDE1JUZU2
+Pb+iSwwQHYaZTKrzchGT5Or2m9qoXadNt54CrnMAyNojA+j56hl0YgCUyyIgvpSnWbWCar6ZeXqp
+8kokUvd0/bpO5qgdAm6xDYBEwa7TIzdfu4V8K5Iu6H6li92Z4b8nby1dqnuH/grdS/yO9SbkbnBC
+bjPsMZ57k8HkyWkaPcBrTiJt7qtYTcbQQcEr6k8Sh17rRdhs9ZgC06DYVYoGmRmioHfRMJ6szHXu
+g/WwYjnPbFfiTNKRCw51KBuav/0aQ/HKd/s7j2G4aSgWQgRecCocIdiP4b0jWy10QJLZYxkNc91p
+vGJHvOB0K7Lrfb5BG7XARsWhIstfTsEokt4YutUqKLsRixeTmJlglFwjz1onl14LBQaTNx47aTbr
+qZ5hHY8y2o4M1nQ+ewkk2gF3R8Q7zTSMmfXK4SVhM7JZG+Ju1zdXtg2pEto=
+-----END CERTIFICATE-----
+
+Security Communication Root CA
+==============================
+-----BEGIN CERTIFICATE-----
+MIIDWjCCAkKgAwIBAgIBADANBgkqhkiG9w0BAQUFADBQMQswCQYDVQQGEwJKUDEYMBYGA1UEChMP
+U0VDT00gVHJ1c3QubmV0MScwJQYDVQQLEx5TZWN1cml0eSBDb21tdW5pY2F0aW9uIFJvb3RDQTEw
+HhcNMDMwOTMwMDQyMDQ5WhcNMjMwOTMwMDQyMDQ5WjBQMQswCQYDVQQGEwJKUDEYMBYGA1UEChMP
+U0VDT00gVHJ1c3QubmV0MScwJQYDVQQLEx5TZWN1cml0eSBDb21tdW5pY2F0aW9uIFJvb3RDQTEw
+ggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCzs/5/022x7xZ8V6UMbXaKL0u/ZPtM7orw
+8yl89f/uKuDp6bpbZCKamm8sOiZpUQWZJtzVHGpxxpp9Hp3dfGzGjGdnSj74cbAZJ6kJDKaVv0uM
+DPpVmDvY6CKhS3E4eayXkmmziX7qIWgGmBSWh9JhNrxtJ1aeV+7AwFb9Ms+k2Y7CI9eNqPPYJayX
+5HA49LY6tJ07lyZDo6G8SVlyTCMwhwFY9k6+HGhWZq/NQV3Is00qVUarH9oe4kA92819uZKAnDfd
+DJZkndwi92SL32HeFZRSFaB9UslLqCHJxrHty8OVYNEP8Ktw+N/LTX7s1vqr2b1/VPKl6Xn62dZ2
+JChzAgMBAAGjPzA9MB0GA1UdDgQWBBSgc0mZaNyFW2XjmygvV5+9M7wHSDALBgNVHQ8EBAMCAQYw
+DwYDVR0TAQH/BAUwAwEB/zANBgkqhkiG9w0BAQUFAAOCAQEAaECpqLvkT115swW1F7NgE+vGkl3g
+0dNq/vu+m22/xwVtWSDEHPC32oRYAmP6SBbvT6UL90qY8j+eG61Ha2POCEfrUj94nK9NrvjVT8+a
+mCoQQTlSxN3Zmw7vkwGusi7KaEIkQmywszo+zenaSMQVy+n5Bw+SUEmK3TGXX8npN6o7WWWXlDLJ
+s58+OmJYxUmtYg5xpTKqL8aJdkNAExNnPaJUJRDL8Try2frbSVa7pv6nQTXD4IhhyYjH3zYQIphZ
+6rBK+1YWc26sTfcioU+tHXotRSflMMFe8toTyyVCUZVHA4xsIcx0Qu1T/zOLjw9XARYvz6buyXAi
+FL39vmwLAw==
+-----END CERTIFICATE-----
+
+Sonera Class 2 Root CA
+======================
+-----BEGIN CERTIFICATE-----
+MIIDIDCCAgigAwIBAgIBHTANBgkqhkiG9w0BAQUFADA5MQswCQYDVQQGEwJGSTEPMA0GA1UEChMG
+U29uZXJhMRkwFwYDVQQDExBTb25lcmEgQ2xhc3MyIENBMB4XDTAxMDQwNjA3Mjk0MFoXDTIxMDQw
+NjA3Mjk0MFowOTELMAkGA1UEBhMCRkkxDzANBgNVBAoTBlNvbmVyYTEZMBcGA1UEAxMQU29uZXJh
+IENsYXNzMiBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAJAXSjWdyvANlsdE+hY3
+/Ei9vX+ALTU74W+oZ6m/AxxNjG8yR9VBaKQTBME1DJqEQ/xcHf+Js+gXGM2RX/uJ4+q/Tl18GybT
+dXnt5oTjV+WtKcT0OijnpXuENmmz/V52vaMtmdOQTiMofRhj8VQ7Jp12W5dCsv+u8E7s3TmVToMG
+f+dJQMjFAbJUWmYdPfz56TwKnoG4cPABi+QjVHzIrviQHgCWctRUz2EjvOr7nQKV0ba5cTppCD8P
+tOFCx4j1P5iop7oc4HFx71hXgVB6XGt0Rg6DA5jDjqhu8nYybieDwnPz3BjotJPqdURrBGAgcVeH
+nfO+oJAjPYok4doh28MCAwEAAaMzMDEwDwYDVR0TAQH/BAUwAwEB/zARBgNVHQ4ECgQISqCqWITT
+XjwwCwYDVR0PBAQDAgEGMA0GCSqGSIb3DQEBBQUAA4IBAQBazof5FnIVV0sd2ZvnoiYw7JNn39Yt
+0jSv9zilzqsWuasvfDXLrNAPtEwr/IDva4yRXzZ299uzGxnq9LIR/WFxRL8oszodv7ND6J+/3DEI
+cbCdjdY0RzKQxmUk96BKfARzjzlvF4xytb1LyHr4e4PDKE6cCepnP7JnBBvDFNr450kkkdAdavph
+Oe9r5yF1BgfYErQhIHBCcYHaPJo2vqZbDWpsmh+Re/n570K6Tk6ezAyNlNzZRZxe7EJQY670XcSx
+EtzKO6gunRRaBXW37Ndj4ro1tgQIkejanZz2ZrUYrAqmVCY0M9IbwdR/GjqOC6oybtv8TyWf2TLH
+llpwrN9M
+-----END CERTIFICATE-----
+
+Staat der Nederlanden Root CA
+=============================
+-----BEGIN CERTIFICATE-----
+MIIDujCCAqKgAwIBAgIEAJiWijANBgkqhkiG9w0BAQUFADBVMQswCQYDVQQGEwJOTDEeMBwGA1UE
+ChMVU3RhYXQgZGVyIE5lZGVybGFuZGVuMSYwJAYDVQQDEx1TdGFhdCBkZXIgTmVkZXJsYW5kZW4g
+Um9vdCBDQTAeFw0wMjEyMTcwOTIzNDlaFw0xNTEyMTYwOTE1MzhaMFUxCzAJBgNVBAYTAk5MMR4w
+HAYDVQQKExVTdGFhdCBkZXIgTmVkZXJsYW5kZW4xJjAkBgNVBAMTHVN0YWF0IGRlciBOZWRlcmxh
+bmRlbiBSb290IENBMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAmNK1URF6gaYUmHFt
+vsznExvWJw56s2oYHLZhWtVhCb/ekBPHZ+7d89rFDBKeNVU+LCeIQGv33N0iYfXCxw719tV2U02P
+jLwYdjeFnejKScfST5gTCaI+Ioicf9byEGW07l8Y1Rfj+MX94p2i71MOhXeiD+EwR+4A5zN9RGca
+C1Hoi6CeUJhoNFIfLm0B8mBF8jHrqTFoKbt6QZ7GGX+UtFE5A3+y3qcym7RHjm+0Sq7lr7HcsBth
+vJly3uSJt3omXdozSVtSnA71iq3DuD3oBmrC1SoLbHuEvVYFy4ZlkuxEK7COudxwC0barbxjiDn6
+22r+I/q85Ej0ZytqERAhSQIDAQABo4GRMIGOMAwGA1UdEwQFMAMBAf8wTwYDVR0gBEgwRjBEBgRV
+HSAAMDwwOgYIKwYBBQUHAgEWLmh0dHA6Ly93d3cucGtpb3ZlcmhlaWQubmwvcG9saWNpZXMvcm9v
+dC1wb2xpY3kwDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBSofeu8Y6R0E3QA7Jbg0zTBLL9s+DAN
+BgkqhkiG9w0BAQUFAAOCAQEABYSHVXQ2YcG70dTGFagTtJ+k/rvuFbQvBgwp8qiSpGEN/KtcCFtR
+EytNwiphyPgJWPwtArI5fZlmgb9uXJVFIGzmeafR2Bwp/MIgJ1HI8XxdNGdphREwxgDS1/PTfLbw
+MVcoEoJz6TMvplW0C5GUR5z6u3pCMuiufi3IvKwUv9kP2Vv8wfl6leF9fpb8cbDCTMjfRTTJzg3y
+nGQI0DvDKcWy7ZAEwbEpkcUwb8GpcjPM/l0WFywRaed+/sWDCN+83CI6LiBpIzlWYGeQiy52OfsR
+iJf2fL1LuCAWZwWN4jvBcj+UlTfHXbme2JOhF4//DGYVwSR8MnwDHTuhWEUykw==
+-----END CERTIFICATE-----
+
+UTN DATACorp SGC Root CA
+========================
+-----BEGIN CERTIFICATE-----
+MIIEXjCCA0agAwIBAgIQRL4Mi1AAIbQR0ypoBqmtaTANBgkqhkiG9w0BAQUFADCBkzELMAkGA1UE
+BhMCVVMxCzAJBgNVBAgTAlVUMRcwFQYDVQQHEw5TYWx0IExha2UgQ2l0eTEeMBwGA1UEChMVVGhl
+IFVTRVJUUlVTVCBOZXR3b3JrMSEwHwYDVQQLExhodHRwOi8vd3d3LnVzZXJ0cnVzdC5jb20xGzAZ
+BgNVBAMTElVUTiAtIERBVEFDb3JwIFNHQzAeFw05OTA2MjQxODU3MjFaFw0xOTA2MjQxOTA2MzBa
+MIGTMQswCQYDVQQGEwJVUzELMAkGA1UECBMCVVQxFzAVBgNVBAcTDlNhbHQgTGFrZSBDaXR5MR4w
+HAYDVQQKExVUaGUgVVNFUlRSVVNUIE5ldHdvcmsxITAfBgNVBAsTGGh0dHA6Ly93d3cudXNlcnRy
+dXN0LmNvbTEbMBkGA1UEAxMSVVROIC0gREFUQUNvcnAgU0dDMIIBIjANBgkqhkiG9w0BAQEFAAOC
+AQ8AMIIBCgKCAQEA3+5YEKIrblXEjr8uRgnn4AgPLit6E5Qbvfa2gI5lBZMAHryv4g+OGQ0SR+ys
+raP6LnD43m77VkIVni5c7yPeIbkFdicZD0/Ww5y0vpQZY/KmEQrrU0icvvIpOxboGqBMpsn0GFlo
+wHDyUwDAXlCCpVZvNvlK4ESGoE1O1kduSUrLZ9emxAW5jh70/P/N5zbgnAVssjMiFdC04MwXwLLA
+9P4yPykqlXvY8qdOD1R8oQ2AswkDwf9c3V6aPryuvEeKaq5xyh+xKrhfQgUL7EYw0XILyulWbfXv
+33i+Ybqypa4ETLyorGkVl73v67SMvzX41MPRKA5cOp9wGDMgd8SirwIDAQABo4GrMIGoMAsGA1Ud
+DwQEAwIBxjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBRTMtGzz3/64PGgXYVOktKeRR20TzA9
+BgNVHR8ENjA0MDKgMKAuhixodHRwOi8vY3JsLnVzZXJ0cnVzdC5jb20vVVROLURBVEFDb3JwU0dD
+LmNybDAqBgNVHSUEIzAhBggrBgEFBQcDAQYKKwYBBAGCNwoDAwYJYIZIAYb4QgQBMA0GCSqGSIb3
+DQEBBQUAA4IBAQAnNZcAiosovcYzMB4p/OL31ZjUQLtgyr+rFywJNn9Q+kHcrpY6CiM+iVnJowft
+Gzet/Hy+UUla3joKVAgWRcKZsYfNjGjgaQPpxE6YsjuMFrMOoAyYUJuTqXAJyCyjj98C5OBxOvG0
+I3KgqgHf35g+FFCgMSa9KOlaMCZ1+XtgHI3zzVAmbQQnmt/VDUVHKWss5nbZqSl9Mt3JNjy9rjXx
+EZ4du5A/EkdOjtd+D2JzHVImOBwYSf0wdJrE5SIv2MCN7ZF6TACPcn9d2t0bi0Vr591pl6jFVkwP
+DPafepE39peC4N1xaf92P2BNPM/3mfnGV/TJVTl4uix5yaaIK/QI
+-----END CERTIFICATE-----
+
+UTN USERFirst Hardware Root CA
+==============================
+-----BEGIN CERTIFICATE-----
+MIIEdDCCA1ygAwIBAgIQRL4Mi1AAJLQR0zYq/mUK/TANBgkqhkiG9w0BAQUFADCBlzELMAkGA1UE
+BhMCVVMxCzAJBgNVBAgTAlVUMRcwFQYDVQQHEw5TYWx0IExha2UgQ2l0eTEeMBwGA1UEChMVVGhl
+IFVTRVJUUlVTVCBOZXR3b3JrMSEwHwYDVQQLExhodHRwOi8vd3d3LnVzZXJ0cnVzdC5jb20xHzAd
+BgNVBAMTFlVUTi1VU0VSRmlyc3QtSGFyZHdhcmUwHhcNOTkwNzA5MTgxMDQyWhcNMTkwNzA5MTgx
+OTIyWjCBlzELMAkGA1UEBhMCVVMxCzAJBgNVBAgTAlVUMRcwFQYDVQQHEw5TYWx0IExha2UgQ2l0
+eTEeMBwGA1UEChMVVGhlIFVTRVJUUlVTVCBOZXR3b3JrMSEwHwYDVQQLExhodHRwOi8vd3d3LnVz
+ZXJ0cnVzdC5jb20xHzAdBgNVBAMTFlVUTi1VU0VSRmlyc3QtSGFyZHdhcmUwggEiMA0GCSqGSIb3
+DQEBAQUAA4IBDwAwggEKAoIBAQCx98M4P7Sof885glFn0G2f0v9Y8+efK+wNiVSZuTiZFvfgIXlI
+wrthdBKWHTxqctU8EGc6Oe0rE81m65UJM6Rsl7HoxuzBdXmcRl6Nq9Bq/bkqVRcQVLMZ8Jr28bFd
+tqdt++BxF2uiiPsA3/4aMXcMmgF6sTLjKwEHOG7DpV4jvEWbe1DByTCP2+UretNb+zNAHqDVmBe8
+i4fDidNdoI6yqqr2jmmIBsX6iSHzCJ1pLgkzmykNRg+MzEk0sGlRvfkGzWitZky8PqxhvQqIDsjf
+Pe58BEydCl5rkdbux+0ojatNh4lz0G6k0B4WixThdkQDf2Os5M1JnMWS9KsyoUhbAgMBAAGjgbkw
+gbYwCwYDVR0PBAQDAgHGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFKFyXyYbKJhDlV0HN9WF
+lp1L0sNFMEQGA1UdHwQ9MDswOaA3oDWGM2h0dHA6Ly9jcmwudXNlcnRydXN0LmNvbS9VVE4tVVNF
+UkZpcnN0LUhhcmR3YXJlLmNybDAxBgNVHSUEKjAoBggrBgEFBQcDAQYIKwYBBQUHAwUGCCsGAQUF
+BwMGBggrBgEFBQcDBzANBgkqhkiG9w0BAQUFAAOCAQEARxkP3nTGmZev/K0oXnWO6y1n7k57K9cM
+//bey1WiCuFMVGWTYGufEpytXoMs61quwOQt9ABjHbjAbPLPSbtNk28GpgoiskliCE7/yMgUsogW
+XecB5BKV5UU0s4tpvc+0hY91UZ59Ojg6FEgSxvunOxqNDYJAB+gECJChicsZUN/KHAG8HQQZexB2
+lzvukJDKxA4fFm517zP4029bHpbj4HR3dHuKom4t3XbWOTCC8KucUvIqx69JXn7HaOWCgchqJ/kn
+iCrVWFCVH/A7HFe7fRQ5YiuayZSSKqMiDP+JJn1fIytH1xUdqWqeUQ0qUZ6B+dQ7XnASfxAynB67
+nfhmqA==
+-----END CERTIFICATE-----
+
+Camerfirma Chambers of Commerce Root
+====================================
+-----BEGIN CERTIFICATE-----
+MIIEvTCCA6WgAwIBAgIBADANBgkqhkiG9w0BAQUFADB/MQswCQYDVQQGEwJFVTEnMCUGA1UEChMe
+QUMgQ2FtZXJmaXJtYSBTQSBDSUYgQTgyNzQzMjg3MSMwIQYDVQQLExpodHRwOi8vd3d3LmNoYW1i
+ZXJzaWduLm9yZzEiMCAGA1UEAxMZQ2hhbWJlcnMgb2YgQ29tbWVyY2UgUm9vdDAeFw0wMzA5MzAx
+NjEzNDNaFw0zNzA5MzAxNjEzNDRaMH8xCzAJBgNVBAYTAkVVMScwJQYDVQQKEx5BQyBDYW1lcmZp
+cm1hIFNBIENJRiBBODI3NDMyODcxIzAhBgNVBAsTGmh0dHA6Ly93d3cuY2hhbWJlcnNpZ24ub3Jn
+MSIwIAYDVQQDExlDaGFtYmVycyBvZiBDb21tZXJjZSBSb290MIIBIDANBgkqhkiG9w0BAQEFAAOC
+AQ0AMIIBCAKCAQEAtzZV5aVdGDDg2olUkfzIx1L4L1DZ77F1c2VHfRtbunXF/KGIJPov7coISjlU
+xFF6tdpg6jg8gbLL8bvZkSM/SAFwdakFKq0fcfPJVD0dBmpAPrMMhe5cG3nCYsS4No41XQEMIwRH
+NaqbYE6gZj3LJgqcQKH0XZi/caulAGgq7YN6D6IUtdQis4CwPAxaUWktWBiP7Zme8a7ileb2R6jW
+DA+wWFjbw2Y3npuRVDM30pQcakjJyfKl2qUMI/cjDpwyVV5xnIQFUZot/eZOKjRa3spAN2cMVCFV
+d9oKDMyXroDclDZK9D7ONhMeU+SsTjoF7Nuucpw4i9A5O4kKPnf+dQIBA6OCAUQwggFAMBIGA1Ud
+EwEB/wQIMAYBAf8CAQwwPAYDVR0fBDUwMzAxoC+gLYYraHR0cDovL2NybC5jaGFtYmVyc2lnbi5v
+cmcvY2hhbWJlcnNyb290LmNybDAdBgNVHQ4EFgQU45T1sU3p26EpW1eLTXYGduHRooowDgYDVR0P
+AQH/BAQDAgEGMBEGCWCGSAGG+EIBAQQEAwIABzAnBgNVHREEIDAegRxjaGFtYmVyc3Jvb3RAY2hh
+bWJlcnNpZ24ub3JnMCcGA1UdEgQgMB6BHGNoYW1iZXJzcm9vdEBjaGFtYmVyc2lnbi5vcmcwWAYD
+VR0gBFEwTzBNBgsrBgEEAYGHLgoDATA+MDwGCCsGAQUFBwIBFjBodHRwOi8vY3BzLmNoYW1iZXJz
+aWduLm9yZy9jcHMvY2hhbWJlcnNyb290Lmh0bWwwDQYJKoZIhvcNAQEFBQADggEBAAxBl8IahsAi
+fJ/7kPMa0QOx7xP5IV8EnNrJpY0nbJaHkb5BkAFyk+cefV/2icZdp0AJPaxJRUXcLo0waLIJuvvD
+L8y6C98/d3tGfToSJI6WjzwFCm/SlCgdbQzALogi1djPHRPH8EjX1wWnz8dHnjs8NMiAT9QUu/wN
+UPf6s+xCX6ndbcj0dc97wXImsQEcXCz9ek60AcUFV7nnPKoF2YjpB0ZBzu9Bga5Y34OirsrXdx/n
+ADydb47kMgkdTXg0eDQ8lJsm7U9xxhl6vSAiSFr+S30Dt+dYvsYyTnQeaN2oaFuzPu5ifdmA6Ap1
+erfutGWaIZDgqtCYvDi1czyL+Nw=
+-----END CERTIFICATE-----
+
+Camerfirma Global Chambersign Root
+==================================
+-----BEGIN CERTIFICATE-----
+MIIExTCCA62gAwIBAgIBADANBgkqhkiG9w0BAQUFADB9MQswCQYDVQQGEwJFVTEnMCUGA1UEChMe
+QUMgQ2FtZXJmaXJtYSBTQSBDSUYgQTgyNzQzMjg3MSMwIQYDVQQLExpodHRwOi8vd3d3LmNoYW1i
+ZXJzaWduLm9yZzEgMB4GA1UEAxMXR2xvYmFsIENoYW1iZXJzaWduIFJvb3QwHhcNMDMwOTMwMTYx
+NDE4WhcNMzcwOTMwMTYxNDE4WjB9MQswCQYDVQQGEwJFVTEnMCUGA1UEChMeQUMgQ2FtZXJmaXJt
+YSBTQSBDSUYgQTgyNzQzMjg3MSMwIQYDVQQLExpodHRwOi8vd3d3LmNoYW1iZXJzaWduLm9yZzEg
+MB4GA1UEAxMXR2xvYmFsIENoYW1iZXJzaWduIFJvb3QwggEgMA0GCSqGSIb3DQEBAQUAA4IBDQAw
+ggEIAoIBAQCicKLQn0KuWxfH2H3PFIP8T8mhtxOviteePgQKkotgVvq0Mi+ITaFgCPS3CU6gSS9J
+1tPfnZdan5QEcOw/Wdm3zGaLmFIoCQLfxS+EjXqXd7/sQJ0lcqu1PzKY+7e3/HKE5TWH+VX6ox8O
+by4o3Wmg2UIQxvi1RMLQQ3/bvOSiPGpVeAp3qdjqGTK3L/5cPxvusZjsyq16aUXjlg9V9ubtdepl
+6DJWk0aJqCWKZQbua795B9Dxt6/tLE2Su8CoX6dnfQTyFQhwrJLWfQTSM/tMtgsL+xrJxI0DqX5c
+8lCrEqWhz0hQpe/SyBoT+rB/sYIcd2oPX9wLlY/vQ37mRQklAgEDo4IBUDCCAUwwEgYDVR0TAQH/
+BAgwBgEB/wIBDDA/BgNVHR8EODA2MDSgMqAwhi5odHRwOi8vY3JsLmNoYW1iZXJzaWduLm9yZy9j
+aGFtYmVyc2lnbnJvb3QuY3JsMB0GA1UdDgQWBBRDnDafsJ4wTcbOX60Qq+UDpfqpFDAOBgNVHQ8B
+Af8EBAMCAQYwEQYJYIZIAYb4QgEBBAQDAgAHMCoGA1UdEQQjMCGBH2NoYW1iZXJzaWducm9vdEBj
+aGFtYmVyc2lnbi5vcmcwKgYDVR0SBCMwIYEfY2hhbWJlcnNpZ25yb290QGNoYW1iZXJzaWduLm9y
+ZzBbBgNVHSAEVDBSMFAGCysGAQQBgYcuCgEBMEEwPwYIKwYBBQUHAgEWM2h0dHA6Ly9jcHMuY2hh
+bWJlcnNpZ24ub3JnL2Nwcy9jaGFtYmVyc2lnbnJvb3QuaHRtbDANBgkqhkiG9w0BAQUFAAOCAQEA
+PDtwkfkEVCeR4e3t/mh/YV3lQWVPMvEYBZRqHN4fcNs+ezICNLUMbKGKfKX0j//U2K0X1S0E0T9Y
+gOKBWYi+wONGkyT+kL0mojAt6JcmVzWJdJYY9hXiryQZVgICsroPFOrGimbBhkVVi76SvpykBMdJ
+PJ7oKXqJ1/6v/2j1pReQvayZzKWGVwlnRtvWFsJG8eSpUPWP0ZIV018+xgBJOm5YstHRJw0lyDL4
+IBHNfTIzSJRUTN3cecQwn+uOuFW114hcxWokPbLTBQNRxgfvzBRydD1ucs4YKIxKoHflCStFREes
+t2d/AYoFWpO+ocH/+OcOZ6RHSXZddZAa9SaP8A==
+-----END CERTIFICATE-----
+
+NetLock Notary (Class A) Root
+=============================
+-----BEGIN CERTIFICATE-----
+MIIGfTCCBWWgAwIBAgICAQMwDQYJKoZIhvcNAQEEBQAwga8xCzAJBgNVBAYTAkhVMRAwDgYDVQQI
+EwdIdW5nYXJ5MREwDwYDVQQHEwhCdWRhcGVzdDEnMCUGA1UEChMeTmV0TG9jayBIYWxvemF0Yml6
+dG9uc2FnaSBLZnQuMRowGAYDVQQLExFUYW51c2l0dmFueWtpYWRvazE2MDQGA1UEAxMtTmV0TG9j
+ayBLb3pqZWd5em9pIChDbGFzcyBBKSBUYW51c2l0dmFueWtpYWRvMB4XDTk5MDIyNDIzMTQ0N1oX
+DTE5MDIxOTIzMTQ0N1owga8xCzAJBgNVBAYTAkhVMRAwDgYDVQQIEwdIdW5nYXJ5MREwDwYDVQQH
+EwhCdWRhcGVzdDEnMCUGA1UEChMeTmV0TG9jayBIYWxvemF0Yml6dG9uc2FnaSBLZnQuMRowGAYD
+VQQLExFUYW51c2l0dmFueWtpYWRvazE2MDQGA1UEAxMtTmV0TG9jayBLb3pqZWd5em9pIChDbGFz
+cyBBKSBUYW51c2l0dmFueWtpYWRvMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAvHSM
+D7tM9DceqQWC2ObhbHDqeLVu0ThEDaiDzl3S1tWBxdRL51uUcCbbO51qTGL3cfNk1mE7PetzozfZ
+z+qMkjvN9wfcZnSX9EUi3fRc4L9t875lM+QVOr/bmJBVOMTtplVjC7B4BPTjbsE/jvxReB+SnoPC
+/tmwqcm8WgD/qaiYdPv2LD4VOQ22BFWoDpggQrOxJa1+mm9dU7GrDPzr4PN6s6iz/0b2Y6LYOph7
+tqyF/7AlT3Rj5xMHpQqPBffAZG9+pyeAlt7ULoZgx2srXnN7F+eRP2QM2EsiNCubMvJIH5+hCoR6
+4sKtlz2O1cH5VqNQ6ca0+pii7pXmKgOM3wIDAQABo4ICnzCCApswDgYDVR0PAQH/BAQDAgAGMBIG
+A1UdEwEB/wQIMAYBAf8CAQQwEQYJYIZIAYb4QgEBBAQDAgAHMIICYAYJYIZIAYb4QgENBIICURaC
+Ak1GSUdZRUxFTSEgRXplbiB0YW51c2l0dmFueSBhIE5ldExvY2sgS2Z0LiBBbHRhbGFub3MgU3pv
+bGdhbHRhdGFzaSBGZWx0ZXRlbGVpYmVuIGxlaXJ0IGVsamFyYXNvayBhbGFwamFuIGtlc3p1bHQu
+IEEgaGl0ZWxlc2l0ZXMgZm9seWFtYXRhdCBhIE5ldExvY2sgS2Z0LiB0ZXJtZWtmZWxlbG9zc2Vn
+LWJpenRvc2l0YXNhIHZlZGkuIEEgZGlnaXRhbGlzIGFsYWlyYXMgZWxmb2dhZGFzYW5hayBmZWx0
+ZXRlbGUgYXogZWxvaXJ0IGVsbGVub3J6ZXNpIGVsamFyYXMgbWVndGV0ZWxlLiBBeiBlbGphcmFz
+IGxlaXJhc2EgbWVndGFsYWxoYXRvIGEgTmV0TG9jayBLZnQuIEludGVybmV0IGhvbmxhcGphbiBh
+IGh0dHBzOi8vd3d3Lm5ldGxvY2submV0L2RvY3MgY2ltZW4gdmFneSBrZXJoZXRvIGF6IGVsbGVu
+b3J6ZXNAbmV0bG9jay5uZXQgZS1tYWlsIGNpbWVuLiBJTVBPUlRBTlQhIFRoZSBpc3N1YW5jZSBh
+bmQgdGhlIHVzZSBvZiB0aGlzIGNlcnRpZmljYXRlIGlzIHN1YmplY3QgdG8gdGhlIE5ldExvY2sg
+Q1BTIGF2YWlsYWJsZSBhdCBodHRwczovL3d3dy5uZXRsb2NrLm5ldC9kb2NzIG9yIGJ5IGUtbWFp
+bCBhdCBjcHNAbmV0bG9jay5uZXQuMA0GCSqGSIb3DQEBBAUAA4IBAQBIJEb3ulZv+sgoA0BO5TE5
+ayZrU3/b39/zcT0mwBQOxmd7I6gMc90Bu8bKbjc5VdXHjFYgDigKDtIqpLBJUsY4B/6+CgmM0ZjP
+ytoUMaFP0jn8DxEsQ8Pdq5PHVT5HfBgaANzze9jyf1JsIPQLX2lS9O74silg6+NJMSEN1rUQQeJB
+CWziGppWS3cC9qCbmieH6FUpccKQn0V4GuEVZD3QDtigdp+uxdAu6tYPVuxkf1qbFFgBJ34TUMdr
+KuZoPL9coAob4Q566eKAw+np9v1sEZ7Q5SgnK1QyQhSCdeZK8CtmdWOMovsEPoMOmzbwGOQmIMOM
+8CgHrTwXZoi1/baI
+-----END CERTIFICATE-----
+
+NetLock Business (Class B) Root
+===============================
+-----BEGIN CERTIFICATE-----
+MIIFSzCCBLSgAwIBAgIBaTANBgkqhkiG9w0BAQQFADCBmTELMAkGA1UEBhMCSFUxETAPBgNVBAcT
+CEJ1ZGFwZXN0MScwJQYDVQQKEx5OZXRMb2NrIEhhbG96YXRiaXp0b25zYWdpIEtmdC4xGjAYBgNV
+BAsTEVRhbnVzaXR2YW55a2lhZG9rMTIwMAYDVQQDEylOZXRMb2NrIFV6bGV0aSAoQ2xhc3MgQikg
+VGFudXNpdHZhbnlraWFkbzAeFw05OTAyMjUxNDEwMjJaFw0xOTAyMjAxNDEwMjJaMIGZMQswCQYD
+VQQGEwJIVTERMA8GA1UEBxMIQnVkYXBlc3QxJzAlBgNVBAoTHk5ldExvY2sgSGFsb3phdGJpenRv
+bnNhZ2kgS2Z0LjEaMBgGA1UECxMRVGFudXNpdHZhbnlraWFkb2sxMjAwBgNVBAMTKU5ldExvY2sg
+VXpsZXRpIChDbGFzcyBCKSBUYW51c2l0dmFueWtpYWRvMIGfMA0GCSqGSIb3DQEBAQUAA4GNADCB
+iQKBgQCx6gTsIKAjwo84YM/HRrPVG/77uZmeBNwcf4xKgZjupNTKihe5In+DCnVMm8Bp2GQ5o+2S
+o/1bXHQawEfKOml2mrriRBf8TKPV/riXiK+IA4kfpPIEPsgHC+b5sy96YhQJRhTKZPWLgLViqNhr
+1nGTLbO/CVRY7QbrqHvcQ7GhaQIDAQABo4ICnzCCApswEgYDVR0TAQH/BAgwBgEB/wIBBDAOBgNV
+HQ8BAf8EBAMCAAYwEQYJYIZIAYb4QgEBBAQDAgAHMIICYAYJYIZIAYb4QgENBIICURaCAk1GSUdZ
+RUxFTSEgRXplbiB0YW51c2l0dmFueSBhIE5ldExvY2sgS2Z0LiBBbHRhbGFub3MgU3pvbGdhbHRh
+dGFzaSBGZWx0ZXRlbGVpYmVuIGxlaXJ0IGVsamFyYXNvayBhbGFwamFuIGtlc3p1bHQuIEEgaGl0
+ZWxlc2l0ZXMgZm9seWFtYXRhdCBhIE5ldExvY2sgS2Z0LiB0ZXJtZWtmZWxlbG9zc2VnLWJpenRv
+c2l0YXNhIHZlZGkuIEEgZGlnaXRhbGlzIGFsYWlyYXMgZWxmb2dhZGFzYW5hayBmZWx0ZXRlbGUg
+YXogZWxvaXJ0IGVsbGVub3J6ZXNpIGVsamFyYXMgbWVndGV0ZWxlLiBBeiBlbGphcmFzIGxlaXJh
+c2EgbWVndGFsYWxoYXRvIGEgTmV0TG9jayBLZnQuIEludGVybmV0IGhvbmxhcGphbiBhIGh0dHBz
+Oi8vd3d3Lm5ldGxvY2submV0L2RvY3MgY2ltZW4gdmFneSBrZXJoZXRvIGF6IGVsbGVub3J6ZXNA
+bmV0bG9jay5uZXQgZS1tYWlsIGNpbWVuLiBJTVBPUlRBTlQhIFRoZSBpc3N1YW5jZSBhbmQgdGhl
+IHVzZSBvZiB0aGlzIGNlcnRpZmljYXRlIGlzIHN1YmplY3QgdG8gdGhlIE5ldExvY2sgQ1BTIGF2
+YWlsYWJsZSBhdCBodHRwczovL3d3dy5uZXRsb2NrLm5ldC9kb2NzIG9yIGJ5IGUtbWFpbCBhdCBj
+cHNAbmV0bG9jay5uZXQuMA0GCSqGSIb3DQEBBAUAA4GBAATbrowXr/gOkDFOzT4JwG06sPgzTEdM
+43WIEJessDgVkcYplswhwG08pXTP2IKlOcNl40JwuyKQ433bNXbhoLXan3BukxowOR0w2y7jfLKR
+stE3Kfq51hdcR0/jHTjrn9V7lagonhVK0dHQKwCXoOKSNitjrFgBazMpUIaD8QFI
+-----END CERTIFICATE-----
+
+NetLock Express (Class C) Root
+==============================
+-----BEGIN CERTIFICATE-----
+MIIFTzCCBLigAwIBAgIBaDANBgkqhkiG9w0BAQQFADCBmzELMAkGA1UEBhMCSFUxETAPBgNVBAcT
+CEJ1ZGFwZXN0MScwJQYDVQQKEx5OZXRMb2NrIEhhbG96YXRiaXp0b25zYWdpIEtmdC4xGjAYBgNV
+BAsTEVRhbnVzaXR2YW55a2lhZG9rMTQwMgYDVQQDEytOZXRMb2NrIEV4cHJlc3N6IChDbGFzcyBD
+KSBUYW51c2l0dmFueWtpYWRvMB4XDTk5MDIyNTE0MDgxMVoXDTE5MDIyMDE0MDgxMVowgZsxCzAJ
+BgNVBAYTAkhVMREwDwYDVQQHEwhCdWRhcGVzdDEnMCUGA1UEChMeTmV0TG9jayBIYWxvemF0Yml6
+dG9uc2FnaSBLZnQuMRowGAYDVQQLExFUYW51c2l0dmFueWtpYWRvazE0MDIGA1UEAxMrTmV0TG9j
+ayBFeHByZXNzeiAoQ2xhc3MgQykgVGFudXNpdHZhbnlraWFkbzCBnzANBgkqhkiG9w0BAQEFAAOB
+jQAwgYkCgYEA6+ywbGGKIyWvYCDj2Z/8kwvbXY2wobNAOoLO/XXgeDIDhlqGlZHtU/qdQPzm6N3Z
+W3oDvV3zOwzDUXmbrVWg6dADEK8KuhRC2VImESLH0iDMgqSaqf64gXadarfSNnU+sYYJ9m5tfk63
+euyucYT2BDMIJTLrdKwWRMbkQJMdf60CAwEAAaOCAp8wggKbMBIGA1UdEwEB/wQIMAYBAf8CAQQw
+DgYDVR0PAQH/BAQDAgAGMBEGCWCGSAGG+EIBAQQEAwIABzCCAmAGCWCGSAGG+EIBDQSCAlEWggJN
+RklHWUVMRU0hIEV6ZW4gdGFudXNpdHZhbnkgYSBOZXRMb2NrIEtmdC4gQWx0YWxhbm9zIFN6b2xn
+YWx0YXRhc2kgRmVsdGV0ZWxlaWJlbiBsZWlydCBlbGphcmFzb2sgYWxhcGphbiBrZXN6dWx0LiBB
+IGhpdGVsZXNpdGVzIGZvbHlhbWF0YXQgYSBOZXRMb2NrIEtmdC4gdGVybWVrZmVsZWxvc3NlZy1i
+aXp0b3NpdGFzYSB2ZWRpLiBBIGRpZ2l0YWxpcyBhbGFpcmFzIGVsZm9nYWRhc2FuYWsgZmVsdGV0
+ZWxlIGF6IGVsb2lydCBlbGxlbm9yemVzaSBlbGphcmFzIG1lZ3RldGVsZS4gQXogZWxqYXJhcyBs
+ZWlyYXNhIG1lZ3RhbGFsaGF0byBhIE5ldExvY2sgS2Z0LiBJbnRlcm5ldCBob25sYXBqYW4gYSBo
+dHRwczovL3d3dy5uZXRsb2NrLm5ldC9kb2NzIGNpbWVuIHZhZ3kga2VyaGV0byBheiBlbGxlbm9y
+emVzQG5ldGxvY2submV0IGUtbWFpbCBjaW1lbi4gSU1QT1JUQU5UISBUaGUgaXNzdWFuY2UgYW5k
+IHRoZSB1c2Ugb2YgdGhpcyBjZXJ0aWZpY2F0ZSBpcyBzdWJqZWN0IHRvIHRoZSBOZXRMb2NrIENQ
+UyBhdmFpbGFibGUgYXQgaHR0cHM6Ly93d3cubmV0bG9jay5uZXQvZG9jcyBvciBieSBlLW1haWwg
+YXQgY3BzQG5ldGxvY2submV0LjANBgkqhkiG9w0BAQQFAAOBgQAQrX/XDDKACtiG8XmYta3UzbM2
+xJZIwVzNmtkFLp++UOv0JhQQLdRmF/iewSf98e3ke0ugbLWrmldwpu2gpO0u9f38vf5NNwgMvOOW
+gyL1SRt/Syu0VMGAfJlOHdCM7tCs5ZL6dVb+ZKATj7i4Fp1hBWeAyNDYpQcCNJgEjTME1A==
+-----END CERTIFICATE-----
+
+XRamp Global CA Root
+====================
+-----BEGIN CERTIFICATE-----
+MIIEMDCCAxigAwIBAgIQUJRs7Bjq1ZxN1ZfvdY+grTANBgkqhkiG9w0BAQUFADCBgjELMAkGA1UE
+BhMCVVMxHjAcBgNVBAsTFXd3dy54cmFtcHNlY3VyaXR5LmNvbTEkMCIGA1UEChMbWFJhbXAgU2Vj
+dXJpdHkgU2VydmljZXMgSW5jMS0wKwYDVQQDEyRYUmFtcCBHbG9iYWwgQ2VydGlmaWNhdGlvbiBB
+dXRob3JpdHkwHhcNMDQxMTAxMTcxNDA0WhcNMzUwMTAxMDUzNzE5WjCBgjELMAkGA1UEBhMCVVMx
+HjAcBgNVBAsTFXd3dy54cmFtcHNlY3VyaXR5LmNvbTEkMCIGA1UEChMbWFJhbXAgU2VjdXJpdHkg
+U2VydmljZXMgSW5jMS0wKwYDVQQDEyRYUmFtcCBHbG9iYWwgQ2VydGlmaWNhdGlvbiBBdXRob3Jp
+dHkwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCYJB69FbS638eMpSe2OAtp87ZOqCwu
+IR1cRN8hXX4jdP5efrRKt6atH67gBhbim1vZZ3RrXYCPKZ2GG9mcDZhtdhAoWORlsH9KmHmf4MMx
+foArtYzAQDsRhtDLooY2YKTVMIJt2W7QDxIEM5dfT2Fa8OT5kavnHTu86M/0ay00fOJIYRyO82FE
+zG+gSqmUsE3a56k0enI4qEHMPJQRfevIpoy3hsvKMzvZPTeL+3o+hiznc9cKV6xkmxnr9A8ECIqs
+AxcZZPRaJSKNNCyy9mgdEm3Tih4U2sSPpuIjhdV6Db1q4Ons7Be7QhtnqiXtRYMh/MHJfNViPvry
+xS3T/dRlAgMBAAGjgZ8wgZwwEwYJKwYBBAGCNxQCBAYeBABDAEEwCwYDVR0PBAQDAgGGMA8GA1Ud
+EwEB/wQFMAMBAf8wHQYDVR0OBBYEFMZPoj0GY4QJnM5i5ASsjVy16bYbMDYGA1UdHwQvMC0wK6Ap
+oCeGJWh0dHA6Ly9jcmwueHJhbXBzZWN1cml0eS5jb20vWEdDQS5jcmwwEAYJKwYBBAGCNxUBBAMC
+AQEwDQYJKoZIhvcNAQEFBQADggEBAJEVOQMBG2f7Shz5CmBbodpNl2L5JFMn14JkTpAuw0kbK5rc
+/Kh4ZzXxHfARvbdI4xD2Dd8/0sm2qlWkSLoC295ZLhVbO50WfUfXN+pfTXYSNrsf16GBBEYgoyxt
+qZ4Bfj8pzgCT3/3JknOJiWSe5yvkHJEs0rnOfc5vMZnT5r7SHpDwCRR5XCOrTdLaIR9NmXmd4c8n
+nxCbHIgNsIpkQTG4DmyQJKSbXHGPurt+HBvbaoAPIbzp26a3QPSyi6mx5O+aGtA9aZnuqCij4Tyz
+8LIRnM98QObd50N9otg6tamN8jSZxNQQ4Qb9CYQQO+7ETPTsJ3xCwnR8gooJybQDJbw=
+-----END CERTIFICATE-----
+
+Go Daddy Class 2 CA
+===================
+-----BEGIN CERTIFICATE-----
+MIIEADCCAuigAwIBAgIBADANBgkqhkiG9w0BAQUFADBjMQswCQYDVQQGEwJVUzEhMB8GA1UEChMY
+VGhlIEdvIERhZGR5IEdyb3VwLCBJbmMuMTEwLwYDVQQLEyhHbyBEYWRkeSBDbGFzcyAyIENlcnRp
+ZmljYXRpb24gQXV0aG9yaXR5MB4XDTA0MDYyOTE3MDYyMFoXDTM0MDYyOTE3MDYyMFowYzELMAkG
+A1UEBhMCVVMxITAfBgNVBAoTGFRoZSBHbyBEYWRkeSBHcm91cCwgSW5jLjExMC8GA1UECxMoR28g
+RGFkZHkgQ2xhc3MgMiBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTCCASAwDQYJKoZIhvcNAQEBBQAD
+ggENADCCAQgCggEBAN6d1+pXGEmhW+vXX0iG6r7d/+TvZxz0ZWizV3GgXne77ZtJ6XCAPVYYYwhv
+2vLM0D9/AlQiVBDYsoHUwHU9S3/Hd8M+eKsaA7Ugay9qK7HFiH7Eux6wwdhFJ2+qN1j3hybX2C32
+qRe3H3I2TqYXP2WYktsqbl2i/ojgC95/5Y0V4evLOtXiEqITLdiOr18SPaAIBQi2XKVlOARFmR6j
+YGB0xUGlcmIbYsUfb18aQr4CUWWoriMYavx4A6lNf4DD+qta/KFApMoZFv6yyO9ecw3ud72a9nmY
+vLEHZ6IVDd2gWMZEewo+YihfukEHU1jPEX44dMX4/7VpkI+EdOqXG68CAQOjgcAwgb0wHQYDVR0O
+BBYEFNLEsNKR1EwRcbNhyz2h/t2oatTjMIGNBgNVHSMEgYUwgYKAFNLEsNKR1EwRcbNhyz2h/t2o
+atTjoWekZTBjMQswCQYDVQQGEwJVUzEhMB8GA1UEChMYVGhlIEdvIERhZGR5IEdyb3VwLCBJbmMu
+MTEwLwYDVQQLEyhHbyBEYWRkeSBDbGFzcyAyIENlcnRpZmljYXRpb24gQXV0aG9yaXR5ggEAMAwG
+A1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEFBQADggEBADJL87LKPpH8EsahB4yOd6AzBhRckB4Y9wim
+PQoZ+YeAEW5p5JYXMP80kWNyOO7MHAGjHZQopDH2esRU1/blMVgDoszOYtuURXO1v0XJJLXVggKt
+I3lpjbi2Tc7PTMozI+gciKqdi0FuFskg5YmezTvacPd+mSYgFFQlq25zheabIZ0KbIIOqPjCDPoQ
+HmyW74cNxA9hi63ugyuV+I6ShHI56yDqg+2DzZduCLzrTia2cyvk0/ZM/iZx4mERdEr/VxqHD3VI
+Ls9RaRegAhJhldXRQLIQTO7ErBBDpqWeCtWVYpoNz4iCxTIM5CufReYNnyicsbkqWletNw+vHX/b
+vZ8=
+-----END CERTIFICATE-----
+
+Starfield Class 2 CA
+====================
+-----BEGIN CERTIFICATE-----
+MIIEDzCCAvegAwIBAgIBADANBgkqhkiG9w0BAQUFADBoMQswCQYDVQQGEwJVUzElMCMGA1UEChMc
+U3RhcmZpZWxkIFRlY2hub2xvZ2llcywgSW5jLjEyMDAGA1UECxMpU3RhcmZpZWxkIENsYXNzIDIg
+Q2VydGlmaWNhdGlvbiBBdXRob3JpdHkwHhcNMDQwNjI5MTczOTE2WhcNMzQwNjI5MTczOTE2WjBo
+MQswCQYDVQQGEwJVUzElMCMGA1UEChMcU3RhcmZpZWxkIFRlY2hub2xvZ2llcywgSW5jLjEyMDAG
+A1UECxMpU3RhcmZpZWxkIENsYXNzIDIgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwggEgMA0GCSqG
+SIb3DQEBAQUAA4IBDQAwggEIAoIBAQC3Msj+6XGmBIWtDBFk385N78gDGIc/oav7PKaf8MOh2tTY
+bitTkPskpD6E8J7oX+zlJ0T1KKY/e97gKvDIr1MvnsoFAZMej2YcOadN+lq2cwQlZut3f+dZxkqZ
+JRRU6ybH838Z1TBwj6+wRir/resp7defqgSHo9T5iaU0X9tDkYI22WY8sbi5gv2cOj4QyDvvBmVm
+epsZGD3/cVE8MC5fvj13c7JdBmzDI1aaK4UmkhynArPkPw2vCHmCuDY96pzTNbO8acr1zJ3o/WSN
+F4Azbl5KXZnJHoe0nRrA1W4TNSNe35tfPe/W93bC6j67eA0cQmdrBNj41tpvi/JEoAGrAgEDo4HF
+MIHCMB0GA1UdDgQWBBS/X7fRzt0fhvRbVazc1xDCDqmI5zCBkgYDVR0jBIGKMIGHgBS/X7fRzt0f
+hvRbVazc1xDCDqmI56FspGowaDELMAkGA1UEBhMCVVMxJTAjBgNVBAoTHFN0YXJmaWVsZCBUZWNo
+bm9sb2dpZXMsIEluYy4xMjAwBgNVBAsTKVN0YXJmaWVsZCBDbGFzcyAyIENlcnRpZmljYXRpb24g
+QXV0aG9yaXR5ggEAMAwGA1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEFBQADggEBAAWdP4id0ckaVaGs
+afPzWdqbAYcaT1epoXkJKtv3L7IezMdeatiDh6GX70k1PncGQVhiv45YuApnP+yz3SFmH8lU+nLM
+PUxA2IGvd56Deruix/U0F47ZEUD0/CwqTRV/p2JdLiXTAAsgGh1o+Re49L2L7ShZ3U0WixeDyLJl
+xy16paq8U4Zt3VekyvggQQto8PT7dL5WXXp59fkdheMtlb71cZBDzI0fmgAKhynpVSJYACPq4xJD
+KVtHCN2MQWplBqjlIapBtJUhlbl90TSrE9atvNziPTnNvT51cKEYWQPJIrSPnNVeKtelttQKbfi3
+QBFGmh95DmK/D5fs4C8fF5Q=
+-----END CERTIFICATE-----
+
+StartCom Certification Authority
+================================
+-----BEGIN CERTIFICATE-----
+MIIHyTCCBbGgAwIBAgIBATANBgkqhkiG9w0BAQUFADB9MQswCQYDVQQGEwJJTDEWMBQGA1UEChMN
+U3RhcnRDb20gTHRkLjErMCkGA1UECxMiU2VjdXJlIERpZ2l0YWwgQ2VydGlmaWNhdGUgU2lnbmlu
+ZzEpMCcGA1UEAxMgU3RhcnRDb20gQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwHhcNMDYwOTE3MTk0
+NjM2WhcNMzYwOTE3MTk0NjM2WjB9MQswCQYDVQQGEwJJTDEWMBQGA1UEChMNU3RhcnRDb20gTHRk
+LjErMCkGA1UECxMiU2VjdXJlIERpZ2l0YWwgQ2VydGlmaWNhdGUgU2lnbmluZzEpMCcGA1UEAxMg
+U3RhcnRDb20gQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAw
+ggIKAoICAQDBiNsJvGxGfHiflXu1M5DycmLWwTYgIiRezul38kMKogZkpMyONvg45iPwbm2xPN1y
+o4UcodM9tDMr0y+v/uqwQVlntsQGfQqedIXWeUyAN3rfOQVSWff0G0ZDpNKFhdLDcfN1YjS6LIp/
+Ho/u7TTQEceWzVI9ujPW3U3eCztKS5/CJi/6tRYccjV3yjxd5srhJosaNnZcAdt0FCX+7bWgiA/d
+eMotHweXMAEtcnn6RtYTKqi5pquDSR3l8u/d5AGOGAqPY1MWhWKpDhk6zLVmpsJrdAfkK+F2PrRt
+2PZE4XNiHzvEvqBTViVsUQn3qqvKv3b9bZvzndu/PWa8DFaqr5hIlTpL36dYUNk4dalb6kMMAv+Z
+6+hsTXBbKWWc3apdzK8BMewM69KN6Oqce+Zu9ydmDBpI125C4z/eIT574Q1w+2OqqGwaVLRcJXrJ
+osmLFqa7LH4XXgVNWG4SHQHuEhANxjJ/GP/89PrNbpHoNkm+Gkhpi8KWTRoSsmkXwQqQ1vp5Iki/
+untp+HDH+no32NgN0nZPV/+Qt+OR0t3vwmC3Zzrd/qqc8NSLf3Iizsafl7b4r4qgEKjZ+xjGtrVc
+UjyJthkqcwEKDwOzEmDyei+B26Nu/yYwl/WL3YlXtq09s68rxbd2AvCl1iuahhQqcvbjM4xdCUsT
+37uMdBNSSwIDAQABo4ICUjCCAk4wDAYDVR0TBAUwAwEB/zALBgNVHQ8EBAMCAa4wHQYDVR0OBBYE
+FE4L7xqkQFulF2mHMMo0aEPQQa7yMGQGA1UdHwRdMFswLKAqoCiGJmh0dHA6Ly9jZXJ0LnN0YXJ0
+Y29tLm9yZy9zZnNjYS1jcmwuY3JsMCugKaAnhiVodHRwOi8vY3JsLnN0YXJ0Y29tLm9yZy9zZnNj
+YS1jcmwuY3JsMIIBXQYDVR0gBIIBVDCCAVAwggFMBgsrBgEEAYG1NwEBATCCATswLwYIKwYBBQUH
+AgEWI2h0dHA6Ly9jZXJ0LnN0YXJ0Y29tLm9yZy9wb2xpY3kucGRmMDUGCCsGAQUFBwIBFilodHRw
+Oi8vY2VydC5zdGFydGNvbS5vcmcvaW50ZXJtZWRpYXRlLnBkZjCB0AYIKwYBBQUHAgIwgcMwJxYg
+U3RhcnQgQ29tbWVyY2lhbCAoU3RhcnRDb20pIEx0ZC4wAwIBARqBl0xpbWl0ZWQgTGlhYmlsaXR5
+LCByZWFkIHRoZSBzZWN0aW9uICpMZWdhbCBMaW1pdGF0aW9ucyogb2YgdGhlIFN0YXJ0Q29tIENl
+cnRpZmljYXRpb24gQXV0aG9yaXR5IFBvbGljeSBhdmFpbGFibGUgYXQgaHR0cDovL2NlcnQuc3Rh
+cnRjb20ub3JnL3BvbGljeS5wZGYwEQYJYIZIAYb4QgEBBAQDAgAHMDgGCWCGSAGG+EIBDQQrFilT
+dGFydENvbSBGcmVlIFNTTCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTANBgkqhkiG9w0BAQUFAAOC
+AgEAFmyZ9GYMNPXQhV59CuzaEE44HF7fpiUFS5Eyweg78T3dRAlbB0mKKctmArexmvclmAk8jhvh
+3TaHK0u7aNM5Zj2gJsfyOZEdUauCe37Vzlrk4gNXcGmXCPleWKYK34wGmkUWFjgKXlf2Ysd6AgXm
+vB618p70qSmD+LIU424oh0TDkBreOKk8rENNZEXO3SipXPJzewT4F+irsfMuXGRuczE6Eri8sxHk
+fY+BUZo7jYn0TZNmezwD7dOaHZrzZVD1oNB1ny+v8OqCQ5j4aZyJecRDjkZy42Q2Eq/3JR44iZB3
+fsNrarnDy0RLrHiQi+fHLB5LEUTINFInzQpdn4XBidUaePKVEFMy3YCEZnXZtWgo+2EuvoSoOMCZ
+EoalHmdkrQYuL6lwhceWD3yJZfWOQ1QOq92lgDmUYMA0yZZwLKMS9R9Ie70cfmu3nZD0Ijuu+Pwq
+yvqCUqDvr0tVk+vBtfAii6w0TiYiBKGHLHVKt+V9E9e4DGTANtLJL4YSjCMJwRuCO3NJo2pXh5Tl
+1njFmUNj403gdy3hZZlyaQQaRwnmDwFWJPsfvw55qVguucQJAX6Vum0ABj6y6koQOdjQK/W/7HW/
+lwLFCRsI3FU34oH7N4RDYiDK51ZLZer+bMEkkyShNOsF/5oirpt9P/FlUQqmMGqz9IgcgA38coro
+g14=
+-----END CERTIFICATE-----
+
+Taiwan GRCA
+===========
+-----BEGIN CERTIFICATE-----
+MIIFcjCCA1qgAwIBAgIQH51ZWtcvwgZEpYAIaeNe9jANBgkqhkiG9w0BAQUFADA/MQswCQYDVQQG
+EwJUVzEwMC4GA1UECgwnR292ZXJubWVudCBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4X
+DTAyMTIwNTEzMjMzM1oXDTMyMTIwNTEzMjMzM1owPzELMAkGA1UEBhMCVFcxMDAuBgNVBAoMJ0dv
+dmVybm1lbnQgUm9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTCCAiIwDQYJKoZIhvcNAQEBBQAD
+ggIPADCCAgoCggIBAJoluOzMonWoe/fOW1mKydGGEghU7Jzy50b2iPN86aXfTEc2pBsBHH8eV4qN
+w8XRIePaJD9IK/ufLqGU5ywck9G/GwGHU5nOp/UKIXZ3/6m3xnOUT0b3EEk3+qhZSV1qgQdW8or5
+BtD3cCJNtLdBuTK4sfCxw5w/cP1T3YGq2GN49thTbqGsaoQkclSGxtKyyhwOeYHWtXBiCAEuTk8O
+1RGvqa/lmr/czIdtJuTJV6L7lvnM4T9TjGxMfptTCAtsF/tnyMKtsc2AtJfcdgEWFelq16TheEfO
+htX7MfP6Mb40qij7cEwdScevLJ1tZqa2jWR+tSBqnTuBto9AAGdLiYa4zGX+FVPpBMHWXx1E1wov
+J5pGfaENda1UhhXcSTvxls4Pm6Dso3pdvtUqdULle96ltqqvKKyskKw4t9VoNSZ63Pc78/1Fm9G7
+Q3hub/FCVGqY8A2tl+lSXunVanLeavcbYBT0peS2cWeqH+riTcFCQP5nRhc4L0c/cZyu5SHKYS1t
+B6iEfC3uUSXxY5Ce/eFXiGvviiNtsea9P63RPZYLhY3Naye7twWb7LuRqQoHEgKXTiCQ8P8NHuJB
+O9NAOueNXdpm5AKwB1KYXA6OM5zCppX7VRluTI6uSw+9wThNXo+EHWbNxWCWtFJaBYmOlXqYwZE8
+lSOyDvR5tMl8wUohAgMBAAGjajBoMB0GA1UdDgQWBBTMzO/MKWCkO7GStjz6MmKPrCUVOzAMBgNV
+HRMEBTADAQH/MDkGBGcqBwAEMTAvMC0CAQAwCQYFKw4DAhoFADAHBgVnKgMAAAQUA5vwIhP/lSg2
+09yewDL7MTqKUWUwDQYJKoZIhvcNAQEFBQADggIBAECASvomyc5eMN1PhnR2WPWus4MzeKR6dBcZ
+TulStbngCnRiqmjKeKBMmo4sIy7VahIkv9Ro04rQ2JyftB8M3jh+Vzj8jeJPXgyfqzvS/3WXy6Tj
+Zwj/5cAWtUgBfen5Cv8b5Wppv3ghqMKnI6mGq3ZW6A4M9hPdKmaKZEk9GhiHkASfQlK3T8v+R0F2
+Ne//AHY2RTKbxkaFXeIksB7jSJaYV0eUVXoPQbFEJPPB/hprv4j9wabak2BegUqZIJxIZhm1AHlU
+D7gsL0u8qV1bYH+Mh6XgUmMqvtg7hUAV/h62ZT/FS9p+tXo1KaMuephgIqP0fSdOLeq0dDzpD6Qz
+DxARvBMB1uUO07+1EqLhRSPAzAhuYbeJq4PjJB7mXQfnHyA+z2fI56wwbSdLaG5LKlwCCDTb+Hbk
+Z6MmnD+iMsJKxYEYMRBWqoTvLQr/uB930r+lWKBi5NdLkXWNiYCYfm3LU05er/ayl4WXudpVBrkk
+7tfGOB5jGxI7leFYrPLfhNVfmS8NVVvmONsuP3LpSIXLuykTjx44VbnzssQwmSNOXfJIoRIM3BKQ
+CZBUkQM8R+XVyWXgt0t97EfTsws+rZ7QdAAO671RrcDeLMDDav7v3Aun+kbfYNucpllQdSNpc5Oy
++fwC00fmcc4QAu4njIT/rEUNE1yDMuAlpYYsfPQS
+-----END CERTIFICATE-----
+
+Firmaprofesional Root CA
+========================
+-----BEGIN CERTIFICATE-----
+MIIEVzCCAz+gAwIBAgIBATANBgkqhkiG9w0BAQUFADCBnTELMAkGA1UEBhMCRVMxIjAgBgNVBAcT
+GUMvIE11bnRhbmVyIDI0NCBCYXJjZWxvbmExQjBABgNVBAMTOUF1dG9yaWRhZCBkZSBDZXJ0aWZp
+Y2FjaW9uIEZpcm1hcHJvZmVzaW9uYWwgQ0lGIEE2MjYzNDA2ODEmMCQGCSqGSIb3DQEJARYXY2FA
+ZmlybWFwcm9mZXNpb25hbC5jb20wHhcNMDExMDI0MjIwMDAwWhcNMTMxMDI0MjIwMDAwWjCBnTEL
+MAkGA1UEBhMCRVMxIjAgBgNVBAcTGUMvIE11bnRhbmVyIDI0NCBCYXJjZWxvbmExQjBABgNVBAMT
+OUF1dG9yaWRhZCBkZSBDZXJ0aWZpY2FjaW9uIEZpcm1hcHJvZmVzaW9uYWwgQ0lGIEE2MjYzNDA2
+ODEmMCQGCSqGSIb3DQEJARYXY2FAZmlybWFwcm9mZXNpb25hbC5jb20wggEiMA0GCSqGSIb3DQEB
+AQUAA4IBDwAwggEKAoIBAQDnIwNvbyOlXnjOlSztlB5uCp4Bx+ow0Syd3Tfom5h5VtP8c9/Qit5V
+j1H5WuretXDE7aTt/6MNbg9kUDGvASdYrv5sp0ovFy3Tc9UTHI9ZpTQsHVQERc1ouKDAA6XPhUJH
+lShbz++AbOCQl4oBPB3zhxAwJkh91/zpnZFx/0GaqUC1N5wpIE8fUuOgfRNtVLcK3ulqTgesrBlf
+3H5idPayBQC6haD9HThuy1q7hryUZzM1gywfI834yJFxzJeL764P3CkDG8A563DtwW4O2GcLiam8
+NeTvtjS0pbbELaW+0MOUJEjb35bTALVmGotmBQ/dPz/LP6pemkr4tErvlTcbAgMBAAGjgZ8wgZww
+KgYDVR0RBCMwIYYfaHR0cDovL3d3dy5maXJtYXByb2Zlc2lvbmFsLmNvbTASBgNVHRMBAf8ECDAG
+AQH/AgEBMCsGA1UdEAQkMCKADzIwMDExMDI0MjIwMDAwWoEPMjAxMzEwMjQyMjAwMDBaMA4GA1Ud
+DwEB/wQEAwIBBjAdBgNVHQ4EFgQUMwugZtHq2s7eYpMEKFK1FH84aLcwDQYJKoZIhvcNAQEFBQAD
+ggEBAEdz/o0nVPD11HecJ3lXV7cVVuzH2Fi3AQL0M+2TUIiefEaxvT8Ub/GzR0iLjJcG1+p+o1wq
+u00vR+L4OQbJnC4xGgN49Lw4xiKLMzHwFgQEffl25EvXwOaD7FnMP97/T2u3Z36mhoEyIwOdyPdf
+wUpgpZKpsaSgYMN4h7Mi8yrrW6ntBas3D7Hi05V2Y1Z0jFhyGzflZKG+TQyTmAyX9odtsz/ny4Cm
+7YjHX1BiAuiZdBbQ5rQ58SfLyEDW44YQqSMSkuBpQWOnryULwMWSyx6Yo1q6xTMPoJcB3X/ge9YG
+VM+h4k0460tQtcsm9MracEpqoeJ5quGnM/b9Sh/22WA=
+-----END CERTIFICATE-----
+
+Wells Fargo Root CA
+===================
+-----BEGIN CERTIFICATE-----
+MIID5TCCAs2gAwIBAgIEOeSXnjANBgkqhkiG9w0BAQUFADCBgjELMAkGA1UEBhMCVVMxFDASBgNV
+BAoTC1dlbGxzIEZhcmdvMSwwKgYDVQQLEyNXZWxscyBGYXJnbyBDZXJ0aWZpY2F0aW9uIEF1dGhv
+cml0eTEvMC0GA1UEAxMmV2VsbHMgRmFyZ28gUm9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkwHhcN
+MDAxMDExMTY0MTI4WhcNMjEwMTE0MTY0MTI4WjCBgjELMAkGA1UEBhMCVVMxFDASBgNVBAoTC1dl
+bGxzIEZhcmdvMSwwKgYDVQQLEyNXZWxscyBGYXJnbyBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTEv
+MC0GA1UEAxMmV2VsbHMgRmFyZ28gUm9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkwggEiMA0GCSqG
+SIb3DQEBAQUAA4IBDwAwggEKAoIBAQDVqDM7Jvk0/82bfuUER84A4n135zHCLielTWi5MbqNQ1mX
+x3Oqfz1cQJ4F5aHiidlMuD+b+Qy0yGIZLEWukR5zcUHESxP9cMIlrCL1dQu3U+SlK93OvRw6esP3
+E48mVJwWa2uv+9iWsWCaSOAlIiR5NM4OJgALTqv9i86C1y8IcGjBqAr5dE8Hq6T54oN+J3N0Prj5
+OEL8pahbSCOz6+MlsoCultQKnMJ4msZoGK43YjdeUXWoWGPAUe5AeH6orxqg4bB4nVCMe+ez/I4j
+sNtlAHCEAQgAFG5Uhpq6zPk3EPbg3oQtnaSFN9OH4xXQwReQfhkhahKpdv0SAulPIV4XAgMBAAGj
+YTBfMA8GA1UdEwEB/wQFMAMBAf8wTAYDVR0gBEUwQzBBBgtghkgBhvt7hwcBCzAyMDAGCCsGAQUF
+BwIBFiRodHRwOi8vd3d3LndlbGxzZmFyZ28uY29tL2NlcnRwb2xpY3kwDQYJKoZIhvcNAQEFBQAD
+ggEBANIn3ZwKdyu7IvICtUpKkfnRLb7kuxpo7w6kAOnu5+/u9vnldKTC2FJYxHT7zmu1Oyl5GFrv
+m+0fazbuSCUlFLZWohDo7qd/0D+j0MNdJu4HzMPBJCGHHt8qElNvQRbn7a6U+oxy+hNH8Dx+rn0R
+OhPs7fpvcmR7nX1/Jv16+yWt6j4pf0zjAFcysLPp7VMX2YuyFA4w6OXVE8Zkr8QA1dhYJPz1j+zx
+x32l2w8n0cbyQIjmH/ZhqPRCyLk306m+LFZ4wnKbWV01QIroTmMatukgalHizqSQ33ZwmVxwQ023
+tqcZZE6St8WRPH9IFmV7Fv3L/PvZ1dZPIWU7Sn9Ho/s=
+-----END CERTIFICATE-----
+
+Swisscom Root CA 1
+==================
+-----BEGIN CERTIFICATE-----
+MIIF2TCCA8GgAwIBAgIQXAuFXAvnWUHfV8w/f52oNjANBgkqhkiG9w0BAQUFADBkMQswCQYDVQQG
+EwJjaDERMA8GA1UEChMIU3dpc3Njb20xJTAjBgNVBAsTHERpZ2l0YWwgQ2VydGlmaWNhdGUgU2Vy
+dmljZXMxGzAZBgNVBAMTElN3aXNzY29tIFJvb3QgQ0EgMTAeFw0wNTA4MTgxMjA2MjBaFw0yNTA4
+MTgyMjA2MjBaMGQxCzAJBgNVBAYTAmNoMREwDwYDVQQKEwhTd2lzc2NvbTElMCMGA1UECxMcRGln
+aXRhbCBDZXJ0aWZpY2F0ZSBTZXJ2aWNlczEbMBkGA1UEAxMSU3dpc3Njb20gUm9vdCBDQSAxMIIC
+IjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA0LmwqAzZuz8h+BvVM5OAFmUgdbI9m2BtRsiM
+MW8Xw/qabFbtPMWRV8PNq5ZJkCoZSx6jbVfd8StiKHVFXqrWW/oLJdihFvkcxC7mlSpnzNApbjyF
+NDhhSbEAn9Y6cV9Nbc5fuankiX9qUvrKm/LcqfmdmUc/TilftKaNXXsLmREDA/7n29uj/x2lzZAe
+AR81sH8A25Bvxn570e56eqeqDFdvpG3FEzuwpdntMhy0XmeLVNxzh+XTF3xmUHJd1BpYwdnP2IkC
+b6dJtDZd0KTeByy2dbcokdaXvij1mB7qWybJvbCXc9qukSbraMH5ORXWZ0sKbU/Lz7DkQnGMU3nn
+7uHbHaBuHYwadzVcFh4rUx80i9Fs/PJnB3r1re3WmquhsUvhzDdf/X/NTa64H5xD+SpYVUNFvJbN
+cA78yeNmuk6NO4HLFWR7uZToXTNShXEuT46iBhFRyePLoW4xCGQMwtI89Tbo19AOeCMgkckkKmUp
+WyL3Ic6DXqTz3kvTaI9GdVyDCW4pa8RwjPWd1yAv/0bSKzjCL3UcPX7ape8eYIVpQtPM+GP+HkM5
+haa2Y0EQs3MevNP6yn0WR+Kn1dCjigoIlmJWbjTb2QK5MHXjBNLnj8KwEUAKrNVxAmKLMb7dxiNY
+MUJDLXT5xp6mig/p/r+D5kNXJLrvRjSq1xIBOO0CAwEAAaOBhjCBgzAOBgNVHQ8BAf8EBAMCAYYw
+HQYDVR0hBBYwFDASBgdghXQBUwABBgdghXQBUwABMBIGA1UdEwEB/wQIMAYBAf8CAQcwHwYDVR0j
+BBgwFoAUAyUv3m+CATpcLNwroWm1Z9SM0/0wHQYDVR0OBBYEFAMlL95vggE6XCzcK6FptWfUjNP9
+MA0GCSqGSIb3DQEBBQUAA4ICAQA1EMvspgQNDQ/NwNurqPKIlwzfky9NfEBWMXrrpA9gzXrzvsMn
+jgM+pN0S734edAY8PzHyHHuRMSG08NBsl9Tpl7IkVh5WwzW9iAUPWxAaZOHHgjD5Mq2eUCzneAXQ
+MbFamIp1TpBcahQq4FJHgmDmHtqBsfsUC1rxn9KVuj7QG9YVHaO+htXbD8BJZLsuUBlL0iT43R4H
+VtA4oJVwIHaM190e3p9xxCPvgxNcoyQVTSlAPGrEqdi3pkSlDfTgnXceQHAm/NrZNuR55LU/vJtl
+vrsRls/bxig5OgjOR1tTWsWZ/l2p3e9M1MalrQLmjAcSHm8D0W+go/MpvRLHUKKwf4ipmXeascCl
+OS5cfGniLLDqN2qk4Vrh9VDlg++luyqI54zb/W1elxmofmZ1a3Hqv7HHb6D0jqTsNFFbjCYDcKF3
+1QESVwA12yPeDooomf2xEG9L/zgtYE4snOtnta1J7ksfrK/7DZBaZmBwXarNeNQk7shBoJMBkpxq
+nvy5JMWzFYJ+vq6VK+uxwNrjAWALXmmshFZhvnEX/h0TD/7Gh0Xp/jKgGg0TpJRVcaUWi7rKibCy
+x/yP2FS1k2Kdzs9Z+z0YzirLNRWCXf9UIltxUvu3yf5gmwBBZPCqKuy2QkPOiWaByIufOVQDJdMW
+NY6E0F/6MBr1mmz0DlP5OlvRHA==
+-----END CERTIFICATE-----
+
+DigiCert Assured ID Root CA
+===========================
+-----BEGIN CERTIFICATE-----
+MIIDtzCCAp+gAwIBAgIQDOfg5RfYRv6P5WD8G/AwOTANBgkqhkiG9w0BAQUFADBlMQswCQYDVQQG
+EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSQw
+IgYDVQQDExtEaWdpQ2VydCBBc3N1cmVkIElEIFJvb3QgQ0EwHhcNMDYxMTEwMDAwMDAwWhcNMzEx
+MTEwMDAwMDAwWjBlMQswCQYDVQQGEwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQL
+ExB3d3cuZGlnaWNlcnQuY29tMSQwIgYDVQQDExtEaWdpQ2VydCBBc3N1cmVkIElEIFJvb3QgQ0Ew
+ggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCtDhXO5EOAXLGH87dg+XESpa7cJpSIqvTO
+9SA5KFhgDPiA2qkVlTJhPLWxKISKityfCgyDF3qPkKyK53lTXDGEKvYPmDI2dsze3Tyoou9q+yHy
+UmHfnyDXH+Kx2f4YZNISW1/5WBg1vEfNoTb5a3/UsDg+wRvDjDPZ2C8Y/igPs6eD1sNuRMBhNZYW
+/lmci3Zt1/GiSw0r/wty2p5g0I6QNcZ4VYcgoc/lbQrISXwxmDNsIumH0DJaoroTghHtORedmTpy
+oeb6pNnVFzF1roV9Iq4/AUaG9ih5yLHa5FcXxH4cDrC0kqZWs72yl+2qp/C3xag/lRbQ/6GW6whf
+GHdPAgMBAAGjYzBhMA4GA1UdDwEB/wQEAwIBhjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBRF
+66Kv9JLLgjEtUYunpyGd823IDzAfBgNVHSMEGDAWgBRF66Kv9JLLgjEtUYunpyGd823IDzANBgkq
+hkiG9w0BAQUFAAOCAQEAog683+Lt8ONyc3pklL/3cmbYMuRCdWKuh+vy1dneVrOfzM4UKLkNl2Bc
+EkxY5NM9g0lFWJc1aRqoR+pWxnmrEthngYTffwk8lOa4JiwgvT2zKIn3X/8i4peEH+ll74fg38Fn
+SbNd67IJKusm7Xi+fT8r87cmNW1fiQG2SVufAQWbqz0lwcy2f8Lxb4bG+mRo64EtlOtCt/qMHt1i
+8b5QZ7dsvfPxH2sMNgcWfzd8qVttevESRmCD1ycEvkvOl77DZypoEd+A5wwzZr8TDRRu838fYxAe
++o0bJW1sj6W3YQGx0qMmoRBxna3iw/nDmVG3KwcIzi7mULKn+gpFL6Lw8g==
+-----END CERTIFICATE-----
+
+DigiCert Global Root CA
+=======================
+-----BEGIN CERTIFICATE-----
+MIIDrzCCApegAwIBAgIQCDvgVpBCRrGhdWrJWZHHSjANBgkqhkiG9w0BAQUFADBhMQswCQYDVQQG
+EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSAw
+HgYDVQQDExdEaWdpQ2VydCBHbG9iYWwgUm9vdCBDQTAeFw0wNjExMTAwMDAwMDBaFw0zMTExMTAw
+MDAwMDBaMGExCzAJBgNVBAYTAlVTMRUwEwYDVQQKEwxEaWdpQ2VydCBJbmMxGTAXBgNVBAsTEHd3
+dy5kaWdpY2VydC5jb20xIDAeBgNVBAMTF0RpZ2lDZXJ0IEdsb2JhbCBSb290IENBMIIBIjANBgkq
+hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA4jvhEXLeqKTTo1eqUKKPC3eQyaKl7hLOllsBCSDMAZOn
+TjC3U/dDxGkAV53ijSLdhwZAAIEJzs4bg7/fzTtxRuLWZscFs3YnFo97nh6Vfe63SKMI2tavegw5
+BmV/Sl0fvBf4q77uKNd0f3p4mVmFaG5cIzJLv07A6Fpt43C/dxC//AH2hdmoRBBYMql1GNXRor5H
+4idq9Joz+EkIYIvUX7Q6hL+hqkpMfT7PT19sdl6gSzeRntwi5m3OFBqOasv+zbMUZBfHWymeMr/y
+7vrTC0LUq7dBMtoM1O/4gdW7jVg/tRvoSSiicNoxBN33shbyTApOB6jtSj1etX+jkMOvJwIDAQAB
+o2MwYTAOBgNVHQ8BAf8EBAMCAYYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUA95QNVbRTLtm
+8KPiGxvDl7I90VUwHwYDVR0jBBgwFoAUA95QNVbRTLtm8KPiGxvDl7I90VUwDQYJKoZIhvcNAQEF
+BQADggEBAMucN6pIExIK+t1EnE9SsPTfrgT1eXkIoyQY/EsrhMAtudXH/vTBH1jLuG2cenTnmCmr
+EbXjcKChzUyImZOMkXDiqw8cvpOp/2PV5Adg06O/nVsJ8dWO41P0jmP6P6fbtGbfYmbW0W5BjfIt
+tep3Sp+dWOIrWcBAI+0tKIJFPnlUkiaY4IBIqDfv8NZ5YBberOgOzW6sRBc4L0na4UU+Krk2U886
+UAb3LujEV0lsYSEY1QSteDwsOoBrp+uvFRTp2InBuThs4pFsiv9kuXclVzDAGySj4dzp30d8tbQk
+CAUw7C29C79Fv1C5qfPrmAESrciIxpg0X40KPMbp1ZWVbd4=
+-----END CERTIFICATE-----
+
+DigiCert High Assurance EV Root CA
+==================================
+-----BEGIN CERTIFICATE-----
+MIIDxTCCAq2gAwIBAgIQAqxcJmoLQJuPC3nyrkYldzANBgkqhkiG9w0BAQUFADBsMQswCQYDVQQG
+EwJVUzEVMBMGA1UEChMMRGlnaUNlcnQgSW5jMRkwFwYDVQQLExB3d3cuZGlnaWNlcnQuY29tMSsw
+KQYDVQQDEyJEaWdpQ2VydCBIaWdoIEFzc3VyYW5jZSBFViBSb290IENBMB4XDTA2MTExMDAwMDAw
+MFoXDTMxMTExMDAwMDAwMFowbDELMAkGA1UEBhMCVVMxFTATBgNVBAoTDERpZ2lDZXJ0IEluYzEZ
+MBcGA1UECxMQd3d3LmRpZ2ljZXJ0LmNvbTErMCkGA1UEAxMiRGlnaUNlcnQgSGlnaCBBc3N1cmFu
+Y2UgRVYgUm9vdCBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAMbM5XPm+9S75S0t
+Mqbf5YE/yc0lSbZxKsPVlDRnogocsF9ppkCxxLeyj9CYpKlBWTrT3JTWPNt0OKRKzE0lgvdKpVMS
+OO7zSW1xkX5jtqumX8OkhPhPYlG++MXs2ziS4wblCJEMxChBVfvLWokVfnHoNb9Ncgk9vjo4UFt3
+MRuNs8ckRZqnrG0AFFoEt7oT61EKmEFBIk5lYYeBQVCmeVyJ3hlKV9Uu5l0cUyx+mM0aBhakaHPQ
+NAQTXKFx01p8VdteZOE3hzBWBOURtCmAEvF5OYiiAhF8J2a3iLd48soKqDirCmTCv2ZdlYTBoSUe
+h10aUAsgEsxBu24LUTi4S8sCAwEAAaNjMGEwDgYDVR0PAQH/BAQDAgGGMA8GA1UdEwEB/wQFMAMB
+Af8wHQYDVR0OBBYEFLE+w2kD+L9HAdSYJhoIAu9jZCvDMB8GA1UdIwQYMBaAFLE+w2kD+L9HAdSY
+JhoIAu9jZCvDMA0GCSqGSIb3DQEBBQUAA4IBAQAcGgaX3NecnzyIZgYIVyHbIUf4KmeqvxgydkAQ
+V8GK83rZEWWONfqe/EW1ntlMMUu4kehDLI6zeM7b41N5cdblIZQB2lWHmiRk9opmzN6cN82oNLFp
+myPInngiK3BD41VHMWEZ71jFhS9OMPagMRYjyOfiZRYzy78aG6A9+MpeizGLYAiJLQwGXFK3xPkK
+mNEVX58Svnw2Yzi9RKR/5CYrCsSXaQ3pjOLAEFe4yHYSkVXySGnYvCoCWw9E1CAx2/S6cCZdkGCe
+vEsXCS+0yx5DaMkHJ8HSXPfqIbloEpw8nL+e/IBcm2PN7EeqJSdnoDfzAIJ9VNep+OkuE6N36B9K
+-----END CERTIFICATE-----
+
+Certplus Class 2 Primary CA
+===========================
+-----BEGIN CERTIFICATE-----
+MIIDkjCCAnqgAwIBAgIRAIW9S/PY2uNp9pTXX8OlRCMwDQYJKoZIhvcNAQEFBQAwPTELMAkGA1UE
+BhMCRlIxETAPBgNVBAoTCENlcnRwbHVzMRswGQYDVQQDExJDbGFzcyAyIFByaW1hcnkgQ0EwHhcN
+OTkwNzA3MTcwNTAwWhcNMTkwNzA2MjM1OTU5WjA9MQswCQYDVQQGEwJGUjERMA8GA1UEChMIQ2Vy
+dHBsdXMxGzAZBgNVBAMTEkNsYXNzIDIgUHJpbWFyeSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP
+ADCCAQoCggEBANxQltAS+DXSCHh6tlJw/W/uz7kRy1134ezpfgSN1sxvc0NXYKwzCkTsA18cgCSR
+5aiRVhKC9+Ar9NuuYS6JEI1rbLqzAr3VNsVINyPi8Fo3UjMXEuLRYE2+L0ER4/YXJQyLkcAbmXuZ
+Vg2v7tK8R1fjeUl7NIknJITesezpWE7+Tt9avkGtrAjFGA7v0lPubNCdEgETjdyAYveVqUSISnFO
+YFWe2yMZeVYHDD9jC1yw4r5+FfyUM1hBOHTE4Y+L3yasH7WLO7dDWWuwJKZtkIvEcupdM5i3y95e
+e++U8Rs+yskhwcWYAqqi9lt3m/V+llU0HGdpwPFC40es/CgcZlUCAwEAAaOBjDCBiTAPBgNVHRME
+CDAGAQH/AgEKMAsGA1UdDwQEAwIBBjAdBgNVHQ4EFgQU43Mt38sOKAze3bOkynm4jrvoMIkwEQYJ
+YIZIAYb4QgEBBAQDAgEGMDcGA1UdHwQwMC4wLKAqoCiGJmh0dHA6Ly93d3cuY2VydHBsdXMuY29t
+L0NSTC9jbGFzczIuY3JsMA0GCSqGSIb3DQEBBQUAA4IBAQCnVM+IRBnL39R/AN9WM2K191EBkOvD
+P9GIROkkXe/nFL0gt5o8AP5tn9uQ3Nf0YtaLcF3n5QRIqWh8yfFC82x/xXp8HVGIutIKPidd3i1R
+TtMTZGnkLuPT55sJmabglZvOGtd/vjzOUrMRFcEPF80Du5wlFbqidon8BvEY0JNLDnyCt6X09l/+
+7UCmnYR0ObncHoUW2ikbhiMAybuJfm6AiB4vFLQDJKgybwOaRywwvlbGp0ICcBvqQNi6BQNwB6SW
+//1IMwrh3KWBkJtN3X3n57LNXMhqlfil9o3EXXgIvnsG1knPGTZQIy4I5p4FTUcY1Rbpsda2ENW7
+l7+ijrRU
+-----END CERTIFICATE-----
+
+DST Root CA X3
+==============
+-----BEGIN CERTIFICATE-----
+MIIDSjCCAjKgAwIBAgIQRK+wgNajJ7qJMDmGLvhAazANBgkqhkiG9w0BAQUFADA/MSQwIgYDVQQK
+ExtEaWdpdGFsIFNpZ25hdHVyZSBUcnVzdCBDby4xFzAVBgNVBAMTDkRTVCBSb290IENBIFgzMB4X
+DTAwMDkzMDIxMTIxOVoXDTIxMDkzMDE0MDExNVowPzEkMCIGA1UEChMbRGlnaXRhbCBTaWduYXR1
+cmUgVHJ1c3QgQ28uMRcwFQYDVQQDEw5EU1QgUm9vdCBDQSBYMzCCASIwDQYJKoZIhvcNAQEBBQAD
+ggEPADCCAQoCggEBAN+v6ZdQCINXtMxiZfaQguzH0yxrMMpb7NnDfcdAwRgUi+DoM3ZJKuM/IUmT
+rE4Orz5Iy2Xu/NMhD2XSKtkyj4zl93ewEnu1lcCJo6m67XMuegwGMoOifooUMM0RoOEqOLl5CjH9
+UL2AZd+3UWODyOKIYepLYYHsUmu5ouJLGiifSKOeDNoJjj4XLh7dIN9bxiqKqy69cK3FCxolkHRy
+xXtqqzTWMIn/5WgTe1QLyNau7Fqckh49ZLOMxt+/yUFw7BZy1SbsOFU5Q9D8/RhcQPGX69Wam40d
+utolucbY38EVAjqr2m7xPi71XAicPNaDaeQQmxkqtilX4+U9m5/wAl0CAwEAAaNCMEAwDwYDVR0T
+AQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFMSnsaR7LHH62+FLkHX/xBVghYkQ
+MA0GCSqGSIb3DQEBBQUAA4IBAQCjGiybFwBcqR7uKGY3Or+Dxz9LwwmglSBd49lZRNI+DT69ikug
+dB/OEIKcdBodfpga3csTS7MgROSR6cz8faXbauX+5v3gTt23ADq1cEmv8uXrAvHRAosZy5Q6XkjE
+GB5YGV8eAlrwDPGxrancWYaLbumR9YbK+rlmM6pZW87ipxZzR8srzJmwN0jP41ZL9c8PDHIyh8bw
+RLtTcm1D9SZImlJnt1ir/md2cXjbDaJWFBM5JDGFoqgCWjBH4d1QB7wCCZAA62RjYJsWvIjJEubS
+fZGL+T0yjWW06XyxV3bqxbYoOb8VZRzI9neWagqNdwvYkQsEjgfbKbYK7p2CNTUQ
+-----END CERTIFICATE-----
+
+DST ACES CA X6
+==============
+-----BEGIN CERTIFICATE-----
+MIIECTCCAvGgAwIBAgIQDV6ZCtadt3js2AdWO4YV2TANBgkqhkiG9w0BAQUFADBbMQswCQYDVQQG
+EwJVUzEgMB4GA1UEChMXRGlnaXRhbCBTaWduYXR1cmUgVHJ1c3QxETAPBgNVBAsTCERTVCBBQ0VT
+MRcwFQYDVQQDEw5EU1QgQUNFUyBDQSBYNjAeFw0wMzExMjAyMTE5NThaFw0xNzExMjAyMTE5NTha
+MFsxCzAJBgNVBAYTAlVTMSAwHgYDVQQKExdEaWdpdGFsIFNpZ25hdHVyZSBUcnVzdDERMA8GA1UE
+CxMIRFNUIEFDRVMxFzAVBgNVBAMTDkRTVCBBQ0VTIENBIFg2MIIBIjANBgkqhkiG9w0BAQEFAAOC
+AQ8AMIIBCgKCAQEAuT31LMmU3HWKlV1j6IR3dma5WZFcRt2SPp/5DgO0PWGSvSMmtWPuktKe1jzI
+DZBfZIGxqAgNTNj50wUoUrQBJcWVHAx+PhCEdc/BGZFjz+iokYi5Q1K7gLFViYsx+tC3dr5BPTCa
+pCIlF3PoHuLTrCq9Wzgh1SpL11V94zpVvddtawJXa+ZHfAjIgrrep4c9oW24MFbCswKBXy314pow
+GCi4ZtPLAZZv6opFVdbgnf9nKxcCpk4aahELfrd755jWjHZvwTvbUJN+5dCOHze4vbrGn2zpfDPy
+MjwmR/onJALJfh1biEITajV8fTXpLmaRcpPVMibEdPVTo7NdmvYJywIDAQABo4HIMIHFMA8GA1Ud
+EwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgHGMB8GA1UdEQQYMBaBFHBraS1vcHNAdHJ1c3Rkc3Qu
+Y29tMGIGA1UdIARbMFkwVwYKYIZIAWUDAgEBATBJMEcGCCsGAQUFBwIBFjtodHRwOi8vd3d3LnRy
+dXN0ZHN0LmNvbS9jZXJ0aWZpY2F0ZXMvcG9saWN5L0FDRVMtaW5kZXguaHRtbDAdBgNVHQ4EFgQU
+CXIGThhDD+XWzMNqizF7eI+og7gwDQYJKoZIhvcNAQEFBQADggEBAKPYjtay284F5zLNAdMEA+V2
+5FYrnJmQ6AgwbN99Pe7lv7UkQIRJ4dEorsTCOlMwiPH1d25Ryvr/ma8kXxug/fKshMrfqfBfBC6t
+Fr8hlxCBPeP/h40y3JTlR4peahPJlJU90u7INJXQgNStMgiAVDzgvVJT11J8smk/f3rPanTK+gQq
+nExaBqXpIK1FZg9p8d2/6eMyi/rgwYZNcjwu2JN4Cir42NInPRmJX1p7ijvMDNpRrscL9yuwNwXs
+vFcj4jjSm2jzVhKIT0J8uDHEtdvkyCE06UgRNe76x5JXxZ805Mf29w4LTJxoeHtxMcfrHuBnQfO3
+oKfN5XozNmr6mis=
+-----END CERTIFICATE-----
+
+SwissSign Gold CA - G2
+======================
+-----BEGIN CERTIFICATE-----
+MIIFujCCA6KgAwIBAgIJALtAHEP1Xk+wMA0GCSqGSIb3DQEBBQUAMEUxCzAJBgNVBAYTAkNIMRUw
+EwYDVQQKEwxTd2lzc1NpZ24gQUcxHzAdBgNVBAMTFlN3aXNzU2lnbiBHb2xkIENBIC0gRzIwHhcN
+MDYxMDI1MDgzMDM1WhcNMzYxMDI1MDgzMDM1WjBFMQswCQYDVQQGEwJDSDEVMBMGA1UEChMMU3dp
+c3NTaWduIEFHMR8wHQYDVQQDExZTd2lzc1NpZ24gR29sZCBDQSAtIEcyMIICIjANBgkqhkiG9w0B
+AQEFAAOCAg8AMIICCgKCAgEAr+TufoskDhJuqVAtFkQ7kpJcyrhdhJJCEyq8ZVeCQD5XJM1QiyUq
+t2/876LQwB8CJEoTlo8jE+YoWACjR8cGp4QjK7u9lit/VcyLwVcfDmJlD909Vopz2q5+bbqBHH5C
+jCA12UNNhPqE21Is8w4ndwtrvxEvcnifLtg+5hg3Wipy+dpikJKVyh+c6bM8K8vzARO/Ws/BtQpg
+vd21mWRTuKCWs2/iJneRjOBiEAKfNA+k1ZIzUd6+jbqEemA8atufK+ze3gE/bk3lUIbLtK/tREDF
+ylqM2tIrfKjuvqblCqoOpd8FUrdVxyJdMmqXl2MT28nbeTZ7hTpKxVKJ+STnnXepgv9VHKVxaSvR
+AiTysybUa9oEVeXBCsdtMDeQKuSeFDNeFhdVxVu1yzSJkvGdJo+hB9TGsnhQ2wwMC3wLjEHXuend
+jIj3o02yMszYF9rNt85mndT9Xv+9lz4pded+p2JYryU0pUHHPbwNUMoDAw8IWh+Vc3hiv69yFGkO
+peUDDniOJihC8AcLYiAQZzlG+qkDzAQ4embvIIO1jEpWjpEA/I5cgt6IoMPiaG59je883WX0XaxR
+7ySArqpWl2/5rX3aYT+YdzylkbYcjCbaZaIJbcHiVOO5ykxMgI93e2CaHt+28kgeDrpOVG2Y4OGi
+GqJ3UM/EY5LsRxmd6+ZrzsECAwEAAaOBrDCBqTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUw
+AwEB/zAdBgNVHQ4EFgQUWyV7lqRlUX64OfPAeGZe6Drn8O4wHwYDVR0jBBgwFoAUWyV7lqRlUX64
+OfPAeGZe6Drn8O4wRgYDVR0gBD8wPTA7BglghXQBWQECAQEwLjAsBggrBgEFBQcCARYgaHR0cDov
+L3JlcG9zaXRvcnkuc3dpc3NzaWduLmNvbS8wDQYJKoZIhvcNAQEFBQADggIBACe645R88a7A3hfm
+5djV9VSwg/S7zV4Fe0+fdWavPOhWfvxyeDgD2StiGwC5+OlgzczOUYrHUDFu4Up+GC9pWbY9ZIEr
+44OE5iKHjn3g7gKZYbge9LgriBIWhMIxkziWMaa5O1M/wySTVltpkuzFwbs4AOPsF6m43Md8AYOf
+Mke6UiI0HTJ6CVanfCU2qT1L2sCCbwq7EsiHSycR+R4tx5M/nttfJmtS2S6K8RTGRI0Vqbe/vd6m
+Gu6uLftIdxf+u+yvGPUqUfA5hJeVbG4bwyvEdGB5JbAKJ9/fXtI5z0V9QkvfsywexcZdylU6oJxp
+mo/a77KwPJ+HbBIrZXAVUjEaJM9vMSNQH4xPjyPDdEFjHFWoFN0+4FFQz/EbMFYOkrCChdiDyyJk
+vC24JdVUorgG6q2SpCSgwYa1ShNqR88uC1aVVMvOmttqtKay20EIhid392qgQmwLOM7XdVAyksLf
+KzAiSNDVQTglXaTpXZ/GlHXQRf0wl0OPkKsKx4ZzYEppLd6leNcG2mqeSz53OiATIgHQv2ieY2Br
+NU0LbbqhPcCT4H8js1WtciVORvnSFu+wZMEBnunKoGqYDs/YYPIvSbjkQuE4NRb0yG5P94FW6Lqj
+viOvrv1vA+ACOzB2+httQc8Bsem4yWb02ybzOqR08kkkW8mw0FfB+j564ZfJ
+-----END CERTIFICATE-----
+
+SwissSign Silver CA - G2
+========================
+-----BEGIN CERTIFICATE-----
+MIIFvTCCA6WgAwIBAgIITxvUL1S7L0swDQYJKoZIhvcNAQEFBQAwRzELMAkGA1UEBhMCQ0gxFTAT
+BgNVBAoTDFN3aXNzU2lnbiBBRzEhMB8GA1UEAxMYU3dpc3NTaWduIFNpbHZlciBDQSAtIEcyMB4X
+DTA2MTAyNTA4MzI0NloXDTM2MTAyNTA4MzI0NlowRzELMAkGA1UEBhMCQ0gxFTATBgNVBAoTDFN3
+aXNzU2lnbiBBRzEhMB8GA1UEAxMYU3dpc3NTaWduIFNpbHZlciBDQSAtIEcyMIICIjANBgkqhkiG
+9w0BAQEFAAOCAg8AMIICCgKCAgEAxPGHf9N4Mfc4yfjDmUO8x/e8N+dOcbpLj6VzHVxumK4DV644
+N0MvFz0fyM5oEMF4rhkDKxD6LHmD9ui5aLlV8gREpzn5/ASLHvGiTSf5YXu6t+WiE7brYT7QbNHm
++/pe7R20nqA1W6GSy/BJkv6FCgU+5tkL4k+73JU3/JHpMjUi0R86TieFnbAVlDLaYQ1HTWBCrpJH
+6INaUFjpiou5XaHc3ZlKHzZnu0jkg7Y360g6rw9njxcH6ATK72oxh9TAtvmUcXtnZLi2kUpCe2Uu
+MGoM9ZDulebyzYLs2aFK7PayS+VFheZteJMELpyCbTapxDFkH4aDCyr0NQp4yVXPQbBH6TCfmb5h
+qAaEuSh6XzjZG6k4sIN/c8HDO0gqgg8hm7jMqDXDhBuDsz6+pJVpATqJAHgE2cn0mRmrVn5bi4Y5
+FZGkECwJMoBgs5PAKrYYC51+jUnyEEp/+dVGLxmSo5mnJqy7jDzmDrxHB9xzUfFwZC8I+bRHHTBs
+ROopN4WSaGa8gzj+ezku01DwH/teYLappvonQfGbGHLy9YR0SslnxFSuSGTfjNFusB3hB48IHpmc
+celM2KX3RxIfdNFRnobzwqIjQAtz20um53MGjMGg6cFZrEb65i/4z3GcRm25xBWNOHkDRUjvxF3X
+CO6HOSKGsg0PWEP3calILv3q1h8CAwEAAaOBrDCBqTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/
+BAUwAwEB/zAdBgNVHQ4EFgQUF6DNweRBtjpbO8tFnb0cwpj6hlgwHwYDVR0jBBgwFoAUF6DNweRB
+tjpbO8tFnb0cwpj6hlgwRgYDVR0gBD8wPTA7BglghXQBWQEDAQEwLjAsBggrBgEFBQcCARYgaHR0
+cDovL3JlcG9zaXRvcnkuc3dpc3NzaWduLmNvbS8wDQYJKoZIhvcNAQEFBQADggIBAHPGgeAn0i0P
+4JUw4ppBf1AsX19iYamGamkYDHRJ1l2E6kFSGG9YrVBWIGrGvShpWJHckRE1qTodvBqlYJ7YH39F
+kWnZfrt4csEGDyrOj4VwYaygzQu4OSlWhDJOhrs9xCrZ1x9y7v5RoSJBsXECYxqCsGKrXlcSH9/L
+3XWgwF15kIwb4FDm3jH+mHtwX6WQ2K34ArZv02DdQEsixT2tOnqfGhpHkXkzuoLcMmkDlm4fS/Bx
+/uNncqCxv1yL5PqZIseEuRuNI5c/7SXgz2W79WEE790eslpBIlqhn10s6FvJbakMDHiqYMZWjwFa
+DGi8aRl5xB9+lwW/xekkUV7U1UtT7dkjWjYDZaPBA61BMPNGG4WQr2W11bHkFlt4dR2Xem1ZqSqP
+e97Dh4kQmUlzeMg9vVE1dCrV8X5pGyq7O70luJpaPXJhkGaH7gzWTdQRdAtq/gsD/KNVV4n+Ssuu
+WxcFyPKNIzFTONItaj+CuY0IavdeQXRuwxF+B6wpYJE/OMpXEA29MC/HpeZBoNquBYeaoKRlbEwJ
+DIm6uNO5wJOKMPqN5ZprFQFOZ6raYlY+hAhm0sQ2fac+EPyI4NSA5QC9qvNOBqN6avlicuMJT+ub
+DgEj8Z+7fNzcbBGXJbLytGMU0gYqZ4yD9c7qB9iaah7s5Aq7KkzrCWA5zspi2C5u
+-----END CERTIFICATE-----
+
+GeoTrust Primary Certification Authority
+========================================
+-----BEGIN CERTIFICATE-----
+MIIDfDCCAmSgAwIBAgIQGKy1av1pthU6Y2yv2vrEoTANBgkqhkiG9w0BAQUFADBYMQswCQYDVQQG
+EwJVUzEWMBQGA1UEChMNR2VvVHJ1c3QgSW5jLjExMC8GA1UEAxMoR2VvVHJ1c3QgUHJpbWFyeSBD
+ZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTAeFw0wNjExMjcwMDAwMDBaFw0zNjA3MTYyMzU5NTlaMFgx
+CzAJBgNVBAYTAlVTMRYwFAYDVQQKEw1HZW9UcnVzdCBJbmMuMTEwLwYDVQQDEyhHZW9UcnVzdCBQ
+cmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIB
+CgKCAQEAvrgVe//UfH1nrYNke8hCUy3f9oQIIGHWAVlqnEQRr+92/ZV+zmEwu3qDXwK9AWbK7hWN
+b6EwnL2hhZ6UOvNWiAAxz9juapYC2e0DjPt1befquFUWBRaa9OBesYjAZIVcFU2Ix7e64HXprQU9
+nceJSOC7KMgD4TCTZF5SwFlwIjVXiIrxlQqD17wxcwE07e9GceBrAqg1cmuXm2bgyxx5X9gaBGge
+RwLmnWDiNpcB3841kt++Z8dtd1k7j53WkBWUvEI0EME5+bEnPn7WinXFsq+W06Lem+SYvn3h6YGt
+tm/81w7a4DSwDRp35+MImO9Y+pyEtzavwt+s0vQQBnBxNQIDAQABo0IwQDAPBgNVHRMBAf8EBTAD
+AQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQULNVQQZcVi/CPNmFbSvtr2ZnJM5IwDQYJKoZI
+hvcNAQEFBQADggEBAFpwfyzdtzRP9YZRqSa+S7iq8XEN3GHHoOo0Hnp3DwQ16CePbJC/kRYkRj5K
+Ts4rFtULUh38H2eiAkUxT87z+gOneZ1TatnaYzr4gNfTmeGl4b7UVXGYNTq+k+qurUKykG/g/CFN
+NWMziUnWm07Kx+dOCQD32sfvmWKZd7aVIl6KoKv0uHiYyjgZmclynnjNS6yvGaBzEi38wkG6gZHa
+Floxt/m0cYASSJlyc1pZU8FjUjPtp8nSOQJw+uCxQmYpqptR7TBUIhRf2asdweSU8Pj1K/fqynhG
+1riR/aYNKxoUAT6A8EKglQdebc3MS6RFjasS6LPeWuWgfOgPIh1a6Vk=
+-----END CERTIFICATE-----
+
+thawte Primary Root CA
+======================
+-----BEGIN CERTIFICATE-----
+MIIEIDCCAwigAwIBAgIQNE7VVyDV7exJ9C/ON9srbTANBgkqhkiG9w0BAQUFADCBqTELMAkGA1UE
+BhMCVVMxFTATBgNVBAoTDHRoYXd0ZSwgSW5jLjEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2
+aWNlcyBEaXZpc2lvbjE4MDYGA1UECxMvKGMpIDIwMDYgdGhhd3RlLCBJbmMuIC0gRm9yIGF1dGhv
+cml6ZWQgdXNlIG9ubHkxHzAdBgNVBAMTFnRoYXd0ZSBQcmltYXJ5IFJvb3QgQ0EwHhcNMDYxMTE3
+MDAwMDAwWhcNMzYwNzE2MjM1OTU5WjCBqTELMAkGA1UEBhMCVVMxFTATBgNVBAoTDHRoYXd0ZSwg
+SW5jLjEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2aWNlcyBEaXZpc2lvbjE4MDYGA1UECxMv
+KGMpIDIwMDYgdGhhd3RlLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNlIG9ubHkxHzAdBgNVBAMT
+FnRoYXd0ZSBQcmltYXJ5IFJvb3QgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCs
+oPD7gFnUnMekz52hWXMJEEUMDSxuaPFsW0hoSVk3/AszGcJ3f8wQLZU0HObrTQmnHNK4yZc2AreJ
+1CRfBsDMRJSUjQJib+ta3RGNKJpchJAQeg29dGYvajig4tVUROsdB58Hum/u6f1OCyn1PoSgAfGc
+q/gcfomk6KHYcWUNo1F77rzSImANuVud37r8UVsLr5iy6S7pBOhih94ryNdOwUxkHt3Ph1i6Sk/K
+aAcdHJ1KxtUvkcx8cXIcxcBn6zL9yZJclNqFwJu/U30rCfSMnZEfl2pSy94JNqR32HuHUETVPm4p
+afs5SSYeCaWAe0At6+gnhcn+Yf1+5nyXHdWdAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYD
+VR0PAQH/BAQDAgEGMB0GA1UdDgQWBBR7W0XPr87Lev0xkhpqtvNG61dIUDANBgkqhkiG9w0BAQUF
+AAOCAQEAeRHAS7ORtvzw6WfUDW5FvlXok9LOAz/t2iWwHVfLHjp2oEzsUHboZHIMpKnxuIvW1oeE
+uzLlQRHAd9mzYJ3rG9XRbkREqaYB7FViHXe4XI5ISXycO1cRrK1zN44veFyQaEfZYGDm/Ac9IiAX
+xPcW6cTYcvnIc3zfFi8VqT79aie2oetaupgf1eNNZAqdE8hhuvU5HIe6uL17In/2/qxAeeWsEG89
+jxt5dovEN7MhGITlNgDrYyCZuen+MwS7QcjBAvlEYyCegc5C09Y/LHbTY5xZ3Y+m4Q6gLkH3LpVH
+z7z9M/P2C2F+fpErgUfCJzDupxBdN49cOSvkBPB7jVaMaA==
+-----END CERTIFICATE-----
+
+VeriSign Class 3 Public Primary Certification Authority - G5
+============================================================
+-----BEGIN CERTIFICATE-----
+MIIE0zCCA7ugAwIBAgIQGNrRniZ96LtKIVjNzGs7SjANBgkqhkiG9w0BAQUFADCByjELMAkGA1UE
+BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO
+ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk
+IHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRp
+ZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwHhcNMDYxMTA4MDAwMDAwWhcNMzYwNzE2MjM1OTU5WjCB
+yjELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2ln
+biBUcnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNiBWZXJpU2lnbiwgSW5jLiAtIEZvciBh
+dXRob3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmlt
+YXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw
+ggEKAoIBAQCvJAgIKXo1nmAMqudLO07cfLw8RRy7K+D+KQL5VwijZIUVJ/XxrcgxiV0i6CqqpkKz
+j/i5Vbext0uz/o9+B1fs70PbZmIVYc9gDaTY3vjgw2IIPVQT60nKWVSFJuUrjxuf6/WhkcIzSdhD
+Y2pSS9KP6HBRTdGJaXvHcPaz3BJ023tdS1bTlr8Vd6Gw9KIl8q8ckmcY5fQGBO+QueQA5N06tRn/
+Arr0PO7gi+s3i+z016zy9vA9r911kTMZHRxAy3QkGSGT2RT+rCpSx4/VBEnkjWNHiDxpg8v+R70r
+fk/Fla4OndTRQ8Bnc+MUCH7lP59zuDMKz10/NIeWiu5T6CUVAgMBAAGjgbIwga8wDwYDVR0TAQH/
+BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2Uv
+Z2lmMCEwHzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVy
+aXNpZ24uY29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFH/TZafC3ey78DAJ80M5+gKvMzEzMA0GCSqG
+SIb3DQEBBQUAA4IBAQCTJEowX2LP2BqYLz3q3JktvXf2pXkiOOzEp6B4Eq1iDkVwZMXnl2YtmAl+
+X6/WzChl8gGqCBpH3vn5fJJaCGkgDdk+bW48DW7Y5gaRQBi5+MHt39tBquCWIMnNZBU4gcmU7qKE
+KQsTb47bDN0lAtukixlE0kF6BWlKWE9gyn6CagsCqiUXObXbf+eEZSqVir2G3l6BFoMtEMze/aiC
+Km0oHw0LxOXnGiYZ4fQRbxC1lfznQgUy286dUV4otp6F01vvpX1FQHKOtw5rDgb7MzVIcbidJ4vE
+ZV8NhnacRHr2lVz2XTIIM6RUthg/aFzyQkqFOFSDX9HoLPKsEdao7WNq
+-----END CERTIFICATE-----
+
+SecureTrust CA
+==============
+-----BEGIN CERTIFICATE-----
+MIIDuDCCAqCgAwIBAgIQDPCOXAgWpa1Cf/DrJxhZ0DANBgkqhkiG9w0BAQUFADBIMQswCQYDVQQG
+EwJVUzEgMB4GA1UEChMXU2VjdXJlVHJ1c3QgQ29ycG9yYXRpb24xFzAVBgNVBAMTDlNlY3VyZVRy
+dXN0IENBMB4XDTA2MTEwNzE5MzExOFoXDTI5MTIzMTE5NDA1NVowSDELMAkGA1UEBhMCVVMxIDAe
+BgNVBAoTF1NlY3VyZVRydXN0IENvcnBvcmF0aW9uMRcwFQYDVQQDEw5TZWN1cmVUcnVzdCBDQTCC
+ASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAKukgeWVzfX2FI7CT8rU4niVWJxB4Q2ZQCQX
+OZEzZum+4YOvYlyJ0fwkW2Gz4BERQRwdbvC4u/jep4G6pkjGnx29vo6pQT64lO0pGtSO0gMdA+9t
+DWccV9cGrcrI9f4Or2YlSASWC12juhbDCE/RRvgUXPLIXgGZbf2IzIaowW8xQmxSPmjL8xk037uH
+GFaAJsTQ3MBv396gwpEWoGQRS0S8Hvbn+mPeZqx2pHGj7DaUaHp3pLHnDi+BeuK1cobvomuL8A/b
+01k/unK8RCSc43Oz969XL0Imnal0ugBS8kvNU3xHCzaFDmapCJcWNFfBZveA4+1wVMeT4C4oFVmH
+ursCAwEAAaOBnTCBmjATBgkrBgEEAYI3FAIEBh4EAEMAQTALBgNVHQ8EBAMCAYYwDwYDVR0TAQH/
+BAUwAwEB/zAdBgNVHQ4EFgQUQjK2FvoE/f5dS3rD/fdMQB1aQ68wNAYDVR0fBC0wKzApoCegJYYj
+aHR0cDovL2NybC5zZWN1cmV0cnVzdC5jb20vU1RDQS5jcmwwEAYJKwYBBAGCNxUBBAMCAQAwDQYJ
+KoZIhvcNAQEFBQADggEBADDtT0rhWDpSclu1pqNlGKa7UTt36Z3q059c4EVlew3KW+JwULKUBRSu
+SceNQQcSc5R+DCMh/bwQf2AQWnL1mA6s7Ll/3XpvXdMc9P+IBWlCqQVxyLesJugutIxq/3HcuLHf
+mbx8IVQr5Fiiu1cprp6poxkmD5kuCLDv/WnPmRoJjeOnnyvJNjR7JLN4TJUXpAYmHrZkUjZfYGfZ
+nMUFdAvnZyPSCPyI6a6Lf+Ew9Dd+/cYy2i2eRDAwbO4H3tI0/NL/QPZL9GZGBlSm8jIKYyYwa5vR
+3ItHuuG51WLQoqD0ZwV4KWMabwTW+MZMo5qxN7SN5ShLHZ4swrhovO0C7jE=
+-----END CERTIFICATE-----
+
+Secure Global CA
+================
+-----BEGIN CERTIFICATE-----
+MIIDvDCCAqSgAwIBAgIQB1YipOjUiolN9BPI8PjqpTANBgkqhkiG9w0BAQUFADBKMQswCQYDVQQG
+EwJVUzEgMB4GA1UEChMXU2VjdXJlVHJ1c3QgQ29ycG9yYXRpb24xGTAXBgNVBAMTEFNlY3VyZSBH
+bG9iYWwgQ0EwHhcNMDYxMTA3MTk0MjI4WhcNMjkxMjMxMTk1MjA2WjBKMQswCQYDVQQGEwJVUzEg
+MB4GA1UEChMXU2VjdXJlVHJ1c3QgQ29ycG9yYXRpb24xGTAXBgNVBAMTEFNlY3VyZSBHbG9iYWwg
+Q0EwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCvNS7YrGxVaQZx5RNoJLNP2MwhR/jx
+YDiJiQPpvepeRlMJ3Fz1Wuj3RSoC6zFh1ykzTM7HfAo3fg+6MpjhHZevj8fcyTiW89sa/FHtaMbQ
+bqR8JNGuQsiWUGMu4P51/pinX0kuleM5M2SOHqRfkNJnPLLZ/kG5VacJjnIFHovdRIWCQtBJwB1g
+8NEXLJXr9qXBkqPFwqcIYA1gBBCWeZ4WNOaptvolRTnIHmX5k/Wq8VLcmZg9pYYaDDUz+kulBAYV
+HDGA76oYa8J719rO+TMg1fW9ajMtgQT7sFzUnKPiXB3jqUJ1XnvUd+85VLrJChgbEplJL4hL/VBi
+0XPnj3pDAgMBAAGjgZ0wgZowEwYJKwYBBAGCNxQCBAYeBABDAEEwCwYDVR0PBAQDAgGGMA8GA1Ud
+EwEB/wQFMAMBAf8wHQYDVR0OBBYEFK9EBMJBfkiD2045AuzshHrmzsmkMDQGA1UdHwQtMCswKaAn
+oCWGI2h0dHA6Ly9jcmwuc2VjdXJldHJ1c3QuY29tL1NHQ0EuY3JsMBAGCSsGAQQBgjcVAQQDAgEA
+MA0GCSqGSIb3DQEBBQUAA4IBAQBjGghAfaReUw132HquHw0LURYD7xh8yOOvaliTFGCRsoTciE6+
+OYo68+aCiV0BN7OrJKQVDpI1WkpEXk5X+nXOH0jOZvQ8QCaSmGwb7iRGDBezUqXbpZGRzzfTb+cn
+CDpOGR86p1hcF895P4vkp9MmI50mD1hp/Ed+stCNi5O/KU9DaXR2Z0vPB4zmAve14bRDtUstFJ/5
+3CYNv6ZHdAbYiNE6KTCEztI5gGIbqMdXSbxqVVFnFUq+NQfk1XWYN3kwFNspnWzFacxHVaIw98xc
+f8LDmBxrThaA63p4ZUWiABqvDA1VZDRIuJK58bRQKfJPIx/abKwfROHdI3hRW8cW
+-----END CERTIFICATE-----
+
+COMODO Certification Authority
+==============================
+-----BEGIN CERTIFICATE-----
+MIIEHTCCAwWgAwIBAgIQToEtioJl4AsC7j41AkblPTANBgkqhkiG9w0BAQUFADCBgTELMAkGA1UE
+BhMCR0IxGzAZBgNVBAgTEkdyZWF0ZXIgTWFuY2hlc3RlcjEQMA4GA1UEBxMHU2FsZm9yZDEaMBgG
+A1UEChMRQ09NT0RPIENBIExpbWl0ZWQxJzAlBgNVBAMTHkNPTU9ETyBDZXJ0aWZpY2F0aW9uIEF1
+dGhvcml0eTAeFw0wNjEyMDEwMDAwMDBaFw0yOTEyMzEyMzU5NTlaMIGBMQswCQYDVQQGEwJHQjEb
+MBkGA1UECBMSR3JlYXRlciBNYW5jaGVzdGVyMRAwDgYDVQQHEwdTYWxmb3JkMRowGAYDVQQKExFD
+T01PRE8gQ0EgTGltaXRlZDEnMCUGA1UEAxMeQ09NT0RPIENlcnRpZmljYXRpb24gQXV0aG9yaXR5
+MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA0ECLi3LjkRv3UcEbVASY06m/weaKXTuH
++7uIzg3jLz8GlvCiKVCZrts7oVewdFFxze1CkU1B/qnI2GqGd0S7WWaXUF601CxwRM/aN5VCaTww
+xHGzUvAhTaHYujl8HJ6jJJ3ygxaYqhZ8Q5sVW7euNJH+1GImGEaaP+vB+fGQV+useg2L23IwambV
+4EajcNxo2f8ESIl33rXp+2dtQem8Ob0y2WIC8bGoPW43nOIv4tOiJovGuFVDiOEjPqXSJDlqR6sA
+1KGzqSX+DT+nHbrTUcELpNqsOO9VUCQFZUaTNE8tja3G1CEZ0o7KBWFxB3NH5YoZEr0ETc5OnKVI
+rLsm9wIDAQABo4GOMIGLMB0GA1UdDgQWBBQLWOWLxkwVN6RAqTCpIb5HNlpW/zAOBgNVHQ8BAf8E
+BAMCAQYwDwYDVR0TAQH/BAUwAwEB/zBJBgNVHR8EQjBAMD6gPKA6hjhodHRwOi8vY3JsLmNvbW9k
+b2NhLmNvbS9DT01PRE9DZXJ0aWZpY2F0aW9uQXV0aG9yaXR5LmNybDANBgkqhkiG9w0BAQUFAAOC
+AQEAPpiem/Yb6dc5t3iuHXIYSdOH5EOC6z/JqvWote9VfCFSZfnVDeFs9D6Mk3ORLgLETgdxb8CP
+OGEIqB6BCsAvIC9Bi5HcSEW88cbeunZrM8gALTFGTO3nnc+IlP8zwFboJIYmuNg4ON8qa90SzMc/
+RxdMosIGlgnW2/4/PEZB31jiVg88O8EckzXZOFKs7sjsLjBOlDW0JB9LeGna8gI4zJVSk/BwJVmc
+IGfE7vmLV2H0knZ9P4SNVbfo5azV8fUZVqZa+5Acr5Pr5RzUZ5ddBA6+C4OmF4O5MBKgxTMVBbkN
++8cFduPYSo38NBejxiEovjBFMR7HeL5YYTisO+IBZQ==
+-----END CERTIFICATE-----
+
+Network Solutions Certificate Authority
+=======================================
+-----BEGIN CERTIFICATE-----
+MIID5jCCAs6gAwIBAgIQV8szb8JcFuZHFhfjkDFo4DANBgkqhkiG9w0BAQUFADBiMQswCQYDVQQG
+EwJVUzEhMB8GA1UEChMYTmV0d29yayBTb2x1dGlvbnMgTC5MLkMuMTAwLgYDVQQDEydOZXR3b3Jr
+IFNvbHV0aW9ucyBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkwHhcNMDYxMjAxMDAwMDAwWhcNMjkxMjMx
+MjM1OTU5WjBiMQswCQYDVQQGEwJVUzEhMB8GA1UEChMYTmV0d29yayBTb2x1dGlvbnMgTC5MLkMu
+MTAwLgYDVQQDEydOZXR3b3JrIFNvbHV0aW9ucyBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkwggEiMA0G
+CSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDkvH6SMG3G2I4rC7xGzuAnlt7e+foS0zwzc7MEL7xx
+jOWftiJgPl9dzgn/ggwbmlFQGiaJ3dVhXRncEg8tCqJDXRfQNJIg6nPPOCwGJgl6cvf6UDL4wpPT
+aaIjzkGxzOTVHzbRijr4jGPiFFlp7Q3Tf2vouAPlT2rlmGNpSAW+Lv8ztumXWWn4Zxmuk2GWRBXT
+crA/vGp97Eh/jcOrqnErU2lBUzS1sLnFBgrEsEX1QV1uiUV7PTsmjHTC5dLRfbIR1PtYMiKagMnc
+/Qzpf14Dl847ABSHJ3A4qY5usyd2mFHgBeMhqxrVhSI8KbWaFsWAqPS7azCPL0YCorEMIuDTAgMB
+AAGjgZcwgZQwHQYDVR0OBBYEFCEwyfsA106Y2oeqKtCnLrFAMadMMA4GA1UdDwEB/wQEAwIBBjAP
+BgNVHRMBAf8EBTADAQH/MFIGA1UdHwRLMEkwR6BFoEOGQWh0dHA6Ly9jcmwubmV0c29sc3NsLmNv
+bS9OZXR3b3JrU29sdXRpb25zQ2VydGlmaWNhdGVBdXRob3JpdHkuY3JsMA0GCSqGSIb3DQEBBQUA
+A4IBAQC7rkvnt1frf6ott3NHhWrB5KUd5Oc86fRZZXe1eltajSU24HqXLjjAV2CDmAaDn7l2em5Q
+4LqILPxFzBiwmZVRDuwduIj/h1AcgsLj4DKAv6ALR8jDMe+ZZzKATxcheQxpXN5eNK4CtSbqUN9/
+GGUsyfJj4akH/nxxH2szJGoeBfcFaMBqEssuXmHLrijTfsK0ZpEmXzwuJF/LWA/rKOyvEZbz3Htv
+wKeI8lN3s2Berq4o2jUsbzRF0ybh3uxbTydrFny9RAQYgrOJeRcQcT16ohZO9QHNpGxlaKFJdlxD
+ydi8NmdspZS11My5vWo1ViHe2MPr+8ukYEywVaCge1ey
+-----END CERTIFICATE-----
+
+WellsSecure Public Root Certificate Authority
+=============================================
+-----BEGIN CERTIFICATE-----
+MIIEvTCCA6WgAwIBAgIBATANBgkqhkiG9w0BAQUFADCBhTELMAkGA1UEBhMCVVMxIDAeBgNVBAoM
+F1dlbGxzIEZhcmdvIFdlbGxzU2VjdXJlMRwwGgYDVQQLDBNXZWxscyBGYXJnbyBCYW5rIE5BMTYw
+NAYDVQQDDC1XZWxsc1NlY3VyZSBQdWJsaWMgUm9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkwHhcN
+MDcxMjEzMTcwNzU0WhcNMjIxMjE0MDAwNzU0WjCBhTELMAkGA1UEBhMCVVMxIDAeBgNVBAoMF1dl
+bGxzIEZhcmdvIFdlbGxzU2VjdXJlMRwwGgYDVQQLDBNXZWxscyBGYXJnbyBCYW5rIE5BMTYwNAYD
+VQQDDC1XZWxsc1NlY3VyZSBQdWJsaWMgUm9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkwggEiMA0G
+CSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDub7S9eeKPCCGeOARBJe+rWxxTkqxtnt3CxC5FlAM1
+iGd0V+PfjLindo8796jE2yljDpFoNoqXjopxaAkH5OjUDk/41itMpBb570OYj7OeUt9tkTmPOL13
+i0Nj67eT/DBMHAGTthP796EfvyXhdDcsHqRePGj4S78NuR4uNuip5Kf4D8uCdXw1LSLWwr8L87T8
+bJVhHlfXBIEyg1J55oNjz7fLY4sR4r1e6/aN7ZVyKLSsEmLpSjPmgzKuBXWVvYSV2ypcm44uDLiB
+K0HmOFafSZtsdvqKXfcBeYF8wYNABf5x/Qw/zE5gCQ5lRxAvAcAFP4/4s0HvWkJ+We/SlwxlAgMB
+AAGjggE0MIIBMDAPBgNVHRMBAf8EBTADAQH/MDkGA1UdHwQyMDAwLqAsoCqGKGh0dHA6Ly9jcmwu
+cGtpLndlbGxzZmFyZ28uY29tL3dzcHJjYS5jcmwwDgYDVR0PAQH/BAQDAgHGMB0GA1UdDgQWBBQm
+lRkQ2eihl5H/3BnZtQQ+0nMKajCBsgYDVR0jBIGqMIGngBQmlRkQ2eihl5H/3BnZtQQ+0nMKaqGB
+i6SBiDCBhTELMAkGA1UEBhMCVVMxIDAeBgNVBAoMF1dlbGxzIEZhcmdvIFdlbGxzU2VjdXJlMRww
+GgYDVQQLDBNXZWxscyBGYXJnbyBCYW5rIE5BMTYwNAYDVQQDDC1XZWxsc1NlY3VyZSBQdWJsaWMg
+Um9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHmCAQEwDQYJKoZIhvcNAQEFBQADggEBALkVsUSRzCPI
+K0134/iaeycNzXK7mQDKfGYZUMbVmO2rvwNa5U3lHshPcZeG1eMd/ZDJPHV3V3p9+N701NX3leZ0
+bh08rnyd2wIDBSxxSyU+B+NemvVmFymIGjifz6pBA4SXa5M4esowRBskRDPQ5NHcKDj0E0M1NSlj
+qHyita04pO2t/caaH/+Xc/77szWnk4bGdpEA5qxRFsQnMlzbc9qlk1eOPm01JghZ1edE13YgY+es
+E2fDbbFwRnzVlhE9iW9dqKHrjQrawx0zbKPqZxmamX9LPYNRKh3KL4YMon4QLSvUFpULB6ouFJJJ
+tylv2G0xffX8oRAHh84vWdw+WNs=
+-----END CERTIFICATE-----
+
+COMODO ECC Certification Authority
+==================================
+-----BEGIN CERTIFICATE-----
+MIICiTCCAg+gAwIBAgIQH0evqmIAcFBUTAGem2OZKjAKBggqhkjOPQQDAzCBhTELMAkGA1UEBhMC
+R0IxGzAZBgNVBAgTEkdyZWF0ZXIgTWFuY2hlc3RlcjEQMA4GA1UEBxMHU2FsZm9yZDEaMBgGA1UE
+ChMRQ09NT0RPIENBIExpbWl0ZWQxKzApBgNVBAMTIkNPTU9ETyBFQ0MgQ2VydGlmaWNhdGlvbiBB
+dXRob3JpdHkwHhcNMDgwMzA2MDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCBhTELMAkGA1UEBhMCR0Ix
+GzAZBgNVBAgTEkdyZWF0ZXIgTWFuY2hlc3RlcjEQMA4GA1UEBxMHU2FsZm9yZDEaMBgGA1UEChMR
+Q09NT0RPIENBIExpbWl0ZWQxKzApBgNVBAMTIkNPTU9ETyBFQ0MgQ2VydGlmaWNhdGlvbiBBdXRo
+b3JpdHkwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAAQDR3svdcmCFYX7deSRFtSrYpn1PlILBs5BAH+X
+4QokPB0BBO490o0JlwzgdeT6+3eKKvUDYEs2ixYjFq0JcfRK9ChQtP6IHG4/bC8vCVlbpVsLM5ni
+wz2J+Wos77LTBumjQjBAMB0GA1UdDgQWBBR1cacZSBm8nZ3qQUfflMRId5nTeTAOBgNVHQ8BAf8E
+BAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAKBggqhkjOPQQDAwNoADBlAjEA7wNbeqy3eApyt4jf/7VG
+FAkK+qDmfQjGGoe9GKhzvSbKYAydzpmfz1wPMOG+FDHqAjAU9JM8SaczepBGR7NjfRObTrdvGDeA
+U/7dIOA1mjbRxwG55tzd8/8dLDoWV9mSOdY=
+-----END CERTIFICATE-----
+
+IGC/A
+=====
+-----BEGIN CERTIFICATE-----
+MIIEAjCCAuqgAwIBAgIFORFFEJQwDQYJKoZIhvcNAQEFBQAwgYUxCzAJBgNVBAYTAkZSMQ8wDQYD
+VQQIEwZGcmFuY2UxDjAMBgNVBAcTBVBhcmlzMRAwDgYDVQQKEwdQTS9TR0ROMQ4wDAYDVQQLEwVE
+Q1NTSTEOMAwGA1UEAxMFSUdDL0ExIzAhBgkqhkiG9w0BCQEWFGlnY2FAc2dkbi5wbS5nb3V2LmZy
+MB4XDTAyMTIxMzE0MjkyM1oXDTIwMTAxNzE0MjkyMlowgYUxCzAJBgNVBAYTAkZSMQ8wDQYDVQQI
+EwZGcmFuY2UxDjAMBgNVBAcTBVBhcmlzMRAwDgYDVQQKEwdQTS9TR0ROMQ4wDAYDVQQLEwVEQ1NT
+STEOMAwGA1UEAxMFSUdDL0ExIzAhBgkqhkiG9w0BCQEWFGlnY2FAc2dkbi5wbS5nb3V2LmZyMIIB
+IjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAsh/R0GLFMzvABIaIs9z4iPf930Pfeo2aSVz2
+TqrMHLmh6yeJ8kbpO0px1R2OLc/mratjUMdUC24SyZA2xtgv2pGqaMVy/hcKshd+ebUyiHDKcMCW
+So7kVc0dJ5S/znIq7Fz5cyD+vfcuiWe4u0dzEvfRNWk68gq5rv9GQkaiv6GFGvm/5P9JhfejcIYy
+HF2fYPepraX/z9E0+X1bF8bc1g4oa8Ld8fUzaJ1O/Id8NhLWo4DoQw1VYZTqZDdH6nfK0LJYBcNd
+frGoRpAxVs5wKpayMLh35nnAvSk7/ZR3TL0gzUEl4C7HG7vupARB0l2tEmqKm0f7yd1GQOGdPDPQ
+tQIDAQABo3cwdTAPBgNVHRMBAf8EBTADAQH/MAsGA1UdDwQEAwIBRjAVBgNVHSAEDjAMMAoGCCqB
+egF5AQEBMB0GA1UdDgQWBBSjBS8YYFDCiQrdKyFP/45OqDAxNjAfBgNVHSMEGDAWgBSjBS8YYFDC
+iQrdKyFP/45OqDAxNjANBgkqhkiG9w0BAQUFAAOCAQEABdwm2Pp3FURo/C9mOnTgXeQp/wYHE4RK
+q89toB9RlPhJy3Q2FLwV3duJL92PoF189RLrn544pEfMs5bZvpwlqwN+Mw+VgQ39FuCIvjfwbF3Q
+MZsyK10XZZOYYLxuj7GoPB7ZHPOpJkL5ZB3C55L29B5aqhlSXa/oovdgoPaN8In1buAKBQGVyYsg
+Crpa/JosPL3Dt8ldeCUFP1YUmwza+zpI/pdpXsoQhvdOlgQITeywvl3cO45Pwf2aNjSaTFR+FwNI
+lQgRHAdvhQh+XU3Endv7rs6y0bO4g2wdsrN58dhwmX7wEwLOXt1R0982gaEbeC9xs/FZTEYYKKuF
+0mBWWg==
+-----END CERTIFICATE-----
+
+Security Communication EV RootCA1
+=================================
+-----BEGIN CERTIFICATE-----
+MIIDfTCCAmWgAwIBAgIBADANBgkqhkiG9w0BAQUFADBgMQswCQYDVQQGEwJKUDElMCMGA1UEChMc
+U0VDT00gVHJ1c3QgU3lzdGVtcyBDTy4sTFRELjEqMCgGA1UECxMhU2VjdXJpdHkgQ29tbXVuaWNh
+dGlvbiBFViBSb290Q0ExMB4XDTA3MDYwNjAyMTIzMloXDTM3MDYwNjAyMTIzMlowYDELMAkGA1UE
+BhMCSlAxJTAjBgNVBAoTHFNFQ09NIFRydXN0IFN5c3RlbXMgQ08uLExURC4xKjAoBgNVBAsTIVNl
+Y3VyaXR5IENvbW11bmljYXRpb24gRVYgUm9vdENBMTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCC
+AQoCggEBALx/7FebJOD+nLpCeamIivqA4PUHKUPqjgo0No0c+qe1OXj/l3X3L+SqawSERMqm4miO
+/VVQYg+kcQ7OBzgtQoVQrTyWb4vVog7P3kmJPdZkLjjlHmy1V4qe70gOzXppFodEtZDkBp2uoQSX
+WHnvIEqCa4wiv+wfD+mEce3xDuS4GBPMVjZd0ZoeUWs5bmB2iDQL87PRsJ3KYeJkHcFGB7hj3R4z
+ZbOOCVVSPbW9/wfrrWFVGCypaZhKqkDFMxRldAD5kd6vA0jFQFTcD4SQaCDFkpbcLuUCRarAX1T4
+bepJz11sS6/vmsJWXMY1VkJqMF/Cq/biPT+zyRGPMUzXn0kCAwEAAaNCMEAwHQYDVR0OBBYEFDVK
+9U2vP9eCOKyrcWUXdYydVZPmMA4GA1UdDwEB/wQEAwIBBjAPBgNVHRMBAf8EBTADAQH/MA0GCSqG
+SIb3DQEBBQUAA4IBAQCoh+ns+EBnXcPBZsdAS5f8hxOQWsTvoMpfi7ent/HWtWS3irO4G8za+6xm
+iEHO6Pzk2x6Ipu0nUBsCMCRGef4Eh3CXQHPRwMFXGZpppSeZq51ihPZRwSzJIxXYKLerJRO1RuGG
+Av8mjMSIkh1W/hln8lXkgKNrnKt34VFxDSDbEJrbvXZ5B3eZKK2aXtqxT0QsNY6llsf9g/BYxnnW
+mHyojf6GPgcWkuF75x3sM3Z+Qi5KhfmRiWiEA4Glm5q+4zfFVKtWOxgtQaQM+ELbmaDgcm+7XeEW
+T1MKZPlO9L9OVL14bIjqv5wTJMJwaaJ/D8g8rQjJsJhAoyrniIPtd490
+-----END CERTIFICATE-----
+
+OISTE WISeKey Global Root GA CA
+===============================
+-----BEGIN CERTIFICATE-----
+MIID8TCCAtmgAwIBAgIQQT1yx/RrH4FDffHSKFTfmjANBgkqhkiG9w0BAQUFADCBijELMAkGA1UE
+BhMCQ0gxEDAOBgNVBAoTB1dJU2VLZXkxGzAZBgNVBAsTEkNvcHlyaWdodCAoYykgMjAwNTEiMCAG
+A1UECxMZT0lTVEUgRm91bmRhdGlvbiBFbmRvcnNlZDEoMCYGA1UEAxMfT0lTVEUgV0lTZUtleSBH
+bG9iYWwgUm9vdCBHQSBDQTAeFw0wNTEyMTExNjAzNDRaFw0zNzEyMTExNjA5NTFaMIGKMQswCQYD
+VQQGEwJDSDEQMA4GA1UEChMHV0lTZUtleTEbMBkGA1UECxMSQ29weXJpZ2h0IChjKSAyMDA1MSIw
+IAYDVQQLExlPSVNURSBGb3VuZGF0aW9uIEVuZG9yc2VkMSgwJgYDVQQDEx9PSVNURSBXSVNlS2V5
+IEdsb2JhbCBSb290IEdBIENBMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAy0+zAJs9
+Nt350UlqaxBJH+zYK7LG+DKBKUOVTJoZIyEVRd7jyBxRVVuuk+g3/ytr6dTqvirdqFEr12bDYVxg
+Asj1znJ7O7jyTmUIms2kahnBAbtzptf2w93NvKSLtZlhuAGio9RN1AU9ka34tAhxZK9w8RxrfvbD
+d50kc3vkDIzh2TbhmYsFmQvtRTEJysIA2/dyoJaqlYfQjse2YXMNdmaM3Bu0Y6Kff5MTMPGhJ9vZ
+/yxViJGg4E8HsChWjBgbl0SOid3gF27nKu+POQoxhILYQBRJLnpB5Kf+42TMwVlxSywhp1t94B3R
+LoGbw9ho972WG6xwsRYUC9tguSYBBQIDAQABo1EwTzALBgNVHQ8EBAMCAYYwDwYDVR0TAQH/BAUw
+AwEB/zAdBgNVHQ4EFgQUswN+rja8sHnR3JQmthG+IbJphpQwEAYJKwYBBAGCNxUBBAMCAQAwDQYJ
+KoZIhvcNAQEFBQADggEBAEuh/wuHbrP5wUOxSPMowB0uyQlB+pQAHKSkq0lPjz0e701vvbyk9vIm
+MMkQyh2I+3QZH4VFvbBsUfk2ftv1TDI6QU9bR8/oCy22xBmddMVHxjtqD6wU2zz0c5ypBd8A3HR4
++vg1YFkCExh8vPtNsCBtQ7tgMHpnM1zFmdH4LTlSc/uMqpclXHLZCB6rTjzjgTGfA6b7wP4piFXa
+hNVQA7bihKOmNqoROgHhGEvWRGizPflTdISzRpFGlgC3gCy24eMQ4tui5yiPAZZiFj4A4xylNoEY
+okxSdsARo27mHbrjWr42U8U+dY+GaSlYU7Wcu2+fXMUY7N0v4ZjJ/L7fCg0=
+-----END CERTIFICATE-----
+
+Microsec e-Szigno Root CA
+=========================
+-----BEGIN CERTIFICATE-----
+MIIHqDCCBpCgAwIBAgIRAMy4579OKRr9otxmpRwsDxEwDQYJKoZIhvcNAQEFBQAwcjELMAkGA1UE
+BhMCSFUxETAPBgNVBAcTCEJ1ZGFwZXN0MRYwFAYDVQQKEw1NaWNyb3NlYyBMdGQuMRQwEgYDVQQL
+EwtlLVN6aWdubyBDQTEiMCAGA1UEAxMZTWljcm9zZWMgZS1Temlnbm8gUm9vdCBDQTAeFw0wNTA0
+MDYxMjI4NDRaFw0xNzA0MDYxMjI4NDRaMHIxCzAJBgNVBAYTAkhVMREwDwYDVQQHEwhCdWRhcGVz
+dDEWMBQGA1UEChMNTWljcm9zZWMgTHRkLjEUMBIGA1UECxMLZS1Temlnbm8gQ0ExIjAgBgNVBAMT
+GU1pY3Jvc2VjIGUtU3ppZ25vIFJvb3QgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIB
+AQDtyADVgXvNOABHzNuEwSFpLHSQDCHZU4ftPkNEU6+r+ICbPHiN1I2uuO/TEdyB5s87lozWbxXG
+d36hL+BfkrYn13aaHUM86tnsL+4582pnS4uCzyL4ZVX+LMsvfUh6PXX5qqAnu3jCBspRwn5mS6/N
+oqdNAoI/gqyFxuEPkEeZlApxcpMqyabAvjxWTHOSJ/FrtfX9/DAFYJLG65Z+AZHCabEeHXtTRbjc
+QR/Ji3HWVBTji1R4P770Yjtb9aPs1ZJ04nQw7wHb4dSrmZsqa/i9phyGI0Jf7Enemotb9HI6QMVJ
+PqW+jqpx62z69Rrkav17fVVA71hu5tnVvCSrwe+3AgMBAAGjggQ3MIIEMzBnBggrBgEFBQcBAQRb
+MFkwKAYIKwYBBQUHMAGGHGh0dHBzOi8vcmNhLmUtc3ppZ25vLmh1L29jc3AwLQYIKwYBBQUHMAKG
+IWh0dHA6Ly93d3cuZS1zemlnbm8uaHUvUm9vdENBLmNydDAPBgNVHRMBAf8EBTADAQH/MIIBcwYD
+VR0gBIIBajCCAWYwggFiBgwrBgEEAYGoGAIBAQEwggFQMCgGCCsGAQUFBwIBFhxodHRwOi8vd3d3
+LmUtc3ppZ25vLmh1L1NaU1ovMIIBIgYIKwYBBQUHAgIwggEUHoIBEABBACAAdABhAG4A+gBzAO0A
+dAB2AOEAbgB5ACAA6QByAHQAZQBsAG0AZQB6AOkAcwDpAGgAZQB6ACAA6QBzACAAZQBsAGYAbwBn
+AGEAZADhAHMA4QBoAG8AegAgAGEAIABTAHoAbwBsAGcA4QBsAHQAYQB0APMAIABTAHoAbwBsAGcA
+4QBsAHQAYQB0AOEAcwBpACAAUwB6AGEAYgDhAGwAeQB6AGEAdABhACAAcwB6AGUAcgBpAG4AdAAg
+AGsAZQBsAGwAIABlAGwAagDhAHIAbgBpADoAIABoAHQAdABwADoALwAvAHcAdwB3AC4AZQAtAHMA
+egBpAGcAbgBvAC4AaAB1AC8AUwBaAFMAWgAvMIHIBgNVHR8EgcAwgb0wgbqggbeggbSGIWh0dHA6
+Ly93d3cuZS1zemlnbm8uaHUvUm9vdENBLmNybIaBjmxkYXA6Ly9sZGFwLmUtc3ppZ25vLmh1L0NO
+PU1pY3Jvc2VjJTIwZS1Temlnbm8lMjBSb290JTIwQ0EsT1U9ZS1Temlnbm8lMjBDQSxPPU1pY3Jv
+c2VjJTIwTHRkLixMPUJ1ZGFwZXN0LEM9SFU/Y2VydGlmaWNhdGVSZXZvY2F0aW9uTGlzdDtiaW5h
+cnkwDgYDVR0PAQH/BAQDAgEGMIGWBgNVHREEgY4wgYuBEGluZm9AZS1zemlnbm8uaHWkdzB1MSMw
+IQYDVQQDDBpNaWNyb3NlYyBlLVN6aWduw7MgUm9vdCBDQTEWMBQGA1UECwwNZS1TemlnbsOzIEhT
+WjEWMBQGA1UEChMNTWljcm9zZWMgS2Z0LjERMA8GA1UEBxMIQnVkYXBlc3QxCzAJBgNVBAYTAkhV
+MIGsBgNVHSMEgaQwgaGAFMegSXUWYYTbMUuE0vE3QJDvTtz3oXakdDByMQswCQYDVQQGEwJIVTER
+MA8GA1UEBxMIQnVkYXBlc3QxFjAUBgNVBAoTDU1pY3Jvc2VjIEx0ZC4xFDASBgNVBAsTC2UtU3pp
+Z25vIENBMSIwIAYDVQQDExlNaWNyb3NlYyBlLVN6aWdubyBSb290IENBghEAzLjnv04pGv2i3Gal
+HCwPETAdBgNVHQ4EFgQUx6BJdRZhhNsxS4TS8TdAkO9O3PcwDQYJKoZIhvcNAQEFBQADggEBANMT
+nGZjWS7KXHAM/IO8VbH0jgdsZifOwTsgqRy7RlRw7lrMoHfqaEQn6/Ip3Xep1fvj1KcExJW4C+FE
+aGAHQzAxQmHl7tnlJNUb3+FKG6qfx1/4ehHqE5MAyopYse7tDk2016g2JnzgOsHVV4Lxdbb9iV/a
+86g4nzUGCM4ilb7N1fy+W955a9x6qWVmvrElWl/tftOsRm1M9DKHtCAE4Gx4sHfRhUZLphK3dehK
+yVZs15KrnfVJONJPU+NVkBHbmJbGSfI+9J8b4PeI3CVimUTYc78/MPMMNz7UwiiAc7EBt51alhQB
+S6kRnSlqLtBdgcDPsiBDxwPgN05dCtxZICU=
+-----END CERTIFICATE-----
+
+Certigna
+========
+-----BEGIN CERTIFICATE-----
+MIIDqDCCApCgAwIBAgIJAP7c4wEPyUj/MA0GCSqGSIb3DQEBBQUAMDQxCzAJBgNVBAYTAkZSMRIw
+EAYDVQQKDAlEaGlteW90aXMxETAPBgNVBAMMCENlcnRpZ25hMB4XDTA3MDYyOTE1MTMwNVoXDTI3
+MDYyOTE1MTMwNVowNDELMAkGA1UEBhMCRlIxEjAQBgNVBAoMCURoaW15b3RpczERMA8GA1UEAwwI
+Q2VydGlnbmEwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDIaPHJ1tazNHUmgh7stL7q
+XOEm7RFHYeGifBZ4QCHkYJ5ayGPhxLGWkv8YbWkj4Sti993iNi+RB7lIzw7sebYs5zRLcAglozyH
+GxnygQcPOJAZ0xH+hrTy0V4eHpbNgGzOOzGTtvKg0KmVEn2lmsxryIRWijOp5yIVUxbwzBfsV1/p
+ogqYCd7jX5xv3EjjhQsVWqa6n6xI4wmy9/Qy3l40vhx4XUJbzg4ij02Q130yGLMLLGq/jj8UEYkg
+DncUtT2UCIf3JR7VsmAA7G8qKCVuKj4YYxclPz5EIBb2JsglrgVKtOdjLPOMFlN+XPsRGgjBRmKf
+Irjxwo1p3Po6WAbfAgMBAAGjgbwwgbkwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUGu3+QTmQ
+tCRZvgHyUtVF9lo53BEwZAYDVR0jBF0wW4AUGu3+QTmQtCRZvgHyUtVF9lo53BGhOKQ2MDQxCzAJ
+BgNVBAYTAkZSMRIwEAYDVQQKDAlEaGlteW90aXMxETAPBgNVBAMMCENlcnRpZ25hggkA/tzjAQ/J
+SP8wDgYDVR0PAQH/BAQDAgEGMBEGCWCGSAGG+EIBAQQEAwIABzANBgkqhkiG9w0BAQUFAAOCAQEA
+hQMeknH2Qq/ho2Ge6/PAD/Kl1NqV5ta+aDY9fm4fTIrv0Q8hbV6lUmPOEvjvKtpv6zf+EwLHyzs+
+ImvaYS5/1HI93TDhHkxAGYwP15zRgzB7mFncfca5DClMoTOi62c6ZYTTluLtdkVwj7Ur3vkj1klu
+PBS1xp81HlDQwY9qcEQCYsuuHWhBp6pX6FOqB9IG9tUUBguRA3UsbHK1YZWaDYu5Def131TN3ubY
+1gkIl2PlwS6wt0QmwCbAr1UwnjvVNioZBPRcHv/PLLf/0P2HQBHVESO7SMAhqaQoLf0V+LBOK/Qw
+WyH8EZE0vkHve52Xdf+XlcCWWC/qu0bXu+TZLg==
+-----END CERTIFICATE-----
+
+AC Ra\xC3\xADz Certic\xC3\xA1mara S.A.
+======================================
+-----BEGIN CERTIFICATE-----
+MIIGZjCCBE6gAwIBAgIPB35Sk3vgFeNX8GmMy+wMMA0GCSqGSIb3DQEBBQUAMHsxCzAJBgNVBAYT
+AkNPMUcwRQYDVQQKDD5Tb2NpZWRhZCBDYW1lcmFsIGRlIENlcnRpZmljYWNpw7NuIERpZ2l0YWwg
+LSBDZXJ0aWPDoW1hcmEgUy5BLjEjMCEGA1UEAwwaQUMgUmHDrXogQ2VydGljw6FtYXJhIFMuQS4w
+HhcNMDYxMTI3MjA0NjI5WhcNMzAwNDAyMjE0MjAyWjB7MQswCQYDVQQGEwJDTzFHMEUGA1UECgw+
+U29jaWVkYWQgQ2FtZXJhbCBkZSBDZXJ0aWZpY2FjacOzbiBEaWdpdGFsIC0gQ2VydGljw6FtYXJh
+IFMuQS4xIzAhBgNVBAMMGkFDIFJhw616IENlcnRpY8OhbWFyYSBTLkEuMIICIjANBgkqhkiG9w0B
+AQEFAAOCAg8AMIICCgKCAgEAq2uJo1PMSCMI+8PPUZYILrgIem08kBeGqentLhM0R7LQcNzJPNCN
+yu5LF6vQhbCnIwTLqKL85XXbQMpiiY9QngE9JlsYhBzLfDe3fezTf3MZsGqy2IiKLUV0qPezuMDU
+2s0iiXRNWhU5cxh0T7XrmafBHoi0wpOQY5fzp6cSsgkiBzPZkc0OnB8OIMfuuzONj8LSWKdf/WU3
+4ojC2I+GdV75LaeHM/J4Ny+LvB2GNzmxlPLYvEqcgxhaBvzz1NS6jBUJJfD5to0EfhcSM2tXSExP
+2yYe68yQ54v5aHxwD6Mq0Do43zeX4lvegGHTgNiRg0JaTASJaBE8rF9ogEHMYELODVoqDA+bMMCm
+8Ibbq0nXl21Ii/kDwFJnmxL3wvIumGVC2daa49AZMQyth9VXAnow6IYm+48jilSH5L887uvDdUhf
+HjlvgWJsxS3EF1QZtzeNnDeRyPYL1epjb4OsOMLzP96a++EjYfDIJss2yKHzMI+ko6Kh3VOz3vCa
+Mh+DkXkwwakfU5tTohVTP92dsxA7SH2JD/ztA/X7JWR1DhcZDY8AFmd5ekD8LVkH2ZD6mq093ICK
+5lw1omdMEWux+IBkAC1vImHFrEsm5VoQgpukg3s0956JkSCXjrdCx2bD0Omk1vUgjcTDlaxECp1b
+czwmPS9KvqfJpxAe+59QafMCAwEAAaOB5jCB4zAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQE
+AwIBBjAdBgNVHQ4EFgQU0QnQ6dfOeXRU+Tows/RtLAMDG2gwgaAGA1UdIASBmDCBlTCBkgYEVR0g
+ADCBiTArBggrBgEFBQcCARYfaHR0cDovL3d3dy5jZXJ0aWNhbWFyYS5jb20vZHBjLzBaBggrBgEF
+BQcCAjBOGkxMaW1pdGFjaW9uZXMgZGUgZ2FyYW507WFzIGRlIGVzdGUgY2VydGlmaWNhZG8gc2Ug
+cHVlZGVuIGVuY29udHJhciBlbiBsYSBEUEMuMA0GCSqGSIb3DQEBBQUAA4ICAQBclLW4RZFNjmEf
+AygPU3zmpFmps4p6xbD/CHwso3EcIRNnoZUSQDWDg4902zNc8El2CoFS3UnUmjIz75uny3XlesuX
+EpBcunvFm9+7OSPI/5jOCk0iAUgHforA1SBClETvv3eiiWdIG0ADBaGJ7M9i4z0ldma/Jre7Ir5v
+/zlXdLp6yQGVwZVR6Kss+LGGIOk/yzVb0hfpKv6DExdA7ohiZVvVO2Dpezy4ydV/NgIlqmjCMRW3
+MGXrfx1IebHPOeJCgBbT9ZMj/EyXyVo3bHwi2ErN0o42gzmRkBDI8ck1fj+404HGIGQatlDCIaR4
+3NAvO2STdPCWkPHv+wlaNECW8DYSwaN0jJN+Qd53i+yG2dIPPy3RzECiiWZIHiCznCNZc6lEc7wk
+eZBWN7PGKX6jD/EpOe9+XCgycDWs2rjIdWb8m0w5R44bb5tNAlQiM+9hup4phO9OSzNHdpdqy35f
+/RWmnkJDW2ZaiogN9xa5P1FlK2Zqi9E4UqLWRhH6/JocdJ6PlwsCT2TG9WjTSy3/pDceiz+/RL5h
+RqGEPQgnTIEgd4kI6mdAXmwIUV80WoyWaM3X94nCHNMyAK9Sy9NgWyo6R35rMDOhYil/SrnhLecU
+Iw4OGEfhefwVVdCx/CVxY3UzHCMrr1zZ7Ud3YA47Dx7SwNxkBYn8eNZcLCZDqQ==
+-----END CERTIFICATE-----
+
+TC TrustCenter Class 2 CA II
+============================
+-----BEGIN CERTIFICATE-----
+MIIEqjCCA5KgAwIBAgIOLmoAAQACH9dSISwRXDswDQYJKoZIhvcNAQEFBQAwdjELMAkGA1UEBhMC
+REUxHDAaBgNVBAoTE1RDIFRydXN0Q2VudGVyIEdtYkgxIjAgBgNVBAsTGVRDIFRydXN0Q2VudGVy
+IENsYXNzIDIgQ0ExJTAjBgNVBAMTHFRDIFRydXN0Q2VudGVyIENsYXNzIDIgQ0EgSUkwHhcNMDYw
+MTEyMTQzODQzWhcNMjUxMjMxMjI1OTU5WjB2MQswCQYDVQQGEwJERTEcMBoGA1UEChMTVEMgVHJ1
+c3RDZW50ZXIgR21iSDEiMCAGA1UECxMZVEMgVHJ1c3RDZW50ZXIgQ2xhc3MgMiBDQTElMCMGA1UE
+AxMcVEMgVHJ1c3RDZW50ZXIgQ2xhc3MgMiBDQSBJSTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCC
+AQoCggEBAKuAh5uO8MN8h9foJIIRszzdQ2Lu+MNF2ujhoF/RKrLqk2jftMjWQ+nEdVl//OEd+DFw
+IxuInie5e/060smp6RQvkL4DUsFJzfb95AhmC1eKokKguNV/aVyQMrKXDcpK3EY+AlWJU+MaWss2
+xgdW94zPEfRMuzBwBJWl9jmM/XOBCH2JXjIeIqkiRUuwZi4wzJ9l/fzLganx4Duvo4bRierERXlQ
+Xa7pIXSSTYtZgo+U4+lK8edJsBTj9WLL1XK9H7nSn6DNqPoByNkN39r8R52zyFTfSUrxIan+GE7u
+SNQZu+995OKdy1u2bv/jzVrndIIFuoAlOMvkaZ6vQaoahPUCAwEAAaOCATQwggEwMA8GA1UdEwEB
+/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBTjq1RMgKHbVkO3kUrL84J6E1wIqzCB
+7QYDVR0fBIHlMIHiMIHfoIHcoIHZhjVodHRwOi8vd3d3LnRydXN0Y2VudGVyLmRlL2NybC92Mi90
+Y19jbGFzc18yX2NhX0lJLmNybIaBn2xkYXA6Ly93d3cudHJ1c3RjZW50ZXIuZGUvQ049VEMlMjBU
+cnVzdENlbnRlciUyMENsYXNzJTIwMiUyMENBJTIwSUksTz1UQyUyMFRydXN0Q2VudGVyJTIwR21i
+SCxPVT1yb290Y2VydHMsREM9dHJ1c3RjZW50ZXIsREM9ZGU/Y2VydGlmaWNhdGVSZXZvY2F0aW9u
+TGlzdD9iYXNlPzANBgkqhkiG9w0BAQUFAAOCAQEAjNfffu4bgBCzg/XbEeprS6iSGNn3Bzn1LL4G
+dXpoUxUc6krtXvwjshOg0wn/9vYua0Fxec3ibf2uWWuFHbhOIprtZjluS5TmVfwLG4t3wVMTZonZ
+KNaL80VKY7f9ewthXbhtvsPcW3nS7Yblok2+XnR8au0WOB9/WIFaGusyiC2y8zl3gK9etmF1Kdsj
+TYjKUCjLhdLTEKJZbtOTVAB6okaVhgWcqRmY5TFyDADiZ9lA4CQze28suVyrZZ0srHbqNZn1l7kP
+JOzHdiEoZa5X6AeIdUpWoNIFOqTmjZKILPPy4cHGYdtBxceb9w4aUUXCYWvcZCcXjFq32nQozZfk
+vQ==
+-----END CERTIFICATE-----
+
+TC TrustCenter Class 3 CA II
+============================
+-----BEGIN CERTIFICATE-----
+MIIEqjCCA5KgAwIBAgIOSkcAAQAC5aBd1j8AUb8wDQYJKoZIhvcNAQEFBQAwdjELMAkGA1UEBhMC
+REUxHDAaBgNVBAoTE1RDIFRydXN0Q2VudGVyIEdtYkgxIjAgBgNVBAsTGVRDIFRydXN0Q2VudGVy
+IENsYXNzIDMgQ0ExJTAjBgNVBAMTHFRDIFRydXN0Q2VudGVyIENsYXNzIDMgQ0EgSUkwHhcNMDYw
+MTEyMTQ0MTU3WhcNMjUxMjMxMjI1OTU5WjB2MQswCQYDVQQGEwJERTEcMBoGA1UEChMTVEMgVHJ1
+c3RDZW50ZXIgR21iSDEiMCAGA1UECxMZVEMgVHJ1c3RDZW50ZXIgQ2xhc3MgMyBDQTElMCMGA1UE
+AxMcVEMgVHJ1c3RDZW50ZXIgQ2xhc3MgMyBDQSBJSTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCC
+AQoCggEBALTgu1G7OVyLBMVMeRwjhjEQY0NVJz/GRcekPewJDRoeIMJWHt4bNwcwIi9v8Qbxq63W
+yKthoy9DxLCyLfzDlml7forkzMA5EpBCYMnMNWju2l+QVl/NHE1bWEnrDgFPZPosPIlY2C8u4rBo
+6SI7dYnWRBpl8huXJh0obazovVkdKyT21oQDZogkAHhg8fir/gKya/si+zXmFtGt9i4S5Po1auUZ
+uV3bOx4a+9P/FRQI2AlqukWdFHlgfa9Aigdzs5OW03Q0jTo3Kd5c7PXuLjHCINy+8U9/I1LZW+Jk
+2ZyqBwi1Rb3R0DHBq1SfqdLDYmAD8bs5SpJKPQq5ncWg/jcCAwEAAaOCATQwggEwMA8GA1UdEwEB
+/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBTUovyfs8PYA9NXXAek0CSnwPIA1DCB
+7QYDVR0fBIHlMIHiMIHfoIHcoIHZhjVodHRwOi8vd3d3LnRydXN0Y2VudGVyLmRlL2NybC92Mi90
+Y19jbGFzc18zX2NhX0lJLmNybIaBn2xkYXA6Ly93d3cudHJ1c3RjZW50ZXIuZGUvQ049VEMlMjBU
+cnVzdENlbnRlciUyMENsYXNzJTIwMyUyMENBJTIwSUksTz1UQyUyMFRydXN0Q2VudGVyJTIwR21i
+SCxPVT1yb290Y2VydHMsREM9dHJ1c3RjZW50ZXIsREM9ZGU/Y2VydGlmaWNhdGVSZXZvY2F0aW9u
+TGlzdD9iYXNlPzANBgkqhkiG9w0BAQUFAAOCAQEANmDkcPcGIEPZIxpC8vijsrlNirTzwppVMXzE
+O2eatN9NDoqTSheLG43KieHPOh6sHfGcMrSOWXaiQYUlN6AT0PV8TtXqluJucsG7Kv5sbviRmEb8
+yRtXW+rIGjs/sFGYPAfaLFkB2otE6OF0/ado3VS6g0bsyEa1+K+XwDsJHI/OcpY9M1ZwvJbL2NV9
+IJqDnxrcOfHFcqMRA/07QlIp2+gB95tejNaNhk4Z+rwcvsUhpYeeeC422wlxo3I0+GzjBgnyXlal
+092Y+tTmBvTwtiBjS+opvaqCZh77gaqnN60TGOaSw4HBM7uIHqHn4rS9MWwOUT1v+5ZWgOI2F9Hc
+5A==
+-----END CERTIFICATE-----
+
+TC TrustCenter Universal CA I
+=============================
+-----BEGIN CERTIFICATE-----
+MIID3TCCAsWgAwIBAgIOHaIAAQAC7LdggHiNtgYwDQYJKoZIhvcNAQEFBQAweTELMAkGA1UEBhMC
+REUxHDAaBgNVBAoTE1RDIFRydXN0Q2VudGVyIEdtYkgxJDAiBgNVBAsTG1RDIFRydXN0Q2VudGVy
+IFVuaXZlcnNhbCBDQTEmMCQGA1UEAxMdVEMgVHJ1c3RDZW50ZXIgVW5pdmVyc2FsIENBIEkwHhcN
+MDYwMzIyMTU1NDI4WhcNMjUxMjMxMjI1OTU5WjB5MQswCQYDVQQGEwJERTEcMBoGA1UEChMTVEMg
+VHJ1c3RDZW50ZXIgR21iSDEkMCIGA1UECxMbVEMgVHJ1c3RDZW50ZXIgVW5pdmVyc2FsIENBMSYw
+JAYDVQQDEx1UQyBUcnVzdENlbnRlciBVbml2ZXJzYWwgQ0EgSTCCASIwDQYJKoZIhvcNAQEBBQAD
+ggEPADCCAQoCggEBAKR3I5ZEr5D0MacQ9CaHnPM42Q9e3s9B6DGtxnSRJJZ4Hgmgm5qVSkr1YnwC
+qMqs+1oEdjneX/H5s7/zA1hV0qq34wQi0fiU2iIIAI3TfCZdzHd55yx4Oagmcw6iXSVphU9VDprv
+xrlE4Vc93x9UIuVvZaozhDrzznq+VZeujRIPFDPiUHDDSYcTvFHe15gSWu86gzOSBnWLknwSaHtw
+ag+1m7Z3W0hZneTvWq3zwZ7U10VOylY0Ibw+F1tvdwxIAUMpsN0/lm7mlaoMwCC2/T42J5zjXM9O
+gdwZu5GQfezmlwQek8wiSdeXhrYTCjxDI3d+8NzmzSQfO4ObNDqDNOMCAwEAAaNjMGEwHwYDVR0j
+BBgwFoAUkqR1LKSevoFE63n8isWVpesQdXMwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC
+AYYwHQYDVR0OBBYEFJKkdSyknr6BROt5/IrFlaXrEHVzMA0GCSqGSIb3DQEBBQUAA4IBAQAo0uCG
+1eb4e/CX3CJrO5UUVg8RMKWaTzqwOuAGy2X17caXJ/4l8lfmXpWMPmRgFVp/Lw0BxbFg/UU1z/Cy
+vwbZ71q+s2IhtNerNXxTPqYn8aEt2hojnczd7Dwtnic0XQ/CNnm8yUpiLe1r2X1BQ3y2qsrtYbE3
+ghUJGooWMNjsydZHcnhLEEYUjl8Or+zHL6sQ17bxbuyGssLoDZJz3KL0Dzq/YSMQiZxIQG5wALPT
+ujdEWBF6AmqI8Dc08BnprNRlc/ZpjGSUOnmFKbAWKwyCPwacx/0QK54PLLae4xW/2TYcuiUaUj0a
+7CIMHOCkoj3w6DnPgcB77V0fb8XQC9eY
+-----END CERTIFICATE-----
+
+Deutsche Telekom Root CA 2
+==========================
+-----BEGIN CERTIFICATE-----
+MIIDnzCCAoegAwIBAgIBJjANBgkqhkiG9w0BAQUFADBxMQswCQYDVQQGEwJERTEcMBoGA1UEChMT
+RGV1dHNjaGUgVGVsZWtvbSBBRzEfMB0GA1UECxMWVC1UZWxlU2VjIFRydXN0IENlbnRlcjEjMCEG
+A1UEAxMaRGV1dHNjaGUgVGVsZWtvbSBSb290IENBIDIwHhcNOTkwNzA5MTIxMTAwWhcNMTkwNzA5
+MjM1OTAwWjBxMQswCQYDVQQGEwJERTEcMBoGA1UEChMTRGV1dHNjaGUgVGVsZWtvbSBBRzEfMB0G
+A1UECxMWVC1UZWxlU2VjIFRydXN0IENlbnRlcjEjMCEGA1UEAxMaRGV1dHNjaGUgVGVsZWtvbSBS
+b290IENBIDIwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCrC6M14IspFLEUha88EOQ5
+bzVdSq7d6mGNlUn0b2SjGmBmpKlAIoTZ1KXleJMOaAGtuU1cOs7TuKhCQN/Po7qCWWqSG6wcmtoI
+KyUn+WkjR/Hg6yx6m/UTAtB+NHzCnjwAWav12gz1MjwrrFDa1sPeg5TKqAyZMg4ISFZbavva4VhY
+AUlfckE8FQYBjl2tqriTtM2e66foai1SNNs671x1Udrb8zH57nGYMsRUFUQM+ZtV7a3fGAigo4aK
+Se5TBY8ZTNXeWHmb0mocQqvF1afPaA+W5OFhmHZhyJF81j4A4pFQh+GdCuatl9Idxjp9y7zaAzTV
+jlsB9WoHtxa2bkp/AgMBAAGjQjBAMB0GA1UdDgQWBBQxw3kbuvVT1xfgiXotF2wKsyudMzAPBgNV
+HRMECDAGAQH/AgEFMA4GA1UdDwEB/wQEAwIBBjANBgkqhkiG9w0BAQUFAAOCAQEAlGRZrTlk5ynr
+E/5aw4sTV8gEJPB0d8Bg42f76Ymmg7+Wgnxu1MM9756AbrsptJh6sTtU6zkXR34ajgv8HzFZMQSy
+zhfzLMdiNlXiItiJVbSYSKpk+tYcNthEeFpaIzpXl/V6ME+un2pMSyuOoAPjPuCp1NJ70rOo4nI8
+rZ7/gFnkm0W09juwzTkZmDLl6iFhkOQxIY40sfcvNUqFENrnijchvllj4PKFiDFT1FQUhXB59C4G
+dyd1Lx+4ivn+xbrYNuSD7Odlt79jWvNGr4GUN9RBjNYj1h7P9WgbRGOiWrqnNVmh5XAFmw4jV5mU
+Cm26OWMohpLzGITY+9HPBVZkVw==
+-----END CERTIFICATE-----
+
+ComSign Secured CA
+==================
+-----BEGIN CERTIFICATE-----
+MIIDqzCCApOgAwIBAgIRAMcoRwmzuGxFjB36JPU2TukwDQYJKoZIhvcNAQEFBQAwPDEbMBkGA1UE
+AxMSQ29tU2lnbiBTZWN1cmVkIENBMRAwDgYDVQQKEwdDb21TaWduMQswCQYDVQQGEwJJTDAeFw0w
+NDAzMjQxMTM3MjBaFw0yOTAzMTYxNTA0NTZaMDwxGzAZBgNVBAMTEkNvbVNpZ24gU2VjdXJlZCBD
+QTEQMA4GA1UEChMHQ29tU2lnbjELMAkGA1UEBhMCSUwwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw
+ggEKAoIBAQDGtWhfHZQVw6QIVS3joFd67+l0Kru5fFdJGhFeTymHDEjWaueP1H5XJLkGieQcPOqs
+49ohgHMhCu95mGwfCP+hUH3ymBvJVG8+pSjsIQQPRbsHPaHA+iqYHU4Gk/v1iDurX8sWv+bznkqH
+7Rnqwp9D5PGBpX8QTz7RSmKtUxvLg/8HZaWSLWapW7ha9B20IZFKF3ueMv5WJDmyVIRD9YTC2LxB
+kMyd1mja6YJQqTtoz7VdApRgFrFD2UNd3V2Hbuq7s8lr9gOUCXDeFhF6K+h2j0kQmHe5Y1yLM5d1
+9guMsqtb3nQgJT/j8xH5h2iGNXHDHYwt6+UarA9z1YJZQIDTAgMBAAGjgacwgaQwDAYDVR0TBAUw
+AwEB/zBEBgNVHR8EPTA7MDmgN6A1hjNodHRwOi8vZmVkaXIuY29tc2lnbi5jby5pbC9jcmwvQ29t
+U2lnblNlY3VyZWRDQS5jcmwwDgYDVR0PAQH/BAQDAgGGMB8GA1UdIwQYMBaAFMFL7XC29z58ADsA
+j8c+DkWfHl3sMB0GA1UdDgQWBBTBS+1wtvc+fAA7AI/HPg5Fnx5d7DANBgkqhkiG9w0BAQUFAAOC
+AQEAFs/ukhNQq3sUnjO2QiBq1BW9Cav8cujvR3qQrFHBZE7piL1DRYHjZiM/EoZNGeQFsOY3wo3a
+BijJD4mkU6l1P7CW+6tMM1X5eCZGbxs2mPtCdsGCuY7e+0X5YxtiOzkGynd6qDwJz2w2PQ8KRUtp
+FhpFfTMDZflScZAmlaxMDPWLkz/MdXSFmLr/YnpNH4n+rr2UAJm/EaXc4HnFFgt9AmEd6oX5AhVP
+51qJThRv4zdLhfXBPGHg/QVBspJ/wx2g0K5SZGBrGMYmnNj1ZOQ2GmKfig8+/21OGVZOIJFsnzQz
+OjRXUDpvgV4GxvU+fE6OK85lBi5d0ipTdF7Tbieejw==
+-----END CERTIFICATE-----
+
+Cybertrust Global Root
+======================
+-----BEGIN CERTIFICATE-----
+MIIDoTCCAomgAwIBAgILBAAAAAABD4WqLUgwDQYJKoZIhvcNAQEFBQAwOzEYMBYGA1UEChMPQ3li
+ZXJ0cnVzdCwgSW5jMR8wHQYDVQQDExZDeWJlcnRydXN0IEdsb2JhbCBSb290MB4XDTA2MTIxNTA4
+MDAwMFoXDTIxMTIxNTA4MDAwMFowOzEYMBYGA1UEChMPQ3liZXJ0cnVzdCwgSW5jMR8wHQYDVQQD
+ExZDeWJlcnRydXN0IEdsb2JhbCBSb290MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA
++Mi8vRRQZhP/8NN57CPytxrHjoXxEnOmGaoQ25yiZXRadz5RfVb23CO21O1fWLE3TdVJDm71aofW
+0ozSJ8bi/zafmGWgE07GKmSb1ZASzxQG9Dvj1Ci+6A74q05IlG2OlTEQXO2iLb3VOm2yHLtgwEZL
+AfVJrn5GitB0jaEMAs7u/OePuGtm839EAL9mJRQr3RAwHQeWP032a7iPt3sMpTjr3kfb1V05/Iin
+89cqdPHoWqI7n1C6poxFNcJQZZXcY4Lv3b93TZxiyWNzFtApD0mpSPCzqrdsxacwOUBdrsTiXSZT
+8M4cIwhhqJQZugRiQOwfOHB3EgZxpzAYXSUnpQIDAQABo4GlMIGiMA4GA1UdDwEB/wQEAwIBBjAP
+BgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBS2CHsNesysIEyGVjJez6tuhS1wVzA/BgNVHR8EODA2
+MDSgMqAwhi5odHRwOi8vd3d3Mi5wdWJsaWMtdHJ1c3QuY29tL2NybC9jdC9jdHJvb3QuY3JsMB8G
+A1UdIwQYMBaAFLYIew16zKwgTIZWMl7Pq26FLXBXMA0GCSqGSIb3DQEBBQUAA4IBAQBW7wojoFRO
+lZfJ+InaRcHUowAl9B8Tq7ejhVhpwjCt2BWKLePJzYFa+HMjWqd8BfP9IjsO0QbE2zZMcwSO5bAi
+5MXzLqXZI+O4Tkogp24CJJ8iYGd7ix1yCcUxXOl5n4BHPa2hCwcUPUf/A2kaDAtE52Mlp3+yybh2
+hO0j9n0Hq0V+09+zv+mKts2oomcrUtW3ZfA5TGOgkXmTUg9U3YO7n9GPp1Nzw8v/MOx8BLjYRB+T
+X3EJIrduPuocA06dGiBh+4E37F78CkWr1+cXVdCg6mCbpvbjjFspwgZgFJ0tl0ypkxWdYcQBX0jW
+WL1WMRJOEcgh4LMRkWXbtKaIOM5V
+-----END CERTIFICATE-----
+
+ePKI Root Certification Authority
+=================================
+-----BEGIN CERTIFICATE-----
+MIIFsDCCA5igAwIBAgIQFci9ZUdcr7iXAF7kBtK8nTANBgkqhkiG9w0BAQUFADBeMQswCQYDVQQG
+EwJUVzEjMCEGA1UECgwaQ2h1bmdod2EgVGVsZWNvbSBDby4sIEx0ZC4xKjAoBgNVBAsMIWVQS0kg
+Um9vdCBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eTAeFw0wNDEyMjAwMjMxMjdaFw0zNDEyMjAwMjMx
+MjdaMF4xCzAJBgNVBAYTAlRXMSMwIQYDVQQKDBpDaHVuZ2h3YSBUZWxlY29tIENvLiwgTHRkLjEq
+MCgGA1UECwwhZVBLSSBSb290IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIICIjANBgkqhkiG9w0B
+AQEFAAOCAg8AMIICCgKCAgEA4SUP7o3biDN1Z82tH306Tm2d0y8U82N0ywEhajfqhFAHSyZbCUNs
+IZ5qyNUD9WBpj8zwIuQf5/dqIjG3LBXy4P4AakP/h2XGtRrBp0xtInAhijHyl3SJCRImHJ7K2RKi
+lTza6We/CKBk49ZCt0Xvl/T29de1ShUCWH2YWEtgvM3XDZoTM1PRYfl61dd4s5oz9wCGzh1NlDiv
+qOx4UXCKXBCDUSH3ET00hl7lSM2XgYI1TBnsZfZrxQWh7kcT1rMhJ5QQCtkkO7q+RBNGMD+XPNjX
+12ruOzjjK9SXDrkb5wdJfzcq+Xd4z1TtW0ado4AOkUPB1ltfFLqfpo0kR0BZv3I4sjZsN/+Z0V0O
+WQqraffAsgRFelQArr5T9rXn4fg8ozHSqf4hUmTFpmfwdQcGlBSBVcYn5AGPF8Fqcde+S/uUWH1+
+ETOxQvdibBjWzwloPn9s9h6PYq2lY9sJpx8iQkEeb5mKPtf5P0B6ebClAZLSnT0IFaUQAS2zMnao
+lQ2zepr7BxB4EW/hj8e6DyUadCrlHJhBmd8hh+iVBmoKs2pHdmX2Os+PYhcZewoozRrSgx4hxyy/
+vv9haLdnG7t4TY3OZ+XkwY63I2binZB1NJipNiuKmpS5nezMirH4JYlcWrYvjB9teSSnUmjDhDXi
+Zo1jDiVN1Rmy5nk3pyKdVDECAwEAAaNqMGgwHQYDVR0OBBYEFB4M97Zn8uGSJglFwFU5Lnc/Qkqi
+MAwGA1UdEwQFMAMBAf8wOQYEZyoHAAQxMC8wLQIBADAJBgUrDgMCGgUAMAcGBWcqAwAABBRFsMLH
+ClZ87lt4DJX5GFPBphzYEDANBgkqhkiG9w0BAQUFAAOCAgEACbODU1kBPpVJufGBuvl2ICO1J2B0
+1GqZNF5sAFPZn/KmsSQHRGoqxqWOeBLoR9lYGxMqXnmbnwoqZ6YlPwZpVnPDimZI+ymBV3QGypzq
+KOg4ZyYr8dW1P2WT+DZdjo2NQCCHGervJ8A9tDkPJXtoUHRVnAxZfVo9QZQlUgjgRywVMRnVvwdV
+xrsStZf0X4OFunHB2WyBEXYKCrC/gpf36j36+uwtqSiUO1bd0lEursC9CBWMd1I0ltabrNMdjmEP
+NXubrjlpC2JgQCA2j6/7Nu4tCEoduL+bXPjqpRugc6bY+G7gMwRfaKonh+3ZwZCc7b3jajWvY9+r
+GNm65ulK6lCKD2GTHuItGeIwlDWSXQ62B68ZgI9HkFFLLk3dheLSClIKF5r8GrBQAuUBo2M3IUxE
+xJtRmREOc5wGj1QupyheRDmHVi03vYVElOEMSyycw5KFNGHLD7ibSkNS/jQ6fbjpKdx2qcgw+BRx
+gMYeNkh0IkFch4LoGHGLQYlE535YW6i4jRPpp2zDR+2zGp1iro2C6pSe3VkQw63d4k3jMdXH7Ojy
+sP6SHhYKGvzZ8/gntsm+HbRsZJB/9OTEW9c3rkIO3aQab3yIVMUWbuF6aC74Or8NpDyJO3inTmOD
+BCEIZ43ygknQW/2xzQ+DhNQ+IIX3Sj0rnP0qCglN6oH4EZw=
+-----END CERTIFICATE-----
+
+T\xc3\x9c\x42\xC4\xB0TAK UEKAE K\xC3\xB6k Sertifika Hizmet Sa\xC4\x9Flay\xc4\xb1\x63\xc4\xb1s\xc4\xb1 - S\xC3\xBCr\xC3\xBCm 3
+=============================================================================================================================
+-----BEGIN CERTIFICATE-----
+MIIFFzCCA/+gAwIBAgIBETANBgkqhkiG9w0BAQUFADCCASsxCzAJBgNVBAYTAlRSMRgwFgYDVQQH
+DA9HZWJ6ZSAtIEtvY2FlbGkxRzBFBgNVBAoMPlTDvHJraXllIEJpbGltc2VsIHZlIFRla25vbG9q
+aWsgQXJhxZ90xLFybWEgS3VydW11IC0gVMOcQsSwVEFLMUgwRgYDVQQLDD9VbHVzYWwgRWxla3Ry
+b25payB2ZSBLcmlwdG9sb2ppIEFyYcWfdMSxcm1hIEVuc3RpdMO8c8O8IC0gVUVLQUUxIzAhBgNV
+BAsMGkthbXUgU2VydGlmaWthc3lvbiBNZXJrZXppMUowSAYDVQQDDEFUw5xCxLBUQUsgVUVLQUUg
+S8O2ayBTZXJ0aWZpa2EgSGl6bWV0IFNhxJ9sYXnEsWPEsXPEsSAtIFPDvHLDvG0gMzAeFw0wNzA4
+MjQxMTM3MDdaFw0xNzA4MjExMTM3MDdaMIIBKzELMAkGA1UEBhMCVFIxGDAWBgNVBAcMD0dlYnpl
+IC0gS29jYWVsaTFHMEUGA1UECgw+VMO8cmtpeWUgQmlsaW1zZWwgdmUgVGVrbm9sb2ppayBBcmHF
+n3TEsXJtYSBLdXJ1bXUgLSBUw5xCxLBUQUsxSDBGBgNVBAsMP1VsdXNhbCBFbGVrdHJvbmlrIHZl
+IEtyaXB0b2xvamkgQXJhxZ90xLFybWEgRW5zdGl0w7xzw7wgLSBVRUtBRTEjMCEGA1UECwwaS2Ft
+dSBTZXJ0aWZpa2FzeW9uIE1lcmtlemkxSjBIBgNVBAMMQVTDnELEsFRBSyBVRUtBRSBLw7ZrIFNl
+cnRpZmlrYSBIaXptZXQgU2HEn2xhecSxY8Sxc8SxIC0gU8O8csO8bSAzMIIBIjANBgkqhkiG9w0B
+AQEFAAOCAQ8AMIIBCgKCAQEAim1L/xCIOsP2fpTo6iBkcK4hgb46ezzb8R1Sf1n68yJMlaCQvEhO
+Eav7t7WNeoMojCZG2E6VQIdhn8WebYGHV2yKO7Rm6sxA/OOqbLLLAdsyv9Lrhc+hDVXDWzhXcLh1
+xnnRFDDtG1hba+818qEhTsXOfJlfbLm4IpNQp81McGq+agV/E5wrHur+R84EpW+sky58K5+eeROR
+6Oqeyjh1jmKwlZMq5d/pXpduIF9fhHpEORlAHLpVK/swsoHvhOPc7Jg4OQOFCKlUAwUp8MmPi+oL
+hmUZEdPpCSPeaJMDyTYcIW7OjGbxmTDY17PDHfiBLqi9ggtm/oLL4eAagsNAgQIDAQABo0IwQDAd
+BgNVHQ4EFgQUvYiHyY/2pAoLquvF/pEjnatKijIwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQF
+MAMBAf8wDQYJKoZIhvcNAQEFBQADggEBAB18+kmPNOm3JpIWmgV050vQbTlswyb2zrgxvMTfvCr4
+N5EY3ATIZJkrGG2AA1nJrvhY0D7twyOfaTyGOBye79oneNGEN3GKPEs5z35FBtYt2IpNeBLWrcLT
+y9LQQfMmNkqblWwM7uXRQydmwYj3erMgbOqwaSvHIOgMA8RBBZniP+Rr+KCGgceExh/VS4ESshYh
+LBOhgLJeDEoTniDYYkCrkOpkSi+sDQESeUWoL4cZaMjihccwsnX5OD+ywJO0a+IDRM5noN+J1q2M
+dqMTw5RhK2vZbMEHCiIHhWyFJEapvj+LeISCfiQMnf2BN+MlqO02TpUsyZyQ2uypQjyttgI=
+-----END CERTIFICATE-----
+
+Buypass Class 2 CA 1
+====================
+-----BEGIN CERTIFICATE-----
+MIIDUzCCAjugAwIBAgIBATANBgkqhkiG9w0BAQUFADBLMQswCQYDVQQGEwJOTzEdMBsGA1UECgwU
+QnV5cGFzcyBBUy05ODMxNjMzMjcxHTAbBgNVBAMMFEJ1eXBhc3MgQ2xhc3MgMiBDQSAxMB4XDTA2
+MTAxMzEwMjUwOVoXDTE2MTAxMzEwMjUwOVowSzELMAkGA1UEBhMCTk8xHTAbBgNVBAoMFEJ1eXBh
+c3MgQVMtOTgzMTYzMzI3MR0wGwYDVQQDDBRCdXlwYXNzIENsYXNzIDIgQ0EgMTCCASIwDQYJKoZI
+hvcNAQEBBQADggEPADCCAQoCggEBAIs8B0XY9t/mx8q6jUPFR42wWsE425KEHK8T1A9vNkYgxC7M
+cXA0ojTTNy7Y3Tp3L8DrKehc0rWpkTSHIln+zNvnma+WwajHQN2lFYxuyHyXA8vmIPLXl18xoS83
+0r7uvqmtqEyeIWZDO6i88wmjONVZJMHCR3axiFyCO7srpgTXjAePzdVBHfCuuCkslFJgNJQ72uA4
+0Z0zPhX0kzLFANq1KWYOOngPIVJfAuWSeyXTkh4vFZ2B5J2O6O+JzhRMVB0cgRJNcKi+EAUXfh/R
+uFdV7c27UsKwHnjCTTZoy1YmwVLBvXb3WNVyfh9EdrsAiR0WnVE1703CVu9r4Iw7DekCAwEAAaNC
+MEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUP42aWYv8e3uco684sDntkHGA1sgwDgYDVR0P
+AQH/BAQDAgEGMA0GCSqGSIb3DQEBBQUAA4IBAQAVGn4TirnoB6NLJzKyQJHyIdFkhb5jatLPgcIV
+1Xp+DCmsNx4cfHZSldq1fyOhKXdlyTKdqC5Wq2B2zha0jX94wNWZUYN/Xtm+DKhQ7SLHrQVMdvvt
+7h5HZPb3J31cKA9FxVxiXqaakZG3Uxcu3K1gnZZkOb1naLKuBctN518fV4bVIJwo+28TOPX2EZL2
+fZleHwzoq0QkKXJAPTZSr4xYkHPB7GEseaHsh7U/2k3ZIQAw3pDaDtMaSKk+hQsUi4y8QZ5q9w5w
+wDX3OaJdZtB7WZ+oRxKaJyOkLY4ng5IgodcVf/EuGO70SH8vf/GhGLWhC5SgYiAynB321O+/TIho
+-----END CERTIFICATE-----
+
+Buypass Class 3 CA 1
+====================
+-----BEGIN CERTIFICATE-----
+MIIDUzCCAjugAwIBAgIBAjANBgkqhkiG9w0BAQUFADBLMQswCQYDVQQGEwJOTzEdMBsGA1UECgwU
+QnV5cGFzcyBBUy05ODMxNjMzMjcxHTAbBgNVBAMMFEJ1eXBhc3MgQ2xhc3MgMyBDQSAxMB4XDTA1
+MDUwOTE0MTMwM1oXDTE1MDUwOTE0MTMwM1owSzELMAkGA1UEBhMCTk8xHTAbBgNVBAoMFEJ1eXBh
+c3MgQVMtOTgzMTYzMzI3MR0wGwYDVQQDDBRCdXlwYXNzIENsYXNzIDMgQ0EgMTCCASIwDQYJKoZI
+hvcNAQEBBQADggEPADCCAQoCggEBAKSO13TZKWTeXx+HgJHqTjnmGcZEC4DVC69TB4sSveZn8AKx
+ifZgisRbsELRwCGoy+Gb72RRtqfPFfV0gGgEkKBYouZ0plNTVUhjP5JW3SROjvi6K//zNIqeKNc0
+n6wv1g/xpC+9UrJJhW05NfBEMJNGJPO251P7vGGvqaMU+8IXF4Rs4HyI+MkcVyzwPX6UvCWThOia
+AJpFBUJXgPROztmuOfbIUxAMZTpHe2DC1vqRycZxbL2RhzyRhkmr8w+gbCZ2Xhysm3HljbybIR6c
+1jh+JIAVMYKWsUnTYjdbiAwKYjT+p0h+mbEwi5A3lRyoH6UsjfRVyNvdWQrCrXig9IsCAwEAAaNC
+MEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUOBTmyPCppAP0Tj4io1vy1uCtQHQwDgYDVR0P
+AQH/BAQDAgEGMA0GCSqGSIb3DQEBBQUAA4IBAQABZ6OMySU9E2NdFm/soT4JXJEVKirZgCFPBdy7
+pYmrEzMqnji3jG8CcmPHc3ceCQa6Oyh7pEfJYWsICCD8igWKH7y6xsL+z27sEzNxZy5p+qksP2bA
+EllNC1QCkoS72xLvg3BweMhT+t/Gxv/ciC8HwEmdMldg0/L2mSlf56oBzKwzqBwKu5HEA6BvtjT5
+htOzdlSY9EqBs1OdTUDs5XcTRa9bqh/YL0yCe/4qxFi7T/ye/QNlGioOw6UgFpRreaaiErS7GqQj
+el/wroQk5PMr+4okoyeYZdowdXb8GZHo2+ubPzK/QJcHJrrM85SFSnonk8+QQtS4Wxam58tAA915
+-----END CERTIFICATE-----
+
+EBG Elektronik Sertifika Hizmet Sa\xC4\x9Flay\xc4\xb1\x63\xc4\xb1s\xc4\xb1
+==========================================================================
+-----BEGIN CERTIFICATE-----
+MIIF5zCCA8+gAwIBAgIITK9zQhyOdAIwDQYJKoZIhvcNAQEFBQAwgYAxODA2BgNVBAMML0VCRyBF
+bGVrdHJvbmlrIFNlcnRpZmlrYSBIaXptZXQgU2HEn2xhecSxY8Sxc8SxMTcwNQYDVQQKDC5FQkcg
+QmlsacWfaW0gVGVrbm9sb2ppbGVyaSB2ZSBIaXptZXRsZXJpIEEuxZ4uMQswCQYDVQQGEwJUUjAe
+Fw0wNjA4MTcwMDIxMDlaFw0xNjA4MTQwMDMxMDlaMIGAMTgwNgYDVQQDDC9FQkcgRWxla3Ryb25p
+ayBTZXJ0aWZpa2EgSGl6bWV0IFNhxJ9sYXnEsWPEsXPEsTE3MDUGA1UECgwuRUJHIEJpbGnFn2lt
+IFRla25vbG9qaWxlcmkgdmUgSGl6bWV0bGVyaSBBLsWeLjELMAkGA1UEBhMCVFIwggIiMA0GCSqG
+SIb3DQEBAQUAA4ICDwAwggIKAoICAQDuoIRh0DpqZhAy2DE4f6en5f2h4fuXd7hxlugTlkaDT7by
+X3JWbhNgpQGR4lvFzVcfd2NR/y8927k/qqk153nQ9dAktiHq6yOU/im/+4mRDGSaBUorzAzu8T2b
+gmmkTPiab+ci2hC6X5L8GCcKqKpE+i4stPtGmggDg3KriORqcsnlZR9uKg+ds+g75AxuetpX/dfr
+eYteIAbTdgtsApWjluTLdlHRKJ2hGvxEok3MenaoDT2/F08iiFD9rrbskFBKW5+VQarKD7JK/oCZ
+TqNGFav4c0JqwmZ2sQomFd2TkuzbqV9UIlKRcF0T6kjsbgNs2d1s/OsNA/+mgxKb8amTD8UmTDGy
+Y5lhcucqZJnSuOl14nypqZoaqsNW2xCaPINStnuWt6yHd6i58mcLlEOzrz5z+kI2sSXFCjEmN1Zn
+uqMLfdb3ic1nobc6HmZP9qBVFCVMLDMNpkGMvQQxahByCp0OLna9XvNRiYuoP1Vzv9s6xiQFlpJI
+qkuNKgPlV5EQ9GooFW5Hd4RcUXSfGenmHmMWOeMRFeNYGkS9y8RsZteEBt8w9DeiQyJ50hBs37vm
+ExH8nYQKE3vwO9D8owrXieqWfo1IhR5kX9tUoqzVegJ5a9KK8GfaZXINFHDk6Y54jzJ0fFfy1tb0
+Nokb+Clsi7n2l9GkLqq+CxnCRelwXQIDAJ3Zo2MwYTAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB
+/wQEAwIBBjAdBgNVHQ4EFgQU587GT/wWZ5b6SqMHwQSny2re2kcwHwYDVR0jBBgwFoAU587GT/wW
+Z5b6SqMHwQSny2re2kcwDQYJKoZIhvcNAQEFBQADggIBAJuYml2+8ygjdsZs93/mQJ7ANtyVDR2t
+FcU22NU57/IeIl6zgrRdu0waypIN30ckHrMk2pGI6YNw3ZPX6bqz3xZaPt7gyPvT/Wwp+BVGoGgm
+zJNSroIBk5DKd8pNSe/iWtkqvTDOTLKBtjDOWU/aWR1qeqRFsIImgYZ29fUQALjuswnoT4cCB64k
+XPBfrAowzIpAoHMEwfuJJPaaHFy3PApnNgUIMbOv2AFoKuB4j3TeuFGkjGwgPaL7s9QJ/XvCgKqT
+bCmYIai7FvOpEl90tYeY8pUm3zTvilORiF0alKM/fCL414i6poyWqD1SNGKfAB5UVUJnxk1Gj7sU
+RT0KlhaOEKGXmdXTMIXM3rRyt7yKPBgpaP3ccQfuJDlq+u2lrDgv+R4QDgZxGhBM/nV+/x5XOULK
+1+EVoVZVWRvRo68R2E7DpSvvkL/A7IITW43WciyTTo9qKd+FPNMN4KIYEsxVL0e3p5sC/kH2iExt
+2qkBR4NkJ2IQgtYSe14DHzSpyZH+r11thie3I6p1GMog57AP14kOpmciY/SDQSsGS7tY1dHXt7kQ
+Y9iJSrSq3RZj9W6+YKH47ejWkE8axsWgKdOnIaj1Wjz3x0miIZpKlVIglnKaZsv30oZDfCK+lvm9
+AahH3eU7QPl1K5srRmSGjR70j/sHd9DqSaIcjVIUpgqT
+-----END CERTIFICATE-----
+
+certSIGN ROOT CA
+================
+-----BEGIN CERTIFICATE-----
+MIIDODCCAiCgAwIBAgIGIAYFFnACMA0GCSqGSIb3DQEBBQUAMDsxCzAJBgNVBAYTAlJPMREwDwYD
+VQQKEwhjZXJ0U0lHTjEZMBcGA1UECxMQY2VydFNJR04gUk9PVCBDQTAeFw0wNjA3MDQxNzIwMDRa
+Fw0zMTA3MDQxNzIwMDRaMDsxCzAJBgNVBAYTAlJPMREwDwYDVQQKEwhjZXJ0U0lHTjEZMBcGA1UE
+CxMQY2VydFNJR04gUk9PVCBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBALczuX7I
+JUqOtdu0KBuqV5Do0SLTZLrTk+jUrIZhQGpgV2hUhE28alQCBf/fm5oqrl0Hj0rDKH/v+yv6efHH
+rfAQUySQi2bJqIirr1qjAOm+ukbuW3N7LBeCgV5iLKECZbO9xSsAfsT8AzNXDe3i+s5dRdY4zTW2
+ssHQnIFKquSyAVwdj1+ZxLGt24gh65AIgoDzMKND5pCCrlUoSe1b16kQOA7+j0xbm0bqQfWwCHTD
+0IgztnzXdN/chNFDDnU5oSVAKOp4yw4sLjmdjItuFhwvJoIQ4uNllAoEwF73XVv4EOLQunpL+943
+AAAaWyjj0pxzPjKHmKHJUS/X3qwzs08CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8B
+Af8EBAMCAcYwHQYDVR0OBBYEFOCMm9slSbPxfIbWskKHC9BroNnkMA0GCSqGSIb3DQEBBQUAA4IB
+AQA+0hyJLjX8+HXd5n9liPRyTMks1zJO890ZeUe9jjtbkw9QSSQTaxQGcu8J06Gh40CEyecYMnQ8
+SG4Pn0vU9x7Tk4ZkVJdjclDVVc/6IJMCopvDI5NOFlV2oHB5bc0hH88vLbwZ44gx+FkagQnIl6Z0
+x2DEW8xXjrJ1/RsCCdtZb3KTafcxQdaIOL+Hsr0Wefmq5L6IJd1hJyMctTEHBDa0GpC9oHRxUIlt
+vBTjD4au8as+x6AJzKNI0eDbZOeStc+vckNwi/nDhDwTqn6Sm1dTk/pwwpEOMfmbZ13pljheX7Nz
+TogVZ96edhBiIL5VaZVDADlN9u6wWk5JRFRYX0KD
+-----END CERTIFICATE-----
+
+CNNIC ROOT
+==========
+-----BEGIN CERTIFICATE-----
+MIIDVTCCAj2gAwIBAgIESTMAATANBgkqhkiG9w0BAQUFADAyMQswCQYDVQQGEwJDTjEOMAwGA1UE
+ChMFQ05OSUMxEzARBgNVBAMTCkNOTklDIFJPT1QwHhcNMDcwNDE2MDcwOTE0WhcNMjcwNDE2MDcw
+OTE0WjAyMQswCQYDVQQGEwJDTjEOMAwGA1UEChMFQ05OSUMxEzARBgNVBAMTCkNOTklDIFJPT1Qw
+ggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDTNfc/c3et6FtzF8LRb+1VvG7q6KR5smzD
+o+/hn7E7SIX1mlwhIhAsxYLO2uOabjfhhyzcuQxauohV3/2q2x8x6gHx3zkBwRP9SFIhxFXf2tiz
+VHa6dLG3fdfA6PZZxU3Iva0fFNrfWEQlMhkqx35+jq44sDB7R3IJMfAw28Mbdim7aXZOV/kbZKKT
+VrdvmW7bCgScEeOAH8tjlBAKqeFkgjH5jCftppkA9nCTGPihNIaj3XrCGHn2emU1z5DrvTOTn1Or
+czvmmzQgLx3vqR1jGqCA2wMv+SYahtKNu6m+UjqHZ0gNv7Sg2Ca+I19zN38m5pIEo3/PIKe38zrK
+y5nLAgMBAAGjczBxMBEGCWCGSAGG+EIBAQQEAwIABzAfBgNVHSMEGDAWgBRl8jGtKvf33VKWCscC
+wQ7vptU7ETAPBgNVHRMBAf8EBTADAQH/MAsGA1UdDwQEAwIB/jAdBgNVHQ4EFgQUZfIxrSr3991S
+lgrHAsEO76bVOxEwDQYJKoZIhvcNAQEFBQADggEBAEs17szkrr/Dbq2flTtLP1se31cpolnKOOK5
+Gv+e5m4y3R6u6jW39ZORTtpC4cMXYFDy0VwmuYK36m3knITnA3kXr5g9lNvHugDnuL8BV8F3RTIM
+O/G0HAiw/VGgod2aHRM2mm23xzy54cXZF/qD1T0VoDy7HgviyJA/qIYM/PmLXoXLT1tLYhFHxUV8
+BS9BsZ4QaRuZluBVeftOhpm4lNqGOGqTo+fLbuXf6iFViZx9fX+Y9QCJ7uOEwFyWtcVG6kbghVW2
+G8kS1sHNzYDzAgE8yGnLRUhj2JTQ7IUOO04RZfSCjKY9ri4ilAnIXOo8gV0WKgOXFlUJ24pBgp5m
+mxE=
+-----END CERTIFICATE-----
+
+ApplicationCA - Japanese Government
+===================================
+-----BEGIN CERTIFICATE-----
+MIIDoDCCAoigAwIBAgIBMTANBgkqhkiG9w0BAQUFADBDMQswCQYDVQQGEwJKUDEcMBoGA1UEChMT
+SmFwYW5lc2UgR292ZXJubWVudDEWMBQGA1UECxMNQXBwbGljYXRpb25DQTAeFw0wNzEyMTIxNTAw
+MDBaFw0xNzEyMTIxNTAwMDBaMEMxCzAJBgNVBAYTAkpQMRwwGgYDVQQKExNKYXBhbmVzZSBHb3Zl
+cm5tZW50MRYwFAYDVQQLEw1BcHBsaWNhdGlvbkNBMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIB
+CgKCAQEAp23gdE6Hj6UG3mii24aZS2QNcfAKBZuOquHMLtJqO8F6tJdhjYq+xpqcBrSGUeQ3DnR4
+fl+Kf5Sk10cI/VBaVuRorChzoHvpfxiSQE8tnfWuREhzNgaeZCw7NCPbXCbkcXmP1G55IrmTwcrN
+wVbtiGrXoDkhBFcsovW8R0FPXjQilbUfKW1eSvNNcr5BViCH/OlQR9cwFO5cjFW6WY2H/CPek9AE
+jP3vbb3QesmlOmpyM8ZKDQUXKi17safY1vC+9D/qDihtQWEjdnjDuGWk81quzMKq2edY3rZ+nYVu
+nyoKb58DKTCXKB28t89UKU5RMfkntigm/qJj5kEW8DOYRwIDAQABo4GeMIGbMB0GA1UdDgQWBBRU
+WssmP3HMlEYNllPqa0jQk/5CdTAOBgNVHQ8BAf8EBAMCAQYwWQYDVR0RBFIwUKROMEwxCzAJBgNV
+BAYTAkpQMRgwFgYDVQQKDA/ml6XmnKzlm73mlL/lupwxIzAhBgNVBAsMGuOCouODl+ODquOCseOD
+vOOCt+ODp+ODs0NBMA8GA1UdEwEB/wQFMAMBAf8wDQYJKoZIhvcNAQEFBQADggEBADlqRHZ3ODrs
+o2dGD/mLBqj7apAxzn7s2tGJfHrrLgy9mTLnsCTWw//1sogJhyzjVOGjprIIC8CFqMjSnHH2HZ9g
+/DgzE+Ge3Atf2hZQKXsvcJEPmbo0NI2VdMV+eKlmXb3KIXdCEKxmJj3ekav9FfBv7WxfEPjzFvYD
+io+nEhEMy/0/ecGc/WLuo89UDNErXxc+4z6/wCs+CZv+iKZ+tJIX/COUgb1up8WMwusRRdv4QcmW
+dupwX3kSa+SjB1oF7ydJzyGfikwJcGapJsErEU4z0g781mzSDjJkaP+tBXhfAx2o45CsJOAPQKdL
+rosot4LKGAfmt1t06SAZf7IbiVQ=
+-----END CERTIFICATE-----
+
+GeoTrust Primary Certification Authority - G3
+=============================================
+-----BEGIN CERTIFICATE-----
+MIID/jCCAuagAwIBAgIQFaxulBmyeUtB9iepwxgPHzANBgkqhkiG9w0BAQsFADCBmDELMAkGA1UE
+BhMCVVMxFjAUBgNVBAoTDUdlb1RydXN0IEluYy4xOTA3BgNVBAsTMChjKSAyMDA4IEdlb1RydXN0
+IEluYy4gLSBGb3IgYXV0aG9yaXplZCB1c2Ugb25seTE2MDQGA1UEAxMtR2VvVHJ1c3QgUHJpbWFy
+eSBDZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEczMB4XDTA4MDQwMjAwMDAwMFoXDTM3MTIwMTIz
+NTk1OVowgZgxCzAJBgNVBAYTAlVTMRYwFAYDVQQKEw1HZW9UcnVzdCBJbmMuMTkwNwYDVQQLEzAo
+YykgMjAwOCBHZW9UcnVzdCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNlIG9ubHkxNjA0BgNVBAMT
+LUdlb1RydXN0IFByaW1hcnkgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMzCCASIwDQYJKoZI
+hvcNAQEBBQADggEPADCCAQoCggEBANziXmJYHTNXOTIz+uvLh4yn1ErdBojqZI4xmKU4kB6Yzy5j
+K/BGvESyiaHAKAxJcCGVn2TAppMSAmUmhsalifD614SgcK9PGpc/BkTVyetyEH3kMSj7HGHmKAdE
+c5IiaacDiGydY8hS2pgn5whMcD60yRLBxWeDXTPzAxHsatBT4tG6NmCUgLthY2xbF37fQJQeqw3C
+IShwiP/WJmxsYAQlTlV+fe+/lEjetx3dcI0FX4ilm/LC7urRQEFtYjgdVgbFA0dRIBn8exALDmKu
+dlW/X3e+PkkBUz2YJQN2JFodtNuJ6nnltrM7P7pMKEF/BqxqjsHQ9gUdfeZChuOl1UcCAwEAAaNC
+MEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFMR5yo6hTgMdHNxr
+2zFblD4/MH8tMA0GCSqGSIb3DQEBCwUAA4IBAQAtxRPPVoB7eni9n64smefv2t+UXglpp+duaIy9
+cr5HqQ6XErhK8WTTOd8lNNTBzU6B8A8ExCSzNJbGpqow32hhc9f5joWJ7w5elShKKiePEI4ufIbE
+Ap7aDHdlDkQNkv39sxY2+hENHYwOB4lqKVb3cvTdFZx3NWZXqxNT2I7BQMXXExZacse3aQHEerGD
+AWh9jUGhlBjBJVz88P6DAod8DQ3PLghcSkANPuyBYeYk28rgDi0Hsj5W3I31QYUHSJsMC8tJP33s
+t/3LjWeJGqvtux6jAAgIFyqCXDFdRootD4abdNlF+9RAsXqqaC2Gspki4cErx5z481+oghLrGREt
+-----END CERTIFICATE-----
+
+thawte Primary Root CA - G2
+===========================
+-----BEGIN CERTIFICATE-----
+MIICiDCCAg2gAwIBAgIQNfwmXNmET8k9Jj1Xm67XVjAKBggqhkjOPQQDAzCBhDELMAkGA1UEBhMC
+VVMxFTATBgNVBAoTDHRoYXd0ZSwgSW5jLjE4MDYGA1UECxMvKGMpIDIwMDcgdGhhd3RlLCBJbmMu
+IC0gRm9yIGF1dGhvcml6ZWQgdXNlIG9ubHkxJDAiBgNVBAMTG3RoYXd0ZSBQcmltYXJ5IFJvb3Qg
+Q0EgLSBHMjAeFw0wNzExMDUwMDAwMDBaFw0zODAxMTgyMzU5NTlaMIGEMQswCQYDVQQGEwJVUzEV
+MBMGA1UEChMMdGhhd3RlLCBJbmMuMTgwNgYDVQQLEy8oYykgMjAwNyB0aGF3dGUsIEluYy4gLSBG
+b3IgYXV0aG9yaXplZCB1c2Ugb25seTEkMCIGA1UEAxMbdGhhd3RlIFByaW1hcnkgUm9vdCBDQSAt
+IEcyMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEotWcgnuVnfFSeIf+iha/BebfowJPDQfGAFG6DAJS
+LSKkQjnE/o/qycG+1E3/n3qe4rF8mq2nhglzh9HnmuN6papu+7qzcMBniKI11KOasf2twu8x+qi5
+8/sIxpHR+ymVo0IwQDAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQU
+mtgAMADna3+FGO6Lts6KDPgR4bswCgYIKoZIzj0EAwMDaQAwZgIxAN344FdHW6fmCsO99YCKlzUN
+G4k8VIZ3KMqh9HneteY4sPBlcIx/AlTCv//YoT7ZzwIxAMSNlPzcU9LcnXgWHxUzI1NS41oxXZ3K
+rr0TKUQNJ1uo52icEvdYPy5yAlejj6EULg==
+-----END CERTIFICATE-----
+
+thawte Primary Root CA - G3
+===========================
+-----BEGIN CERTIFICATE-----
+MIIEKjCCAxKgAwIBAgIQYAGXt0an6rS0mtZLL/eQ+zANBgkqhkiG9w0BAQsFADCBrjELMAkGA1UE
+BhMCVVMxFTATBgNVBAoTDHRoYXd0ZSwgSW5jLjEoMCYGA1UECxMfQ2VydGlmaWNhdGlvbiBTZXJ2
+aWNlcyBEaXZpc2lvbjE4MDYGA1UECxMvKGMpIDIwMDggdGhhd3RlLCBJbmMuIC0gRm9yIGF1dGhv
+cml6ZWQgdXNlIG9ubHkxJDAiBgNVBAMTG3RoYXd0ZSBQcmltYXJ5IFJvb3QgQ0EgLSBHMzAeFw0w
+ODA0MDIwMDAwMDBaFw0zNzEyMDEyMzU5NTlaMIGuMQswCQYDVQQGEwJVUzEVMBMGA1UEChMMdGhh
+d3RlLCBJbmMuMSgwJgYDVQQLEx9DZXJ0aWZpY2F0aW9uIFNlcnZpY2VzIERpdmlzaW9uMTgwNgYD
+VQQLEy8oYykgMjAwOCB0aGF3dGUsIEluYy4gLSBGb3IgYXV0aG9yaXplZCB1c2Ugb25seTEkMCIG
+A1UEAxMbdGhhd3RlIFByaW1hcnkgUm9vdCBDQSAtIEczMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8A
+MIIBCgKCAQEAsr8nLPvb2FvdeHsbnndmgcs+vHyu86YnmjSjaDFxODNi5PNxZnmxqWWjpYvVj2At
+P0LMqmsywCPLLEHd5N/8YZzic7IilRFDGF/Eth9XbAoFWCLINkw6fKXRz4aviKdEAhN0cXMKQlkC
++BsUa0Lfb1+6a4KinVvnSr0eAXLbS3ToO39/fR8EtCab4LRarEc9VbjXsCZSKAExQGbY2SS99irY
+7CFJXJv2eul/VTV+lmuNk5Mny5K76qxAwJ/C+IDPXfRa3M50hqY+bAtTyr2SzhkGcuYMXDhpxwTW
+vGzOW/b3aJzcJRVIiKHpqfiYnODz1TEoYRFsZ5aNOZnLwkUkOQIDAQABo0IwQDAPBgNVHRMBAf8E
+BTADAQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQUrWyqlGCc7eT/+j4KdCtjA/e2Wb8wDQYJ
+KoZIhvcNAQELBQADggEBABpA2JVlrAmSicY59BDlqQ5mU1143vokkbvnRFHfxhY0Cu9qRFHqKweK
+A3rD6z8KLFIWoCtDuSWQP3CpMyVtRRooOyfPqsMpQhvfO0zAMzRbQYi/aytlryjvsvXDqmbOe1bu
+t8jLZ8HJnBoYuMTDSQPxYA5QzUbF83d597YV4Djbxy8ooAw/dyZ02SUS2jHaGh7cKUGRIjxpp7sC
+8rZcJwOJ9Abqm+RyguOhCcHpABnTPtRwa7pxpqpYrvS76Wy274fMm7v/OeZWYdMKp8RcTGB7BXcm
+er/YB1IsYvdwY9k5vG8cwnncdimvzsUsZAReiDZuMdRAGmI0Nj81Aa6sY6A=
+-----END CERTIFICATE-----
+
+GeoTrust Primary Certification Authority - G2
+=============================================
+-----BEGIN CERTIFICATE-----
+MIICrjCCAjWgAwIBAgIQPLL0SAoA4v7rJDteYD7DazAKBggqhkjOPQQDAzCBmDELMAkGA1UEBhMC
+VVMxFjAUBgNVBAoTDUdlb1RydXN0IEluYy4xOTA3BgNVBAsTMChjKSAyMDA3IEdlb1RydXN0IElu
+Yy4gLSBGb3IgYXV0aG9yaXplZCB1c2Ugb25seTE2MDQGA1UEAxMtR2VvVHJ1c3QgUHJpbWFyeSBD
+ZXJ0aWZpY2F0aW9uIEF1dGhvcml0eSAtIEcyMB4XDTA3MTEwNTAwMDAwMFoXDTM4MDExODIzNTk1
+OVowgZgxCzAJBgNVBAYTAlVTMRYwFAYDVQQKEw1HZW9UcnVzdCBJbmMuMTkwNwYDVQQLEzAoYykg
+MjAwNyBHZW9UcnVzdCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNlIG9ubHkxNjA0BgNVBAMTLUdl
+b1RydXN0IFByaW1hcnkgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkgLSBHMjB2MBAGByqGSM49AgEG
+BSuBBAAiA2IABBWx6P0DFUPlrOuHNxFi79KDNlJ9RVcLSo17VDs6bl8VAsBQps8lL33KSLjHUGMc
+KiEIfJo22Av+0SbFWDEwKCXzXV2juLaltJLtbCyf691DiaI8S0iRHVDsJt/WYC69IaNCMEAwDwYD
+VR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFBVfNVdRVfslsq0DafwBo/q+
+EVXVMAoGCCqGSM49BAMDA2cAMGQCMGSWWaboCd6LuvpaiIjwH5HTRqjySkwCY/tsXzjbLkGTqQ7m
+ndwxHLKgpxgceeHHNgIwOlavmnRs9vuD4DPTCF+hnMJbn0bWtsuRBmOiBuczrD6ogRLQy7rQkgu2
+npaqBA+K
+-----END CERTIFICATE-----
+
+VeriSign Universal Root Certification Authority
+===============================================
+-----BEGIN CERTIFICATE-----
+MIIEuTCCA6GgAwIBAgIQQBrEZCGzEyEDDrvkEhrFHTANBgkqhkiG9w0BAQsFADCBvTELMAkGA1UE
+BhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBO
+ZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwOCBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVk
+IHVzZSBvbmx5MTgwNgYDVQQDEy9WZXJpU2lnbiBVbml2ZXJzYWwgUm9vdCBDZXJ0aWZpY2F0aW9u
+IEF1dGhvcml0eTAeFw0wODA0MDIwMDAwMDBaFw0zNzEyMDEyMzU5NTlaMIG9MQswCQYDVQQGEwJV
+UzEXMBUGA1UEChMOVmVyaVNpZ24sIEluYy4xHzAdBgNVBAsTFlZlcmlTaWduIFRydXN0IE5ldHdv
+cmsxOjA4BgNVBAsTMShjKSAyMDA4IFZlcmlTaWduLCBJbmMuIC0gRm9yIGF1dGhvcml6ZWQgdXNl
+IG9ubHkxODA2BgNVBAMTL1ZlcmlTaWduIFVuaXZlcnNhbCBSb290IENlcnRpZmljYXRpb24gQXV0
+aG9yaXR5MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAx2E3XrEBNNti1xWb/1hajCMj
+1mCOkdeQmIN65lgZOIzF9uVkhbSicfvtvbnazU0AtMgtc6XHaXGVHzk8skQHnOgO+k1KxCHfKWGP
+MiJhgsWHH26MfF8WIFFE0XBPV+rjHOPMee5Y2A7Cs0WTwCznmhcrewA3ekEzeOEz4vMQGn+HLL72
+9fdC4uW/h2KJXwBL38Xd5HVEMkE6HnFuacsLdUYI0crSK5XQz/u5QGtkjFdN/BMReYTtXlT2NJ8I
+AfMQJQYXStrxHXpma5hgZqTZ79IugvHw7wnqRMkVauIDbjPTrJ9VAMf2CGqUuV/c4DPxhGD5WycR
+tPwW8rtWaoAljQIDAQABo4GyMIGvMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMG0G
+CCsGAQUFBwEMBGEwX6FdoFswWTBXMFUWCWltYWdlL2dpZjAhMB8wBwYFKw4DAhoEFI/l0xqGrI2O
+a8PPgGrUSBgsexkuMCUWI2h0dHA6Ly9sb2dvLnZlcmlzaWduLmNvbS92c2xvZ28uZ2lmMB0GA1Ud
+DgQWBBS2d/ppSEefUxLVwuoHMnYH0ZcHGTANBgkqhkiG9w0BAQsFAAOCAQEASvj4sAPmLGd75JR3
+Y8xuTPl9Dg3cyLk1uXBPY/ok+myDjEedO2Pzmvl2MpWRsXe8rJq+seQxIcaBlVZaDrHC1LGmWazx
+Y8u4TB1ZkErvkBYoH1quEPuBUDgMbMzxPcP1Y+Oz4yHJJDnp/RVmRvQbEdBNc6N9Rvk97ahfYtTx
+P/jgdFcrGJ2BtMQo2pSXpXDrrB2+BxHw1dvd5Yzw1TKwg+ZX4o+/vqGqvz0dtdQ46tewXDpPaj+P
+wGZsY6rp2aQW9IHRlRQOfc2VNNnSj3BzgXucfr2YYdhFh5iQxeuGMMY1v/D/w1WIg0vvBZIGcfK4
+mJO37M2CYfE45k+XmCpajQ==
+-----END CERTIFICATE-----
+
+VeriSign Class 3 Public Primary Certification Authority - G4
+============================================================
+-----BEGIN CERTIFICATE-----
+MIIDhDCCAwqgAwIBAgIQL4D+I4wOIg9IZxIokYesszAKBggqhkjOPQQDAzCByjELMAkGA1UEBhMC
+VVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBUcnVzdCBOZXR3
+b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRob3JpemVkIHVz
+ZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5IENlcnRpZmlj
+YXRpb24gQXV0aG9yaXR5IC0gRzQwHhcNMDcxMTA1MDAwMDAwWhcNMzgwMTE4MjM1OTU5WjCByjEL
+MAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMR8wHQYDVQQLExZWZXJpU2lnbiBU
+cnVzdCBOZXR3b3JrMTowOAYDVQQLEzEoYykgMjAwNyBWZXJpU2lnbiwgSW5jLiAtIEZvciBhdXRo
+b3JpemVkIHVzZSBvbmx5MUUwQwYDVQQDEzxWZXJpU2lnbiBDbGFzcyAzIFB1YmxpYyBQcmltYXJ5
+IENlcnRpZmljYXRpb24gQXV0aG9yaXR5IC0gRzQwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAASnVnp8
+Utpkmw4tXNherJI9/gHmGUo9FANL+mAnINmDiWn6VMaaGF5VKmTeBvaNSjutEDxlPZCIBIngMGGz
+rl0Bp3vefLK+ymVhAIau2o970ImtTR1ZmkGxvEeA3J5iw/mjgbIwga8wDwYDVR0TAQH/BAUwAwEB
+/zAOBgNVHQ8BAf8EBAMCAQYwbQYIKwYBBQUHAQwEYTBfoV2gWzBZMFcwVRYJaW1hZ2UvZ2lmMCEw
+HzAHBgUrDgMCGgQUj+XTGoasjY5rw8+AatRIGCx7GS4wJRYjaHR0cDovL2xvZ28udmVyaXNpZ24u
+Y29tL3ZzbG9nby5naWYwHQYDVR0OBBYEFLMWkf3upm7ktS5Jj4d4gYDs5bG1MAoGCCqGSM49BAMD
+A2gAMGUCMGYhDBgmYFo4e1ZC4Kf8NoRRkSAsdk1DPcQdhCPQrNZ8NQbOzWm9kA3bbEhCHQ6qQgIx
+AJw9SDkjOVgaFRJZap7v1VmyHVIsmXHNxynfGyphe3HR3vPA5Q06Sqotp9iGKt0uEA==
+-----END CERTIFICATE-----
+
+NetLock Arany (Class Gold) Főtanúsítvány
+============================================
+-----BEGIN CERTIFICATE-----
+MIIEFTCCAv2gAwIBAgIGSUEs5AAQMA0GCSqGSIb3DQEBCwUAMIGnMQswCQYDVQQGEwJIVTERMA8G
+A1UEBwwIQnVkYXBlc3QxFTATBgNVBAoMDE5ldExvY2sgS2Z0LjE3MDUGA1UECwwuVGFuw7pzw610
+dsOhbnlraWFkw7NrIChDZXJ0aWZpY2F0aW9uIFNlcnZpY2VzKTE1MDMGA1UEAwwsTmV0TG9jayBB
+cmFueSAoQ2xhc3MgR29sZCkgRsWRdGFuw7pzw610dsOhbnkwHhcNMDgxMjExMTUwODIxWhcNMjgx
+MjA2MTUwODIxWjCBpzELMAkGA1UEBhMCSFUxETAPBgNVBAcMCEJ1ZGFwZXN0MRUwEwYDVQQKDAxO
+ZXRMb2NrIEtmdC4xNzA1BgNVBAsMLlRhbsO6c8OtdHbDoW55a2lhZMOzayAoQ2VydGlmaWNhdGlv
+biBTZXJ2aWNlcykxNTAzBgNVBAMMLE5ldExvY2sgQXJhbnkgKENsYXNzIEdvbGQpIEbFkXRhbsO6
+c8OtdHbDoW55MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAxCRec75LbRTDofTjl5Bu
+0jBFHjzuZ9lk4BqKf8owyoPjIMHj9DrTlF8afFttvzBPhCf2nx9JvMaZCpDyD/V/Q4Q3Y1GLeqVw
+/HpYzY6b7cNGbIRwXdrzAZAj/E4wqX7hJ2Pn7WQ8oLjJM2P+FpD/sLj916jAwJRDC7bVWaaeVtAk
+H3B5r9s5VA1lddkVQZQBr17s9o3x/61k/iCa11zr/qYfCGSji3ZVrR47KGAuhyXoqq8fxmRGILdw
+fzzeSNuWU7c5d+Qa4scWhHaXWy+7GRWF+GmF9ZmnqfI0p6m2pgP8b4Y9VHx2BJtr+UBdADTHLpl1
+neWIA6pN+APSQnbAGwIDAKiLo0UwQzASBgNVHRMBAf8ECDAGAQH/AgEEMA4GA1UdDwEB/wQEAwIB
+BjAdBgNVHQ4EFgQUzPpnk/C2uNClwB7zU/2MU9+D15YwDQYJKoZIhvcNAQELBQADggEBAKt/7hwW
+qZw8UQCgwBEIBaeZ5m8BiFRhbvG5GK1Krf6BQCOUL/t1fC8oS2IkgYIL9WHxHG64YTjrgfpioTta
+YtOUZcTh5m2C+C8lcLIhJsFyUR+MLMOEkMNaj7rP9KdlpeuY0fsFskZ1FSNqb4VjMIDw1Z4fKRzC
+bLBQWV2QWzuoDTDPv31/zvGdg73JRm4gpvlhUbohL3u+pRVjodSVh/GeufOJ8z2FuLjbvrW5Kfna
+NwUASZQDhETnv0Mxz3WLJdH0pmT1kvarBes96aULNmLazAZfNou2XjG4Kvte9nHfRCaexOYNkbQu
+dZWAUWpLMKawYqGT8ZvYzsRjdT9ZR7E=
+-----END CERTIFICATE-----
+
+Staat der Nederlanden Root CA - G2
+==================================
+-----BEGIN CERTIFICATE-----
+MIIFyjCCA7KgAwIBAgIEAJiWjDANBgkqhkiG9w0BAQsFADBaMQswCQYDVQQGEwJOTDEeMBwGA1UE
+CgwVU3RhYXQgZGVyIE5lZGVybGFuZGVuMSswKQYDVQQDDCJTdGFhdCBkZXIgTmVkZXJsYW5kZW4g
+Um9vdCBDQSAtIEcyMB4XDTA4MDMyNjExMTgxN1oXDTIwMDMyNTExMDMxMFowWjELMAkGA1UEBhMC
+TkwxHjAcBgNVBAoMFVN0YWF0IGRlciBOZWRlcmxhbmRlbjErMCkGA1UEAwwiU3RhYXQgZGVyIE5l
+ZGVybGFuZGVuIFJvb3QgQ0EgLSBHMjCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMVZ
+5291qj5LnLW4rJ4L5PnZyqtdj7U5EILXr1HgO+EASGrP2uEGQxGZqhQlEq0i6ABtQ8SpuOUfiUtn
+vWFI7/3S4GCI5bkYYCjDdyutsDeqN95kWSpGV+RLufg3fNU254DBtvPUZ5uW6M7XxgpT0GtJlvOj
+CwV3SPcl5XCsMBQgJeN/dVrlSPhOewMHBPqCYYdu8DvEpMfQ9XQ+pV0aCPKbJdL2rAQmPlU6Yiil
+e7Iwr/g3wtG61jj99O9JMDeZJiFIhQGp5Rbn3JBV3w/oOM2ZNyFPXfUib2rFEhZgF1XyZWampzCR
+OME4HYYEhLoaJXhena/MUGDWE4dS7WMfbWV9whUYdMrhfmQpjHLYFhN9C0lK8SgbIHRrxT3dsKpI
+CT0ugpTNGmXZK4iambwYfp/ufWZ8Pr2UuIHOzZgweMFvZ9C+X+Bo7d7iscksWXiSqt8rYGPy5V65
+48r6f1CGPqI0GAwJaCgRHOThuVw+R7oyPxjMW4T182t0xHJ04eOLoEq9jWYv6q012iDTiIJh8BIi
+trzQ1aTsr1SIJSQ8p22xcik/Plemf1WvbibG/ufMQFxRRIEKeN5KzlW/HdXZt1bv8Hb/C3m1r737
+qWmRRpdogBQ2HbN/uymYNqUg+oJgYjOk7Na6B6duxc8UpufWkjTYgfX8HV2qXB72o007uPc5AgMB
+AAGjgZcwgZQwDwYDVR0TAQH/BAUwAwEB/zBSBgNVHSAESzBJMEcGBFUdIAAwPzA9BggrBgEFBQcC
+ARYxaHR0cDovL3d3dy5wa2lvdmVyaGVpZC5ubC9wb2xpY2llcy9yb290LXBvbGljeS1HMjAOBgNV
+HQ8BAf8EBAMCAQYwHQYDVR0OBBYEFJFoMocVHYnitfGsNig0jQt8YojrMA0GCSqGSIb3DQEBCwUA
+A4ICAQCoQUpnKpKBglBu4dfYszk78wIVCVBR7y29JHuIhjv5tLySCZa59sCrI2AGeYwRTlHSeYAz
++51IvuxBQ4EffkdAHOV6CMqqi3WtFMTC6GY8ggen5ieCWxjmD27ZUD6KQhgpxrRW/FYQoAUXvQwj
+f/ST7ZwaUb7dRUG/kSS0H4zpX897IZmflZ85OkYcbPnNe5yQzSipx6lVu6xiNGI1E0sUOlWDuYaN
+kqbG9AclVMwWVxJKgnjIFNkXgiYtXSAfea7+1HAWFpWD2DU5/1JddRwWxRNVz0fMdWVSSt7wsKfk
+CpYL+63C4iWEst3kvX5ZbJvw8NjnyvLplzh+ib7M+zkXYT9y2zqR2GUBGR2tUKRXCnxLvJxxcypF
+URmFzI79R6d0lR2o0a9OF7FpJsKqeFdbxU2n5Z4FF5TKsl+gSRiNNOkmbEgeqmiSBeGCc1qb3Adb
+CG19ndeNIdn8FCCqwkXfP+cAslHkwvgFuXkajDTznlvkN1trSt8sV4pAWja63XVECDdCcAz+3F4h
+oKOKwJCcaNpQ5kUQR3i2TtJlycM33+FCY7BXN0Ute4qcvwXqZVUz9zkQxSgqIXobisQk+T8VyJoV
+IPVVYpbtbZNQvOSqeK3Zywplh6ZmwcSBo3c6WB4L7oOLnR7SUqTMHW+wmG2UMbX4cQrcufx9MmDm
+66+KAQ==
+-----END CERTIFICATE-----
+
+CA Disig
+========
+-----BEGIN CERTIFICATE-----
+MIIEDzCCAvegAwIBAgIBATANBgkqhkiG9w0BAQUFADBKMQswCQYDVQQGEwJTSzETMBEGA1UEBxMK
+QnJhdGlzbGF2YTETMBEGA1UEChMKRGlzaWcgYS5zLjERMA8GA1UEAxMIQ0EgRGlzaWcwHhcNMDYw
+MzIyMDEzOTM0WhcNMTYwMzIyMDEzOTM0WjBKMQswCQYDVQQGEwJTSzETMBEGA1UEBxMKQnJhdGlz
+bGF2YTETMBEGA1UEChMKRGlzaWcgYS5zLjERMA8GA1UEAxMIQ0EgRGlzaWcwggEiMA0GCSqGSIb3
+DQEBAQUAA4IBDwAwggEKAoIBAQCS9jHBfYj9mQGp2HvycXXxMcbzdWb6UShGhJd4NLxs/LxFWYgm
+GErENx+hSkS943EE9UQX4j/8SFhvXJ56CbpRNyIjZkMhsDxkovhqFQ4/61HhVKndBpnXmjxUizkD
+Pw/Fzsbrg3ICqB9x8y34dQjbYkzo+s7552oftms1grrijxaSfQUMbEYDXcDtab86wYqg6I7ZuUUo
+hwjstMoVvoLdtUSLLa2GDGhibYVW8qwUYzrG0ZmsNHhWS8+2rT+MitcE5eN4TPWGqvWP+j1scaMt
+ymfraHtuM6kMgiioTGohQBUgDCZbg8KpFhXAJIJdKxatymP2dACw30PEEGBWZ2NFAgMBAAGjgf8w
+gfwwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUjbJJaJ1yCCW5wCf1UJNWSEZx+Y8wDgYDVR0P
+AQH/BAQDAgEGMDYGA1UdEQQvMC2BE2Nhb3BlcmF0b3JAZGlzaWcuc2uGFmh0dHA6Ly93d3cuZGlz
+aWcuc2svY2EwZgYDVR0fBF8wXTAtoCugKYYnaHR0cDovL3d3dy5kaXNpZy5zay9jYS9jcmwvY2Ff
+ZGlzaWcuY3JsMCygKqAohiZodHRwOi8vY2EuZGlzaWcuc2svY2EvY3JsL2NhX2Rpc2lnLmNybDAa
+BgNVHSAEEzARMA8GDSuBHpGT5goAAAABAQEwDQYJKoZIhvcNAQEFBQADggEBAF00dGFMrzvY/59t
+WDYcPQuBDRIrRhCA/ec8J9B6yKm2fnQwM6M6int0wHl5QpNt/7EpFIKrIYwvF/k/Ji/1WcbvgAa3
+mkkp7M5+cTxqEEHA9tOasnxakZzArFvITV734VP/Q3f8nktnbNfzg9Gg4H8l37iYC5oyOGwwoPP/
+CBUz91BKez6jPiCp3C9WgArtQVCwyfTssuMmRAAOb54GvCKWU3BlxFAKRmukLyeBEicTXxChds6K
+ezfqwzlhA5WYOudsiCUI/HloDYd9Yvi0X/vF2Ey9WLw/Q1vUHgFNPGO+I++MzVpQuGhU+QqZMxEA
+4Z7CRneC9VkGjCFMhwnN5ag=
+-----END CERTIFICATE-----
+
+Juur-SK
+=======
+-----BEGIN CERTIFICATE-----
+MIIE5jCCA86gAwIBAgIEO45L/DANBgkqhkiG9w0BAQUFADBdMRgwFgYJKoZIhvcNAQkBFglwa2lA
+c2suZWUxCzAJBgNVBAYTAkVFMSIwIAYDVQQKExlBUyBTZXJ0aWZpdHNlZXJpbWlza2Vza3VzMRAw
+DgYDVQQDEwdKdXVyLVNLMB4XDTAxMDgzMDE0MjMwMVoXDTE2MDgyNjE0MjMwMVowXTEYMBYGCSqG
+SIb3DQEJARYJcGtpQHNrLmVlMQswCQYDVQQGEwJFRTEiMCAGA1UEChMZQVMgU2VydGlmaXRzZWVy
+aW1pc2tlc2t1czEQMA4GA1UEAxMHSnV1ci1TSzCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC
+ggEBAIFxNj4zB9bjMI0TfncyRsvPGbJgMUaXhvSYRqTCZUXP00B841oiqBB4M8yIsdOBSvZiF3tf
+TQou0M+LI+5PAk676w7KvRhj6IAcjeEcjT3g/1tf6mTll+g/mX8MCgkzABpTpyHhOEvWgxutr2TC
++Rx6jGZITWYfGAriPrsfB2WThbkasLnE+w0R9vXW+RvHLCu3GFH+4Hv2qEivbDtPL+/40UceJlfw
+UR0zlv/vWT3aTdEVNMfqPxZIe5EcgEMPPbgFPtGzlc3Yyg/CQ2fbt5PgIoIuvvVoKIO5wTtpeyDa
+Tpxt4brNj3pssAki14sL2xzVWiZbDcDq5WDQn/413z8CAwEAAaOCAawwggGoMA8GA1UdEwEB/wQF
+MAMBAf8wggEWBgNVHSAEggENMIIBCTCCAQUGCisGAQQBzh8BAQEwgfYwgdAGCCsGAQUFBwICMIHD
+HoHAAFMAZQBlACAAcwBlAHIAdABpAGYAaQBrAGEAYQB0ACAAbwBuACAAdgDkAGwAagBhAHMAdABh
+AHQAdQBkACAAQQBTAC0AaQBzACAAUwBlAHIAdABpAGYAaQB0AHMAZQBlAHIAaQBtAGkAcwBrAGUA
+cwBrAHUAcwAgAGEAbABhAG0ALQBTAEsAIABzAGUAcgB0AGkAZgBpAGsAYQBhAHQAaQBkAGUAIABr
+AGkAbgBuAGkAdABhAG0AaQBzAGUAawBzMCEGCCsGAQUFBwIBFhVodHRwOi8vd3d3LnNrLmVlL2Nw
+cy8wKwYDVR0fBCQwIjAgoB6gHIYaaHR0cDovL3d3dy5zay5lZS9qdXVyL2NybC8wHQYDVR0OBBYE
+FASqekej5ImvGs8KQKcYP2/v6X2+MB8GA1UdIwQYMBaAFASqekej5ImvGs8KQKcYP2/v6X2+MA4G
+A1UdDwEB/wQEAwIB5jANBgkqhkiG9w0BAQUFAAOCAQEAe8EYlFOiCfP+JmeaUOTDBS8rNXiRTHyo
+ERF5TElZrMj3hWVcRrs7EKACr81Ptcw2Kuxd/u+gkcm2k298gFTsxwhwDY77guwqYHhpNjbRxZyL
+abVAyJRld/JXIWY7zoVAtjNjGr95HvxcHdMdkxuLDF2FvZkwMhgJkVLpfKG6/2SSmuz+Ne6ML678
+IIbsSt4beDI3poHSna9aEhbKmVv8b20OxaAehsmR0FyYgl9jDIpaq9iVpszLita/ZEuOyoqysOkh
+Mp6qqIWYNIE5ITuoOlIyPfZrN4YGWhWY3PARZv40ILcD9EEQfTmEeZZyY7aWAuVrua0ZTbvGRNs2
+yyqcjg==
+-----END CERTIFICATE-----
+
+Hongkong Post Root CA 1
+=======================
+-----BEGIN CERTIFICATE-----
+MIIDMDCCAhigAwIBAgICA+gwDQYJKoZIhvcNAQEFBQAwRzELMAkGA1UEBhMCSEsxFjAUBgNVBAoT
+DUhvbmdrb25nIFBvc3QxIDAeBgNVBAMTF0hvbmdrb25nIFBvc3QgUm9vdCBDQSAxMB4XDTAzMDUx
+NTA1MTMxNFoXDTIzMDUxNTA0NTIyOVowRzELMAkGA1UEBhMCSEsxFjAUBgNVBAoTDUhvbmdrb25n
+IFBvc3QxIDAeBgNVBAMTF0hvbmdrb25nIFBvc3QgUm9vdCBDQSAxMIIBIjANBgkqhkiG9w0BAQEF
+AAOCAQ8AMIIBCgKCAQEArP84tulmAknjorThkPlAj3n54r15/gK97iSSHSL22oVyaf7XPwnU3ZG1
+ApzQjVrhVcNQhrkpJsLj2aDxaQMoIIBFIi1WpztUlVYiWR8o3x8gPW2iNr4joLFutbEnPzlTCeqr
+auh0ssJlXI6/fMN4hM2eFvz1Lk8gKgifd/PFHsSaUmYeSF7jEAaPIpjhZY4bXSNmO7ilMlHIhqqh
+qZ5/dpTCpmy3QfDVyAY45tQM4vM7TG1QjMSDJ8EThFk9nnV0ttgCXjqQesBCNnLsak3c78QA3xMY
+V18meMjWCnl3v/evt3a5pQuEF10Q6m/hq5URX208o1xNg1vysxmKgIsLhwIDAQABoyYwJDASBgNV
+HRMBAf8ECDAGAQH/AgEDMA4GA1UdDwEB/wQEAwIBxjANBgkqhkiG9w0BAQUFAAOCAQEADkbVPK7i
+h9legYsCmEEIjEy82tvuJxuC52pF7BaLT4Wg87JwvVqWuspube5Gi27nKi6Wsxkz67SfqLI37pio
+l7Yutmcn1KZJ/RyTZXaeQi/cImyaT/JaFTmxcdcrUehtHJjA2Sr0oYJ71clBoiMBdDhViw+5Lmei
+IAQ32pwL0xch4I+XeTRvhEgCIDMb5jREn5Fw9IBehEPCKdJsEhTkYY2sEJCehFC78JZvRZ+K88ps
+T/oROhUVRsPNH4NbLUES7VBnQRM9IauUiqpOfMGx+6fWtScvl6tu4B3i0RwsH0Ti/L6RoZz71ilT
+c4afU9hDDl3WY4JxHYB0yvbiAmvZWg==
+-----END CERTIFICATE-----
+
+SecureSign RootCA11
+===================
+-----BEGIN CERTIFICATE-----
+MIIDbTCCAlWgAwIBAgIBATANBgkqhkiG9w0BAQUFADBYMQswCQYDVQQGEwJKUDErMCkGA1UEChMi
+SmFwYW4gQ2VydGlmaWNhdGlvbiBTZXJ2aWNlcywgSW5jLjEcMBoGA1UEAxMTU2VjdXJlU2lnbiBS
+b290Q0ExMTAeFw0wOTA0MDgwNDU2NDdaFw0yOTA0MDgwNDU2NDdaMFgxCzAJBgNVBAYTAkpQMSsw
+KQYDVQQKEyJKYXBhbiBDZXJ0aWZpY2F0aW9uIFNlcnZpY2VzLCBJbmMuMRwwGgYDVQQDExNTZWN1
+cmVTaWduIFJvb3RDQTExMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA/XeqpRyQBTvL
+TJszi1oURaTnkBbR31fSIRCkF/3frNYfp+TbfPfs37gD2pRY/V1yfIw/XwFndBWW4wI8h9uuywGO
+wvNmxoVF9ALGOrVisq/6nL+k5tSAMJjzDbaTj6nU2DbysPyKyiyhFTOVMdrAG/LuYpmGYz+/3ZMq
+g6h2uRMft85OQoWPIucuGvKVCbIFtUROd6EgvanyTgp9UK31BQ1FT0Zx/Sg+U/sE2C3XZR1KG/rP
+O7AxmjVuyIsG0wCR8pQIZUyxNAYAeoni8McDWc/V1uinMrPmmECGxc0nEovMe863ETxiYAcjPitA
+bpSACW22s293bzUIUPsCh8U+iQIDAQABo0IwQDAdBgNVHQ4EFgQUW/hNT7KlhtQ60vFjmqC+CfZX
+t94wDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wDQYJKoZIhvcNAQEFBQADggEBAKCh
+OBZmLqdWHyGcBvod7bkixTgm2E5P7KN/ed5GIaGHd48HCJqypMWvDzKYC3xmKbabfSVSSUOrTC4r
+bnpwrxYO4wJs+0LmGJ1F2FXI6Dvd5+H0LgscNFxsWEr7jIhQX5Ucv+2rIrVls4W6ng+4reV6G4pQ
+Oh29Dbx7VFALuUKvVaAYga1lme++5Jy/xIWrQbJUb9wlze144o4MjQlJ3WN7WmmWAiGovVJZ6X01
+y8hSyn+B/tlr0/cR7SXf+Of5pPpyl4RTDaXQMhhRdlkUbA/r7F+AjHVDg8OFmP9Mni0N5HeDk061
+lgeLKBObjBmNQSdJQO7e5iNEOdyhIta6A/I=
+-----END CERTIFICATE-----
+
+ACEDICOM Root
+=============
+-----BEGIN CERTIFICATE-----
+MIIFtTCCA52gAwIBAgIIYY3HhjsBggUwDQYJKoZIhvcNAQEFBQAwRDEWMBQGA1UEAwwNQUNFRElD
+T00gUm9vdDEMMAoGA1UECwwDUEtJMQ8wDQYDVQQKDAZFRElDT00xCzAJBgNVBAYTAkVTMB4XDTA4
+MDQxODE2MjQyMloXDTI4MDQxMzE2MjQyMlowRDEWMBQGA1UEAwwNQUNFRElDT00gUm9vdDEMMAoG
+A1UECwwDUEtJMQ8wDQYDVQQKDAZFRElDT00xCzAJBgNVBAYTAkVTMIICIjANBgkqhkiG9w0BAQEF
+AAOCAg8AMIICCgKCAgEA/5KV4WgGdrQsyFhIyv2AVClVYyT/kGWbEHV7w2rbYgIB8hiGtXxaOLHk
+WLn709gtn70yN78sFW2+tfQh0hOR2QetAQXW8713zl9CgQr5auODAKgrLlUTY4HKRxx7XBZXehuD
+YAQ6PmXDzQHe3qTWDLqO3tkE7hdWIpuPY/1NFgu3e3eM+SW10W2ZEi5PGrjm6gSSrj0RuVFCPYew
+MYWveVqc/udOXpJPQ/yrOq2lEiZmueIM15jO1FillUAKt0SdE3QrwqXrIhWYENiLxQSfHY9g5QYb
+m8+5eaA9oiM/Qj9r+hwDezCNzmzAv+YbX79nuIQZ1RXve8uQNjFiybwCq0Zfm/4aaJQ0PZCOrfbk
+HQl/Sog4P75n/TSW9R28MHTLOO7VbKvU/PQAtwBbhTIWdjPp2KOZnQUAqhbm84F9b32qhm2tFXTT
+xKJxqvQUfecyuB+81fFOvW8XAjnXDpVCOscAPukmYxHqC9FK/xidstd7LzrZlvvoHpKuE1XI2Sf2
+3EgbsCTBheN3nZqk8wwRHQ3ItBTutYJXCb8gWH8vIiPYcMt5bMlL8qkqyPyHK9caUPgn6C9D4zq9
+2Fdx/c6mUlv53U3t5fZvie27k5x2IXXwkkwp9y+cAS7+UEaeZAwUswdbxcJzbPEHXEUkFDWug/Fq
+TYl6+rPYLWbwNof1K1MCAwEAAaOBqjCBpzAPBgNVHRMBAf8EBTADAQH/MB8GA1UdIwQYMBaAFKaz
+4SsrSbbXc6GqlPUB53NlTKxQMA4GA1UdDwEB/wQEAwIBhjAdBgNVHQ4EFgQUprPhKytJttdzoaqU
+9QHnc2VMrFAwRAYDVR0gBD0wOzA5BgRVHSAAMDEwLwYIKwYBBQUHAgEWI2h0dHA6Ly9hY2VkaWNv
+bS5lZGljb21ncm91cC5jb20vZG9jMA0GCSqGSIb3DQEBBQUAA4ICAQDOLAtSUWImfQwng4/F9tqg
+aHtPkl7qpHMyEVNEskTLnewPeUKzEKbHDZ3Ltvo/Onzqv4hTGzz3gvoFNTPhNahXwOf9jU8/kzJP
+eGYDdwdY6ZXIfj7QeQCM8htRM5u8lOk6e25SLTKeI6RF+7YuE7CLGLHdztUdp0J/Vb77W7tH1Pwk
+zQSulgUV1qzOMPPKC8W64iLgpq0i5ALudBF/TP94HTXa5gI06xgSYXcGCRZj6hitoocf8seACQl1
+ThCojz2GuHURwCRiipZ7SkXp7FnFvmuD5uHorLUwHv4FB4D54SMNUI8FmP8sX+g7tq3PgbUhh8oI
+KiMnMCArz+2UW6yyetLHKKGKC5tNSixthT8Jcjxn4tncB7rrZXtaAWPWkFtPF2Y9fwsZo5NjEFIq
+nxQWWOLcpfShFosOkYuByptZ+thrkQdlVV9SH686+5DdaaVbnG0OLLb6zqylfDJKZ0DcMDQj3dcE
+I2bw/FWAp/tmGYI1Z2JwOV5vx+qQQEQIHriy1tvuWacNGHk0vFQYXlPKNFHtRQrmjseCNj6nOGOp
+MCwXEGCSn1WHElkQwg9naRHMTh5+Spqtr0CodaxWkHS4oJyleW/c6RrIaQXpuvoDs3zk4E7Czp3o
+tkYNbn5XOmeUwssfnHdKZ05phkOTOPu220+DkdRgfks+KzgHVZhepA==
+-----END CERTIFICATE-----
+
+Verisign Class 3 Public Primary Certification Authority
+=======================================================
+-----BEGIN CERTIFICATE-----
+MIICPDCCAaUCEDyRMcsf9tAbDpq40ES/Er4wDQYJKoZIhvcNAQEFBQAwXzELMAkGA1UEBhMCVVMx
+FzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAzIFB1YmxpYyBQcmltYXJ5
+IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MB4XDTk2MDEyOTAwMDAwMFoXDTI4MDgwMjIzNTk1OVow
+XzELMAkGA1UEBhMCVVMxFzAVBgNVBAoTDlZlcmlTaWduLCBJbmMuMTcwNQYDVQQLEy5DbGFzcyAz
+IFB1YmxpYyBQcmltYXJ5IENlcnRpZmljYXRpb24gQXV0aG9yaXR5MIGfMA0GCSqGSIb3DQEBAQUA
+A4GNADCBiQKBgQDJXFme8huKARS0EN8EQNvjV69qRUCPhAwL0TPZ2RHP7gJYHyX3KqhEBarsAx94
+f56TuZoAqiN91qyFomNFx3InzPRMxnVx0jnvT0Lwdd8KkMaOIG+YD/isI19wKTakyYbnsZogy1Ol
+hec9vn2a/iRFM9x2Fe0PonFkTGUugWhFpwIDAQABMA0GCSqGSIb3DQEBBQUAA4GBABByUqkFFBky
+CEHwxWsKzH4PIRnN5GfcX6kb5sroc50i2JhucwNhkcV8sEVAbkSdjbCxlnRhLQ2pRdKkkirWmnWX
+bj9T/UWZYB2oK0z5XqcJ2HUw19JlYD1n1khVdWk/kfVIC0dpImmClr7JyDiGSnoscxlIaU5rfGW/
+D/xwzoiQ
+-----END CERTIFICATE-----
+
+Microsec e-Szigno Root CA 2009
+==============================
+-----BEGIN CERTIFICATE-----
+MIIECjCCAvKgAwIBAgIJAMJ+QwRORz8ZMA0GCSqGSIb3DQEBCwUAMIGCMQswCQYDVQQGEwJIVTER
+MA8GA1UEBwwIQnVkYXBlc3QxFjAUBgNVBAoMDU1pY3Jvc2VjIEx0ZC4xJzAlBgNVBAMMHk1pY3Jv
+c2VjIGUtU3ppZ25vIFJvb3QgQ0EgMjAwOTEfMB0GCSqGSIb3DQEJARYQaW5mb0BlLXN6aWduby5o
+dTAeFw0wOTA2MTYxMTMwMThaFw0yOTEyMzAxMTMwMThaMIGCMQswCQYDVQQGEwJIVTERMA8GA1UE
+BwwIQnVkYXBlc3QxFjAUBgNVBAoMDU1pY3Jvc2VjIEx0ZC4xJzAlBgNVBAMMHk1pY3Jvc2VjIGUt
+U3ppZ25vIFJvb3QgQ0EgMjAwOTEfMB0GCSqGSIb3DQEJARYQaW5mb0BlLXN6aWduby5odTCCASIw
+DQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAOn4j/NjrdqG2KfgQvvPkd6mJviZpWNwrZuuyjNA
+fW2WbqEORO7hE52UQlKavXWFdCyoDh2Tthi3jCyoz/tccbna7P7ofo/kLx2yqHWH2Leh5TvPmUpG
+0IMZfcChEhyVbUr02MelTTMuhTlAdX4UfIASmFDHQWe4oIBhVKZsTh/gnQ4H6cm6M+f+wFUoLAKA
+pxn1ntxVUwOXewdI/5n7N4okxFnMUBBjjqqpGrCEGob5X7uxUG6k0QrM1XF+H6cbfPVTbiJfyyvm
+1HxdrtbCxkzlBQHZ7Vf8wSN5/PrIJIOV87VqUQHQd9bpEqH5GoP7ghu5sJf0dgYzQ0mg/wu1+rUC
+AwEAAaOBgDB+MA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBTLD8bf
+QkPMPcu1SCOhGnqmKrs0aDAfBgNVHSMEGDAWgBTLD8bfQkPMPcu1SCOhGnqmKrs0aDAbBgNVHREE
+FDASgRBpbmZvQGUtc3ppZ25vLmh1MA0GCSqGSIb3DQEBCwUAA4IBAQDJ0Q5eLtXMs3w+y/w9/w0o
+lZMEyL/azXm4Q5DwpL7v8u8hmLzU1F0G9u5C7DBsoKqpyvGvivo/C3NqPuouQH4frlRheesuCDfX
+I/OMn74dseGkddug4lQUsbocKaQY9hK6ohQU4zE1yED/t+AFdlfBHFny+L/k7SViXITwfn4fs775
+tyERzAMBVnCnEJIeGzSBHq2cGsMEPO0CYdYeBvNfOofyK/FFh+U9rNHHV4S9a67c2Pm2G2JwCz02
+yULyMtd6YebS2z3PyKnJm9zbWETXbzivf3jTo60adbocwTZ8jx5tHMN1Rq41Bab2XD0h7lbwyYIi
+LXpUq3DDfSJlgnCW
+-----END CERTIFICATE-----
+
+E-Guven Kok Elektronik Sertifika Hizmet Saglayicisi
+===================================================
+-----BEGIN CERTIFICATE-----
+MIIDtjCCAp6gAwIBAgIQRJmNPMADJ72cdpW56tustTANBgkqhkiG9w0BAQUFADB1MQswCQYDVQQG
+EwJUUjEoMCYGA1UEChMfRWxla3Ryb25payBCaWxnaSBHdXZlbmxpZ2kgQS5TLjE8MDoGA1UEAxMz
+ZS1HdXZlbiBLb2sgRWxla3Ryb25payBTZXJ0aWZpa2EgSGl6bWV0IFNhZ2xheWljaXNpMB4XDTA3
+MDEwNDExMzI0OFoXDTE3MDEwNDExMzI0OFowdTELMAkGA1UEBhMCVFIxKDAmBgNVBAoTH0VsZWt0
+cm9uaWsgQmlsZ2kgR3V2ZW5saWdpIEEuUy4xPDA6BgNVBAMTM2UtR3V2ZW4gS29rIEVsZWt0cm9u
+aWsgU2VydGlmaWthIEhpem1ldCBTYWdsYXlpY2lzaTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCC
+AQoCggEBAMMSIJ6wXgBljU5Gu4Bc6SwGl9XzcslwuedLZYDBS75+PNdUMZTe1RK6UxYC6lhj71vY
+8+0qGqpxSKPcEC1fX+tcS5yWCEIlKBHMilpiAVDV6wlTL/jDj/6z/P2douNffb7tC+Bg62nsM+3Y
+jfsSSYMAyYuXjDtzKjKzEve5TfL0TW3H5tYmNwjy2f1rXKPlSFxYvEK+A1qBuhw1DADT9SN+cTAI
+JjjcJRFHLfO6IxClv7wC90Nex/6wN1CZew+TzuZDLMN+DfIcQ2Zgy2ExR4ejT669VmxMvLz4Bcpk
+9Ok0oSy1c+HCPujIyTQlCFzz7abHlJ+tiEMl1+E5YP6sOVkCAwEAAaNCMEAwDgYDVR0PAQH/BAQD
+AgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFJ/uRLOU1fqRTy7ZVZoEVtstxNulMA0GCSqG
+SIb3DQEBBQUAA4IBAQB/X7lTW2M9dTLn+sR0GstG30ZpHFLPqk/CaOv/gKlR6D1id4k9CnU58W5d
+F4dvaAXBlGzZXd/aslnLpRCKysw5zZ/rTt5S/wzw9JKp8mxTq5vSR6AfdPebmvEvFZ96ZDAYBzwq
+D2fK/A+JYZ1lpTzlvBNbCNvj/+27BrtqBrF6T2XGgv0enIu1De5Iu7i9qgi0+6N8y5/NkHZchpZ4
+Vwpm+Vganf2XKWDeEaaQHBkc7gGWIjQ0LpH5t8Qn0Xvmv/uARFoW5evg1Ao4vOSR49XrXMGs3xtq
+fJ7lddK2l4fbzIcrQzqECK+rPNv3PGYxhrCdU3nt+CPeQuMtgvEP5fqX
+-----END CERTIFICATE-----
+
+GlobalSign Root CA - R3
+=======================
+-----BEGIN CERTIFICATE-----
+MIIDXzCCAkegAwIBAgILBAAAAAABIVhTCKIwDQYJKoZIhvcNAQELBQAwTDEgMB4GA1UECxMXR2xv
+YmFsU2lnbiBSb290IENBIC0gUjMxEzARBgNVBAoTCkdsb2JhbFNpZ24xEzARBgNVBAMTCkdsb2Jh
+bFNpZ24wHhcNMDkwMzE4MTAwMDAwWhcNMjkwMzE4MTAwMDAwWjBMMSAwHgYDVQQLExdHbG9iYWxT
+aWduIFJvb3QgQ0EgLSBSMzETMBEGA1UEChMKR2xvYmFsU2lnbjETMBEGA1UEAxMKR2xvYmFsU2ln
+bjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAMwldpB5BngiFvXAg7aEyiie/QV2EcWt
+iHL8RgJDx7KKnQRfJMsuS+FggkbhUqsMgUdwbN1k0ev1LKMPgj0MK66X17YUhhB5uzsTgHeMCOFJ
+0mpiLx9e+pZo34knlTifBtc+ycsmWQ1z3rDI6SYOgxXG71uL0gRgykmmKPZpO/bLyCiR5Z2KYVc3
+rHQU3HTgOu5yLy6c+9C7v/U9AOEGM+iCK65TpjoWc4zdQQ4gOsC0p6Hpsk+QLjJg6VfLuQSSaGjl
+OCZgdbKfd/+RFO+uIEn8rUAVSNECMWEZXriX7613t2Saer9fwRPvm2L7DWzgVGkWqQPabumDk3F2
+xmmFghcCAwEAAaNCMEAwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE
+FI/wS3+oLkUkrk1Q+mOai97i3Ru8MA0GCSqGSIb3DQEBCwUAA4IBAQBLQNvAUKr+yAzv95ZURUm7
+lgAJQayzE4aGKAczymvmdLm6AC2upArT9fHxD4q/c2dKg8dEe3jgr25sbwMpjjM5RcOO5LlXbKr8
+EpbsU8Yt5CRsuZRj+9xTaGdWPoO4zzUhw8lo/s7awlOqzJCK6fBdRoyV3XpYKBovHd7NADdBj+1E
+bddTKJd+82cEHhXXipa0095MJ6RMG3NzdvQXmcIfeg7jLQitChws/zyrVQ4PkX4268NXSb7hLi18
+YIvDQVETI53O9zJrlAGomecsMx86OyXShkDOOyyGeMlhLxS67ttVb9+E7gUJTb0o2HLO02JQZR7r
+kpeDMdmztcpHWD9f
+-----END CERTIFICATE-----
+
+TC TrustCenter Universal CA III
+===============================
+-----BEGIN CERTIFICATE-----
+MIID4TCCAsmgAwIBAgIOYyUAAQACFI0zFQLkbPQwDQYJKoZIhvcNAQEFBQAwezELMAkGA1UEBhMC
+REUxHDAaBgNVBAoTE1RDIFRydXN0Q2VudGVyIEdtYkgxJDAiBgNVBAsTG1RDIFRydXN0Q2VudGVy
+IFVuaXZlcnNhbCBDQTEoMCYGA1UEAxMfVEMgVHJ1c3RDZW50ZXIgVW5pdmVyc2FsIENBIElJSTAe
+Fw0wOTA5MDkwODE1MjdaFw0yOTEyMzEyMzU5NTlaMHsxCzAJBgNVBAYTAkRFMRwwGgYDVQQKExNU
+QyBUcnVzdENlbnRlciBHbWJIMSQwIgYDVQQLExtUQyBUcnVzdENlbnRlciBVbml2ZXJzYWwgQ0Ex
+KDAmBgNVBAMTH1RDIFRydXN0Q2VudGVyIFVuaXZlcnNhbCBDQSBJSUkwggEiMA0GCSqGSIb3DQEB
+AQUAA4IBDwAwggEKAoIBAQDC2pxisLlxErALyBpXsq6DFJmzNEubkKLF5+cvAqBNLaT6hdqbJYUt
+QCggbergvbFIgyIpRJ9Og+41URNzdNW88jBmlFPAQDYvDIRlzg9uwliT6CwLOunBjvvya8o84pxO
+juT5fdMnnxvVZ3iHLX8LR7PH6MlIfK8vzArZQe+f/prhsq75U7Xl6UafYOPfjdN/+5Z+s7Vy+Eut
+CHnNaYlAJ/Uqwa1D7KRTyGG299J5KmcYdkhtWyUB0SbFt1dpIxVbYYqt8Bst2a9c8SaQaanVDED1
+M4BDj5yjdipFtK+/fz6HP3bFzSreIMUWWMv5G/UPyw0RUmS40nZid4PxWJ//AgMBAAGjYzBhMB8G
+A1UdIwQYMBaAFFbn4VslQ4Dg9ozhcbyO5YAvxEjiMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/
+BAQDAgEGMB0GA1UdDgQWBBRW5+FbJUOA4PaM4XG8juWAL8RI4jANBgkqhkiG9w0BAQUFAAOCAQEA
+g8ev6n9NCjw5sWi+e22JLumzCecYV42FmhfzdkJQEw/HkG8zrcVJYCtsSVgZ1OK+t7+rSbyUyKu+
+KGwWaODIl0YgoGhnYIg5IFHYaAERzqf2EQf27OysGh+yZm5WZ2B6dF7AbZc2rrUNXWZzwCUyRdhK
+BgePxLcHsU0GDeGl6/R1yrqc0L2z0zIkTO5+4nYES0lT2PLpVDP85XEfPRRclkvxOvIAu2y0+pZV
+CIgJwcyRGSmwIC3/yzikQOEXvnlhgP8HA4ZMTnsGnxGGjYnuJ8Tb4rwZjgvDwxPHLQNjO9Po5KIq
+woIIlBZU8O8fJ5AluA0OKBtHd0e9HKgl8ZS0Zg==
+-----END CERTIFICATE-----
+
+Autoridad de Certificacion Firmaprofesional CIF A62634068
+=========================================================
+-----BEGIN CERTIFICATE-----
+MIIGFDCCA/ygAwIBAgIIU+w77vuySF8wDQYJKoZIhvcNAQEFBQAwUTELMAkGA1UEBhMCRVMxQjBA
+BgNVBAMMOUF1dG9yaWRhZCBkZSBDZXJ0aWZpY2FjaW9uIEZpcm1hcHJvZmVzaW9uYWwgQ0lGIEE2
+MjYzNDA2ODAeFw0wOTA1MjAwODM4MTVaFw0zMDEyMzEwODM4MTVaMFExCzAJBgNVBAYTAkVTMUIw
+QAYDVQQDDDlBdXRvcmlkYWQgZGUgQ2VydGlmaWNhY2lvbiBGaXJtYXByb2Zlc2lvbmFsIENJRiBB
+NjI2MzQwNjgwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDKlmuO6vj78aI14H9M2uDD
+Utd9thDIAl6zQyrET2qyyhxdKJp4ERppWVevtSBC5IsP5t9bpgOSL/UR5GLXMnE42QQMcas9UX4P
+B99jBVzpv5RvwSmCwLTaUbDBPLutN0pcyvFLNg4kq7/DhHf9qFD0sefGL9ItWY16Ck6WaVICqjaY
+7Pz6FIMMNx/Jkjd/14Et5cS54D40/mf0PmbR0/RAz15iNA9wBj4gGFrO93IbJWyTdBSTo3OxDqqH
+ECNZXyAFGUftaI6SEspd/NYrspI8IM/hX68gvqB2f3bl7BqGYTM+53u0P6APjqK5am+5hyZvQWyI
+plD9amML9ZMWGxmPsu2bm8mQ9QEM3xk9Dz44I8kvjwzRAv4bVdZO0I08r0+k8/6vKtMFnXkIoctX
+MbScyJCyZ/QYFpM6/EfY0XiWMR+6KwxfXZmtY4laJCB22N/9q06mIqqdXuYnin1oKaPnirjaEbsX
+LZmdEyRG98Xi2J+Of8ePdG1asuhy9azuJBCtLxTa/y2aRnFHvkLfuwHb9H/TKI8xWVvTyQKmtFLK
+bpf7Q8UIJm+K9Lv9nyiqDdVF8xM6HdjAeI9BZzwelGSuewvF6NkBiDkal4ZkQdU7hwxu+g/GvUgU
+vzlN1J5Bto+WHWOWk9mVBngxaJ43BjuAiUVhOSPHG0SjFeUc+JIwuwIDAQABo4HvMIHsMBIGA1Ud
+EwEB/wQIMAYBAf8CAQEwDgYDVR0PAQH/BAQDAgEGMB0GA1UdDgQWBBRlzeurNR4APn7VdMActHNH
+DhpkLzCBpgYDVR0gBIGeMIGbMIGYBgRVHSAAMIGPMC8GCCsGAQUFBwIBFiNodHRwOi8vd3d3LmZp
+cm1hcHJvZmVzaW9uYWwuY29tL2NwczBcBggrBgEFBQcCAjBQHk4AUABhAHMAZQBvACAAZABlACAA
+bABhACAAQgBvAG4AYQBuAG8AdgBhACAANAA3ACAAQgBhAHIAYwBlAGwAbwBuAGEAIAAwADgAMAAx
+ADcwDQYJKoZIhvcNAQEFBQADggIBABd9oPm03cXF661LJLWhAqvdpYhKsg9VSytXjDvlMd3+xDLx
+51tkljYyGOylMnfX40S2wBEqgLk9am58m9Ot/MPWo+ZkKXzR4Tgegiv/J2Wv+xYVxC5xhOW1//qk
+R71kMrv2JYSiJ0L1ILDCExARzRAVukKQKtJE4ZYm6zFIEv0q2skGz3QeqUvVhyj5eTSSPi5E6PaP
+T481PyWzOdxjKpBrIF/EUhJOlywqrJ2X3kjyo2bbwtKDlaZmp54lD+kLM5FlClrD2VQS3a/DTg4f
+Jl4N3LON7NWBcN7STyQF82xO9UxJZo3R/9ILJUFI/lGExkKvgATP0H5kSeTy36LssUzAKh3ntLFl
+osS88Zj0qnAHY7S42jtM+kAiMFsRpvAFDsYCA0irhpuF3dvd6qJ2gHN99ZwExEWN57kci57q13XR
+crHedUTnQn3iV2t93Jm8PYMo6oCTjcVMZcFwgbg4/EMxsvYDNEeyrPsiBsse3RdHHF9mudMaotoR
+saS8I8nkvof/uZS2+F0gStRf571oe2XyFR7SOqkt6dhrJKyXWERHrVkY8SFlcN7ONGCoQPHzPKTD
+KCOM/iczQ0CgFzzr6juwcqajuUpLXhZI9LK8yIySxZ2frHI2vDSANGupi5LAuBft7HZT9SQBjLMi
+6Et8Vcad+qMUu2WFbm5PEn4KPJ2V
+-----END CERTIFICATE-----
+
+Izenpe.com
+==========
+-----BEGIN CERTIFICATE-----
+MIIF8TCCA9mgAwIBAgIQALC3WhZIX7/hy/WL1xnmfTANBgkqhkiG9w0BAQsFADA4MQswCQYDVQQG
+EwJFUzEUMBIGA1UECgwLSVpFTlBFIFMuQS4xEzARBgNVBAMMCkl6ZW5wZS5jb20wHhcNMDcxMjEz
+MTMwODI4WhcNMzcxMjEzMDgyNzI1WjA4MQswCQYDVQQGEwJFUzEUMBIGA1UECgwLSVpFTlBFIFMu
+QS4xEzARBgNVBAMMCkl6ZW5wZS5jb20wggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDJ
+03rKDx6sp4boFmVqscIbRTJxldn+EFvMr+eleQGPicPK8lVx93e+d5TzcqQsRNiekpsUOqHnJJAK
+ClaOxdgmlOHZSOEtPtoKct2jmRXagaKH9HtuJneJWK3W6wyyQXpzbm3benhB6QiIEn6HLmYRY2xU
++zydcsC8Lv/Ct90NduM61/e0aL6i9eOBbsFGb12N4E3GVFWJGjMxCrFXuaOKmMPsOzTFlUFpfnXC
+PCDFYbpRR6AgkJOhkEvzTnyFRVSa0QUmQbC1TR0zvsQDyCV8wXDbO/QJLVQnSKwv4cSsPsjLkkxT
+OTcj7NMB+eAJRE1NZMDhDVqHIrytG6P+JrUV86f8hBnp7KGItERphIPzidF0BqnMC9bC3ieFUCbK
+F7jJeodWLBoBHmy+E60QrLUk9TiRodZL2vG70t5HtfG8gfZZa88ZU+mNFctKy6lvROUbQc/hhqfK
+0GqfvEyNBjNaooXlkDWgYlwWTvDjovoDGrQscbNYLN57C9saD+veIR8GdwYDsMnvmfzAuU8Lhij+
+0rnq49qlw0dpEuDb8PYZi+17cNcC1u2HGCgsBCRMd+RIihrGO5rUD8r6ddIBQFqNeb+Lz0vPqhbB
+leStTIo+F5HUsWLlguWABKQDfo2/2n+iD5dPDNMN+9fR5XJ+HMh3/1uaD7euBUbl8agW7EekFwID
+AQABo4H2MIHzMIGwBgNVHREEgagwgaWBD2luZm9AaXplbnBlLmNvbaSBkTCBjjFHMEUGA1UECgw+
+SVpFTlBFIFMuQS4gLSBDSUYgQTAxMzM3MjYwLVJNZXJjLlZpdG9yaWEtR2FzdGVpeiBUMTA1NSBG
+NjIgUzgxQzBBBgNVBAkMOkF2ZGEgZGVsIE1lZGl0ZXJyYW5lbyBFdG9yYmlkZWEgMTQgLSAwMTAx
+MCBWaXRvcmlhLUdhc3RlaXowDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0O
+BBYEFB0cZQ6o8iV7tJHP5LGx5r1VdGwFMA0GCSqGSIb3DQEBCwUAA4ICAQB4pgwWSp9MiDrAyw6l
+Fn2fuUhfGI8NYjb2zRlrrKvV9pF9rnHzP7MOeIWblaQnIUdCSnxIOvVFfLMMjlF4rJUT3sb9fbga
+kEyrkgPH7UIBzg/YsfqikuFgba56awmqxinuaElnMIAkejEWOVt+8Rwu3WwJrfIxwYJOubv5vr8q
+hT/AQKM6WfxZSzwoJNu0FXWuDYi6LnPAvViH5ULy617uHjAimcs30cQhbIHsvm0m5hzkQiCeR7Cs
+g1lwLDXWrzY0tM07+DKo7+N4ifuNRSzanLh+QBxh5z6ikixL8s36mLYp//Pye6kfLqCTVyvehQP5
+aTfLnnhqBbTFMXiJ7HqnheG5ezzevh55hM6fcA5ZwjUukCox2eRFekGkLhObNA5me0mrZJfQRsN5
+nXJQY6aYWwa9SG3YOYNw6DXwBdGqvOPbyALqfP2C2sJbUjWumDqtujWTI6cfSN01RpiyEGjkpTHC
+ClguGYEQyVB1/OpaFs4R1+7vUIgtYf8/QnMFlEPVjjxOAToZpR9GTnfQXeWBIiGH/pR9hNiTrdZo
+Q0iy2+tzJOeRf1SktoA+naM8THLCV8Sg1Mw4J87VBp6iSNnpn86CcDaTmjvfliHjWbcM2pE38P1Z
+WrOZyGlsQyYBNWNgVYkDOnXYukrZVP/u3oDYLdE41V4tC5h9Pmzb/CaIxw==
+-----END CERTIFICATE-----
+
+Chambers of Commerce Root - 2008
+================================
+-----BEGIN CERTIFICATE-----
+MIIHTzCCBTegAwIBAgIJAKPaQn6ksa7aMA0GCSqGSIb3DQEBBQUAMIGuMQswCQYDVQQGEwJFVTFD
+MEEGA1UEBxM6TWFkcmlkIChzZWUgY3VycmVudCBhZGRyZXNzIGF0IHd3dy5jYW1lcmZpcm1hLmNv
+bS9hZGRyZXNzKTESMBAGA1UEBRMJQTgyNzQzMjg3MRswGQYDVQQKExJBQyBDYW1lcmZpcm1hIFMu
+QS4xKTAnBgNVBAMTIENoYW1iZXJzIG9mIENvbW1lcmNlIFJvb3QgLSAyMDA4MB4XDTA4MDgwMTEy
+Mjk1MFoXDTM4MDczMTEyMjk1MFowga4xCzAJBgNVBAYTAkVVMUMwQQYDVQQHEzpNYWRyaWQgKHNl
+ZSBjdXJyZW50IGFkZHJlc3MgYXQgd3d3LmNhbWVyZmlybWEuY29tL2FkZHJlc3MpMRIwEAYDVQQF
+EwlBODI3NDMyODcxGzAZBgNVBAoTEkFDIENhbWVyZmlybWEgUy5BLjEpMCcGA1UEAxMgQ2hhbWJl
+cnMgb2YgQ29tbWVyY2UgUm9vdCAtIDIwMDgwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoIC
+AQCvAMtwNyuAWko6bHiUfaN/Gh/2NdW928sNRHI+JrKQUrpjOyhYb6WzbZSm891kDFX29ufyIiKA
+XuFixrYp4YFs8r/lfTJqVKAyGVn+H4vXPWCGhSRv4xGzdz4gljUha7MI2XAuZPeEklPWDrCQiorj
+h40G072QDuKZoRuGDtqaCrsLYVAGUvGef3bsyw/QHg3PmTA9HMRFEFis1tPo1+XqxQEHd9ZR5gN/
+ikilTWh1uem8nk4ZcfUyS5xtYBkL+8ydddy/Js2Pk3g5eXNeJQ7KXOt3EgfLZEFHcpOrUMPrCXZk
+NNI5t3YRCQ12RcSprj1qr7V9ZS+UWBDsXHyvfuK2GNnQm05aSd+pZgvMPMZ4fKecHePOjlO+Bd5g
+D2vlGts/4+EhySnB8esHnFIbAURRPHsl18TlUlRdJQfKFiC4reRB7noI/plvg6aRArBsNlVq5331
+lubKgdaX8ZSD6e2wsWsSaR6s+12pxZjptFtYer49okQ6Y1nUCyXeG0+95QGezdIp1Z8XGQpvvwyQ
+0wlf2eOKNcx5Wk0ZN5K3xMGtr/R5JJqyAQuxr1yW84Ay+1w9mPGgP0revq+ULtlVmhduYJ1jbLhj
+ya6BXBg14JC7vjxPNyK5fuvPnnchpj04gftI2jE9K+OJ9dC1vX7gUMQSibMjmhAxhduub+84Mxh2
+EQIDAQABo4IBbDCCAWgwEgYDVR0TAQH/BAgwBgEB/wIBDDAdBgNVHQ4EFgQU+SSsD7K1+HnA+mCI
+G8TZTQKeFxkwgeMGA1UdIwSB2zCB2IAU+SSsD7K1+HnA+mCIG8TZTQKeFxmhgbSkgbEwga4xCzAJ
+BgNVBAYTAkVVMUMwQQYDVQQHEzpNYWRyaWQgKHNlZSBjdXJyZW50IGFkZHJlc3MgYXQgd3d3LmNh
+bWVyZmlybWEuY29tL2FkZHJlc3MpMRIwEAYDVQQFEwlBODI3NDMyODcxGzAZBgNVBAoTEkFDIENh
+bWVyZmlybWEgUy5BLjEpMCcGA1UEAxMgQ2hhbWJlcnMgb2YgQ29tbWVyY2UgUm9vdCAtIDIwMDiC
+CQCj2kJ+pLGu2jAOBgNVHQ8BAf8EBAMCAQYwPQYDVR0gBDYwNDAyBgRVHSAAMCowKAYIKwYBBQUH
+AgEWHGh0dHA6Ly9wb2xpY3kuY2FtZXJmaXJtYS5jb20wDQYJKoZIhvcNAQEFBQADggIBAJASryI1
+wqM58C7e6bXpeHxIvj99RZJe6dqxGfwWPJ+0W2aeaufDuV2I6A+tzyMP3iU6XsxPpcG1Lawk0lgH
+3qLPaYRgM+gQDROpI9CF5Y57pp49chNyM/WqfcZjHwj0/gF/JM8rLFQJ3uIrbZLGOU8W6jx+ekbU
+RWpGqOt1glanq6B8aBMz9p0w8G8nOSQjKpD9kCk18pPfNKXG9/jvjA9iSnyu0/VU+I22mlaHFoI6
+M6taIgj3grrqLuBHmrS1RaMFO9ncLkVAO+rcf+g769HsJtg1pDDFOqxXnrN2pSB7+R5KBWIBpih1
+YJeSDW4+TTdDDZIVnBgizVGZoCkaPF+KMjNbMMeJL0eYD6MDxvbxrN8y8NmBGuScvfaAFPDRLLmF
+9dijscilIeUcE5fuDr3fKanvNFNb0+RqE4QGtjICxFKuItLcsiFCGtpA8CnJ7AoMXOLQusxI0zcK
+zBIKinmwPQN/aUv0NCB9szTqjktk9T79syNnFQ0EuPAtwQlRPLJsFfClI9eDdOTlLsn+mCdCxqvG
+nrDQWzilm1DefhiYtUU79nm06PcaewaD+9CL2rvHvRirCG88gGtAPxkZumWK5r7VXNM21+9AUiRg
+OGcEMeyP84LG3rlV8zsxkVrctQgVrXYlCg17LofiDKYGvCYQbTed7N14jHyAxfDZd0jQ
+-----END CERTIFICATE-----
+
+Global Chambersign Root - 2008
+==============================
+-----BEGIN CERTIFICATE-----
+MIIHSTCCBTGgAwIBAgIJAMnN0+nVfSPOMA0GCSqGSIb3DQEBBQUAMIGsMQswCQYDVQQGEwJFVTFD
+MEEGA1UEBxM6TWFkcmlkIChzZWUgY3VycmVudCBhZGRyZXNzIGF0IHd3dy5jYW1lcmZpcm1hLmNv
+bS9hZGRyZXNzKTESMBAGA1UEBRMJQTgyNzQzMjg3MRswGQYDVQQKExJBQyBDYW1lcmZpcm1hIFMu
+QS4xJzAlBgNVBAMTHkdsb2JhbCBDaGFtYmVyc2lnbiBSb290IC0gMjAwODAeFw0wODA4MDExMjMx
+NDBaFw0zODA3MzExMjMxNDBaMIGsMQswCQYDVQQGEwJFVTFDMEEGA1UEBxM6TWFkcmlkIChzZWUg
+Y3VycmVudCBhZGRyZXNzIGF0IHd3dy5jYW1lcmZpcm1hLmNvbS9hZGRyZXNzKTESMBAGA1UEBRMJ
+QTgyNzQzMjg3MRswGQYDVQQKExJBQyBDYW1lcmZpcm1hIFMuQS4xJzAlBgNVBAMTHkdsb2JhbCBD
+aGFtYmVyc2lnbiBSb290IC0gMjAwODCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMDf
+VtPkOpt2RbQT2//BthmLN0EYlVJH6xedKYiONWwGMi5HYvNJBL99RDaxccy9Wglz1dmFRP+RVyXf
+XjaOcNFccUMd2drvXNL7G706tcuto8xEpw2uIRU/uXpbknXYpBI4iRmKt4DS4jJvVpyR1ogQC7N0
+ZJJ0YPP2zxhPYLIj0Mc7zmFLmY/CDNBAspjcDahOo7kKrmCgrUVSY7pmvWjg+b4aqIG7HkF4ddPB
+/gBVsIdU6CeQNR1MM62X/JcumIS/LMmjv9GYERTtY/jKmIhYF5ntRQOXfjyGHoiMvvKRhI9lNNgA
+TH23MRdaKXoKGCQwoze1eqkBfSbW+Q6OWfH9GzO1KTsXO0G2Id3UwD2ln58fQ1DJu7xsepeY7s2M
+H/ucUa6LcL0nn3HAa6x9kGbo1106DbDVwo3VyJ2dwW3Q0L9R5OP4wzg2rtandeavhENdk5IMagfe
+Ox2YItaswTXbo6Al/3K1dh3ebeksZixShNBFks4c5eUzHdwHU1SjqoI7mjcv3N2gZOnm3b2u/GSF
+HTynyQbehP9r6GsaPMWis0L7iwk+XwhSx2LE1AVxv8Rk5Pihg+g+EpuoHtQ2TS9x9o0o9oOpE9Jh
+wZG7SMA0j0GMS0zbaRL/UJScIINZc+18ofLx/d33SdNDWKBWY8o9PeU1VlnpDsogzCtLkykPAgMB
+AAGjggFqMIIBZjASBgNVHRMBAf8ECDAGAQH/AgEMMB0GA1UdDgQWBBS5CcqcHtvTbDprru1U8VuT
+BjUuXjCB4QYDVR0jBIHZMIHWgBS5CcqcHtvTbDprru1U8VuTBjUuXqGBsqSBrzCBrDELMAkGA1UE
+BhMCRVUxQzBBBgNVBAcTOk1hZHJpZCAoc2VlIGN1cnJlbnQgYWRkcmVzcyBhdCB3d3cuY2FtZXJm
+aXJtYS5jb20vYWRkcmVzcykxEjAQBgNVBAUTCUE4Mjc0MzI4NzEbMBkGA1UEChMSQUMgQ2FtZXJm
+aXJtYSBTLkEuMScwJQYDVQQDEx5HbG9iYWwgQ2hhbWJlcnNpZ24gUm9vdCAtIDIwMDiCCQDJzdPp
+1X0jzjAOBgNVHQ8BAf8EBAMCAQYwPQYDVR0gBDYwNDAyBgRVHSAAMCowKAYIKwYBBQUHAgEWHGh0
+dHA6Ly9wb2xpY3kuY2FtZXJmaXJtYS5jb20wDQYJKoZIhvcNAQEFBQADggIBAICIf3DekijZBZRG
+/5BXqfEv3xoNa/p8DhxJJHkn2EaqbylZUohwEurdPfWbU1Rv4WCiqAm57OtZfMY18dwY6fFn5a+6
+ReAJ3spED8IXDneRRXozX1+WLGiLwUePmJs9wOzL9dWCkoQ10b42OFZyMVtHLaoXpGNR6woBrX/s
+dZ7LoR/xfxKxueRkf2fWIyr0uDldmOghp+G9PUIadJpwr2hsUF1Jz//7Dl3mLEfXgTpZALVza2Mg
+9jFFCDkO9HB+QHBaP9BrQql0PSgvAm11cpUJjUhjxsYjV5KTXjXBjfkK9yydYhz2rXzdpjEetrHH
+foUm+qRqtdpjMNHvkzeyZi99Bffnt0uYlDXA2TopwZ2yUDMdSqlapskD7+3056huirRXhOukP9Du
+qqqHW2Pok+JrqNS4cnhrG+055F3Lm6qH1U9OAP7Zap88MQ8oAgF9mOinsKJknnn4SPIVqczmyETr
+P3iZ8ntxPjzxmKfFGBI/5rsoM0LpRQp8bfKGeS/Fghl9CYl8slR2iK7ewfPM4W7bMdaTrpmg7yVq
+c5iJWzouE4gev8CSlDQb4ye3ix5vQv/n6TebUB0tovkC7stYWDpxvGjjqsGvHCgfotwjZT+B6q6Z
+09gwzxMNTxXJhLynSC34MCN32EZLeW32jO06f2ARePTpm67VVMB0gNELQp/B
+-----END CERTIFICATE-----
+
+Go Daddy Root Certificate Authority - G2
+========================================
+-----BEGIN CERTIFICATE-----
+MIIDxTCCAq2gAwIBAgIBADANBgkqhkiG9w0BAQsFADCBgzELMAkGA1UEBhMCVVMxEDAOBgNVBAgT
+B0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxGjAYBgNVBAoTEUdvRGFkZHkuY29tLCBJbmMu
+MTEwLwYDVQQDEyhHbyBEYWRkeSBSb290IENlcnRpZmljYXRlIEF1dGhvcml0eSAtIEcyMB4XDTA5
+MDkwMTAwMDAwMFoXDTM3MTIzMTIzNTk1OVowgYMxCzAJBgNVBAYTAlVTMRAwDgYDVQQIEwdBcml6
+b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMRowGAYDVQQKExFHb0RhZGR5LmNvbSwgSW5jLjExMC8G
+A1UEAxMoR28gRGFkZHkgUm9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkgLSBHMjCCASIwDQYJKoZI
+hvcNAQEBBQADggEPADCCAQoCggEBAL9xYgjx+lk09xvJGKP3gElY6SKDE6bFIEMBO4Tx5oVJnyfq
+9oQbTqC023CYxzIBsQU+B07u9PpPL1kwIuerGVZr4oAH/PMWdYA5UXvl+TW2dE6pjYIT5LY/qQOD
++qK+ihVqf94Lw7YZFAXK6sOoBJQ7RnwyDfMAZiLIjWltNowRGLfTshxgtDj6AozO091GB94KPutd
+fMh8+7ArU6SSYmlRJQVhGkSBjCypQ5Yj36w6gZoOKcUcqeldHraenjAKOc7xiID7S13MMuyFYkMl
+NAJWJwGRtDtwKj9useiciAF9n9T521NtYJ2/LOdYq7hfRvzOxBsDPAnrSTFcaUaz4EcCAwEAAaNC
+MEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFDqahQcQZyi27/a9
+BUFuIMGU2g/eMA0GCSqGSIb3DQEBCwUAA4IBAQCZ21151fmXWWcDYfF+OwYxdS2hII5PZYe096ac
+vNjpL9DbWu7PdIxztDhC2gV7+AJ1uP2lsdeu9tfeE8tTEH6KRtGX+rcuKxGrkLAngPnon1rpN5+r
+5N9ss4UXnT3ZJE95kTXWXwTrgIOrmgIttRD02JDHBHNA7XIloKmf7J6raBKZV8aPEjoJpL1E/QYV
+N8Gb5DKj7Tjo2GTzLH4U/ALqn83/B2gX2yKQOC16jdFU8WnjXzPKej17CuPKf1855eJ1usV2GDPO
+LPAvTK33sefOT6jEm0pUBsV/fdUID+Ic/n4XuKxe9tQWskMJDE32p2u0mYRlynqI4uJEvlz36hz1
+-----END CERTIFICATE-----
+
+Starfield Root Certificate Authority - G2
+=========================================
+-----BEGIN CERTIFICATE-----
+MIID3TCCAsWgAwIBAgIBADANBgkqhkiG9w0BAQsFADCBjzELMAkGA1UEBhMCVVMxEDAOBgNVBAgT
+B0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxJTAjBgNVBAoTHFN0YXJmaWVsZCBUZWNobm9s
+b2dpZXMsIEluYy4xMjAwBgNVBAMTKVN0YXJmaWVsZCBSb290IENlcnRpZmljYXRlIEF1dGhvcml0
+eSAtIEcyMB4XDTA5MDkwMTAwMDAwMFoXDTM3MTIzMTIzNTk1OVowgY8xCzAJBgNVBAYTAlVTMRAw
+DgYDVQQIEwdBcml6b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMSUwIwYDVQQKExxTdGFyZmllbGQg
+VGVjaG5vbG9naWVzLCBJbmMuMTIwMAYDVQQDEylTdGFyZmllbGQgUm9vdCBDZXJ0aWZpY2F0ZSBB
+dXRob3JpdHkgLSBHMjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAL3twQP89o/8ArFv
+W59I2Z154qK3A2FWGMNHttfKPTUuiUP3oWmb3ooa/RMgnLRJdzIpVv257IzdIvpy3Cdhl+72WoTs
+bhm5iSzchFvVdPtrX8WJpRBSiUZV9Lh1HOZ/5FSuS/hVclcCGfgXcVnrHigHdMWdSL5stPSksPNk
+N3mSwOxGXn/hbVNMYq/NHwtjuzqd+/x5AJhhdM8mgkBj87JyahkNmcrUDnXMN/uLicFZ8WJ/X7Nf
+ZTD4p7dNdloedl40wOiWVpmKs/B/pM293DIxfJHP4F8R+GuqSVzRmZTRouNjWwl2tVZi4Ut0HZbU
+JtQIBFnQmA4O5t78w+wfkPECAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC
+AQYwHQYDVR0OBBYEFHwMMh+n2TB/xH1oo2Kooc6rB1snMA0GCSqGSIb3DQEBCwUAA4IBAQARWfol
+TwNvlJk7mh+ChTnUdgWUXuEok21iXQnCoKjUsHU48TRqneSfioYmUeYs0cYtbpUgSpIB7LiKZ3sx
+4mcujJUDJi5DnUox9g61DLu34jd/IroAow57UvtruzvE03lRTs2Q9GcHGcg8RnoNAX3FWOdt5oUw
+F5okxBDgBPfg8n/Uqgr/Qh037ZTlZFkSIHc40zI+OIF1lnP6aI+xy84fxez6nH7PfrHxBy22/L/K
+pL/QlwVKvOoYKAKQvVR4CSFx09F9HdkWsKlhPdAKACL8x3vLCWRFCztAgfd9fDL1mMpYjn0q7pBZ
+c2T5NnReJaH1ZgUufzkVqSr7UIuOhWn0
+-----END CERTIFICATE-----
+
+Starfield Services Root Certificate Authority - G2
+==================================================
+-----BEGIN CERTIFICATE-----
+MIID7zCCAtegAwIBAgIBADANBgkqhkiG9w0BAQsFADCBmDELMAkGA1UEBhMCVVMxEDAOBgNVBAgT
+B0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxJTAjBgNVBAoTHFN0YXJmaWVsZCBUZWNobm9s
+b2dpZXMsIEluYy4xOzA5BgNVBAMTMlN0YXJmaWVsZCBTZXJ2aWNlcyBSb290IENlcnRpZmljYXRl
+IEF1dGhvcml0eSAtIEcyMB4XDTA5MDkwMTAwMDAwMFoXDTM3MTIzMTIzNTk1OVowgZgxCzAJBgNV
+BAYTAlVTMRAwDgYDVQQIEwdBcml6b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMSUwIwYDVQQKExxT
+dGFyZmllbGQgVGVjaG5vbG9naWVzLCBJbmMuMTswOQYDVQQDEzJTdGFyZmllbGQgU2VydmljZXMg
+Um9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkgLSBHMjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCC
+AQoCggEBANUMOsQq+U7i9b4Zl1+OiFOxHz/Lz58gE20pOsgPfTz3a3Y4Y9k2YKibXlwAgLIvWX/2
+h/klQ4bnaRtSmpDhcePYLQ1Ob/bISdm28xpWriu2dBTrz/sm4xq6HZYuajtYlIlHVv8loJNwU4Pa
+hHQUw2eeBGg6345AWh1KTs9DkTvnVtYAcMtS7nt9rjrnvDH5RfbCYM8TWQIrgMw0R9+53pBlbQLP
+LJGmpufehRhJfGZOozptqbXuNC66DQO4M99H67FrjSXZm86B0UVGMpZwh94CDklDhbZsc7tk6mFB
+rMnUVN+HL8cisibMn1lUaJ/8viovxFUcdUBgF4UCVTmLfwUCAwEAAaNCMEAwDwYDVR0TAQH/BAUw
+AwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFJxfAN+qAdcwKziIorhtSpzyEZGDMA0GCSqG
+SIb3DQEBCwUAA4IBAQBLNqaEd2ndOxmfZyMIbw5hyf2E3F/YNoHN2BtBLZ9g3ccaaNnRbobhiCPP
+E95Dz+I0swSdHynVv/heyNXBve6SbzJ08pGCL72CQnqtKrcgfU28elUSwhXqvfdqlS5sdJ/PHLTy
+xQGjhdByPq1zqwubdQxtRbeOlKyWN7Wg0I8VRw7j6IPdj/3vQQF3zCepYoUz8jcI73HPdwbeyBkd
+iEDPfUYd/x7H4c7/I9vG+o1VTqkC50cRRj70/b17KSa7qWFiNyi2LSr2EIZkyXCn0q23KXB56jza
+YyWf/Wi3MOxw+3WKt21gZ7IeyLnp2KhvAotnDU0mV3HaIPzBSlCNsSi6
+-----END CERTIFICATE-----
+
+AffirmTrust Commercial
+======================
+-----BEGIN CERTIFICATE-----
+MIIDTDCCAjSgAwIBAgIId3cGJyapsXwwDQYJKoZIhvcNAQELBQAwRDELMAkGA1UEBhMCVVMxFDAS
+BgNVBAoMC0FmZmlybVRydXN0MR8wHQYDVQQDDBZBZmZpcm1UcnVzdCBDb21tZXJjaWFsMB4XDTEw
+MDEyOTE0MDYwNloXDTMwMTIzMTE0MDYwNlowRDELMAkGA1UEBhMCVVMxFDASBgNVBAoMC0FmZmly
+bVRydXN0MR8wHQYDVQQDDBZBZmZpcm1UcnVzdCBDb21tZXJjaWFsMIIBIjANBgkqhkiG9w0BAQEF
+AAOCAQ8AMIIBCgKCAQEA9htPZwcroRX1BiLLHwGy43NFBkRJLLtJJRTWzsO3qyxPxkEylFf6Eqdb
+DuKPHx6GGaeqtS25Xw2Kwq+FNXkyLbscYjfysVtKPcrNcV/pQr6U6Mje+SJIZMblq8Yrba0F8PrV
+C8+a5fBQpIs7R6UjW3p6+DM/uO+Zl+MgwdYoic+U+7lF7eNAFxHUdPALMeIrJmqbTFeurCA+ukV6
+BfO9m2kVrn1OIGPENXY6BwLJN/3HR+7o8XYdcxXyl6S1yHp52UKqK39c/s4mT6NmgTWvRLpUHhww
+MmWd5jyTXlBOeuM61G7MGvv50jeuJCqrVwMiKA1JdX+3KNp1v47j3A55MQIDAQABo0IwQDAdBgNV
+HQ4EFgQUnZPGU4teyq8/nx4P5ZmVvCT2lI8wDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC
+AQYwDQYJKoZIhvcNAQELBQADggEBAFis9AQOzcAN/wr91LoWXym9e2iZWEnStB03TX8nfUYGXUPG
+hi4+c7ImfU+TqbbEKpqrIZcUsd6M06uJFdhrJNTxFq7YpFzUf1GO7RgBsZNjvbz4YYCanrHOQnDi
+qX0GJX0nof5v7LMeJNrjS1UaADs1tDvZ110w/YETifLCBivtZ8SOyUOyXGsViQK8YvxO8rUzqrJv
+0wqiUOP2O+guRMLbZjipM1ZI8W0bM40NjD9gN53Tym1+NH4Nn3J2ixufcv1SNUFFApYvHLKac0kh
+sUlHRUe072o0EclNmsxZt9YCnlpOZbWUrhvfKbAW8b8Angc6F2S1BLUjIZkKlTuXfO8=
+-----END CERTIFICATE-----
+
+AffirmTrust Networking
+======================
+-----BEGIN CERTIFICATE-----
+MIIDTDCCAjSgAwIBAgIIfE8EORzUmS0wDQYJKoZIhvcNAQEFBQAwRDELMAkGA1UEBhMCVVMxFDAS
+BgNVBAoMC0FmZmlybVRydXN0MR8wHQYDVQQDDBZBZmZpcm1UcnVzdCBOZXR3b3JraW5nMB4XDTEw
+MDEyOTE0MDgyNFoXDTMwMTIzMTE0MDgyNFowRDELMAkGA1UEBhMCVVMxFDASBgNVBAoMC0FmZmly
+bVRydXN0MR8wHQYDVQQDDBZBZmZpcm1UcnVzdCBOZXR3b3JraW5nMIIBIjANBgkqhkiG9w0BAQEF
+AAOCAQ8AMIIBCgKCAQEAtITMMxcua5Rsa2FSoOujz3mUTOWUgJnLVWREZY9nZOIG41w3SfYvm4SE
+Hi3yYJ0wTsyEheIszx6e/jarM3c1RNg1lho9Nuh6DtjVR6FqaYvZ/Ls6rnla1fTWcbuakCNrmreI
+dIcMHl+5ni36q1Mr3Lt2PpNMCAiMHqIjHNRqrSK6mQEubWXLviRmVSRLQESxG9fhwoXA3hA/Pe24
+/PHxI1Pcv2WXb9n5QHGNfb2V1M6+oF4nI979ptAmDgAp6zxG8D1gvz9Q0twmQVGeFDdCBKNwV6gb
+h+0t+nvujArjqWaJGctB+d1ENmHP4ndGyH329JKBNv3bNPFyfvMMFr20FQIDAQABo0IwQDAdBgNV
+HQ4EFgQUBx/S55zawm6iQLSwelAQUHTEyL0wDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC
+AQYwDQYJKoZIhvcNAQEFBQADggEBAIlXshZ6qML91tmbmzTCnLQyFE2npN/svqe++EPbkTfOtDIu
+UFUaNU52Q3Eg75N3ThVwLofDwR1t3Mu1J9QsVtFSUzpE0nPIxBsFZVpikpzuQY0x2+c06lkh1QF6
+12S4ZDnNye2v7UsDSKegmQGA3GWjNq5lWUhPgkvIZfFXHeVZLgo/bNjR9eUJtGxUAArgFU2HdW23
+WJZa3W3SAKD0m0i+wzekujbgfIeFlxoVot4uolu9rxj5kFDNcFn4J2dHy8egBzp90SxdbBk6ZrV9
+/ZFvgrG+CJPbFEfxojfHRZ48x3evZKiT3/Zpg4Jg8klCNO1aAFSFHBY2kgxc+qatv9s=
+-----END CERTIFICATE-----
+
+AffirmTrust Premium
+===================
+-----BEGIN CERTIFICATE-----
+MIIFRjCCAy6gAwIBAgIIbYwURrGmCu4wDQYJKoZIhvcNAQEMBQAwQTELMAkGA1UEBhMCVVMxFDAS
+BgNVBAoMC0FmZmlybVRydXN0MRwwGgYDVQQDDBNBZmZpcm1UcnVzdCBQcmVtaXVtMB4XDTEwMDEy
+OTE0MTAzNloXDTQwMTIzMTE0MTAzNlowQTELMAkGA1UEBhMCVVMxFDASBgNVBAoMC0FmZmlybVRy
+dXN0MRwwGgYDVQQDDBNBZmZpcm1UcnVzdCBQcmVtaXVtMIICIjANBgkqhkiG9w0BAQEFAAOCAg8A
+MIICCgKCAgEAxBLfqV/+Qd3d9Z+K4/as4Tx4mrzY8H96oDMq3I0gW64tb+eT2TZwamjPjlGjhVtn
+BKAQJG9dKILBl1fYSCkTtuG+kU3fhQxTGJoeJKJPj/CihQvL9Cl/0qRY7iZNyaqoe5rZ+jjeRFcV
+5fiMyNlI4g0WJx0eyIOFJbe6qlVBzAMiSy2RjYvmia9mx+n/K+k8rNrSs8PhaJyJ+HoAVt70VZVs
++7pk3WKL3wt3MutizCaam7uqYoNMtAZ6MMgpv+0GTZe5HMQxK9VfvFMSF5yZVylmd2EhMQcuJUmd
+GPLu8ytxjLW6OQdJd/zvLpKQBY0tL3d770O/Nbua2Plzpyzy0FfuKE4mX4+QaAkvuPjcBukumj5R
+p9EixAqnOEhss/n/fauGV+O61oV4d7pD6kh/9ti+I20ev9E2bFhc8e6kGVQa9QPSdubhjL08s9NI
+S+LI+H+SqHZGnEJlPqQewQcDWkYtuJfzt9WyVSHvutxMAJf7FJUnM7/oQ0dG0giZFmA7mn7S5u04
+6uwBHjxIVkkJx0w3AJ6IDsBz4W9m6XJHMD4Q5QsDyZpCAGzFlH5hxIrff4IaC1nEWTJ3s7xgaVY5
+/bQGeyzWZDbZvUjthB9+pSKPKrhC9IK31FOQeE4tGv2Bb0TXOwF0lkLgAOIua+rF7nKsu7/+6qqo
++Nz2snmKtmcCAwEAAaNCMEAwHQYDVR0OBBYEFJ3AZ6YMItkm9UWrpmVSESfYRaxjMA8GA1UdEwEB
+/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMA0GCSqGSIb3DQEBDAUAA4ICAQCzV00QYk465KzquByv
+MiPIs0laUZx2KI15qldGF9X1Uva3ROgIRL8YhNILgM3FEv0AVQVhh0HctSSePMTYyPtwni94loMg
+Nt58D2kTiKV1NpgIpsbfrM7jWNa3Pt668+s0QNiigfV4Py/VpfzZotReBA4Xrf5B8OWycvpEgjNC
+6C1Y91aMYj+6QrCcDFx+LmUmXFNPALJ4fqENmS2NuB2OosSw/WDQMKSOyARiqcTtNd56l+0OOF6S
+L5Nwpamcb6d9Ex1+xghIsV5n61EIJenmJWtSKZGc0jlzCFfemQa0W50QBuHCAKi4HEoCChTQwUHK
++4w1IX2COPKpVJEZNZOUbWo6xbLQu4mGk+ibyQ86p3q4ofB4Rvr8Ny/lioTz3/4E2aFooC8k4gmV
+BtWVyuEklut89pMFu+1z6S3RdTnX5yTb2E5fQ4+e0BQ5v1VwSJlXMbSc7kqYA5YwH2AG7hsj/oFg
+IxpHYoWlzBk0gG+zrBrjn/B7SK3VAdlntqlyk+otZrWyuOQ9PLLvTIzq6we/qzWaVYa8GKa1qF60
+g2xraUDTn9zxw2lrueFtCfTxqlB2Cnp9ehehVZZCmTEJ3WARjQUwfuaORtGdFNrHF+QFlozEJLUb
+zxQHskD4o55BhrwE0GuWyCqANP2/7waj3VjFhT0+j/6eKeC2uAloGRwYQw==
+-----END CERTIFICATE-----
+
+AffirmTrust Premium ECC
+=======================
+-----BEGIN CERTIFICATE-----
+MIIB/jCCAYWgAwIBAgIIdJclisc/elQwCgYIKoZIzj0EAwMwRTELMAkGA1UEBhMCVVMxFDASBgNV
+BAoMC0FmZmlybVRydXN0MSAwHgYDVQQDDBdBZmZpcm1UcnVzdCBQcmVtaXVtIEVDQzAeFw0xMDAx
+MjkxNDIwMjRaFw00MDEyMzExNDIwMjRaMEUxCzAJBgNVBAYTAlVTMRQwEgYDVQQKDAtBZmZpcm1U
+cnVzdDEgMB4GA1UEAwwXQWZmaXJtVHJ1c3QgUHJlbWl1bSBFQ0MwdjAQBgcqhkjOPQIBBgUrgQQA
+IgNiAAQNMF4bFZ0D0KF5Nbc6PJJ6yhUczWLznCZcBz3lVPqj1swS6vQUX+iOGasvLkjmrBhDeKzQ
+N8O9ss0s5kfiGuZjuD0uL3jET9v0D6RoTFVya5UdThhClXjMNzyR4ptlKymjQjBAMB0GA1UdDgQW
+BBSaryl6wBE1NSZRMADDav5A1a7WPDAPBgNVHRMBAf8EBTADAQH/MA4GA1UdDwEB/wQEAwIBBjAK
+BggqhkjOPQQDAwNnADBkAjAXCfOHiFBar8jAQr9HX/VsaobgxCd05DhT1wV/GzTjxi+zygk8N53X
+57hG8f2h4nECMEJZh0PUUd+60wkyWs6Iflc9nF9Ca/UHLbXwgpP5WW+uZPpY5Yse42O+tYHNbwKM
+eQ==
+-----END CERTIFICATE-----
+
+Certum Trusted Network CA
+=========================
+-----BEGIN CERTIFICATE-----
+MIIDuzCCAqOgAwIBAgIDBETAMA0GCSqGSIb3DQEBBQUAMH4xCzAJBgNVBAYTAlBMMSIwIAYDVQQK
+ExlVbml6ZXRvIFRlY2hub2xvZ2llcyBTLkEuMScwJQYDVQQLEx5DZXJ0dW0gQ2VydGlmaWNhdGlv
+biBBdXRob3JpdHkxIjAgBgNVBAMTGUNlcnR1bSBUcnVzdGVkIE5ldHdvcmsgQ0EwHhcNMDgxMDIy
+MTIwNzM3WhcNMjkxMjMxMTIwNzM3WjB+MQswCQYDVQQGEwJQTDEiMCAGA1UEChMZVW5pemV0byBU
+ZWNobm9sb2dpZXMgUy5BLjEnMCUGA1UECxMeQ2VydHVtIENlcnRpZmljYXRpb24gQXV0aG9yaXR5
+MSIwIAYDVQQDExlDZXJ0dW0gVHJ1c3RlZCBOZXR3b3JrIENBMIIBIjANBgkqhkiG9w0BAQEFAAOC
+AQ8AMIIBCgKCAQEA4/t9o3K6wvDJFIf1awFO4W5AB7ptJ11/91sts1rHUV+rpDKmYYe2bg+G0jAC
+l/jXaVehGDldamR5xgFZrDwxSjh80gTSSyjoIF87B6LMTXPb865Px1bVWqeWifrzq2jUI4ZZJ88J
+J7ysbnKDHDBy3+Ci6dLhdHUZvSqeexVUBBvXQzmtVSjF4hq79MDkrjhJM8x2hZ85RdKknvISjFH4
+fOQtf/WsX+sWn7Et0brMkUJ3TCXJkDhv2/DM+44el1k+1WBO5gUo7Ul5E0u6SNsv+XLTOcr+H9g0
+cvW0QM8xAcPs3hEtF10fuFDRXhmnad4HMyjKUJX5p1TLVIZQRan5SQIDAQABo0IwQDAPBgNVHRMB
+Af8EBTADAQH/MB0GA1UdDgQWBBQIds3LB/8k9sXN7buQvOKEN0Z19zAOBgNVHQ8BAf8EBAMCAQYw
+DQYJKoZIhvcNAQEFBQADggEBAKaorSLOAT2mo/9i0Eidi15ysHhE49wcrwn9I0j6vSrEuVUEtRCj
+jSfeC4Jj0O7eDDd5QVsisrCaQVymcODU0HfLI9MA4GxWL+FpDQ3Zqr8hgVDZBqWo/5U30Kr+4rP1
+mS1FhIrlQgnXdAIv94nYmem8J9RHjboNRhx3zxSkHLmkMcScKHQDNP8zGSal6Q10tz6XxnboJ5aj
+Zt3hrvJBW8qYVoNzcOSGGtIxQbovvi0TWnZvTuhOgQ4/WwMioBK+ZlgRSssDxLQqKi2WF+A5VLxI
+03YnnZotBqbJ7DnSq9ufmgsnAjUpsUCV5/nonFWIGUbWtzT1fs45mtk48VH3Tyw=
+-----END CERTIFICATE-----
+
+Certinomis - Autorité Racine
+=============================
+-----BEGIN CERTIFICATE-----
+MIIFnDCCA4SgAwIBAgIBATANBgkqhkiG9w0BAQUFADBjMQswCQYDVQQGEwJGUjETMBEGA1UEChMK
+Q2VydGlub21pczEXMBUGA1UECxMOMDAwMiA0MzM5OTg5MDMxJjAkBgNVBAMMHUNlcnRpbm9taXMg
+LSBBdXRvcml0w6kgUmFjaW5lMB4XDTA4MDkxNzA4Mjg1OVoXDTI4MDkxNzA4Mjg1OVowYzELMAkG
+A1UEBhMCRlIxEzARBgNVBAoTCkNlcnRpbm9taXMxFzAVBgNVBAsTDjAwMDIgNDMzOTk4OTAzMSYw
+JAYDVQQDDB1DZXJ0aW5vbWlzIC0gQXV0b3JpdMOpIFJhY2luZTCCAiIwDQYJKoZIhvcNAQEBBQAD
+ggIPADCCAgoCggIBAJ2Fn4bT46/HsmtuM+Cet0I0VZ35gb5j2CN2DpdUzZlMGvE5x4jYF1AMnmHa
+wE5V3udauHpOd4cN5bjr+p5eex7Ezyh0x5P1FMYiKAT5kcOrJ3NqDi5N8y4oH3DfVS9O7cdxbwly
+Lu3VMpfQ8Vh30WC8Tl7bmoT2R2FFK/ZQpn9qcSdIhDWerP5pqZ56XjUl+rSnSTV3lqc2W+HN3yNw
+2F1MpQiD8aYkOBOo7C+ooWfHpi2GR+6K/OybDnT0K0kCe5B1jPyZOQE51kqJ5Z52qz6WKDgmi92N
+jMD2AR5vpTESOH2VwnHu7XSu5DaiQ3XV8QCb4uTXzEIDS3h65X27uK4uIJPT5GHfceF2Z5c/tt9q
+c1pkIuVC28+BA5PY9OMQ4HL2AHCs8MF6DwV/zzRpRbWT5BnbUhYjBYkOjUjkJW+zeL9i9Qf6lSTC
+lrLooyPCXQP8w9PlfMl1I9f09bze5N/NgL+RiH2nE7Q5uiy6vdFrzPOlKO1Enn1So2+WLhl+HPNb
+xxaOu2B9d2ZHVIIAEWBsMsGoOBvrbpgT1u449fCfDu/+MYHB0iSVL1N6aaLwD4ZFjliCK0wi1F6g
+530mJ0jfJUaNSih8hp75mxpZuWW/Bd22Ql095gBIgl4g9xGC3srYn+Y3RyYe63j3YcNBZFgCQfna
+4NH4+ej9Uji29YnfAgMBAAGjWzBZMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgEGMB0G
+A1UdDgQWBBQNjLZh2kS40RR9w759XkjwzspqsDAXBgNVHSAEEDAOMAwGCiqBegFWAgIAAQEwDQYJ
+KoZIhvcNAQEFBQADggIBACQ+YAZ+He86PtvqrxyaLAEL9MW12Ukx9F1BjYkMTv9sov3/4gbIOZ/x
+WqndIlgVqIrTseYyCYIDbNc/CMf4uboAbbnW/FIyXaR/pDGUu7ZMOH8oMDX/nyNTt7buFHAAQCva
+R6s0fl6nVjBhK4tDrP22iCj1a7Y+YEq6QpA0Z43q619FVDsXrIvkxmUP7tCMXWY5zjKn2BCXwH40
+nJ+U8/aGH88bc62UeYdocMMzpXDn2NU4lG9jeeu/Cg4I58UvD0KgKxRA/yHgBcUn4YQRE7rWhh1B
+CxMjidPJC+iKunqjo3M3NYB9Ergzd0A4wPpeMNLytqOx1qKVl4GbUu1pTP+A5FPbVFsDbVRfsbjv
+JL1vnxHDx2TCDyhihWZeGnuyt++uNckZM6i4J9szVb9o4XVIRFb7zdNIu0eJOqxp9YDG5ERQL1TE
+qkPFMTFYvZbF6nVsmnWxTfj3l/+WFvKXTej28xH5On2KOG4Ey+HTRRWqpdEdnV1j6CTmNhTih60b
+WfVEm/vXd3wfAXBioSAaosUaKPQhA+4u2cGA6rnZgtZbdsLLO7XSAPCjDuGtbkD326C00EauFddE
+wk01+dIL8hf2rGbVJLJP0RyZwG71fet0BLj5TXcJ17TPBzAJ8bgAVtkXFhYKK4bfjwEZGuW7gmP/
+vgt2Fl43N+bYdJeimUV5
+-----END CERTIFICATE-----
+
+Root CA Generalitat Valenciana
+==============================
+-----BEGIN CERTIFICATE-----
+MIIGizCCBXOgAwIBAgIEO0XlaDANBgkqhkiG9w0BAQUFADBoMQswCQYDVQQGEwJFUzEfMB0GA1UE
+ChMWR2VuZXJhbGl0YXQgVmFsZW5jaWFuYTEPMA0GA1UECxMGUEtJR1ZBMScwJQYDVQQDEx5Sb290
+IENBIEdlbmVyYWxpdGF0IFZhbGVuY2lhbmEwHhcNMDEwNzA2MTYyMjQ3WhcNMjEwNzAxMTUyMjQ3
+WjBoMQswCQYDVQQGEwJFUzEfMB0GA1UEChMWR2VuZXJhbGl0YXQgVmFsZW5jaWFuYTEPMA0GA1UE
+CxMGUEtJR1ZBMScwJQYDVQQDEx5Sb290IENBIEdlbmVyYWxpdGF0IFZhbGVuY2lhbmEwggEiMA0G
+CSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDGKqtXETcvIorKA3Qdyu0togu8M1JAJke+WmmmO3I2
+F0zo37i7L3bhQEZ0ZQKQUgi0/6iMweDHiVYQOTPvaLRfX9ptI6GJXiKjSgbwJ/BXufjpTjJ3Cj9B
+ZPPrZe52/lSqfR0grvPXdMIKX/UIKFIIzFVd0g/bmoGlu6GzwZTNVOAydTGRGmKy3nXiz0+J2ZGQ
+D0EbtFpKd71ng+CT516nDOeB0/RSrFOyA8dEJvt55cs0YFAQexvba9dHq198aMpunUEDEO5rmXte
+JajCq+TA81yc477OMUxkHl6AovWDfgzWyoxVjr7gvkkHD6MkQXpYHYTqWBLI4bft75PelAgxAgMB
+AAGjggM7MIIDNzAyBggrBgEFBQcBAQQmMCQwIgYIKwYBBQUHMAGGFmh0dHA6Ly9vY3NwLnBraS5n
+dmEuZXMwEgYDVR0TAQH/BAgwBgEB/wIBAjCCAjQGA1UdIASCAiswggInMIICIwYKKwYBBAG/VQIB
+ADCCAhMwggHoBggrBgEFBQcCAjCCAdoeggHWAEEAdQB0AG8AcgBpAGQAYQBkACAAZABlACAAQwBl
+AHIAdABpAGYAaQBjAGEAYwBpAPMAbgAgAFIAYQDtAHoAIABkAGUAIABsAGEAIABHAGUAbgBlAHIA
+YQBsAGkAdABhAHQAIABWAGEAbABlAG4AYwBpAGEAbgBhAC4ADQAKAEwAYQAgAEQAZQBjAGwAYQBy
+AGEAYwBpAPMAbgAgAGQAZQAgAFAAcgDhAGMAdABpAGMAYQBzACAAZABlACAAQwBlAHIAdABpAGYA
+aQBjAGEAYwBpAPMAbgAgAHEAdQBlACAAcgBpAGcAZQAgAGUAbAAgAGYAdQBuAGMAaQBvAG4AYQBt
+AGkAZQBuAHQAbwAgAGQAZQAgAGwAYQAgAHAAcgBlAHMAZQBuAHQAZQAgAEEAdQB0AG8AcgBpAGQA
+YQBkACAAZABlACAAQwBlAHIAdABpAGYAaQBjAGEAYwBpAPMAbgAgAHMAZQAgAGUAbgBjAHUAZQBu
+AHQAcgBhACAAZQBuACAAbABhACAAZABpAHIAZQBjAGMAaQDzAG4AIAB3AGUAYgAgAGgAdAB0AHAA
+OgAvAC8AdwB3AHcALgBwAGsAaQAuAGcAdgBhAC4AZQBzAC8AYwBwAHMwJQYIKwYBBQUHAgEWGWh0
+dHA6Ly93d3cucGtpLmd2YS5lcy9jcHMwHQYDVR0OBBYEFHs100DSHHgZZu90ECjcPk+yeAT8MIGV
+BgNVHSMEgY0wgYqAFHs100DSHHgZZu90ECjcPk+yeAT8oWykajBoMQswCQYDVQQGEwJFUzEfMB0G
+A1UEChMWR2VuZXJhbGl0YXQgVmFsZW5jaWFuYTEPMA0GA1UECxMGUEtJR1ZBMScwJQYDVQQDEx5S
+b290IENBIEdlbmVyYWxpdGF0IFZhbGVuY2lhbmGCBDtF5WgwDQYJKoZIhvcNAQEFBQADggEBACRh
+TvW1yEICKrNcda3FbcrnlD+laJWIwVTAEGmiEi8YPyVQqHxK6sYJ2fR1xkDar1CdPaUWu20xxsdz
+Ckj+IHLtb8zog2EWRpABlUt9jppSCS/2bxzkoXHPjCpaF3ODR00PNvsETUlR4hTJZGH71BTg9J63
+NI8KJr2XXPR5OkowGcytT6CYirQxlyric21+eLj4iIlPsSKRZEv1UN4D2+XFducTZnV+ZfsBn5OH
+iJ35Rld8TWCvmHMTI6QgkYH60GFmuH3Rr9ZvHmw96RH9qfmCIoaZM3Fa6hlXPZHNqcCjbgcTpsnt
++GijnsNacgmHKNHEc8RzGF9QdRYxn7fofMM=
+-----END CERTIFICATE-----
+
+A-Trust-nQual-03
+================
+-----BEGIN CERTIFICATE-----
+MIIDzzCCAregAwIBAgIDAWweMA0GCSqGSIb3DQEBBQUAMIGNMQswCQYDVQQGEwJBVDFIMEYGA1UE
+Cgw/QS1UcnVzdCBHZXMuIGYuIFNpY2hlcmhlaXRzc3lzdGVtZSBpbSBlbGVrdHIuIERhdGVudmVy
+a2VociBHbWJIMRkwFwYDVQQLDBBBLVRydXN0LW5RdWFsLTAzMRkwFwYDVQQDDBBBLVRydXN0LW5R
+dWFsLTAzMB4XDTA1MDgxNzIyMDAwMFoXDTE1MDgxNzIyMDAwMFowgY0xCzAJBgNVBAYTAkFUMUgw
+RgYDVQQKDD9BLVRydXN0IEdlcy4gZi4gU2ljaGVyaGVpdHNzeXN0ZW1lIGltIGVsZWt0ci4gRGF0
+ZW52ZXJrZWhyIEdtYkgxGTAXBgNVBAsMEEEtVHJ1c3QtblF1YWwtMDMxGTAXBgNVBAMMEEEtVHJ1
+c3QtblF1YWwtMDMwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCtPWFuA/OQO8BBC4SA
+zewqo51ru27CQoT3URThoKgtUaNR8t4j8DRE/5TrzAUjlUC5B3ilJfYKvUWG6Nm9wASOhURh73+n
+yfrBJcyFLGM/BWBzSQXgYHiVEEvc+RFZznF/QJuKqiTfC0Li21a8StKlDJu3Qz7dg9MmEALP6iPE
+SU7l0+m0iKsMrmKS1GWH2WrX9IWf5DMiJaXlyDO6w8dB3F/GaswADm0yqLaHNgBid5seHzTLkDx4
+iHQF63n1k3Flyp3HaxgtPVxO59X4PzF9j4fsCiIvI+n+u33J4PTs63zEsMMtYrWacdaxaujs2e3V
+cuy+VwHOBVWf3tFgiBCzAgMBAAGjNjA0MA8GA1UdEwEB/wQFMAMBAf8wEQYDVR0OBAoECERqlWdV
+eRFPMA4GA1UdDwEB/wQEAwIBBjANBgkqhkiG9w0BAQUFAAOCAQEAVdRU0VlIXLOThaq/Yy/kgM40
+ozRiPvbY7meIMQQDbwvUB/tOdQ/TLtPAF8fGKOwGDREkDg6lXb+MshOWcdzUzg4NCmgybLlBMRmr
+sQd7TZjTXLDR8KdCoLXEjq/+8T/0709GAHbrAvv5ndJAlseIOrifEXnzgGWovR/TeIGgUUw3tKZd
+JXDRZslo+S4RFGjxVJgIrCaSD96JntT6s3kr0qN51OyLrIdTaEJMUVF0HhsnLuP1Hyl0Te2v9+GS
+mYHovjrHF1D2t8b8m7CKa9aIA5GPBnc6hQLdmNVDeD/GMBWsm2vLV7eJUYs66MmEDNuxUCAKGkq6
+ahq97BvIxYSazQ==
+-----END CERTIFICATE-----
+
+TWCA Root Certification Authority
+=================================
+-----BEGIN CERTIFICATE-----
+MIIDezCCAmOgAwIBAgIBATANBgkqhkiG9w0BAQUFADBfMQswCQYDVQQGEwJUVzESMBAGA1UECgwJ
+VEFJV0FOLUNBMRAwDgYDVQQLDAdSb290IENBMSowKAYDVQQDDCFUV0NBIFJvb3QgQ2VydGlmaWNh
+dGlvbiBBdXRob3JpdHkwHhcNMDgwODI4MDcyNDMzWhcNMzAxMjMxMTU1OTU5WjBfMQswCQYDVQQG
+EwJUVzESMBAGA1UECgwJVEFJV0FOLUNBMRAwDgYDVQQLDAdSb290IENBMSowKAYDVQQDDCFUV0NB
+IFJvb3QgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEK
+AoIBAQCwfnK4pAOU5qfeCTiRShFAh6d8WWQUe7UREN3+v9XAu1bihSX0NXIP+FPQQeFEAcK0HMMx
+QhZHhTMidrIKbw/lJVBPhYa+v5guEGcevhEFhgWQxFnQfHgQsIBct+HHK3XLfJ+utdGdIzdjp9xC
+oi2SBBtQwXu4PhvJVgSLL1KbralW6cH/ralYhzC2gfeXRfwZVzsrb+RH9JlF/h3x+JejiB03HFyP
+4HYlmlD4oFT/RJB2I9IyxsOrBr/8+7/zrX2SYgJbKdM1o5OaQ2RgXbL6Mv87BK9NQGr5x+PvI/1r
+y+UPizgN7gr8/g+YnzAx3WxSZfmLgb4i4RxYA7qRG4kHAgMBAAGjQjBAMA4GA1UdDwEB/wQEAwIB
+BjAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBRqOFsmjd6LWvJPelSDGRjjCDWmujANBgkqhkiG
+9w0BAQUFAAOCAQEAPNV3PdrfibqHDAhUaiBQkr6wQT25JmSDCi/oQMCXKCeCMErJk/9q56YAf4lC
+mtYR5VPOL8zy2gXE/uJQxDqGfczafhAJO5I1KlOy/usrBdlsXebQ79NqZp4VKIV66IIArB6nCWlW
+QtNoURi+VJq/REG6Sb4gumlc7rh3zc5sH62Dlhh9DrUUOYTxKOkto557HnpyWoOzeW/vtPzQCqVY
+T0bf+215WfKEIlKuD8z7fDvnaspHYcN6+NOSBB+4IIThNlQWx0DeO4pz3N/GCUzf7Nr/1FNCocny
+Yh0igzyXxfkZYiesZSLX0zzG5Y6yU8xJzrww/nsOM5D77dIUkR8Hrw==
+-----END CERTIFICATE-----
+
+Security Communication RootCA2
+==============================
+-----BEGIN CERTIFICATE-----
+MIIDdzCCAl+gAwIBAgIBADANBgkqhkiG9w0BAQsFADBdMQswCQYDVQQGEwJKUDElMCMGA1UEChMc
+U0VDT00gVHJ1c3QgU3lzdGVtcyBDTy4sTFRELjEnMCUGA1UECxMeU2VjdXJpdHkgQ29tbXVuaWNh
+dGlvbiBSb290Q0EyMB4XDTA5MDUyOTA1MDAzOVoXDTI5MDUyOTA1MDAzOVowXTELMAkGA1UEBhMC
+SlAxJTAjBgNVBAoTHFNFQ09NIFRydXN0IFN5c3RlbXMgQ08uLExURC4xJzAlBgNVBAsTHlNlY3Vy
+aXR5IENvbW11bmljYXRpb24gUm9vdENBMjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEB
+ANAVOVKxUrO6xVmCxF1SrjpDZYBLx/KWvNs2l9amZIyoXvDjChz335c9S672XewhtUGrzbl+dp++
++T42NKA7wfYxEUV0kz1XgMX5iZnK5atq1LXaQZAQwdbWQonCv/Q4EpVMVAX3NuRFg3sUZdbcDE3R
+3n4MqzvEFb46VqZab3ZpUql6ucjrappdUtAtCms1FgkQhNBqyjoGADdH5H5XTz+L62e4iKrFvlNV
+spHEfbmwhRkGeC7bYRr6hfVKkaHnFtWOojnflLhwHyg/i/xAXmODPIMqGplrz95Zajv8bxbXH/1K
+EOtOghY6rCcMU/Gt1SSwawNQwS08Ft1ENCcadfsCAwEAAaNCMEAwHQYDVR0OBBYEFAqFqXdlBZh8
+QIH4D5csOPEK7DzPMA4GA1UdDwEB/wQEAwIBBjAPBgNVHRMBAf8EBTADAQH/MA0GCSqGSIb3DQEB
+CwUAA4IBAQBMOqNErLlFsceTfsgLCkLfZOoc7llsCLqJX2rKSpWeeo8HxdpFcoJxDjrSzG+ntKEj
+u/Ykn8sX/oymzsLS28yN/HH8AynBbF0zX2S2ZTuJbxh2ePXcokgfGT+Ok+vx+hfuzU7jBBJV1uXk
+3fs+BXziHV7Gp7yXT2g69ekuCkO2r1dcYmh8t/2jioSgrGK+KwmHNPBqAbubKVY8/gA3zyNs8U6q
+tnRGEmyR7jTV7JqR50S+kDFy1UkC9gLl9B/rfNmWVan/7Ir5mUf/NVoCqgTLiluHcSmRvaS0eg29
+mvVXIwAHIRc/SjnRBUkLp7Y3gaVdjKozXoEofKd9J+sAro03
+-----END CERTIFICATE-----
+
+EC-ACC
+======
+-----BEGIN CERTIFICATE-----
+MIIFVjCCBD6gAwIBAgIQ7is969Qh3hSoYqwE893EATANBgkqhkiG9w0BAQUFADCB8zELMAkGA1UE
+BhMCRVMxOzA5BgNVBAoTMkFnZW5jaWEgQ2F0YWxhbmEgZGUgQ2VydGlmaWNhY2lvIChOSUYgUS0w
+ODAxMTc2LUkpMSgwJgYDVQQLEx9TZXJ2ZWlzIFB1YmxpY3MgZGUgQ2VydGlmaWNhY2lvMTUwMwYD
+VQQLEyxWZWdldSBodHRwczovL3d3dy5jYXRjZXJ0Lm5ldC92ZXJhcnJlbCAoYykwMzE1MDMGA1UE
+CxMsSmVyYXJxdWlhIEVudGl0YXRzIGRlIENlcnRpZmljYWNpbyBDYXRhbGFuZXMxDzANBgNVBAMT
+BkVDLUFDQzAeFw0wMzAxMDcyMzAwMDBaFw0zMTAxMDcyMjU5NTlaMIHzMQswCQYDVQQGEwJFUzE7
+MDkGA1UEChMyQWdlbmNpYSBDYXRhbGFuYSBkZSBDZXJ0aWZpY2FjaW8gKE5JRiBRLTA4MDExNzYt
+SSkxKDAmBgNVBAsTH1NlcnZlaXMgUHVibGljcyBkZSBDZXJ0aWZpY2FjaW8xNTAzBgNVBAsTLFZl
+Z2V1IGh0dHBzOi8vd3d3LmNhdGNlcnQubmV0L3ZlcmFycmVsIChjKTAzMTUwMwYDVQQLEyxKZXJh
+cnF1aWEgRW50aXRhdHMgZGUgQ2VydGlmaWNhY2lvIENhdGFsYW5lczEPMA0GA1UEAxMGRUMtQUND
+MIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAsyLHT+KXQpWIR4NA9h0X84NzJB5R85iK
+w5K4/0CQBXCHYMkAqbWUZRkiFRfCQ2xmRJoNBD45b6VLeqpjt4pEndljkYRm4CgPukLjbo73FCeT
+ae6RDqNfDrHrZqJyTxIThmV6PttPB/SnCWDaOkKZx7J/sxaVHMf5NLWUhdWZXqBIoH7nF2W4onW4
+HvPlQn2v7fOKSGRdghST2MDk/7NQcvJ29rNdQlB50JQ+awwAvthrDk4q7D7SzIKiGGUzE3eeml0a
+E9jD2z3Il3rucO2n5nzbcc8tlGLfbdb1OL4/pYUKGbio2Al1QnDE6u/LDsg0qBIimAy4E5S2S+zw
+0JDnJwIDAQABo4HjMIHgMB0GA1UdEQQWMBSBEmVjX2FjY0BjYXRjZXJ0Lm5ldDAPBgNVHRMBAf8E
+BTADAQH/MA4GA1UdDwEB/wQEAwIBBjAdBgNVHQ4EFgQUoMOLRKo3pUW/l4Ba0fF4opvpXY0wfwYD
+VR0gBHgwdjB0BgsrBgEEAfV4AQMBCjBlMCwGCCsGAQUFBwIBFiBodHRwczovL3d3dy5jYXRjZXJ0
+Lm5ldC92ZXJhcnJlbDA1BggrBgEFBQcCAjApGidWZWdldSBodHRwczovL3d3dy5jYXRjZXJ0Lm5l
+dC92ZXJhcnJlbCAwDQYJKoZIhvcNAQEFBQADggEBAKBIW4IB9k1IuDlVNZyAelOZ1Vr/sXE7zDkJ
+lF7W2u++AVtd0x7Y/X1PzaBB4DSTv8vihpw3kpBWHNzrKQXlxJ7HNd+KDM3FIUPpqojlNcAZQmNa
+Al6kSBg6hW/cnbw/nZzBh7h6YQjpdwt/cKt63dmXLGQehb+8dJahw3oS7AwaboMMPOhyRp/7SNVe
+l+axofjk70YllJyJ22k4vuxcDlbHZVHlUIiIv0LVKz3l+bqeLrPK9HOSAgu+TGbrIP65y7WZf+a2
+E/rKS03Z7lNGBjvGTq2TWoF+bCpLagVFjPIhpDGQh2xlnJ2lYJU6Un/10asIbvPuW/mIPX64b24D
+5EI=
+-----END CERTIFICATE-----
+
+Hellenic Academic and Research Institutions RootCA 2011
+=======================================================
+-----BEGIN CERTIFICATE-----
+MIIEMTCCAxmgAwIBAgIBADANBgkqhkiG9w0BAQUFADCBlTELMAkGA1UEBhMCR1IxRDBCBgNVBAoT
+O0hlbGxlbmljIEFjYWRlbWljIGFuZCBSZXNlYXJjaCBJbnN0aXR1dGlvbnMgQ2VydC4gQXV0aG9y
+aXR5MUAwPgYDVQQDEzdIZWxsZW5pYyBBY2FkZW1pYyBhbmQgUmVzZWFyY2ggSW5zdGl0dXRpb25z
+IFJvb3RDQSAyMDExMB4XDTExMTIwNjEzNDk1MloXDTMxMTIwMTEzNDk1MlowgZUxCzAJBgNVBAYT
+AkdSMUQwQgYDVQQKEztIZWxsZW5pYyBBY2FkZW1pYyBhbmQgUmVzZWFyY2ggSW5zdGl0dXRpb25z
+IENlcnQuIEF1dGhvcml0eTFAMD4GA1UEAxM3SGVsbGVuaWMgQWNhZGVtaWMgYW5kIFJlc2VhcmNo
+IEluc3RpdHV0aW9ucyBSb290Q0EgMjAxMTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEB
+AKlTAOMupvaO+mDYLZU++CwqVE7NuYRhlFhPjz2L5EPzdYmNUeTDN9KKiE15HrcS3UN4SoqS5tdI
+1Q+kOilENbgH9mgdVc04UfCMJDGFr4PJfel3r+0ae50X+bOdOFAPplp5kYCvN66m0zH7tSYJnTxa
+71HFK9+WXesyHgLacEnsbgzImjeN9/E2YEsmLIKe0HjzDQ9jpFEw4fkrJxIH2Oq9GGKYsFk3fb7u
+8yBRQlqD75O6aRXxYp2fmTmCobd0LovUxQt7L/DICto9eQqakxylKHJzkUOap9FNhYS5qXSPFEDH
+3N6sQWRstBmbAmNtJGSPRLIl6s5ddAxjMlyNh+UCAwEAAaOBiTCBhjAPBgNVHRMBAf8EBTADAQH/
+MAsGA1UdDwQEAwIBBjAdBgNVHQ4EFgQUppFC/RNhSiOeCKQp5dgTBCPuQSUwRwYDVR0eBEAwPqA8
+MAWCAy5ncjAFggMuZXUwBoIELmVkdTAGggQub3JnMAWBAy5ncjAFgQMuZXUwBoEELmVkdTAGgQQu
+b3JnMA0GCSqGSIb3DQEBBQUAA4IBAQAf73lB4XtuP7KMhjdCSk4cNx6NZrokgclPEg8hwAOXhiVt
+XdMiKahsog2p6z0GW5k6x8zDmjR/qw7IThzh+uTczQ2+vyT+bOdrwg3IBp5OjWEopmr95fZi6hg8
+TqBTnbI6nOulnJEWtk2C4AwFSKls9cz4y51JtPACpf1wA+2KIaWuE4ZJwzNzvoc7dIsXRSZMFpGD
+/md9zU1jZ/rzAxKWeAaNsWftjj++n08C9bMJL/NMh98qy5V8AcysNnq/onN694/BtZqhFLKPM58N
+7yLcZnuEvUUXBj08yrl3NI/K6s8/MT7jiOOASSXIl7WdmplNsDz4SgCbZN2fOUvRJ9e4
+-----END CERTIFICATE-----
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/certs.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/certs.py
new file mode 100644
index 0000000..bc00826
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/certs.py
@@ -0,0 +1,24 @@
+#!/usr/bin/env python
+# -*- coding: utf-8 -*-
+
+"""
+certs.py
+~~~~~~~~
+
+This module returns the preferred default CA certificate bundle.
+
+If you are packaging Requests, e.g., for a Linux distribution or a managed
+environment, you can change the definition of where() to return a separately
+packaged CA bundle.
+"""
+
+import os.path
+
+
+def where():
+    """Return the preferred certificate bundle."""
+    # vendored bundle inside Requests
+    return os.path.join(os.path.dirname(__file__), 'cacert.pem')
+
+if __name__ == '__main__':
+    print(where())
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/compat.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/compat.py
new file mode 100644
index 0000000..0d61a57
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/compat.py
@@ -0,0 +1,115 @@
+# -*- coding: utf-8 -*-
+
+"""
+pythoncompat
+"""
+
+from .packages import charade as chardet
+
+import sys
+
+# -------
+# Pythons
+# -------
+
+# Syntax sugar.
+_ver = sys.version_info
+
+#: Python 2.x?
+is_py2 = (_ver[0] == 2)
+
+#: Python 3.x?
+is_py3 = (_ver[0] == 3)
+
+#: Python 3.0.x
+is_py30 = (is_py3 and _ver[1] == 0)
+
+#: Python 3.1.x
+is_py31 = (is_py3 and _ver[1] == 1)
+
+#: Python 3.2.x
+is_py32 = (is_py3 and _ver[1] == 2)
+
+#: Python 3.3.x
+is_py33 = (is_py3 and _ver[1] == 3)
+
+#: Python 3.4.x
+is_py34 = (is_py3 and _ver[1] == 4)
+
+#: Python 2.7.x
+is_py27 = (is_py2 and _ver[1] == 7)
+
+#: Python 2.6.x
+is_py26 = (is_py2 and _ver[1] == 6)
+
+#: Python 2.5.x
+is_py25 = (is_py2 and _ver[1] == 5)
+
+#: Python 2.4.x
+is_py24 = (is_py2 and _ver[1] == 4)   # I'm assuming this is not by choice.
+
+
+# ---------
+# Platforms
+# ---------
+
+
+# Syntax sugar.
+_ver = sys.version.lower()
+
+is_pypy = ('pypy' in _ver)
+is_jython = ('jython' in _ver)
+is_ironpython = ('iron' in _ver)
+
+# Assume CPython, if nothing else.
+is_cpython = not any((is_pypy, is_jython, is_ironpython))
+
+# Windows-based system.
+is_windows = 'win32' in str(sys.platform).lower()
+
+# Standard Linux 2+ system.
+is_linux = ('linux' in str(sys.platform).lower())
+is_osx = ('darwin' in str(sys.platform).lower())
+is_hpux = ('hpux' in str(sys.platform).lower())   # Complete guess.
+is_solaris = ('solar==' in str(sys.platform).lower())   # Complete guess.
+
+try:
+    import simplejson as json
+except ImportError:
+    import json
+
+# ---------
+# Specifics
+# ---------
+
+if is_py2:
+    from urllib import quote, unquote, quote_plus, unquote_plus, urlencode, getproxies, proxy_bypass
+    from urlparse import urlparse, urlunparse, urljoin, urlsplit, urldefrag
+    from urllib2 import parse_http_list
+    import cookielib
+    from Cookie import Morsel
+    from StringIO import StringIO
+    from .packages.urllib3.packages.ordered_dict import OrderedDict
+    from httplib import IncompleteRead
+
+    builtin_str = str
+    bytes = str
+    str = unicode
+    basestring = basestring
+    numeric_types = (int, long, float)
+
+
+elif is_py3:
+    from urllib.parse import urlparse, urlunparse, urljoin, urlsplit, urlencode, quote, unquote, quote_plus, unquote_plus, urldefrag
+    from urllib.request import parse_http_list, getproxies, proxy_bypass
+    from http import cookiejar as cookielib
+    from http.cookies import Morsel
+    from io import StringIO
+    from collections import OrderedDict
+    from http.client import IncompleteRead
+
+    builtin_str = str
+    str = str
+    bytes = bytes
+    basestring = (str, bytes)
+    numeric_types = (int, float)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/cookies.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/cookies.py
new file mode 100644
index 0000000..f3ac64f
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/cookies.py
@@ -0,0 +1,406 @@
+# -*- coding: utf-8 -*-
+
+"""
+Compatibility code to be able to use `cookielib.CookieJar` with requests.
+
+requests.utils imports from here, so be careful with imports.
+"""
+
+import time
+import collections
+from .compat import cookielib, urlparse, Morsel
+
+try:
+    import threading
+    # grr, pyflakes: this fixes "redefinition of unused 'threading'"
+    threading
+except ImportError:
+    import dummy_threading as threading
+
+
+class MockRequest(object):
+    """Wraps a `requests.Request` to mimic a `urllib2.Request`.
+
+    The code in `cookielib.CookieJar` expects this interface in order to correctly
+    manage cookie policies, i.e., determine whether a cookie can be set, given the
+    domains of the request and the cookie.
+
+    The original request object is read-only. The client is responsible for collecting
+    the new headers via `get_new_headers()` and interpreting them appropriately. You
+    probably want `get_cookie_header`, defined below.
+    """
+
+    def __init__(self, request):
+        self._r = request
+        self._new_headers = {}
+        self.type = urlparse(self._r.url).scheme
+
+    def get_type(self):
+        return self.type
+
+    def get_host(self):
+        return urlparse(self._r.url).netloc
+
+    def get_origin_req_host(self):
+        return self.get_host()
+
+    def get_full_url(self):
+        return self._r.url
+
+    def is_unverifiable(self):
+        return True
+
+    def has_header(self, name):
+        return name in self._r.headers or name in self._new_headers
+
+    def get_header(self, name, default=None):
+        return self._r.headers.get(name, self._new_headers.get(name, default))
+
+    def add_header(self, key, val):
+        """cookielib has no legitimate use for this method; add it back if you find one."""
+        raise NotImplementedError("Cookie headers should be added with add_unredirected_header()")
+
+    def add_unredirected_header(self, name, value):
+        self._new_headers[name] = value
+
+    def get_new_headers(self):
+        return self._new_headers
+
+    @property
+    def unverifiable(self):
+        return self.is_unverifiable()
+
+    @property
+    def origin_req_host(self):
+        return self.get_origin_req_host()
+
+    @property
+    def host(self):
+        return self.get_host()
+
+
+class MockResponse(object):
+    """Wraps a `httplib.HTTPMessage` to mimic a `urllib.addinfourl`.
+
+    ...what? Basically, expose the parsed HTTP headers from the server response
+    the way `cookielib` expects to see them.
+    """
+
+    def __init__(self, headers):
+        """Make a MockResponse for `cookielib` to read.
+
+        :param headers: a httplib.HTTPMessage or analogous carrying the headers
+        """
+        self._headers = headers
+
+    def info(self):
+        return self._headers
+
+    def getheaders(self, name):
+        self._headers.getheaders(name)
+
+
+def extract_cookies_to_jar(jar, request, response):
+    """Extract the cookies from the response into a CookieJar.
+
+    :param jar: cookielib.CookieJar (not necessarily a RequestsCookieJar)
+    :param request: our own requests.Request object
+    :param response: urllib3.HTTPResponse object
+    """
+    if not (hasattr(response, '_original_response') and
+            response._original_response):
+        return
+    # the _original_response field is the wrapped httplib.HTTPResponse object,
+    req = MockRequest(request)
+    # pull out the HTTPMessage with the headers and put it in the mock:
+    res = MockResponse(response._original_response.msg)
+    jar.extract_cookies(res, req)
+
+
+def get_cookie_header(jar, request):
+    """Produce an appropriate Cookie header string to be sent with `request`, or None."""
+    r = MockRequest(request)
+    jar.add_cookie_header(r)
+    return r.get_new_headers().get('Cookie')
+
+
+def remove_cookie_by_name(cookiejar, name, domain=None, path=None):
+    """Unsets a cookie by name, by default over all domains and paths.
+
+    Wraps CookieJar.clear(), is O(n).
+    """
+    clearables = []
+    for cookie in cookiejar:
+        if cookie.name == name:
+            if domain is None or domain == cookie.domain:
+                if path is None or path == cookie.path:
+                    clearables.append((cookie.domain, cookie.path, cookie.name))
+
+    for domain, path, name in clearables:
+        cookiejar.clear(domain, path, name)
+
+
+class CookieConflictError(RuntimeError):
+    """There are two cookies that meet the criteria specified in the cookie jar.
+    Use .get and .set and include domain and path args in order to be more specific."""
+
+
+class RequestsCookieJar(cookielib.CookieJar, collections.MutableMapping):
+    """Compatibility class; is a cookielib.CookieJar, but exposes a dict interface.
+
+    This is the CookieJar we create by default for requests and sessions that
+    don't specify one, since some clients may expect response.cookies and
+    session.cookies to support dict operations.
+
+    Don't use the dict interface internally; it's just for compatibility with
+    with external client code. All `requests` code should work out of the box
+    with externally provided instances of CookieJar, e.g., LWPCookieJar and
+    FileCookieJar.
+
+    Caution: dictionary operations that are normally O(1) may be O(n).
+
+    Unlike a regular CookieJar, this class is pickleable.
+    """
+
+    def get(self, name, default=None, domain=None, path=None):
+        """Dict-like get() that also supports optional domain and path args in
+        order to resolve naming collisions from using one cookie jar over
+        multiple domains. Caution: operation is O(n), not O(1)."""
+        try:
+            return self._find_no_duplicates(name, domain, path)
+        except KeyError:
+            return default
+
+    def set(self, name, value, **kwargs):
+        """Dict-like set() that also supports optional domain and path args in
+        order to resolve naming collisions from using one cookie jar over
+        multiple domains."""
+        # support client code that unsets cookies by assignment of a None value:
+        if value is None:
+            remove_cookie_by_name(self, name, domain=kwargs.get('domain'), path=kwargs.get('path'))
+            return
+
+        if isinstance(value, Morsel):
+            c = morsel_to_cookie(value)
+        else:
+            c = create_cookie(name, value, **kwargs)
+        self.set_cookie(c)
+        return c
+
+    def keys(self):
+        """Dict-like keys() that returns a list of names of cookies from the jar.
+        See values() and items()."""
+        keys = []
+        for cookie in iter(self):
+            keys.append(cookie.name)
+        return keys
+
+    def values(self):
+        """Dict-like values() that returns a list of values of cookies from the jar.
+        See keys() and items()."""
+        values = []
+        for cookie in iter(self):
+            values.append(cookie.value)
+        return values
+
+    def items(self):
+        """Dict-like items() that returns a list of name-value tuples from the jar.
+        See keys() and values(). Allows client-code to call "dict(RequestsCookieJar)
+        and get a vanilla python dict of key value pairs."""
+        items = []
+        for cookie in iter(self):
+            items.append((cookie.name, cookie.value))
+        return items
+
+    def list_domains(self):
+        """Utility method to list all the domains in the jar."""
+        domains = []
+        for cookie in iter(self):
+            if cookie.domain not in domains:
+                domains.append(cookie.domain)
+        return domains
+
+    def list_paths(self):
+        """Utility method to list all the paths in the jar."""
+        paths = []
+        for cookie in iter(self):
+            if cookie.path not in paths:
+                paths.append(cookie.path)
+        return paths
+
+    def multiple_domains(self):
+        """Returns True if there are multiple domains in the jar.
+        Returns False otherwise."""
+        domains = []
+        for cookie in iter(self):
+            if cookie.domain is not None and cookie.domain in domains:
+                return True
+            domains.append(cookie.domain)
+        return False  # there is only one domain in jar
+
+    def get_dict(self, domain=None, path=None):
+        """Takes as an argument an optional domain and path and returns a plain old
+        Python dict of name-value pairs of cookies that meet the requirements."""
+        dictionary = {}
+        for cookie in iter(self):
+            if (domain is None or cookie.domain == domain) and (path is None
+                                                or cookie.path == path):
+                dictionary[cookie.name] = cookie.value
+        return dictionary
+
+    def __getitem__(self, name):
+        """Dict-like __getitem__() for compatibility with client code. Throws exception
+        if there are more than one cookie with name. In that case, use the more
+        explicit get() method instead. Caution: operation is O(n), not O(1)."""
+
+        return self._find_no_duplicates(name)
+
+    def __setitem__(self, name, value):
+        """Dict-like __setitem__ for compatibility with client code. Throws exception
+        if there is already a cookie of that name in the jar. In that case, use the more
+        explicit set() method instead."""
+
+        self.set(name, value)
+
+    def __delitem__(self, name):
+        """Deletes a cookie given a name. Wraps cookielib.CookieJar's remove_cookie_by_name()."""
+        remove_cookie_by_name(self, name)
+
+    def set_cookie(self, cookie, *args, **kwargs):
+        if cookie.value.startswith('"') and cookie.value.endswith('"'):
+            cookie.value = cookie.value.replace('\\"', '')
+        return super(RequestsCookieJar, self).set_cookie(cookie, *args, **kwargs)
+
+    def update(self, other):
+        """Updates this jar with cookies from another CookieJar or dict-like"""
+        if isinstance(other, cookielib.CookieJar):
+            for cookie in other:
+                self.set_cookie(cookie)
+        else:
+            super(RequestsCookieJar, self).update(other)
+
+    def _find(self, name, domain=None, path=None):
+        """Requests uses this method internally to get cookie values. Takes as args name
+        and optional domain and path. Returns a cookie.value. If there are conflicting cookies,
+        _find arbitrarily chooses one. See _find_no_duplicates if you want an exception thrown
+        if there are conflicting cookies."""
+        for cookie in iter(self):
+            if cookie.name == name:
+                if domain is None or cookie.domain == domain:
+                    if path is None or cookie.path == path:
+                        return cookie.value
+
+        raise KeyError('name=%r, domain=%r, path=%r' % (name, domain, path))
+
+    def _find_no_duplicates(self, name, domain=None, path=None):
+        """__get_item__ and get call _find_no_duplicates -- never used in Requests internally.
+        Takes as args name and optional domain and path. Returns a cookie.value.
+        Throws KeyError if cookie is not found and CookieConflictError if there are
+        multiple cookies that match name and optionally domain and path."""
+        toReturn = None
+        for cookie in iter(self):
+            if cookie.name == name:
+                if domain is None or cookie.domain == domain:
+                    if path is None or cookie.path == path:
+                        if toReturn is not None:  # if there are multiple cookies that meet passed in criteria
+                            raise CookieConflictError('There are multiple cookies with name, %r' % (name))
+                        toReturn = cookie.value  # we will eventually return this as long as no cookie conflict
+
+        if toReturn:
+            return toReturn
+        raise KeyError('name=%r, domain=%r, path=%r' % (name, domain, path))
+
+    def __getstate__(self):
+        """Unlike a normal CookieJar, this class is pickleable."""
+        state = self.__dict__.copy()
+        # remove the unpickleable RLock object
+        state.pop('_cookies_lock')
+        return state
+
+    def __setstate__(self, state):
+        """Unlike a normal CookieJar, this class is pickleable."""
+        self.__dict__.update(state)
+        if '_cookies_lock' not in self.__dict__:
+            self._cookies_lock = threading.RLock()
+
+    def copy(self):
+        """Return a copy of this RequestsCookieJar."""
+        new_cj = RequestsCookieJar()
+        new_cj.update(self)
+        return new_cj
+
+
+def create_cookie(name, value, **kwargs):
+    """Make a cookie from underspecified parameters.
+
+    By default, the pair of `name` and `value` will be set for the domain ''
+    and sent on every request (this is sometimes called a "supercookie").
+    """
+    result = dict(
+        version=0,
+        name=name,
+        value=value,
+        port=None,
+        domain='',
+        path='/',
+        secure=False,
+        expires=None,
+        discard=True,
+        comment=None,
+        comment_url=None,
+        rest={'HttpOnly': None},
+        rfc2109=False,)
+
+    badargs = set(kwargs) - set(result)
+    if badargs:
+        err = 'create_cookie() got unexpected keyword arguments: %s'
+        raise TypeError(err % list(badargs))
+
+    result.update(kwargs)
+    result['port_specified'] = bool(result['port'])
+    result['domain_specified'] = bool(result['domain'])
+    result['domain_initial_dot'] = result['domain'].startswith('.')
+    result['path_specified'] = bool(result['path'])
+
+    return cookielib.Cookie(**result)
+
+
+def morsel_to_cookie(morsel):
+    """Convert a Morsel object into a Cookie containing the one k/v pair."""
+    expires = None
+    if morsel["max-age"]:
+        expires = time.time() + morsel["max-age"]
+    elif morsel['expires']:
+        expires = morsel['expires']
+        if type(expires) == type(""):
+            time_template = "%a, %d-%b-%Y %H:%M:%S GMT"
+            expires = time.mktime(time.strptime(expires, time_template))
+    c = create_cookie(
+        name=morsel.key,
+        value=morsel.value,
+        version=morsel['version'] or 0,
+        port=None,
+        domain=morsel['domain'],
+        path=morsel['path'],
+        secure=bool(morsel['secure']),
+        expires=expires,
+        discard=False,
+        comment=morsel['comment'],
+        comment_url=bool(morsel['comment']),
+        rest={'HttpOnly': morsel['httponly']},
+        rfc2109=False,)
+    return c
+
+
+def cookiejar_from_dict(cookie_dict, cookiejar=None):
+    """Returns a CookieJar from a key/value dictionary.
+
+    :param cookie_dict: Dict of key/values to insert into CookieJar.
+    """
+    if cookiejar is None:
+        cookiejar = RequestsCookieJar()
+
+    if cookie_dict is not None:
+        for name in cookie_dict:
+            cookiejar.set_cookie(create_cookie(name, cookie_dict[name]))
+    return cookiejar
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/exceptions.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/exceptions.py
new file mode 100644
index 0000000..22207e3
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/exceptions.py
@@ -0,0 +1,59 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.exceptions
+~~~~~~~~~~~~~~~~~~~
+
+This module contains the set of Requests' exceptions.
+
+"""
+
+
+class RequestException(IOError):
+    """There was an ambiguous exception that occurred while handling your
+    request."""
+
+
+class HTTPError(RequestException):
+    """An HTTP error occurred."""
+
+    def __init__(self, *args, **kwargs):
+        """ Initializes HTTPError with optional `response` object. """
+        self.response = kwargs.pop('response', None)
+        super(HTTPError, self).__init__(*args, **kwargs)
+
+
+class ConnectionError(RequestException):
+    """A Connection error occurred."""
+
+
+class SSLError(ConnectionError):
+    """An SSL error occurred."""
+
+
+class Timeout(RequestException):
+    """The request timed out."""
+
+
+class URLRequired(RequestException):
+    """A valid URL is required to make a request."""
+
+
+class TooManyRedirects(RequestException):
+    """Too many redirects."""
+
+
+class MissingSchema(RequestException, ValueError):
+    """The URL schema (e.g. http or https) is missing."""
+
+
+class InvalidSchema(RequestException, ValueError):
+    """See defaults.py for valid schemas."""
+
+
+class InvalidURL(RequestException, ValueError):
+    """ The URL provided was somehow invalid. """
+
+
+class ChunkedEncodingError(RequestException):
+    """The server declared chunked encoding but sent an invalid chunk."""
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/hooks.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/hooks.py
new file mode 100644
index 0000000..5dfaf6b
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/hooks.py
@@ -0,0 +1,45 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.hooks
+~~~~~~~~~~~~~~
+
+This module provides the capabilities for the Requests hooks system.
+
+Available hooks:
+
+``response``:
+    The response generated from a Request.
+
+"""
+
+
+HOOKS = ['response']
+
+
+def default_hooks():
+    hooks = {}
+    for event in HOOKS:
+        hooks[event] = []
+    return hooks
+
+# TODO: response is the only one
+
+
+def dispatch_hook(key, hooks, hook_data, **kwargs):
+    """Dispatches a hook dictionary on a given piece of data."""
+
+    hooks = hooks or dict()
+
+    if key in hooks:
+        hooks = hooks.get(key)
+
+        if hasattr(hooks, '__call__'):
+            hooks = [hooks]
+
+        for hook in hooks:
+            _hook_data = hook(hook_data, **kwargs)
+            if _hook_data is not None:
+                hook_data = _hook_data
+
+    return hook_data
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/models.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/models.py
new file mode 100644
index 0000000..8fd9735
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/models.py
@@ -0,0 +1,730 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.models
+~~~~~~~~~~~~~~~
+
+This module contains the primary objects that power Requests.
+"""
+
+import collections
+import logging
+import datetime
+
+from io import BytesIO, UnsupportedOperation
+from .hooks import default_hooks
+from .structures import CaseInsensitiveDict
+
+from .auth import HTTPBasicAuth
+from .cookies import cookiejar_from_dict, get_cookie_header
+from .packages.urllib3.filepost import encode_multipart_formdata
+from .packages.urllib3.util import parse_url
+from .exceptions import (
+    HTTPError, RequestException, MissingSchema, InvalidURL,
+    ChunkedEncodingError)
+from .utils import (
+    guess_filename, get_auth_from_url, requote_uri,
+    stream_decode_response_unicode, to_key_val_list, parse_header_links,
+    iter_slices, guess_json_utf, super_len, to_native_string)
+from .compat import (
+    cookielib, urlunparse, urlsplit, urlencode, str, bytes, StringIO,
+    is_py2, chardet, json, builtin_str, basestring, IncompleteRead)
+
+CONTENT_CHUNK_SIZE = 10 * 1024
+ITER_CHUNK_SIZE = 512
+
+log = logging.getLogger(__name__)
+
+
+class RequestEncodingMixin(object):
+    @property
+    def path_url(self):
+        """Build the path URL to use."""
+
+        url = []
+
+        p = urlsplit(self.url)
+
+        path = p.path
+        if not path:
+            path = '/'
+
+        url.append(path)
+
+        query = p.query
+        if query:
+            url.append('?')
+            url.append(query)
+
+        return ''.join(url)
+
+    @staticmethod
+    def _encode_params(data):
+        """Encode parameters in a piece of data.
+
+        Will successfully encode parameters when passed as a dict or a list of
+        2-tuples. Order is retained if data is a list of 2-tuples but arbitrary
+        if parameters are supplied as a dict.
+        """
+
+        if isinstance(data, (str, bytes)):
+            return data
+        elif hasattr(data, 'read'):
+            return data
+        elif hasattr(data, '__iter__'):
+            result = []
+            for k, vs in to_key_val_list(data):
+                if isinstance(vs, basestring) or not hasattr(vs, '__iter__'):
+                    vs = [vs]
+                for v in vs:
+                    if v is not None:
+                        result.append(
+                            (k.encode('utf-8') if isinstance(k, str) else k,
+                             v.encode('utf-8') if isinstance(v, str) else v))
+            return urlencode(result, doseq=True)
+        else:
+            return data
+
+    @staticmethod
+    def _encode_files(files, data):
+        """Build the body for a multipart/form-data request.
+
+        Will successfully encode files when passed as a dict or a list of
+        2-tuples. Order is retained if data is a list of 2-tuples but abritrary
+        if parameters are supplied as a dict.
+
+        """
+        if (not files):
+            raise ValueError("Files must be provided.")
+        elif isinstance(data, basestring):
+            raise ValueError("Data must not be a string.")
+
+        new_fields = []
+        fields = to_key_val_list(data or {})
+        files = to_key_val_list(files or {})
+
+        for field, val in fields:
+            if isinstance(val, basestring) or not hasattr(val, '__iter__'):
+                val = [val]
+            for v in val:
+                if v is not None:
+                    # Don't call str() on bytestrings: in Py3 it all goes wrong.
+                    if not isinstance(v, bytes):
+                        v = str(v)
+
+                    new_fields.append(
+                        (field.decode('utf-8') if isinstance(field, bytes) else field,
+                         v.encode('utf-8') if isinstance(v, str) else v))
+
+        for (k, v) in files:
+            # support for explicit filename
+            ft = None
+            if isinstance(v, (tuple, list)):
+                if len(v) == 2:
+                    fn, fp = v
+                else:
+                    fn, fp, ft = v
+            else:
+                fn = guess_filename(v) or k
+                fp = v
+            if isinstance(fp, str):
+                fp = StringIO(fp)
+            if isinstance(fp, bytes):
+                fp = BytesIO(fp)
+
+            if ft:
+                new_v = (fn, fp.read(), ft)
+            else:
+                new_v = (fn, fp.read())
+            new_fields.append((k, new_v))
+
+        body, content_type = encode_multipart_formdata(new_fields)
+
+        return body, content_type
+
+
+class RequestHooksMixin(object):
+    def register_hook(self, event, hook):
+        """Properly register a hook."""
+
+        if event not in self.hooks:
+            raise ValueError('Unsupported event specified, with event name "%s"' % (event))
+
+        if isinstance(hook, collections.Callable):
+            self.hooks[event].append(hook)
+        elif hasattr(hook, '__iter__'):
+            self.hooks[event].extend(h for h in hook if isinstance(h, collections.Callable))
+
+    def deregister_hook(self, event, hook):
+        """Deregister a previously registered hook.
+        Returns True if the hook existed, False if not.
+        """
+
+        try:
+            self.hooks[event].remove(hook)
+            return True
+        except ValueError:
+            return False
+
+
+class Request(RequestHooksMixin):
+    """A user-created :class:`Request <Request>` object.
+
+    Used to prepare a :class:`PreparedRequest <PreparedRequest>`, which is sent to the server.
+
+    :param method: HTTP method to use.
+    :param url: URL to send.
+    :param headers: dictionary of headers to send.
+    :param files: dictionary of {filename: fileobject} files to multipart upload.
+    :param data: the body to attach the request. If a dictionary is provided, form-encoding will take place.
+    :param params: dictionary of URL parameters to append to the URL.
+    :param auth: Auth handler or (user, pass) tuple.
+    :param cookies: dictionary or CookieJar of cookies to attach to this request.
+    :param hooks: dictionary of callback hooks, for internal usage.
+
+    Usage::
+
+      >>> import requests
+      >>> req = requests.Request('GET', 'http://httpbin.org/get')
+      >>> req.prepare()
+      <PreparedRequest [GET]>
+
+    """
+    def __init__(self,
+        method=None,
+        url=None,
+        headers=None,
+        files=None,
+        data=None,
+        params=None,
+        auth=None,
+        cookies=None,
+        hooks=None):
+
+        # Default empty dicts for dict params.
+        data = [] if data is None else data
+        files = [] if files is None else files
+        headers = {} if headers is None else headers
+        params = {} if params is None else params
+        hooks = {} if hooks is None else hooks
+
+        self.hooks = default_hooks()
+        for (k, v) in list(hooks.items()):
+            self.register_hook(event=k, hook=v)
+
+        self.method = method
+        self.url = url
+        self.headers = headers
+        self.files = files
+        self.data = data
+        self.params = params
+        self.auth = auth
+        self.cookies = cookies
+
+    def __repr__(self):
+        return '<Request [%s]>' % (self.method)
+
+    def prepare(self):
+        """Constructs a :class:`PreparedRequest <PreparedRequest>` for transmission and returns it."""
+        p = PreparedRequest()
+        p.prepare(
+            method=self.method,
+            url=self.url,
+            headers=self.headers,
+            files=self.files,
+            data=self.data,
+            params=self.params,
+            auth=self.auth,
+            cookies=self.cookies,
+            hooks=self.hooks,
+        )
+        return p
+
+
+class PreparedRequest(RequestEncodingMixin, RequestHooksMixin):
+    """The fully mutable :class:`PreparedRequest <PreparedRequest>` object,
+    containing the exact bytes that will be sent to the server.
+
+    Generated from either a :class:`Request <Request>` object or manually.
+
+    Usage::
+
+      >>> import requests
+      >>> req = requests.Request('GET', 'http://httpbin.org/get')
+      >>> r = req.prepare()
+      <PreparedRequest [GET]>
+
+      >>> s = requests.Session()
+      >>> s.send(r)
+      <Response [200]>
+
+    """
+
+    def __init__(self):
+        #: HTTP verb to send to the server.
+        self.method = None
+        #: HTTP URL to send the request to.
+        self.url = None
+        #: dictionary of HTTP headers.
+        self.headers = None
+        #: request body to send to the server.
+        self.body = None
+        #: dictionary of callback hooks, for internal usage.
+        self.hooks = default_hooks()
+
+    def prepare(self, method=None, url=None, headers=None, files=None,
+                data=None, params=None, auth=None, cookies=None, hooks=None):
+        """Prepares the the entire request with the given parameters."""
+
+        self.prepare_method(method)
+        self.prepare_url(url, params)
+        self.prepare_headers(headers)
+        self.prepare_cookies(cookies)
+        self.prepare_body(data, files)
+        self.prepare_auth(auth, url)
+        # Note that prepare_auth must be last to enable authentication schemes
+        # such as OAuth to work on a fully prepared request.
+
+        # This MUST go after prepare_auth. Authenticators could add a hook
+        self.prepare_hooks(hooks)
+
+    def __repr__(self):
+        return '<PreparedRequest [%s]>' % (self.method)
+
+    def copy(self):
+        p = PreparedRequest()
+        p.method = self.method
+        p.url = self.url
+        p.headers = self.headers
+        p.body = self.body
+        p.hooks = self.hooks
+        return p
+
+    def prepare_method(self, method):
+        """Prepares the given HTTP method."""
+        self.method = method
+        if self.method is not None:
+            self.method = self.method.upper()
+
+    def prepare_url(self, url, params):
+        """Prepares the given HTTP URL."""
+        #: Accept objects that have string representations.
+        try:
+            url = unicode(url)
+        except NameError:
+            # We're on Python 3.
+            url = str(url)
+        except UnicodeDecodeError:
+            pass
+
+        # Support for unicode domain names and paths.
+        scheme, auth, host, port, path, query, fragment = parse_url(url)
+
+        if not scheme:
+            raise MissingSchema("Invalid URL %r: No schema supplied" % url)
+
+        if not host:
+            raise InvalidURL("Invalid URL %r: No host supplied" % url)
+
+        # Only want to apply IDNA to the hostname
+        try:
+            host = host.encode('idna').decode('utf-8')
+        except UnicodeError:
+            raise InvalidURL('URL has an invalid label.')
+
+        # Carefully reconstruct the network location
+        netloc = auth or ''
+        if netloc:
+            netloc += '@'
+        netloc += host
+        if port:
+            netloc += ':' + str(port)
+
+        # Bare domains aren't valid URLs.
+        if not path:
+            path = '/'
+
+        if is_py2:
+            if isinstance(scheme, str):
+                scheme = scheme.encode('utf-8')
+            if isinstance(netloc, str):
+                netloc = netloc.encode('utf-8')
+            if isinstance(path, str):
+                path = path.encode('utf-8')
+            if isinstance(query, str):
+                query = query.encode('utf-8')
+            if isinstance(fragment, str):
+                fragment = fragment.encode('utf-8')
+
+        enc_params = self._encode_params(params)
+        if enc_params:
+            if query:
+                query = '%s&%s' % (query, enc_params)
+            else:
+                query = enc_params
+
+        url = requote_uri(urlunparse([scheme, netloc, path, None, query, fragment]))
+        self.url = url
+
+    def prepare_headers(self, headers):
+        """Prepares the given HTTP headers."""
+
+        if headers:
+            self.headers = CaseInsensitiveDict((to_native_string(name), value) for name, value in headers.items())
+        else:
+            self.headers = CaseInsensitiveDict()
+
+    def prepare_body(self, data, files):
+        """Prepares the given HTTP body data."""
+
+        # Check if file, fo, generator, iterator.
+        # If not, run through normal process.
+
+        # Nottin' on you.
+        body = None
+        content_type = None
+        length = None
+
+        is_stream = all([
+            hasattr(data, '__iter__'),
+            not isinstance(data, basestring),
+            not isinstance(data, list),
+            not isinstance(data, dict)
+        ])
+
+        try:
+            length = super_len(data)
+        except (TypeError, AttributeError, UnsupportedOperation):
+            length = None
+
+        if is_stream:
+            body = data
+
+            if files:
+                raise NotImplementedError('Streamed bodies and files are mutually exclusive.')
+
+            if length is not None:
+                self.headers['Content-Length'] = str(length)
+            else:
+                self.headers['Transfer-Encoding'] = 'chunked'
+        else:
+            # Multi-part file uploads.
+            if files:
+                (body, content_type) = self._encode_files(files, data)
+            else:
+                if data:
+                    body = self._encode_params(data)
+                    if isinstance(data, str) or isinstance(data, builtin_str) or hasattr(data, 'read'):
+                        content_type = None
+                    else:
+                        content_type = 'application/x-www-form-urlencoded'
+
+            self.prepare_content_length(body)
+
+            # Add content-type if it wasn't explicitly provided.
+            if (content_type) and (not 'content-type' in self.headers):
+                self.headers['Content-Type'] = content_type
+
+        self.body = body
+
+    def prepare_content_length(self, body):
+        if hasattr(body, 'seek') and hasattr(body, 'tell'):
+            body.seek(0, 2)
+            self.headers['Content-Length'] = str(body.tell())
+            body.seek(0, 0)
+        elif body is not None:
+            l = super_len(body)
+            if l:
+                self.headers['Content-Length'] = str(l)
+        elif self.method not in ('GET', 'HEAD'):
+            self.headers['Content-Length'] = '0'
+
+    def prepare_auth(self, auth, url=''):
+        """Prepares the given HTTP auth data."""
+
+        # If no Auth is explicitly provided, extract it from the URL first.
+        if auth is None:
+            url_auth = get_auth_from_url(self.url)
+            auth = url_auth if any(url_auth) else None
+
+        if auth:
+            if isinstance(auth, tuple) and len(auth) == 2:
+                # special-case basic HTTP auth
+                auth = HTTPBasicAuth(*auth)
+
+            # Allow auth to make its changes.
+            r = auth(self)
+
+            # Update self to reflect the auth changes.
+            self.__dict__.update(r.__dict__)
+
+            # Recompute Content-Length
+            self.prepare_content_length(self.body)
+
+    def prepare_cookies(self, cookies):
+        """Prepares the given HTTP cookie data."""
+
+        if isinstance(cookies, cookielib.CookieJar):
+            cookies = cookies
+        else:
+            cookies = cookiejar_from_dict(cookies)
+
+        if 'cookie' not in self.headers:
+            cookie_header = get_cookie_header(cookies, self)
+            if cookie_header is not None:
+                self.headers['Cookie'] = cookie_header
+
+    def prepare_hooks(self, hooks):
+        """Prepares the given hooks."""
+        for event in hooks:
+            self.register_hook(event, hooks[event])
+
+
+class Response(object):
+    """The :class:`Response <Response>` object, which contains a
+    server's response to an HTTP request.
+    """
+
+    def __init__(self):
+        super(Response, self).__init__()
+
+        self._content = False
+        self._content_consumed = False
+
+        #: Integer Code of responded HTTP Status.
+        self.status_code = None
+
+        #: Case-insensitive Dictionary of Response Headers.
+        #: For example, ``headers['content-encoding']`` will return the
+        #: value of a ``'Content-Encoding'`` response header.
+        self.headers = CaseInsensitiveDict()
+
+        #: File-like object representation of response (for advanced usage).
+        #: Requires that ``stream=True` on the request.
+        # This requirement does not apply for use internally to Requests.
+        self.raw = None
+
+        #: Final URL location of Response.
+        self.url = None
+
+        #: Encoding to decode with when accessing r.text.
+        self.encoding = None
+
+        #: A list of :class:`Response <Response>` objects from
+        #: the history of the Request. Any redirect responses will end
+        #: up here. The list is sorted from the oldest to the most recent request.
+        self.history = []
+
+        self.reason = None
+
+        #: A CookieJar of Cookies the server sent back.
+        self.cookies = cookiejar_from_dict({})
+
+        #: The amount of time elapsed between sending the request
+        #: and the arrival of the response (as a timedelta)
+        self.elapsed = datetime.timedelta(0)
+
+    def __repr__(self):
+        return '<Response [%s]>' % (self.status_code)
+
+    def __bool__(self):
+        """Returns true if :attr:`status_code` is 'OK'."""
+        return self.ok
+
+    def __nonzero__(self):
+        """Returns true if :attr:`status_code` is 'OK'."""
+        return self.ok
+
+    def __iter__(self):
+        """Allows you to use a response as an iterator."""
+        return self.iter_content(128)
+
+    @property
+    def ok(self):
+        try:
+            self.raise_for_status()
+        except RequestException:
+            return False
+        return True
+
+    @property
+    def apparent_encoding(self):
+        """The apparent encoding, provided by the lovely Charade library
+        (Thanks, Ian!)."""
+        return chardet.detect(self.content)['encoding']
+
+    def iter_content(self, chunk_size=1, decode_unicode=False):
+        """Iterates over the response data.  When stream=True is set on the
+        request, this avoids reading the content at once into memory for
+        large responses.  The chunk size is the number of bytes it should
+        read into memory.  This is not necessarily the length of each item
+        returned as decoding can take place.
+        """
+        if self._content_consumed:
+            # simulate reading small chunks of the content
+            return iter_slices(self._content, chunk_size)
+
+        def generate():
+            try:
+                # Special case for urllib3.
+                try:
+                    for chunk in self.raw.stream(chunk_size,
+                                                 decode_content=True):
+                        yield chunk
+                except IncompleteRead as e:
+                    raise ChunkedEncodingError(e)
+            except AttributeError:
+                # Standard file-like object.
+                while 1:
+                    chunk = self.raw.read(chunk_size)
+                    if not chunk:
+                        break
+                    yield chunk
+
+            self._content_consumed = True
+
+        gen = generate()
+
+        if decode_unicode:
+            gen = stream_decode_response_unicode(gen, self)
+
+        return gen
+
+    def iter_lines(self, chunk_size=ITER_CHUNK_SIZE, decode_unicode=None):
+        """Iterates over the response data, one line at a time.  When
+        stream=True is set on the request, this avoids reading the
+        content at once into memory for large responses.
+        """
+
+        pending = None
+
+        for chunk in self.iter_content(chunk_size=chunk_size,
+                                       decode_unicode=decode_unicode):
+
+            if pending is not None:
+                chunk = pending + chunk
+            lines = chunk.splitlines()
+
+            if lines and lines[-1] and chunk and lines[-1][-1] == chunk[-1]:
+                pending = lines.pop()
+            else:
+                pending = None
+
+            for line in lines:
+                yield line
+
+        if pending is not None:
+            yield pending
+
+    @property
+    def content(self):
+        """Content of the response, in bytes."""
+
+        if self._content is False:
+            # Read the contents.
+            try:
+                if self._content_consumed:
+                    raise RuntimeError(
+                        'The content for this response was already consumed')
+
+                if self.status_code == 0:
+                    self._content = None
+                else:
+                    self._content = bytes().join(self.iter_content(CONTENT_CHUNK_SIZE)) or bytes()
+
+            except AttributeError:
+                self._content = None
+
+        self._content_consumed = True
+        # don't need to release the connection; that's been handled by urllib3
+        # since we exhausted the data.
+        return self._content
+
+    @property
+    def text(self):
+        """Content of the response, in unicode.
+
+        if Response.encoding is None and chardet module is available, encoding
+        will be guessed.
+        """
+
+        # Try charset from content-type
+        content = None
+        encoding = self.encoding
+
+        if not self.content:
+            return str('')
+
+        # Fallback to auto-detected encoding.
+        if self.encoding is None:
+            encoding = self.apparent_encoding
+
+        # Decode unicode from given encoding.
+        try:
+            content = str(self.content, encoding, errors='replace')
+        except (LookupError, TypeError):
+            # A LookupError is raised if the encoding was not found which could
+            # indicate a misspelling or similar mistake.
+            #
+            # A TypeError can be raised if encoding is None
+            #
+            # So we try blindly encoding.
+            content = str(self.content, errors='replace')
+
+        return content
+
+    def json(self, **kwargs):
+        """Returns the json-encoded content of a response, if any.
+
+        :param \*\*kwargs: Optional arguments that ``json.loads`` takes.
+        """
+
+        if not self.encoding and len(self.content) > 3:
+            # No encoding set. JSON RFC 4627 section 3 states we should expect
+            # UTF-8, -16 or -32. Detect which one to use; If the detection or
+            # decoding fails, fall back to `self.text` (using chardet to make
+            # a best guess).
+            encoding = guess_json_utf(self.content)
+            if encoding is not None:
+                return json.loads(self.content.decode(encoding), **kwargs)
+        return json.loads(self.text or self.content, **kwargs)
+
+    @property
+    def links(self):
+        """Returns the parsed header links of the response, if any."""
+
+        header = self.headers.get('link')
+
+        # l = MultiDict()
+        l = {}
+
+        if header:
+            links = parse_header_links(header)
+
+            for link in links:
+                key = link.get('rel') or link.get('url')
+                l[key] = link
+
+        return l
+
+    def raise_for_status(self):
+        """Raises stored :class:`HTTPError`, if one occurred."""
+
+        http_error_msg = ''
+
+        if 400 <= self.status_code < 500:
+            http_error_msg = '%s Client Error: %s' % (self.status_code, self.reason)
+
+        elif 500 <= self.status_code < 600:
+            http_error_msg = '%s Server Error: %s' % (self.status_code, self.reason)
+
+        if http_error_msg:
+            raise HTTPError(http_error_msg, response=self)
+
+    def close(self):
+        """Closes the underlying file descriptor and releases the connection
+        back to the pool.
+
+        *Note: Should not normally need to be called explicitly.*
+        """
+        return self.raw.release_conn()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/__init__.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/__init__.py
new file mode 100644
index 0000000..d62c4b7
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/__init__.py
@@ -0,0 +1,3 @@
+from __future__ import absolute_import
+
+from . import urllib3
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/__init__.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/__init__.py
new file mode 100644
index 0000000..67c4281
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/__init__.py
@@ -0,0 +1,32 @@
+######################## BEGIN LICENSE BLOCK ########################
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+__version__ = "1.0.3"
+from sys import version_info
+
+
+def detect(aBuf):
+    if ((version_info < (3, 0) and isinstance(aBuf, unicode)) or
+            (version_info >= (3, 0) and not isinstance(aBuf, bytes))):
+        raise ValueError('Expected a bytes object, not a unicode object')
+
+    from . import universaldetector
+    u = universaldetector.UniversalDetector()
+    u.reset()
+    u.feed(aBuf)
+    u.close()
+    return u.result
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/big5freq.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/big5freq.py
new file mode 100644
index 0000000..65bffc0
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/big5freq.py
@@ -0,0 +1,925 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# Big5 frequency table
+# by Taiwan's Mandarin Promotion Council
+# <http://www.edu.tw:81/mandr/>
+#
+# 128  --> 0.42261
+# 256  --> 0.57851
+# 512  --> 0.74851
+# 1024 --> 0.89384
+# 2048 --> 0.97583
+#
+# Ideal Distribution Ratio = 0.74851/(1-0.74851) =2.98
+# Random Distribution Ration = 512/(5401-512)=0.105
+#
+# Typical Distribution Ratio about 25% of Ideal one, still much higher than RDR
+
+BIG5_TYPICAL_DISTRIBUTION_RATIO = 0.75
+
+#Char to FreqOrder table
+BIG5_TABLE_SIZE = 5376
+
+Big5CharToFreqOrder = (
+   1,1801,1506, 255,1431, 198,   9,  82,   6,5008, 177, 202,3681,1256,2821, 110, #   16
+3814,  33,3274, 261,  76,  44,2114,  16,2946,2187,1176, 659,3971,  26,3451,2653, #   32
+1198,3972,3350,4202, 410,2215, 302, 590, 361,1964,   8, 204,  58,4510,5009,1932, #   48
+  63,5010,5011, 317,1614,  75, 222, 159,4203,2417,1480,5012,3555,3091, 224,2822, #   64
+3682,   3,  10,3973,1471,  29,2787,1135,2866,1940, 873, 130,3275,1123, 312,5013, #   80
+4511,2052, 507, 252, 682,5014, 142,1915, 124, 206,2947,  34,3556,3204,  64, 604, #   96
+5015,2501,1977,1978, 155,1991, 645, 641,1606,5016,3452, 337,  72, 406,5017,  80, #  112
+ 630, 238,3205,1509, 263, 939,1092,2654, 756,1440,1094,3453, 449,  69,2987, 591, #  128
+ 179,2096, 471, 115,2035,1844,  60,  50,2988, 134, 806,1869, 734,2036,3454, 180, #  144
+ 995,1607, 156, 537,2907, 688,5018, 319,1305, 779,2145, 514,2379, 298,4512, 359, #  160
+2502,  90,2716,1338, 663,  11, 906,1099,2553,  20,2441, 182, 532,1716,5019, 732, #  176
+1376,4204,1311,1420,3206,  25,2317,1056, 113, 399, 382,1950, 242,3455,2474, 529, #  192
+3276, 475,1447,3683,5020, 117,  21, 656, 810,1297,2300,2334,3557,5021, 126,4205, #  208
+ 706, 456, 150, 613,4513,  71,1118,2037,4206, 145,3092,  85, 835, 486,2115,1246, #  224
+1426, 428, 727,1285,1015, 800, 106, 623, 303,1281,5022,2128,2359, 347,3815, 221, #  240
+3558,3135,5023,1956,1153,4207,  83, 296,1199,3093, 192, 624,  93,5024, 822,1898, #  256
+2823,3136, 795,2065, 991,1554,1542,1592,  27,  43,2867, 859, 139,1456, 860,4514, #  272
+ 437, 712,3974, 164,2397,3137, 695, 211,3037,2097, 195,3975,1608,3559,3560,3684, #  288
+3976, 234, 811,2989,2098,3977,2233,1441,3561,1615,2380, 668,2077,1638, 305, 228, #  304
+1664,4515, 467, 415,5025, 262,2099,1593, 239, 108, 300, 200,1033, 512,1247,2078, #  320
+5026,5027,2176,3207,3685,2682, 593, 845,1062,3277,  88,1723,2038,3978,1951, 212, #  336
+ 266, 152, 149, 468,1899,4208,4516,  77, 187,5028,3038,  37,   5,2990,5029,3979, #  352
+5030,5031,  39,2524,4517,2908,3208,2079,  55, 148,  74,4518, 545, 483,1474,1029, #  368
+1665, 217,1870,1531,3138,1104,2655,4209,  24, 172,3562, 900,3980,3563,3564,4519, #  384
+  32,1408,2824,1312, 329, 487,2360,2251,2717, 784,2683,   4,3039,3351,1427,1789, #  400
+ 188, 109, 499,5032,3686,1717,1790, 888,1217,3040,4520,5033,3565,5034,3352,1520, #  416
+3687,3981, 196,1034, 775,5035,5036, 929,1816, 249, 439,  38,5037,1063,5038, 794, #  432
+3982,1435,2301,  46, 178,3278,2066,5039,2381,5040, 214,1709,4521, 804,  35, 707, #  448
+ 324,3688,1601,2554, 140, 459,4210,5041,5042,1365, 839, 272, 978,2262,2580,3456, #  464
+2129,1363,3689,1423, 697, 100,3094,  48,  70,1231, 495,3139,2196,5043,1294,5044, #  480
+2080, 462, 586,1042,3279, 853, 256, 988, 185,2382,3457,1698, 434,1084,5045,3458, #  496
+ 314,2625,2788,4522,2335,2336, 569,2285, 637,1817,2525, 757,1162,1879,1616,3459, #  512
+ 287,1577,2116, 768,4523,1671,2868,3566,2526,1321,3816, 909,2418,5046,4211, 933, #  528
+3817,4212,2053,2361,1222,4524, 765,2419,1322, 786,4525,5047,1920,1462,1677,2909, #  544
+1699,5048,4526,1424,2442,3140,3690,2600,3353,1775,1941,3460,3983,4213, 309,1369, #  560
+1130,2825, 364,2234,1653,1299,3984,3567,3985,3986,2656, 525,1085,3041, 902,2001, #  576
+1475, 964,4527, 421,1845,1415,1057,2286, 940,1364,3141, 376,4528,4529,1381,   7, #  592
+2527, 983,2383, 336,1710,2684,1846, 321,3461, 559,1131,3042,2752,1809,1132,1313, #  608
+ 265,1481,1858,5049, 352,1203,2826,3280, 167,1089, 420,2827, 776, 792,1724,3568, #  624
+4214,2443,3281,5050,4215,5051, 446, 229, 333,2753, 901,3818,1200,1557,4530,2657, #  640
+1921, 395,2754,2685,3819,4216,1836, 125, 916,3209,2626,4531,5052,5053,3820,5054, #  656
+5055,5056,4532,3142,3691,1133,2555,1757,3462,1510,2318,1409,3569,5057,2146, 438, #  672
+2601,2910,2384,3354,1068, 958,3043, 461, 311,2869,2686,4217,1916,3210,4218,1979, #  688
+ 383, 750,2755,2627,4219, 274, 539, 385,1278,1442,5058,1154,1965, 384, 561, 210, #  704
+  98,1295,2556,3570,5059,1711,2420,1482,3463,3987,2911,1257, 129,5060,3821, 642, #  720
+ 523,2789,2790,2658,5061, 141,2235,1333,  68, 176, 441, 876, 907,4220, 603,2602, #  736
+ 710, 171,3464, 404, 549,  18,3143,2398,1410,3692,1666,5062,3571,4533,2912,4534, #  752
+5063,2991, 368,5064, 146, 366,  99, 871,3693,1543, 748, 807,1586,1185,  22,2263, #  768
+ 379,3822,3211,5065,3212, 505,1942,2628,1992,1382,2319,5066, 380,2362, 218, 702, #  784
+1818,1248,3465,3044,3572,3355,3282,5067,2992,3694, 930,3283,3823,5068,  59,5069, #  800
+ 585, 601,4221, 497,3466,1112,1314,4535,1802,5070,1223,1472,2177,5071, 749,1837, #  816
+ 690,1900,3824,1773,3988,1476, 429,1043,1791,2236,2117, 917,4222, 447,1086,1629, #  832
+5072, 556,5073,5074,2021,1654, 844,1090, 105, 550, 966,1758,2828,1008,1783, 686, #  848
+1095,5075,2287, 793,1602,5076,3573,2603,4536,4223,2948,2302,4537,3825, 980,2503, #  864
+ 544, 353, 527,4538, 908,2687,2913,5077, 381,2629,1943,1348,5078,1341,1252, 560, #  880
+3095,5079,3467,2870,5080,2054, 973, 886,2081, 143,4539,5081,5082, 157,3989, 496, #  896
+4224,  57, 840, 540,2039,4540,4541,3468,2118,1445, 970,2264,1748,1966,2082,4225, #  912
+3144,1234,1776,3284,2829,3695, 773,1206,2130,1066,2040,1326,3990,1738,1725,4226, #  928
+ 279,3145,  51,1544,2604, 423,1578,2131,2067, 173,4542,1880,5083,5084,1583, 264, #  944
+ 610,3696,4543,2444, 280, 154,5085,5086,5087,1739, 338,1282,3096, 693,2871,1411, #  960
+1074,3826,2445,5088,4544,5089,5090,1240, 952,2399,5091,2914,1538,2688, 685,1483, #  976
+4227,2475,1436, 953,4228,2055,4545, 671,2400,  79,4229,2446,3285, 608, 567,2689, #  992
+3469,4230,4231,1691, 393,1261,1792,2401,5092,4546,5093,5094,5095,5096,1383,1672, # 1008
+3827,3213,1464, 522,1119, 661,1150, 216, 675,4547,3991,1432,3574, 609,4548,2690, # 1024
+2402,5097,5098,5099,4232,3045,   0,5100,2476, 315, 231,2447, 301,3356,4549,2385, # 1040
+5101, 233,4233,3697,1819,4550,4551,5102,  96,1777,1315,2083,5103, 257,5104,1810, # 1056
+3698,2718,1139,1820,4234,2022,1124,2164,2791,1778,2659,5105,3097, 363,1655,3214, # 1072
+5106,2993,5107,5108,5109,3992,1567,3993, 718, 103,3215, 849,1443, 341,3357,2949, # 1088
+1484,5110,1712, 127,  67, 339,4235,2403, 679,1412, 821,5111,5112, 834, 738, 351, # 1104
+2994,2147, 846, 235,1497,1881, 418,1993,3828,2719, 186,1100,2148,2756,3575,1545, # 1120
+1355,2950,2872,1377, 583,3994,4236,2581,2995,5113,1298,3699,1078,2557,3700,2363, # 1136
+  78,3829,3830, 267,1289,2100,2002,1594,4237, 348, 369,1274,2197,2178,1838,4552, # 1152
+1821,2830,3701,2757,2288,2003,4553,2951,2758, 144,3358, 882,4554,3995,2759,3470, # 1168
+4555,2915,5114,4238,1726, 320,5115,3996,3046, 788,2996,5116,2831,1774,1327,2873, # 1184
+3997,2832,5117,1306,4556,2004,1700,3831,3576,2364,2660, 787,2023, 506, 824,3702, # 1200
+ 534, 323,4557,1044,3359,2024,1901, 946,3471,5118,1779,1500,1678,5119,1882,4558, # 1216
+ 165, 243,4559,3703,2528, 123, 683,4239, 764,4560,  36,3998,1793, 589,2916, 816, # 1232
+ 626,1667,3047,2237,1639,1555,1622,3832,3999,5120,4000,2874,1370,1228,1933, 891, # 1248
+2084,2917, 304,4240,5121, 292,2997,2720,3577, 691,2101,4241,1115,4561, 118, 662, # 1264
+5122, 611,1156, 854,2386,1316,2875,   2, 386, 515,2918,5123,5124,3286, 868,2238, # 1280
+1486, 855,2661, 785,2216,3048,5125,1040,3216,3578,5126,3146, 448,5127,1525,5128, # 1296
+2165,4562,5129,3833,5130,4242,2833,3579,3147, 503, 818,4001,3148,1568, 814, 676, # 1312
+1444, 306,1749,5131,3834,1416,1030, 197,1428, 805,2834,1501,4563,5132,5133,5134, # 1328
+1994,5135,4564,5136,5137,2198,  13,2792,3704,2998,3149,1229,1917,5138,3835,2132, # 1344
+5139,4243,4565,2404,3580,5140,2217,1511,1727,1120,5141,5142, 646,3836,2448, 307, # 1360
+5143,5144,1595,3217,5145,5146,5147,3705,1113,1356,4002,1465,2529,2530,5148, 519, # 1376
+5149, 128,2133,  92,2289,1980,5150,4003,1512, 342,3150,2199,5151,2793,2218,1981, # 1392
+3360,4244, 290,1656,1317, 789, 827,2365,5152,3837,4566, 562, 581,4004,5153, 401, # 1408
+4567,2252,  94,4568,5154,1399,2794,5155,1463,2025,4569,3218,1944,5156, 828,1105, # 1424
+4245,1262,1394,5157,4246, 605,4570,5158,1784,2876,5159,2835, 819,2102, 578,2200, # 1440
+2952,5160,1502, 436,3287,4247,3288,2836,4005,2919,3472,3473,5161,2721,2320,5162, # 1456
+5163,2337,2068,  23,4571, 193, 826,3838,2103, 699,1630,4248,3098, 390,1794,1064, # 1472
+3581,5164,1579,3099,3100,1400,5165,4249,1839,1640,2877,5166,4572,4573, 137,4250, # 1488
+ 598,3101,1967, 780, 104, 974,2953,5167, 278, 899, 253, 402, 572, 504, 493,1339, # 1504
+5168,4006,1275,4574,2582,2558,5169,3706,3049,3102,2253, 565,1334,2722, 863,  41, # 1520
+5170,5171,4575,5172,1657,2338,  19, 463,2760,4251, 606,5173,2999,3289,1087,2085, # 1536
+1323,2662,3000,5174,1631,1623,1750,4252,2691,5175,2878, 791,2723,2663,2339, 232, # 1552
+2421,5176,3001,1498,5177,2664,2630, 755,1366,3707,3290,3151,2026,1609, 119,1918, # 1568
+3474, 862,1026,4253,5178,4007,3839,4576,4008,4577,2265,1952,2477,5179,1125, 817, # 1584
+4254,4255,4009,1513,1766,2041,1487,4256,3050,3291,2837,3840,3152,5180,5181,1507, # 1600
+5182,2692, 733,  40,1632,1106,2879, 345,4257, 841,2531, 230,4578,3002,1847,3292, # 1616
+3475,5183,1263, 986,3476,5184, 735, 879, 254,1137, 857, 622,1300,1180,1388,1562, # 1632
+4010,4011,2954, 967,2761,2665,1349, 592,2134,1692,3361,3003,1995,4258,1679,4012, # 1648
+1902,2188,5185, 739,3708,2724,1296,1290,5186,4259,2201,2202,1922,1563,2605,2559, # 1664
+1871,2762,3004,5187, 435,5188, 343,1108, 596,  17,1751,4579,2239,3477,3709,5189, # 1680
+4580, 294,3582,2955,1693, 477, 979, 281,2042,3583, 643,2043,3710,2631,2795,2266, # 1696
+1031,2340,2135,2303,3584,4581, 367,1249,2560,5190,3585,5191,4582,1283,3362,2005, # 1712
+ 240,1762,3363,4583,4584, 836,1069,3153, 474,5192,2149,2532, 268,3586,5193,3219, # 1728
+1521,1284,5194,1658,1546,4260,5195,3587,3588,5196,4261,3364,2693,1685,4262, 961, # 1744
+1673,2632, 190,2006,2203,3841,4585,4586,5197, 570,2504,3711,1490,5198,4587,2633, # 1760
+3293,1957,4588, 584,1514, 396,1045,1945,5199,4589,1968,2449,5200,5201,4590,4013, # 1776
+ 619,5202,3154,3294, 215,2007,2796,2561,3220,4591,3221,4592, 763,4263,3842,4593, # 1792
+5203,5204,1958,1767,2956,3365,3712,1174, 452,1477,4594,3366,3155,5205,2838,1253, # 1808
+2387,2189,1091,2290,4264, 492,5206, 638,1169,1825,2136,1752,4014, 648, 926,1021, # 1824
+1324,4595, 520,4596, 997, 847,1007, 892,4597,3843,2267,1872,3713,2405,1785,4598, # 1840
+1953,2957,3103,3222,1728,4265,2044,3714,4599,2008,1701,3156,1551,  30,2268,4266, # 1856
+5207,2027,4600,3589,5208, 501,5209,4267, 594,3478,2166,1822,3590,3479,3591,3223, # 1872
+ 829,2839,4268,5210,1680,3157,1225,4269,5211,3295,4601,4270,3158,2341,5212,4602, # 1888
+4271,5213,4015,4016,5214,1848,2388,2606,3367,5215,4603, 374,4017, 652,4272,4273, # 1904
+ 375,1140, 798,5216,5217,5218,2366,4604,2269, 546,1659, 138,3051,2450,4605,5219, # 1920
+2254, 612,1849, 910, 796,3844,1740,1371, 825,3845,3846,5220,2920,2562,5221, 692, # 1936
+ 444,3052,2634, 801,4606,4274,5222,1491, 244,1053,3053,4275,4276, 340,5223,4018, # 1952
+1041,3005, 293,1168,  87,1357,5224,1539, 959,5225,2240, 721, 694,4277,3847, 219, # 1968
+1478, 644,1417,3368,2666,1413,1401,1335,1389,4019,5226,5227,3006,2367,3159,1826, # 1984
+ 730,1515, 184,2840,  66,4607,5228,1660,2958, 246,3369, 378,1457, 226,3480, 975, # 2000
+4020,2959,1264,3592, 674, 696,5229, 163,5230,1141,2422,2167, 713,3593,3370,4608, # 2016
+4021,5231,5232,1186,  15,5233,1079,1070,5234,1522,3224,3594, 276,1050,2725, 758, # 2032
+1126, 653,2960,3296,5235,2342, 889,3595,4022,3104,3007, 903,1250,4609,4023,3481, # 2048
+3596,1342,1681,1718, 766,3297, 286,  89,2961,3715,5236,1713,5237,2607,3371,3008, # 2064
+5238,2962,2219,3225,2880,5239,4610,2505,2533, 181, 387,1075,4024, 731,2190,3372, # 2080
+5240,3298, 310, 313,3482,2304, 770,4278,  54,3054, 189,4611,3105,3848,4025,5241, # 2096
+1230,1617,1850, 355,3597,4279,4612,3373, 111,4280,3716,1350,3160,3483,3055,4281, # 2112
+2150,3299,3598,5242,2797,4026,4027,3009, 722,2009,5243,1071, 247,1207,2343,2478, # 2128
+1378,4613,2010, 864,1437,1214,4614, 373,3849,1142,2220, 667,4615, 442,2763,2563, # 2144
+3850,4028,1969,4282,3300,1840, 837, 170,1107, 934,1336,1883,5244,5245,2119,4283, # 2160
+2841, 743,1569,5246,4616,4284, 582,2389,1418,3484,5247,1803,5248, 357,1395,1729, # 2176
+3717,3301,2423,1564,2241,5249,3106,3851,1633,4617,1114,2086,4285,1532,5250, 482, # 2192
+2451,4618,5251,5252,1492, 833,1466,5253,2726,3599,1641,2842,5254,1526,1272,3718, # 2208
+4286,1686,1795, 416,2564,1903,1954,1804,5255,3852,2798,3853,1159,2321,5256,2881, # 2224
+4619,1610,1584,3056,2424,2764, 443,3302,1163,3161,5257,5258,4029,5259,4287,2506, # 2240
+3057,4620,4030,3162,2104,1647,3600,2011,1873,4288,5260,4289, 431,3485,5261, 250, # 2256
+  97,  81,4290,5262,1648,1851,1558, 160, 848,5263, 866, 740,1694,5264,2204,2843, # 2272
+3226,4291,4621,3719,1687, 950,2479, 426, 469,3227,3720,3721,4031,5265,5266,1188, # 2288
+ 424,1996, 861,3601,4292,3854,2205,2694, 168,1235,3602,4293,5267,2087,1674,4622, # 2304
+3374,3303, 220,2565,1009,5268,3855, 670,3010, 332,1208, 717,5269,5270,3603,2452, # 2320
+4032,3375,5271, 513,5272,1209,2882,3376,3163,4623,1080,5273,5274,5275,5276,2534, # 2336
+3722,3604, 815,1587,4033,4034,5277,3605,3486,3856,1254,4624,1328,3058,1390,4035, # 2352
+1741,4036,3857,4037,5278, 236,3858,2453,3304,5279,5280,3723,3859,1273,3860,4625, # 2368
+5281, 308,5282,4626, 245,4627,1852,2480,1307,2583, 430, 715,2137,2454,5283, 270, # 2384
+ 199,2883,4038,5284,3606,2727,1753, 761,1754, 725,1661,1841,4628,3487,3724,5285, # 2400
+5286, 587,  14,3305, 227,2608, 326, 480,2270, 943,2765,3607, 291, 650,1884,5287, # 2416
+1702,1226, 102,1547,  62,3488, 904,4629,3489,1164,4294,5288,5289,1224,1548,2766, # 2432
+ 391, 498,1493,5290,1386,1419,5291,2056,1177,4630, 813, 880,1081,2368, 566,1145, # 2448
+4631,2291,1001,1035,2566,2609,2242, 394,1286,5292,5293,2069,5294,  86,1494,1730, # 2464
+4039, 491,1588, 745, 897,2963, 843,3377,4040,2767,2884,3306,1768, 998,2221,2070, # 2480
+ 397,1827,1195,1970,3725,3011,3378, 284,5295,3861,2507,2138,2120,1904,5296,4041, # 2496
+2151,4042,4295,1036,3490,1905, 114,2567,4296, 209,1527,5297,5298,2964,2844,2635, # 2512
+2390,2728,3164, 812,2568,5299,3307,5300,1559, 737,1885,3726,1210, 885,  28,2695, # 2528
+3608,3862,5301,4297,1004,1780,4632,5302, 346,1982,2222,2696,4633,3863,1742, 797, # 2544
+1642,4043,1934,1072,1384,2152, 896,4044,3308,3727,3228,2885,3609,5303,2569,1959, # 2560
+4634,2455,1786,5304,5305,5306,4045,4298,1005,1308,3728,4299,2729,4635,4636,1528, # 2576
+2610, 161,1178,4300,1983, 987,4637,1101,4301, 631,4046,1157,3229,2425,1343,1241, # 2592
+1016,2243,2570, 372, 877,2344,2508,1160, 555,1935, 911,4047,5307, 466,1170, 169, # 2608
+1051,2921,2697,3729,2481,3012,1182,2012,2571,1251,2636,5308, 992,2345,3491,1540, # 2624
+2730,1201,2071,2406,1997,2482,5309,4638, 528,1923,2191,1503,1874,1570,2369,3379, # 2640
+3309,5310, 557,1073,5311,1828,3492,2088,2271,3165,3059,3107, 767,3108,2799,4639, # 2656
+1006,4302,4640,2346,1267,2179,3730,3230, 778,4048,3231,2731,1597,2667,5312,4641, # 2672
+5313,3493,5314,5315,5316,3310,2698,1433,3311, 131,  95,1504,4049, 723,4303,3166, # 2688
+1842,3610,2768,2192,4050,2028,2105,3731,5317,3013,4051,1218,5318,3380,3232,4052, # 2704
+4304,2584, 248,1634,3864, 912,5319,2845,3732,3060,3865, 654,  53,5320,3014,5321, # 2720
+1688,4642, 777,3494,1032,4053,1425,5322, 191, 820,2121,2846, 971,4643, 931,3233, # 2736
+ 135, 664, 783,3866,1998, 772,2922,1936,4054,3867,4644,2923,3234, 282,2732, 640, # 2752
+1372,3495,1127, 922, 325,3381,5323,5324, 711,2045,5325,5326,4055,2223,2800,1937, # 2768
+4056,3382,2224,2255,3868,2305,5327,4645,3869,1258,3312,4057,3235,2139,2965,4058, # 2784
+4059,5328,2225, 258,3236,4646, 101,1227,5329,3313,1755,5330,1391,3314,5331,2924, # 2800
+2057, 893,5332,5333,5334,1402,4305,2347,5335,5336,3237,3611,5337,5338, 878,1325, # 2816
+1781,2801,4647, 259,1385,2585, 744,1183,2272,4648,5339,4060,2509,5340, 684,1024, # 2832
+4306,5341, 472,3612,3496,1165,3315,4061,4062, 322,2153, 881, 455,1695,1152,1340, # 2848
+ 660, 554,2154,4649,1058,4650,4307, 830,1065,3383,4063,4651,1924,5342,1703,1919, # 2864
+5343, 932,2273, 122,5344,4652, 947, 677,5345,3870,2637, 297,1906,1925,2274,4653, # 2880
+2322,3316,5346,5347,4308,5348,4309,  84,4310, 112, 989,5349, 547,1059,4064, 701, # 2896
+3613,1019,5350,4311,5351,3497, 942, 639, 457,2306,2456, 993,2966, 407, 851, 494, # 2912
+4654,3384, 927,5352,1237,5353,2426,3385, 573,4312, 680, 921,2925,1279,1875, 285, # 2928
+ 790,1448,1984, 719,2168,5354,5355,4655,4065,4066,1649,5356,1541, 563,5357,1077, # 2944
+5358,3386,3061,3498, 511,3015,4067,4068,3733,4069,1268,2572,3387,3238,4656,4657, # 2960
+5359, 535,1048,1276,1189,2926,2029,3167,1438,1373,2847,2967,1134,2013,5360,4313, # 2976
+1238,2586,3109,1259,5361, 700,5362,2968,3168,3734,4314,5363,4315,1146,1876,1907, # 2992
+4658,2611,4070, 781,2427, 132,1589, 203, 147, 273,2802,2407, 898,1787,2155,4071, # 3008
+4072,5364,3871,2803,5365,5366,4659,4660,5367,3239,5368,1635,3872, 965,5369,1805, # 3024
+2699,1516,3614,1121,1082,1329,3317,4073,1449,3873,  65,1128,2848,2927,2769,1590, # 3040
+3874,5370,5371,  12,2668,  45, 976,2587,3169,4661, 517,2535,1013,1037,3240,5372, # 3056
+3875,2849,5373,3876,5374,3499,5375,2612, 614,1999,2323,3877,3110,2733,2638,5376, # 3072
+2588,4316, 599,1269,5377,1811,3735,5378,2700,3111, 759,1060, 489,1806,3388,3318, # 3088
+1358,5379,5380,2391,1387,1215,2639,2256, 490,5381,5382,4317,1759,2392,2348,5383, # 3104
+4662,3878,1908,4074,2640,1807,3241,4663,3500,3319,2770,2349, 874,5384,5385,3501, # 3120
+3736,1859,  91,2928,3737,3062,3879,4664,5386,3170,4075,2669,5387,3502,1202,1403, # 3136
+3880,2969,2536,1517,2510,4665,3503,2511,5388,4666,5389,2701,1886,1495,1731,4076, # 3152
+2370,4667,5390,2030,5391,5392,4077,2702,1216, 237,2589,4318,2324,4078,3881,4668, # 3168
+4669,2703,3615,3504, 445,4670,5393,5394,5395,5396,2771,  61,4079,3738,1823,4080, # 3184
+5397, 687,2046, 935, 925, 405,2670, 703,1096,1860,2734,4671,4081,1877,1367,2704, # 3200
+3389, 918,2106,1782,2483, 334,3320,1611,1093,4672, 564,3171,3505,3739,3390, 945, # 3216
+2641,2058,4673,5398,1926, 872,4319,5399,3506,2705,3112, 349,4320,3740,4082,4674, # 3232
+3882,4321,3741,2156,4083,4675,4676,4322,4677,2408,2047, 782,4084, 400, 251,4323, # 3248
+1624,5400,5401, 277,3742, 299,1265, 476,1191,3883,2122,4324,4325,1109, 205,5402, # 3264
+2590,1000,2157,3616,1861,5403,5404,5405,4678,5406,4679,2573, 107,2484,2158,4085, # 3280
+3507,3172,5407,1533, 541,1301, 158, 753,4326,2886,3617,5408,1696, 370,1088,4327, # 3296
+4680,3618, 579, 327, 440, 162,2244, 269,1938,1374,3508, 968,3063,  56,1396,3113, # 3312
+2107,3321,3391,5409,1927,2159,4681,3016,5410,3619,5411,5412,3743,4682,2485,5413, # 3328
+2804,5414,1650,4683,5415,2613,5416,5417,4086,2671,3392,1149,3393,4087,3884,4088, # 3344
+5418,1076,  49,5419, 951,3242,3322,3323, 450,2850, 920,5420,1812,2805,2371,4328, # 3360
+1909,1138,2372,3885,3509,5421,3243,4684,1910,1147,1518,2428,4685,3886,5422,4686, # 3376
+2393,2614, 260,1796,3244,5423,5424,3887,3324, 708,5425,3620,1704,5426,3621,1351, # 3392
+1618,3394,3017,1887, 944,4329,3395,4330,3064,3396,4331,5427,3744, 422, 413,1714, # 3408
+3325, 500,2059,2350,4332,2486,5428,1344,1911, 954,5429,1668,5430,5431,4089,2409, # 3424
+4333,3622,3888,4334,5432,2307,1318,2512,3114, 133,3115,2887,4687, 629,  31,2851, # 3440
+2706,3889,4688, 850, 949,4689,4090,2970,1732,2089,4335,1496,1853,5433,4091, 620, # 3456
+3245, 981,1242,3745,3397,1619,3746,1643,3326,2140,2457,1971,1719,3510,2169,5434, # 3472
+3246,5435,5436,3398,1829,5437,1277,4690,1565,2048,5438,1636,3623,3116,5439, 869, # 3488
+2852, 655,3890,3891,3117,4092,3018,3892,1310,3624,4691,5440,5441,5442,1733, 558, # 3504
+4692,3747, 335,1549,3065,1756,4336,3748,1946,3511,1830,1291,1192, 470,2735,2108, # 3520
+2806, 913,1054,4093,5443,1027,5444,3066,4094,4693, 982,2672,3399,3173,3512,3247, # 3536
+3248,1947,2807,5445, 571,4694,5446,1831,5447,3625,2591,1523,2429,5448,2090, 984, # 3552
+4695,3749,1960,5449,3750, 852, 923,2808,3513,3751, 969,1519, 999,2049,2325,1705, # 3568
+5450,3118, 615,1662, 151, 597,4095,2410,2326,1049, 275,4696,3752,4337, 568,3753, # 3584
+3626,2487,4338,3754,5451,2430,2275, 409,3249,5452,1566,2888,3514,1002, 769,2853, # 3600
+ 194,2091,3174,3755,2226,3327,4339, 628,1505,5453,5454,1763,2180,3019,4096, 521, # 3616
+1161,2592,1788,2206,2411,4697,4097,1625,4340,4341, 412,  42,3119, 464,5455,2642, # 3632
+4698,3400,1760,1571,2889,3515,2537,1219,2207,3893,2643,2141,2373,4699,4700,3328, # 3648
+1651,3401,3627,5456,5457,3628,2488,3516,5458,3756,5459,5460,2276,2092, 460,5461, # 3664
+4701,5462,3020, 962, 588,3629, 289,3250,2644,1116,  52,5463,3067,1797,5464,5465, # 3680
+5466,1467,5467,1598,1143,3757,4342,1985,1734,1067,4702,1280,3402, 465,4703,1572, # 3696
+ 510,5468,1928,2245,1813,1644,3630,5469,4704,3758,5470,5471,2673,1573,1534,5472, # 3712
+5473, 536,1808,1761,3517,3894,3175,2645,5474,5475,5476,4705,3518,2929,1912,2809, # 3728
+5477,3329,1122, 377,3251,5478, 360,5479,5480,4343,1529, 551,5481,2060,3759,1769, # 3744
+2431,5482,2930,4344,3330,3120,2327,2109,2031,4706,1404, 136,1468,1479, 672,1171, # 3760
+3252,2308, 271,3176,5483,2772,5484,2050, 678,2736, 865,1948,4707,5485,2014,4098, # 3776
+2971,5486,2737,2227,1397,3068,3760,4708,4709,1735,2931,3403,3631,5487,3895, 509, # 3792
+2854,2458,2890,3896,5488,5489,3177,3178,4710,4345,2538,4711,2309,1166,1010, 552, # 3808
+ 681,1888,5490,5491,2972,2973,4099,1287,1596,1862,3179, 358, 453, 736, 175, 478, # 3824
+1117, 905,1167,1097,5492,1854,1530,5493,1706,5494,2181,3519,2292,3761,3520,3632, # 3840
+4346,2093,4347,5495,3404,1193,2489,4348,1458,2193,2208,1863,1889,1421,3331,2932, # 3856
+3069,2182,3521, 595,2123,5496,4100,5497,5498,4349,1707,2646, 223,3762,1359, 751, # 3872
+3121, 183,3522,5499,2810,3021, 419,2374, 633, 704,3897,2394, 241,5500,5501,5502, # 3888
+ 838,3022,3763,2277,2773,2459,3898,1939,2051,4101,1309,3122,2246,1181,5503,1136, # 3904
+2209,3899,2375,1446,4350,2310,4712,5504,5505,4351,1055,2615, 484,3764,5506,4102, # 3920
+ 625,4352,2278,3405,1499,4353,4103,5507,4104,4354,3253,2279,2280,3523,5508,5509, # 3936
+2774, 808,2616,3765,3406,4105,4355,3123,2539, 526,3407,3900,4356, 955,5510,1620, # 3952
+4357,2647,2432,5511,1429,3766,1669,1832, 994, 928,5512,3633,1260,5513,5514,5515, # 3968
+1949,2293, 741,2933,1626,4358,2738,2460, 867,1184, 362,3408,1392,5516,5517,4106, # 3984
+4359,1770,1736,3254,2934,4713,4714,1929,2707,1459,1158,5518,3070,3409,2891,1292, # 4000
+1930,2513,2855,3767,1986,1187,2072,2015,2617,4360,5519,2574,2514,2170,3768,2490, # 4016
+3332,5520,3769,4715,5521,5522, 666,1003,3023,1022,3634,4361,5523,4716,1814,2257, # 4032
+ 574,3901,1603, 295,1535, 705,3902,4362, 283, 858, 417,5524,5525,3255,4717,4718, # 4048
+3071,1220,1890,1046,2281,2461,4107,1393,1599, 689,2575, 388,4363,5526,2491, 802, # 4064
+5527,2811,3903,2061,1405,2258,5528,4719,3904,2110,1052,1345,3256,1585,5529, 809, # 4080
+5530,5531,5532, 575,2739,3524, 956,1552,1469,1144,2328,5533,2329,1560,2462,3635, # 4096
+3257,4108, 616,2210,4364,3180,2183,2294,5534,1833,5535,3525,4720,5536,1319,3770, # 4112
+3771,1211,3636,1023,3258,1293,2812,5537,5538,5539,3905, 607,2311,3906, 762,2892, # 4128
+1439,4365,1360,4721,1485,3072,5540,4722,1038,4366,1450,2062,2648,4367,1379,4723, # 4144
+2593,5541,5542,4368,1352,1414,2330,2935,1172,5543,5544,3907,3908,4724,1798,1451, # 4160
+5545,5546,5547,5548,2936,4109,4110,2492,2351, 411,4111,4112,3637,3333,3124,4725, # 4176
+1561,2674,1452,4113,1375,5549,5550,  47,2974, 316,5551,1406,1591,2937,3181,5552, # 4192
+1025,2142,3125,3182, 354,2740, 884,2228,4369,2412, 508,3772, 726,3638, 996,2433, # 4208
+3639, 729,5553, 392,2194,1453,4114,4726,3773,5554,5555,2463,3640,2618,1675,2813, # 4224
+ 919,2352,2975,2353,1270,4727,4115,  73,5556,5557, 647,5558,3259,2856,2259,1550, # 4240
+1346,3024,5559,1332, 883,3526,5560,5561,5562,5563,3334,2775,5564,1212, 831,1347, # 4256
+4370,4728,2331,3909,1864,3073, 720,3910,4729,4730,3911,5565,4371,5566,5567,4731, # 4272
+5568,5569,1799,4732,3774,2619,4733,3641,1645,2376,4734,5570,2938, 669,2211,2675, # 4288
+2434,5571,2893,5572,5573,1028,3260,5574,4372,2413,5575,2260,1353,5576,5577,4735, # 4304
+3183, 518,5578,4116,5579,4373,1961,5580,2143,4374,5581,5582,3025,2354,2355,3912, # 4320
+ 516,1834,1454,4117,2708,4375,4736,2229,2620,1972,1129,3642,5583,2776,5584,2976, # 4336
+1422, 577,1470,3026,1524,3410,5585,5586, 432,4376,3074,3527,5587,2594,1455,2515, # 4352
+2230,1973,1175,5588,1020,2741,4118,3528,4737,5589,2742,5590,1743,1361,3075,3529, # 4368
+2649,4119,4377,4738,2295, 895, 924,4378,2171, 331,2247,3076, 166,1627,3077,1098, # 4384
+5591,1232,2894,2231,3411,4739, 657, 403,1196,2377, 542,3775,3412,1600,4379,3530, # 4400
+5592,4740,2777,3261, 576, 530,1362,4741,4742,2540,2676,3776,4120,5593, 842,3913, # 4416
+5594,2814,2032,1014,4121, 213,2709,3413, 665, 621,4380,5595,3777,2939,2435,5596, # 4432
+2436,3335,3643,3414,4743,4381,2541,4382,4744,3644,1682,4383,3531,1380,5597, 724, # 4448
+2282, 600,1670,5598,1337,1233,4745,3126,2248,5599,1621,4746,5600, 651,4384,5601, # 4464
+1612,4385,2621,5602,2857,5603,2743,2312,3078,5604, 716,2464,3079, 174,1255,2710, # 4480
+4122,3645, 548,1320,1398, 728,4123,1574,5605,1891,1197,3080,4124,5606,3081,3082, # 4496
+3778,3646,3779, 747,5607, 635,4386,4747,5608,5609,5610,4387,5611,5612,4748,5613, # 4512
+3415,4749,2437, 451,5614,3780,2542,2073,4388,2744,4389,4125,5615,1764,4750,5616, # 4528
+4390, 350,4751,2283,2395,2493,5617,4391,4126,2249,1434,4127, 488,4752, 458,4392, # 4544
+4128,3781, 771,1330,2396,3914,2576,3184,2160,2414,1553,2677,3185,4393,5618,2494, # 4560
+2895,2622,1720,2711,4394,3416,4753,5619,2543,4395,5620,3262,4396,2778,5621,2016, # 4576
+2745,5622,1155,1017,3782,3915,5623,3336,2313, 201,1865,4397,1430,5624,4129,5625, # 4592
+5626,5627,5628,5629,4398,1604,5630, 414,1866, 371,2595,4754,4755,3532,2017,3127, # 4608
+4756,1708, 960,4399, 887, 389,2172,1536,1663,1721,5631,2232,4130,2356,2940,1580, # 4624
+5632,5633,1744,4757,2544,4758,4759,5634,4760,5635,2074,5636,4761,3647,3417,2896, # 4640
+4400,5637,4401,2650,3418,2815, 673,2712,2465, 709,3533,4131,3648,4402,5638,1148, # 4656
+ 502, 634,5639,5640,1204,4762,3649,1575,4763,2623,3783,5641,3784,3128, 948,3263, # 4672
+ 121,1745,3916,1110,5642,4403,3083,2516,3027,4132,3785,1151,1771,3917,1488,4133, # 4688
+1987,5643,2438,3534,5644,5645,2094,5646,4404,3918,1213,1407,2816, 531,2746,2545, # 4704
+3264,1011,1537,4764,2779,4405,3129,1061,5647,3786,3787,1867,2897,5648,2018, 120, # 4720
+4406,4407,2063,3650,3265,2314,3919,2678,3419,1955,4765,4134,5649,3535,1047,2713, # 4736
+1266,5650,1368,4766,2858, 649,3420,3920,2546,2747,1102,2859,2679,5651,5652,2000, # 4752
+5653,1111,3651,2977,5654,2495,3921,3652,2817,1855,3421,3788,5655,5656,3422,2415, # 4768
+2898,3337,3266,3653,5657,2577,5658,3654,2818,4135,1460, 856,5659,3655,5660,2899, # 4784
+2978,5661,2900,3922,5662,4408, 632,2517, 875,3923,1697,3924,2296,5663,5664,4767, # 4800
+3028,1239, 580,4768,4409,5665, 914, 936,2075,1190,4136,1039,2124,5666,5667,5668, # 4816
+5669,3423,1473,5670,1354,4410,3925,4769,2173,3084,4137, 915,3338,4411,4412,3339, # 4832
+1605,1835,5671,2748, 398,3656,4413,3926,4138, 328,1913,2860,4139,3927,1331,4414, # 4848
+3029, 937,4415,5672,3657,4140,4141,3424,2161,4770,3425, 524, 742, 538,3085,1012, # 4864
+5673,5674,3928,2466,5675, 658,1103, 225,3929,5676,5677,4771,5678,4772,5679,3267, # 4880
+1243,5680,4142, 963,2250,4773,5681,2714,3658,3186,5682,5683,2596,2332,5684,4774, # 4896
+5685,5686,5687,3536, 957,3426,2547,2033,1931,2941,2467, 870,2019,3659,1746,2780, # 4912
+2781,2439,2468,5688,3930,5689,3789,3130,3790,3537,3427,3791,5690,1179,3086,5691, # 4928
+3187,2378,4416,3792,2548,3188,3131,2749,4143,5692,3428,1556,2549,2297, 977,2901, # 4944
+2034,4144,1205,3429,5693,1765,3430,3189,2125,1271, 714,1689,4775,3538,5694,2333, # 4960
+3931, 533,4417,3660,2184, 617,5695,2469,3340,3539,2315,5696,5697,3190,5698,5699, # 4976
+3932,1988, 618, 427,2651,3540,3431,5700,5701,1244,1690,5702,2819,4418,4776,5703, # 4992
+3541,4777,5704,2284,1576, 473,3661,4419,3432, 972,5705,3662,5706,3087,5707,5708, # 5008
+4778,4779,5709,3793,4145,4146,5710, 153,4780, 356,5711,1892,2902,4420,2144, 408, # 5024
+ 803,2357,5712,3933,5713,4421,1646,2578,2518,4781,4782,3934,5714,3935,4422,5715, # 5040
+2416,3433, 752,5716,5717,1962,3341,2979,5718, 746,3030,2470,4783,4423,3794, 698, # 5056
+4784,1893,4424,3663,2550,4785,3664,3936,5719,3191,3434,5720,1824,1302,4147,2715, # 5072
+3937,1974,4425,5721,4426,3192, 823,1303,1288,1236,2861,3542,4148,3435, 774,3938, # 5088
+5722,1581,4786,1304,2862,3939,4787,5723,2440,2162,1083,3268,4427,4149,4428, 344, # 5104
+1173, 288,2316, 454,1683,5724,5725,1461,4788,4150,2597,5726,5727,4789, 985, 894, # 5120
+5728,3436,3193,5729,1914,2942,3795,1989,5730,2111,1975,5731,4151,5732,2579,1194, # 5136
+ 425,5733,4790,3194,1245,3796,4429,5734,5735,2863,5736, 636,4791,1856,3940, 760, # 5152
+1800,5737,4430,2212,1508,4792,4152,1894,1684,2298,5738,5739,4793,4431,4432,2213, # 5168
+ 479,5740,5741, 832,5742,4153,2496,5743,2980,2497,3797, 990,3132, 627,1815,2652, # 5184
+4433,1582,4434,2126,2112,3543,4794,5744, 799,4435,3195,5745,4795,2113,1737,3031, # 5200
+1018, 543, 754,4436,3342,1676,4796,4797,4154,4798,1489,5746,3544,5747,2624,2903, # 5216
+4155,5748,5749,2981,5750,5751,5752,5753,3196,4799,4800,2185,1722,5754,3269,3270, # 5232
+1843,3665,1715, 481, 365,1976,1857,5755,5756,1963,2498,4801,5757,2127,3666,3271, # 5248
+ 433,1895,2064,2076,5758, 602,2750,5759,5760,5761,5762,5763,3032,1628,3437,5764, # 5264
+3197,4802,4156,2904,4803,2519,5765,2551,2782,5766,5767,5768,3343,4804,2905,5769, # 5280
+4805,5770,2864,4806,4807,1221,2982,4157,2520,5771,5772,5773,1868,1990,5774,5775, # 5296
+5776,1896,5777,5778,4808,1897,4158, 318,5779,2095,4159,4437,5780,5781, 485,5782, # 5312
+ 938,3941, 553,2680, 116,5783,3942,3667,5784,3545,2681,2783,3438,3344,2820,5785, # 5328
+3668,2943,4160,1747,2944,2983,5786,5787, 207,5788,4809,5789,4810,2521,5790,3033, # 5344
+ 890,3669,3943,5791,1878,3798,3439,5792,2186,2358,3440,1652,5793,5794,5795, 941, # 5360
+2299, 208,3546,4161,2020, 330,4438,3944,2906,2499,3799,4439,4811,5796,5797,5798, # 5376  #last 512
+#Everything below is of no interest for detection purpose
+2522,1613,4812,5799,3345,3945,2523,5800,4162,5801,1637,4163,2471,4813,3946,5802, # 5392
+2500,3034,3800,5803,5804,2195,4814,5805,2163,5806,5807,5808,5809,5810,5811,5812, # 5408
+5813,5814,5815,5816,5817,5818,5819,5820,5821,5822,5823,5824,5825,5826,5827,5828, # 5424
+5829,5830,5831,5832,5833,5834,5835,5836,5837,5838,5839,5840,5841,5842,5843,5844, # 5440
+5845,5846,5847,5848,5849,5850,5851,5852,5853,5854,5855,5856,5857,5858,5859,5860, # 5456
+5861,5862,5863,5864,5865,5866,5867,5868,5869,5870,5871,5872,5873,5874,5875,5876, # 5472
+5877,5878,5879,5880,5881,5882,5883,5884,5885,5886,5887,5888,5889,5890,5891,5892, # 5488
+5893,5894,5895,5896,5897,5898,5899,5900,5901,5902,5903,5904,5905,5906,5907,5908, # 5504
+5909,5910,5911,5912,5913,5914,5915,5916,5917,5918,5919,5920,5921,5922,5923,5924, # 5520
+5925,5926,5927,5928,5929,5930,5931,5932,5933,5934,5935,5936,5937,5938,5939,5940, # 5536
+5941,5942,5943,5944,5945,5946,5947,5948,5949,5950,5951,5952,5953,5954,5955,5956, # 5552
+5957,5958,5959,5960,5961,5962,5963,5964,5965,5966,5967,5968,5969,5970,5971,5972, # 5568
+5973,5974,5975,5976,5977,5978,5979,5980,5981,5982,5983,5984,5985,5986,5987,5988, # 5584
+5989,5990,5991,5992,5993,5994,5995,5996,5997,5998,5999,6000,6001,6002,6003,6004, # 5600
+6005,6006,6007,6008,6009,6010,6011,6012,6013,6014,6015,6016,6017,6018,6019,6020, # 5616
+6021,6022,6023,6024,6025,6026,6027,6028,6029,6030,6031,6032,6033,6034,6035,6036, # 5632
+6037,6038,6039,6040,6041,6042,6043,6044,6045,6046,6047,6048,6049,6050,6051,6052, # 5648
+6053,6054,6055,6056,6057,6058,6059,6060,6061,6062,6063,6064,6065,6066,6067,6068, # 5664
+6069,6070,6071,6072,6073,6074,6075,6076,6077,6078,6079,6080,6081,6082,6083,6084, # 5680
+6085,6086,6087,6088,6089,6090,6091,6092,6093,6094,6095,6096,6097,6098,6099,6100, # 5696
+6101,6102,6103,6104,6105,6106,6107,6108,6109,6110,6111,6112,6113,6114,6115,6116, # 5712
+6117,6118,6119,6120,6121,6122,6123,6124,6125,6126,6127,6128,6129,6130,6131,6132, # 5728
+6133,6134,6135,6136,6137,6138,6139,6140,6141,6142,6143,6144,6145,6146,6147,6148, # 5744
+6149,6150,6151,6152,6153,6154,6155,6156,6157,6158,6159,6160,6161,6162,6163,6164, # 5760
+6165,6166,6167,6168,6169,6170,6171,6172,6173,6174,6175,6176,6177,6178,6179,6180, # 5776
+6181,6182,6183,6184,6185,6186,6187,6188,6189,6190,6191,6192,6193,6194,6195,6196, # 5792
+6197,6198,6199,6200,6201,6202,6203,6204,6205,6206,6207,6208,6209,6210,6211,6212, # 5808
+6213,6214,6215,6216,6217,6218,6219,6220,6221,6222,6223,3670,6224,6225,6226,6227, # 5824
+6228,6229,6230,6231,6232,6233,6234,6235,6236,6237,6238,6239,6240,6241,6242,6243, # 5840
+6244,6245,6246,6247,6248,6249,6250,6251,6252,6253,6254,6255,6256,6257,6258,6259, # 5856
+6260,6261,6262,6263,6264,6265,6266,6267,6268,6269,6270,6271,6272,6273,6274,6275, # 5872
+6276,6277,6278,6279,6280,6281,6282,6283,6284,6285,4815,6286,6287,6288,6289,6290, # 5888
+6291,6292,4816,6293,6294,6295,6296,6297,6298,6299,6300,6301,6302,6303,6304,6305, # 5904
+6306,6307,6308,6309,6310,6311,4817,4818,6312,6313,6314,6315,6316,6317,6318,4819, # 5920
+6319,6320,6321,6322,6323,6324,6325,6326,6327,6328,6329,6330,6331,6332,6333,6334, # 5936
+6335,6336,6337,4820,6338,6339,6340,6341,6342,6343,6344,6345,6346,6347,6348,6349, # 5952
+6350,6351,6352,6353,6354,6355,6356,6357,6358,6359,6360,6361,6362,6363,6364,6365, # 5968
+6366,6367,6368,6369,6370,6371,6372,6373,6374,6375,6376,6377,6378,6379,6380,6381, # 5984
+6382,6383,6384,6385,6386,6387,6388,6389,6390,6391,6392,6393,6394,6395,6396,6397, # 6000
+6398,6399,6400,6401,6402,6403,6404,6405,6406,6407,6408,6409,6410,3441,6411,6412, # 6016
+6413,6414,6415,6416,6417,6418,6419,6420,6421,6422,6423,6424,6425,4440,6426,6427, # 6032
+6428,6429,6430,6431,6432,6433,6434,6435,6436,6437,6438,6439,6440,6441,6442,6443, # 6048
+6444,6445,6446,6447,6448,6449,6450,6451,6452,6453,6454,4821,6455,6456,6457,6458, # 6064
+6459,6460,6461,6462,6463,6464,6465,6466,6467,6468,6469,6470,6471,6472,6473,6474, # 6080
+6475,6476,6477,3947,3948,6478,6479,6480,6481,3272,4441,6482,6483,6484,6485,4442, # 6096
+6486,6487,6488,6489,6490,6491,6492,6493,6494,6495,6496,4822,6497,6498,6499,6500, # 6112
+6501,6502,6503,6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516, # 6128
+6517,6518,6519,6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532, # 6144
+6533,6534,6535,6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548, # 6160
+6549,6550,6551,6552,6553,6554,6555,6556,2784,6557,4823,6558,6559,6560,6561,6562, # 6176
+6563,6564,6565,6566,6567,6568,6569,3949,6570,6571,6572,4824,6573,6574,6575,6576, # 6192
+6577,6578,6579,6580,6581,6582,6583,4825,6584,6585,6586,3950,2785,6587,6588,6589, # 6208
+6590,6591,6592,6593,6594,6595,6596,6597,6598,6599,6600,6601,6602,6603,6604,6605, # 6224
+6606,6607,6608,6609,6610,6611,6612,4826,6613,6614,6615,4827,6616,6617,6618,6619, # 6240
+6620,6621,6622,6623,6624,6625,4164,6626,6627,6628,6629,6630,6631,6632,6633,6634, # 6256
+3547,6635,4828,6636,6637,6638,6639,6640,6641,6642,3951,2984,6643,6644,6645,6646, # 6272
+6647,6648,6649,4165,6650,4829,6651,6652,4830,6653,6654,6655,6656,6657,6658,6659, # 6288
+6660,6661,6662,4831,6663,6664,6665,6666,6667,6668,6669,6670,6671,4166,6672,4832, # 6304
+3952,6673,6674,6675,6676,4833,6677,6678,6679,4167,6680,6681,6682,3198,6683,6684, # 6320
+6685,6686,6687,6688,6689,6690,6691,6692,6693,6694,6695,6696,6697,4834,6698,6699, # 6336
+6700,6701,6702,6703,6704,6705,6706,6707,6708,6709,6710,6711,6712,6713,6714,6715, # 6352
+6716,6717,6718,6719,6720,6721,6722,6723,6724,6725,6726,6727,6728,6729,6730,6731, # 6368
+6732,6733,6734,4443,6735,6736,6737,6738,6739,6740,6741,6742,6743,6744,6745,4444, # 6384
+6746,6747,6748,6749,6750,6751,6752,6753,6754,6755,6756,6757,6758,6759,6760,6761, # 6400
+6762,6763,6764,6765,6766,6767,6768,6769,6770,6771,6772,6773,6774,6775,6776,6777, # 6416
+6778,6779,6780,6781,4168,6782,6783,3442,6784,6785,6786,6787,6788,6789,6790,6791, # 6432
+4169,6792,6793,6794,6795,6796,6797,6798,6799,6800,6801,6802,6803,6804,6805,6806, # 6448
+6807,6808,6809,6810,6811,4835,6812,6813,6814,4445,6815,6816,4446,6817,6818,6819, # 6464
+6820,6821,6822,6823,6824,6825,6826,6827,6828,6829,6830,6831,6832,6833,6834,6835, # 6480
+3548,6836,6837,6838,6839,6840,6841,6842,6843,6844,6845,6846,4836,6847,6848,6849, # 6496
+6850,6851,6852,6853,6854,3953,6855,6856,6857,6858,6859,6860,6861,6862,6863,6864, # 6512
+6865,6866,6867,6868,6869,6870,6871,6872,6873,6874,6875,6876,6877,3199,6878,6879, # 6528
+6880,6881,6882,4447,6883,6884,6885,6886,6887,6888,6889,6890,6891,6892,6893,6894, # 6544
+6895,6896,6897,6898,6899,6900,6901,6902,6903,6904,4170,6905,6906,6907,6908,6909, # 6560
+6910,6911,6912,6913,6914,6915,6916,6917,6918,6919,6920,6921,6922,6923,6924,6925, # 6576
+6926,6927,4837,6928,6929,6930,6931,6932,6933,6934,6935,6936,3346,6937,6938,4838, # 6592
+6939,6940,6941,4448,6942,6943,6944,6945,6946,4449,6947,6948,6949,6950,6951,6952, # 6608
+6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,6967,6968, # 6624
+6969,6970,6971,6972,6973,6974,6975,6976,6977,6978,6979,6980,6981,6982,6983,6984, # 6640
+6985,6986,6987,6988,6989,6990,6991,6992,6993,6994,3671,6995,6996,6997,6998,4839, # 6656
+6999,7000,7001,7002,3549,7003,7004,7005,7006,7007,7008,7009,7010,7011,7012,7013, # 6672
+7014,7015,7016,7017,7018,7019,7020,7021,7022,7023,7024,7025,7026,7027,7028,7029, # 6688
+7030,4840,7031,7032,7033,7034,7035,7036,7037,7038,4841,7039,7040,7041,7042,7043, # 6704
+7044,7045,7046,7047,7048,7049,7050,7051,7052,7053,7054,7055,7056,7057,7058,7059, # 6720
+7060,7061,7062,7063,7064,7065,7066,7067,7068,7069,7070,2985,7071,7072,7073,7074, # 6736
+7075,7076,7077,7078,7079,7080,4842,7081,7082,7083,7084,7085,7086,7087,7088,7089, # 6752
+7090,7091,7092,7093,7094,7095,7096,7097,7098,7099,7100,7101,7102,7103,7104,7105, # 6768
+7106,7107,7108,7109,7110,7111,7112,7113,7114,7115,7116,7117,7118,4450,7119,7120, # 6784
+7121,7122,7123,7124,7125,7126,7127,7128,7129,7130,7131,7132,7133,7134,7135,7136, # 6800
+7137,7138,7139,7140,7141,7142,7143,4843,7144,7145,7146,7147,7148,7149,7150,7151, # 6816
+7152,7153,7154,7155,7156,7157,7158,7159,7160,7161,7162,7163,7164,7165,7166,7167, # 6832
+7168,7169,7170,7171,7172,7173,7174,7175,7176,7177,7178,7179,7180,7181,7182,7183, # 6848
+7184,7185,7186,7187,7188,4171,4172,7189,7190,7191,7192,7193,7194,7195,7196,7197, # 6864
+7198,7199,7200,7201,7202,7203,7204,7205,7206,7207,7208,7209,7210,7211,7212,7213, # 6880
+7214,7215,7216,7217,7218,7219,7220,7221,7222,7223,7224,7225,7226,7227,7228,7229, # 6896
+7230,7231,7232,7233,7234,7235,7236,7237,7238,7239,7240,7241,7242,7243,7244,7245, # 6912
+7246,7247,7248,7249,7250,7251,7252,7253,7254,7255,7256,7257,7258,7259,7260,7261, # 6928
+7262,7263,7264,7265,7266,7267,7268,7269,7270,7271,7272,7273,7274,7275,7276,7277, # 6944
+7278,7279,7280,7281,7282,7283,7284,7285,7286,7287,7288,7289,7290,7291,7292,7293, # 6960
+7294,7295,7296,4844,7297,7298,7299,7300,7301,7302,7303,7304,7305,7306,7307,7308, # 6976
+7309,7310,7311,7312,7313,7314,7315,7316,4451,7317,7318,7319,7320,7321,7322,7323, # 6992
+7324,7325,7326,7327,7328,7329,7330,7331,7332,7333,7334,7335,7336,7337,7338,7339, # 7008
+7340,7341,7342,7343,7344,7345,7346,7347,7348,7349,7350,7351,7352,7353,4173,7354, # 7024
+7355,4845,7356,7357,7358,7359,7360,7361,7362,7363,7364,7365,7366,7367,7368,7369, # 7040
+7370,7371,7372,7373,7374,7375,7376,7377,7378,7379,7380,7381,7382,7383,7384,7385, # 7056
+7386,7387,7388,4846,7389,7390,7391,7392,7393,7394,7395,7396,7397,7398,7399,7400, # 7072
+7401,7402,7403,7404,7405,3672,7406,7407,7408,7409,7410,7411,7412,7413,7414,7415, # 7088
+7416,7417,7418,7419,7420,7421,7422,7423,7424,7425,7426,7427,7428,7429,7430,7431, # 7104
+7432,7433,7434,7435,7436,7437,7438,7439,7440,7441,7442,7443,7444,7445,7446,7447, # 7120
+7448,7449,7450,7451,7452,7453,4452,7454,3200,7455,7456,7457,7458,7459,7460,7461, # 7136
+7462,7463,7464,7465,7466,7467,7468,7469,7470,7471,7472,7473,7474,4847,7475,7476, # 7152
+7477,3133,7478,7479,7480,7481,7482,7483,7484,7485,7486,7487,7488,7489,7490,7491, # 7168
+7492,7493,7494,7495,7496,7497,7498,7499,7500,7501,7502,3347,7503,7504,7505,7506, # 7184
+7507,7508,7509,7510,7511,7512,7513,7514,7515,7516,7517,7518,7519,7520,7521,4848, # 7200
+7522,7523,7524,7525,7526,7527,7528,7529,7530,7531,7532,7533,7534,7535,7536,7537, # 7216
+7538,7539,7540,7541,7542,7543,7544,7545,7546,7547,7548,7549,3801,4849,7550,7551, # 7232
+7552,7553,7554,7555,7556,7557,7558,7559,7560,7561,7562,7563,7564,7565,7566,7567, # 7248
+7568,7569,3035,7570,7571,7572,7573,7574,7575,7576,7577,7578,7579,7580,7581,7582, # 7264
+7583,7584,7585,7586,7587,7588,7589,7590,7591,7592,7593,7594,7595,7596,7597,7598, # 7280
+7599,7600,7601,7602,7603,7604,7605,7606,7607,7608,7609,7610,7611,7612,7613,7614, # 7296
+7615,7616,4850,7617,7618,3802,7619,7620,7621,7622,7623,7624,7625,7626,7627,7628, # 7312
+7629,7630,7631,7632,4851,7633,7634,7635,7636,7637,7638,7639,7640,7641,7642,7643, # 7328
+7644,7645,7646,7647,7648,7649,7650,7651,7652,7653,7654,7655,7656,7657,7658,7659, # 7344
+7660,7661,7662,7663,7664,7665,7666,7667,7668,7669,7670,4453,7671,7672,7673,7674, # 7360
+7675,7676,7677,7678,7679,7680,7681,7682,7683,7684,7685,7686,7687,7688,7689,7690, # 7376
+7691,7692,7693,7694,7695,7696,7697,3443,7698,7699,7700,7701,7702,4454,7703,7704, # 7392
+7705,7706,7707,7708,7709,7710,7711,7712,7713,2472,7714,7715,7716,7717,7718,7719, # 7408
+7720,7721,7722,7723,7724,7725,7726,7727,7728,7729,7730,7731,3954,7732,7733,7734, # 7424
+7735,7736,7737,7738,7739,7740,7741,7742,7743,7744,7745,7746,7747,7748,7749,7750, # 7440
+3134,7751,7752,4852,7753,7754,7755,4853,7756,7757,7758,7759,7760,4174,7761,7762, # 7456
+7763,7764,7765,7766,7767,7768,7769,7770,7771,7772,7773,7774,7775,7776,7777,7778, # 7472
+7779,7780,7781,7782,7783,7784,7785,7786,7787,7788,7789,7790,7791,7792,7793,7794, # 7488
+7795,7796,7797,7798,7799,7800,7801,7802,7803,7804,7805,4854,7806,7807,7808,7809, # 7504
+7810,7811,7812,7813,7814,7815,7816,7817,7818,7819,7820,7821,7822,7823,7824,7825, # 7520
+4855,7826,7827,7828,7829,7830,7831,7832,7833,7834,7835,7836,7837,7838,7839,7840, # 7536
+7841,7842,7843,7844,7845,7846,7847,3955,7848,7849,7850,7851,7852,7853,7854,7855, # 7552
+7856,7857,7858,7859,7860,3444,7861,7862,7863,7864,7865,7866,7867,7868,7869,7870, # 7568
+7871,7872,7873,7874,7875,7876,7877,7878,7879,7880,7881,7882,7883,7884,7885,7886, # 7584
+7887,7888,7889,7890,7891,4175,7892,7893,7894,7895,7896,4856,4857,7897,7898,7899, # 7600
+7900,2598,7901,7902,7903,7904,7905,7906,7907,7908,4455,7909,7910,7911,7912,7913, # 7616
+7914,3201,7915,7916,7917,7918,7919,7920,7921,4858,7922,7923,7924,7925,7926,7927, # 7632
+7928,7929,7930,7931,7932,7933,7934,7935,7936,7937,7938,7939,7940,7941,7942,7943, # 7648
+7944,7945,7946,7947,7948,7949,7950,7951,7952,7953,7954,7955,7956,7957,7958,7959, # 7664
+7960,7961,7962,7963,7964,7965,7966,7967,7968,7969,7970,7971,7972,7973,7974,7975, # 7680
+7976,7977,7978,7979,7980,7981,4859,7982,7983,7984,7985,7986,7987,7988,7989,7990, # 7696
+7991,7992,7993,7994,7995,7996,4860,7997,7998,7999,8000,8001,8002,8003,8004,8005, # 7712
+8006,8007,8008,8009,8010,8011,8012,8013,8014,8015,8016,4176,8017,8018,8019,8020, # 7728
+8021,8022,8023,4861,8024,8025,8026,8027,8028,8029,8030,8031,8032,8033,8034,8035, # 7744
+8036,4862,4456,8037,8038,8039,8040,4863,8041,8042,8043,8044,8045,8046,8047,8048, # 7760
+8049,8050,8051,8052,8053,8054,8055,8056,8057,8058,8059,8060,8061,8062,8063,8064, # 7776
+8065,8066,8067,8068,8069,8070,8071,8072,8073,8074,8075,8076,8077,8078,8079,8080, # 7792
+8081,8082,8083,8084,8085,8086,8087,8088,8089,8090,8091,8092,8093,8094,8095,8096, # 7808
+8097,8098,8099,4864,4177,8100,8101,8102,8103,8104,8105,8106,8107,8108,8109,8110, # 7824
+8111,8112,8113,8114,8115,8116,8117,8118,8119,8120,4178,8121,8122,8123,8124,8125, # 7840
+8126,8127,8128,8129,8130,8131,8132,8133,8134,8135,8136,8137,8138,8139,8140,8141, # 7856
+8142,8143,8144,8145,4865,4866,8146,8147,8148,8149,8150,8151,8152,8153,8154,8155, # 7872
+8156,8157,8158,8159,8160,8161,8162,8163,8164,8165,4179,8166,8167,8168,8169,8170, # 7888
+8171,8172,8173,8174,8175,8176,8177,8178,8179,8180,8181,4457,8182,8183,8184,8185, # 7904
+8186,8187,8188,8189,8190,8191,8192,8193,8194,8195,8196,8197,8198,8199,8200,8201, # 7920
+8202,8203,8204,8205,8206,8207,8208,8209,8210,8211,8212,8213,8214,8215,8216,8217, # 7936
+8218,8219,8220,8221,8222,8223,8224,8225,8226,8227,8228,8229,8230,8231,8232,8233, # 7952
+8234,8235,8236,8237,8238,8239,8240,8241,8242,8243,8244,8245,8246,8247,8248,8249, # 7968
+8250,8251,8252,8253,8254,8255,8256,3445,8257,8258,8259,8260,8261,8262,4458,8263, # 7984
+8264,8265,8266,8267,8268,8269,8270,8271,8272,4459,8273,8274,8275,8276,3550,8277, # 8000
+8278,8279,8280,8281,8282,8283,8284,8285,8286,8287,8288,8289,4460,8290,8291,8292, # 8016
+8293,8294,8295,8296,8297,8298,8299,8300,8301,8302,8303,8304,8305,8306,8307,4867, # 8032
+8308,8309,8310,8311,8312,3551,8313,8314,8315,8316,8317,8318,8319,8320,8321,8322, # 8048
+8323,8324,8325,8326,4868,8327,8328,8329,8330,8331,8332,8333,8334,8335,8336,8337, # 8064
+8338,8339,8340,8341,8342,8343,8344,8345,8346,8347,8348,8349,8350,8351,8352,8353, # 8080
+8354,8355,8356,8357,8358,8359,8360,8361,8362,8363,4869,4461,8364,8365,8366,8367, # 8096
+8368,8369,8370,4870,8371,8372,8373,8374,8375,8376,8377,8378,8379,8380,8381,8382, # 8112
+8383,8384,8385,8386,8387,8388,8389,8390,8391,8392,8393,8394,8395,8396,8397,8398, # 8128
+8399,8400,8401,8402,8403,8404,8405,8406,8407,8408,8409,8410,4871,8411,8412,8413, # 8144
+8414,8415,8416,8417,8418,8419,8420,8421,8422,4462,8423,8424,8425,8426,8427,8428, # 8160
+8429,8430,8431,8432,8433,2986,8434,8435,8436,8437,8438,8439,8440,8441,8442,8443, # 8176
+8444,8445,8446,8447,8448,8449,8450,8451,8452,8453,8454,8455,8456,8457,8458,8459, # 8192
+8460,8461,8462,8463,8464,8465,8466,8467,8468,8469,8470,8471,8472,8473,8474,8475, # 8208
+8476,8477,8478,4180,8479,8480,8481,8482,8483,8484,8485,8486,8487,8488,8489,8490, # 8224
+8491,8492,8493,8494,8495,8496,8497,8498,8499,8500,8501,8502,8503,8504,8505,8506, # 8240
+8507,8508,8509,8510,8511,8512,8513,8514,8515,8516,8517,8518,8519,8520,8521,8522, # 8256
+8523,8524,8525,8526,8527,8528,8529,8530,8531,8532,8533,8534,8535,8536,8537,8538, # 8272
+8539,8540,8541,8542,8543,8544,8545,8546,8547,8548,8549,8550,8551,8552,8553,8554, # 8288
+8555,8556,8557,8558,8559,8560,8561,8562,8563,8564,4872,8565,8566,8567,8568,8569, # 8304
+8570,8571,8572,8573,4873,8574,8575,8576,8577,8578,8579,8580,8581,8582,8583,8584, # 8320
+8585,8586,8587,8588,8589,8590,8591,8592,8593,8594,8595,8596,8597,8598,8599,8600, # 8336
+8601,8602,8603,8604,8605,3803,8606,8607,8608,8609,8610,8611,8612,8613,4874,3804, # 8352
+8614,8615,8616,8617,8618,8619,8620,8621,3956,8622,8623,8624,8625,8626,8627,8628, # 8368
+8629,8630,8631,8632,8633,8634,8635,8636,8637,8638,2865,8639,8640,8641,8642,8643, # 8384
+8644,8645,8646,8647,8648,8649,8650,8651,8652,8653,8654,8655,8656,4463,8657,8658, # 8400
+8659,4875,4876,8660,8661,8662,8663,8664,8665,8666,8667,8668,8669,8670,8671,8672, # 8416
+8673,8674,8675,8676,8677,8678,8679,8680,8681,4464,8682,8683,8684,8685,8686,8687, # 8432
+8688,8689,8690,8691,8692,8693,8694,8695,8696,8697,8698,8699,8700,8701,8702,8703, # 8448
+8704,8705,8706,8707,8708,8709,2261,8710,8711,8712,8713,8714,8715,8716,8717,8718, # 8464
+8719,8720,8721,8722,8723,8724,8725,8726,8727,8728,8729,8730,8731,8732,8733,4181, # 8480
+8734,8735,8736,8737,8738,8739,8740,8741,8742,8743,8744,8745,8746,8747,8748,8749, # 8496
+8750,8751,8752,8753,8754,8755,8756,8757,8758,8759,8760,8761,8762,8763,4877,8764, # 8512
+8765,8766,8767,8768,8769,8770,8771,8772,8773,8774,8775,8776,8777,8778,8779,8780, # 8528
+8781,8782,8783,8784,8785,8786,8787,8788,4878,8789,4879,8790,8791,8792,4880,8793, # 8544
+8794,8795,8796,8797,8798,8799,8800,8801,4881,8802,8803,8804,8805,8806,8807,8808, # 8560
+8809,8810,8811,8812,8813,8814,8815,3957,8816,8817,8818,8819,8820,8821,8822,8823, # 8576
+8824,8825,8826,8827,8828,8829,8830,8831,8832,8833,8834,8835,8836,8837,8838,8839, # 8592
+8840,8841,8842,8843,8844,8845,8846,8847,4882,8848,8849,8850,8851,8852,8853,8854, # 8608
+8855,8856,8857,8858,8859,8860,8861,8862,8863,8864,8865,8866,8867,8868,8869,8870, # 8624
+8871,8872,8873,8874,8875,8876,8877,8878,8879,8880,8881,8882,8883,8884,3202,8885, # 8640
+8886,8887,8888,8889,8890,8891,8892,8893,8894,8895,8896,8897,8898,8899,8900,8901, # 8656
+8902,8903,8904,8905,8906,8907,8908,8909,8910,8911,8912,8913,8914,8915,8916,8917, # 8672
+8918,8919,8920,8921,8922,8923,8924,4465,8925,8926,8927,8928,8929,8930,8931,8932, # 8688
+4883,8933,8934,8935,8936,8937,8938,8939,8940,8941,8942,8943,2214,8944,8945,8946, # 8704
+8947,8948,8949,8950,8951,8952,8953,8954,8955,8956,8957,8958,8959,8960,8961,8962, # 8720
+8963,8964,8965,4884,8966,8967,8968,8969,8970,8971,8972,8973,8974,8975,8976,8977, # 8736
+8978,8979,8980,8981,8982,8983,8984,8985,8986,8987,8988,8989,8990,8991,8992,4885, # 8752
+8993,8994,8995,8996,8997,8998,8999,9000,9001,9002,9003,9004,9005,9006,9007,9008, # 8768
+9009,9010,9011,9012,9013,9014,9015,9016,9017,9018,9019,9020,9021,4182,9022,9023, # 8784
+9024,9025,9026,9027,9028,9029,9030,9031,9032,9033,9034,9035,9036,9037,9038,9039, # 8800
+9040,9041,9042,9043,9044,9045,9046,9047,9048,9049,9050,9051,9052,9053,9054,9055, # 8816
+9056,9057,9058,9059,9060,9061,9062,9063,4886,9064,9065,9066,9067,9068,9069,4887, # 8832
+9070,9071,9072,9073,9074,9075,9076,9077,9078,9079,9080,9081,9082,9083,9084,9085, # 8848
+9086,9087,9088,9089,9090,9091,9092,9093,9094,9095,9096,9097,9098,9099,9100,9101, # 8864
+9102,9103,9104,9105,9106,9107,9108,9109,9110,9111,9112,9113,9114,9115,9116,9117, # 8880
+9118,9119,9120,9121,9122,9123,9124,9125,9126,9127,9128,9129,9130,9131,9132,9133, # 8896
+9134,9135,9136,9137,9138,9139,9140,9141,3958,9142,9143,9144,9145,9146,9147,9148, # 8912
+9149,9150,9151,4888,9152,9153,9154,9155,9156,9157,9158,9159,9160,9161,9162,9163, # 8928
+9164,9165,9166,9167,9168,9169,9170,9171,9172,9173,9174,9175,4889,9176,9177,9178, # 8944
+9179,9180,9181,9182,9183,9184,9185,9186,9187,9188,9189,9190,9191,9192,9193,9194, # 8960
+9195,9196,9197,9198,9199,9200,9201,9202,9203,4890,9204,9205,9206,9207,9208,9209, # 8976
+9210,9211,9212,9213,9214,9215,9216,9217,9218,9219,9220,9221,9222,4466,9223,9224, # 8992
+9225,9226,9227,9228,9229,9230,9231,9232,9233,9234,9235,9236,9237,9238,9239,9240, # 9008
+9241,9242,9243,9244,9245,4891,9246,9247,9248,9249,9250,9251,9252,9253,9254,9255, # 9024
+9256,9257,4892,9258,9259,9260,9261,4893,4894,9262,9263,9264,9265,9266,9267,9268, # 9040
+9269,9270,9271,9272,9273,4467,9274,9275,9276,9277,9278,9279,9280,9281,9282,9283, # 9056
+9284,9285,3673,9286,9287,9288,9289,9290,9291,9292,9293,9294,9295,9296,9297,9298, # 9072
+9299,9300,9301,9302,9303,9304,9305,9306,9307,9308,9309,9310,9311,9312,9313,9314, # 9088
+9315,9316,9317,9318,9319,9320,9321,9322,4895,9323,9324,9325,9326,9327,9328,9329, # 9104
+9330,9331,9332,9333,9334,9335,9336,9337,9338,9339,9340,9341,9342,9343,9344,9345, # 9120
+9346,9347,4468,9348,9349,9350,9351,9352,9353,9354,9355,9356,9357,9358,9359,9360, # 9136
+9361,9362,9363,9364,9365,9366,9367,9368,9369,9370,9371,9372,9373,4896,9374,4469, # 9152
+9375,9376,9377,9378,9379,4897,9380,9381,9382,9383,9384,9385,9386,9387,9388,9389, # 9168
+9390,9391,9392,9393,9394,9395,9396,9397,9398,9399,9400,9401,9402,9403,9404,9405, # 9184
+9406,4470,9407,2751,9408,9409,3674,3552,9410,9411,9412,9413,9414,9415,9416,9417, # 9200
+9418,9419,9420,9421,4898,9422,9423,9424,9425,9426,9427,9428,9429,3959,9430,9431, # 9216
+9432,9433,9434,9435,9436,4471,9437,9438,9439,9440,9441,9442,9443,9444,9445,9446, # 9232
+9447,9448,9449,9450,3348,9451,9452,9453,9454,9455,9456,9457,9458,9459,9460,9461, # 9248
+9462,9463,9464,9465,9466,9467,9468,9469,9470,9471,9472,4899,9473,9474,9475,9476, # 9264
+9477,4900,9478,9479,9480,9481,9482,9483,9484,9485,9486,9487,9488,3349,9489,9490, # 9280
+9491,9492,9493,9494,9495,9496,9497,9498,9499,9500,9501,9502,9503,9504,9505,9506, # 9296
+9507,9508,9509,9510,9511,9512,9513,9514,9515,9516,9517,9518,9519,9520,4901,9521, # 9312
+9522,9523,9524,9525,9526,4902,9527,9528,9529,9530,9531,9532,9533,9534,9535,9536, # 9328
+9537,9538,9539,9540,9541,9542,9543,9544,9545,9546,9547,9548,9549,9550,9551,9552, # 9344
+9553,9554,9555,9556,9557,9558,9559,9560,9561,9562,9563,9564,9565,9566,9567,9568, # 9360
+9569,9570,9571,9572,9573,9574,9575,9576,9577,9578,9579,9580,9581,9582,9583,9584, # 9376
+3805,9585,9586,9587,9588,9589,9590,9591,9592,9593,9594,9595,9596,9597,9598,9599, # 9392
+9600,9601,9602,4903,9603,9604,9605,9606,9607,4904,9608,9609,9610,9611,9612,9613, # 9408
+9614,4905,9615,9616,9617,9618,9619,9620,9621,9622,9623,9624,9625,9626,9627,9628, # 9424
+9629,9630,9631,9632,4906,9633,9634,9635,9636,9637,9638,9639,9640,9641,9642,9643, # 9440
+4907,9644,9645,9646,9647,9648,9649,9650,9651,9652,9653,9654,9655,9656,9657,9658, # 9456
+9659,9660,9661,9662,9663,9664,9665,9666,9667,9668,9669,9670,9671,9672,4183,9673, # 9472
+9674,9675,9676,9677,4908,9678,9679,9680,9681,4909,9682,9683,9684,9685,9686,9687, # 9488
+9688,9689,9690,4910,9691,9692,9693,3675,9694,9695,9696,2945,9697,9698,9699,9700, # 9504
+9701,9702,9703,9704,9705,4911,9706,9707,9708,9709,9710,9711,9712,9713,9714,9715, # 9520
+9716,9717,9718,9719,9720,9721,9722,9723,9724,9725,9726,9727,9728,9729,9730,9731, # 9536
+9732,9733,9734,9735,4912,9736,9737,9738,9739,9740,4913,9741,9742,9743,9744,9745, # 9552
+9746,9747,9748,9749,9750,9751,9752,9753,9754,9755,9756,9757,9758,4914,9759,9760, # 9568
+9761,9762,9763,9764,9765,9766,9767,9768,9769,9770,9771,9772,9773,9774,9775,9776, # 9584
+9777,9778,9779,9780,9781,9782,4915,9783,9784,9785,9786,9787,9788,9789,9790,9791, # 9600
+9792,9793,4916,9794,9795,9796,9797,9798,9799,9800,9801,9802,9803,9804,9805,9806, # 9616
+9807,9808,9809,9810,9811,9812,9813,9814,9815,9816,9817,9818,9819,9820,9821,9822, # 9632
+9823,9824,9825,9826,9827,9828,9829,9830,9831,9832,9833,9834,9835,9836,9837,9838, # 9648
+9839,9840,9841,9842,9843,9844,9845,9846,9847,9848,9849,9850,9851,9852,9853,9854, # 9664
+9855,9856,9857,9858,9859,9860,9861,9862,9863,9864,9865,9866,9867,9868,4917,9869, # 9680
+9870,9871,9872,9873,9874,9875,9876,9877,9878,9879,9880,9881,9882,9883,9884,9885, # 9696
+9886,9887,9888,9889,9890,9891,9892,4472,9893,9894,9895,9896,9897,3806,9898,9899, # 9712
+9900,9901,9902,9903,9904,9905,9906,9907,9908,9909,9910,9911,9912,9913,9914,4918, # 9728
+9915,9916,9917,4919,9918,9919,9920,9921,4184,9922,9923,9924,9925,9926,9927,9928, # 9744
+9929,9930,9931,9932,9933,9934,9935,9936,9937,9938,9939,9940,9941,9942,9943,9944, # 9760
+9945,9946,4920,9947,9948,9949,9950,9951,9952,9953,9954,9955,4185,9956,9957,9958, # 9776
+9959,9960,9961,9962,9963,9964,9965,4921,9966,9967,9968,4473,9969,9970,9971,9972, # 9792
+9973,9974,9975,9976,9977,4474,9978,9979,9980,9981,9982,9983,9984,9985,9986,9987, # 9808
+9988,9989,9990,9991,9992,9993,9994,9995,9996,9997,9998,9999,10000,10001,10002,10003, # 9824
+10004,10005,10006,10007,10008,10009,10010,10011,10012,10013,10014,10015,10016,10017,10018,10019, # 9840
+10020,10021,4922,10022,4923,10023,10024,10025,10026,10027,10028,10029,10030,10031,10032,10033, # 9856
+10034,10035,10036,10037,10038,10039,10040,10041,10042,10043,10044,10045,10046,10047,10048,4924, # 9872
+10049,10050,10051,10052,10053,10054,10055,10056,10057,10058,10059,10060,10061,10062,10063,10064, # 9888
+10065,10066,10067,10068,10069,10070,10071,10072,10073,10074,10075,10076,10077,10078,10079,10080, # 9904
+10081,10082,10083,10084,10085,10086,10087,4475,10088,10089,10090,10091,10092,10093,10094,10095, # 9920
+10096,10097,4476,10098,10099,10100,10101,10102,10103,10104,10105,10106,10107,10108,10109,10110, # 9936
+10111,2174,10112,10113,10114,10115,10116,10117,10118,10119,10120,10121,10122,10123,10124,10125, # 9952
+10126,10127,10128,10129,10130,10131,10132,10133,10134,10135,10136,10137,10138,10139,10140,3807, # 9968
+4186,4925,10141,10142,10143,10144,10145,10146,10147,4477,4187,10148,10149,10150,10151,10152, # 9984
+10153,4188,10154,10155,10156,10157,10158,10159,10160,10161,4926,10162,10163,10164,10165,10166, #10000
+10167,10168,10169,10170,10171,10172,10173,10174,10175,10176,10177,10178,10179,10180,10181,10182, #10016
+10183,10184,10185,10186,10187,10188,10189,10190,10191,10192,3203,10193,10194,10195,10196,10197, #10032
+10198,10199,10200,4478,10201,10202,10203,10204,4479,10205,10206,10207,10208,10209,10210,10211, #10048
+10212,10213,10214,10215,10216,10217,10218,10219,10220,10221,10222,10223,10224,10225,10226,10227, #10064
+10228,10229,10230,10231,10232,10233,10234,4927,10235,10236,10237,10238,10239,10240,10241,10242, #10080
+10243,10244,10245,10246,10247,10248,10249,10250,10251,10252,10253,10254,10255,10256,10257,10258, #10096
+10259,10260,10261,10262,10263,10264,10265,10266,10267,10268,10269,10270,10271,10272,10273,4480, #10112
+4928,4929,10274,10275,10276,10277,10278,10279,10280,10281,10282,10283,10284,10285,10286,10287, #10128
+10288,10289,10290,10291,10292,10293,10294,10295,10296,10297,10298,10299,10300,10301,10302,10303, #10144
+10304,10305,10306,10307,10308,10309,10310,10311,10312,10313,10314,10315,10316,10317,10318,10319, #10160
+10320,10321,10322,10323,10324,10325,10326,10327,10328,10329,10330,10331,10332,10333,10334,4930, #10176
+10335,10336,10337,10338,10339,10340,10341,10342,4931,10343,10344,10345,10346,10347,10348,10349, #10192
+10350,10351,10352,10353,10354,10355,3088,10356,2786,10357,10358,10359,10360,4189,10361,10362, #10208
+10363,10364,10365,10366,10367,10368,10369,10370,10371,10372,10373,10374,10375,4932,10376,10377, #10224
+10378,10379,10380,10381,10382,10383,10384,10385,10386,10387,10388,10389,10390,10391,10392,4933, #10240
+10393,10394,10395,4934,10396,10397,10398,10399,10400,10401,10402,10403,10404,10405,10406,10407, #10256
+10408,10409,10410,10411,10412,3446,10413,10414,10415,10416,10417,10418,10419,10420,10421,10422, #10272
+10423,4935,10424,10425,10426,10427,10428,10429,10430,4936,10431,10432,10433,10434,10435,10436, #10288
+10437,10438,10439,10440,10441,10442,10443,4937,10444,10445,10446,10447,4481,10448,10449,10450, #10304
+10451,10452,10453,10454,10455,10456,10457,10458,10459,10460,10461,10462,10463,10464,10465,10466, #10320
+10467,10468,10469,10470,10471,10472,10473,10474,10475,10476,10477,10478,10479,10480,10481,10482, #10336
+10483,10484,10485,10486,10487,10488,10489,10490,10491,10492,10493,10494,10495,10496,10497,10498, #10352
+10499,10500,10501,10502,10503,10504,10505,4938,10506,10507,10508,10509,10510,2552,10511,10512, #10368
+10513,10514,10515,10516,3447,10517,10518,10519,10520,10521,10522,10523,10524,10525,10526,10527, #10384
+10528,10529,10530,10531,10532,10533,10534,10535,10536,10537,10538,10539,10540,10541,10542,10543, #10400
+4482,10544,4939,10545,10546,10547,10548,10549,10550,10551,10552,10553,10554,10555,10556,10557, #10416
+10558,10559,10560,10561,10562,10563,10564,10565,10566,10567,3676,4483,10568,10569,10570,10571, #10432
+10572,3448,10573,10574,10575,10576,10577,10578,10579,10580,10581,10582,10583,10584,10585,10586, #10448
+10587,10588,10589,10590,10591,10592,10593,10594,10595,10596,10597,10598,10599,10600,10601,10602, #10464
+10603,10604,10605,10606,10607,10608,10609,10610,10611,10612,10613,10614,10615,10616,10617,10618, #10480
+10619,10620,10621,10622,10623,10624,10625,10626,10627,4484,10628,10629,10630,10631,10632,4940, #10496
+10633,10634,10635,10636,10637,10638,10639,10640,10641,10642,10643,10644,10645,10646,10647,10648, #10512
+10649,10650,10651,10652,10653,10654,10655,10656,4941,10657,10658,10659,2599,10660,10661,10662, #10528
+10663,10664,10665,10666,3089,10667,10668,10669,10670,10671,10672,10673,10674,10675,10676,10677, #10544
+10678,10679,10680,4942,10681,10682,10683,10684,10685,10686,10687,10688,10689,10690,10691,10692, #10560
+10693,10694,10695,10696,10697,4485,10698,10699,10700,10701,10702,10703,10704,4943,10705,3677, #10576
+10706,10707,10708,10709,10710,10711,10712,4944,10713,10714,10715,10716,10717,10718,10719,10720, #10592
+10721,10722,10723,10724,10725,10726,10727,10728,4945,10729,10730,10731,10732,10733,10734,10735, #10608
+10736,10737,10738,10739,10740,10741,10742,10743,10744,10745,10746,10747,10748,10749,10750,10751, #10624
+10752,10753,10754,10755,10756,10757,10758,10759,10760,10761,4946,10762,10763,10764,10765,10766, #10640
+10767,4947,4948,10768,10769,10770,10771,10772,10773,10774,10775,10776,10777,10778,10779,10780, #10656
+10781,10782,10783,10784,10785,10786,10787,10788,10789,10790,10791,10792,10793,10794,10795,10796, #10672
+10797,10798,10799,10800,10801,10802,10803,10804,10805,10806,10807,10808,10809,10810,10811,10812, #10688
+10813,10814,10815,10816,10817,10818,10819,10820,10821,10822,10823,10824,10825,10826,10827,10828, #10704
+10829,10830,10831,10832,10833,10834,10835,10836,10837,10838,10839,10840,10841,10842,10843,10844, #10720
+10845,10846,10847,10848,10849,10850,10851,10852,10853,10854,10855,10856,10857,10858,10859,10860, #10736
+10861,10862,10863,10864,10865,10866,10867,10868,10869,10870,10871,10872,10873,10874,10875,10876, #10752
+10877,10878,4486,10879,10880,10881,10882,10883,10884,10885,4949,10886,10887,10888,10889,10890, #10768
+10891,10892,10893,10894,10895,10896,10897,10898,10899,10900,10901,10902,10903,10904,10905,10906, #10784
+10907,10908,10909,10910,10911,10912,10913,10914,10915,10916,10917,10918,10919,4487,10920,10921, #10800
+10922,10923,10924,10925,10926,10927,10928,10929,10930,10931,10932,4950,10933,10934,10935,10936, #10816
+10937,10938,10939,10940,10941,10942,10943,10944,10945,10946,10947,10948,10949,4488,10950,10951, #10832
+10952,10953,10954,10955,10956,10957,10958,10959,4190,10960,10961,10962,10963,10964,10965,10966, #10848
+10967,10968,10969,10970,10971,10972,10973,10974,10975,10976,10977,10978,10979,10980,10981,10982, #10864
+10983,10984,10985,10986,10987,10988,10989,10990,10991,10992,10993,10994,10995,10996,10997,10998, #10880
+10999,11000,11001,11002,11003,11004,11005,11006,3960,11007,11008,11009,11010,11011,11012,11013, #10896
+11014,11015,11016,11017,11018,11019,11020,11021,11022,11023,11024,11025,11026,11027,11028,11029, #10912
+11030,11031,11032,4951,11033,11034,11035,11036,11037,11038,11039,11040,11041,11042,11043,11044, #10928
+11045,11046,11047,4489,11048,11049,11050,11051,4952,11052,11053,11054,11055,11056,11057,11058, #10944
+4953,11059,11060,11061,11062,11063,11064,11065,11066,11067,11068,11069,11070,11071,4954,11072, #10960
+11073,11074,11075,11076,11077,11078,11079,11080,11081,11082,11083,11084,11085,11086,11087,11088, #10976
+11089,11090,11091,11092,11093,11094,11095,11096,11097,11098,11099,11100,11101,11102,11103,11104, #10992
+11105,11106,11107,11108,11109,11110,11111,11112,11113,11114,11115,3808,11116,11117,11118,11119, #11008
+11120,11121,11122,11123,11124,11125,11126,11127,11128,11129,11130,11131,11132,11133,11134,4955, #11024
+11135,11136,11137,11138,11139,11140,11141,11142,11143,11144,11145,11146,11147,11148,11149,11150, #11040
+11151,11152,11153,11154,11155,11156,11157,11158,11159,11160,11161,4956,11162,11163,11164,11165, #11056
+11166,11167,11168,11169,11170,11171,11172,11173,11174,11175,11176,11177,11178,11179,11180,4957, #11072
+11181,11182,11183,11184,11185,11186,4958,11187,11188,11189,11190,11191,11192,11193,11194,11195, #11088
+11196,11197,11198,11199,11200,3678,11201,11202,11203,11204,11205,11206,4191,11207,11208,11209, #11104
+11210,11211,11212,11213,11214,11215,11216,11217,11218,11219,11220,11221,11222,11223,11224,11225, #11120
+11226,11227,11228,11229,11230,11231,11232,11233,11234,11235,11236,11237,11238,11239,11240,11241, #11136
+11242,11243,11244,11245,11246,11247,11248,11249,11250,11251,4959,11252,11253,11254,11255,11256, #11152
+11257,11258,11259,11260,11261,11262,11263,11264,11265,11266,11267,11268,11269,11270,11271,11272, #11168
+11273,11274,11275,11276,11277,11278,11279,11280,11281,11282,11283,11284,11285,11286,11287,11288, #11184
+11289,11290,11291,11292,11293,11294,11295,11296,11297,11298,11299,11300,11301,11302,11303,11304, #11200
+11305,11306,11307,11308,11309,11310,11311,11312,11313,11314,3679,11315,11316,11317,11318,4490, #11216
+11319,11320,11321,11322,11323,11324,11325,11326,11327,11328,11329,11330,11331,11332,11333,11334, #11232
+11335,11336,11337,11338,11339,11340,11341,11342,11343,11344,11345,11346,11347,4960,11348,11349, #11248
+11350,11351,11352,11353,11354,11355,11356,11357,11358,11359,11360,11361,11362,11363,11364,11365, #11264
+11366,11367,11368,11369,11370,11371,11372,11373,11374,11375,11376,11377,3961,4961,11378,11379, #11280
+11380,11381,11382,11383,11384,11385,11386,11387,11388,11389,11390,11391,11392,11393,11394,11395, #11296
+11396,11397,4192,11398,11399,11400,11401,11402,11403,11404,11405,11406,11407,11408,11409,11410, #11312
+11411,4962,11412,11413,11414,11415,11416,11417,11418,11419,11420,11421,11422,11423,11424,11425, #11328
+11426,11427,11428,11429,11430,11431,11432,11433,11434,11435,11436,11437,11438,11439,11440,11441, #11344
+11442,11443,11444,11445,11446,11447,11448,11449,11450,11451,11452,11453,11454,11455,11456,11457, #11360
+11458,11459,11460,11461,11462,11463,11464,11465,11466,11467,11468,11469,4963,11470,11471,4491, #11376
+11472,11473,11474,11475,4964,11476,11477,11478,11479,11480,11481,11482,11483,11484,11485,11486, #11392
+11487,11488,11489,11490,11491,11492,4965,11493,11494,11495,11496,11497,11498,11499,11500,11501, #11408
+11502,11503,11504,11505,11506,11507,11508,11509,11510,11511,11512,11513,11514,11515,11516,11517, #11424
+11518,11519,11520,11521,11522,11523,11524,11525,11526,11527,11528,11529,3962,11530,11531,11532, #11440
+11533,11534,11535,11536,11537,11538,11539,11540,11541,11542,11543,11544,11545,11546,11547,11548, #11456
+11549,11550,11551,11552,11553,11554,11555,11556,11557,11558,11559,11560,11561,11562,11563,11564, #11472
+4193,4194,11565,11566,11567,11568,11569,11570,11571,11572,11573,11574,11575,11576,11577,11578, #11488
+11579,11580,11581,11582,11583,11584,11585,11586,11587,11588,11589,11590,11591,4966,4195,11592, #11504
+11593,11594,11595,11596,11597,11598,11599,11600,11601,11602,11603,11604,3090,11605,11606,11607, #11520
+11608,11609,11610,4967,11611,11612,11613,11614,11615,11616,11617,11618,11619,11620,11621,11622, #11536
+11623,11624,11625,11626,11627,11628,11629,11630,11631,11632,11633,11634,11635,11636,11637,11638, #11552
+11639,11640,11641,11642,11643,11644,11645,11646,11647,11648,11649,11650,11651,11652,11653,11654, #11568
+11655,11656,11657,11658,11659,11660,11661,11662,11663,11664,11665,11666,11667,11668,11669,11670, #11584
+11671,11672,11673,11674,4968,11675,11676,11677,11678,11679,11680,11681,11682,11683,11684,11685, #11600
+11686,11687,11688,11689,11690,11691,11692,11693,3809,11694,11695,11696,11697,11698,11699,11700, #11616
+11701,11702,11703,11704,11705,11706,11707,11708,11709,11710,11711,11712,11713,11714,11715,11716, #11632
+11717,11718,3553,11719,11720,11721,11722,11723,11724,11725,11726,11727,11728,11729,11730,4969, #11648
+11731,11732,11733,11734,11735,11736,11737,11738,11739,11740,4492,11741,11742,11743,11744,11745, #11664
+11746,11747,11748,11749,11750,11751,11752,4970,11753,11754,11755,11756,11757,11758,11759,11760, #11680
+11761,11762,11763,11764,11765,11766,11767,11768,11769,11770,11771,11772,11773,11774,11775,11776, #11696
+11777,11778,11779,11780,11781,11782,11783,11784,11785,11786,11787,11788,11789,11790,4971,11791, #11712
+11792,11793,11794,11795,11796,11797,4972,11798,11799,11800,11801,11802,11803,11804,11805,11806, #11728
+11807,11808,11809,11810,4973,11811,11812,11813,11814,11815,11816,11817,11818,11819,11820,11821, #11744
+11822,11823,11824,11825,11826,11827,11828,11829,11830,11831,11832,11833,11834,3680,3810,11835, #11760
+11836,4974,11837,11838,11839,11840,11841,11842,11843,11844,11845,11846,11847,11848,11849,11850, #11776
+11851,11852,11853,11854,11855,11856,11857,11858,11859,11860,11861,11862,11863,11864,11865,11866, #11792
+11867,11868,11869,11870,11871,11872,11873,11874,11875,11876,11877,11878,11879,11880,11881,11882, #11808
+11883,11884,4493,11885,11886,11887,11888,11889,11890,11891,11892,11893,11894,11895,11896,11897, #11824
+11898,11899,11900,11901,11902,11903,11904,11905,11906,11907,11908,11909,11910,11911,11912,11913, #11840
+11914,11915,4975,11916,11917,11918,11919,11920,11921,11922,11923,11924,11925,11926,11927,11928, #11856
+11929,11930,11931,11932,11933,11934,11935,11936,11937,11938,11939,11940,11941,11942,11943,11944, #11872
+11945,11946,11947,11948,11949,4976,11950,11951,11952,11953,11954,11955,11956,11957,11958,11959, #11888
+11960,11961,11962,11963,11964,11965,11966,11967,11968,11969,11970,11971,11972,11973,11974,11975, #11904
+11976,11977,11978,11979,11980,11981,11982,11983,11984,11985,11986,11987,4196,11988,11989,11990, #11920
+11991,11992,4977,11993,11994,11995,11996,11997,11998,11999,12000,12001,12002,12003,12004,12005, #11936
+12006,12007,12008,12009,12010,12011,12012,12013,12014,12015,12016,12017,12018,12019,12020,12021, #11952
+12022,12023,12024,12025,12026,12027,12028,12029,12030,12031,12032,12033,12034,12035,12036,12037, #11968
+12038,12039,12040,12041,12042,12043,12044,12045,12046,12047,12048,12049,12050,12051,12052,12053, #11984
+12054,12055,12056,12057,12058,12059,12060,12061,4978,12062,12063,12064,12065,12066,12067,12068, #12000
+12069,12070,12071,12072,12073,12074,12075,12076,12077,12078,12079,12080,12081,12082,12083,12084, #12016
+12085,12086,12087,12088,12089,12090,12091,12092,12093,12094,12095,12096,12097,12098,12099,12100, #12032
+12101,12102,12103,12104,12105,12106,12107,12108,12109,12110,12111,12112,12113,12114,12115,12116, #12048
+12117,12118,12119,12120,12121,12122,12123,4979,12124,12125,12126,12127,12128,4197,12129,12130, #12064
+12131,12132,12133,12134,12135,12136,12137,12138,12139,12140,12141,12142,12143,12144,12145,12146, #12080
+12147,12148,12149,12150,12151,12152,12153,12154,4980,12155,12156,12157,12158,12159,12160,4494, #12096
+12161,12162,12163,12164,3811,12165,12166,12167,12168,12169,4495,12170,12171,4496,12172,12173, #12112
+12174,12175,12176,3812,12177,12178,12179,12180,12181,12182,12183,12184,12185,12186,12187,12188, #12128
+12189,12190,12191,12192,12193,12194,12195,12196,12197,12198,12199,12200,12201,12202,12203,12204, #12144
+12205,12206,12207,12208,12209,12210,12211,12212,12213,12214,12215,12216,12217,12218,12219,12220, #12160
+12221,4981,12222,12223,12224,12225,12226,12227,12228,12229,12230,12231,12232,12233,12234,12235, #12176
+4982,12236,12237,12238,12239,12240,12241,12242,12243,12244,12245,4983,12246,12247,12248,12249, #12192
+4984,12250,12251,12252,12253,12254,12255,12256,12257,12258,12259,12260,12261,12262,12263,12264, #12208
+4985,12265,4497,12266,12267,12268,12269,12270,12271,12272,12273,12274,12275,12276,12277,12278, #12224
+12279,12280,12281,12282,12283,12284,12285,12286,12287,4986,12288,12289,12290,12291,12292,12293, #12240
+12294,12295,12296,2473,12297,12298,12299,12300,12301,12302,12303,12304,12305,12306,12307,12308, #12256
+12309,12310,12311,12312,12313,12314,12315,12316,12317,12318,12319,3963,12320,12321,12322,12323, #12272
+12324,12325,12326,12327,12328,12329,12330,12331,12332,4987,12333,12334,12335,12336,12337,12338, #12288
+12339,12340,12341,12342,12343,12344,12345,12346,12347,12348,12349,12350,12351,12352,12353,12354, #12304
+12355,12356,12357,12358,12359,3964,12360,12361,12362,12363,12364,12365,12366,12367,12368,12369, #12320
+12370,3965,12371,12372,12373,12374,12375,12376,12377,12378,12379,12380,12381,12382,12383,12384, #12336
+12385,12386,12387,12388,12389,12390,12391,12392,12393,12394,12395,12396,12397,12398,12399,12400, #12352
+12401,12402,12403,12404,12405,12406,12407,12408,4988,12409,12410,12411,12412,12413,12414,12415, #12368
+12416,12417,12418,12419,12420,12421,12422,12423,12424,12425,12426,12427,12428,12429,12430,12431, #12384
+12432,12433,12434,12435,12436,12437,12438,3554,12439,12440,12441,12442,12443,12444,12445,12446, #12400
+12447,12448,12449,12450,12451,12452,12453,12454,12455,12456,12457,12458,12459,12460,12461,12462, #12416
+12463,12464,4989,12465,12466,12467,12468,12469,12470,12471,12472,12473,12474,12475,12476,12477, #12432
+12478,12479,12480,4990,12481,12482,12483,12484,12485,12486,12487,12488,12489,4498,12490,12491, #12448
+12492,12493,12494,12495,12496,12497,12498,12499,12500,12501,12502,12503,12504,12505,12506,12507, #12464
+12508,12509,12510,12511,12512,12513,12514,12515,12516,12517,12518,12519,12520,12521,12522,12523, #12480
+12524,12525,12526,12527,12528,12529,12530,12531,12532,12533,12534,12535,12536,12537,12538,12539, #12496
+12540,12541,12542,12543,12544,12545,12546,12547,12548,12549,12550,12551,4991,12552,12553,12554, #12512
+12555,12556,12557,12558,12559,12560,12561,12562,12563,12564,12565,12566,12567,12568,12569,12570, #12528
+12571,12572,12573,12574,12575,12576,12577,12578,3036,12579,12580,12581,12582,12583,3966,12584, #12544
+12585,12586,12587,12588,12589,12590,12591,12592,12593,12594,12595,12596,12597,12598,12599,12600, #12560
+12601,12602,12603,12604,12605,12606,12607,12608,12609,12610,12611,12612,12613,12614,12615,12616, #12576
+12617,12618,12619,12620,12621,12622,12623,12624,12625,12626,12627,12628,12629,12630,12631,12632, #12592
+12633,12634,12635,12636,12637,12638,12639,12640,12641,12642,12643,12644,12645,12646,4499,12647, #12608
+12648,12649,12650,12651,12652,12653,12654,12655,12656,12657,12658,12659,12660,12661,12662,12663, #12624
+12664,12665,12666,12667,12668,12669,12670,12671,12672,12673,12674,12675,12676,12677,12678,12679, #12640
+12680,12681,12682,12683,12684,12685,12686,12687,12688,12689,12690,12691,12692,12693,12694,12695, #12656
+12696,12697,12698,4992,12699,12700,12701,12702,12703,12704,12705,12706,12707,12708,12709,12710, #12672
+12711,12712,12713,12714,12715,12716,12717,12718,12719,12720,12721,12722,12723,12724,12725,12726, #12688
+12727,12728,12729,12730,12731,12732,12733,12734,12735,12736,12737,12738,12739,12740,12741,12742, #12704
+12743,12744,12745,12746,12747,12748,12749,12750,12751,12752,12753,12754,12755,12756,12757,12758, #12720
+12759,12760,12761,12762,12763,12764,12765,12766,12767,12768,12769,12770,12771,12772,12773,12774, #12736
+12775,12776,12777,12778,4993,2175,12779,12780,12781,12782,12783,12784,12785,12786,4500,12787, #12752
+12788,12789,12790,12791,12792,12793,12794,12795,12796,12797,12798,12799,12800,12801,12802,12803, #12768
+12804,12805,12806,12807,12808,12809,12810,12811,12812,12813,12814,12815,12816,12817,12818,12819, #12784
+12820,12821,12822,12823,12824,12825,12826,4198,3967,12827,12828,12829,12830,12831,12832,12833, #12800
+12834,12835,12836,12837,12838,12839,12840,12841,12842,12843,12844,12845,12846,12847,12848,12849, #12816
+12850,12851,12852,12853,12854,12855,12856,12857,12858,12859,12860,12861,4199,12862,12863,12864, #12832
+12865,12866,12867,12868,12869,12870,12871,12872,12873,12874,12875,12876,12877,12878,12879,12880, #12848
+12881,12882,12883,12884,12885,12886,12887,4501,12888,12889,12890,12891,12892,12893,12894,12895, #12864
+12896,12897,12898,12899,12900,12901,12902,12903,12904,12905,12906,12907,12908,12909,12910,12911, #12880
+12912,4994,12913,12914,12915,12916,12917,12918,12919,12920,12921,12922,12923,12924,12925,12926, #12896
+12927,12928,12929,12930,12931,12932,12933,12934,12935,12936,12937,12938,12939,12940,12941,12942, #12912
+12943,12944,12945,12946,12947,12948,12949,12950,12951,12952,12953,12954,12955,12956,1772,12957, #12928
+12958,12959,12960,12961,12962,12963,12964,12965,12966,12967,12968,12969,12970,12971,12972,12973, #12944
+12974,12975,12976,12977,12978,12979,12980,12981,12982,12983,12984,12985,12986,12987,12988,12989, #12960
+12990,12991,12992,12993,12994,12995,12996,12997,4502,12998,4503,12999,13000,13001,13002,13003, #12976
+4504,13004,13005,13006,13007,13008,13009,13010,13011,13012,13013,13014,13015,13016,13017,13018, #12992
+13019,13020,13021,13022,13023,13024,13025,13026,13027,13028,13029,3449,13030,13031,13032,13033, #13008
+13034,13035,13036,13037,13038,13039,13040,13041,13042,13043,13044,13045,13046,13047,13048,13049, #13024
+13050,13051,13052,13053,13054,13055,13056,13057,13058,13059,13060,13061,13062,13063,13064,13065, #13040
+13066,13067,13068,13069,13070,13071,13072,13073,13074,13075,13076,13077,13078,13079,13080,13081, #13056
+13082,13083,13084,13085,13086,13087,13088,13089,13090,13091,13092,13093,13094,13095,13096,13097, #13072
+13098,13099,13100,13101,13102,13103,13104,13105,13106,13107,13108,13109,13110,13111,13112,13113, #13088
+13114,13115,13116,13117,13118,3968,13119,4995,13120,13121,13122,13123,13124,13125,13126,13127, #13104
+4505,13128,13129,13130,13131,13132,13133,13134,4996,4506,13135,13136,13137,13138,13139,4997, #13120
+13140,13141,13142,13143,13144,13145,13146,13147,13148,13149,13150,13151,13152,13153,13154,13155, #13136
+13156,13157,13158,13159,4998,13160,13161,13162,13163,13164,13165,13166,13167,13168,13169,13170, #13152
+13171,13172,13173,13174,13175,13176,4999,13177,13178,13179,13180,13181,13182,13183,13184,13185, #13168
+13186,13187,13188,13189,13190,13191,13192,13193,13194,13195,13196,13197,13198,13199,13200,13201, #13184
+13202,13203,13204,13205,13206,5000,13207,13208,13209,13210,13211,13212,13213,13214,13215,13216, #13200
+13217,13218,13219,13220,13221,13222,13223,13224,13225,13226,13227,4200,5001,13228,13229,13230, #13216
+13231,13232,13233,13234,13235,13236,13237,13238,13239,13240,3969,13241,13242,13243,13244,3970, #13232
+13245,13246,13247,13248,13249,13250,13251,13252,13253,13254,13255,13256,13257,13258,13259,13260, #13248
+13261,13262,13263,13264,13265,13266,13267,13268,3450,13269,13270,13271,13272,13273,13274,13275, #13264
+13276,5002,13277,13278,13279,13280,13281,13282,13283,13284,13285,13286,13287,13288,13289,13290, #13280
+13291,13292,13293,13294,13295,13296,13297,13298,13299,13300,13301,13302,3813,13303,13304,13305, #13296
+13306,13307,13308,13309,13310,13311,13312,13313,13314,13315,13316,13317,13318,13319,13320,13321, #13312
+13322,13323,13324,13325,13326,13327,13328,4507,13329,13330,13331,13332,13333,13334,13335,13336, #13328
+13337,13338,13339,13340,13341,5003,13342,13343,13344,13345,13346,13347,13348,13349,13350,13351, #13344
+13352,13353,13354,13355,13356,13357,13358,13359,13360,13361,13362,13363,13364,13365,13366,13367, #13360
+5004,13368,13369,13370,13371,13372,13373,13374,13375,13376,13377,13378,13379,13380,13381,13382, #13376
+13383,13384,13385,13386,13387,13388,13389,13390,13391,13392,13393,13394,13395,13396,13397,13398, #13392
+13399,13400,13401,13402,13403,13404,13405,13406,13407,13408,13409,13410,13411,13412,13413,13414, #13408
+13415,13416,13417,13418,13419,13420,13421,13422,13423,13424,13425,13426,13427,13428,13429,13430, #13424
+13431,13432,4508,13433,13434,13435,4201,13436,13437,13438,13439,13440,13441,13442,13443,13444, #13440
+13445,13446,13447,13448,13449,13450,13451,13452,13453,13454,13455,13456,13457,5005,13458,13459, #13456
+13460,13461,13462,13463,13464,13465,13466,13467,13468,13469,13470,4509,13471,13472,13473,13474, #13472
+13475,13476,13477,13478,13479,13480,13481,13482,13483,13484,13485,13486,13487,13488,13489,13490, #13488
+13491,13492,13493,13494,13495,13496,13497,13498,13499,13500,13501,13502,13503,13504,13505,13506, #13504
+13507,13508,13509,13510,13511,13512,13513,13514,13515,13516,13517,13518,13519,13520,13521,13522, #13520
+13523,13524,13525,13526,13527,13528,13529,13530,13531,13532,13533,13534,13535,13536,13537,13538, #13536
+13539,13540,13541,13542,13543,13544,13545,13546,13547,13548,13549,13550,13551,13552,13553,13554, #13552
+13555,13556,13557,13558,13559,13560,13561,13562,13563,13564,13565,13566,13567,13568,13569,13570, #13568
+13571,13572,13573,13574,13575,13576,13577,13578,13579,13580,13581,13582,13583,13584,13585,13586, #13584
+13587,13588,13589,13590,13591,13592,13593,13594,13595,13596,13597,13598,13599,13600,13601,13602, #13600
+13603,13604,13605,13606,13607,13608,13609,13610,13611,13612,13613,13614,13615,13616,13617,13618, #13616
+13619,13620,13621,13622,13623,13624,13625,13626,13627,13628,13629,13630,13631,13632,13633,13634, #13632
+13635,13636,13637,13638,13639,13640,13641,13642,5006,13643,13644,13645,13646,13647,13648,13649, #13648
+13650,13651,5007,13652,13653,13654,13655,13656,13657,13658,13659,13660,13661,13662,13663,13664, #13664
+13665,13666,13667,13668,13669,13670,13671,13672,13673,13674,13675,13676,13677,13678,13679,13680, #13680
+13681,13682,13683,13684,13685,13686,13687,13688,13689,13690,13691,13692,13693,13694,13695,13696, #13696
+13697,13698,13699,13700,13701,13702,13703,13704,13705,13706,13707,13708,13709,13710,13711,13712, #13712
+13713,13714,13715,13716,13717,13718,13719,13720,13721,13722,13723,13724,13725,13726,13727,13728, #13728
+13729,13730,13731,13732,13733,13734,13735,13736,13737,13738,13739,13740,13741,13742,13743,13744, #13744
+13745,13746,13747,13748,13749,13750,13751,13752,13753,13754,13755,13756,13757,13758,13759,13760, #13760
+13761,13762,13763,13764,13765,13766,13767,13768,13769,13770,13771,13772,13773,13774,3273,13775, #13776
+13776,13777,13778,13779,13780,13781,13782,13783,13784,13785,13786,13787,13788,13789,13790,13791, #13792
+13792,13793,13794,13795,13796,13797,13798,13799,13800,13801,13802,13803,13804,13805,13806,13807, #13808
+13808,13809,13810,13811,13812,13813,13814,13815,13816,13817,13818,13819,13820,13821,13822,13823, #13824
+13824,13825,13826,13827,13828,13829,13830,13831,13832,13833,13834,13835,13836,13837,13838,13839, #13840
+13840,13841,13842,13843,13844,13845,13846,13847,13848,13849,13850,13851,13852,13853,13854,13855, #13856
+13856,13857,13858,13859,13860,13861,13862,13863,13864,13865,13866,13867,13868,13869,13870,13871, #13872
+13872,13873,13874,13875,13876,13877,13878,13879,13880,13881,13882,13883,13884,13885,13886,13887, #13888
+13888,13889,13890,13891,13892,13893,13894,13895,13896,13897,13898,13899,13900,13901,13902,13903, #13904
+13904,13905,13906,13907,13908,13909,13910,13911,13912,13913,13914,13915,13916,13917,13918,13919, #13920
+13920,13921,13922,13923,13924,13925,13926,13927,13928,13929,13930,13931,13932,13933,13934,13935, #13936
+13936,13937,13938,13939,13940,13941,13942,13943,13944,13945,13946,13947,13948,13949,13950,13951, #13952
+13952,13953,13954,13955,13956,13957,13958,13959,13960,13961,13962,13963,13964,13965,13966,13967, #13968
+13968,13969,13970,13971,13972) #13973
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/big5prober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/big5prober.py
new file mode 100644
index 0000000..becce81
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/big5prober.py
@@ -0,0 +1,42 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .mbcharsetprober import MultiByteCharSetProber
+from .codingstatemachine import CodingStateMachine
+from .chardistribution import Big5DistributionAnalysis
+from .mbcssm import Big5SMModel
+
+
+class Big5Prober(MultiByteCharSetProber):
+    def __init__(self):
+        MultiByteCharSetProber.__init__(self)
+        self._mCodingSM = CodingStateMachine(Big5SMModel)
+        self._mDistributionAnalyzer = Big5DistributionAnalysis()
+        self.reset()
+
+    def get_charset_name(self):
+        return "Big5"
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/chardistribution.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/chardistribution.py
new file mode 100644
index 0000000..4e64a00
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/chardistribution.py
@@ -0,0 +1,231 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .euctwfreq import (EUCTWCharToFreqOrder, EUCTW_TABLE_SIZE,
+                        EUCTW_TYPICAL_DISTRIBUTION_RATIO)
+from .euckrfreq import (EUCKRCharToFreqOrder, EUCKR_TABLE_SIZE,
+                        EUCKR_TYPICAL_DISTRIBUTION_RATIO)
+from .gb2312freq import (GB2312CharToFreqOrder, GB2312_TABLE_SIZE,
+                         GB2312_TYPICAL_DISTRIBUTION_RATIO)
+from .big5freq import (Big5CharToFreqOrder, BIG5_TABLE_SIZE,
+                       BIG5_TYPICAL_DISTRIBUTION_RATIO)
+from .jisfreq import (JISCharToFreqOrder, JIS_TABLE_SIZE,
+                      JIS_TYPICAL_DISTRIBUTION_RATIO)
+from .compat import wrap_ord
+
+ENOUGH_DATA_THRESHOLD = 1024
+SURE_YES = 0.99
+SURE_NO = 0.01
+MINIMUM_DATA_THRESHOLD = 3
+
+
+class CharDistributionAnalysis:
+    def __init__(self):
+        # Mapping table to get frequency order from char order (get from
+        # GetOrder())
+        self._mCharToFreqOrder = None
+        self._mTableSize = None  # Size of above table
+        # This is a constant value which varies from language to language,
+        # used in calculating confidence.  See
+        # http://www.mozilla.org/projects/intl/UniversalCharsetDetection.html
+        # for further detail.
+        self._mTypicalDistributionRatio = None
+        self.reset()
+
+    def reset(self):
+        """reset analyser, clear any state"""
+        # If this flag is set to True, detection is done and conclusion has
+        # been made
+        self._mDone = False
+        self._mTotalChars = 0  # Total characters encountered
+        # The number of characters whose frequency order is less than 512
+        self._mFreqChars = 0
+
+    def feed(self, aBuf, aCharLen):
+        """feed a character with known length"""
+        if aCharLen == 2:
+            # we only care about 2-bytes character in our distribution analysis
+            order = self.get_order(aBuf)
+        else:
+            order = -1
+        if order >= 0:
+            self._mTotalChars += 1
+            # order is valid
+            if order < self._mTableSize:
+                if 512 > self._mCharToFreqOrder[order]:
+                    self._mFreqChars += 1
+
+    def get_confidence(self):
+        """return confidence based on existing data"""
+        # if we didn't receive any character in our consideration range,
+        # return negative answer
+        if self._mTotalChars <= 0 or self._mFreqChars <= MINIMUM_DATA_THRESHOLD:
+            return SURE_NO
+
+        if self._mTotalChars != self._mFreqChars:
+            r = (self._mFreqChars / ((self._mTotalChars - self._mFreqChars)
+                 * self._mTypicalDistributionRatio))
+            if r < SURE_YES:
+                return r
+
+        # normalize confidence (we don't want to be 100% sure)
+        return SURE_YES
+
+    def got_enough_data(self):
+        # It is not necessary to receive all data to draw conclusion.
+        # For charset detection, certain amount of data is enough
+        return self._mTotalChars > ENOUGH_DATA_THRESHOLD
+
+    def get_order(self, aBuf):
+        # We do not handle characters based on the original encoding string,
+        # but convert this encoding string to a number, here called order.
+        # This allows multiple encodings of a language to share one frequency
+        # table.
+        return -1
+
+
+class EUCTWDistributionAnalysis(CharDistributionAnalysis):
+    def __init__(self):
+        CharDistributionAnalysis.__init__(self)
+        self._mCharToFreqOrder = EUCTWCharToFreqOrder
+        self._mTableSize = EUCTW_TABLE_SIZE
+        self._mTypicalDistributionRatio = EUCTW_TYPICAL_DISTRIBUTION_RATIO
+
+    def get_order(self, aBuf):
+        # for euc-TW encoding, we are interested
+        #   first  byte range: 0xc4 -- 0xfe
+        #   second byte range: 0xa1 -- 0xfe
+        # no validation needed here. State machine has done that
+        first_char = wrap_ord(aBuf[0])
+        if first_char >= 0xC4:
+            return 94 * (first_char - 0xC4) + wrap_ord(aBuf[1]) - 0xA1
+        else:
+            return -1
+
+
+class EUCKRDistributionAnalysis(CharDistributionAnalysis):
+    def __init__(self):
+        CharDistributionAnalysis.__init__(self)
+        self._mCharToFreqOrder = EUCKRCharToFreqOrder
+        self._mTableSize = EUCKR_TABLE_SIZE
+        self._mTypicalDistributionRatio = EUCKR_TYPICAL_DISTRIBUTION_RATIO
+
+    def get_order(self, aBuf):
+        # for euc-KR encoding, we are interested
+        #   first  byte range: 0xb0 -- 0xfe
+        #   second byte range: 0xa1 -- 0xfe
+        # no validation needed here. State machine has done that
+        first_char = wrap_ord(aBuf[0])
+        if first_char >= 0xB0:
+            return 94 * (first_char - 0xB0) + wrap_ord(aBuf[1]) - 0xA1
+        else:
+            return -1
+
+
+class GB2312DistributionAnalysis(CharDistributionAnalysis):
+    def __init__(self):
+        CharDistributionAnalysis.__init__(self)
+        self._mCharToFreqOrder = GB2312CharToFreqOrder
+        self._mTableSize = GB2312_TABLE_SIZE
+        self._mTypicalDistributionRatio = GB2312_TYPICAL_DISTRIBUTION_RATIO
+
+    def get_order(self, aBuf):
+        # for GB2312 encoding, we are interested
+        #  first  byte range: 0xb0 -- 0xfe
+        #  second byte range: 0xa1 -- 0xfe
+        # no validation needed here. State machine has done that
+        first_char, second_char = wrap_ord(aBuf[0]), wrap_ord(aBuf[1])
+        if (first_char >= 0xB0) and (second_char >= 0xA1):
+            return 94 * (first_char - 0xB0) + second_char - 0xA1
+        else:
+            return -1
+
+
+class Big5DistributionAnalysis(CharDistributionAnalysis):
+    def __init__(self):
+        CharDistributionAnalysis.__init__(self)
+        self._mCharToFreqOrder = Big5CharToFreqOrder
+        self._mTableSize = BIG5_TABLE_SIZE
+        self._mTypicalDistributionRatio = BIG5_TYPICAL_DISTRIBUTION_RATIO
+
+    def get_order(self, aBuf):
+        # for big5 encoding, we are interested
+        #   first  byte range: 0xa4 -- 0xfe
+        #   second byte range: 0x40 -- 0x7e , 0xa1 -- 0xfe
+        # no validation needed here. State machine has done that
+        first_char, second_char = wrap_ord(aBuf[0]), wrap_ord(aBuf[1])
+        if first_char >= 0xA4:
+            if second_char >= 0xA1:
+                return 157 * (first_char - 0xA4) + second_char - 0xA1 + 63
+            else:
+                return 157 * (first_char - 0xA4) + second_char - 0x40
+        else:
+            return -1
+
+
+class SJISDistributionAnalysis(CharDistributionAnalysis):
+    def __init__(self):
+        CharDistributionAnalysis.__init__(self)
+        self._mCharToFreqOrder = JISCharToFreqOrder
+        self._mTableSize = JIS_TABLE_SIZE
+        self._mTypicalDistributionRatio = JIS_TYPICAL_DISTRIBUTION_RATIO
+
+    def get_order(self, aBuf):
+        # for sjis encoding, we are interested
+        #   first  byte range: 0x81 -- 0x9f , 0xe0 -- 0xfe
+        #   second byte range: 0x40 -- 0x7e,  0x81 -- oxfe
+        # no validation needed here. State machine has done that
+        first_char, second_char = wrap_ord(aBuf[0]), wrap_ord(aBuf[1])
+        if (first_char >= 0x81) and (first_char <= 0x9F):
+            order = 188 * (first_char - 0x81)
+        elif (first_char >= 0xE0) and (first_char <= 0xEF):
+            order = 188 * (first_char - 0xE0 + 31)
+        else:
+            return -1
+        order = order + second_char - 0x40
+        if second_char > 0x7F:
+            order = -1
+        return order
+
+
+class EUCJPDistributionAnalysis(CharDistributionAnalysis):
+    def __init__(self):
+        CharDistributionAnalysis.__init__(self)
+        self._mCharToFreqOrder = JISCharToFreqOrder
+        self._mTableSize = JIS_TABLE_SIZE
+        self._mTypicalDistributionRatio = JIS_TYPICAL_DISTRIBUTION_RATIO
+
+    def get_order(self, aBuf):
+        # for euc-JP encoding, we are interested
+        #   first  byte range: 0xa0 -- 0xfe
+        #   second byte range: 0xa1 -- 0xfe
+        # no validation needed here. State machine has done that
+        char = wrap_ord(aBuf[0])
+        if char >= 0xA0:
+            return 94 * (char - 0xA1) + wrap_ord(aBuf[1]) - 0xa1
+        else:
+            return -1
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/charsetgroupprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/charsetgroupprober.py
new file mode 100644
index 0000000..85e7a1c
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/charsetgroupprober.py
@@ -0,0 +1,106 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+# 
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+# 
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+# 
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+# 
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from . import constants
+import sys
+from .charsetprober import CharSetProber
+
+
+class CharSetGroupProber(CharSetProber):
+    def __init__(self):
+        CharSetProber.__init__(self)
+        self._mActiveNum = 0
+        self._mProbers = []
+        self._mBestGuessProber = None
+
+    def reset(self):
+        CharSetProber.reset(self)
+        self._mActiveNum = 0
+        for prober in self._mProbers:
+            if prober:
+                prober.reset()
+                prober.active = True
+                self._mActiveNum += 1
+        self._mBestGuessProber = None
+
+    def get_charset_name(self):
+        if not self._mBestGuessProber:
+            self.get_confidence()
+            if not self._mBestGuessProber:
+                return None
+#                self._mBestGuessProber = self._mProbers[0]
+        return self._mBestGuessProber.get_charset_name()
+
+    def feed(self, aBuf):
+        for prober in self._mProbers:
+            if not prober:
+                continue
+            if not prober.active:
+                continue
+            st = prober.feed(aBuf)
+            if not st:
+                continue
+            if st == constants.eFoundIt:
+                self._mBestGuessProber = prober
+                return self.get_state()
+            elif st == constants.eNotMe:
+                prober.active = False
+                self._mActiveNum -= 1
+                if self._mActiveNum <= 0:
+                    self._mState = constants.eNotMe
+                    return self.get_state()
+        return self.get_state()
+
+    def get_confidence(self):
+        st = self.get_state()
+        if st == constants.eFoundIt:
+            return 0.99
+        elif st == constants.eNotMe:
+            return 0.01
+        bestConf = 0.0
+        self._mBestGuessProber = None
+        for prober in self._mProbers:
+            if not prober:
+                continue
+            if not prober.active:
+                if constants._debug:
+                    sys.stderr.write(prober.get_charset_name()
+                                     + ' not active\n')
+                continue
+            cf = prober.get_confidence()
+            if constants._debug:
+                sys.stderr.write('%s confidence = %s\n' %
+                                 (prober.get_charset_name(), cf))
+            if bestConf < cf:
+                bestConf = cf
+                self._mBestGuessProber = prober
+        if not self._mBestGuessProber:
+            return 0.0
+        return bestConf
+#        else:
+#            self._mBestGuessProber = self._mProbers[0]
+#            return self._mBestGuessProber.get_confidence()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/charsetprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/charsetprober.py
new file mode 100644
index 0000000..9758171
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/charsetprober.py
@@ -0,0 +1,62 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 2001
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from . import constants
+import re
+
+
+class CharSetProber:
+    def __init__(self):
+        pass
+
+    def reset(self):
+        self._mState = constants.eDetecting
+
+    def get_charset_name(self):
+        return None
+
+    def feed(self, aBuf):
+        pass
+
+    def get_state(self):
+        return self._mState
+
+    def get_confidence(self):
+        return 0.0
+
+    def filter_high_bit_only(self, aBuf):
+        aBuf = re.sub(b'([\x00-\x7F])+', b' ', aBuf)
+        return aBuf
+
+    def filter_without_english_letters(self, aBuf):
+        aBuf = re.sub(b'([A-Za-z])+', b' ', aBuf)
+        return aBuf
+
+    def filter_with_english_letters(self, aBuf):
+        # TODO
+        return aBuf
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/codingstatemachine.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/codingstatemachine.py
new file mode 100644
index 0000000..8dd8c91
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/codingstatemachine.py
@@ -0,0 +1,61 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .constants import eStart
+from .compat import wrap_ord
+
+
+class CodingStateMachine:
+    def __init__(self, sm):
+        self._mModel = sm
+        self._mCurrentBytePos = 0
+        self._mCurrentCharLen = 0
+        self.reset()
+
+    def reset(self):
+        self._mCurrentState = eStart
+
+    def next_state(self, c):
+        # for each byte we get its class
+        # if it is first byte, we also get byte length
+        # PY3K: aBuf is a byte stream, so c is an int, not a byte
+        byteCls = self._mModel['classTable'][wrap_ord(c)]
+        if self._mCurrentState == eStart:
+            self._mCurrentBytePos = 0
+            self._mCurrentCharLen = self._mModel['charLenTable'][byteCls]
+        # from byte's class and stateTable, we get its next state
+        curr_state = (self._mCurrentState * self._mModel['classFactor']
+                      + byteCls)
+        self._mCurrentState = self._mModel['stateTable'][curr_state]
+        self._mCurrentBytePos += 1
+        return self._mCurrentState
+
+    def get_current_charlen(self):
+        return self._mCurrentCharLen
+
+    def get_coding_state_machine(self):
+        return self._mModel['name']
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/compat.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/compat.py
new file mode 100644
index 0000000..d9e30ad
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/compat.py
@@ -0,0 +1,34 @@
+######################## BEGIN LICENSE BLOCK ########################
+# Contributor(s):
+#   Ian Cordasco - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+import sys
+
+
+if sys.version_info < (3, 0):
+    base_str = (str, unicode)
+else:
+    base_str = (bytes, str)
+
+
+def wrap_ord(a):
+    if sys.version_info < (3, 0) and isinstance(a, base_str):
+        return ord(a)
+    else:
+        return a
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/constants.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/constants.py
new file mode 100644
index 0000000..e4d148b
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/constants.py
@@ -0,0 +1,39 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 2001
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+# 
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+# 
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+_debug = 0
+
+eDetecting = 0
+eFoundIt = 1
+eNotMe = 2
+
+eStart = 0
+eError = 1
+eItsMe = 2
+
+SHORTCUT_THRESHOLD = 0.95
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/cp949prober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/cp949prober.py
new file mode 100644
index 0000000..ff4272f
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/cp949prober.py
@@ -0,0 +1,44 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .mbcharsetprober import MultiByteCharSetProber
+from .codingstatemachine import CodingStateMachine
+from .chardistribution import EUCKRDistributionAnalysis
+from .mbcssm import CP949SMModel
+
+
+class CP949Prober(MultiByteCharSetProber):
+    def __init__(self):
+        MultiByteCharSetProber.__init__(self)
+        self._mCodingSM = CodingStateMachine(CP949SMModel)
+        # NOTE: CP949 is a superset of EUC-KR, so the distribution should be
+        #       not different.
+        self._mDistributionAnalyzer = EUCKRDistributionAnalysis()
+        self.reset()
+
+    def get_charset_name(self):
+        return "CP949"
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/escprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/escprober.py
new file mode 100644
index 0000000..80a844f
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/escprober.py
@@ -0,0 +1,86 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from . import constants
+from .escsm import (HZSMModel, ISO2022CNSMModel, ISO2022JPSMModel,
+                    ISO2022KRSMModel)
+from .charsetprober import CharSetProber
+from .codingstatemachine import CodingStateMachine
+from .compat import wrap_ord
+
+
+class EscCharSetProber(CharSetProber):
+    def __init__(self):
+        CharSetProber.__init__(self)
+        self._mCodingSM = [
+            CodingStateMachine(HZSMModel),
+            CodingStateMachine(ISO2022CNSMModel),
+            CodingStateMachine(ISO2022JPSMModel),
+            CodingStateMachine(ISO2022KRSMModel)
+        ]
+        self.reset()
+
+    def reset(self):
+        CharSetProber.reset(self)
+        for codingSM in self._mCodingSM:
+            if not codingSM:
+                continue
+            codingSM.active = True
+            codingSM.reset()
+        self._mActiveSM = len(self._mCodingSM)
+        self._mDetectedCharset = None
+
+    def get_charset_name(self):
+        return self._mDetectedCharset
+
+    def get_confidence(self):
+        if self._mDetectedCharset:
+            return 0.99
+        else:
+            return 0.00
+
+    def feed(self, aBuf):
+        for c in aBuf:
+            # PY3K: aBuf is a byte array, so c is an int, not a byte
+            for codingSM in self._mCodingSM:
+                if not codingSM:
+                    continue
+                if not codingSM.active:
+                    continue
+                codingState = codingSM.next_state(wrap_ord(c))
+                if codingState == constants.eError:
+                    codingSM.active = False
+                    self._mActiveSM -= 1
+                    if self._mActiveSM <= 0:
+                        self._mState = constants.eNotMe
+                        return self.get_state()
+                elif codingState == constants.eItsMe:
+                    self._mState = constants.eFoundIt
+                    self._mDetectedCharset = codingSM.get_coding_state_machine()  # nopep8
+                    return self.get_state()
+
+        return self.get_state()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/escsm.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/escsm.py
new file mode 100644
index 0000000..bd302b4
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/escsm.py
@@ -0,0 +1,242 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .constants import eStart, eError, eItsMe
+
+HZ_cls = (
+1,0,0,0,0,0,0,0,  # 00 - 07
+0,0,0,0,0,0,0,0,  # 08 - 0f
+0,0,0,0,0,0,0,0,  # 10 - 17
+0,0,0,1,0,0,0,0,  # 18 - 1f
+0,0,0,0,0,0,0,0,  # 20 - 27
+0,0,0,0,0,0,0,0,  # 28 - 2f
+0,0,0,0,0,0,0,0,  # 30 - 37
+0,0,0,0,0,0,0,0,  # 38 - 3f
+0,0,0,0,0,0,0,0,  # 40 - 47
+0,0,0,0,0,0,0,0,  # 48 - 4f
+0,0,0,0,0,0,0,0,  # 50 - 57
+0,0,0,0,0,0,0,0,  # 58 - 5f
+0,0,0,0,0,0,0,0,  # 60 - 67
+0,0,0,0,0,0,0,0,  # 68 - 6f
+0,0,0,0,0,0,0,0,  # 70 - 77
+0,0,0,4,0,5,2,0,  # 78 - 7f
+1,1,1,1,1,1,1,1,  # 80 - 87
+1,1,1,1,1,1,1,1,  # 88 - 8f
+1,1,1,1,1,1,1,1,  # 90 - 97
+1,1,1,1,1,1,1,1,  # 98 - 9f
+1,1,1,1,1,1,1,1,  # a0 - a7
+1,1,1,1,1,1,1,1,  # a8 - af
+1,1,1,1,1,1,1,1,  # b0 - b7
+1,1,1,1,1,1,1,1,  # b8 - bf
+1,1,1,1,1,1,1,1,  # c0 - c7
+1,1,1,1,1,1,1,1,  # c8 - cf
+1,1,1,1,1,1,1,1,  # d0 - d7
+1,1,1,1,1,1,1,1,  # d8 - df
+1,1,1,1,1,1,1,1,  # e0 - e7
+1,1,1,1,1,1,1,1,  # e8 - ef
+1,1,1,1,1,1,1,1,  # f0 - f7
+1,1,1,1,1,1,1,1,  # f8 - ff
+)
+
+HZ_st = (
+eStart,eError,     3,eStart,eStart,eStart,eError,eError,# 00-07
+eError,eError,eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,# 08-0f
+eItsMe,eItsMe,eError,eError,eStart,eStart,     4,eError,# 10-17
+     5,eError,     6,eError,     5,     5,     4,eError,# 18-1f
+     4,eError,     4,     4,     4,eError,     4,eError,# 20-27
+     4,eItsMe,eStart,eStart,eStart,eStart,eStart,eStart,# 28-2f
+)
+
+HZCharLenTable = (0, 0, 0, 0, 0, 0)
+
+HZSMModel = {'classTable': HZ_cls,
+             'classFactor': 6,
+             'stateTable': HZ_st,
+             'charLenTable': HZCharLenTable,
+             'name': "HZ-GB-2312"}
+
+ISO2022CN_cls = (
+2,0,0,0,0,0,0,0,  # 00 - 07
+0,0,0,0,0,0,0,0,  # 08 - 0f
+0,0,0,0,0,0,0,0,  # 10 - 17
+0,0,0,1,0,0,0,0,  # 18 - 1f
+0,0,0,0,0,0,0,0,  # 20 - 27
+0,3,0,0,0,0,0,0,  # 28 - 2f
+0,0,0,0,0,0,0,0,  # 30 - 37
+0,0,0,0,0,0,0,0,  # 38 - 3f
+0,0,0,4,0,0,0,0,  # 40 - 47
+0,0,0,0,0,0,0,0,  # 48 - 4f
+0,0,0,0,0,0,0,0,  # 50 - 57
+0,0,0,0,0,0,0,0,  # 58 - 5f
+0,0,0,0,0,0,0,0,  # 60 - 67
+0,0,0,0,0,0,0,0,  # 68 - 6f
+0,0,0,0,0,0,0,0,  # 70 - 77
+0,0,0,0,0,0,0,0,  # 78 - 7f
+2,2,2,2,2,2,2,2,  # 80 - 87
+2,2,2,2,2,2,2,2,  # 88 - 8f
+2,2,2,2,2,2,2,2,  # 90 - 97
+2,2,2,2,2,2,2,2,  # 98 - 9f
+2,2,2,2,2,2,2,2,  # a0 - a7
+2,2,2,2,2,2,2,2,  # a8 - af
+2,2,2,2,2,2,2,2,  # b0 - b7
+2,2,2,2,2,2,2,2,  # b8 - bf
+2,2,2,2,2,2,2,2,  # c0 - c7
+2,2,2,2,2,2,2,2,  # c8 - cf
+2,2,2,2,2,2,2,2,  # d0 - d7
+2,2,2,2,2,2,2,2,  # d8 - df
+2,2,2,2,2,2,2,2,  # e0 - e7
+2,2,2,2,2,2,2,2,  # e8 - ef
+2,2,2,2,2,2,2,2,  # f0 - f7
+2,2,2,2,2,2,2,2,  # f8 - ff
+)
+
+ISO2022CN_st = (
+eStart,     3,eError,eStart,eStart,eStart,eStart,eStart,# 00-07
+eStart,eError,eError,eError,eError,eError,eError,eError,# 08-0f
+eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,# 10-17
+eItsMe,eItsMe,eItsMe,eError,eError,eError,     4,eError,# 18-1f
+eError,eError,eError,eItsMe,eError,eError,eError,eError,# 20-27
+     5,     6,eError,eError,eError,eError,eError,eError,# 28-2f
+eError,eError,eError,eItsMe,eError,eError,eError,eError,# 30-37
+eError,eError,eError,eError,eError,eItsMe,eError,eStart,# 38-3f
+)
+
+ISO2022CNCharLenTable = (0, 0, 0, 0, 0, 0, 0, 0, 0)
+
+ISO2022CNSMModel = {'classTable': ISO2022CN_cls,
+                    'classFactor': 9,
+                    'stateTable': ISO2022CN_st,
+                    'charLenTable': ISO2022CNCharLenTable,
+                    'name': "ISO-2022-CN"}
+
+ISO2022JP_cls = (
+2,0,0,0,0,0,0,0,  # 00 - 07
+0,0,0,0,0,0,2,2,  # 08 - 0f
+0,0,0,0,0,0,0,0,  # 10 - 17
+0,0,0,1,0,0,0,0,  # 18 - 1f
+0,0,0,0,7,0,0,0,  # 20 - 27
+3,0,0,0,0,0,0,0,  # 28 - 2f
+0,0,0,0,0,0,0,0,  # 30 - 37
+0,0,0,0,0,0,0,0,  # 38 - 3f
+6,0,4,0,8,0,0,0,  # 40 - 47
+0,9,5,0,0,0,0,0,  # 48 - 4f
+0,0,0,0,0,0,0,0,  # 50 - 57
+0,0,0,0,0,0,0,0,  # 58 - 5f
+0,0,0,0,0,0,0,0,  # 60 - 67
+0,0,0,0,0,0,0,0,  # 68 - 6f
+0,0,0,0,0,0,0,0,  # 70 - 77
+0,0,0,0,0,0,0,0,  # 78 - 7f
+2,2,2,2,2,2,2,2,  # 80 - 87
+2,2,2,2,2,2,2,2,  # 88 - 8f
+2,2,2,2,2,2,2,2,  # 90 - 97
+2,2,2,2,2,2,2,2,  # 98 - 9f
+2,2,2,2,2,2,2,2,  # a0 - a7
+2,2,2,2,2,2,2,2,  # a8 - af
+2,2,2,2,2,2,2,2,  # b0 - b7
+2,2,2,2,2,2,2,2,  # b8 - bf
+2,2,2,2,2,2,2,2,  # c0 - c7
+2,2,2,2,2,2,2,2,  # c8 - cf
+2,2,2,2,2,2,2,2,  # d0 - d7
+2,2,2,2,2,2,2,2,  # d8 - df
+2,2,2,2,2,2,2,2,  # e0 - e7
+2,2,2,2,2,2,2,2,  # e8 - ef
+2,2,2,2,2,2,2,2,  # f0 - f7
+2,2,2,2,2,2,2,2,  # f8 - ff
+)
+
+ISO2022JP_st = (
+eStart,     3,eError,eStart,eStart,eStart,eStart,eStart,# 00-07
+eStart,eStart,eError,eError,eError,eError,eError,eError,# 08-0f
+eError,eError,eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,# 10-17
+eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eError,eError,# 18-1f
+eError,     5,eError,eError,eError,     4,eError,eError,# 20-27
+eError,eError,eError,     6,eItsMe,eError,eItsMe,eError,# 28-2f
+eError,eError,eError,eError,eError,eError,eItsMe,eItsMe,# 30-37
+eError,eError,eError,eItsMe,eError,eError,eError,eError,# 38-3f
+eError,eError,eError,eError,eItsMe,eError,eStart,eStart,# 40-47
+)
+
+ISO2022JPCharLenTable = (0, 0, 0, 0, 0, 0, 0, 0, 0, 0)
+
+ISO2022JPSMModel = {'classTable': ISO2022JP_cls,
+                    'classFactor': 10,
+                    'stateTable': ISO2022JP_st,
+                    'charLenTable': ISO2022JPCharLenTable,
+                    'name': "ISO-2022-JP"}
+
+ISO2022KR_cls = (
+2,0,0,0,0,0,0,0,  # 00 - 07
+0,0,0,0,0,0,0,0,  # 08 - 0f
+0,0,0,0,0,0,0,0,  # 10 - 17
+0,0,0,1,0,0,0,0,  # 18 - 1f
+0,0,0,0,3,0,0,0,  # 20 - 27
+0,4,0,0,0,0,0,0,  # 28 - 2f
+0,0,0,0,0,0,0,0,  # 30 - 37
+0,0,0,0,0,0,0,0,  # 38 - 3f
+0,0,0,5,0,0,0,0,  # 40 - 47
+0,0,0,0,0,0,0,0,  # 48 - 4f
+0,0,0,0,0,0,0,0,  # 50 - 57
+0,0,0,0,0,0,0,0,  # 58 - 5f
+0,0,0,0,0,0,0,0,  # 60 - 67
+0,0,0,0,0,0,0,0,  # 68 - 6f
+0,0,0,0,0,0,0,0,  # 70 - 77
+0,0,0,0,0,0,0,0,  # 78 - 7f
+2,2,2,2,2,2,2,2,  # 80 - 87
+2,2,2,2,2,2,2,2,  # 88 - 8f
+2,2,2,2,2,2,2,2,  # 90 - 97
+2,2,2,2,2,2,2,2,  # 98 - 9f
+2,2,2,2,2,2,2,2,  # a0 - a7
+2,2,2,2,2,2,2,2,  # a8 - af
+2,2,2,2,2,2,2,2,  # b0 - b7
+2,2,2,2,2,2,2,2,  # b8 - bf
+2,2,2,2,2,2,2,2,  # c0 - c7
+2,2,2,2,2,2,2,2,  # c8 - cf
+2,2,2,2,2,2,2,2,  # d0 - d7
+2,2,2,2,2,2,2,2,  # d8 - df
+2,2,2,2,2,2,2,2,  # e0 - e7
+2,2,2,2,2,2,2,2,  # e8 - ef
+2,2,2,2,2,2,2,2,  # f0 - f7
+2,2,2,2,2,2,2,2,  # f8 - ff
+)
+
+ISO2022KR_st = (
+eStart,     3,eError,eStart,eStart,eStart,eError,eError,# 00-07
+eError,eError,eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,# 08-0f
+eItsMe,eItsMe,eError,eError,eError,     4,eError,eError,# 10-17
+eError,eError,eError,eError,     5,eError,eError,eError,# 18-1f
+eError,eError,eError,eItsMe,eStart,eStart,eStart,eStart,# 20-27
+)
+
+ISO2022KRCharLenTable = (0, 0, 0, 0, 0, 0)
+
+ISO2022KRSMModel = {'classTable': ISO2022KR_cls,
+                    'classFactor': 6,
+                    'stateTable': ISO2022KR_st,
+                    'charLenTable': ISO2022KRCharLenTable,
+                    'name': "ISO-2022-KR"}
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/eucjpprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/eucjpprober.py
new file mode 100644
index 0000000..8e64fdc
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/eucjpprober.py
@@ -0,0 +1,90 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+import sys
+from . import constants
+from .mbcharsetprober import MultiByteCharSetProber
+from .codingstatemachine import CodingStateMachine
+from .chardistribution import EUCJPDistributionAnalysis
+from .jpcntx import EUCJPContextAnalysis
+from .mbcssm import EUCJPSMModel
+
+
+class EUCJPProber(MultiByteCharSetProber):
+    def __init__(self):
+        MultiByteCharSetProber.__init__(self)
+        self._mCodingSM = CodingStateMachine(EUCJPSMModel)
+        self._mDistributionAnalyzer = EUCJPDistributionAnalysis()
+        self._mContextAnalyzer = EUCJPContextAnalysis()
+        self.reset()
+
+    def reset(self):
+        MultiByteCharSetProber.reset(self)
+        self._mContextAnalyzer.reset()
+
+    def get_charset_name(self):
+        return "EUC-JP"
+
+    def feed(self, aBuf):
+        aLen = len(aBuf)
+        for i in range(0, aLen):
+            # PY3K: aBuf is a byte array, so aBuf[i] is an int, not a byte
+            codingState = self._mCodingSM.next_state(aBuf[i])
+            if codingState == constants.eError:
+                if constants._debug:
+                    sys.stderr.write(self.get_charset_name()
+                                     + ' prober hit error at byte ' + str(i)
+                                     + '\n')
+                self._mState = constants.eNotMe
+                break
+            elif codingState == constants.eItsMe:
+                self._mState = constants.eFoundIt
+                break
+            elif codingState == constants.eStart:
+                charLen = self._mCodingSM.get_current_charlen()
+                if i == 0:
+                    self._mLastChar[1] = aBuf[0]
+                    self._mContextAnalyzer.feed(self._mLastChar, charLen)
+                    self._mDistributionAnalyzer.feed(self._mLastChar, charLen)
+                else:
+                    self._mContextAnalyzer.feed(aBuf[i - 1:i + 1], charLen)
+                    self._mDistributionAnalyzer.feed(aBuf[i - 1:i + 1],
+                                                     charLen)
+
+        self._mLastChar[0] = aBuf[aLen - 1]
+
+        if self.get_state() == constants.eDetecting:
+            if (self._mContextAnalyzer.got_enough_data() and
+               (self.get_confidence() > constants.SHORTCUT_THRESHOLD)):
+                self._mState = constants.eFoundIt
+
+        return self.get_state()
+
+    def get_confidence(self):
+        contxtCf = self._mContextAnalyzer.get_confidence()
+        distribCf = self._mDistributionAnalyzer.get_confidence()
+        return max(contxtCf, distribCf)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euckrfreq.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euckrfreq.py
new file mode 100644
index 0000000..a179e4c
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euckrfreq.py
@@ -0,0 +1,596 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+# 
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+# 
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# Sampling from about 20M text materials include literature and computer technology
+
+# 128  --> 0.79
+# 256  --> 0.92
+# 512  --> 0.986
+# 1024 --> 0.99944
+# 2048 --> 0.99999
+#
+# Idea Distribution Ratio = 0.98653 / (1-0.98653) = 73.24
+# Random Distribution Ration = 512 / (2350-512) = 0.279.
+# 
+# Typical Distribution Ratio  
+
+EUCKR_TYPICAL_DISTRIBUTION_RATIO = 6.0
+
+EUCKR_TABLE_SIZE = 2352
+
+# Char to FreqOrder table , 
+EUCKRCharToFreqOrder = ( \
+  13, 130, 120,1396, 481,1719,1720, 328, 609, 212,1721, 707, 400, 299,1722,  87,
+1397,1723, 104, 536,1117,1203,1724,1267, 685,1268, 508,1725,1726,1727,1728,1398,
+1399,1729,1730,1731, 141, 621, 326,1057, 368,1732, 267, 488,  20,1733,1269,1734,
+ 945,1400,1735,  47, 904,1270,1736,1737, 773, 248,1738, 409, 313, 786, 429,1739,
+ 116, 987, 813,1401, 683,  75,1204, 145,1740,1741,1742,1743,  16, 847, 667, 622,
+ 708,1744,1745,1746, 966, 787, 304, 129,1747,  60, 820, 123, 676,1748,1749,1750,
+1751, 617,1752, 626,1753,1754,1755,1756, 653,1757,1758,1759,1760,1761,1762, 856,
+ 344,1763,1764,1765,1766,  89, 401, 418, 806, 905, 848,1767,1768,1769, 946,1205,
+ 709,1770,1118,1771, 241,1772,1773,1774,1271,1775, 569,1776, 999,1777,1778,1779,
+1780, 337, 751,1058,  28, 628, 254,1781, 177, 906, 270, 349, 891,1079,1782,  19,
+1783, 379,1784, 315,1785, 629, 754,1402, 559,1786, 636, 203,1206,1787, 710, 567,
+1788, 935, 814,1789,1790,1207, 766, 528,1791,1792,1208,1793,1794,1795,1796,1797,
+1403,1798,1799, 533,1059,1404,1405,1156,1406, 936, 884,1080,1800, 351,1801,1802,
+1803,1804,1805, 801,1806,1807,1808,1119,1809,1157, 714, 474,1407,1810, 298, 899,
+ 885,1811,1120, 802,1158,1812, 892,1813,1814,1408, 659,1815,1816,1121,1817,1818,
+1819,1820,1821,1822, 319,1823, 594, 545,1824, 815, 937,1209,1825,1826, 573,1409,
+1022,1827,1210,1828,1829,1830,1831,1832,1833, 556, 722, 807,1122,1060,1834, 697,
+1835, 900, 557, 715,1836,1410, 540,1411, 752,1159, 294, 597,1211, 976, 803, 770,
+1412,1837,1838,  39, 794,1413, 358,1839, 371, 925,1840, 453, 661, 788, 531, 723,
+ 544,1023,1081, 869,  91,1841, 392, 430, 790, 602,1414, 677,1082, 457,1415,1416,
+1842,1843, 475, 327,1024,1417, 795, 121,1844, 733, 403,1418,1845,1846,1847, 300,
+ 119, 711,1212, 627,1848,1272, 207,1849,1850, 796,1213, 382,1851, 519,1852,1083,
+ 893,1853,1854,1855, 367, 809, 487, 671,1856, 663,1857,1858, 956, 471, 306, 857,
+1859,1860,1160,1084,1861,1862,1863,1864,1865,1061,1866,1867,1868,1869,1870,1871,
+ 282,  96, 574,1872, 502,1085,1873,1214,1874, 907,1875,1876, 827, 977,1419,1420,
+1421, 268,1877,1422,1878,1879,1880, 308,1881,   2, 537,1882,1883,1215,1884,1885,
+ 127, 791,1886,1273,1423,1887,  34, 336, 404, 643,1888, 571, 654, 894, 840,1889,
+   0, 886,1274, 122, 575, 260, 908, 938,1890,1275, 410, 316,1891,1892, 100,1893,
+1894,1123,  48,1161,1124,1025,1895, 633, 901,1276,1896,1897, 115, 816,1898, 317,
+1899, 694,1900, 909, 734,1424, 572, 866,1425, 691,  85, 524,1010, 543, 394, 841,
+1901,1902,1903,1026,1904,1905,1906,1907,1908,1909,  30, 451, 651, 988, 310,1910,
+1911,1426, 810,1216,  93,1912,1913,1277,1217,1914, 858, 759,  45,  58, 181, 610,
+ 269,1915,1916, 131,1062, 551, 443,1000, 821,1427, 957, 895,1086,1917,1918, 375,
+1919, 359,1920, 687,1921, 822,1922, 293,1923,1924,  40, 662, 118, 692,  29, 939,
+ 887, 640, 482, 174,1925,  69,1162, 728,1428, 910,1926,1278,1218,1279, 386, 870,
+ 217, 854,1163, 823,1927,1928,1929,1930, 834,1931,  78,1932, 859,1933,1063,1934,
+1935,1936,1937, 438,1164, 208, 595,1938,1939,1940,1941,1219,1125,1942, 280, 888,
+1429,1430,1220,1431,1943,1944,1945,1946,1947,1280, 150, 510,1432,1948,1949,1950,
+1951,1952,1953,1954,1011,1087,1955,1433,1043,1956, 881,1957, 614, 958,1064,1065,
+1221,1958, 638,1001, 860, 967, 896,1434, 989, 492, 553,1281,1165,1959,1282,1002,
+1283,1222,1960,1961,1962,1963,  36, 383, 228, 753, 247, 454,1964, 876, 678,1965,
+1966,1284, 126, 464, 490, 835, 136, 672, 529, 940,1088,1435, 473,1967,1968, 467,
+  50, 390, 227, 587, 279, 378, 598, 792, 968, 240, 151, 160, 849, 882,1126,1285,
+ 639,1044, 133, 140, 288, 360, 811, 563,1027, 561, 142, 523,1969,1970,1971,   7,
+ 103, 296, 439, 407, 506, 634, 990,1972,1973,1974,1975, 645,1976,1977,1978,1979,
+1980,1981, 236,1982,1436,1983,1984,1089, 192, 828, 618, 518,1166, 333,1127,1985,
+ 818,1223,1986,1987,1988,1989,1990,1991,1992,1993, 342,1128,1286, 746, 842,1994,
+1995, 560, 223,1287,  98,   8, 189, 650, 978,1288,1996,1437,1997,  17, 345, 250,
+ 423, 277, 234, 512, 226,  97, 289,  42, 167,1998, 201,1999,2000, 843, 836, 824,
+ 532, 338, 783,1090, 182, 576, 436,1438,1439, 527, 500,2001, 947, 889,2002,2003,
+2004,2005, 262, 600, 314, 447,2006, 547,2007, 693, 738,1129,2008,  71,1440, 745,
+ 619, 688,2009, 829,2010,2011, 147,2012,  33, 948,2013,2014,  74, 224,2015,  61,
+ 191, 918, 399, 637,2016,1028,1130, 257, 902,2017,2018,2019,2020,2021,2022,2023,
+2024,2025,2026, 837,2027,2028,2029,2030, 179, 874, 591,  52, 724, 246,2031,2032,
+2033,2034,1167, 969,2035,1289, 630, 605, 911,1091,1168,2036,2037,2038,1441, 912,
+2039, 623,2040,2041, 253,1169,1290,2042,1442, 146, 620, 611, 577, 433,2043,1224,
+ 719,1170, 959, 440, 437, 534,  84, 388, 480,1131, 159, 220, 198, 679,2044,1012,
+ 819,1066,1443, 113,1225, 194, 318,1003,1029,2045,2046,2047,2048,1067,2049,2050,
+2051,2052,2053,  59, 913, 112,2054, 632,2055, 455, 144, 739,1291,2056, 273, 681,
+ 499,2057, 448,2058,2059, 760,2060,2061, 970, 384, 169, 245,1132,2062,2063, 414,
+1444,2064,2065,  41, 235,2066, 157, 252, 877, 568, 919, 789, 580,2067, 725,2068,
+2069,1292,2070,2071,1445,2072,1446,2073,2074,  55, 588,  66,1447, 271,1092,2075,
+1226,2076, 960,1013, 372,2077,2078,2079,2080,2081,1293,2082,2083,2084,2085, 850,
+2086,2087,2088,2089,2090, 186,2091,1068, 180,2092,2093,2094, 109,1227, 522, 606,
+2095, 867,1448,1093, 991,1171, 926, 353,1133,2096, 581,2097,2098,2099,1294,1449,
+1450,2100, 596,1172,1014,1228,2101,1451,1295,1173,1229,2102,2103,1296,1134,1452,
+ 949,1135,2104,2105,1094,1453,1454,1455,2106,1095,2107,2108,2109,2110,2111,2112,
+2113,2114,2115,2116,2117, 804,2118,2119,1230,1231, 805,1456, 405,1136,2120,2121,
+2122,2123,2124, 720, 701,1297, 992,1457, 927,1004,2125,2126,2127,2128,2129,2130,
+  22, 417,2131, 303,2132, 385,2133, 971, 520, 513,2134,1174,  73,1096, 231, 274,
+ 962,1458, 673,2135,1459,2136, 152,1137,2137,2138,2139,2140,1005,1138,1460,1139,
+2141,2142,2143,2144,  11, 374, 844,2145, 154,1232,  46,1461,2146, 838, 830, 721,
+1233, 106,2147,  90, 428, 462, 578, 566,1175, 352,2148,2149, 538,1234, 124,1298,
+2150,1462, 761, 565,2151, 686,2152, 649,2153,  72, 173,2154, 460, 415,2155,1463,
+2156,1235, 305,2157,2158,2159,2160,2161,2162, 579,2163,2164,2165,2166,2167, 747,
+2168,2169,2170,2171,1464, 669,2172,2173,2174,2175,2176,1465,2177,  23, 530, 285,
+2178, 335, 729,2179, 397,2180,2181,2182,1030,2183,2184, 698,2185,2186, 325,2187,
+2188, 369,2189, 799,1097,1015, 348,2190,1069, 680,2191, 851,1466,2192,2193,  10,
+2194, 613, 424,2195, 979, 108, 449, 589,  27, 172,  81,1031,  80, 774, 281, 350,
+1032, 525, 301, 582,1176,2196, 674,1045,2197,2198,1467, 730, 762,2199,2200,2201,
+2202,1468,2203, 993,2204,2205, 266,1070, 963,1140,2206,2207,2208, 664,1098, 972,
+2209,2210,2211,1177,1469,1470, 871,2212,2213,2214,2215,2216,1471,2217,2218,2219,
+2220,2221,2222,2223,2224,2225,2226,2227,1472,1236,2228,2229,2230,2231,2232,2233,
+2234,2235,1299,2236,2237, 200,2238, 477, 373,2239,2240, 731, 825, 777,2241,2242,
+2243, 521, 486, 548,2244,2245,2246,1473,1300,  53, 549, 137, 875,  76, 158,2247,
+1301,1474, 469, 396,1016, 278, 712,2248, 321, 442, 503, 767, 744, 941,1237,1178,
+1475,2249,  82, 178,1141,1179, 973,2250,1302,2251, 297,2252,2253, 570,2254,2255,
+2256,  18, 450, 206,2257, 290, 292,1142,2258, 511, 162,  99, 346, 164, 735,2259,
+1476,1477,   4, 554, 343, 798,1099,2260,1100,2261,  43, 171,1303, 139, 215,2262,
+2263, 717, 775,2264,1033, 322, 216,2265, 831,2266, 149,2267,1304,2268,2269, 702,
+1238, 135, 845, 347, 309,2270, 484,2271, 878, 655, 238,1006,1478,2272,  67,2273,
+ 295,2274,2275, 461,2276, 478, 942, 412,2277,1034,2278,2279,2280, 265,2281, 541,
+2282,2283,2284,2285,2286,  70, 852,1071,2287,2288,2289,2290,  21,  56, 509, 117,
+ 432,2291,2292, 331, 980, 552,1101, 148, 284, 105, 393,1180,1239, 755,2293, 187,
+2294,1046,1479,2295, 340,2296,  63,1047, 230,2297,2298,1305, 763,1306, 101, 800,
+ 808, 494,2299,2300,2301, 903,2302,  37,1072,  14,   5,2303,  79, 675,2304, 312,
+2305,2306,2307,2308,2309,1480,   6,1307,2310,2311,2312,   1, 470,  35,  24, 229,
+2313, 695, 210,  86, 778,  15, 784, 592, 779,  32,  77, 855, 964,2314, 259,2315,
+ 501, 380,2316,2317,  83, 981, 153, 689,1308,1481,1482,1483,2318,2319, 716,1484,
+2320,2321,2322,2323,2324,2325,1485,2326,2327, 128,  57,  68, 261,1048, 211, 170,
+1240,  31,2328,  51, 435, 742,2329,2330,2331, 635,2332, 264, 456,2333,2334,2335,
+ 425,2336,1486, 143, 507, 263, 943,2337, 363, 920,1487, 256,1488,1102, 243, 601,
+1489,2338,2339,2340,2341,2342,2343,2344, 861,2345,2346,2347,2348,2349,2350, 395,
+2351,1490,1491,  62, 535, 166, 225,2352,2353, 668, 419,1241, 138, 604, 928,2354,
+1181,2355,1492,1493,2356,2357,2358,1143,2359, 696,2360, 387, 307,1309, 682, 476,
+2361,2362, 332,  12, 222, 156,2363, 232,2364, 641, 276, 656, 517,1494,1495,1035,
+ 416, 736,1496,2365,1017, 586,2366,2367,2368,1497,2369, 242,2370,2371,2372,1498,
+2373, 965, 713,2374,2375,2376,2377, 740, 982,1499, 944,1500,1007,2378,2379,1310,
+1501,2380,2381,2382, 785, 329,2383,2384,1502,2385,2386,2387, 932,2388,1503,2389,
+2390,2391,2392,1242,2393,2394,2395,2396,2397, 994, 950,2398,2399,2400,2401,1504,
+1311,2402,2403,2404,2405,1049, 749,2406,2407, 853, 718,1144,1312,2408,1182,1505,
+2409,2410, 255, 516, 479, 564, 550, 214,1506,1507,1313, 413, 239, 444, 339,1145,
+1036,1508,1509,1314,1037,1510,1315,2411,1511,2412,2413,2414, 176, 703, 497, 624,
+ 593, 921, 302,2415, 341, 165,1103,1512,2416,1513,2417,2418,2419, 376,2420, 700,
+2421,2422,2423, 258, 768,1316,2424,1183,2425, 995, 608,2426,2427,2428,2429, 221,
+2430,2431,2432,2433,2434,2435,2436,2437, 195, 323, 726, 188, 897, 983,1317, 377,
+ 644,1050, 879,2438, 452,2439,2440,2441,2442,2443,2444, 914,2445,2446,2447,2448,
+ 915, 489,2449,1514,1184,2450,2451, 515,  64, 427, 495,2452, 583,2453, 483, 485,
+1038, 562, 213,1515, 748, 666,2454,2455,2456,2457, 334,2458, 780, 996,1008, 705,
+1243,2459,2460,2461,2462,2463, 114,2464, 493,1146, 366, 163,1516, 961,1104,2465,
+ 291,2466,1318,1105,2467,1517, 365,2468, 355, 951,1244,2469,1319,2470, 631,2471,
+2472, 218,1320, 364, 320, 756,1518,1519,1321,1520,1322,2473,2474,2475,2476, 997,
+2477,2478,2479,2480, 665,1185,2481, 916,1521,2482,2483,2484, 584, 684,2485,2486,
+ 797,2487,1051,1186,2488,2489,2490,1522,2491,2492, 370,2493,1039,1187,  65,2494,
+ 434, 205, 463,1188,2495, 125, 812, 391, 402, 826, 699, 286, 398, 155, 781, 771,
+ 585,2496, 590, 505,1073,2497, 599, 244, 219, 917,1018, 952, 646,1523,2498,1323,
+2499,2500,  49, 984, 354, 741,2501, 625,2502,1324,2503,1019, 190, 357, 757, 491,
+  95, 782, 868,2504,2505,2506,2507,2508,2509, 134,1524,1074, 422,1525, 898,2510,
+ 161,2511,2512,2513,2514, 769,2515,1526,2516,2517, 411,1325,2518, 472,1527,2519,
+2520,2521,2522,2523,2524, 985,2525,2526,2527,2528,2529,2530, 764,2531,1245,2532,
+2533,  25, 204, 311,2534, 496,2535,1052,2536,2537,2538,2539,2540,2541,2542, 199,
+ 704, 504, 468, 758, 657,1528, 196,  44, 839,1246, 272, 750,2543, 765, 862,2544,
+2545,1326,2546, 132, 615, 933,2547, 732,2548,2549,2550,1189,1529,2551, 283,1247,
+1053, 607, 929,2552,2553,2554, 930, 183, 872, 616,1040,1147,2555,1148,1020, 441,
+ 249,1075,2556,2557,2558, 466, 743,2559,2560,2561,  92, 514, 426, 420, 526,2562,
+2563,2564,2565,2566,2567,2568, 185,2569,2570,2571,2572, 776,1530, 658,2573, 362,
+2574, 361, 922,1076, 793,2575,2576,2577,2578,2579,2580,1531, 251,2581,2582,2583,
+2584,1532,  54, 612, 237,1327,2585,2586, 275, 408, 647, 111,2587,1533,1106, 465,
+   3, 458,   9,  38,2588, 107, 110, 890, 209,  26, 737, 498,2589,1534,2590, 431,
+ 202,  88,1535, 356, 287,1107, 660,1149,2591, 381,1536, 986,1150, 445,1248,1151,
+ 974,2592,2593, 846,2594, 446, 953, 184,1249,1250, 727,2595, 923, 193, 883,2596,
+2597,2598, 102, 324, 539, 817,2599, 421,1041,2600, 832,2601,  94, 175, 197, 406,
+2602, 459,2603,2604,2605,2606,2607, 330, 555,2608,2609,2610, 706,1108, 389,2611,
+2612,2613,2614, 233,2615, 833, 558, 931, 954,1251,2616,2617,1537, 546,2618,2619,
+1009,2620,2621,2622,1538, 690,1328,2623, 955,2624,1539,2625,2626, 772,2627,2628,
+2629,2630,2631, 924, 648, 863, 603,2632,2633, 934,1540, 864, 865,2634, 642,1042,
+ 670,1190,2635,2636,2637,2638, 168,2639, 652, 873, 542,1054,1541,2640,2641,2642,  # 512, 256
+#Everything below is of no interest for detection purpose
+2643,2644,2645,2646,2647,2648,2649,2650,2651,2652,2653,2654,2655,2656,2657,2658,
+2659,2660,2661,2662,2663,2664,2665,2666,2667,2668,2669,2670,2671,2672,2673,2674,
+2675,2676,2677,2678,2679,2680,2681,2682,2683,2684,2685,2686,2687,2688,2689,2690,
+2691,2692,2693,2694,2695,2696,2697,2698,2699,1542, 880,2700,2701,2702,2703,2704,
+2705,2706,2707,2708,2709,2710,2711,2712,2713,2714,2715,2716,2717,2718,2719,2720,
+2721,2722,2723,2724,2725,1543,2726,2727,2728,2729,2730,2731,2732,1544,2733,2734,
+2735,2736,2737,2738,2739,2740,2741,2742,2743,2744,2745,2746,2747,2748,2749,2750,
+2751,2752,2753,2754,1545,2755,2756,2757,2758,2759,2760,2761,2762,2763,2764,2765,
+2766,1546,2767,1547,2768,2769,2770,2771,2772,2773,2774,2775,2776,2777,2778,2779,
+2780,2781,2782,2783,2784,2785,2786,1548,2787,2788,2789,1109,2790,2791,2792,2793,
+2794,2795,2796,2797,2798,2799,2800,2801,2802,2803,2804,2805,2806,2807,2808,2809,
+2810,2811,2812,1329,2813,2814,2815,2816,2817,2818,2819,2820,2821,2822,2823,2824,
+2825,2826,2827,2828,2829,2830,2831,2832,2833,2834,2835,2836,2837,2838,2839,2840,
+2841,2842,2843,2844,2845,2846,2847,2848,2849,2850,2851,2852,2853,2854,2855,2856,
+1549,2857,2858,2859,2860,1550,2861,2862,1551,2863,2864,2865,2866,2867,2868,2869,
+2870,2871,2872,2873,2874,1110,1330,2875,2876,2877,2878,2879,2880,2881,2882,2883,
+2884,2885,2886,2887,2888,2889,2890,2891,2892,2893,2894,2895,2896,2897,2898,2899,
+2900,2901,2902,2903,2904,2905,2906,2907,2908,2909,2910,2911,2912,2913,2914,2915,
+2916,2917,2918,2919,2920,2921,2922,2923,2924,2925,2926,2927,2928,2929,2930,1331,
+2931,2932,2933,2934,2935,2936,2937,2938,2939,2940,2941,2942,2943,1552,2944,2945,
+2946,2947,2948,2949,2950,2951,2952,2953,2954,2955,2956,2957,2958,2959,2960,2961,
+2962,2963,2964,1252,2965,2966,2967,2968,2969,2970,2971,2972,2973,2974,2975,2976,
+2977,2978,2979,2980,2981,2982,2983,2984,2985,2986,2987,2988,2989,2990,2991,2992,
+2993,2994,2995,2996,2997,2998,2999,3000,3001,3002,3003,3004,3005,3006,3007,3008,
+3009,3010,3011,3012,1553,3013,3014,3015,3016,3017,1554,3018,1332,3019,3020,3021,
+3022,3023,3024,3025,3026,3027,3028,3029,3030,3031,3032,3033,3034,3035,3036,3037,
+3038,3039,3040,3041,3042,3043,3044,3045,3046,3047,3048,3049,3050,1555,3051,3052,
+3053,1556,1557,3054,3055,3056,3057,3058,3059,3060,3061,3062,3063,3064,3065,3066,
+3067,1558,3068,3069,3070,3071,3072,3073,3074,3075,3076,1559,3077,3078,3079,3080,
+3081,3082,3083,1253,3084,3085,3086,3087,3088,3089,3090,3091,3092,3093,3094,3095,
+3096,3097,3098,3099,3100,3101,3102,3103,3104,3105,3106,3107,3108,1152,3109,3110,
+3111,3112,3113,1560,3114,3115,3116,3117,1111,3118,3119,3120,3121,3122,3123,3124,
+3125,3126,3127,3128,3129,3130,3131,3132,3133,3134,3135,3136,3137,3138,3139,3140,
+3141,3142,3143,3144,3145,3146,3147,3148,3149,3150,3151,3152,3153,3154,3155,3156,
+3157,3158,3159,3160,3161,3162,3163,3164,3165,3166,3167,3168,3169,3170,3171,3172,
+3173,3174,3175,3176,1333,3177,3178,3179,3180,3181,3182,3183,3184,3185,3186,3187,
+3188,3189,1561,3190,3191,1334,3192,3193,3194,3195,3196,3197,3198,3199,3200,3201,
+3202,3203,3204,3205,3206,3207,3208,3209,3210,3211,3212,3213,3214,3215,3216,3217,
+3218,3219,3220,3221,3222,3223,3224,3225,3226,3227,3228,3229,3230,3231,3232,3233,
+3234,1562,3235,3236,3237,3238,3239,3240,3241,3242,3243,3244,3245,3246,3247,3248,
+3249,3250,3251,3252,3253,3254,3255,3256,3257,3258,3259,3260,3261,3262,3263,3264,
+3265,3266,3267,3268,3269,3270,3271,3272,3273,3274,3275,3276,3277,1563,3278,3279,
+3280,3281,3282,3283,3284,3285,3286,3287,3288,3289,3290,3291,3292,3293,3294,3295,
+3296,3297,3298,3299,3300,3301,3302,3303,3304,3305,3306,3307,3308,3309,3310,3311,
+3312,3313,3314,3315,3316,3317,3318,3319,3320,3321,3322,3323,3324,3325,3326,3327,
+3328,3329,3330,3331,3332,3333,3334,3335,3336,3337,3338,3339,3340,3341,3342,3343,
+3344,3345,3346,3347,3348,3349,3350,3351,3352,3353,3354,3355,3356,3357,3358,3359,
+3360,3361,3362,3363,3364,1335,3365,3366,3367,3368,3369,3370,3371,3372,3373,3374,
+3375,3376,3377,3378,3379,3380,3381,3382,3383,3384,3385,3386,3387,1336,3388,3389,
+3390,3391,3392,3393,3394,3395,3396,3397,3398,3399,3400,3401,3402,3403,3404,3405,
+3406,3407,3408,3409,3410,3411,3412,3413,3414,1337,3415,3416,3417,3418,3419,1338,
+3420,3421,3422,1564,1565,3423,3424,3425,3426,3427,3428,3429,3430,3431,1254,3432,
+3433,3434,1339,3435,3436,3437,3438,3439,1566,3440,3441,3442,3443,3444,3445,3446,
+3447,3448,3449,3450,3451,3452,3453,3454,1255,3455,3456,3457,3458,3459,1567,1191,
+3460,1568,1569,3461,3462,3463,1570,3464,3465,3466,3467,3468,1571,3469,3470,3471,
+3472,3473,1572,3474,3475,3476,3477,3478,3479,3480,3481,3482,3483,3484,3485,3486,
+1340,3487,3488,3489,3490,3491,3492,1021,3493,3494,3495,3496,3497,3498,1573,3499,
+1341,3500,3501,3502,3503,3504,3505,3506,3507,3508,3509,3510,3511,1342,3512,3513,
+3514,3515,3516,1574,1343,3517,3518,3519,1575,3520,1576,3521,3522,3523,3524,3525,
+3526,3527,3528,3529,3530,3531,3532,3533,3534,3535,3536,3537,3538,3539,3540,3541,
+3542,3543,3544,3545,3546,3547,3548,3549,3550,3551,3552,3553,3554,3555,3556,3557,
+3558,3559,3560,3561,3562,3563,3564,3565,3566,3567,3568,3569,3570,3571,3572,3573,
+3574,3575,3576,3577,3578,3579,3580,1577,3581,3582,1578,3583,3584,3585,3586,3587,
+3588,3589,3590,3591,3592,3593,3594,3595,3596,3597,3598,3599,3600,3601,3602,3603,
+3604,1579,3605,3606,3607,3608,3609,3610,3611,3612,3613,3614,3615,3616,3617,3618,
+3619,3620,3621,3622,3623,3624,3625,3626,3627,3628,3629,1580,3630,3631,1581,3632,
+3633,3634,3635,3636,3637,3638,3639,3640,3641,3642,3643,3644,3645,3646,3647,3648,
+3649,3650,3651,3652,3653,3654,3655,3656,1582,3657,3658,3659,3660,3661,3662,3663,
+3664,3665,3666,3667,3668,3669,3670,3671,3672,3673,3674,3675,3676,3677,3678,3679,
+3680,3681,3682,3683,3684,3685,3686,3687,3688,3689,3690,3691,3692,3693,3694,3695,
+3696,3697,3698,3699,3700,1192,3701,3702,3703,3704,1256,3705,3706,3707,3708,1583,
+1257,3709,3710,3711,3712,3713,3714,3715,3716,1584,3717,3718,3719,3720,3721,3722,
+3723,3724,3725,3726,3727,3728,3729,3730,3731,3732,3733,3734,3735,3736,3737,3738,
+3739,3740,3741,3742,3743,3744,3745,1344,3746,3747,3748,3749,3750,3751,3752,3753,
+3754,3755,3756,1585,3757,3758,3759,3760,3761,3762,3763,3764,3765,3766,1586,3767,
+3768,3769,3770,3771,3772,3773,3774,3775,3776,3777,3778,1345,3779,3780,3781,3782,
+3783,3784,3785,3786,3787,3788,3789,3790,3791,3792,3793,3794,3795,1346,1587,3796,
+3797,1588,3798,3799,3800,3801,3802,3803,3804,3805,3806,1347,3807,3808,3809,3810,
+3811,1589,3812,3813,3814,3815,3816,3817,3818,3819,3820,3821,1590,3822,3823,1591,
+1348,3824,3825,3826,3827,3828,3829,3830,1592,3831,3832,1593,3833,3834,3835,3836,
+3837,3838,3839,3840,3841,3842,3843,3844,1349,3845,3846,3847,3848,3849,3850,3851,
+3852,3853,3854,3855,3856,3857,3858,1594,3859,3860,3861,3862,3863,3864,3865,3866,
+3867,3868,3869,1595,3870,3871,3872,3873,1596,3874,3875,3876,3877,3878,3879,3880,
+3881,3882,3883,3884,3885,3886,1597,3887,3888,3889,3890,3891,3892,3893,3894,3895,
+1598,3896,3897,3898,1599,1600,3899,1350,3900,1351,3901,3902,1352,3903,3904,3905,
+3906,3907,3908,3909,3910,3911,3912,3913,3914,3915,3916,3917,3918,3919,3920,3921,
+3922,3923,3924,1258,3925,3926,3927,3928,3929,3930,3931,1193,3932,1601,3933,3934,
+3935,3936,3937,3938,3939,3940,3941,3942,3943,1602,3944,3945,3946,3947,3948,1603,
+3949,3950,3951,3952,3953,3954,3955,3956,3957,3958,3959,3960,3961,3962,3963,3964,
+3965,1604,3966,3967,3968,3969,3970,3971,3972,3973,3974,3975,3976,3977,1353,3978,
+3979,3980,3981,3982,3983,3984,3985,3986,3987,3988,3989,3990,3991,1354,3992,3993,
+3994,3995,3996,3997,3998,3999,4000,4001,4002,4003,4004,4005,4006,4007,4008,4009,
+4010,4011,4012,4013,4014,4015,4016,4017,4018,4019,4020,4021,4022,4023,1355,4024,
+4025,4026,4027,4028,4029,4030,4031,4032,4033,4034,4035,4036,4037,4038,4039,4040,
+1605,4041,4042,4043,4044,4045,4046,4047,4048,4049,4050,4051,4052,4053,4054,4055,
+4056,4057,4058,4059,4060,1606,4061,4062,4063,4064,1607,4065,4066,4067,4068,4069,
+4070,4071,4072,4073,4074,4075,4076,1194,4077,4078,1608,4079,4080,4081,4082,4083,
+4084,4085,4086,4087,1609,4088,4089,4090,4091,4092,4093,4094,4095,4096,4097,4098,
+4099,4100,4101,4102,4103,4104,4105,4106,4107,4108,1259,4109,4110,4111,4112,4113,
+4114,4115,4116,4117,4118,4119,4120,4121,4122,4123,4124,1195,4125,4126,4127,1610,
+4128,4129,4130,4131,4132,4133,4134,4135,4136,4137,1356,4138,4139,4140,4141,4142,
+4143,4144,1611,4145,4146,4147,4148,4149,4150,4151,4152,4153,4154,4155,4156,4157,
+4158,4159,4160,4161,4162,4163,4164,4165,4166,4167,4168,4169,4170,4171,4172,4173,
+4174,4175,4176,4177,4178,4179,4180,4181,4182,4183,4184,4185,4186,4187,4188,4189,
+4190,4191,4192,4193,4194,4195,4196,4197,4198,4199,4200,4201,4202,4203,4204,4205,
+4206,4207,4208,4209,4210,4211,4212,4213,4214,4215,4216,4217,4218,4219,1612,4220,
+4221,4222,4223,4224,4225,4226,4227,1357,4228,1613,4229,4230,4231,4232,4233,4234,
+4235,4236,4237,4238,4239,4240,4241,4242,4243,1614,4244,4245,4246,4247,4248,4249,
+4250,4251,4252,4253,4254,4255,4256,4257,4258,4259,4260,4261,4262,4263,4264,4265,
+4266,4267,4268,4269,4270,1196,1358,4271,4272,4273,4274,4275,4276,4277,4278,4279,
+4280,4281,4282,4283,4284,4285,4286,4287,1615,4288,4289,4290,4291,4292,4293,4294,
+4295,4296,4297,4298,4299,4300,4301,4302,4303,4304,4305,4306,4307,4308,4309,4310,
+4311,4312,4313,4314,4315,4316,4317,4318,4319,4320,4321,4322,4323,4324,4325,4326,
+4327,4328,4329,4330,4331,4332,4333,4334,1616,4335,4336,4337,4338,4339,4340,4341,
+4342,4343,4344,4345,4346,4347,4348,4349,4350,4351,4352,4353,4354,4355,4356,4357,
+4358,4359,4360,1617,4361,4362,4363,4364,4365,1618,4366,4367,4368,4369,4370,4371,
+4372,4373,4374,4375,4376,4377,4378,4379,4380,4381,4382,4383,4384,4385,4386,4387,
+4388,4389,4390,4391,4392,4393,4394,4395,4396,4397,4398,4399,4400,4401,4402,4403,
+4404,4405,4406,4407,4408,4409,4410,4411,4412,4413,4414,4415,4416,1619,4417,4418,
+4419,4420,4421,4422,4423,4424,4425,1112,4426,4427,4428,4429,4430,1620,4431,4432,
+4433,4434,4435,4436,4437,4438,4439,4440,4441,4442,1260,1261,4443,4444,4445,4446,
+4447,4448,4449,4450,4451,4452,4453,4454,4455,1359,4456,4457,4458,4459,4460,4461,
+4462,4463,4464,4465,1621,4466,4467,4468,4469,4470,4471,4472,4473,4474,4475,4476,
+4477,4478,4479,4480,4481,4482,4483,4484,4485,4486,4487,4488,4489,1055,4490,4491,
+4492,4493,4494,4495,4496,4497,4498,4499,4500,4501,4502,4503,4504,4505,4506,4507,
+4508,4509,4510,4511,4512,4513,4514,4515,4516,4517,4518,1622,4519,4520,4521,1623,
+4522,4523,4524,4525,4526,4527,4528,4529,4530,4531,4532,4533,4534,4535,1360,4536,
+4537,4538,4539,4540,4541,4542,4543, 975,4544,4545,4546,4547,4548,4549,4550,4551,
+4552,4553,4554,4555,4556,4557,4558,4559,4560,4561,4562,4563,4564,4565,4566,4567,
+4568,4569,4570,4571,1624,4572,4573,4574,4575,4576,1625,4577,4578,4579,4580,4581,
+4582,4583,4584,1626,4585,4586,4587,4588,4589,4590,4591,4592,4593,4594,4595,1627,
+4596,4597,4598,4599,4600,4601,4602,4603,4604,4605,4606,4607,4608,4609,4610,4611,
+4612,4613,4614,4615,1628,4616,4617,4618,4619,4620,4621,4622,4623,4624,4625,4626,
+4627,4628,4629,4630,4631,4632,4633,4634,4635,4636,4637,4638,4639,4640,4641,4642,
+4643,4644,4645,4646,4647,4648,4649,1361,4650,4651,4652,4653,4654,4655,4656,4657,
+4658,4659,4660,4661,1362,4662,4663,4664,4665,4666,4667,4668,4669,4670,4671,4672,
+4673,4674,4675,4676,4677,4678,4679,4680,4681,4682,1629,4683,4684,4685,4686,4687,
+1630,4688,4689,4690,4691,1153,4692,4693,4694,1113,4695,4696,4697,4698,4699,4700,
+4701,4702,4703,4704,4705,4706,4707,4708,4709,4710,4711,1197,4712,4713,4714,4715,
+4716,4717,4718,4719,4720,4721,4722,4723,4724,4725,4726,4727,4728,4729,4730,4731,
+4732,4733,4734,4735,1631,4736,1632,4737,4738,4739,4740,4741,4742,4743,4744,1633,
+4745,4746,4747,4748,4749,1262,4750,4751,4752,4753,4754,1363,4755,4756,4757,4758,
+4759,4760,4761,4762,4763,4764,4765,4766,4767,4768,1634,4769,4770,4771,4772,4773,
+4774,4775,4776,4777,4778,1635,4779,4780,4781,4782,4783,4784,4785,4786,4787,4788,
+4789,1636,4790,4791,4792,4793,4794,4795,4796,4797,4798,4799,4800,4801,4802,4803,
+4804,4805,4806,1637,4807,4808,4809,1638,4810,4811,4812,4813,4814,4815,4816,4817,
+4818,1639,4819,4820,4821,4822,4823,4824,4825,4826,4827,4828,4829,4830,4831,4832,
+4833,1077,4834,4835,4836,4837,4838,4839,4840,4841,4842,4843,4844,4845,4846,4847,
+4848,4849,4850,4851,4852,4853,4854,4855,4856,4857,4858,4859,4860,4861,4862,4863,
+4864,4865,4866,4867,4868,4869,4870,4871,4872,4873,4874,4875,4876,4877,4878,4879,
+4880,4881,4882,4883,1640,4884,4885,1641,4886,4887,4888,4889,4890,4891,4892,4893,
+4894,4895,4896,4897,4898,4899,4900,4901,4902,4903,4904,4905,4906,4907,4908,4909,
+4910,4911,1642,4912,4913,4914,1364,4915,4916,4917,4918,4919,4920,4921,4922,4923,
+4924,4925,4926,4927,4928,4929,4930,4931,1643,4932,4933,4934,4935,4936,4937,4938,
+4939,4940,4941,4942,4943,4944,4945,4946,4947,4948,4949,4950,4951,4952,4953,4954,
+4955,4956,4957,4958,4959,4960,4961,4962,4963,4964,4965,4966,4967,4968,4969,4970,
+4971,4972,4973,4974,4975,4976,4977,4978,4979,4980,1644,4981,4982,4983,4984,1645,
+4985,4986,1646,4987,4988,4989,4990,4991,4992,4993,4994,4995,4996,4997,4998,4999,
+5000,5001,5002,5003,5004,5005,1647,5006,1648,5007,5008,5009,5010,5011,5012,1078,
+5013,5014,5015,5016,5017,5018,5019,5020,5021,5022,5023,5024,5025,5026,5027,5028,
+1365,5029,5030,5031,5032,5033,5034,5035,5036,5037,5038,5039,1649,5040,5041,5042,
+5043,5044,5045,1366,5046,5047,5048,5049,5050,5051,5052,5053,5054,5055,1650,5056,
+5057,5058,5059,5060,5061,5062,5063,5064,5065,5066,5067,5068,5069,5070,5071,5072,
+5073,5074,5075,5076,5077,1651,5078,5079,5080,5081,5082,5083,5084,5085,5086,5087,
+5088,5089,5090,5091,5092,5093,5094,5095,5096,5097,5098,5099,5100,5101,5102,5103,
+5104,5105,5106,5107,5108,5109,5110,1652,5111,5112,5113,5114,5115,5116,5117,5118,
+1367,5119,5120,5121,5122,5123,5124,5125,5126,5127,5128,5129,1653,5130,5131,5132,
+5133,5134,5135,5136,5137,5138,5139,5140,5141,5142,5143,5144,5145,5146,5147,5148,
+5149,1368,5150,1654,5151,1369,5152,5153,5154,5155,5156,5157,5158,5159,5160,5161,
+5162,5163,5164,5165,5166,5167,5168,5169,5170,5171,5172,5173,5174,5175,5176,5177,
+5178,1370,5179,5180,5181,5182,5183,5184,5185,5186,5187,5188,5189,5190,5191,5192,
+5193,5194,5195,5196,5197,5198,1655,5199,5200,5201,5202,1656,5203,5204,5205,5206,
+1371,5207,1372,5208,5209,5210,5211,1373,5212,5213,1374,5214,5215,5216,5217,5218,
+5219,5220,5221,5222,5223,5224,5225,5226,5227,5228,5229,5230,5231,5232,5233,5234,
+5235,5236,5237,5238,5239,5240,5241,5242,5243,5244,5245,5246,5247,1657,5248,5249,
+5250,5251,1658,1263,5252,5253,5254,5255,5256,1375,5257,5258,5259,5260,5261,5262,
+5263,5264,5265,5266,5267,5268,5269,5270,5271,5272,5273,5274,5275,5276,5277,5278,
+5279,5280,5281,5282,5283,1659,5284,5285,5286,5287,5288,5289,5290,5291,5292,5293,
+5294,5295,5296,5297,5298,5299,5300,1660,5301,5302,5303,5304,5305,5306,5307,5308,
+5309,5310,5311,5312,5313,5314,5315,5316,5317,5318,5319,5320,5321,1376,5322,5323,
+5324,5325,5326,5327,5328,5329,5330,5331,5332,5333,1198,5334,5335,5336,5337,5338,
+5339,5340,5341,5342,5343,1661,5344,5345,5346,5347,5348,5349,5350,5351,5352,5353,
+5354,5355,5356,5357,5358,5359,5360,5361,5362,5363,5364,5365,5366,5367,5368,5369,
+5370,5371,5372,5373,5374,5375,5376,5377,5378,5379,5380,5381,5382,5383,5384,5385,
+5386,5387,5388,5389,5390,5391,5392,5393,5394,5395,5396,5397,5398,1264,5399,5400,
+5401,5402,5403,5404,5405,5406,5407,5408,5409,5410,5411,5412,1662,5413,5414,5415,
+5416,1663,5417,5418,5419,5420,5421,5422,5423,5424,5425,5426,5427,5428,5429,5430,
+5431,5432,5433,5434,5435,5436,5437,5438,1664,5439,5440,5441,5442,5443,5444,5445,
+5446,5447,5448,5449,5450,5451,5452,5453,5454,5455,5456,5457,5458,5459,5460,5461,
+5462,5463,5464,5465,5466,5467,5468,5469,5470,5471,5472,5473,5474,5475,5476,5477,
+5478,1154,5479,5480,5481,5482,5483,5484,5485,1665,5486,5487,5488,5489,5490,5491,
+5492,5493,5494,5495,5496,5497,5498,5499,5500,5501,5502,5503,5504,5505,5506,5507,
+5508,5509,5510,5511,5512,5513,5514,5515,5516,5517,5518,5519,5520,5521,5522,5523,
+5524,5525,5526,5527,5528,5529,5530,5531,5532,5533,5534,5535,5536,5537,5538,5539,
+5540,5541,5542,5543,5544,5545,5546,5547,5548,1377,5549,5550,5551,5552,5553,5554,
+5555,5556,5557,5558,5559,5560,5561,5562,5563,5564,5565,5566,5567,5568,5569,5570,
+1114,5571,5572,5573,5574,5575,5576,5577,5578,5579,5580,5581,5582,5583,5584,5585,
+5586,5587,5588,5589,5590,5591,5592,1378,5593,5594,5595,5596,5597,5598,5599,5600,
+5601,5602,5603,5604,5605,5606,5607,5608,5609,5610,5611,5612,5613,5614,1379,5615,
+5616,5617,5618,5619,5620,5621,5622,5623,5624,5625,5626,5627,5628,5629,5630,5631,
+5632,5633,5634,1380,5635,5636,5637,5638,5639,5640,5641,5642,5643,5644,5645,5646,
+5647,5648,5649,1381,1056,5650,5651,5652,5653,5654,5655,5656,5657,5658,5659,5660,
+1666,5661,5662,5663,5664,5665,5666,5667,5668,1667,5669,1668,5670,5671,5672,5673,
+5674,5675,5676,5677,5678,1155,5679,5680,5681,5682,5683,5684,5685,5686,5687,5688,
+5689,5690,5691,5692,5693,5694,5695,5696,5697,5698,1669,5699,5700,5701,5702,5703,
+5704,5705,1670,5706,5707,5708,5709,5710,1671,5711,5712,5713,5714,1382,5715,5716,
+5717,5718,5719,5720,5721,5722,5723,5724,5725,1672,5726,5727,1673,1674,5728,5729,
+5730,5731,5732,5733,5734,5735,5736,1675,5737,5738,5739,5740,5741,5742,5743,5744,
+1676,5745,5746,5747,5748,5749,5750,5751,1383,5752,5753,5754,5755,5756,5757,5758,
+5759,5760,5761,5762,5763,5764,5765,5766,5767,5768,1677,5769,5770,5771,5772,5773,
+1678,5774,5775,5776, 998,5777,5778,5779,5780,5781,5782,5783,5784,5785,1384,5786,
+5787,5788,5789,5790,5791,5792,5793,5794,5795,5796,5797,5798,5799,5800,1679,5801,
+5802,5803,1115,1116,5804,5805,5806,5807,5808,5809,5810,5811,5812,5813,5814,5815,
+5816,5817,5818,5819,5820,5821,5822,5823,5824,5825,5826,5827,5828,5829,5830,5831,
+5832,5833,5834,5835,5836,5837,5838,5839,5840,5841,5842,5843,5844,5845,5846,5847,
+5848,5849,5850,5851,5852,5853,5854,5855,1680,5856,5857,5858,5859,5860,5861,5862,
+5863,5864,1681,5865,5866,5867,1682,5868,5869,5870,5871,5872,5873,5874,5875,5876,
+5877,5878,5879,1683,5880,1684,5881,5882,5883,5884,1685,5885,5886,5887,5888,5889,
+5890,5891,5892,5893,5894,5895,5896,5897,5898,5899,5900,5901,5902,5903,5904,5905,
+5906,5907,1686,5908,5909,5910,5911,5912,5913,5914,5915,5916,5917,5918,5919,5920,
+5921,5922,5923,5924,5925,5926,5927,5928,5929,5930,5931,5932,5933,5934,5935,1687,
+5936,5937,5938,5939,5940,5941,5942,5943,5944,5945,5946,5947,5948,5949,5950,5951,
+5952,1688,1689,5953,1199,5954,5955,5956,5957,5958,5959,5960,5961,1690,5962,5963,
+5964,5965,5966,5967,5968,5969,5970,5971,5972,5973,5974,5975,5976,5977,5978,5979,
+5980,5981,1385,5982,1386,5983,5984,5985,5986,5987,5988,5989,5990,5991,5992,5993,
+5994,5995,5996,5997,5998,5999,6000,6001,6002,6003,6004,6005,6006,6007,6008,6009,
+6010,6011,6012,6013,6014,6015,6016,6017,6018,6019,6020,6021,6022,6023,6024,6025,
+6026,6027,1265,6028,6029,1691,6030,6031,6032,6033,6034,6035,6036,6037,6038,6039,
+6040,6041,6042,6043,6044,6045,6046,6047,6048,6049,6050,6051,6052,6053,6054,6055,
+6056,6057,6058,6059,6060,6061,6062,6063,6064,6065,6066,6067,6068,6069,6070,6071,
+6072,6073,6074,6075,6076,6077,6078,6079,6080,6081,6082,6083,6084,1692,6085,6086,
+6087,6088,6089,6090,6091,6092,6093,6094,6095,6096,6097,6098,6099,6100,6101,6102,
+6103,6104,6105,6106,6107,6108,6109,6110,6111,6112,6113,6114,6115,6116,6117,6118,
+6119,6120,6121,6122,6123,6124,6125,6126,6127,6128,6129,6130,6131,1693,6132,6133,
+6134,6135,6136,1694,6137,6138,6139,6140,6141,1695,6142,6143,6144,6145,6146,6147,
+6148,6149,6150,6151,6152,6153,6154,6155,6156,6157,6158,6159,6160,6161,6162,6163,
+6164,6165,6166,6167,6168,6169,6170,6171,6172,6173,6174,6175,6176,6177,6178,6179,
+6180,6181,6182,6183,6184,6185,1696,6186,6187,6188,6189,6190,6191,6192,6193,6194,
+6195,6196,6197,6198,6199,6200,6201,6202,6203,6204,6205,6206,6207,6208,6209,6210,
+6211,6212,6213,6214,6215,6216,6217,6218,6219,1697,6220,6221,6222,6223,6224,6225,
+6226,6227,6228,6229,6230,6231,6232,6233,6234,6235,6236,6237,6238,6239,6240,6241,
+6242,6243,6244,6245,6246,6247,6248,6249,6250,6251,6252,6253,1698,6254,6255,6256,
+6257,6258,6259,6260,6261,6262,6263,1200,6264,6265,6266,6267,6268,6269,6270,6271,  #1024
+6272,6273,6274,6275,6276,6277,6278,6279,6280,6281,6282,6283,6284,6285,6286,6287,
+6288,6289,6290,6291,6292,6293,6294,6295,6296,6297,6298,6299,6300,6301,6302,1699,
+6303,6304,1700,6305,6306,6307,6308,6309,6310,6311,6312,6313,6314,6315,6316,6317,
+6318,6319,6320,6321,6322,6323,6324,6325,6326,6327,6328,6329,6330,6331,6332,6333,
+6334,6335,6336,6337,6338,6339,1701,6340,6341,6342,6343,6344,1387,6345,6346,6347,
+6348,6349,6350,6351,6352,6353,6354,6355,6356,6357,6358,6359,6360,6361,6362,6363,
+6364,6365,6366,6367,6368,6369,6370,6371,6372,6373,6374,6375,6376,6377,6378,6379,
+6380,6381,6382,6383,6384,6385,6386,6387,6388,6389,6390,6391,6392,6393,6394,6395,
+6396,6397,6398,6399,6400,6401,6402,6403,6404,6405,6406,6407,6408,6409,6410,6411,
+6412,6413,1702,6414,6415,6416,6417,6418,6419,6420,6421,6422,1703,6423,6424,6425,
+6426,6427,6428,6429,6430,6431,6432,6433,6434,6435,6436,6437,6438,1704,6439,6440,
+6441,6442,6443,6444,6445,6446,6447,6448,6449,6450,6451,6452,6453,6454,6455,6456,
+6457,6458,6459,6460,6461,6462,6463,6464,6465,6466,6467,6468,6469,6470,6471,6472,
+6473,6474,6475,6476,6477,6478,6479,6480,6481,6482,6483,6484,6485,6486,6487,6488,
+6489,6490,6491,6492,6493,6494,6495,6496,6497,6498,6499,6500,6501,6502,6503,1266,
+6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516,6517,6518,6519,
+6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532,6533,6534,6535,
+6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548,6549,6550,6551,
+1705,1706,6552,6553,6554,6555,6556,6557,6558,6559,6560,6561,6562,6563,6564,6565,
+6566,6567,6568,6569,6570,6571,6572,6573,6574,6575,6576,6577,6578,6579,6580,6581,
+6582,6583,6584,6585,6586,6587,6588,6589,6590,6591,6592,6593,6594,6595,6596,6597,
+6598,6599,6600,6601,6602,6603,6604,6605,6606,6607,6608,6609,6610,6611,6612,6613,
+6614,6615,6616,6617,6618,6619,6620,6621,6622,6623,6624,6625,6626,6627,6628,6629,
+6630,6631,6632,6633,6634,6635,6636,6637,1388,6638,6639,6640,6641,6642,6643,6644,
+1707,6645,6646,6647,6648,6649,6650,6651,6652,6653,6654,6655,6656,6657,6658,6659,
+6660,6661,6662,6663,1708,6664,6665,6666,6667,6668,6669,6670,6671,6672,6673,6674,
+1201,6675,6676,6677,6678,6679,6680,6681,6682,6683,6684,6685,6686,6687,6688,6689,
+6690,6691,6692,6693,6694,6695,6696,6697,6698,6699,6700,6701,6702,6703,6704,6705,
+6706,6707,6708,6709,6710,6711,6712,6713,6714,6715,6716,6717,6718,6719,6720,6721,
+6722,6723,6724,6725,1389,6726,6727,6728,6729,6730,6731,6732,6733,6734,6735,6736,
+1390,1709,6737,6738,6739,6740,6741,6742,1710,6743,6744,6745,6746,1391,6747,6748,
+6749,6750,6751,6752,6753,6754,6755,6756,6757,1392,6758,6759,6760,6761,6762,6763,
+6764,6765,6766,6767,6768,6769,6770,6771,6772,6773,6774,6775,6776,6777,6778,6779,
+6780,1202,6781,6782,6783,6784,6785,6786,6787,6788,6789,6790,6791,6792,6793,6794,
+6795,6796,6797,6798,6799,6800,6801,6802,6803,6804,6805,6806,6807,6808,6809,1711,
+6810,6811,6812,6813,6814,6815,6816,6817,6818,6819,6820,6821,6822,6823,6824,6825,
+6826,6827,6828,6829,6830,6831,6832,6833,6834,6835,6836,1393,6837,6838,6839,6840,
+6841,6842,6843,6844,6845,6846,6847,6848,6849,6850,6851,6852,6853,6854,6855,6856,
+6857,6858,6859,6860,6861,6862,6863,6864,6865,6866,6867,6868,6869,6870,6871,6872,
+6873,6874,6875,6876,6877,6878,6879,6880,6881,6882,6883,6884,6885,6886,6887,6888,
+6889,6890,6891,6892,6893,6894,6895,6896,6897,6898,6899,6900,6901,6902,1712,6903,
+6904,6905,6906,6907,6908,6909,6910,1713,6911,6912,6913,6914,6915,6916,6917,6918,
+6919,6920,6921,6922,6923,6924,6925,6926,6927,6928,6929,6930,6931,6932,6933,6934,
+6935,6936,6937,6938,6939,6940,6941,6942,6943,6944,6945,6946,6947,6948,6949,6950,
+6951,6952,6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,
+6967,6968,6969,6970,6971,6972,6973,6974,1714,6975,6976,6977,6978,6979,6980,6981,
+6982,6983,6984,6985,6986,6987,6988,1394,6989,6990,6991,6992,6993,6994,6995,6996,
+6997,6998,6999,7000,1715,7001,7002,7003,7004,7005,7006,7007,7008,7009,7010,7011,
+7012,7013,7014,7015,7016,7017,7018,7019,7020,7021,7022,7023,7024,7025,7026,7027,
+7028,1716,7029,7030,7031,7032,7033,7034,7035,7036,7037,7038,7039,7040,7041,7042,
+7043,7044,7045,7046,7047,7048,7049,7050,7051,7052,7053,7054,7055,7056,7057,7058,
+7059,7060,7061,7062,7063,7064,7065,7066,7067,7068,7069,7070,7071,7072,7073,7074,
+7075,7076,7077,7078,7079,7080,7081,7082,7083,7084,7085,7086,7087,7088,7089,7090,
+7091,7092,7093,7094,7095,7096,7097,7098,7099,7100,7101,7102,7103,7104,7105,7106,
+7107,7108,7109,7110,7111,7112,7113,7114,7115,7116,7117,7118,7119,7120,7121,7122,
+7123,7124,7125,7126,7127,7128,7129,7130,7131,7132,7133,7134,7135,7136,7137,7138,
+7139,7140,7141,7142,7143,7144,7145,7146,7147,7148,7149,7150,7151,7152,7153,7154,
+7155,7156,7157,7158,7159,7160,7161,7162,7163,7164,7165,7166,7167,7168,7169,7170,
+7171,7172,7173,7174,7175,7176,7177,7178,7179,7180,7181,7182,7183,7184,7185,7186,
+7187,7188,7189,7190,7191,7192,7193,7194,7195,7196,7197,7198,7199,7200,7201,7202,
+7203,7204,7205,7206,7207,1395,7208,7209,7210,7211,7212,7213,1717,7214,7215,7216,
+7217,7218,7219,7220,7221,7222,7223,7224,7225,7226,7227,7228,7229,7230,7231,7232,
+7233,7234,7235,7236,7237,7238,7239,7240,7241,7242,7243,7244,7245,7246,7247,7248,
+7249,7250,7251,7252,7253,7254,7255,7256,7257,7258,7259,7260,7261,7262,7263,7264,
+7265,7266,7267,7268,7269,7270,7271,7272,7273,7274,7275,7276,7277,7278,7279,7280,
+7281,7282,7283,7284,7285,7286,7287,7288,7289,7290,7291,7292,7293,7294,7295,7296,
+7297,7298,7299,7300,7301,7302,7303,7304,7305,7306,7307,7308,7309,7310,7311,7312,
+7313,1718,7314,7315,7316,7317,7318,7319,7320,7321,7322,7323,7324,7325,7326,7327,
+7328,7329,7330,7331,7332,7333,7334,7335,7336,7337,7338,7339,7340,7341,7342,7343,
+7344,7345,7346,7347,7348,7349,7350,7351,7352,7353,7354,7355,7356,7357,7358,7359,
+7360,7361,7362,7363,7364,7365,7366,7367,7368,7369,7370,7371,7372,7373,7374,7375,
+7376,7377,7378,7379,7380,7381,7382,7383,7384,7385,7386,7387,7388,7389,7390,7391,
+7392,7393,7394,7395,7396,7397,7398,7399,7400,7401,7402,7403,7404,7405,7406,7407,
+7408,7409,7410,7411,7412,7413,7414,7415,7416,7417,7418,7419,7420,7421,7422,7423,
+7424,7425,7426,7427,7428,7429,7430,7431,7432,7433,7434,7435,7436,7437,7438,7439,
+7440,7441,7442,7443,7444,7445,7446,7447,7448,7449,7450,7451,7452,7453,7454,7455,
+7456,7457,7458,7459,7460,7461,7462,7463,7464,7465,7466,7467,7468,7469,7470,7471,
+7472,7473,7474,7475,7476,7477,7478,7479,7480,7481,7482,7483,7484,7485,7486,7487,
+7488,7489,7490,7491,7492,7493,7494,7495,7496,7497,7498,7499,7500,7501,7502,7503,
+7504,7505,7506,7507,7508,7509,7510,7511,7512,7513,7514,7515,7516,7517,7518,7519,
+7520,7521,7522,7523,7524,7525,7526,7527,7528,7529,7530,7531,7532,7533,7534,7535,
+7536,7537,7538,7539,7540,7541,7542,7543,7544,7545,7546,7547,7548,7549,7550,7551,
+7552,7553,7554,7555,7556,7557,7558,7559,7560,7561,7562,7563,7564,7565,7566,7567,
+7568,7569,7570,7571,7572,7573,7574,7575,7576,7577,7578,7579,7580,7581,7582,7583,
+7584,7585,7586,7587,7588,7589,7590,7591,7592,7593,7594,7595,7596,7597,7598,7599,
+7600,7601,7602,7603,7604,7605,7606,7607,7608,7609,7610,7611,7612,7613,7614,7615,
+7616,7617,7618,7619,7620,7621,7622,7623,7624,7625,7626,7627,7628,7629,7630,7631,
+7632,7633,7634,7635,7636,7637,7638,7639,7640,7641,7642,7643,7644,7645,7646,7647,
+7648,7649,7650,7651,7652,7653,7654,7655,7656,7657,7658,7659,7660,7661,7662,7663,
+7664,7665,7666,7667,7668,7669,7670,7671,7672,7673,7674,7675,7676,7677,7678,7679,
+7680,7681,7682,7683,7684,7685,7686,7687,7688,7689,7690,7691,7692,7693,7694,7695,
+7696,7697,7698,7699,7700,7701,7702,7703,7704,7705,7706,7707,7708,7709,7710,7711,
+7712,7713,7714,7715,7716,7717,7718,7719,7720,7721,7722,7723,7724,7725,7726,7727,
+7728,7729,7730,7731,7732,7733,7734,7735,7736,7737,7738,7739,7740,7741,7742,7743,
+7744,7745,7746,7747,7748,7749,7750,7751,7752,7753,7754,7755,7756,7757,7758,7759,
+7760,7761,7762,7763,7764,7765,7766,7767,7768,7769,7770,7771,7772,7773,7774,7775,
+7776,7777,7778,7779,7780,7781,7782,7783,7784,7785,7786,7787,7788,7789,7790,7791,
+7792,7793,7794,7795,7796,7797,7798,7799,7800,7801,7802,7803,7804,7805,7806,7807,
+7808,7809,7810,7811,7812,7813,7814,7815,7816,7817,7818,7819,7820,7821,7822,7823,
+7824,7825,7826,7827,7828,7829,7830,7831,7832,7833,7834,7835,7836,7837,7838,7839,
+7840,7841,7842,7843,7844,7845,7846,7847,7848,7849,7850,7851,7852,7853,7854,7855,
+7856,7857,7858,7859,7860,7861,7862,7863,7864,7865,7866,7867,7868,7869,7870,7871,
+7872,7873,7874,7875,7876,7877,7878,7879,7880,7881,7882,7883,7884,7885,7886,7887,
+7888,7889,7890,7891,7892,7893,7894,7895,7896,7897,7898,7899,7900,7901,7902,7903,
+7904,7905,7906,7907,7908,7909,7910,7911,7912,7913,7914,7915,7916,7917,7918,7919,
+7920,7921,7922,7923,7924,7925,7926,7927,7928,7929,7930,7931,7932,7933,7934,7935,
+7936,7937,7938,7939,7940,7941,7942,7943,7944,7945,7946,7947,7948,7949,7950,7951,
+7952,7953,7954,7955,7956,7957,7958,7959,7960,7961,7962,7963,7964,7965,7966,7967,
+7968,7969,7970,7971,7972,7973,7974,7975,7976,7977,7978,7979,7980,7981,7982,7983,
+7984,7985,7986,7987,7988,7989,7990,7991,7992,7993,7994,7995,7996,7997,7998,7999,
+8000,8001,8002,8003,8004,8005,8006,8007,8008,8009,8010,8011,8012,8013,8014,8015,
+8016,8017,8018,8019,8020,8021,8022,8023,8024,8025,8026,8027,8028,8029,8030,8031,
+8032,8033,8034,8035,8036,8037,8038,8039,8040,8041,8042,8043,8044,8045,8046,8047,
+8048,8049,8050,8051,8052,8053,8054,8055,8056,8057,8058,8059,8060,8061,8062,8063,
+8064,8065,8066,8067,8068,8069,8070,8071,8072,8073,8074,8075,8076,8077,8078,8079,
+8080,8081,8082,8083,8084,8085,8086,8087,8088,8089,8090,8091,8092,8093,8094,8095,
+8096,8097,8098,8099,8100,8101,8102,8103,8104,8105,8106,8107,8108,8109,8110,8111,
+8112,8113,8114,8115,8116,8117,8118,8119,8120,8121,8122,8123,8124,8125,8126,8127,
+8128,8129,8130,8131,8132,8133,8134,8135,8136,8137,8138,8139,8140,8141,8142,8143,
+8144,8145,8146,8147,8148,8149,8150,8151,8152,8153,8154,8155,8156,8157,8158,8159,
+8160,8161,8162,8163,8164,8165,8166,8167,8168,8169,8170,8171,8172,8173,8174,8175,
+8176,8177,8178,8179,8180,8181,8182,8183,8184,8185,8186,8187,8188,8189,8190,8191,
+8192,8193,8194,8195,8196,8197,8198,8199,8200,8201,8202,8203,8204,8205,8206,8207,
+8208,8209,8210,8211,8212,8213,8214,8215,8216,8217,8218,8219,8220,8221,8222,8223,
+8224,8225,8226,8227,8228,8229,8230,8231,8232,8233,8234,8235,8236,8237,8238,8239,
+8240,8241,8242,8243,8244,8245,8246,8247,8248,8249,8250,8251,8252,8253,8254,8255,
+8256,8257,8258,8259,8260,8261,8262,8263,8264,8265,8266,8267,8268,8269,8270,8271,
+8272,8273,8274,8275,8276,8277,8278,8279,8280,8281,8282,8283,8284,8285,8286,8287,
+8288,8289,8290,8291,8292,8293,8294,8295,8296,8297,8298,8299,8300,8301,8302,8303,
+8304,8305,8306,8307,8308,8309,8310,8311,8312,8313,8314,8315,8316,8317,8318,8319,
+8320,8321,8322,8323,8324,8325,8326,8327,8328,8329,8330,8331,8332,8333,8334,8335,
+8336,8337,8338,8339,8340,8341,8342,8343,8344,8345,8346,8347,8348,8349,8350,8351,
+8352,8353,8354,8355,8356,8357,8358,8359,8360,8361,8362,8363,8364,8365,8366,8367,
+8368,8369,8370,8371,8372,8373,8374,8375,8376,8377,8378,8379,8380,8381,8382,8383,
+8384,8385,8386,8387,8388,8389,8390,8391,8392,8393,8394,8395,8396,8397,8398,8399,
+8400,8401,8402,8403,8404,8405,8406,8407,8408,8409,8410,8411,8412,8413,8414,8415,
+8416,8417,8418,8419,8420,8421,8422,8423,8424,8425,8426,8427,8428,8429,8430,8431,
+8432,8433,8434,8435,8436,8437,8438,8439,8440,8441,8442,8443,8444,8445,8446,8447,
+8448,8449,8450,8451,8452,8453,8454,8455,8456,8457,8458,8459,8460,8461,8462,8463,
+8464,8465,8466,8467,8468,8469,8470,8471,8472,8473,8474,8475,8476,8477,8478,8479,
+8480,8481,8482,8483,8484,8485,8486,8487,8488,8489,8490,8491,8492,8493,8494,8495,
+8496,8497,8498,8499,8500,8501,8502,8503,8504,8505,8506,8507,8508,8509,8510,8511,
+8512,8513,8514,8515,8516,8517,8518,8519,8520,8521,8522,8523,8524,8525,8526,8527,
+8528,8529,8530,8531,8532,8533,8534,8535,8536,8537,8538,8539,8540,8541,8542,8543,
+8544,8545,8546,8547,8548,8549,8550,8551,8552,8553,8554,8555,8556,8557,8558,8559,
+8560,8561,8562,8563,8564,8565,8566,8567,8568,8569,8570,8571,8572,8573,8574,8575,
+8576,8577,8578,8579,8580,8581,8582,8583,8584,8585,8586,8587,8588,8589,8590,8591,
+8592,8593,8594,8595,8596,8597,8598,8599,8600,8601,8602,8603,8604,8605,8606,8607,
+8608,8609,8610,8611,8612,8613,8614,8615,8616,8617,8618,8619,8620,8621,8622,8623,
+8624,8625,8626,8627,8628,8629,8630,8631,8632,8633,8634,8635,8636,8637,8638,8639,
+8640,8641,8642,8643,8644,8645,8646,8647,8648,8649,8650,8651,8652,8653,8654,8655,
+8656,8657,8658,8659,8660,8661,8662,8663,8664,8665,8666,8667,8668,8669,8670,8671,
+8672,8673,8674,8675,8676,8677,8678,8679,8680,8681,8682,8683,8684,8685,8686,8687,
+8688,8689,8690,8691,8692,8693,8694,8695,8696,8697,8698,8699,8700,8701,8702,8703,
+8704,8705,8706,8707,8708,8709,8710,8711,8712,8713,8714,8715,8716,8717,8718,8719,
+8720,8721,8722,8723,8724,8725,8726,8727,8728,8729,8730,8731,8732,8733,8734,8735,
+8736,8737,8738,8739,8740,8741)
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euckrprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euckrprober.py
new file mode 100644
index 0000000..5982a46
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euckrprober.py
@@ -0,0 +1,42 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .mbcharsetprober import MultiByteCharSetProber
+from .codingstatemachine import CodingStateMachine
+from .chardistribution import EUCKRDistributionAnalysis
+from .mbcssm import EUCKRSMModel
+
+
+class EUCKRProber(MultiByteCharSetProber):
+    def __init__(self):
+        MultiByteCharSetProber.__init__(self)
+        self._mCodingSM = CodingStateMachine(EUCKRSMModel)
+        self._mDistributionAnalyzer = EUCKRDistributionAnalysis()
+        self.reset()
+
+    def get_charset_name(self):
+        return "EUC-KR"
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euctwfreq.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euctwfreq.py
new file mode 100644
index 0000000..576e750
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euctwfreq.py
@@ -0,0 +1,428 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# EUCTW frequency table
+# Converted from big5 work
+# by Taiwan's Mandarin Promotion Council
+# <http:#www.edu.tw:81/mandr/>
+
+# 128  --> 0.42261
+# 256  --> 0.57851
+# 512  --> 0.74851
+# 1024 --> 0.89384
+# 2048 --> 0.97583
+#
+# Idea Distribution Ratio = 0.74851/(1-0.74851) =2.98
+# Random Distribution Ration = 512/(5401-512)=0.105
+#
+# Typical Distribution Ratio about 25% of Ideal one, still much higher than RDR
+
+EUCTW_TYPICAL_DISTRIBUTION_RATIO = 0.75
+
+# Char to FreqOrder table ,
+EUCTW_TABLE_SIZE = 8102
+
+EUCTWCharToFreqOrder = (
+   1,1800,1506, 255,1431, 198,   9,  82,   6,7310, 177, 202,3615,1256,2808, 110, # 2742
+3735,  33,3241, 261,  76,  44,2113,  16,2931,2184,1176, 659,3868,  26,3404,2643, # 2758
+1198,3869,3313,4060, 410,2211, 302, 590, 361,1963,   8, 204,  58,4296,7311,1931, # 2774
+  63,7312,7313, 317,1614,  75, 222, 159,4061,2412,1480,7314,3500,3068, 224,2809, # 2790
+3616,   3,  10,3870,1471,  29,2774,1135,2852,1939, 873, 130,3242,1123, 312,7315, # 2806
+4297,2051, 507, 252, 682,7316, 142,1914, 124, 206,2932,  34,3501,3173,  64, 604, # 2822
+7317,2494,1976,1977, 155,1990, 645, 641,1606,7318,3405, 337,  72, 406,7319,  80, # 2838
+ 630, 238,3174,1509, 263, 939,1092,2644, 756,1440,1094,3406, 449,  69,2969, 591, # 2854
+ 179,2095, 471, 115,2034,1843,  60,  50,2970, 134, 806,1868, 734,2035,3407, 180, # 2870
+ 995,1607, 156, 537,2893, 688,7320, 319,1305, 779,2144, 514,2374, 298,4298, 359, # 2886
+2495,  90,2707,1338, 663,  11, 906,1099,2545,  20,2436, 182, 532,1716,7321, 732, # 2902
+1376,4062,1311,1420,3175,  25,2312,1056, 113, 399, 382,1949, 242,3408,2467, 529, # 2918
+3243, 475,1447,3617,7322, 117,  21, 656, 810,1297,2295,2329,3502,7323, 126,4063, # 2934
+ 706, 456, 150, 613,4299,  71,1118,2036,4064, 145,3069,  85, 835, 486,2114,1246, # 2950
+1426, 428, 727,1285,1015, 800, 106, 623, 303,1281,7324,2127,2354, 347,3736, 221, # 2966
+3503,3110,7325,1955,1153,4065,  83, 296,1199,3070, 192, 624,  93,7326, 822,1897, # 2982
+2810,3111, 795,2064, 991,1554,1542,1592,  27,  43,2853, 859, 139,1456, 860,4300, # 2998
+ 437, 712,3871, 164,2392,3112, 695, 211,3017,2096, 195,3872,1608,3504,3505,3618, # 3014
+3873, 234, 811,2971,2097,3874,2229,1441,3506,1615,2375, 668,2076,1638, 305, 228, # 3030
+1664,4301, 467, 415,7327, 262,2098,1593, 239, 108, 300, 200,1033, 512,1247,2077, # 3046
+7328,7329,2173,3176,3619,2673, 593, 845,1062,3244,  88,1723,2037,3875,1950, 212, # 3062
+ 266, 152, 149, 468,1898,4066,4302,  77, 187,7330,3018,  37,   5,2972,7331,3876, # 3078
+7332,7333,  39,2517,4303,2894,3177,2078,  55, 148,  74,4304, 545, 483,1474,1029, # 3094
+1665, 217,1869,1531,3113,1104,2645,4067,  24, 172,3507, 900,3877,3508,3509,4305, # 3110
+  32,1408,2811,1312, 329, 487,2355,2247,2708, 784,2674,   4,3019,3314,1427,1788, # 3126
+ 188, 109, 499,7334,3620,1717,1789, 888,1217,3020,4306,7335,3510,7336,3315,1520, # 3142
+3621,3878, 196,1034, 775,7337,7338, 929,1815, 249, 439,  38,7339,1063,7340, 794, # 3158
+3879,1435,2296,  46, 178,3245,2065,7341,2376,7342, 214,1709,4307, 804,  35, 707, # 3174
+ 324,3622,1601,2546, 140, 459,4068,7343,7344,1365, 839, 272, 978,2257,2572,3409, # 3190
+2128,1363,3623,1423, 697, 100,3071,  48,  70,1231, 495,3114,2193,7345,1294,7346, # 3206
+2079, 462, 586,1042,3246, 853, 256, 988, 185,2377,3410,1698, 434,1084,7347,3411, # 3222
+ 314,2615,2775,4308,2330,2331, 569,2280, 637,1816,2518, 757,1162,1878,1616,3412, # 3238
+ 287,1577,2115, 768,4309,1671,2854,3511,2519,1321,3737, 909,2413,7348,4069, 933, # 3254
+3738,7349,2052,2356,1222,4310, 765,2414,1322, 786,4311,7350,1919,1462,1677,2895, # 3270
+1699,7351,4312,1424,2437,3115,3624,2590,3316,1774,1940,3413,3880,4070, 309,1369, # 3286
+1130,2812, 364,2230,1653,1299,3881,3512,3882,3883,2646, 525,1085,3021, 902,2000, # 3302
+1475, 964,4313, 421,1844,1415,1057,2281, 940,1364,3116, 376,4314,4315,1381,   7, # 3318
+2520, 983,2378, 336,1710,2675,1845, 321,3414, 559,1131,3022,2742,1808,1132,1313, # 3334
+ 265,1481,1857,7352, 352,1203,2813,3247, 167,1089, 420,2814, 776, 792,1724,3513, # 3350
+4071,2438,3248,7353,4072,7354, 446, 229, 333,2743, 901,3739,1200,1557,4316,2647, # 3366
+1920, 395,2744,2676,3740,4073,1835, 125, 916,3178,2616,4317,7355,7356,3741,7357, # 3382
+7358,7359,4318,3117,3625,1133,2547,1757,3415,1510,2313,1409,3514,7360,2145, 438, # 3398
+2591,2896,2379,3317,1068, 958,3023, 461, 311,2855,2677,4074,1915,3179,4075,1978, # 3414
+ 383, 750,2745,2617,4076, 274, 539, 385,1278,1442,7361,1154,1964, 384, 561, 210, # 3430
+  98,1295,2548,3515,7362,1711,2415,1482,3416,3884,2897,1257, 129,7363,3742, 642, # 3446
+ 523,2776,2777,2648,7364, 141,2231,1333,  68, 176, 441, 876, 907,4077, 603,2592, # 3462
+ 710, 171,3417, 404, 549,  18,3118,2393,1410,3626,1666,7365,3516,4319,2898,4320, # 3478
+7366,2973, 368,7367, 146, 366,  99, 871,3627,1543, 748, 807,1586,1185,  22,2258, # 3494
+ 379,3743,3180,7368,3181, 505,1941,2618,1991,1382,2314,7369, 380,2357, 218, 702, # 3510
+1817,1248,3418,3024,3517,3318,3249,7370,2974,3628, 930,3250,3744,7371,  59,7372, # 3526
+ 585, 601,4078, 497,3419,1112,1314,4321,1801,7373,1223,1472,2174,7374, 749,1836, # 3542
+ 690,1899,3745,1772,3885,1476, 429,1043,1790,2232,2116, 917,4079, 447,1086,1629, # 3558
+7375, 556,7376,7377,2020,1654, 844,1090, 105, 550, 966,1758,2815,1008,1782, 686, # 3574
+1095,7378,2282, 793,1602,7379,3518,2593,4322,4080,2933,2297,4323,3746, 980,2496, # 3590
+ 544, 353, 527,4324, 908,2678,2899,7380, 381,2619,1942,1348,7381,1341,1252, 560, # 3606
+3072,7382,3420,2856,7383,2053, 973, 886,2080, 143,4325,7384,7385, 157,3886, 496, # 3622
+4081,  57, 840, 540,2038,4326,4327,3421,2117,1445, 970,2259,1748,1965,2081,4082, # 3638
+3119,1234,1775,3251,2816,3629, 773,1206,2129,1066,2039,1326,3887,1738,1725,4083, # 3654
+ 279,3120,  51,1544,2594, 423,1578,2130,2066, 173,4328,1879,7386,7387,1583, 264, # 3670
+ 610,3630,4329,2439, 280, 154,7388,7389,7390,1739, 338,1282,3073, 693,2857,1411, # 3686
+1074,3747,2440,7391,4330,7392,7393,1240, 952,2394,7394,2900,1538,2679, 685,1483, # 3702
+4084,2468,1436, 953,4085,2054,4331, 671,2395,  79,4086,2441,3252, 608, 567,2680, # 3718
+3422,4087,4088,1691, 393,1261,1791,2396,7395,4332,7396,7397,7398,7399,1383,1672, # 3734
+3748,3182,1464, 522,1119, 661,1150, 216, 675,4333,3888,1432,3519, 609,4334,2681, # 3750
+2397,7400,7401,7402,4089,3025,   0,7403,2469, 315, 231,2442, 301,3319,4335,2380, # 3766
+7404, 233,4090,3631,1818,4336,4337,7405,  96,1776,1315,2082,7406, 257,7407,1809, # 3782
+3632,2709,1139,1819,4091,2021,1124,2163,2778,1777,2649,7408,3074, 363,1655,3183, # 3798
+7409,2975,7410,7411,7412,3889,1567,3890, 718, 103,3184, 849,1443, 341,3320,2934, # 3814
+1484,7413,1712, 127,  67, 339,4092,2398, 679,1412, 821,7414,7415, 834, 738, 351, # 3830
+2976,2146, 846, 235,1497,1880, 418,1992,3749,2710, 186,1100,2147,2746,3520,1545, # 3846
+1355,2935,2858,1377, 583,3891,4093,2573,2977,7416,1298,3633,1078,2549,3634,2358, # 3862
+  78,3750,3751, 267,1289,2099,2001,1594,4094, 348, 369,1274,2194,2175,1837,4338, # 3878
+1820,2817,3635,2747,2283,2002,4339,2936,2748, 144,3321, 882,4340,3892,2749,3423, # 3894
+4341,2901,7417,4095,1726, 320,7418,3893,3026, 788,2978,7419,2818,1773,1327,2859, # 3910
+3894,2819,7420,1306,4342,2003,1700,3752,3521,2359,2650, 787,2022, 506, 824,3636, # 3926
+ 534, 323,4343,1044,3322,2023,1900, 946,3424,7421,1778,1500,1678,7422,1881,4344, # 3942
+ 165, 243,4345,3637,2521, 123, 683,4096, 764,4346,  36,3895,1792, 589,2902, 816, # 3958
+ 626,1667,3027,2233,1639,1555,1622,3753,3896,7423,3897,2860,1370,1228,1932, 891, # 3974
+2083,2903, 304,4097,7424, 292,2979,2711,3522, 691,2100,4098,1115,4347, 118, 662, # 3990
+7425, 611,1156, 854,2381,1316,2861,   2, 386, 515,2904,7426,7427,3253, 868,2234, # 4006
+1486, 855,2651, 785,2212,3028,7428,1040,3185,3523,7429,3121, 448,7430,1525,7431, # 4022
+2164,4348,7432,3754,7433,4099,2820,3524,3122, 503, 818,3898,3123,1568, 814, 676, # 4038
+1444, 306,1749,7434,3755,1416,1030, 197,1428, 805,2821,1501,4349,7435,7436,7437, # 4054
+1993,7438,4350,7439,7440,2195,  13,2779,3638,2980,3124,1229,1916,7441,3756,2131, # 4070
+7442,4100,4351,2399,3525,7443,2213,1511,1727,1120,7444,7445, 646,3757,2443, 307, # 4086
+7446,7447,1595,3186,7448,7449,7450,3639,1113,1356,3899,1465,2522,2523,7451, 519, # 4102
+7452, 128,2132,  92,2284,1979,7453,3900,1512, 342,3125,2196,7454,2780,2214,1980, # 4118
+3323,7455, 290,1656,1317, 789, 827,2360,7456,3758,4352, 562, 581,3901,7457, 401, # 4134
+4353,2248,  94,4354,1399,2781,7458,1463,2024,4355,3187,1943,7459, 828,1105,4101, # 4150
+1262,1394,7460,4102, 605,4356,7461,1783,2862,7462,2822, 819,2101, 578,2197,2937, # 4166
+7463,1502, 436,3254,4103,3255,2823,3902,2905,3425,3426,7464,2712,2315,7465,7466, # 4182
+2332,2067,  23,4357, 193, 826,3759,2102, 699,1630,4104,3075, 390,1793,1064,3526, # 4198
+7467,1579,3076,3077,1400,7468,4105,1838,1640,2863,7469,4358,4359, 137,4106, 598, # 4214
+3078,1966, 780, 104, 974,2938,7470, 278, 899, 253, 402, 572, 504, 493,1339,7471, # 4230
+3903,1275,4360,2574,2550,7472,3640,3029,3079,2249, 565,1334,2713, 863,  41,7473, # 4246
+7474,4361,7475,1657,2333,  19, 463,2750,4107, 606,7476,2981,3256,1087,2084,1323, # 4262
+2652,2982,7477,1631,1623,1750,4108,2682,7478,2864, 791,2714,2653,2334, 232,2416, # 4278
+7479,2983,1498,7480,2654,2620, 755,1366,3641,3257,3126,2025,1609, 119,1917,3427, # 4294
+ 862,1026,4109,7481,3904,3760,4362,3905,4363,2260,1951,2470,7482,1125, 817,4110, # 4310
+4111,3906,1513,1766,2040,1487,4112,3030,3258,2824,3761,3127,7483,7484,1507,7485, # 4326
+2683, 733,  40,1632,1106,2865, 345,4113, 841,2524, 230,4364,2984,1846,3259,3428, # 4342
+7486,1263, 986,3429,7487, 735, 879, 254,1137, 857, 622,1300,1180,1388,1562,3907, # 4358
+3908,2939, 967,2751,2655,1349, 592,2133,1692,3324,2985,1994,4114,1679,3909,1901, # 4374
+2185,7488, 739,3642,2715,1296,1290,7489,4115,2198,2199,1921,1563,2595,2551,1870, # 4390
+2752,2986,7490, 435,7491, 343,1108, 596,  17,1751,4365,2235,3430,3643,7492,4366, # 4406
+ 294,3527,2940,1693, 477, 979, 281,2041,3528, 643,2042,3644,2621,2782,2261,1031, # 4422
+2335,2134,2298,3529,4367, 367,1249,2552,7493,3530,7494,4368,1283,3325,2004, 240, # 4438
+1762,3326,4369,4370, 836,1069,3128, 474,7495,2148,2525, 268,3531,7496,3188,1521, # 4454
+1284,7497,1658,1546,4116,7498,3532,3533,7499,4117,3327,2684,1685,4118, 961,1673, # 4470
+2622, 190,2005,2200,3762,4371,4372,7500, 570,2497,3645,1490,7501,4373,2623,3260, # 4486
+1956,4374, 584,1514, 396,1045,1944,7502,4375,1967,2444,7503,7504,4376,3910, 619, # 4502
+7505,3129,3261, 215,2006,2783,2553,3189,4377,3190,4378, 763,4119,3763,4379,7506, # 4518
+7507,1957,1767,2941,3328,3646,1174, 452,1477,4380,3329,3130,7508,2825,1253,2382, # 4534
+2186,1091,2285,4120, 492,7509, 638,1169,1824,2135,1752,3911, 648, 926,1021,1324, # 4550
+4381, 520,4382, 997, 847,1007, 892,4383,3764,2262,1871,3647,7510,2400,1784,4384, # 4566
+1952,2942,3080,3191,1728,4121,2043,3648,4385,2007,1701,3131,1551,  30,2263,4122, # 4582
+7511,2026,4386,3534,7512, 501,7513,4123, 594,3431,2165,1821,3535,3432,3536,3192, # 4598
+ 829,2826,4124,7514,1680,3132,1225,4125,7515,3262,4387,4126,3133,2336,7516,4388, # 4614
+4127,7517,3912,3913,7518,1847,2383,2596,3330,7519,4389, 374,3914, 652,4128,4129, # 4630
+ 375,1140, 798,7520,7521,7522,2361,4390,2264, 546,1659, 138,3031,2445,4391,7523, # 4646
+2250, 612,1848, 910, 796,3765,1740,1371, 825,3766,3767,7524,2906,2554,7525, 692, # 4662
+ 444,3032,2624, 801,4392,4130,7526,1491, 244,1053,3033,4131,4132, 340,7527,3915, # 4678
+1041,2987, 293,1168,  87,1357,7528,1539, 959,7529,2236, 721, 694,4133,3768, 219, # 4694
+1478, 644,1417,3331,2656,1413,1401,1335,1389,3916,7530,7531,2988,2362,3134,1825, # 4710
+ 730,1515, 184,2827,  66,4393,7532,1660,2943, 246,3332, 378,1457, 226,3433, 975, # 4726
+3917,2944,1264,3537, 674, 696,7533, 163,7534,1141,2417,2166, 713,3538,3333,4394, # 4742
+3918,7535,7536,1186,  15,7537,1079,1070,7538,1522,3193,3539, 276,1050,2716, 758, # 4758
+1126, 653,2945,3263,7539,2337, 889,3540,3919,3081,2989, 903,1250,4395,3920,3434, # 4774
+3541,1342,1681,1718, 766,3264, 286,  89,2946,3649,7540,1713,7541,2597,3334,2990, # 4790
+7542,2947,2215,3194,2866,7543,4396,2498,2526, 181, 387,1075,3921, 731,2187,3335, # 4806
+7544,3265, 310, 313,3435,2299, 770,4134,  54,3034, 189,4397,3082,3769,3922,7545, # 4822
+1230,1617,1849, 355,3542,4135,4398,3336, 111,4136,3650,1350,3135,3436,3035,4137, # 4838
+2149,3266,3543,7546,2784,3923,3924,2991, 722,2008,7547,1071, 247,1207,2338,2471, # 4854
+1378,4399,2009, 864,1437,1214,4400, 373,3770,1142,2216, 667,4401, 442,2753,2555, # 4870
+3771,3925,1968,4138,3267,1839, 837, 170,1107, 934,1336,1882,7548,7549,2118,4139, # 4886
+2828, 743,1569,7550,4402,4140, 582,2384,1418,3437,7551,1802,7552, 357,1395,1729, # 4902
+3651,3268,2418,1564,2237,7553,3083,3772,1633,4403,1114,2085,4141,1532,7554, 482, # 4918
+2446,4404,7555,7556,1492, 833,1466,7557,2717,3544,1641,2829,7558,1526,1272,3652, # 4934
+4142,1686,1794, 416,2556,1902,1953,1803,7559,3773,2785,3774,1159,2316,7560,2867, # 4950
+4405,1610,1584,3036,2419,2754, 443,3269,1163,3136,7561,7562,3926,7563,4143,2499, # 4966
+3037,4406,3927,3137,2103,1647,3545,2010,1872,4144,7564,4145, 431,3438,7565, 250, # 4982
+  97,  81,4146,7566,1648,1850,1558, 160, 848,7567, 866, 740,1694,7568,2201,2830, # 4998
+3195,4147,4407,3653,1687, 950,2472, 426, 469,3196,3654,3655,3928,7569,7570,1188, # 5014
+ 424,1995, 861,3546,4148,3775,2202,2685, 168,1235,3547,4149,7571,2086,1674,4408, # 5030
+3337,3270, 220,2557,1009,7572,3776, 670,2992, 332,1208, 717,7573,7574,3548,2447, # 5046
+3929,3338,7575, 513,7576,1209,2868,3339,3138,4409,1080,7577,7578,7579,7580,2527, # 5062
+3656,3549, 815,1587,3930,3931,7581,3550,3439,3777,1254,4410,1328,3038,1390,3932, # 5078
+1741,3933,3778,3934,7582, 236,3779,2448,3271,7583,7584,3657,3780,1273,3781,4411, # 5094
+7585, 308,7586,4412, 245,4413,1851,2473,1307,2575, 430, 715,2136,2449,7587, 270, # 5110
+ 199,2869,3935,7588,3551,2718,1753, 761,1754, 725,1661,1840,4414,3440,3658,7589, # 5126
+7590, 587,  14,3272, 227,2598, 326, 480,2265, 943,2755,3552, 291, 650,1883,7591, # 5142
+1702,1226, 102,1547,  62,3441, 904,4415,3442,1164,4150,7592,7593,1224,1548,2756, # 5158
+ 391, 498,1493,7594,1386,1419,7595,2055,1177,4416, 813, 880,1081,2363, 566,1145, # 5174
+4417,2286,1001,1035,2558,2599,2238, 394,1286,7596,7597,2068,7598,  86,1494,1730, # 5190
+3936, 491,1588, 745, 897,2948, 843,3340,3937,2757,2870,3273,1768, 998,2217,2069, # 5206
+ 397,1826,1195,1969,3659,2993,3341, 284,7599,3782,2500,2137,2119,1903,7600,3938, # 5222
+2150,3939,4151,1036,3443,1904, 114,2559,4152, 209,1527,7601,7602,2949,2831,2625, # 5238
+2385,2719,3139, 812,2560,7603,3274,7604,1559, 737,1884,3660,1210, 885,  28,2686, # 5254
+3553,3783,7605,4153,1004,1779,4418,7606, 346,1981,2218,2687,4419,3784,1742, 797, # 5270
+1642,3940,1933,1072,1384,2151, 896,3941,3275,3661,3197,2871,3554,7607,2561,1958, # 5286
+4420,2450,1785,7608,7609,7610,3942,4154,1005,1308,3662,4155,2720,4421,4422,1528, # 5302
+2600, 161,1178,4156,1982, 987,4423,1101,4157, 631,3943,1157,3198,2420,1343,1241, # 5318
+1016,2239,2562, 372, 877,2339,2501,1160, 555,1934, 911,3944,7611, 466,1170, 169, # 5334
+1051,2907,2688,3663,2474,2994,1182,2011,2563,1251,2626,7612, 992,2340,3444,1540, # 5350
+2721,1201,2070,2401,1996,2475,7613,4424, 528,1922,2188,1503,1873,1570,2364,3342, # 5366
+3276,7614, 557,1073,7615,1827,3445,2087,2266,3140,3039,3084, 767,3085,2786,4425, # 5382
+1006,4158,4426,2341,1267,2176,3664,3199, 778,3945,3200,2722,1597,2657,7616,4427, # 5398
+7617,3446,7618,7619,7620,3277,2689,1433,3278, 131,  95,1504,3946, 723,4159,3141, # 5414
+1841,3555,2758,2189,3947,2027,2104,3665,7621,2995,3948,1218,7622,3343,3201,3949, # 5430
+4160,2576, 248,1634,3785, 912,7623,2832,3666,3040,3786, 654,  53,7624,2996,7625, # 5446
+1688,4428, 777,3447,1032,3950,1425,7626, 191, 820,2120,2833, 971,4429, 931,3202, # 5462
+ 135, 664, 783,3787,1997, 772,2908,1935,3951,3788,4430,2909,3203, 282,2723, 640, # 5478
+1372,3448,1127, 922, 325,3344,7627,7628, 711,2044,7629,7630,3952,2219,2787,1936, # 5494
+3953,3345,2220,2251,3789,2300,7631,4431,3790,1258,3279,3954,3204,2138,2950,3955, # 5510
+3956,7632,2221, 258,3205,4432, 101,1227,7633,3280,1755,7634,1391,3281,7635,2910, # 5526
+2056, 893,7636,7637,7638,1402,4161,2342,7639,7640,3206,3556,7641,7642, 878,1325, # 5542
+1780,2788,4433, 259,1385,2577, 744,1183,2267,4434,7643,3957,2502,7644, 684,1024, # 5558
+4162,7645, 472,3557,3449,1165,3282,3958,3959, 322,2152, 881, 455,1695,1152,1340, # 5574
+ 660, 554,2153,4435,1058,4436,4163, 830,1065,3346,3960,4437,1923,7646,1703,1918, # 5590
+7647, 932,2268, 122,7648,4438, 947, 677,7649,3791,2627, 297,1905,1924,2269,4439, # 5606
+2317,3283,7650,7651,4164,7652,4165,  84,4166, 112, 989,7653, 547,1059,3961, 701, # 5622
+3558,1019,7654,4167,7655,3450, 942, 639, 457,2301,2451, 993,2951, 407, 851, 494, # 5638
+4440,3347, 927,7656,1237,7657,2421,3348, 573,4168, 680, 921,2911,1279,1874, 285, # 5654
+ 790,1448,1983, 719,2167,7658,7659,4441,3962,3963,1649,7660,1541, 563,7661,1077, # 5670
+7662,3349,3041,3451, 511,2997,3964,3965,3667,3966,1268,2564,3350,3207,4442,4443, # 5686
+7663, 535,1048,1276,1189,2912,2028,3142,1438,1373,2834,2952,1134,2012,7664,4169, # 5702
+1238,2578,3086,1259,7665, 700,7666,2953,3143,3668,4170,7667,4171,1146,1875,1906, # 5718
+4444,2601,3967, 781,2422, 132,1589, 203, 147, 273,2789,2402, 898,1786,2154,3968, # 5734
+3969,7668,3792,2790,7669,7670,4445,4446,7671,3208,7672,1635,3793, 965,7673,1804, # 5750
+2690,1516,3559,1121,1082,1329,3284,3970,1449,3794,  65,1128,2835,2913,2759,1590, # 5766
+3795,7674,7675,  12,2658,  45, 976,2579,3144,4447, 517,2528,1013,1037,3209,7676, # 5782
+3796,2836,7677,3797,7678,3452,7679,2602, 614,1998,2318,3798,3087,2724,2628,7680, # 5798
+2580,4172, 599,1269,7681,1810,3669,7682,2691,3088, 759,1060, 489,1805,3351,3285, # 5814
+1358,7683,7684,2386,1387,1215,2629,2252, 490,7685,7686,4173,1759,2387,2343,7687, # 5830
+4448,3799,1907,3971,2630,1806,3210,4449,3453,3286,2760,2344, 874,7688,7689,3454, # 5846
+3670,1858,  91,2914,3671,3042,3800,4450,7690,3145,3972,2659,7691,3455,1202,1403, # 5862
+3801,2954,2529,1517,2503,4451,3456,2504,7692,4452,7693,2692,1885,1495,1731,3973, # 5878
+2365,4453,7694,2029,7695,7696,3974,2693,1216, 237,2581,4174,2319,3975,3802,4454, # 5894
+4455,2694,3560,3457, 445,4456,7697,7698,7699,7700,2761,  61,3976,3672,1822,3977, # 5910
+7701, 687,2045, 935, 925, 405,2660, 703,1096,1859,2725,4457,3978,1876,1367,2695, # 5926
+3352, 918,2105,1781,2476, 334,3287,1611,1093,4458, 564,3146,3458,3673,3353, 945, # 5942
+2631,2057,4459,7702,1925, 872,4175,7703,3459,2696,3089, 349,4176,3674,3979,4460, # 5958
+3803,4177,3675,2155,3980,4461,4462,4178,4463,2403,2046, 782,3981, 400, 251,4179, # 5974
+1624,7704,7705, 277,3676, 299,1265, 476,1191,3804,2121,4180,4181,1109, 205,7706, # 5990
+2582,1000,2156,3561,1860,7707,7708,7709,4464,7710,4465,2565, 107,2477,2157,3982, # 6006
+3460,3147,7711,1533, 541,1301, 158, 753,4182,2872,3562,7712,1696, 370,1088,4183, # 6022
+4466,3563, 579, 327, 440, 162,2240, 269,1937,1374,3461, 968,3043,  56,1396,3090, # 6038
+2106,3288,3354,7713,1926,2158,4467,2998,7714,3564,7715,7716,3677,4468,2478,7717, # 6054
+2791,7718,1650,4469,7719,2603,7720,7721,3983,2661,3355,1149,3356,3984,3805,3985, # 6070
+7722,1076,  49,7723, 951,3211,3289,3290, 450,2837, 920,7724,1811,2792,2366,4184, # 6086
+1908,1138,2367,3806,3462,7725,3212,4470,1909,1147,1518,2423,4471,3807,7726,4472, # 6102
+2388,2604, 260,1795,3213,7727,7728,3808,3291, 708,7729,3565,1704,7730,3566,1351, # 6118
+1618,3357,2999,1886, 944,4185,3358,4186,3044,3359,4187,7731,3678, 422, 413,1714, # 6134
+3292, 500,2058,2345,4188,2479,7732,1344,1910, 954,7733,1668,7734,7735,3986,2404, # 6150
+4189,3567,3809,4190,7736,2302,1318,2505,3091, 133,3092,2873,4473, 629,  31,2838, # 6166
+2697,3810,4474, 850, 949,4475,3987,2955,1732,2088,4191,1496,1852,7737,3988, 620, # 6182
+3214, 981,1242,3679,3360,1619,3680,1643,3293,2139,2452,1970,1719,3463,2168,7738, # 6198
+3215,7739,7740,3361,1828,7741,1277,4476,1565,2047,7742,1636,3568,3093,7743, 869, # 6214
+2839, 655,3811,3812,3094,3989,3000,3813,1310,3569,4477,7744,7745,7746,1733, 558, # 6230
+4478,3681, 335,1549,3045,1756,4192,3682,1945,3464,1829,1291,1192, 470,2726,2107, # 6246
+2793, 913,1054,3990,7747,1027,7748,3046,3991,4479, 982,2662,3362,3148,3465,3216, # 6262
+3217,1946,2794,7749, 571,4480,7750,1830,7751,3570,2583,1523,2424,7752,2089, 984, # 6278
+4481,3683,1959,7753,3684, 852, 923,2795,3466,3685, 969,1519, 999,2048,2320,1705, # 6294
+7754,3095, 615,1662, 151, 597,3992,2405,2321,1049, 275,4482,3686,4193, 568,3687, # 6310
+3571,2480,4194,3688,7755,2425,2270, 409,3218,7756,1566,2874,3467,1002, 769,2840, # 6326
+ 194,2090,3149,3689,2222,3294,4195, 628,1505,7757,7758,1763,2177,3001,3993, 521, # 6342
+1161,2584,1787,2203,2406,4483,3994,1625,4196,4197, 412,  42,3096, 464,7759,2632, # 6358
+4484,3363,1760,1571,2875,3468,2530,1219,2204,3814,2633,2140,2368,4485,4486,3295, # 6374
+1651,3364,3572,7760,7761,3573,2481,3469,7762,3690,7763,7764,2271,2091, 460,7765, # 6390
+4487,7766,3002, 962, 588,3574, 289,3219,2634,1116,  52,7767,3047,1796,7768,7769, # 6406
+7770,1467,7771,1598,1143,3691,4198,1984,1734,1067,4488,1280,3365, 465,4489,1572, # 6422
+ 510,7772,1927,2241,1812,1644,3575,7773,4490,3692,7774,7775,2663,1573,1534,7776, # 6438
+7777,4199, 536,1807,1761,3470,3815,3150,2635,7778,7779,7780,4491,3471,2915,1911, # 6454
+2796,7781,3296,1122, 377,3220,7782, 360,7783,7784,4200,1529, 551,7785,2059,3693, # 6470
+1769,2426,7786,2916,4201,3297,3097,2322,2108,2030,4492,1404, 136,1468,1479, 672, # 6486
+1171,3221,2303, 271,3151,7787,2762,7788,2049, 678,2727, 865,1947,4493,7789,2013, # 6502
+3995,2956,7790,2728,2223,1397,3048,3694,4494,4495,1735,2917,3366,3576,7791,3816, # 6518
+ 509,2841,2453,2876,3817,7792,7793,3152,3153,4496,4202,2531,4497,2304,1166,1010, # 6534
+ 552, 681,1887,7794,7795,2957,2958,3996,1287,1596,1861,3154, 358, 453, 736, 175, # 6550
+ 478,1117, 905,1167,1097,7796,1853,1530,7797,1706,7798,2178,3472,2287,3695,3473, # 6566
+3577,4203,2092,4204,7799,3367,1193,2482,4205,1458,2190,2205,1862,1888,1421,3298, # 6582
+2918,3049,2179,3474, 595,2122,7800,3997,7801,7802,4206,1707,2636, 223,3696,1359, # 6598
+ 751,3098, 183,3475,7803,2797,3003, 419,2369, 633, 704,3818,2389, 241,7804,7805, # 6614
+7806, 838,3004,3697,2272,2763,2454,3819,1938,2050,3998,1309,3099,2242,1181,7807, # 6630
+1136,2206,3820,2370,1446,4207,2305,4498,7808,7809,4208,1055,2605, 484,3698,7810, # 6646
+3999, 625,4209,2273,3368,1499,4210,4000,7811,4001,4211,3222,2274,2275,3476,7812, # 6662
+7813,2764, 808,2606,3699,3369,4002,4212,3100,2532, 526,3370,3821,4213, 955,7814, # 6678
+1620,4214,2637,2427,7815,1429,3700,1669,1831, 994, 928,7816,3578,1260,7817,7818, # 6694
+7819,1948,2288, 741,2919,1626,4215,2729,2455, 867,1184, 362,3371,1392,7820,7821, # 6710
+4003,4216,1770,1736,3223,2920,4499,4500,1928,2698,1459,1158,7822,3050,3372,2877, # 6726
+1292,1929,2506,2842,3701,1985,1187,2071,2014,2607,4217,7823,2566,2507,2169,3702, # 6742
+2483,3299,7824,3703,4501,7825,7826, 666,1003,3005,1022,3579,4218,7827,4502,1813, # 6758
+2253, 574,3822,1603, 295,1535, 705,3823,4219, 283, 858, 417,7828,7829,3224,4503, # 6774
+4504,3051,1220,1889,1046,2276,2456,4004,1393,1599, 689,2567, 388,4220,7830,2484, # 6790
+ 802,7831,2798,3824,2060,1405,2254,7832,4505,3825,2109,1052,1345,3225,1585,7833, # 6806
+ 809,7834,7835,7836, 575,2730,3477, 956,1552,1469,1144,2323,7837,2324,1560,2457, # 6822
+3580,3226,4005, 616,2207,3155,2180,2289,7838,1832,7839,3478,4506,7840,1319,3704, # 6838
+3705,1211,3581,1023,3227,1293,2799,7841,7842,7843,3826, 607,2306,3827, 762,2878, # 6854
+1439,4221,1360,7844,1485,3052,7845,4507,1038,4222,1450,2061,2638,4223,1379,4508, # 6870
+2585,7846,7847,4224,1352,1414,2325,2921,1172,7848,7849,3828,3829,7850,1797,1451, # 6886
+7851,7852,7853,7854,2922,4006,4007,2485,2346, 411,4008,4009,3582,3300,3101,4509, # 6902
+1561,2664,1452,4010,1375,7855,7856,  47,2959, 316,7857,1406,1591,2923,3156,7858, # 6918
+1025,2141,3102,3157, 354,2731, 884,2224,4225,2407, 508,3706, 726,3583, 996,2428, # 6934
+3584, 729,7859, 392,2191,1453,4011,4510,3707,7860,7861,2458,3585,2608,1675,2800, # 6950
+ 919,2347,2960,2348,1270,4511,4012,  73,7862,7863, 647,7864,3228,2843,2255,1550, # 6966
+1346,3006,7865,1332, 883,3479,7866,7867,7868,7869,3301,2765,7870,1212, 831,1347, # 6982
+4226,4512,2326,3830,1863,3053, 720,3831,4513,4514,3832,7871,4227,7872,7873,4515, # 6998
+7874,7875,1798,4516,3708,2609,4517,3586,1645,2371,7876,7877,2924, 669,2208,2665, # 7014
+2429,7878,2879,7879,7880,1028,3229,7881,4228,2408,7882,2256,1353,7883,7884,4518, # 7030
+3158, 518,7885,4013,7886,4229,1960,7887,2142,4230,7888,7889,3007,2349,2350,3833, # 7046
+ 516,1833,1454,4014,2699,4231,4519,2225,2610,1971,1129,3587,7890,2766,7891,2961, # 7062
+1422, 577,1470,3008,1524,3373,7892,7893, 432,4232,3054,3480,7894,2586,1455,2508, # 7078
+2226,1972,1175,7895,1020,2732,4015,3481,4520,7896,2733,7897,1743,1361,3055,3482, # 7094
+2639,4016,4233,4521,2290, 895, 924,4234,2170, 331,2243,3056, 166,1627,3057,1098, # 7110
+7898,1232,2880,2227,3374,4522, 657, 403,1196,2372, 542,3709,3375,1600,4235,3483, # 7126
+7899,4523,2767,3230, 576, 530,1362,7900,4524,2533,2666,3710,4017,7901, 842,3834, # 7142
+7902,2801,2031,1014,4018, 213,2700,3376, 665, 621,4236,7903,3711,2925,2430,7904, # 7158
+2431,3302,3588,3377,7905,4237,2534,4238,4525,3589,1682,4239,3484,1380,7906, 724, # 7174
+2277, 600,1670,7907,1337,1233,4526,3103,2244,7908,1621,4527,7909, 651,4240,7910, # 7190
+1612,4241,2611,7911,2844,7912,2734,2307,3058,7913, 716,2459,3059, 174,1255,2701, # 7206
+4019,3590, 548,1320,1398, 728,4020,1574,7914,1890,1197,3060,4021,7915,3061,3062, # 7222
+3712,3591,3713, 747,7916, 635,4242,4528,7917,7918,7919,4243,7920,7921,4529,7922, # 7238
+3378,4530,2432, 451,7923,3714,2535,2072,4244,2735,4245,4022,7924,1764,4531,7925, # 7254
+4246, 350,7926,2278,2390,2486,7927,4247,4023,2245,1434,4024, 488,4532, 458,4248, # 7270
+4025,3715, 771,1330,2391,3835,2568,3159,2159,2409,1553,2667,3160,4249,7928,2487, # 7286
+2881,2612,1720,2702,4250,3379,4533,7929,2536,4251,7930,3231,4252,2768,7931,2015, # 7302
+2736,7932,1155,1017,3716,3836,7933,3303,2308, 201,1864,4253,1430,7934,4026,7935, # 7318
+7936,7937,7938,7939,4254,1604,7940, 414,1865, 371,2587,4534,4535,3485,2016,3104, # 7334
+4536,1708, 960,4255, 887, 389,2171,1536,1663,1721,7941,2228,4027,2351,2926,1580, # 7350
+7942,7943,7944,1744,7945,2537,4537,4538,7946,4539,7947,2073,7948,7949,3592,3380, # 7366
+2882,4256,7950,4257,2640,3381,2802, 673,2703,2460, 709,3486,4028,3593,4258,7951, # 7382
+1148, 502, 634,7952,7953,1204,4540,3594,1575,4541,2613,3717,7954,3718,3105, 948, # 7398
+3232, 121,1745,3837,1110,7955,4259,3063,2509,3009,4029,3719,1151,1771,3838,1488, # 7414
+4030,1986,7956,2433,3487,7957,7958,2093,7959,4260,3839,1213,1407,2803, 531,2737, # 7430
+2538,3233,1011,1537,7960,2769,4261,3106,1061,7961,3720,3721,1866,2883,7962,2017, # 7446
+ 120,4262,4263,2062,3595,3234,2309,3840,2668,3382,1954,4542,7963,7964,3488,1047, # 7462
+2704,1266,7965,1368,4543,2845, 649,3383,3841,2539,2738,1102,2846,2669,7966,7967, # 7478
+1999,7968,1111,3596,2962,7969,2488,3842,3597,2804,1854,3384,3722,7970,7971,3385, # 7494
+2410,2884,3304,3235,3598,7972,2569,7973,3599,2805,4031,1460, 856,7974,3600,7975, # 7510
+2885,2963,7976,2886,3843,7977,4264, 632,2510, 875,3844,1697,3845,2291,7978,7979, # 7526
+4544,3010,1239, 580,4545,4265,7980, 914, 936,2074,1190,4032,1039,2123,7981,7982, # 7542
+7983,3386,1473,7984,1354,4266,3846,7985,2172,3064,4033, 915,3305,4267,4268,3306, # 7558
+1605,1834,7986,2739, 398,3601,4269,3847,4034, 328,1912,2847,4035,3848,1331,4270, # 7574
+3011, 937,4271,7987,3602,4036,4037,3387,2160,4546,3388, 524, 742, 538,3065,1012, # 7590
+7988,7989,3849,2461,7990, 658,1103, 225,3850,7991,7992,4547,7993,4548,7994,3236, # 7606
+1243,7995,4038, 963,2246,4549,7996,2705,3603,3161,7997,7998,2588,2327,7999,4550, # 7622
+8000,8001,8002,3489,3307, 957,3389,2540,2032,1930,2927,2462, 870,2018,3604,1746, # 7638
+2770,2771,2434,2463,8003,3851,8004,3723,3107,3724,3490,3390,3725,8005,1179,3066, # 7654
+8006,3162,2373,4272,3726,2541,3163,3108,2740,4039,8007,3391,1556,2542,2292, 977, # 7670
+2887,2033,4040,1205,3392,8008,1765,3393,3164,2124,1271,1689, 714,4551,3491,8009, # 7686
+2328,3852, 533,4273,3605,2181, 617,8010,2464,3308,3492,2310,8011,8012,3165,8013, # 7702
+8014,3853,1987, 618, 427,2641,3493,3394,8015,8016,1244,1690,8017,2806,4274,4552, # 7718
+8018,3494,8019,8020,2279,1576, 473,3606,4275,3395, 972,8021,3607,8022,3067,8023, # 7734
+8024,4553,4554,8025,3727,4041,4042,8026, 153,4555, 356,8027,1891,2888,4276,2143, # 7750
+ 408, 803,2352,8028,3854,8029,4277,1646,2570,2511,4556,4557,3855,8030,3856,4278, # 7766
+8031,2411,3396, 752,8032,8033,1961,2964,8034, 746,3012,2465,8035,4279,3728, 698, # 7782
+4558,1892,4280,3608,2543,4559,3609,3857,8036,3166,3397,8037,1823,1302,4043,2706, # 7798
+3858,1973,4281,8038,4282,3167, 823,1303,1288,1236,2848,3495,4044,3398, 774,3859, # 7814
+8039,1581,4560,1304,2849,3860,4561,8040,2435,2161,1083,3237,4283,4045,4284, 344, # 7830
+1173, 288,2311, 454,1683,8041,8042,1461,4562,4046,2589,8043,8044,4563, 985, 894, # 7846
+8045,3399,3168,8046,1913,2928,3729,1988,8047,2110,1974,8048,4047,8049,2571,1194, # 7862
+ 425,8050,4564,3169,1245,3730,4285,8051,8052,2850,8053, 636,4565,1855,3861, 760, # 7878
+1799,8054,4286,2209,1508,4566,4048,1893,1684,2293,8055,8056,8057,4287,4288,2210, # 7894
+ 479,8058,8059, 832,8060,4049,2489,8061,2965,2490,3731, 990,3109, 627,1814,2642, # 7910
+4289,1582,4290,2125,2111,3496,4567,8062, 799,4291,3170,8063,4568,2112,1737,3013, # 7926
+1018, 543, 754,4292,3309,1676,4569,4570,4050,8064,1489,8065,3497,8066,2614,2889, # 7942
+4051,8067,8068,2966,8069,8070,8071,8072,3171,4571,4572,2182,1722,8073,3238,3239, # 7958
+1842,3610,1715, 481, 365,1975,1856,8074,8075,1962,2491,4573,8076,2126,3611,3240, # 7974
+ 433,1894,2063,2075,8077, 602,2741,8078,8079,8080,8081,8082,3014,1628,3400,8083, # 7990
+3172,4574,4052,2890,4575,2512,8084,2544,2772,8085,8086,8087,3310,4576,2891,8088, # 8006
+4577,8089,2851,4578,4579,1221,2967,4053,2513,8090,8091,8092,1867,1989,8093,8094, # 8022
+8095,1895,8096,8097,4580,1896,4054, 318,8098,2094,4055,4293,8099,8100, 485,8101, # 8038
+ 938,3862, 553,2670, 116,8102,3863,3612,8103,3498,2671,2773,3401,3311,2807,8104, # 8054
+3613,2929,4056,1747,2930,2968,8105,8106, 207,8107,8108,2672,4581,2514,8109,3015, # 8070
+ 890,3614,3864,8110,1877,3732,3402,8111,2183,2353,3403,1652,8112,8113,8114, 941, # 8086
+2294, 208,3499,4057,2019, 330,4294,3865,2892,2492,3733,4295,8115,8116,8117,8118, # 8102
+#Everything below is of no interest for detection purpose
+2515,1613,4582,8119,3312,3866,2516,8120,4058,8121,1637,4059,2466,4583,3867,8122, # 8118
+2493,3016,3734,8123,8124,2192,8125,8126,2162,8127,8128,8129,8130,8131,8132,8133, # 8134
+8134,8135,8136,8137,8138,8139,8140,8141,8142,8143,8144,8145,8146,8147,8148,8149, # 8150
+8150,8151,8152,8153,8154,8155,8156,8157,8158,8159,8160,8161,8162,8163,8164,8165, # 8166
+8166,8167,8168,8169,8170,8171,8172,8173,8174,8175,8176,8177,8178,8179,8180,8181, # 8182
+8182,8183,8184,8185,8186,8187,8188,8189,8190,8191,8192,8193,8194,8195,8196,8197, # 8198
+8198,8199,8200,8201,8202,8203,8204,8205,8206,8207,8208,8209,8210,8211,8212,8213, # 8214
+8214,8215,8216,8217,8218,8219,8220,8221,8222,8223,8224,8225,8226,8227,8228,8229, # 8230
+8230,8231,8232,8233,8234,8235,8236,8237,8238,8239,8240,8241,8242,8243,8244,8245, # 8246
+8246,8247,8248,8249,8250,8251,8252,8253,8254,8255,8256,8257,8258,8259,8260,8261, # 8262
+8262,8263,8264,8265,8266,8267,8268,8269,8270,8271,8272,8273,8274,8275,8276,8277, # 8278
+8278,8279,8280,8281,8282,8283,8284,8285,8286,8287,8288,8289,8290,8291,8292,8293, # 8294
+8294,8295,8296,8297,8298,8299,8300,8301,8302,8303,8304,8305,8306,8307,8308,8309, # 8310
+8310,8311,8312,8313,8314,8315,8316,8317,8318,8319,8320,8321,8322,8323,8324,8325, # 8326
+8326,8327,8328,8329,8330,8331,8332,8333,8334,8335,8336,8337,8338,8339,8340,8341, # 8342
+8342,8343,8344,8345,8346,8347,8348,8349,8350,8351,8352,8353,8354,8355,8356,8357, # 8358
+8358,8359,8360,8361,8362,8363,8364,8365,8366,8367,8368,8369,8370,8371,8372,8373, # 8374
+8374,8375,8376,8377,8378,8379,8380,8381,8382,8383,8384,8385,8386,8387,8388,8389, # 8390
+8390,8391,8392,8393,8394,8395,8396,8397,8398,8399,8400,8401,8402,8403,8404,8405, # 8406
+8406,8407,8408,8409,8410,8411,8412,8413,8414,8415,8416,8417,8418,8419,8420,8421, # 8422
+8422,8423,8424,8425,8426,8427,8428,8429,8430,8431,8432,8433,8434,8435,8436,8437, # 8438
+8438,8439,8440,8441,8442,8443,8444,8445,8446,8447,8448,8449,8450,8451,8452,8453, # 8454
+8454,8455,8456,8457,8458,8459,8460,8461,8462,8463,8464,8465,8466,8467,8468,8469, # 8470
+8470,8471,8472,8473,8474,8475,8476,8477,8478,8479,8480,8481,8482,8483,8484,8485, # 8486
+8486,8487,8488,8489,8490,8491,8492,8493,8494,8495,8496,8497,8498,8499,8500,8501, # 8502
+8502,8503,8504,8505,8506,8507,8508,8509,8510,8511,8512,8513,8514,8515,8516,8517, # 8518
+8518,8519,8520,8521,8522,8523,8524,8525,8526,8527,8528,8529,8530,8531,8532,8533, # 8534
+8534,8535,8536,8537,8538,8539,8540,8541,8542,8543,8544,8545,8546,8547,8548,8549, # 8550
+8550,8551,8552,8553,8554,8555,8556,8557,8558,8559,8560,8561,8562,8563,8564,8565, # 8566
+8566,8567,8568,8569,8570,8571,8572,8573,8574,8575,8576,8577,8578,8579,8580,8581, # 8582
+8582,8583,8584,8585,8586,8587,8588,8589,8590,8591,8592,8593,8594,8595,8596,8597, # 8598
+8598,8599,8600,8601,8602,8603,8604,8605,8606,8607,8608,8609,8610,8611,8612,8613, # 8614
+8614,8615,8616,8617,8618,8619,8620,8621,8622,8623,8624,8625,8626,8627,8628,8629, # 8630
+8630,8631,8632,8633,8634,8635,8636,8637,8638,8639,8640,8641,8642,8643,8644,8645, # 8646
+8646,8647,8648,8649,8650,8651,8652,8653,8654,8655,8656,8657,8658,8659,8660,8661, # 8662
+8662,8663,8664,8665,8666,8667,8668,8669,8670,8671,8672,8673,8674,8675,8676,8677, # 8678
+8678,8679,8680,8681,8682,8683,8684,8685,8686,8687,8688,8689,8690,8691,8692,8693, # 8694
+8694,8695,8696,8697,8698,8699,8700,8701,8702,8703,8704,8705,8706,8707,8708,8709, # 8710
+8710,8711,8712,8713,8714,8715,8716,8717,8718,8719,8720,8721,8722,8723,8724,8725, # 8726
+8726,8727,8728,8729,8730,8731,8732,8733,8734,8735,8736,8737,8738,8739,8740,8741) # 8742
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euctwprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euctwprober.py
new file mode 100644
index 0000000..fe652fe
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/euctwprober.py
@@ -0,0 +1,41 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+# 
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+# 
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .mbcharsetprober import MultiByteCharSetProber
+from .codingstatemachine import CodingStateMachine
+from .chardistribution import EUCTWDistributionAnalysis
+from .mbcssm import EUCTWSMModel
+
+class EUCTWProber(MultiByteCharSetProber):
+    def __init__(self):
+        MultiByteCharSetProber.__init__(self)
+        self._mCodingSM = CodingStateMachine(EUCTWSMModel)
+        self._mDistributionAnalyzer = EUCTWDistributionAnalysis()
+        self.reset()
+
+    def get_charset_name(self):
+        return "EUC-TW"
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/gb2312freq.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/gb2312freq.py
new file mode 100644
index 0000000..1238f51
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/gb2312freq.py
@@ -0,0 +1,472 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# GB2312 most frequently used character table
+#
+# Char to FreqOrder table , from hz6763
+
+# 512  --> 0.79  -- 0.79
+# 1024 --> 0.92  -- 0.13
+# 2048 --> 0.98  -- 0.06
+# 6768 --> 1.00  -- 0.02
+#
+# Ideal Distribution Ratio = 0.79135/(1-0.79135) = 3.79
+# Random Distribution Ration = 512 / (3755 - 512) = 0.157
+#
+# Typical Distribution Ratio about 25% of Ideal one, still much higher that RDR
+
+GB2312_TYPICAL_DISTRIBUTION_RATIO = 0.9
+
+GB2312_TABLE_SIZE = 3760
+
+GB2312CharToFreqOrder = (
+1671, 749,1443,2364,3924,3807,2330,3921,1704,3463,2691,1511,1515, 572,3191,2205,
+2361, 224,2558, 479,1711, 963,3162, 440,4060,1905,2966,2947,3580,2647,3961,3842,
+2204, 869,4207, 970,2678,5626,2944,2956,1479,4048, 514,3595, 588,1346,2820,3409,
+ 249,4088,1746,1873,2047,1774, 581,1813, 358,1174,3590,1014,1561,4844,2245, 670,
+1636,3112, 889,1286, 953, 556,2327,3060,1290,3141, 613, 185,3477,1367, 850,3820,
+1715,2428,2642,2303,2732,3041,2562,2648,3566,3946,1349, 388,3098,2091,1360,3585,
+ 152,1687,1539, 738,1559,  59,1232,2925,2267,1388,1249,1741,1679,2960, 151,1566,
+1125,1352,4271, 924,4296, 385,3166,4459, 310,1245,2850,  70,3285,2729,3534,3575,
+2398,3298,3466,1960,2265, 217,3647, 864,1909,2084,4401,2773,1010,3269,5152, 853,
+3051,3121,1244,4251,1895, 364,1499,1540,2313,1180,3655,2268, 562, 715,2417,3061,
+ 544, 336,3768,2380,1752,4075, 950, 280,2425,4382, 183,2759,3272, 333,4297,2155,
+1688,2356,1444,1039,4540, 736,1177,3349,2443,2368,2144,2225, 565, 196,1482,3406,
+ 927,1335,4147, 692, 878,1311,1653,3911,3622,1378,4200,1840,2969,3149,2126,1816,
+2534,1546,2393,2760, 737,2494,  13, 447, 245,2747,  38,2765,2129,2589,1079, 606,
+ 360, 471,3755,2890, 404, 848, 699,1785,1236, 370,2221,1023,3746,2074,2026,2023,
+2388,1581,2119, 812,1141,3091,2536,1519, 804,2053, 406,1596,1090, 784, 548,4414,
+1806,2264,2936,1100, 343,4114,5096, 622,3358, 743,3668,1510,1626,5020,3567,2513,
+3195,4115,5627,2489,2991,  24,2065,2697,1087,2719,  48,1634, 315,  68, 985,2052,
+ 198,2239,1347,1107,1439, 597,2366,2172, 871,3307, 919,2487,2790,1867, 236,2570,
+1413,3794, 906,3365,3381,1701,1982,1818,1524,2924,1205, 616,2586,2072,2004, 575,
+ 253,3099,  32,1365,1182, 197,1714,2454,1201, 554,3388,3224,2748, 756,2587, 250,
+2567,1507,1517,3529,1922,2761,2337,3416,1961,1677,2452,2238,3153, 615, 911,1506,
+1474,2495,1265,1906,2749,3756,3280,2161, 898,2714,1759,3450,2243,2444, 563,  26,
+3286,2266,3769,3344,2707,3677, 611,1402, 531,1028,2871,4548,1375, 261,2948, 835,
+1190,4134, 353, 840,2684,1900,3082,1435,2109,1207,1674, 329,1872,2781,4055,2686,
+2104, 608,3318,2423,2957,2768,1108,3739,3512,3271,3985,2203,1771,3520,1418,2054,
+1681,1153, 225,1627,2929, 162,2050,2511,3687,1954, 124,1859,2431,1684,3032,2894,
+ 585,4805,3969,2869,2704,2088,2032,2095,3656,2635,4362,2209, 256, 518,2042,2105,
+3777,3657, 643,2298,1148,1779, 190, 989,3544, 414,  11,2135,2063,2979,1471, 403,
+3678, 126, 770,1563, 671,2499,3216,2877, 600,1179, 307,2805,4937,1268,1297,2694,
+ 252,4032,1448,1494,1331,1394, 127,2256, 222,1647,1035,1481,3056,1915,1048, 873,
+3651, 210,  33,1608,2516, 200,1520, 415, 102,   0,3389,1287, 817,  91,3299,2940,
+ 836,1814, 549,2197,1396,1669,2987,3582,2297,2848,4528,1070, 687,  20,1819, 121,
+1552,1364,1461,1968,2617,3540,2824,2083, 177, 948,4938,2291, 110,4549,2066, 648,
+3359,1755,2110,2114,4642,4845,1693,3937,3308,1257,1869,2123, 208,1804,3159,2992,
+2531,2549,3361,2418,1350,2347,2800,2568,1291,2036,2680,  72, 842,1990, 212,1233,
+1154,1586,  75,2027,3410,4900,1823,1337,2710,2676, 728,2810,1522,3026,4995, 157,
+ 755,1050,4022, 710, 785,1936,2194,2085,1406,2777,2400, 150,1250,4049,1206, 807,
+1910, 534, 529,3309,1721,1660, 274,  39,2827, 661,2670,1578, 925,3248,3815,1094,
+4278,4901,4252,  41,1150,3747,2572,2227,4501,3658,4902,3813,3357,3617,2884,2258,
+ 887, 538,4187,3199,1294,2439,3042,2329,2343,2497,1255, 107, 543,1527, 521,3478,
+3568, 194,5062,  15, 961,3870,1241,1192,2664,  66,5215,3260,2111,1295,1127,2152,
+3805,4135, 901,1164,1976, 398,1278, 530,1460, 748, 904,1054,1966,1426,  53,2909,
+ 509, 523,2279,1534, 536,1019, 239,1685, 460,2353, 673,1065,2401,3600,4298,2272,
+1272,2363, 284,1753,3679,4064,1695,  81, 815,2677,2757,2731,1386, 859, 500,4221,
+2190,2566, 757,1006,2519,2068,1166,1455, 337,2654,3203,1863,1682,1914,3025,1252,
+1409,1366, 847, 714,2834,2038,3209, 964,2970,1901, 885,2553,1078,1756,3049, 301,
+1572,3326, 688,2130,1996,2429,1805,1648,2930,3421,2750,3652,3088, 262,1158,1254,
+ 389,1641,1812, 526,1719, 923,2073,1073,1902, 468, 489,4625,1140, 857,2375,3070,
+3319,2863, 380, 116,1328,2693,1161,2244, 273,1212,1884,2769,3011,1775,1142, 461,
+3066,1200,2147,2212, 790, 702,2695,4222,1601,1058, 434,2338,5153,3640,  67,2360,
+4099,2502, 618,3472,1329, 416,1132, 830,2782,1807,2653,3211,3510,1662, 192,2124,
+ 296,3979,1739,1611,3684,  23, 118, 324, 446,1239,1225, 293,2520,3814,3795,2535,
+3116,  17,1074, 467,2692,2201, 387,2922,  45,1326,3055,1645,3659,2817, 958, 243,
+1903,2320,1339,2825,1784,3289, 356, 576, 865,2315,2381,3377,3916,1088,3122,1713,
+1655, 935, 628,4689,1034,1327, 441, 800, 720, 894,1979,2183,1528,5289,2702,1071,
+4046,3572,2399,1571,3281,  79, 761,1103, 327, 134, 758,1899,1371,1615, 879, 442,
+ 215,2605,2579, 173,2048,2485,1057,2975,3317,1097,2253,3801,4263,1403,1650,2946,
+ 814,4968,3487,1548,2644,1567,1285,   2, 295,2636,  97, 946,3576, 832, 141,4257,
+3273, 760,3821,3521,3156,2607, 949,1024,1733,1516,1803,1920,2125,2283,2665,3180,
+1501,2064,3560,2171,1592, 803,3518,1416, 732,3897,4258,1363,1362,2458, 119,1427,
+ 602,1525,2608,1605,1639,3175, 694,3064,  10, 465,  76,2000,4846,4208, 444,3781,
+1619,3353,2206,1273,3796, 740,2483, 320,1723,2377,3660,2619,1359,1137,1762,1724,
+2345,2842,1850,1862, 912, 821,1866, 612,2625,1735,2573,3369,1093, 844,  89, 937,
+ 930,1424,3564,2413,2972,1004,3046,3019,2011, 711,3171,1452,4178, 428, 801,1943,
+ 432, 445,2811, 206,4136,1472, 730, 349,  73, 397,2802,2547, 998,1637,1167, 789,
+ 396,3217, 154,1218, 716,1120,1780,2819,4826,1931,3334,3762,2139,1215,2627, 552,
+3664,3628,3232,1405,2383,3111,1356,2652,3577,3320,3101,1703, 640,1045,1370,1246,
+4996, 371,1575,2436,1621,2210, 984,4033,1734,2638,  16,4529, 663,2755,3255,1451,
+3917,2257,1253,1955,2234,1263,2951, 214,1229, 617, 485, 359,1831,1969, 473,2310,
+ 750,2058, 165,  80,2864,2419, 361,4344,2416,2479,1134, 796,3726,1266,2943, 860,
+2715, 938, 390,2734,1313,1384, 248, 202, 877,1064,2854, 522,3907, 279,1602, 297,
+2357, 395,3740, 137,2075, 944,4089,2584,1267,3802,  62,1533,2285, 178, 176, 780,
+2440, 201,3707, 590, 478,1560,4354,2117,1075,  30,  74,4643,4004,1635,1441,2745,
+ 776,2596, 238,1077,1692,1912,2844, 605, 499,1742,3947, 241,3053, 980,1749, 936,
+2640,4511,2582, 515,1543,2162,5322,2892,2993, 890,2148,1924, 665,1827,3581,1032,
+ 968,3163, 339,1044,1896, 270, 583,1791,1720,4367,1194,3488,3669,  43,2523,1657,
+ 163,2167, 290,1209,1622,3378, 550, 634,2508,2510, 695,2634,2384,2512,1476,1414,
+ 220,1469,2341,2138,2852,3183,2900,4939,2865,3502,1211,3680, 854,3227,1299,2976,
+3172, 186,2998,1459, 443,1067,3251,1495, 321,1932,3054, 909, 753,1410,1828, 436,
+2441,1119,1587,3164,2186,1258, 227, 231,1425,1890,3200,3942, 247, 959, 725,5254,
+2741, 577,2158,2079, 929, 120, 174, 838,2813, 591,1115, 417,2024,  40,3240,1536,
+1037, 291,4151,2354, 632,1298,2406,2500,3535,1825,1846,3451, 205,1171, 345,4238,
+  18,1163, 811, 685,2208,1217, 425,1312,1508,1175,4308,2552,1033, 587,1381,3059,
+2984,3482, 340,1316,4023,3972, 792,3176, 519, 777,4690, 918, 933,4130,2981,3741,
+  90,3360,2911,2200,5184,4550, 609,3079,2030, 272,3379,2736, 363,3881,1130,1447,
+ 286, 779, 357,1169,3350,3137,1630,1220,2687,2391, 747,1277,3688,2618,2682,2601,
+1156,3196,5290,4034,3102,1689,3596,3128, 874, 219,2783, 798, 508,1843,2461, 269,
+1658,1776,1392,1913,2983,3287,2866,2159,2372, 829,4076,  46,4253,2873,1889,1894,
+ 915,1834,1631,2181,2318, 298, 664,2818,3555,2735, 954,3228,3117, 527,3511,2173,
+ 681,2712,3033,2247,2346,3467,1652, 155,2164,3382, 113,1994, 450, 899, 494, 994,
+1237,2958,1875,2336,1926,3727, 545,1577,1550, 633,3473, 204,1305,3072,2410,1956,
+2471, 707,2134, 841,2195,2196,2663,3843,1026,4940, 990,3252,4997, 368,1092, 437,
+3212,3258,1933,1829, 675,2977,2893, 412, 943,3723,4644,3294,3283,2230,2373,5154,
+2389,2241,2661,2323,1404,2524, 593, 787, 677,3008,1275,2059, 438,2709,2609,2240,
+2269,2246,1446,  36,1568,1373,3892,1574,2301,1456,3962, 693,2276,5216,2035,1143,
+2720,1919,1797,1811,2763,4137,2597,1830,1699,1488,1198,2090, 424,1694, 312,3634,
+3390,4179,3335,2252,1214, 561,1059,3243,2295,2561, 975,5155,2321,2751,3772, 472,
+1537,3282,3398,1047,2077,2348,2878,1323,3340,3076, 690,2906,  51, 369, 170,3541,
+1060,2187,2688,3670,2541,1083,1683, 928,3918, 459, 109,4427, 599,3744,4286, 143,
+2101,2730,2490,  82,1588,3036,2121, 281,1860, 477,4035,1238,2812,3020,2716,3312,
+1530,2188,2055,1317, 843, 636,1808,1173,3495, 649, 181,1002, 147,3641,1159,2414,
+3750,2289,2795, 813,3123,2610,1136,4368,   5,3391,4541,2174, 420, 429,1728, 754,
+1228,2115,2219, 347,2223,2733, 735,1518,3003,2355,3134,1764,3948,3329,1888,2424,
+1001,1234,1972,3321,3363,1672,1021,1450,1584, 226, 765, 655,2526,3404,3244,2302,
+3665, 731, 594,2184, 319,1576, 621, 658,2656,4299,2099,3864,1279,2071,2598,2739,
+ 795,3086,3699,3908,1707,2352,2402,1382,3136,2475,1465,4847,3496,3865,1085,3004,
+2591,1084, 213,2287,1963,3565,2250, 822, 793,4574,3187,1772,1789,3050, 595,1484,
+1959,2770,1080,2650, 456, 422,2996, 940,3322,4328,4345,3092,2742, 965,2784, 739,
+4124, 952,1358,2498,2949,2565, 332,2698,2378, 660,2260,2473,4194,3856,2919, 535,
+1260,2651,1208,1428,1300,1949,1303,2942, 433,2455,2450,1251,1946, 614,1269, 641,
+1306,1810,2737,3078,2912, 564,2365,1419,1415,1497,4460,2367,2185,1379,3005,1307,
+3218,2175,1897,3063, 682,1157,4040,4005,1712,1160,1941,1399, 394, 402,2952,1573,
+1151,2986,2404, 862, 299,2033,1489,3006, 346, 171,2886,3401,1726,2932, 168,2533,
+  47,2507,1030,3735,1145,3370,1395,1318,1579,3609,4560,2857,4116,1457,2529,1965,
+ 504,1036,2690,2988,2405, 745,5871, 849,2397,2056,3081, 863,2359,3857,2096,  99,
+1397,1769,2300,4428,1643,3455,1978,1757,3718,1440,  35,4879,3742,1296,4228,2280,
+ 160,5063,1599,2013, 166, 520,3479,1646,3345,3012, 490,1937,1545,1264,2182,2505,
+1096,1188,1369,1436,2421,1667,2792,2460,1270,2122, 727,3167,2143, 806,1706,1012,
+1800,3037, 960,2218,1882, 805, 139,2456,1139,1521, 851,1052,3093,3089, 342,2039,
+ 744,5097,1468,1502,1585,2087, 223, 939, 326,2140,2577, 892,2481,1623,4077, 982,
+3708, 135,2131,  87,2503,3114,2326,1106, 876,1616, 547,2997,2831,2093,3441,4530,
+4314,   9,3256,4229,4148, 659,1462,1986,1710,2046,2913,2231,4090,4880,5255,3392,
+3274,1368,3689,4645,1477, 705,3384,3635,1068,1529,2941,1458,3782,1509, 100,1656,
+2548, 718,2339, 408,1590,2780,3548,1838,4117,3719,1345,3530, 717,3442,2778,3220,
+2898,1892,4590,3614,3371,2043,1998,1224,3483, 891, 635, 584,2559,3355, 733,1766,
+1729,1172,3789,1891,2307, 781,2982,2271,1957,1580,5773,2633,2005,4195,3097,1535,
+3213,1189,1934,5693,3262, 586,3118,1324,1598, 517,1564,2217,1868,1893,4445,3728,
+2703,3139,1526,1787,1992,3882,2875,1549,1199,1056,2224,1904,2711,5098,4287, 338,
+1993,3129,3489,2689,1809,2815,1997, 957,1855,3898,2550,3275,3057,1105,1319, 627,
+1505,1911,1883,3526, 698,3629,3456,1833,1431, 746,  77,1261,2017,2296,1977,1885,
+ 125,1334,1600, 525,1798,1109,2222,1470,1945, 559,2236,1186,3443,2476,1929,1411,
+2411,3135,1777,3372,2621,1841,1613,3229, 668,1430,1839,2643,2916, 195,1989,2671,
+2358,1387, 629,3205,2293,5256,4439, 123,1310, 888,1879,4300,3021,3605,1003,1162,
+3192,2910,2010, 140,2395,2859,  55,1082,2012,2901, 662, 419,2081,1438, 680,2774,
+4654,3912,1620,1731,1625,5035,4065,2328, 512,1344, 802,5443,2163,2311,2537, 524,
+3399,  98,1155,2103,1918,2606,3925,2816,1393,2465,1504,3773,2177,3963,1478,4346,
+ 180,1113,4655,3461,2028,1698, 833,2696,1235,1322,1594,4408,3623,3013,3225,2040,
+3022, 541,2881, 607,3632,2029,1665,1219, 639,1385,1686,1099,2803,3231,1938,3188,
+2858, 427, 676,2772,1168,2025, 454,3253,2486,3556, 230,1950, 580, 791,1991,1280,
+1086,1974,2034, 630, 257,3338,2788,4903,1017,  86,4790, 966,2789,1995,1696,1131,
+ 259,3095,4188,1308, 179,1463,5257, 289,4107,1248,  42,3413,1725,2288, 896,1947,
+ 774,4474,4254, 604,3430,4264, 392,2514,2588, 452, 237,1408,3018, 988,4531,1970,
+3034,3310, 540,2370,1562,1288,2990, 502,4765,1147,   4,1853,2708, 207, 294,2814,
+4078,2902,2509, 684,  34,3105,3532,2551, 644, 709,2801,2344, 573,1727,3573,3557,
+2021,1081,3100,4315,2100,3681, 199,2263,1837,2385, 146,3484,1195,2776,3949, 997,
+1939,3973,1008,1091,1202,1962,1847,1149,4209,5444,1076, 493, 117,5400,2521, 972,
+1490,2934,1796,4542,2374,1512,2933,2657, 413,2888,1135,2762,2314,2156,1355,2369,
+ 766,2007,2527,2170,3124,2491,2593,2632,4757,2437, 234,3125,3591,1898,1750,1376,
+1942,3468,3138, 570,2127,2145,3276,4131, 962, 132,1445,4196,  19, 941,3624,3480,
+3366,1973,1374,4461,3431,2629, 283,2415,2275, 808,2887,3620,2112,2563,1353,3610,
+ 955,1089,3103,1053,  96,  88,4097, 823,3808,1583, 399, 292,4091,3313, 421,1128,
+ 642,4006, 903,2539,1877,2082, 596,  29,4066,1790, 722,2157, 130, 995,1569, 769,
+1485, 464, 513,2213, 288,1923,1101,2453,4316, 133, 486,2445,  50, 625, 487,2207,
+  57, 423, 481,2962, 159,3729,1558, 491, 303, 482, 501, 240,2837, 112,3648,2392,
+1783, 362,   8,3433,3422, 610,2793,3277,1390,1284,1654,  21,3823, 734, 367, 623,
+ 193, 287, 374,1009,1483, 816, 476, 313,2255,2340,1262,2150,2899,1146,2581, 782,
+2116,1659,2018,1880, 255,3586,3314,1110,2867,2137,2564, 986,2767,5185,2006, 650,
+ 158, 926, 762, 881,3157,2717,2362,3587, 306,3690,3245,1542,3077,2427,1691,2478,
+2118,2985,3490,2438, 539,2305, 983, 129,1754, 355,4201,2386, 827,2923, 104,1773,
+2838,2771, 411,2905,3919, 376, 767, 122,1114, 828,2422,1817,3506, 266,3460,1007,
+1609,4998, 945,2612,4429,2274, 726,1247,1964,2914,2199,2070,4002,4108, 657,3323,
+1422, 579, 455,2764,4737,1222,2895,1670, 824,1223,1487,2525, 558, 861,3080, 598,
+2659,2515,1967, 752,2583,2376,2214,4180, 977, 704,2464,4999,2622,4109,1210,2961,
+ 819,1541, 142,2284,  44, 418, 457,1126,3730,4347,4626,1644,1876,3671,1864, 302,
+1063,5694, 624, 723,1984,3745,1314,1676,2488,1610,1449,3558,3569,2166,2098, 409,
+1011,2325,3704,2306, 818,1732,1383,1824,1844,3757, 999,2705,3497,1216,1423,2683,
+2426,2954,2501,2726,2229,1475,2554,5064,1971,1794,1666,2014,1343, 783, 724, 191,
+2434,1354,2220,5065,1763,2752,2472,4152, 131, 175,2885,3434,  92,1466,4920,2616,
+3871,3872,3866, 128,1551,1632, 669,1854,3682,4691,4125,1230, 188,2973,3290,1302,
+1213, 560,3266, 917, 763,3909,3249,1760, 868,1958, 764,1782,2097, 145,2277,3774,
+4462,  64,1491,3062, 971,2132,3606,2442, 221,1226,1617, 218, 323,1185,3207,3147,
+ 571, 619,1473,1005,1744,2281, 449,1887,2396,3685, 275, 375,3816,1743,3844,3731,
+ 845,1983,2350,4210,1377, 773, 967,3499,3052,3743,2725,4007,1697,1022,3943,1464,
+3264,2855,2722,1952,1029,2839,2467,  84,4383,2215, 820,1391,2015,2448,3672, 377,
+1948,2168, 797,2545,3536,2578,2645,  94,2874,1678, 405,1259,3071, 771, 546,1315,
+ 470,1243,3083, 895,2468, 981, 969,2037, 846,4181, 653,1276,2928,  14,2594, 557,
+3007,2474, 156, 902,1338,1740,2574, 537,2518, 973,2282,2216,2433,1928, 138,2903,
+1293,2631,1612, 646,3457, 839,2935, 111, 496,2191,2847, 589,3186, 149,3994,2060,
+4031,2641,4067,3145,1870,  37,3597,2136,1025,2051,3009,3383,3549,1121,1016,3261,
+1301, 251,2446,2599,2153, 872,3246, 637, 334,3705, 831, 884, 921,3065,3140,4092,
+2198,1944, 246,2964, 108,2045,1152,1921,2308,1031, 203,3173,4170,1907,3890, 810,
+1401,2003,1690, 506, 647,1242,2828,1761,1649,3208,2249,1589,3709,2931,5156,1708,
+ 498, 666,2613, 834,3817,1231, 184,2851,1124, 883,3197,2261,3710,1765,1553,2658,
+1178,2639,2351,  93,1193, 942,2538,2141,4402, 235,1821, 870,1591,2192,1709,1871,
+3341,1618,4126,2595,2334, 603, 651,  69, 701, 268,2662,3411,2555,1380,1606, 503,
+ 448, 254,2371,2646, 574,1187,2309,1770, 322,2235,1292,1801, 305, 566,1133, 229,
+2067,2057, 706, 167, 483,2002,2672,3295,1820,3561,3067, 316, 378,2746,3452,1112,
+ 136,1981, 507,1651,2917,1117, 285,4591, 182,2580,3522,1304, 335,3303,1835,2504,
+1795,1792,2248, 674,1018,2106,2449,1857,2292,2845, 976,3047,1781,2600,2727,1389,
+1281,  52,3152, 153, 265,3950, 672,3485,3951,4463, 430,1183, 365, 278,2169,  27,
+1407,1336,2304, 209,1340,1730,2202,1852,2403,2883, 979,1737,1062, 631,2829,2542,
+3876,2592, 825,2086,2226,3048,3625, 352,1417,3724, 542, 991, 431,1351,3938,1861,
+2294, 826,1361,2927,3142,3503,1738, 463,2462,2723, 582,1916,1595,2808, 400,3845,
+3891,2868,3621,2254,  58,2492,1123, 910,2160,2614,1372,1603,1196,1072,3385,1700,
+3267,1980, 696, 480,2430, 920, 799,1570,2920,1951,2041,4047,2540,1321,4223,2469,
+3562,2228,1271,2602, 401,2833,3351,2575,5157, 907,2312,1256, 410, 263,3507,1582,
+ 996, 678,1849,2316,1480, 908,3545,2237, 703,2322, 667,1826,2849,1531,2604,2999,
+2407,3146,2151,2630,1786,3711, 469,3542, 497,3899,2409, 858, 837,4446,3393,1274,
+ 786, 620,1845,2001,3311, 484, 308,3367,1204,1815,3691,2332,1532,2557,1842,2020,
+2724,1927,2333,4440, 567,  22,1673,2728,4475,1987,1858,1144,1597, 101,1832,3601,
+  12, 974,3783,4391, 951,1412,   1,3720, 453,4608,4041, 528,1041,1027,3230,2628,
+1129, 875,1051,3291,1203,2262,1069,2860,2799,2149,2615,3278, 144,1758,3040,  31,
+ 475,1680, 366,2685,3184, 311,1642,4008,2466,5036,1593,1493,2809, 216,1420,1668,
+ 233, 304,2128,3284, 232,1429,1768,1040,2008,3407,2740,2967,2543, 242,2133, 778,
+1565,2022,2620, 505,2189,2756,1098,2273, 372,1614, 708, 553,2846,2094,2278, 169,
+3626,2835,4161, 228,2674,3165, 809,1454,1309, 466,1705,1095, 900,3423, 880,2667,
+3751,5258,2317,3109,2571,4317,2766,1503,1342, 866,4447,1118,  63,2076, 314,1881,
+1348,1061, 172, 978,3515,1747, 532, 511,3970,   6, 601, 905,2699,3300,1751, 276,
+1467,3725,2668,  65,4239,2544,2779,2556,1604, 578,2451,1802, 992,2331,2624,1320,
+3446, 713,1513,1013, 103,2786,2447,1661, 886,1702, 916, 654,3574,2031,1556, 751,
+2178,2821,2179,1498,1538,2176, 271, 914,2251,2080,1325, 638,1953,2937,3877,2432,
+2754,  95,3265,1716, 260,1227,4083, 775, 106,1357,3254, 426,1607, 555,2480, 772,
+1985, 244,2546, 474, 495,1046,2611,1851,2061,  71,2089,1675,2590, 742,3758,2843,
+3222,1433, 267,2180,2576,2826,2233,2092,3913,2435, 956,1745,3075, 856,2113,1116,
+ 451,   3,1988,2896,1398, 993,2463,1878,2049,1341,2718,2721,2870,2108, 712,2904,
+4363,2753,2324, 277,2872,2349,2649, 384, 987, 435, 691,3000, 922, 164,3939, 652,
+1500,1184,4153,2482,3373,2165,4848,2335,3775,3508,3154,2806,2830,1554,2102,1664,
+2530,1434,2408, 893,1547,2623,3447,2832,2242,2532,3169,2856,3223,2078,  49,3770,
+3469, 462, 318, 656,2259,3250,3069, 679,1629,2758, 344,1138,1104,3120,1836,1283,
+3115,2154,1437,4448, 934, 759,1999, 794,2862,1038, 533,2560,1722,2342, 855,2626,
+1197,1663,4476,3127,  85,4240,2528,  25,1111,1181,3673, 407,3470,4561,2679,2713,
+ 768,1925,2841,3986,1544,1165, 932, 373,1240,2146,1930,2673, 721,4766, 354,4333,
+ 391,2963, 187,  61,3364,1442,1102, 330,1940,1767, 341,3809,4118, 393,2496,2062,
+2211, 105, 331, 300, 439, 913,1332, 626, 379,3304,1557, 328, 689,3952, 309,1555,
+ 931, 317,2517,3027, 325, 569, 686,2107,3084,  60,1042,1333,2794, 264,3177,4014,
+1628, 258,3712,   7,4464,1176,1043,1778, 683, 114,1975,  78,1492, 383,1886, 510,
+ 386, 645,5291,2891,2069,3305,4138,3867,2939,2603,2493,1935,1066,1848,3588,1015,
+1282,1289,4609, 697,1453,3044,2666,3611,1856,2412,  54, 719,1330, 568,3778,2459,
+1748, 788, 492, 551,1191,1000, 488,3394,3763, 282,1799, 348,2016,1523,3155,2390,
+1049, 382,2019,1788,1170, 729,2968,3523, 897,3926,2785,2938,3292, 350,2319,3238,
+1718,1717,2655,3453,3143,4465, 161,2889,2980,2009,1421,  56,1908,1640,2387,2232,
+1917,1874,2477,4921, 148,  83,3438, 592,4245,2882,1822,1055, 741, 115,1496,1624,
+ 381,1638,4592,1020, 516,3214, 458, 947,4575,1432, 211,1514,2926,1865,2142, 189,
+ 852,1221,1400,1486, 882,2299,4036, 351,  28,1122, 700,6479,6480,6481,6482,6483,  # last 512
+#Everything below is of no interest for detection purpose
+5508,6484,3900,3414,3974,4441,4024,3537,4037,5628,5099,3633,6485,3148,6486,3636,
+5509,3257,5510,5973,5445,5872,4941,4403,3174,4627,5873,6276,2286,4230,5446,5874,
+5122,6102,6103,4162,5447,5123,5323,4849,6277,3980,3851,5066,4246,5774,5067,6278,
+3001,2807,5695,3346,5775,5974,5158,5448,6487,5975,5976,5776,3598,6279,5696,4806,
+4211,4154,6280,6488,6489,6490,6281,4212,5037,3374,4171,6491,4562,4807,4722,4827,
+5977,6104,4532,4079,5159,5324,5160,4404,3858,5359,5875,3975,4288,4610,3486,4512,
+5325,3893,5360,6282,6283,5560,2522,4231,5978,5186,5449,2569,3878,6284,5401,3578,
+4415,6285,4656,5124,5979,2506,4247,4449,3219,3417,4334,4969,4329,6492,4576,4828,
+4172,4416,4829,5402,6286,3927,3852,5361,4369,4830,4477,4867,5876,4173,6493,6105,
+4657,6287,6106,5877,5450,6494,4155,4868,5451,3700,5629,4384,6288,6289,5878,3189,
+4881,6107,6290,6495,4513,6496,4692,4515,4723,5100,3356,6497,6291,3810,4080,5561,
+3570,4430,5980,6498,4355,5697,6499,4724,6108,6109,3764,4050,5038,5879,4093,3226,
+6292,5068,5217,4693,3342,5630,3504,4831,4377,4466,4309,5698,4431,5777,6293,5778,
+4272,3706,6110,5326,3752,4676,5327,4273,5403,4767,5631,6500,5699,5880,3475,5039,
+6294,5562,5125,4348,4301,4482,4068,5126,4593,5700,3380,3462,5981,5563,3824,5404,
+4970,5511,3825,4738,6295,6501,5452,4516,6111,5881,5564,6502,6296,5982,6503,4213,
+4163,3454,6504,6112,4009,4450,6113,4658,6297,6114,3035,6505,6115,3995,4904,4739,
+4563,4942,4110,5040,3661,3928,5362,3674,6506,5292,3612,4791,5565,4149,5983,5328,
+5259,5021,4725,4577,4564,4517,4364,6298,5405,4578,5260,4594,4156,4157,5453,3592,
+3491,6507,5127,5512,4709,4922,5984,5701,4726,4289,6508,4015,6116,5128,4628,3424,
+4241,5779,6299,4905,6509,6510,5454,5702,5780,6300,4365,4923,3971,6511,5161,3270,
+3158,5985,4100, 867,5129,5703,6117,5363,3695,3301,5513,4467,6118,6512,5455,4232,
+4242,4629,6513,3959,4478,6514,5514,5329,5986,4850,5162,5566,3846,4694,6119,5456,
+4869,5781,3779,6301,5704,5987,5515,4710,6302,5882,6120,4392,5364,5705,6515,6121,
+6516,6517,3736,5988,5457,5989,4695,2457,5883,4551,5782,6303,6304,6305,5130,4971,
+6122,5163,6123,4870,3263,5365,3150,4871,6518,6306,5783,5069,5706,3513,3498,4409,
+5330,5632,5366,5458,5459,3991,5990,4502,3324,5991,5784,3696,4518,5633,4119,6519,
+4630,5634,4417,5707,4832,5992,3418,6124,5993,5567,4768,5218,6520,4595,3458,5367,
+6125,5635,6126,4202,6521,4740,4924,6307,3981,4069,4385,6308,3883,2675,4051,3834,
+4302,4483,5568,5994,4972,4101,5368,6309,5164,5884,3922,6127,6522,6523,5261,5460,
+5187,4164,5219,3538,5516,4111,3524,5995,6310,6311,5369,3181,3386,2484,5188,3464,
+5569,3627,5708,6524,5406,5165,4677,4492,6312,4872,4851,5885,4468,5996,6313,5709,
+5710,6128,2470,5886,6314,5293,4882,5785,3325,5461,5101,6129,5711,5786,6525,4906,
+6526,6527,4418,5887,5712,4808,2907,3701,5713,5888,6528,3765,5636,5331,6529,6530,
+3593,5889,3637,4943,3692,5714,5787,4925,6315,6130,5462,4405,6131,6132,6316,5262,
+6531,6532,5715,3859,5716,5070,4696,5102,3929,5788,3987,4792,5997,6533,6534,3920,
+4809,5000,5998,6535,2974,5370,6317,5189,5263,5717,3826,6536,3953,5001,4883,3190,
+5463,5890,4973,5999,4741,6133,6134,3607,5570,6000,4711,3362,3630,4552,5041,6318,
+6001,2950,2953,5637,4646,5371,4944,6002,2044,4120,3429,6319,6537,5103,4833,6538,
+6539,4884,4647,3884,6003,6004,4758,3835,5220,5789,4565,5407,6540,6135,5294,4697,
+4852,6320,6321,3206,4907,6541,6322,4945,6542,6136,6543,6323,6005,4631,3519,6544,
+5891,6545,5464,3784,5221,6546,5571,4659,6547,6324,6137,5190,6548,3853,6549,4016,
+4834,3954,6138,5332,3827,4017,3210,3546,4469,5408,5718,3505,4648,5790,5131,5638,
+5791,5465,4727,4318,6325,6326,5792,4553,4010,4698,3439,4974,3638,4335,3085,6006,
+5104,5042,5166,5892,5572,6327,4356,4519,5222,5573,5333,5793,5043,6550,5639,5071,
+4503,6328,6139,6551,6140,3914,3901,5372,6007,5640,4728,4793,3976,3836,4885,6552,
+4127,6553,4451,4102,5002,6554,3686,5105,6555,5191,5072,5295,4611,5794,5296,6556,
+5893,5264,5894,4975,5466,5265,4699,4976,4370,4056,3492,5044,4886,6557,5795,4432,
+4769,4357,5467,3940,4660,4290,6141,4484,4770,4661,3992,6329,4025,4662,5022,4632,
+4835,4070,5297,4663,4596,5574,5132,5409,5895,6142,4504,5192,4664,5796,5896,3885,
+5575,5797,5023,4810,5798,3732,5223,4712,5298,4084,5334,5468,6143,4052,4053,4336,
+4977,4794,6558,5335,4908,5576,5224,4233,5024,4128,5469,5225,4873,6008,5045,4729,
+4742,4633,3675,4597,6559,5897,5133,5577,5003,5641,5719,6330,6560,3017,2382,3854,
+4406,4811,6331,4393,3964,4946,6561,2420,3722,6562,4926,4378,3247,1736,4442,6332,
+5134,6333,5226,3996,2918,5470,4319,4003,4598,4743,4744,4485,3785,3902,5167,5004,
+5373,4394,5898,6144,4874,1793,3997,6334,4085,4214,5106,5642,4909,5799,6009,4419,
+4189,3330,5899,4165,4420,5299,5720,5227,3347,6145,4081,6335,2876,3930,6146,3293,
+3786,3910,3998,5900,5300,5578,2840,6563,5901,5579,6147,3531,5374,6564,6565,5580,
+4759,5375,6566,6148,3559,5643,6336,6010,5517,6337,6338,5721,5902,3873,6011,6339,
+6567,5518,3868,3649,5722,6568,4771,4947,6569,6149,4812,6570,2853,5471,6340,6341,
+5644,4795,6342,6012,5723,6343,5724,6013,4349,6344,3160,6150,5193,4599,4514,4493,
+5168,4320,6345,4927,3666,4745,5169,5903,5005,4928,6346,5725,6014,4730,4203,5046,
+4948,3395,5170,6015,4150,6016,5726,5519,6347,5047,3550,6151,6348,4197,4310,5904,
+6571,5581,2965,6152,4978,3960,4291,5135,6572,5301,5727,4129,4026,5905,4853,5728,
+5472,6153,6349,4533,2700,4505,5336,4678,3583,5073,2994,4486,3043,4554,5520,6350,
+6017,5800,4487,6351,3931,4103,5376,6352,4011,4321,4311,4190,5136,6018,3988,3233,
+4350,5906,5645,4198,6573,5107,3432,4191,3435,5582,6574,4139,5410,6353,5411,3944,
+5583,5074,3198,6575,6354,4358,6576,5302,4600,5584,5194,5412,6577,6578,5585,5413,
+5303,4248,5414,3879,4433,6579,4479,5025,4854,5415,6355,4760,4772,3683,2978,4700,
+3797,4452,3965,3932,3721,4910,5801,6580,5195,3551,5907,3221,3471,3029,6019,3999,
+5908,5909,5266,5267,3444,3023,3828,3170,4796,5646,4979,4259,6356,5647,5337,3694,
+6357,5648,5338,4520,4322,5802,3031,3759,4071,6020,5586,4836,4386,5048,6581,3571,
+4679,4174,4949,6154,4813,3787,3402,3822,3958,3215,3552,5268,4387,3933,4950,4359,
+6021,5910,5075,3579,6358,4234,4566,5521,6359,3613,5049,6022,5911,3375,3702,3178,
+4911,5339,4521,6582,6583,4395,3087,3811,5377,6023,6360,6155,4027,5171,5649,4421,
+4249,2804,6584,2270,6585,4000,4235,3045,6156,5137,5729,4140,4312,3886,6361,4330,
+6157,4215,6158,3500,3676,4929,4331,3713,4930,5912,4265,3776,3368,5587,4470,4855,
+3038,4980,3631,6159,6160,4132,4680,6161,6362,3923,4379,5588,4255,6586,4121,6587,
+6363,4649,6364,3288,4773,4774,6162,6024,6365,3543,6588,4274,3107,3737,5050,5803,
+4797,4522,5589,5051,5730,3714,4887,5378,4001,4523,6163,5026,5522,4701,4175,2791,
+3760,6589,5473,4224,4133,3847,4814,4815,4775,3259,5416,6590,2738,6164,6025,5304,
+3733,5076,5650,4816,5590,6591,6165,6592,3934,5269,6593,3396,5340,6594,5804,3445,
+3602,4042,4488,5731,5732,3525,5591,4601,5196,6166,6026,5172,3642,4612,3202,4506,
+4798,6366,3818,5108,4303,5138,5139,4776,3332,4304,2915,3415,4434,5077,5109,4856,
+2879,5305,4817,6595,5913,3104,3144,3903,4634,5341,3133,5110,5651,5805,6167,4057,
+5592,2945,4371,5593,6596,3474,4182,6367,6597,6168,4507,4279,6598,2822,6599,4777,
+4713,5594,3829,6169,3887,5417,6170,3653,5474,6368,4216,2971,5228,3790,4579,6369,
+5733,6600,6601,4951,4746,4555,6602,5418,5475,6027,3400,4665,5806,6171,4799,6028,
+5052,6172,3343,4800,4747,5006,6370,4556,4217,5476,4396,5229,5379,5477,3839,5914,
+5652,5807,4714,3068,4635,5808,6173,5342,4192,5078,5419,5523,5734,6174,4557,6175,
+4602,6371,6176,6603,5809,6372,5735,4260,3869,5111,5230,6029,5112,6177,3126,4681,
+5524,5915,2706,3563,4748,3130,6178,4018,5525,6604,6605,5478,4012,4837,6606,4534,
+4193,5810,4857,3615,5479,6030,4082,3697,3539,4086,5270,3662,4508,4931,5916,4912,
+5811,5027,3888,6607,4397,3527,3302,3798,2775,2921,2637,3966,4122,4388,4028,4054,
+1633,4858,5079,3024,5007,3982,3412,5736,6608,3426,3236,5595,3030,6179,3427,3336,
+3279,3110,6373,3874,3039,5080,5917,5140,4489,3119,6374,5812,3405,4494,6031,4666,
+4141,6180,4166,6032,5813,4981,6609,5081,4422,4982,4112,3915,5653,3296,3983,6375,
+4266,4410,5654,6610,6181,3436,5082,6611,5380,6033,3819,5596,4535,5231,5306,5113,
+6612,4952,5918,4275,3113,6613,6376,6182,6183,5814,3073,4731,4838,5008,3831,6614,
+4888,3090,3848,4280,5526,5232,3014,5655,5009,5737,5420,5527,6615,5815,5343,5173,
+5381,4818,6616,3151,4953,6617,5738,2796,3204,4360,2989,4281,5739,5174,5421,5197,
+3132,5141,3849,5142,5528,5083,3799,3904,4839,5480,2880,4495,3448,6377,6184,5271,
+5919,3771,3193,6034,6035,5920,5010,6036,5597,6037,6378,6038,3106,5422,6618,5423,
+5424,4142,6619,4889,5084,4890,4313,5740,6620,3437,5175,5307,5816,4199,5198,5529,
+5817,5199,5656,4913,5028,5344,3850,6185,2955,5272,5011,5818,4567,4580,5029,5921,
+3616,5233,6621,6622,6186,4176,6039,6379,6380,3352,5200,5273,2908,5598,5234,3837,
+5308,6623,6624,5819,4496,4323,5309,5201,6625,6626,4983,3194,3838,4167,5530,5922,
+5274,6381,6382,3860,3861,5599,3333,4292,4509,6383,3553,5481,5820,5531,4778,6187,
+3955,3956,4324,4389,4218,3945,4325,3397,2681,5923,4779,5085,4019,5482,4891,5382,
+5383,6040,4682,3425,5275,4094,6627,5310,3015,5483,5657,4398,5924,3168,4819,6628,
+5925,6629,5532,4932,4613,6041,6630,4636,6384,4780,4204,5658,4423,5821,3989,4683,
+5822,6385,4954,6631,5345,6188,5425,5012,5384,3894,6386,4490,4104,6632,5741,5053,
+6633,5823,5926,5659,5660,5927,6634,5235,5742,5824,4840,4933,4820,6387,4859,5928,
+4955,6388,4143,3584,5825,5346,5013,6635,5661,6389,5014,5484,5743,4337,5176,5662,
+6390,2836,6391,3268,6392,6636,6042,5236,6637,4158,6638,5744,5663,4471,5347,3663,
+4123,5143,4293,3895,6639,6640,5311,5929,5826,3800,6189,6393,6190,5664,5348,3554,
+3594,4749,4603,6641,5385,4801,6043,5827,4183,6642,5312,5426,4761,6394,5665,6191,
+4715,2669,6643,6644,5533,3185,5427,5086,5930,5931,5386,6192,6044,6645,4781,4013,
+5745,4282,4435,5534,4390,4267,6045,5746,4984,6046,2743,6193,3501,4087,5485,5932,
+5428,4184,4095,5747,4061,5054,3058,3862,5933,5600,6646,5144,3618,6395,3131,5055,
+5313,6396,4650,4956,3855,6194,3896,5202,4985,4029,4225,6195,6647,5828,5486,5829,
+3589,3002,6648,6397,4782,5276,6649,6196,6650,4105,3803,4043,5237,5830,6398,4096,
+3643,6399,3528,6651,4453,3315,4637,6652,3984,6197,5535,3182,3339,6653,3096,2660,
+6400,6654,3449,5934,4250,4236,6047,6401,5831,6655,5487,3753,4062,5832,6198,6199,
+6656,3766,6657,3403,4667,6048,6658,4338,2897,5833,3880,2797,3780,4326,6659,5748,
+5015,6660,5387,4351,5601,4411,6661,3654,4424,5935,4339,4072,5277,4568,5536,6402,
+6662,5238,6663,5349,5203,6200,5204,6201,5145,4536,5016,5056,4762,5834,4399,4957,
+6202,6403,5666,5749,6664,4340,6665,5936,5177,5667,6666,6667,3459,4668,6404,6668,
+6669,4543,6203,6670,4276,6405,4480,5537,6671,4614,5205,5668,6672,3348,2193,4763,
+6406,6204,5937,5602,4177,5669,3419,6673,4020,6205,4443,4569,5388,3715,3639,6407,
+6049,4058,6206,6674,5938,4544,6050,4185,4294,4841,4651,4615,5488,6207,6408,6051,
+5178,3241,3509,5835,6208,4958,5836,4341,5489,5278,6209,2823,5538,5350,5206,5429,
+6675,4638,4875,4073,3516,4684,4914,4860,5939,5603,5389,6052,5057,3237,5490,3791,
+6676,6409,6677,4821,4915,4106,5351,5058,4243,5539,4244,5604,4842,4916,5239,3028,
+3716,5837,5114,5605,5390,5940,5430,6210,4332,6678,5540,4732,3667,3840,6053,4305,
+3408,5670,5541,6410,2744,5240,5750,6679,3234,5606,6680,5607,5671,3608,4283,4159,
+4400,5352,4783,6681,6411,6682,4491,4802,6211,6412,5941,6413,6414,5542,5751,6683,
+4669,3734,5942,6684,6415,5943,5059,3328,4670,4144,4268,6685,6686,6687,6688,4372,
+3603,6689,5944,5491,4373,3440,6416,5543,4784,4822,5608,3792,4616,5838,5672,3514,
+5391,6417,4892,6690,4639,6691,6054,5673,5839,6055,6692,6056,5392,6212,4038,5544,
+5674,4497,6057,6693,5840,4284,5675,4021,4545,5609,6418,4454,6419,6213,4113,4472,
+5314,3738,5087,5279,4074,5610,4959,4063,3179,4750,6058,6420,6214,3476,4498,4716,
+5431,4960,4685,6215,5241,6694,6421,6216,6695,5841,5945,6422,3748,5946,5179,3905,
+5752,5545,5947,4374,6217,4455,6423,4412,6218,4803,5353,6696,3832,5280,6219,4327,
+4702,6220,6221,6059,4652,5432,6424,3749,4751,6425,5753,4986,5393,4917,5948,5030,
+5754,4861,4733,6426,4703,6697,6222,4671,5949,4546,4961,5180,6223,5031,3316,5281,
+6698,4862,4295,4934,5207,3644,6427,5842,5950,6428,6429,4570,5843,5282,6430,6224,
+5088,3239,6060,6699,5844,5755,6061,6431,2701,5546,6432,5115,5676,4039,3993,3327,
+4752,4425,5315,6433,3941,6434,5677,4617,4604,3074,4581,6225,5433,6435,6226,6062,
+4823,5756,5116,6227,3717,5678,4717,5845,6436,5679,5846,6063,5847,6064,3977,3354,
+6437,3863,5117,6228,5547,5394,4499,4524,6229,4605,6230,4306,4500,6700,5951,6065,
+3693,5952,5089,4366,4918,6701,6231,5548,6232,6702,6438,4704,5434,6703,6704,5953,
+4168,6705,5680,3420,6706,5242,4407,6066,3812,5757,5090,5954,4672,4525,3481,5681,
+4618,5395,5354,5316,5955,6439,4962,6707,4526,6440,3465,4673,6067,6441,5682,6708,
+5435,5492,5758,5683,4619,4571,4674,4804,4893,4686,5493,4753,6233,6068,4269,6442,
+6234,5032,4705,5146,5243,5208,5848,6235,6443,4963,5033,4640,4226,6236,5849,3387,
+6444,6445,4436,4437,5850,4843,5494,4785,4894,6709,4361,6710,5091,5956,3331,6237,
+4987,5549,6069,6711,4342,3517,4473,5317,6070,6712,6071,4706,6446,5017,5355,6713,
+6714,4988,5436,6447,4734,5759,6715,4735,4547,4456,4754,6448,5851,6449,6450,3547,
+5852,5318,6451,6452,5092,4205,6716,6238,4620,4219,5611,6239,6072,4481,5760,5957,
+5958,4059,6240,6453,4227,4537,6241,5761,4030,4186,5244,5209,3761,4457,4876,3337,
+5495,5181,6242,5959,5319,5612,5684,5853,3493,5854,6073,4169,5613,5147,4895,6074,
+5210,6717,5182,6718,3830,6243,2798,3841,6075,6244,5855,5614,3604,4606,5496,5685,
+5118,5356,6719,6454,5960,5357,5961,6720,4145,3935,4621,5119,5962,4261,6721,6455,
+4786,5963,4375,4582,6245,6246,6247,6076,5437,4877,5856,3376,4380,6248,4160,6722,
+5148,6456,5211,6457,6723,4718,6458,6724,6249,5358,4044,3297,6459,6250,5857,5615,
+5497,5245,6460,5498,6725,6251,6252,5550,3793,5499,2959,5396,6461,6462,4572,5093,
+5500,5964,3806,4146,6463,4426,5762,5858,6077,6253,4755,3967,4220,5965,6254,4989,
+5501,6464,4352,6726,6078,4764,2290,5246,3906,5438,5283,3767,4964,2861,5763,5094,
+6255,6256,4622,5616,5859,5860,4707,6727,4285,4708,4824,5617,6257,5551,4787,5212,
+4965,4935,4687,6465,6728,6466,5686,6079,3494,4413,2995,5247,5966,5618,6729,5967,
+5764,5765,5687,5502,6730,6731,6080,5397,6467,4990,6258,6732,4538,5060,5619,6733,
+4719,5688,5439,5018,5149,5284,5503,6734,6081,4607,6259,5120,3645,5861,4583,6260,
+4584,4675,5620,4098,5440,6261,4863,2379,3306,4585,5552,5689,4586,5285,6735,4864,
+6736,5286,6082,6737,4623,3010,4788,4381,4558,5621,4587,4896,3698,3161,5248,4353,
+4045,6262,3754,5183,4588,6738,6263,6739,6740,5622,3936,6741,6468,6742,6264,5095,
+6469,4991,5968,6743,4992,6744,6083,4897,6745,4256,5766,4307,3108,3968,4444,5287,
+3889,4343,6084,4510,6085,4559,6086,4898,5969,6746,5623,5061,4919,5249,5250,5504,
+5441,6265,5320,4878,3242,5862,5251,3428,6087,6747,4237,5624,5442,6266,5553,4539,
+6748,2585,3533,5398,4262,6088,5150,4736,4438,6089,6267,5505,4966,6749,6268,6750,
+6269,5288,5554,3650,6090,6091,4624,6092,5690,6751,5863,4270,5691,4277,5555,5864,
+6752,5692,4720,4865,6470,5151,4688,4825,6753,3094,6754,6471,3235,4653,6755,5213,
+5399,6756,3201,4589,5865,4967,6472,5866,6473,5019,3016,6757,5321,4756,3957,4573,
+6093,4993,5767,4721,6474,6758,5625,6759,4458,6475,6270,6760,5556,4994,5214,5252,
+6271,3875,5768,6094,5034,5506,4376,5769,6761,2120,6476,5253,5770,6762,5771,5970,
+3990,5971,5557,5558,5772,6477,6095,2787,4641,5972,5121,6096,6097,6272,6763,3703,
+5867,5507,6273,4206,6274,4789,6098,6764,3619,3646,3833,3804,2394,3788,4936,3978,
+4866,4899,6099,6100,5559,6478,6765,3599,5868,6101,5869,5870,6275,6766,4527,6767)
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/gb2312prober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/gb2312prober.py
new file mode 100644
index 0000000..0325a2d
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/gb2312prober.py
@@ -0,0 +1,41 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+# 
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+# 
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .mbcharsetprober import MultiByteCharSetProber
+from .codingstatemachine import CodingStateMachine
+from .chardistribution import GB2312DistributionAnalysis
+from .mbcssm import GB2312SMModel
+
+class GB2312Prober(MultiByteCharSetProber):
+    def __init__(self):
+        MultiByteCharSetProber.__init__(self)
+        self._mCodingSM = CodingStateMachine(GB2312SMModel)
+        self._mDistributionAnalyzer = GB2312DistributionAnalysis()
+        self.reset()
+
+    def get_charset_name(self):
+        return "GB2312"
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/hebrewprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/hebrewprober.py
new file mode 100644
index 0000000..ba225c5
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/hebrewprober.py
@@ -0,0 +1,283 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+#          Shy Shalom
+# Portions created by the Initial Developer are Copyright (C) 2005
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .charsetprober import CharSetProber
+from .constants import eNotMe, eDetecting
+from .compat import wrap_ord
+
+# This prober doesn't actually recognize a language or a charset.
+# It is a helper prober for the use of the Hebrew model probers
+
+### General ideas of the Hebrew charset recognition ###
+#
+# Four main charsets exist in Hebrew:
+# "ISO-8859-8" - Visual Hebrew
+# "windows-1255" - Logical Hebrew
+# "ISO-8859-8-I" - Logical Hebrew
+# "x-mac-hebrew" - ?? Logical Hebrew ??
+#
+# Both "ISO" charsets use a completely identical set of code points, whereas
+# "windows-1255" and "x-mac-hebrew" are two different proper supersets of
+# these code points. windows-1255 defines additional characters in the range
+# 0x80-0x9F as some misc punctuation marks as well as some Hebrew-specific
+# diacritics and additional 'Yiddish' ligature letters in the range 0xc0-0xd6.
+# x-mac-hebrew defines similar additional code points but with a different
+# mapping.
+#
+# As far as an average Hebrew text with no diacritics is concerned, all four
+# charsets are identical with respect to code points. Meaning that for the
+# main Hebrew alphabet, all four map the same values to all 27 Hebrew letters
+# (including final letters).
+#
+# The dominant difference between these charsets is their directionality.
+# "Visual" directionality means that the text is ordered as if the renderer is
+# not aware of a BIDI rendering algorithm. The renderer sees the text and
+# draws it from left to right. The text itself when ordered naturally is read
+# backwards. A buffer of Visual Hebrew generally looks like so:
+# "[last word of first line spelled backwards] [whole line ordered backwards
+# and spelled backwards] [first word of first line spelled backwards]
+# [end of line] [last word of second line] ... etc' "
+# adding punctuation marks, numbers and English text to visual text is
+# naturally also "visual" and from left to right.
+#
+# "Logical" directionality means the text is ordered "naturally" according to
+# the order it is read. It is the responsibility of the renderer to display
+# the text from right to left. A BIDI algorithm is used to place general
+# punctuation marks, numbers and English text in the text.
+#
+# Texts in x-mac-hebrew are almost impossible to find on the Internet. From
+# what little evidence I could find, it seems that its general directionality
+# is Logical.
+#
+# To sum up all of the above, the Hebrew probing mechanism knows about two
+# charsets:
+# Visual Hebrew - "ISO-8859-8" - backwards text - Words and sentences are
+#    backwards while line order is natural. For charset recognition purposes
+#    the line order is unimportant (In fact, for this implementation, even
+#    word order is unimportant).
+# Logical Hebrew - "windows-1255" - normal, naturally ordered text.
+#
+# "ISO-8859-8-I" is a subset of windows-1255 and doesn't need to be
+#    specifically identified.
+# "x-mac-hebrew" is also identified as windows-1255. A text in x-mac-hebrew
+#    that contain special punctuation marks or diacritics is displayed with
+#    some unconverted characters showing as question marks. This problem might
+#    be corrected using another model prober for x-mac-hebrew. Due to the fact
+#    that x-mac-hebrew texts are so rare, writing another model prober isn't
+#    worth the effort and performance hit.
+#
+#### The Prober ####
+#
+# The prober is divided between two SBCharSetProbers and a HebrewProber,
+# all of which are managed, created, fed data, inquired and deleted by the
+# SBCSGroupProber. The two SBCharSetProbers identify that the text is in
+# fact some kind of Hebrew, Logical or Visual. The final decision about which
+# one is it is made by the HebrewProber by combining final-letter scores
+# with the scores of the two SBCharSetProbers to produce a final answer.
+#
+# The SBCSGroupProber is responsible for stripping the original text of HTML
+# tags, English characters, numbers, low-ASCII punctuation characters, spaces
+# and new lines. It reduces any sequence of such characters to a single space.
+# The buffer fed to each prober in the SBCS group prober is pure text in
+# high-ASCII.
+# The two SBCharSetProbers (model probers) share the same language model:
+# Win1255Model.
+# The first SBCharSetProber uses the model normally as any other
+# SBCharSetProber does, to recognize windows-1255, upon which this model was
+# built. The second SBCharSetProber is told to make the pair-of-letter
+# lookup in the language model backwards. This in practice exactly simulates
+# a visual Hebrew model using the windows-1255 logical Hebrew model.
+#
+# The HebrewProber is not using any language model. All it does is look for
+# final-letter evidence suggesting the text is either logical Hebrew or visual
+# Hebrew. Disjointed from the model probers, the results of the HebrewProber
+# alone are meaningless. HebrewProber always returns 0.00 as confidence
+# since it never identifies a charset by itself. Instead, the pointer to the
+# HebrewProber is passed to the model probers as a helper "Name Prober".
+# When the Group prober receives a positive identification from any prober,
+# it asks for the name of the charset identified. If the prober queried is a
+# Hebrew model prober, the model prober forwards the call to the
+# HebrewProber to make the final decision. In the HebrewProber, the
+# decision is made according to the final-letters scores maintained and Both
+# model probers scores. The answer is returned in the form of the name of the
+# charset identified, either "windows-1255" or "ISO-8859-8".
+
+# windows-1255 / ISO-8859-8 code points of interest
+FINAL_KAF = 0xea
+NORMAL_KAF = 0xeb
+FINAL_MEM = 0xed
+NORMAL_MEM = 0xee
+FINAL_NUN = 0xef
+NORMAL_NUN = 0xf0
+FINAL_PE = 0xf3
+NORMAL_PE = 0xf4
+FINAL_TSADI = 0xf5
+NORMAL_TSADI = 0xf6
+
+# Minimum Visual vs Logical final letter score difference.
+# If the difference is below this, don't rely solely on the final letter score
+# distance.
+MIN_FINAL_CHAR_DISTANCE = 5
+
+# Minimum Visual vs Logical model score difference.
+# If the difference is below this, don't rely at all on the model score
+# distance.
+MIN_MODEL_DISTANCE = 0.01
+
+VISUAL_HEBREW_NAME = "ISO-8859-8"
+LOGICAL_HEBREW_NAME = "windows-1255"
+
+
+class HebrewProber(CharSetProber):
+    def __init__(self):
+        CharSetProber.__init__(self)
+        self._mLogicalProber = None
+        self._mVisualProber = None
+        self.reset()
+
+    def reset(self):
+        self._mFinalCharLogicalScore = 0
+        self._mFinalCharVisualScore = 0
+        # The two last characters seen in the previous buffer,
+        # mPrev and mBeforePrev are initialized to space in order to simulate
+        # a word delimiter at the beginning of the data
+        self._mPrev = ' '
+        self._mBeforePrev = ' '
+        # These probers are owned by the group prober.
+
+    def set_model_probers(self, logicalProber, visualProber):
+        self._mLogicalProber = logicalProber
+        self._mVisualProber = visualProber
+
+    def is_final(self, c):
+        return wrap_ord(c) in [FINAL_KAF, FINAL_MEM, FINAL_NUN, FINAL_PE,
+                               FINAL_TSADI]
+
+    def is_non_final(self, c):
+        # The normal Tsadi is not a good Non-Final letter due to words like
+        # 'lechotet' (to chat) containing an apostrophe after the tsadi. This
+        # apostrophe is converted to a space in FilterWithoutEnglishLetters
+        # causing the Non-Final tsadi to appear at an end of a word even
+        # though this is not the case in the original text.
+        # The letters Pe and Kaf rarely display a related behavior of not being
+        # a good Non-Final letter. Words like 'Pop', 'Winamp' and 'Mubarak'
+        # for example legally end with a Non-Final Pe or Kaf. However, the
+        # benefit of these letters as Non-Final letters outweighs the damage
+        # since these words are quite rare.
+        return wrap_ord(c) in [NORMAL_KAF, NORMAL_MEM, NORMAL_NUN, NORMAL_PE]
+
+    def feed(self, aBuf):
+        # Final letter analysis for logical-visual decision.
+        # Look for evidence that the received buffer is either logical Hebrew
+        # or visual Hebrew.
+        # The following cases are checked:
+        # 1) A word longer than 1 letter, ending with a final letter. This is
+        #    an indication that the text is laid out "naturally" since the
+        #    final letter really appears at the end. +1 for logical score.
+        # 2) A word longer than 1 letter, ending with a Non-Final letter. In
+        #    normal Hebrew, words ending with Kaf, Mem, Nun, Pe or Tsadi,
+        #    should not end with the Non-Final form of that letter. Exceptions
+        #    to this rule are mentioned above in isNonFinal(). This is an
+        #    indication that the text is laid out backwards. +1 for visual
+        #    score
+        # 3) A word longer than 1 letter, starting with a final letter. Final
+        #    letters should not appear at the beginning of a word. This is an
+        #    indication that the text is laid out backwards. +1 for visual
+        #    score.
+        #
+        # The visual score and logical score are accumulated throughout the
+        # text and are finally checked against each other in GetCharSetName().
+        # No checking for final letters in the middle of words is done since
+        # that case is not an indication for either Logical or Visual text.
+        #
+        # We automatically filter out all 7-bit characters (replace them with
+        # spaces) so the word boundary detection works properly. [MAP]
+
+        if self.get_state() == eNotMe:
+            # Both model probers say it's not them. No reason to continue.
+            return eNotMe
+
+        aBuf = self.filter_high_bit_only(aBuf)
+
+        for cur in aBuf:
+            if cur == ' ':
+                # We stand on a space - a word just ended
+                if self._mBeforePrev != ' ':
+                    # next-to-last char was not a space so self._mPrev is not a
+                    # 1 letter word
+                    if self.is_final(self._mPrev):
+                        # case (1) [-2:not space][-1:final letter][cur:space]
+                        self._mFinalCharLogicalScore += 1
+                    elif self.is_non_final(self._mPrev):
+                        # case (2) [-2:not space][-1:Non-Final letter][
+                        #  cur:space]
+                        self._mFinalCharVisualScore += 1
+            else:
+                # Not standing on a space
+                if ((self._mBeforePrev == ' ') and
+                        (self.is_final(self._mPrev)) and (cur != ' ')):
+                    # case (3) [-2:space][-1:final letter][cur:not space]
+                    self._mFinalCharVisualScore += 1
+            self._mBeforePrev = self._mPrev
+            self._mPrev = cur
+
+        # Forever detecting, till the end or until both model probers return
+        # eNotMe (handled above)
+        return eDetecting
+
+    def get_charset_name(self):
+        # Make the decision: is it Logical or Visual?
+        # If the final letter score distance is dominant enough, rely on it.
+        finalsub = self._mFinalCharLogicalScore - self._mFinalCharVisualScore
+        if finalsub >= MIN_FINAL_CHAR_DISTANCE:
+            return LOGICAL_HEBREW_NAME
+        if finalsub <= -MIN_FINAL_CHAR_DISTANCE:
+            return VISUAL_HEBREW_NAME
+
+        # It's not dominant enough, try to rely on the model scores instead.
+        modelsub = (self._mLogicalProber.get_confidence()
+                    - self._mVisualProber.get_confidence())
+        if modelsub > MIN_MODEL_DISTANCE:
+            return LOGICAL_HEBREW_NAME
+        if modelsub < -MIN_MODEL_DISTANCE:
+            return VISUAL_HEBREW_NAME
+
+        # Still no good, back to final letter distance, maybe it'll save the
+        # day.
+        if finalsub < 0.0:
+            return VISUAL_HEBREW_NAME
+
+        # (finalsub > 0 - Logical) or (don't know what to do) default to
+        # Logical.
+        return LOGICAL_HEBREW_NAME
+
+    def get_state(self):
+        # Remain active as long as any of the model probers are active.
+        if (self._mLogicalProber.get_state() == eNotMe) and \
+           (self._mVisualProber.get_state() == eNotMe):
+            return eNotMe
+        return eDetecting
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/jisfreq.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/jisfreq.py
new file mode 100644
index 0000000..064345b
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/jisfreq.py
@@ -0,0 +1,569 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# Sampling from about 20M text materials include literature and computer technology
+#
+# Japanese frequency table, applied to both S-JIS and EUC-JP
+# They are sorted in order.
+
+# 128  --> 0.77094
+# 256  --> 0.85710
+# 512  --> 0.92635
+# 1024 --> 0.97130
+# 2048 --> 0.99431
+#
+# Ideal Distribution Ratio = 0.92635 / (1-0.92635) = 12.58
+# Random Distribution Ration = 512 / (2965+62+83+86-512) = 0.191
+#
+# Typical Distribution Ratio, 25% of IDR
+
+JIS_TYPICAL_DISTRIBUTION_RATIO = 3.0
+
+# Char to FreqOrder table ,
+JIS_TABLE_SIZE = 4368
+
+JISCharToFreqOrder = (
+  40,   1,   6, 182, 152, 180, 295,2127, 285, 381,3295,4304,3068,4606,3165,3510, #   16
+3511,1822,2785,4607,1193,2226,5070,4608, 171,2996,1247,  18, 179,5071, 856,1661, #   32
+1262,5072, 619, 127,3431,3512,3230,1899,1700, 232, 228,1294,1298, 284, 283,2041, #   48
+2042,1061,1062,  48,  49,  44,  45, 433, 434,1040,1041, 996, 787,2997,1255,4305, #   64
+2108,4609,1684,1648,5073,5074,5075,5076,5077,5078,3687,5079,4610,5080,3927,3928, #   80
+5081,3296,3432, 290,2285,1471,2187,5082,2580,2825,1303,2140,1739,1445,2691,3375, #   96
+1691,3297,4306,4307,4611, 452,3376,1182,2713,3688,3069,4308,5083,5084,5085,5086, #  112
+5087,5088,5089,5090,5091,5092,5093,5094,5095,5096,5097,5098,5099,5100,5101,5102, #  128
+5103,5104,5105,5106,5107,5108,5109,5110,5111,5112,4097,5113,5114,5115,5116,5117, #  144
+5118,5119,5120,5121,5122,5123,5124,5125,5126,5127,5128,5129,5130,5131,5132,5133, #  160
+5134,5135,5136,5137,5138,5139,5140,5141,5142,5143,5144,5145,5146,5147,5148,5149, #  176
+5150,5151,5152,4612,5153,5154,5155,5156,5157,5158,5159,5160,5161,5162,5163,5164, #  192
+5165,5166,5167,5168,5169,5170,5171,5172,5173,5174,5175,1472, 598, 618, 820,1205, #  208
+1309,1412,1858,1307,1692,5176,5177,5178,5179,5180,5181,5182,1142,1452,1234,1172, #  224
+1875,2043,2149,1793,1382,2973, 925,2404,1067,1241, 960,1377,2935,1491, 919,1217, #  240
+1865,2030,1406,1499,2749,4098,5183,5184,5185,5186,5187,5188,2561,4099,3117,1804, #  256
+2049,3689,4309,3513,1663,5189,3166,3118,3298,1587,1561,3433,5190,3119,1625,2998, #  272
+3299,4613,1766,3690,2786,4614,5191,5192,5193,5194,2161,  26,3377,   2,3929,  20, #  288
+3691,  47,4100,  50,  17,  16,  35, 268,  27, 243,  42, 155,  24, 154,  29, 184, #  304
+   4,  91,  14,  92,  53, 396,  33, 289,   9,  37,  64, 620,  21,  39, 321,   5, #  320
+  12,  11,  52,  13,   3, 208, 138,   0,   7,  60, 526, 141, 151,1069, 181, 275, #  336
+1591,  83, 132,1475, 126, 331, 829,  15,  69, 160,  59,  22, 157,  55,1079, 312, #  352
+ 109,  38,  23,  25,  10,  19,  79,5195,  61, 382,1124,   8,  30,5196,5197,5198, #  368
+5199,5200,5201,5202,5203,5204,5205,5206,  89,  62,  74,  34,2416, 112, 139, 196, #  384
+ 271, 149,  84, 607, 131, 765,  46,  88, 153, 683,  76, 874, 101, 258,  57,  80, #  400
+  32, 364, 121,1508, 169,1547,  68, 235, 145,2999,  41, 360,3027,  70,  63,  31, #  416
+  43, 259, 262,1383,  99, 533, 194,  66,  93, 846, 217, 192,  56, 106,  58, 565, #  432
+ 280, 272, 311, 256, 146,  82, 308,  71, 100, 128, 214, 655, 110, 261, 104,1140, #  448
+  54,  51,  36,  87,  67,3070, 185,2618,2936,2020,  28,1066,2390,2059,5207,5208, #  464
+5209,5210,5211,5212,5213,5214,5215,5216,4615,5217,5218,5219,5220,5221,5222,5223, #  480
+5224,5225,5226,5227,5228,5229,5230,5231,5232,5233,5234,5235,5236,3514,5237,5238, #  496
+5239,5240,5241,5242,5243,5244,2297,2031,4616,4310,3692,5245,3071,5246,3598,5247, #  512
+4617,3231,3515,5248,4101,4311,4618,3808,4312,4102,5249,4103,4104,3599,5250,5251, #  528
+5252,5253,5254,5255,5256,5257,5258,5259,5260,5261,5262,5263,5264,5265,5266,5267, #  544
+5268,5269,5270,5271,5272,5273,5274,5275,5276,5277,5278,5279,5280,5281,5282,5283, #  560
+5284,5285,5286,5287,5288,5289,5290,5291,5292,5293,5294,5295,5296,5297,5298,5299, #  576
+5300,5301,5302,5303,5304,5305,5306,5307,5308,5309,5310,5311,5312,5313,5314,5315, #  592
+5316,5317,5318,5319,5320,5321,5322,5323,5324,5325,5326,5327,5328,5329,5330,5331, #  608
+5332,5333,5334,5335,5336,5337,5338,5339,5340,5341,5342,5343,5344,5345,5346,5347, #  624
+5348,5349,5350,5351,5352,5353,5354,5355,5356,5357,5358,5359,5360,5361,5362,5363, #  640
+5364,5365,5366,5367,5368,5369,5370,5371,5372,5373,5374,5375,5376,5377,5378,5379, #  656
+5380,5381, 363, 642,2787,2878,2788,2789,2316,3232,2317,3434,2011, 165,1942,3930, #  672
+3931,3932,3933,5382,4619,5383,4620,5384,5385,5386,5387,5388,5389,5390,5391,5392, #  688
+5393,5394,5395,5396,5397,5398,5399,5400,5401,5402,5403,5404,5405,5406,5407,5408, #  704
+5409,5410,5411,5412,5413,5414,5415,5416,5417,5418,5419,5420,5421,5422,5423,5424, #  720
+5425,5426,5427,5428,5429,5430,5431,5432,5433,5434,5435,5436,5437,5438,5439,5440, #  736
+5441,5442,5443,5444,5445,5446,5447,5448,5449,5450,5451,5452,5453,5454,5455,5456, #  752
+5457,5458,5459,5460,5461,5462,5463,5464,5465,5466,5467,5468,5469,5470,5471,5472, #  768
+5473,5474,5475,5476,5477,5478,5479,5480,5481,5482,5483,5484,5485,5486,5487,5488, #  784
+5489,5490,5491,5492,5493,5494,5495,5496,5497,5498,5499,5500,5501,5502,5503,5504, #  800
+5505,5506,5507,5508,5509,5510,5511,5512,5513,5514,5515,5516,5517,5518,5519,5520, #  816
+5521,5522,5523,5524,5525,5526,5527,5528,5529,5530,5531,5532,5533,5534,5535,5536, #  832
+5537,5538,5539,5540,5541,5542,5543,5544,5545,5546,5547,5548,5549,5550,5551,5552, #  848
+5553,5554,5555,5556,5557,5558,5559,5560,5561,5562,5563,5564,5565,5566,5567,5568, #  864
+5569,5570,5571,5572,5573,5574,5575,5576,5577,5578,5579,5580,5581,5582,5583,5584, #  880
+5585,5586,5587,5588,5589,5590,5591,5592,5593,5594,5595,5596,5597,5598,5599,5600, #  896
+5601,5602,5603,5604,5605,5606,5607,5608,5609,5610,5611,5612,5613,5614,5615,5616, #  912
+5617,5618,5619,5620,5621,5622,5623,5624,5625,5626,5627,5628,5629,5630,5631,5632, #  928
+5633,5634,5635,5636,5637,5638,5639,5640,5641,5642,5643,5644,5645,5646,5647,5648, #  944
+5649,5650,5651,5652,5653,5654,5655,5656,5657,5658,5659,5660,5661,5662,5663,5664, #  960
+5665,5666,5667,5668,5669,5670,5671,5672,5673,5674,5675,5676,5677,5678,5679,5680, #  976
+5681,5682,5683,5684,5685,5686,5687,5688,5689,5690,5691,5692,5693,5694,5695,5696, #  992
+5697,5698,5699,5700,5701,5702,5703,5704,5705,5706,5707,5708,5709,5710,5711,5712, # 1008
+5713,5714,5715,5716,5717,5718,5719,5720,5721,5722,5723,5724,5725,5726,5727,5728, # 1024
+5729,5730,5731,5732,5733,5734,5735,5736,5737,5738,5739,5740,5741,5742,5743,5744, # 1040
+5745,5746,5747,5748,5749,5750,5751,5752,5753,5754,5755,5756,5757,5758,5759,5760, # 1056
+5761,5762,5763,5764,5765,5766,5767,5768,5769,5770,5771,5772,5773,5774,5775,5776, # 1072
+5777,5778,5779,5780,5781,5782,5783,5784,5785,5786,5787,5788,5789,5790,5791,5792, # 1088
+5793,5794,5795,5796,5797,5798,5799,5800,5801,5802,5803,5804,5805,5806,5807,5808, # 1104
+5809,5810,5811,5812,5813,5814,5815,5816,5817,5818,5819,5820,5821,5822,5823,5824, # 1120
+5825,5826,5827,5828,5829,5830,5831,5832,5833,5834,5835,5836,5837,5838,5839,5840, # 1136
+5841,5842,5843,5844,5845,5846,5847,5848,5849,5850,5851,5852,5853,5854,5855,5856, # 1152
+5857,5858,5859,5860,5861,5862,5863,5864,5865,5866,5867,5868,5869,5870,5871,5872, # 1168
+5873,5874,5875,5876,5877,5878,5879,5880,5881,5882,5883,5884,5885,5886,5887,5888, # 1184
+5889,5890,5891,5892,5893,5894,5895,5896,5897,5898,5899,5900,5901,5902,5903,5904, # 1200
+5905,5906,5907,5908,5909,5910,5911,5912,5913,5914,5915,5916,5917,5918,5919,5920, # 1216
+5921,5922,5923,5924,5925,5926,5927,5928,5929,5930,5931,5932,5933,5934,5935,5936, # 1232
+5937,5938,5939,5940,5941,5942,5943,5944,5945,5946,5947,5948,5949,5950,5951,5952, # 1248
+5953,5954,5955,5956,5957,5958,5959,5960,5961,5962,5963,5964,5965,5966,5967,5968, # 1264
+5969,5970,5971,5972,5973,5974,5975,5976,5977,5978,5979,5980,5981,5982,5983,5984, # 1280
+5985,5986,5987,5988,5989,5990,5991,5992,5993,5994,5995,5996,5997,5998,5999,6000, # 1296
+6001,6002,6003,6004,6005,6006,6007,6008,6009,6010,6011,6012,6013,6014,6015,6016, # 1312
+6017,6018,6019,6020,6021,6022,6023,6024,6025,6026,6027,6028,6029,6030,6031,6032, # 1328
+6033,6034,6035,6036,6037,6038,6039,6040,6041,6042,6043,6044,6045,6046,6047,6048, # 1344
+6049,6050,6051,6052,6053,6054,6055,6056,6057,6058,6059,6060,6061,6062,6063,6064, # 1360
+6065,6066,6067,6068,6069,6070,6071,6072,6073,6074,6075,6076,6077,6078,6079,6080, # 1376
+6081,6082,6083,6084,6085,6086,6087,6088,6089,6090,6091,6092,6093,6094,6095,6096, # 1392
+6097,6098,6099,6100,6101,6102,6103,6104,6105,6106,6107,6108,6109,6110,6111,6112, # 1408
+6113,6114,2044,2060,4621, 997,1235, 473,1186,4622, 920,3378,6115,6116, 379,1108, # 1424
+4313,2657,2735,3934,6117,3809, 636,3233, 573,1026,3693,3435,2974,3300,2298,4105, # 1440
+ 854,2937,2463, 393,2581,2417, 539, 752,1280,2750,2480, 140,1161, 440, 708,1569, # 1456
+ 665,2497,1746,1291,1523,3000, 164,1603, 847,1331, 537,1997, 486, 508,1693,2418, # 1472
+1970,2227, 878,1220, 299,1030, 969, 652,2751, 624,1137,3301,2619,  65,3302,2045, # 1488
+1761,1859,3120,1930,3694,3516, 663,1767, 852, 835,3695, 269, 767,2826,2339,1305, # 1504
+ 896,1150, 770,1616,6118, 506,1502,2075,1012,2519, 775,2520,2975,2340,2938,4314, # 1520
+3028,2086,1224,1943,2286,6119,3072,4315,2240,1273,1987,3935,1557, 175, 597, 985, # 1536
+3517,2419,2521,1416,3029, 585, 938,1931,1007,1052,1932,1685,6120,3379,4316,4623, # 1552
+ 804, 599,3121,1333,2128,2539,1159,1554,2032,3810, 687,2033,2904, 952, 675,1467, # 1568
+3436,6121,2241,1096,1786,2440,1543,1924, 980,1813,2228, 781,2692,1879, 728,1918, # 1584
+3696,4624, 548,1950,4625,1809,1088,1356,3303,2522,1944, 502, 972, 373, 513,2827, # 1600
+ 586,2377,2391,1003,1976,1631,6122,2464,1084, 648,1776,4626,2141, 324, 962,2012, # 1616
+2177,2076,1384, 742,2178,1448,1173,1810, 222, 102, 301, 445, 125,2420, 662,2498, # 1632
+ 277, 200,1476,1165,1068, 224,2562,1378,1446, 450,1880, 659, 791, 582,4627,2939, # 1648
+3936,1516,1274, 555,2099,3697,1020,1389,1526,3380,1762,1723,1787,2229, 412,2114, # 1664
+1900,2392,3518, 512,2597, 427,1925,2341,3122,1653,1686,2465,2499, 697, 330, 273, # 1680
+ 380,2162, 951, 832, 780, 991,1301,3073, 965,2270,3519, 668,2523,2636,1286, 535, # 1696
+1407, 518, 671, 957,2658,2378, 267, 611,2197,3030,6123, 248,2299, 967,1799,2356, # 1712
+ 850,1418,3437,1876,1256,1480,2828,1718,6124,6125,1755,1664,2405,6126,4628,2879, # 1728
+2829, 499,2179, 676,4629, 557,2329,2214,2090, 325,3234, 464, 811,3001, 992,2342, # 1744
+2481,1232,1469, 303,2242, 466,1070,2163, 603,1777,2091,4630,2752,4631,2714, 322, # 1760
+2659,1964,1768, 481,2188,1463,2330,2857,3600,2092,3031,2421,4632,2318,2070,1849, # 1776
+2598,4633,1302,2254,1668,1701,2422,3811,2905,3032,3123,2046,4106,1763,1694,4634, # 1792
+1604, 943,1724,1454, 917, 868,2215,1169,2940, 552,1145,1800,1228,1823,1955, 316, # 1808
+1080,2510, 361,1807,2830,4107,2660,3381,1346,1423,1134,4108,6127, 541,1263,1229, # 1824
+1148,2540, 545, 465,1833,2880,3438,1901,3074,2482, 816,3937, 713,1788,2500, 122, # 1840
+1575, 195,1451,2501,1111,6128, 859, 374,1225,2243,2483,4317, 390,1033,3439,3075, # 1856
+2524,1687, 266, 793,1440,2599, 946, 779, 802, 507, 897,1081, 528,2189,1292, 711, # 1872
+1866,1725,1167,1640, 753, 398,2661,1053, 246, 348,4318, 137,1024,3440,1600,2077, # 1888
+2129, 825,4319, 698, 238, 521, 187,2300,1157,2423,1641,1605,1464,1610,1097,2541, # 1904
+1260,1436, 759,2255,1814,2150, 705,3235, 409,2563,3304, 561,3033,2005,2564, 726, # 1920
+1956,2343,3698,4109, 949,3812,3813,3520,1669, 653,1379,2525, 881,2198, 632,2256, # 1936
+1027, 778,1074, 733,1957, 514,1481,2466, 554,2180, 702,3938,1606,1017,1398,6129, # 1952
+1380,3521, 921, 993,1313, 594, 449,1489,1617,1166, 768,1426,1360, 495,1794,3601, # 1968
+1177,3602,1170,4320,2344, 476, 425,3167,4635,3168,1424, 401,2662,1171,3382,1998, # 1984
+1089,4110, 477,3169, 474,6130,1909, 596,2831,1842, 494, 693,1051,1028,1207,3076, # 2000
+ 606,2115, 727,2790,1473,1115, 743,3522, 630, 805,1532,4321,2021, 366,1057, 838, # 2016
+ 684,1114,2142,4322,2050,1492,1892,1808,2271,3814,2424,1971,1447,1373,3305,1090, # 2032
+1536,3939,3523,3306,1455,2199, 336, 369,2331,1035, 584,2393, 902, 718,2600,6131, # 2048
+2753, 463,2151,1149,1611,2467, 715,1308,3124,1268, 343,1413,3236,1517,1347,2663, # 2064
+2093,3940,2022,1131,1553,2100,2941,1427,3441,2942,1323,2484,6132,1980, 872,2368, # 2080
+2441,2943, 320,2369,2116,1082, 679,1933,3941,2791,3815, 625,1143,2023, 422,2200, # 2096
+3816,6133, 730,1695, 356,2257,1626,2301,2858,2637,1627,1778, 937, 883,2906,2693, # 2112
+3002,1769,1086, 400,1063,1325,3307,2792,4111,3077, 456,2345,1046, 747,6134,1524, # 2128
+ 884,1094,3383,1474,2164,1059, 974,1688,2181,2258,1047, 345,1665,1187, 358, 875, # 2144
+3170, 305, 660,3524,2190,1334,1135,3171,1540,1649,2542,1527, 927, 968,2793, 885, # 2160
+1972,1850, 482, 500,2638,1218,1109,1085,2543,1654,2034, 876,  78,2287,1482,1277, # 2176
+ 861,1675,1083,1779, 724,2754, 454, 397,1132,1612,2332, 893, 672,1237, 257,2259, # 2192
+2370, 135,3384, 337,2244, 547, 352, 340, 709,2485,1400, 788,1138,2511, 540, 772, # 2208
+1682,2260,2272,2544,2013,1843,1902,4636,1999,1562,2288,4637,2201,1403,1533, 407, # 2224
+ 576,3308,1254,2071, 978,3385, 170, 136,1201,3125,2664,3172,2394, 213, 912, 873, # 2240
+3603,1713,2202, 699,3604,3699, 813,3442, 493, 531,1054, 468,2907,1483, 304, 281, # 2256
+4112,1726,1252,2094, 339,2319,2130,2639, 756,1563,2944, 748, 571,2976,1588,2425, # 2272
+2715,1851,1460,2426,1528,1392,1973,3237, 288,3309, 685,3386, 296, 892,2716,2216, # 2288
+1570,2245, 722,1747,2217, 905,3238,1103,6135,1893,1441,1965, 251,1805,2371,3700, # 2304
+2601,1919,1078,  75,2182,1509,1592,1270,2640,4638,2152,6136,3310,3817, 524, 706, # 2320
+1075, 292,3818,1756,2602, 317,  98,3173,3605,3525,1844,2218,3819,2502, 814, 567, # 2336
+ 385,2908,1534,6137, 534,1642,3239, 797,6138,1670,1529, 953,4323, 188,1071, 538, # 2352
+ 178, 729,3240,2109,1226,1374,2000,2357,2977, 731,2468,1116,2014,2051,6139,1261, # 2368
+1593, 803,2859,2736,3443, 556, 682, 823,1541,6140,1369,2289,1706,2794, 845, 462, # 2384
+2603,2665,1361, 387, 162,2358,1740, 739,1770,1720,1304,1401,3241,1049, 627,1571, # 2400
+2427,3526,1877,3942,1852,1500, 431,1910,1503, 677, 297,2795, 286,1433,1038,1198, # 2416
+2290,1133,1596,4113,4639,2469,1510,1484,3943,6141,2442, 108, 712,4640,2372, 866, # 2432
+3701,2755,3242,1348, 834,1945,1408,3527,2395,3243,1811, 824, 994,1179,2110,1548, # 2448
+1453, 790,3003, 690,4324,4325,2832,2909,3820,1860,3821, 225,1748, 310, 346,1780, # 2464
+2470, 821,1993,2717,2796, 828, 877,3528,2860,2471,1702,2165,2910,2486,1789, 453, # 2480
+ 359,2291,1676,  73,1164,1461,1127,3311, 421, 604, 314,1037, 589, 116,2487, 737, # 2496
+ 837,1180, 111, 244, 735,6142,2261,1861,1362, 986, 523, 418, 581,2666,3822, 103, # 2512
+ 855, 503,1414,1867,2488,1091, 657,1597, 979, 605,1316,4641,1021,2443,2078,2001, # 2528
+1209,  96, 587,2166,1032, 260,1072,2153, 173,  94, 226,3244, 819,2006,4642,4114, # 2544
+2203, 231,1744, 782,  97,2667, 786,3387, 887, 391, 442,2219,4326,1425,6143,2694, # 2560
+ 633,1544,1202, 483,2015, 592,2052,1958,2472,1655, 419, 129,4327,3444,3312,1714, # 2576
+1257,3078,4328,1518,1098, 865,1310,1019,1885,1512,1734, 469,2444, 148, 773, 436, # 2592
+1815,1868,1128,1055,4329,1245,2756,3445,2154,1934,1039,4643, 579,1238, 932,2320, # 2608
+ 353, 205, 801, 115,2428, 944,2321,1881, 399,2565,1211, 678, 766,3944, 335,2101, # 2624
+1459,1781,1402,3945,2737,2131,1010, 844, 981,1326,1013, 550,1816,1545,2620,1335, # 2640
+1008, 371,2881, 936,1419,1613,3529,1456,1395,2273,1834,2604,1317,2738,2503, 416, # 2656
+1643,4330, 806,1126, 229, 591,3946,1314,1981,1576,1837,1666, 347,1790, 977,3313, # 2672
+ 764,2861,1853, 688,2429,1920,1462,  77, 595, 415,2002,3034, 798,1192,4115,6144, # 2688
+2978,4331,3035,2695,2582,2072,2566, 430,2430,1727, 842,1396,3947,3702, 613, 377, # 2704
+ 278, 236,1417,3388,3314,3174, 757,1869, 107,3530,6145,1194, 623,2262, 207,1253, # 2720
+2167,3446,3948, 492,1117,1935, 536,1838,2757,1246,4332, 696,2095,2406,1393,1572, # 2736
+3175,1782, 583, 190, 253,1390,2230, 830,3126,3389, 934,3245,1703,1749,2979,1870, # 2752
+2545,1656,2204, 869,2346,4116,3176,1817, 496,1764,4644, 942,1504, 404,1903,1122, # 2768
+1580,3606,2945,1022, 515, 372,1735, 955,2431,3036,6146,2797,1110,2302,2798, 617, # 2784
+6147, 441, 762,1771,3447,3607,3608,1904, 840,3037,  86, 939,1385, 572,1370,2445, # 2800
+1336, 114,3703, 898, 294, 203,3315, 703,1583,2274, 429, 961,4333,1854,1951,3390, # 2816
+2373,3704,4334,1318,1381, 966,1911,2322,1006,1155, 309, 989, 458,2718,1795,1372, # 2832
+1203, 252,1689,1363,3177, 517,1936, 168,1490, 562, 193,3823,1042,4117,1835, 551, # 2848
+ 470,4645, 395, 489,3448,1871,1465,2583,2641, 417,1493, 279,1295, 511,1236,1119, # 2864
+  72,1231,1982,1812,3004, 871,1564, 984,3449,1667,2696,2096,4646,2347,2833,1673, # 2880
+3609, 695,3246,2668, 807,1183,4647, 890, 388,2333,1801,1457,2911,1765,1477,1031, # 2896
+3316,3317,1278,3391,2799,2292,2526, 163,3450,4335,2669,1404,1802,6148,2323,2407, # 2912
+1584,1728,1494,1824,1269, 298, 909,3318,1034,1632, 375, 776,1683,2061, 291, 210, # 2928
+1123, 809,1249,1002,2642,3038, 206,1011,2132, 144, 975, 882,1565, 342, 667, 754, # 2944
+1442,2143,1299,2303,2062, 447, 626,2205,1221,2739,2912,1144,1214,2206,2584, 760, # 2960
+1715, 614, 950,1281,2670,2621, 810, 577,1287,2546,4648, 242,2168, 250,2643, 691, # 2976
+ 123,2644, 647, 313,1029, 689,1357,2946,1650, 216, 771,1339,1306, 808,2063, 549, # 2992
+ 913,1371,2913,2914,6149,1466,1092,1174,1196,1311,2605,2396,1783,1796,3079, 406, # 3008
+2671,2117,3949,4649, 487,1825,2220,6150,2915, 448,2348,1073,6151,2397,1707, 130, # 3024
+ 900,1598, 329, 176,1959,2527,1620,6152,2275,4336,3319,1983,2191,3705,3610,2155, # 3040
+3706,1912,1513,1614,6153,1988, 646, 392,2304,1589,3320,3039,1826,1239,1352,1340, # 3056
+2916, 505,2567,1709,1437,2408,2547, 906,6154,2672, 384,1458,1594,1100,1329, 710, # 3072
+ 423,3531,2064,2231,2622,1989,2673,1087,1882, 333, 841,3005,1296,2882,2379, 580, # 3088
+1937,1827,1293,2585, 601, 574, 249,1772,4118,2079,1120, 645, 901,1176,1690, 795, # 3104
+2207, 478,1434, 516,1190,1530, 761,2080, 930,1264, 355, 435,1552, 644,1791, 987, # 3120
+ 220,1364,1163,1121,1538, 306,2169,1327,1222, 546,2645, 218, 241, 610,1704,3321, # 3136
+1984,1839,1966,2528, 451,6155,2586,3707,2568, 907,3178, 254,2947, 186,1845,4650, # 3152
+ 745, 432,1757, 428,1633, 888,2246,2221,2489,3611,2118,1258,1265, 956,3127,1784, # 3168
+4337,2490, 319, 510, 119, 457,3612, 274,2035,2007,4651,1409,3128, 970,2758, 590, # 3184
+2800, 661,2247,4652,2008,3950,1420,1549,3080,3322,3951,1651,1375,2111, 485,2491, # 3200
+1429,1156,6156,2548,2183,1495, 831,1840,2529,2446, 501,1657, 307,1894,3247,1341, # 3216
+ 666, 899,2156,1539,2549,1559, 886, 349,2208,3081,2305,1736,3824,2170,2759,1014, # 3232
+1913,1386, 542,1397,2948, 490, 368, 716, 362, 159, 282,2569,1129,1658,1288,1750, # 3248
+2674, 276, 649,2016, 751,1496, 658,1818,1284,1862,2209,2087,2512,3451, 622,2834, # 3264
+ 376, 117,1060,2053,1208,1721,1101,1443, 247,1250,3179,1792,3952,2760,2398,3953, # 3280
+6157,2144,3708, 446,2432,1151,2570,3452,2447,2761,2835,1210,2448,3082, 424,2222, # 3296
+1251,2449,2119,2836, 504,1581,4338, 602, 817, 857,3825,2349,2306, 357,3826,1470, # 3312
+1883,2883, 255, 958, 929,2917,3248, 302,4653,1050,1271,1751,2307,1952,1430,2697, # 3328
+2719,2359, 354,3180, 777, 158,2036,4339,1659,4340,4654,2308,2949,2248,1146,2232, # 3344
+3532,2720,1696,2623,3827,6158,3129,1550,2698,1485,1297,1428, 637, 931,2721,2145, # 3360
+ 914,2550,2587,  81,2450, 612, 827,2646,1242,4655,1118,2884, 472,1855,3181,3533, # 3376
+3534, 569,1353,2699,1244,1758,2588,4119,2009,2762,2171,3709,1312,1531,6159,1152, # 3392
+1938, 134,1830, 471,3710,2276,1112,1535,3323,3453,3535, 982,1337,2950, 488, 826, # 3408
+ 674,1058,1628,4120,2017, 522,2399, 211, 568,1367,3454, 350, 293,1872,1139,3249, # 3424
+1399,1946,3006,1300,2360,3324, 588, 736,6160,2606, 744, 669,3536,3828,6161,1358, # 3440
+ 199, 723, 848, 933, 851,1939,1505,1514,1338,1618,1831,4656,1634,3613, 443,2740, # 3456
+3829, 717,1947, 491,1914,6162,2551,1542,4121,1025,6163,1099,1223, 198,3040,2722, # 3472
+ 370, 410,1905,2589, 998,1248,3182,2380, 519,1449,4122,1710, 947, 928,1153,4341, # 3488
+2277, 344,2624,1511, 615, 105, 161,1212,1076,1960,3130,2054,1926,1175,1906,2473, # 3504
+ 414,1873,2801,6164,2309, 315,1319,3325, 318,2018,2146,2157, 963, 631, 223,4342, # 3520
+4343,2675, 479,3711,1197,2625,3712,2676,2361,6165,4344,4123,6166,2451,3183,1886, # 3536
+2184,1674,1330,1711,1635,1506, 799, 219,3250,3083,3954,1677,3713,3326,2081,3614, # 3552
+1652,2073,4657,1147,3041,1752, 643,1961, 147,1974,3955,6167,1716,2037, 918,3007, # 3568
+1994, 120,1537, 118, 609,3184,4345, 740,3455,1219, 332,1615,3830,6168,1621,2980, # 3584
+1582, 783, 212, 553,2350,3714,1349,2433,2082,4124, 889,6169,2310,1275,1410, 973, # 3600
+ 166,1320,3456,1797,1215,3185,2885,1846,2590,2763,4658, 629, 822,3008, 763, 940, # 3616
+1990,2862, 439,2409,1566,1240,1622, 926,1282,1907,2764, 654,2210,1607, 327,1130, # 3632
+3956,1678,1623,6170,2434,2192, 686, 608,3831,3715, 903,3957,3042,6171,2741,1522, # 3648
+1915,1105,1555,2552,1359, 323,3251,4346,3457, 738,1354,2553,2311,2334,1828,2003, # 3664
+3832,1753,2351,1227,6172,1887,4125,1478,6173,2410,1874,1712,1847, 520,1204,2607, # 3680
+ 264,4659, 836,2677,2102, 600,4660,3833,2278,3084,6174,4347,3615,1342, 640, 532, # 3696
+ 543,2608,1888,2400,2591,1009,4348,1497, 341,1737,3616,2723,1394, 529,3252,1321, # 3712
+ 983,4661,1515,2120, 971,2592, 924, 287,1662,3186,4349,2700,4350,1519, 908,1948, # 3728
+2452, 156, 796,1629,1486,2223,2055, 694,4126,1259,1036,3392,1213,2249,2742,1889, # 3744
+1230,3958,1015, 910, 408, 559,3617,4662, 746, 725, 935,4663,3959,3009,1289, 563, # 3760
+ 867,4664,3960,1567,2981,2038,2626, 988,2263,2381,4351, 143,2374, 704,1895,6175, # 3776
+1188,3716,2088, 673,3085,2362,4352, 484,1608,1921,2765,2918, 215, 904,3618,3537, # 3792
+ 894, 509, 976,3043,2701,3961,4353,2837,2982, 498,6176,6177,1102,3538,1332,3393, # 3808
+1487,1636,1637, 233, 245,3962, 383, 650, 995,3044, 460,1520,1206,2352, 749,3327, # 3824
+ 530, 700, 389,1438,1560,1773,3963,2264, 719,2951,2724,3834, 870,1832,1644,1000, # 3840
+ 839,2474,3717, 197,1630,3394, 365,2886,3964,1285,2133, 734, 922, 818,1106, 732, # 3856
+ 480,2083,1774,3458, 923,2279,1350, 221,3086,  85,2233,2234,3835,1585,3010,2147, # 3872
+1387,1705,2382,1619,2475, 133, 239,2802,1991,1016,2084,2383, 411,2838,1113, 651, # 3888
+1985,1160,3328, 990,1863,3087,1048,1276,2647, 265,2627,1599,3253,2056, 150, 638, # 3904
+2019, 656, 853, 326,1479, 680,1439,4354,1001,1759, 413,3459,3395,2492,1431, 459, # 3920
+4355,1125,3329,2265,1953,1450,2065,2863, 849, 351,2678,3131,3254,3255,1104,1577, # 3936
+ 227,1351,1645,2453,2193,1421,2887, 812,2121, 634,  95,2435, 201,2312,4665,1646, # 3952
+1671,2743,1601,2554,2702,2648,2280,1315,1366,2089,3132,1573,3718,3965,1729,1189, # 3968
+ 328,2679,1077,1940,1136, 558,1283, 964,1195, 621,2074,1199,1743,3460,3619,1896, # 3984
+1916,1890,3836,2952,1154,2112,1064, 862, 378,3011,2066,2113,2803,1568,2839,6178, # 4000
+3088,2919,1941,1660,2004,1992,2194, 142, 707,1590,1708,1624,1922,1023,1836,1233, # 4016
+1004,2313, 789, 741,3620,6179,1609,2411,1200,4127,3719,3720,4666,2057,3721, 593, # 4032
+2840, 367,2920,1878,6180,3461,1521, 628,1168, 692,2211,2649, 300, 720,2067,2571, # 4048
+2953,3396, 959,2504,3966,3539,3462,1977, 701,6181, 954,1043, 800, 681, 183,3722, # 4064
+1803,1730,3540,4128,2103, 815,2314, 174, 467, 230,2454,1093,2134, 755,3541,3397, # 4080
+1141,1162,6182,1738,2039, 270,3256,2513,1005,1647,2185,3837, 858,1679,1897,1719, # 4096
+2954,2324,1806, 402, 670, 167,4129,1498,2158,2104, 750,6183, 915, 189,1680,1551, # 4112
+ 455,4356,1501,2455, 405,1095,2955, 338,1586,1266,1819, 570, 641,1324, 237,1556, # 4128
+2650,1388,3723,6184,1368,2384,1343,1978,3089,2436, 879,3724, 792,1191, 758,3012, # 4144
+1411,2135,1322,4357, 240,4667,1848,3725,1574,6185, 420,3045,1546,1391, 714,4358, # 4160
+1967, 941,1864, 863, 664, 426, 560,1731,2680,1785,2864,1949,2363, 403,3330,1415, # 4176
+1279,2136,1697,2335, 204, 721,2097,3838,  90,6186,2085,2505, 191,3967, 124,2148, # 4192
+1376,1798,1178,1107,1898,1405, 860,4359,1243,1272,2375,2983,1558,2456,1638, 113, # 4208
+3621, 578,1923,2609, 880, 386,4130, 784,2186,2266,1422,2956,2172,1722, 497, 263, # 4224
+2514,1267,2412,2610, 177,2703,3542, 774,1927,1344, 616,1432,1595,1018, 172,4360, # 4240
+2325, 911,4361, 438,1468,3622, 794,3968,2024,2173,1681,1829,2957, 945, 895,3090, # 4256
+ 575,2212,2476, 475,2401,2681, 785,2744,1745,2293,2555,1975,3133,2865, 394,4668, # 4272
+3839, 635,4131, 639, 202,1507,2195,2766,1345,1435,2572,3726,1908,1184,1181,2457, # 4288
+3727,3134,4362, 843,2611, 437, 916,4669, 234, 769,1884,3046,3047,3623, 833,6187, # 4304
+1639,2250,2402,1355,1185,2010,2047, 999, 525,1732,1290,1488,2612, 948,1578,3728, # 4320
+2413,2477,1216,2725,2159, 334,3840,1328,3624,2921,1525,4132, 564,1056, 891,4363, # 4336
+1444,1698,2385,2251,3729,1365,2281,2235,1717,6188, 864,3841,2515, 444, 527,2767, # 4352
+2922,3625, 544, 461,6189, 566, 209,2437,3398,2098,1065,2068,3331,3626,3257,2137, # 4368  #last 512
+#Everything below is of no interest for detection purpose
+2138,2122,3730,2888,1995,1820,1044,6190,6191,6192,6193,6194,6195,6196,6197,6198, # 4384
+6199,6200,6201,6202,6203,6204,6205,4670,6206,6207,6208,6209,6210,6211,6212,6213, # 4400
+6214,6215,6216,6217,6218,6219,6220,6221,6222,6223,6224,6225,6226,6227,6228,6229, # 4416
+6230,6231,6232,6233,6234,6235,6236,6237,3187,6238,6239,3969,6240,6241,6242,6243, # 4432
+6244,4671,6245,6246,4672,6247,6248,4133,6249,6250,4364,6251,2923,2556,2613,4673, # 4448
+4365,3970,6252,6253,6254,6255,4674,6256,6257,6258,2768,2353,4366,4675,4676,3188, # 4464
+4367,3463,6259,4134,4677,4678,6260,2267,6261,3842,3332,4368,3543,6262,6263,6264, # 4480
+3013,1954,1928,4135,4679,6265,6266,2478,3091,6267,4680,4369,6268,6269,1699,6270, # 4496
+3544,4136,4681,6271,4137,6272,4370,2804,6273,6274,2593,3971,3972,4682,6275,2236, # 4512
+4683,6276,6277,4684,6278,6279,4138,3973,4685,6280,6281,3258,6282,6283,6284,6285, # 4528
+3974,4686,2841,3975,6286,6287,3545,6288,6289,4139,4687,4140,6290,4141,6291,4142, # 4544
+6292,6293,3333,6294,6295,6296,4371,6297,3399,6298,6299,4372,3976,6300,6301,6302, # 4560
+4373,6303,6304,3843,3731,6305,4688,4374,6306,6307,3259,2294,6308,3732,2530,4143, # 4576
+6309,4689,6310,6311,6312,3048,6313,6314,4690,3733,2237,6315,6316,2282,3334,6317, # 4592
+6318,3844,6319,6320,4691,6321,3400,4692,6322,4693,6323,3049,6324,4375,6325,3977, # 4608
+6326,6327,6328,3546,6329,4694,3335,6330,4695,4696,6331,6332,6333,6334,4376,3978, # 4624
+6335,4697,3979,4144,6336,3980,4698,6337,6338,6339,6340,6341,4699,4700,4701,6342, # 4640
+6343,4702,6344,6345,4703,6346,6347,4704,6348,4705,4706,3135,6349,4707,6350,4708, # 4656
+6351,4377,6352,4709,3734,4145,6353,2506,4710,3189,6354,3050,4711,3981,6355,3547, # 4672
+3014,4146,4378,3735,2651,3845,3260,3136,2224,1986,6356,3401,6357,4712,2594,3627, # 4688
+3137,2573,3736,3982,4713,3628,4714,4715,2682,3629,4716,6358,3630,4379,3631,6359, # 4704
+6360,6361,3983,6362,6363,6364,6365,4147,3846,4717,6366,6367,3737,2842,6368,4718, # 4720
+2628,6369,3261,6370,2386,6371,6372,3738,3984,4719,3464,4720,3402,6373,2924,3336, # 4736
+4148,2866,6374,2805,3262,4380,2704,2069,2531,3138,2806,2984,6375,2769,6376,4721, # 4752
+4722,3403,6377,6378,3548,6379,6380,2705,3092,1979,4149,2629,3337,2889,6381,3338, # 4768
+4150,2557,3339,4381,6382,3190,3263,3739,6383,4151,4723,4152,2558,2574,3404,3191, # 4784
+6384,6385,4153,6386,4724,4382,6387,6388,4383,6389,6390,4154,6391,4725,3985,6392, # 4800
+3847,4155,6393,6394,6395,6396,6397,3465,6398,4384,6399,6400,6401,6402,6403,6404, # 4816
+4156,6405,6406,6407,6408,2123,6409,6410,2326,3192,4726,6411,6412,6413,6414,4385, # 4832
+4157,6415,6416,4158,6417,3093,3848,6418,3986,6419,6420,3849,6421,6422,6423,4159, # 4848
+6424,6425,4160,6426,3740,6427,6428,6429,6430,3987,6431,4727,6432,2238,6433,6434, # 4864
+4386,3988,6435,6436,3632,6437,6438,2843,6439,6440,6441,6442,3633,6443,2958,6444, # 4880
+6445,3466,6446,2364,4387,3850,6447,4388,2959,3340,6448,3851,6449,4728,6450,6451, # 4896
+3264,4729,6452,3193,6453,4389,4390,2706,3341,4730,6454,3139,6455,3194,6456,3051, # 4912
+2124,3852,1602,4391,4161,3853,1158,3854,4162,3989,4392,3990,4731,4732,4393,2040, # 4928
+4163,4394,3265,6457,2807,3467,3855,6458,6459,6460,3991,3468,4733,4734,6461,3140, # 4944
+2960,6462,4735,6463,6464,6465,6466,4736,4737,4738,4739,6467,6468,4164,2403,3856, # 4960
+6469,6470,2770,2844,6471,4740,6472,6473,6474,6475,6476,6477,6478,3195,6479,4741, # 4976
+4395,6480,2867,6481,4742,2808,6482,2493,4165,6483,6484,6485,6486,2295,4743,6487, # 4992
+6488,6489,3634,6490,6491,6492,6493,6494,6495,6496,2985,4744,6497,6498,4745,6499, # 5008
+6500,2925,3141,4166,6501,6502,4746,6503,6504,4747,6505,6506,6507,2890,6508,6509, # 5024
+6510,6511,6512,6513,6514,6515,6516,6517,6518,6519,3469,4167,6520,6521,6522,4748, # 5040
+4396,3741,4397,4749,4398,3342,2125,4750,6523,4751,4752,4753,3052,6524,2961,4168, # 5056
+6525,4754,6526,4755,4399,2926,4169,6527,3857,6528,4400,4170,6529,4171,6530,6531, # 5072
+2595,6532,6533,6534,6535,3635,6536,6537,6538,6539,6540,6541,6542,4756,6543,6544, # 5088
+6545,6546,6547,6548,4401,6549,6550,6551,6552,4402,3405,4757,4403,6553,6554,6555, # 5104
+4172,3742,6556,6557,6558,3992,3636,6559,6560,3053,2726,6561,3549,4173,3054,4404, # 5120
+6562,6563,3993,4405,3266,3550,2809,4406,6564,6565,6566,4758,4759,6567,3743,6568, # 5136
+4760,3744,4761,3470,6569,6570,6571,4407,6572,3745,4174,6573,4175,2810,4176,3196, # 5152
+4762,6574,4177,6575,6576,2494,2891,3551,6577,6578,3471,6579,4408,6580,3015,3197, # 5168
+6581,3343,2532,3994,3858,6582,3094,3406,4409,6583,2892,4178,4763,4410,3016,4411, # 5184
+6584,3995,3142,3017,2683,6585,4179,6586,6587,4764,4412,6588,6589,4413,6590,2986, # 5200
+6591,2962,3552,6592,2963,3472,6593,6594,4180,4765,6595,6596,2225,3267,4414,6597, # 5216
+3407,3637,4766,6598,6599,3198,6600,4415,6601,3859,3199,6602,3473,4767,2811,4416, # 5232
+1856,3268,3200,2575,3996,3997,3201,4417,6603,3095,2927,6604,3143,6605,2268,6606, # 5248
+3998,3860,3096,2771,6607,6608,3638,2495,4768,6609,3861,6610,3269,2745,4769,4181, # 5264
+3553,6611,2845,3270,6612,6613,6614,3862,6615,6616,4770,4771,6617,3474,3999,4418, # 5280
+4419,6618,3639,3344,6619,4772,4182,6620,2126,6621,6622,6623,4420,4773,6624,3018, # 5296
+6625,4774,3554,6626,4183,2025,3746,6627,4184,2707,6628,4421,4422,3097,1775,4185, # 5312
+3555,6629,6630,2868,6631,6632,4423,6633,6634,4424,2414,2533,2928,6635,4186,2387, # 5328
+6636,4775,6637,4187,6638,1891,4425,3202,3203,6639,6640,4776,6641,3345,6642,6643, # 5344
+3640,6644,3475,3346,3641,4000,6645,3144,6646,3098,2812,4188,3642,3204,6647,3863, # 5360
+3476,6648,3864,6649,4426,4001,6650,6651,6652,2576,6653,4189,4777,6654,6655,6656, # 5376
+2846,6657,3477,3205,4002,6658,4003,6659,3347,2252,6660,6661,6662,4778,6663,6664, # 5392
+6665,6666,6667,6668,6669,4779,4780,2048,6670,3478,3099,6671,3556,3747,4004,6672, # 5408
+6673,6674,3145,4005,3748,6675,6676,6677,6678,6679,3408,6680,6681,6682,6683,3206, # 5424
+3207,6684,6685,4781,4427,6686,4782,4783,4784,6687,6688,6689,4190,6690,6691,3479, # 5440
+6692,2746,6693,4428,6694,6695,6696,6697,6698,6699,4785,6700,6701,3208,2727,6702, # 5456
+3146,6703,6704,3409,2196,6705,4429,6706,6707,6708,2534,1996,6709,6710,6711,2747, # 5472
+6712,6713,6714,4786,3643,6715,4430,4431,6716,3557,6717,4432,4433,6718,6719,6720, # 5488
+6721,3749,6722,4006,4787,6723,6724,3644,4788,4434,6725,6726,4789,2772,6727,6728, # 5504
+6729,6730,6731,2708,3865,2813,4435,6732,6733,4790,4791,3480,6734,6735,6736,6737, # 5520
+4436,3348,6738,3410,4007,6739,6740,4008,6741,6742,4792,3411,4191,6743,6744,6745, # 5536
+6746,6747,3866,6748,3750,6749,6750,6751,6752,6753,6754,6755,3867,6756,4009,6757, # 5552
+4793,4794,6758,2814,2987,6759,6760,6761,4437,6762,6763,6764,6765,3645,6766,6767, # 5568
+3481,4192,6768,3751,6769,6770,2174,6771,3868,3752,6772,6773,6774,4193,4795,4438, # 5584
+3558,4796,4439,6775,4797,6776,6777,4798,6778,4799,3559,4800,6779,6780,6781,3482, # 5600
+6782,2893,6783,6784,4194,4801,4010,6785,6786,4440,6787,4011,6788,6789,6790,6791, # 5616
+6792,6793,4802,6794,6795,6796,4012,6797,6798,6799,6800,3349,4803,3483,6801,4804, # 5632
+4195,6802,4013,6803,6804,4196,6805,4014,4015,6806,2847,3271,2848,6807,3484,6808, # 5648
+6809,6810,4441,6811,4442,4197,4443,3272,4805,6812,3412,4016,1579,6813,6814,4017, # 5664
+6815,3869,6816,2964,6817,4806,6818,6819,4018,3646,6820,6821,4807,4019,4020,6822, # 5680
+6823,3560,6824,6825,4021,4444,6826,4198,6827,6828,4445,6829,6830,4199,4808,6831, # 5696
+6832,6833,3870,3019,2458,6834,3753,3413,3350,6835,4809,3871,4810,3561,4446,6836, # 5712
+6837,4447,4811,4812,6838,2459,4448,6839,4449,6840,6841,4022,3872,6842,4813,4814, # 5728
+6843,6844,4815,4200,4201,4202,6845,4023,6846,6847,4450,3562,3873,6848,6849,4816, # 5744
+4817,6850,4451,4818,2139,6851,3563,6852,6853,3351,6854,6855,3352,4024,2709,3414, # 5760
+4203,4452,6856,4204,6857,6858,3874,3875,6859,6860,4819,6861,6862,6863,6864,4453, # 5776
+3647,6865,6866,4820,6867,6868,6869,6870,4454,6871,2869,6872,6873,4821,6874,3754, # 5792
+6875,4822,4205,6876,6877,6878,3648,4206,4455,6879,4823,6880,4824,3876,6881,3055, # 5808
+4207,6882,3415,6883,6884,6885,4208,4209,6886,4210,3353,6887,3354,3564,3209,3485, # 5824
+2652,6888,2728,6889,3210,3755,6890,4025,4456,6891,4825,6892,6893,6894,6895,4211, # 5840
+6896,6897,6898,4826,6899,6900,4212,6901,4827,6902,2773,3565,6903,4828,6904,6905, # 5856
+6906,6907,3649,3650,6908,2849,3566,6909,3567,3100,6910,6911,6912,6913,6914,6915, # 5872
+4026,6916,3355,4829,3056,4457,3756,6917,3651,6918,4213,3652,2870,6919,4458,6920, # 5888
+2438,6921,6922,3757,2774,4830,6923,3356,4831,4832,6924,4833,4459,3653,2507,6925, # 5904
+4834,2535,6926,6927,3273,4027,3147,6928,3568,6929,6930,6931,4460,6932,3877,4461, # 5920
+2729,3654,6933,6934,6935,6936,2175,4835,2630,4214,4028,4462,4836,4215,6937,3148, # 5936
+4216,4463,4837,4838,4217,6938,6939,2850,4839,6940,4464,6941,6942,6943,4840,6944, # 5952
+4218,3274,4465,6945,6946,2710,6947,4841,4466,6948,6949,2894,6950,6951,4842,6952, # 5968
+4219,3057,2871,6953,6954,6955,6956,4467,6957,2711,6958,6959,6960,3275,3101,4843, # 5984
+6961,3357,3569,6962,4844,6963,6964,4468,4845,3570,6965,3102,4846,3758,6966,4847, # 6000
+3878,4848,4849,4029,6967,2929,3879,4850,4851,6968,6969,1733,6970,4220,6971,6972, # 6016
+6973,6974,6975,6976,4852,6977,6978,6979,6980,6981,6982,3759,6983,6984,6985,3486, # 6032
+3487,6986,3488,3416,6987,6988,6989,6990,6991,6992,6993,6994,6995,6996,6997,4853, # 6048
+6998,6999,4030,7000,7001,3211,7002,7003,4221,7004,7005,3571,4031,7006,3572,7007, # 6064
+2614,4854,2577,7008,7009,2965,3655,3656,4855,2775,3489,3880,4222,4856,3881,4032, # 6080
+3882,3657,2730,3490,4857,7010,3149,7011,4469,4858,2496,3491,4859,2283,7012,7013, # 6096
+7014,2365,4860,4470,7015,7016,3760,7017,7018,4223,1917,7019,7020,7021,4471,7022, # 6112
+2776,4472,7023,7024,7025,7026,4033,7027,3573,4224,4861,4034,4862,7028,7029,1929, # 6128
+3883,4035,7030,4473,3058,7031,2536,3761,3884,7032,4036,7033,2966,2895,1968,4474, # 6144
+3276,4225,3417,3492,4226,2105,7034,7035,1754,2596,3762,4227,4863,4475,3763,4864, # 6160
+3764,2615,2777,3103,3765,3658,3418,4865,2296,3766,2815,7036,7037,7038,3574,2872, # 6176
+3277,4476,7039,4037,4477,7040,7041,4038,7042,7043,7044,7045,7046,7047,2537,7048, # 6192
+7049,7050,7051,7052,7053,7054,4478,7055,7056,3767,3659,4228,3575,7057,7058,4229, # 6208
+7059,7060,7061,3660,7062,3212,7063,3885,4039,2460,7064,7065,7066,7067,7068,7069, # 6224
+7070,7071,7072,7073,7074,4866,3768,4867,7075,7076,7077,7078,4868,3358,3278,2653, # 6240
+7079,7080,4479,3886,7081,7082,4869,7083,7084,7085,7086,7087,7088,2538,7089,7090, # 6256
+7091,4040,3150,3769,4870,4041,2896,3359,4230,2930,7092,3279,7093,2967,4480,3213, # 6272
+4481,3661,7094,7095,7096,7097,7098,7099,7100,7101,7102,2461,3770,7103,7104,4231, # 6288
+3151,7105,7106,7107,4042,3662,7108,7109,4871,3663,4872,4043,3059,7110,7111,7112, # 6304
+3493,2988,7113,4873,7114,7115,7116,3771,4874,7117,7118,4232,4875,7119,3576,2336, # 6320
+4876,7120,4233,3419,4044,4877,4878,4482,4483,4879,4484,4234,7121,3772,4880,1045, # 6336
+3280,3664,4881,4882,7122,7123,7124,7125,4883,7126,2778,7127,4485,4486,7128,4884, # 6352
+3214,3887,7129,7130,3215,7131,4885,4045,7132,7133,4046,7134,7135,7136,7137,7138, # 6368
+7139,7140,7141,7142,7143,4235,7144,4886,7145,7146,7147,4887,7148,7149,7150,4487, # 6384
+4047,4488,7151,7152,4888,4048,2989,3888,7153,3665,7154,4049,7155,7156,7157,7158, # 6400
+7159,7160,2931,4889,4890,4489,7161,2631,3889,4236,2779,7162,7163,4891,7164,3060, # 6416
+7165,1672,4892,7166,4893,4237,3281,4894,7167,7168,3666,7169,3494,7170,7171,4050, # 6432
+7172,7173,3104,3360,3420,4490,4051,2684,4052,7174,4053,7175,7176,7177,2253,4054, # 6448
+7178,7179,4895,7180,3152,3890,3153,4491,3216,7181,7182,7183,2968,4238,4492,4055, # 6464
+7184,2990,7185,2479,7186,7187,4493,7188,7189,7190,7191,7192,4896,7193,4897,2969, # 6480
+4494,4898,7194,3495,7195,7196,4899,4495,7197,3105,2731,7198,4900,7199,7200,7201, # 6496
+4056,7202,3361,7203,7204,4496,4901,4902,7205,4497,7206,7207,2315,4903,7208,4904, # 6512
+7209,4905,2851,7210,7211,3577,7212,3578,4906,7213,4057,3667,4907,7214,4058,2354, # 6528
+3891,2376,3217,3773,7215,7216,7217,7218,7219,4498,7220,4908,3282,2685,7221,3496, # 6544
+4909,2632,3154,4910,7222,2337,7223,4911,7224,7225,7226,4912,4913,3283,4239,4499, # 6560
+7227,2816,7228,7229,7230,7231,7232,7233,7234,4914,4500,4501,7235,7236,7237,2686, # 6576
+7238,4915,7239,2897,4502,7240,4503,7241,2516,7242,4504,3362,3218,7243,7244,7245, # 6592
+4916,7246,7247,4505,3363,7248,7249,7250,7251,3774,4506,7252,7253,4917,7254,7255, # 6608
+3284,2991,4918,4919,3219,3892,4920,3106,3497,4921,7256,7257,7258,4922,7259,4923, # 6624
+3364,4507,4508,4059,7260,4240,3498,7261,7262,4924,7263,2992,3893,4060,3220,7264, # 6640
+7265,7266,7267,7268,7269,4509,3775,7270,2817,7271,4061,4925,4510,3776,7272,4241, # 6656
+4511,3285,7273,7274,3499,7275,7276,7277,4062,4512,4926,7278,3107,3894,7279,7280, # 6672
+4927,7281,4513,7282,7283,3668,7284,7285,4242,4514,4243,7286,2058,4515,4928,4929, # 6688
+4516,7287,3286,4244,7288,4517,7289,7290,7291,3669,7292,7293,4930,4931,4932,2355, # 6704
+4933,7294,2633,4518,7295,4245,7296,7297,4519,7298,7299,4520,4521,4934,7300,4246, # 6720
+4522,7301,7302,7303,3579,7304,4247,4935,7305,4936,7306,7307,7308,7309,3777,7310, # 6736
+4523,7311,7312,7313,4248,3580,7314,4524,3778,4249,7315,3581,7316,3287,7317,3221, # 6752
+7318,4937,7319,7320,7321,7322,7323,7324,4938,4939,7325,4525,7326,7327,7328,4063, # 6768
+7329,7330,4940,7331,7332,4941,7333,4526,7334,3500,2780,1741,4942,2026,1742,7335, # 6784
+7336,3582,4527,2388,7337,7338,7339,4528,7340,4250,4943,7341,7342,7343,4944,7344, # 6800
+7345,7346,3020,7347,4945,7348,7349,7350,7351,3895,7352,3896,4064,3897,7353,7354, # 6816
+7355,4251,7356,7357,3898,7358,3779,7359,3780,3288,7360,7361,4529,7362,4946,4530, # 6832
+2027,7363,3899,4531,4947,3222,3583,7364,4948,7365,7366,7367,7368,4949,3501,4950, # 6848
+3781,4951,4532,7369,2517,4952,4252,4953,3155,7370,4954,4955,4253,2518,4533,7371, # 6864
+7372,2712,4254,7373,7374,7375,3670,4956,3671,7376,2389,3502,4065,7377,2338,7378, # 6880
+7379,7380,7381,3061,7382,4957,7383,7384,7385,7386,4958,4534,7387,7388,2993,7389, # 6896
+3062,7390,4959,7391,7392,7393,4960,3108,4961,7394,4535,7395,4962,3421,4536,7396, # 6912
+4963,7397,4964,1857,7398,4965,7399,7400,2176,3584,4966,7401,7402,3422,4537,3900, # 6928
+3585,7403,3782,7404,2852,7405,7406,7407,4538,3783,2654,3423,4967,4539,7408,3784, # 6944
+3586,2853,4540,4541,7409,3901,7410,3902,7411,7412,3785,3109,2327,3903,7413,7414, # 6960
+2970,4066,2932,7415,7416,7417,3904,3672,3424,7418,4542,4543,4544,7419,4968,7420, # 6976
+7421,4255,7422,7423,7424,7425,7426,4067,7427,3673,3365,4545,7428,3110,2559,3674, # 6992
+7429,7430,3156,7431,7432,3503,7433,3425,4546,7434,3063,2873,7435,3223,4969,4547, # 7008
+4548,2898,4256,4068,7436,4069,3587,3786,2933,3787,4257,4970,4971,3788,7437,4972, # 7024
+3064,7438,4549,7439,7440,7441,7442,7443,4973,3905,7444,2874,7445,7446,7447,7448, # 7040
+3021,7449,4550,3906,3588,4974,7450,7451,3789,3675,7452,2578,7453,4070,7454,7455, # 7056
+7456,4258,3676,7457,4975,7458,4976,4259,3790,3504,2634,4977,3677,4551,4260,7459, # 7072
+7460,7461,7462,3907,4261,4978,7463,7464,7465,7466,4979,4980,7467,7468,2213,4262, # 7088
+7469,7470,7471,3678,4981,7472,2439,7473,4263,3224,3289,7474,3908,2415,4982,7475, # 7104
+4264,7476,4983,2655,7477,7478,2732,4552,2854,2875,7479,7480,4265,7481,4553,4984, # 7120
+7482,7483,4266,7484,3679,3366,3680,2818,2781,2782,3367,3589,4554,3065,7485,4071, # 7136
+2899,7486,7487,3157,2462,4072,4555,4073,4985,4986,3111,4267,2687,3368,4556,4074, # 7152
+3791,4268,7488,3909,2783,7489,2656,1962,3158,4557,4987,1963,3159,3160,7490,3112, # 7168
+4988,4989,3022,4990,4991,3792,2855,7491,7492,2971,4558,7493,7494,4992,7495,7496, # 7184
+7497,7498,4993,7499,3426,4559,4994,7500,3681,4560,4269,4270,3910,7501,4075,4995, # 7200
+4271,7502,7503,4076,7504,4996,7505,3225,4997,4272,4077,2819,3023,7506,7507,2733, # 7216
+4561,7508,4562,7509,3369,3793,7510,3590,2508,7511,7512,4273,3113,2994,2616,7513, # 7232
+7514,7515,7516,7517,7518,2820,3911,4078,2748,7519,7520,4563,4998,7521,7522,7523, # 7248
+7524,4999,4274,7525,4564,3682,2239,4079,4565,7526,7527,7528,7529,5000,7530,7531, # 7264
+5001,4275,3794,7532,7533,7534,3066,5002,4566,3161,7535,7536,4080,7537,3162,7538, # 7280
+7539,4567,7540,7541,7542,7543,7544,7545,5003,7546,4568,7547,7548,7549,7550,7551, # 7296
+7552,7553,7554,7555,7556,5004,7557,7558,7559,5005,7560,3795,7561,4569,7562,7563, # 7312
+7564,2821,3796,4276,4277,4081,7565,2876,7566,5006,7567,7568,2900,7569,3797,3912, # 7328
+7570,7571,7572,4278,7573,7574,7575,5007,7576,7577,5008,7578,7579,4279,2934,7580, # 7344
+7581,5009,7582,4570,7583,4280,7584,7585,7586,4571,4572,3913,7587,4573,3505,7588, # 7360
+5010,7589,7590,7591,7592,3798,4574,7593,7594,5011,7595,4281,7596,7597,7598,4282, # 7376
+5012,7599,7600,5013,3163,7601,5014,7602,3914,7603,7604,2734,4575,4576,4577,7605, # 7392
+7606,7607,7608,7609,3506,5015,4578,7610,4082,7611,2822,2901,2579,3683,3024,4579, # 7408
+3507,7612,4580,7613,3226,3799,5016,7614,7615,7616,7617,7618,7619,7620,2995,3290, # 7424
+7621,4083,7622,5017,7623,7624,7625,7626,7627,4581,3915,7628,3291,7629,5018,7630, # 7440
+7631,7632,7633,4084,7634,7635,3427,3800,7636,7637,4582,7638,5019,4583,5020,7639, # 7456
+3916,7640,3801,5021,4584,4283,7641,7642,3428,3591,2269,7643,2617,7644,4585,3592, # 7472
+7645,4586,2902,7646,7647,3227,5022,7648,4587,7649,4284,7650,7651,7652,4588,2284, # 7488
+7653,5023,7654,7655,7656,4589,5024,3802,7657,7658,5025,3508,4590,7659,7660,7661, # 7504
+1969,5026,7662,7663,3684,1821,2688,7664,2028,2509,4285,7665,2823,1841,7666,2689, # 7520
+3114,7667,3917,4085,2160,5027,5028,2972,7668,5029,7669,7670,7671,3593,4086,7672, # 7536
+4591,4087,5030,3803,7673,7674,7675,7676,7677,7678,7679,4286,2366,4592,4593,3067, # 7552
+2328,7680,7681,4594,3594,3918,2029,4287,7682,5031,3919,3370,4288,4595,2856,7683, # 7568
+3509,7684,7685,5032,5033,7686,7687,3804,2784,7688,7689,7690,7691,3371,7692,7693, # 7584
+2877,5034,7694,7695,3920,4289,4088,7696,7697,7698,5035,7699,5036,4290,5037,5038, # 7600
+5039,7700,7701,7702,5040,5041,3228,7703,1760,7704,5042,3229,4596,2106,4089,7705, # 7616
+4597,2824,5043,2107,3372,7706,4291,4090,5044,7707,4091,7708,5045,3025,3805,4598, # 7632
+4292,4293,4294,3373,7709,4599,7710,5046,7711,7712,5047,5048,3806,7713,7714,7715, # 7648
+5049,7716,7717,7718,7719,4600,5050,7720,7721,7722,5051,7723,4295,3429,7724,7725, # 7664
+7726,7727,3921,7728,3292,5052,4092,7729,7730,7731,7732,7733,7734,7735,5053,5054, # 7680
+7736,7737,7738,7739,3922,3685,7740,7741,7742,7743,2635,5055,7744,5056,4601,7745, # 7696
+7746,2560,7747,7748,7749,7750,3923,7751,7752,7753,7754,7755,4296,2903,7756,7757, # 7712
+7758,7759,7760,3924,7761,5057,4297,7762,7763,5058,4298,7764,4093,7765,7766,5059, # 7728
+3925,7767,7768,7769,7770,7771,7772,7773,7774,7775,7776,3595,7777,4299,5060,4094, # 7744
+7778,3293,5061,7779,7780,4300,7781,7782,4602,7783,3596,7784,7785,3430,2367,7786, # 7760
+3164,5062,5063,4301,7787,7788,4095,5064,5065,7789,3374,3115,7790,7791,7792,7793, # 7776
+7794,7795,7796,3597,4603,7797,7798,3686,3116,3807,5066,7799,7800,5067,7801,7802, # 7792
+4604,4302,5068,4303,4096,7803,7804,3294,7805,7806,5069,4605,2690,7807,3026,7808, # 7808
+7809,7810,7811,7812,7813,7814,7815,7816,7817,7818,7819,7820,7821,7822,7823,7824, # 7824
+7825,7826,7827,7828,7829,7830,7831,7832,7833,7834,7835,7836,7837,7838,7839,7840, # 7840
+7841,7842,7843,7844,7845,7846,7847,7848,7849,7850,7851,7852,7853,7854,7855,7856, # 7856
+7857,7858,7859,7860,7861,7862,7863,7864,7865,7866,7867,7868,7869,7870,7871,7872, # 7872
+7873,7874,7875,7876,7877,7878,7879,7880,7881,7882,7883,7884,7885,7886,7887,7888, # 7888
+7889,7890,7891,7892,7893,7894,7895,7896,7897,7898,7899,7900,7901,7902,7903,7904, # 7904
+7905,7906,7907,7908,7909,7910,7911,7912,7913,7914,7915,7916,7917,7918,7919,7920, # 7920
+7921,7922,7923,7924,3926,7925,7926,7927,7928,7929,7930,7931,7932,7933,7934,7935, # 7936
+7936,7937,7938,7939,7940,7941,7942,7943,7944,7945,7946,7947,7948,7949,7950,7951, # 7952
+7952,7953,7954,7955,7956,7957,7958,7959,7960,7961,7962,7963,7964,7965,7966,7967, # 7968
+7968,7969,7970,7971,7972,7973,7974,7975,7976,7977,7978,7979,7980,7981,7982,7983, # 7984
+7984,7985,7986,7987,7988,7989,7990,7991,7992,7993,7994,7995,7996,7997,7998,7999, # 8000
+8000,8001,8002,8003,8004,8005,8006,8007,8008,8009,8010,8011,8012,8013,8014,8015, # 8016
+8016,8017,8018,8019,8020,8021,8022,8023,8024,8025,8026,8027,8028,8029,8030,8031, # 8032
+8032,8033,8034,8035,8036,8037,8038,8039,8040,8041,8042,8043,8044,8045,8046,8047, # 8048
+8048,8049,8050,8051,8052,8053,8054,8055,8056,8057,8058,8059,8060,8061,8062,8063, # 8064
+8064,8065,8066,8067,8068,8069,8070,8071,8072,8073,8074,8075,8076,8077,8078,8079, # 8080
+8080,8081,8082,8083,8084,8085,8086,8087,8088,8089,8090,8091,8092,8093,8094,8095, # 8096
+8096,8097,8098,8099,8100,8101,8102,8103,8104,8105,8106,8107,8108,8109,8110,8111, # 8112
+8112,8113,8114,8115,8116,8117,8118,8119,8120,8121,8122,8123,8124,8125,8126,8127, # 8128
+8128,8129,8130,8131,8132,8133,8134,8135,8136,8137,8138,8139,8140,8141,8142,8143, # 8144
+8144,8145,8146,8147,8148,8149,8150,8151,8152,8153,8154,8155,8156,8157,8158,8159, # 8160
+8160,8161,8162,8163,8164,8165,8166,8167,8168,8169,8170,8171,8172,8173,8174,8175, # 8176
+8176,8177,8178,8179,8180,8181,8182,8183,8184,8185,8186,8187,8188,8189,8190,8191, # 8192
+8192,8193,8194,8195,8196,8197,8198,8199,8200,8201,8202,8203,8204,8205,8206,8207, # 8208
+8208,8209,8210,8211,8212,8213,8214,8215,8216,8217,8218,8219,8220,8221,8222,8223, # 8224
+8224,8225,8226,8227,8228,8229,8230,8231,8232,8233,8234,8235,8236,8237,8238,8239, # 8240
+8240,8241,8242,8243,8244,8245,8246,8247,8248,8249,8250,8251,8252,8253,8254,8255, # 8256
+8256,8257,8258,8259,8260,8261,8262,8263,8264,8265,8266,8267,8268,8269,8270,8271) # 8272
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/jpcntx.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/jpcntx.py
new file mode 100644
index 0000000..f7f69ba
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/jpcntx.py
@@ -0,0 +1,219 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .compat import wrap_ord
+
+NUM_OF_CATEGORY = 6
+DONT_KNOW = -1
+ENOUGH_REL_THRESHOLD = 100
+MAX_REL_THRESHOLD = 1000
+MINIMUM_DATA_THRESHOLD = 4
+
+# This is hiragana 2-char sequence table, the number in each cell represents its frequency category
+jp2CharContext = (
+(0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1),
+(2,4,0,4,0,3,0,4,0,3,4,4,4,2,4,3,3,4,3,2,3,3,4,2,3,3,3,2,4,1,4,3,3,1,5,4,3,4,3,4,3,5,3,0,3,5,4,2,0,3,1,0,3,3,0,3,3,0,1,1,0,4,3,0,3,3,0,4,0,2,0,3,5,5,5,5,4,0,4,1,0,3,4),
+(0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2),
+(0,4,0,5,0,5,0,4,0,4,5,4,4,3,5,3,5,1,5,3,4,3,4,4,3,4,3,3,4,3,5,4,4,3,5,5,3,5,5,5,3,5,5,3,4,5,5,3,1,3,2,0,3,4,0,4,2,0,4,2,1,5,3,2,3,5,0,4,0,2,0,5,4,4,5,4,5,0,4,0,0,4,4),
+(0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0),
+(0,3,0,4,0,3,0,3,0,4,5,4,3,3,3,3,4,3,5,4,4,3,5,4,4,3,4,3,4,4,4,4,5,3,4,4,3,4,5,5,4,5,5,1,4,5,4,3,0,3,3,1,3,3,0,4,4,0,3,3,1,5,3,3,3,5,0,4,0,3,0,4,4,3,4,3,3,0,4,1,1,3,4),
+(0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0),
+(0,4,0,3,0,3,0,4,0,3,4,4,3,2,2,1,2,1,3,1,3,3,3,3,3,4,3,1,3,3,5,3,3,0,4,3,0,5,4,3,3,5,4,4,3,4,4,5,0,1,2,0,1,2,0,2,2,0,1,0,0,5,2,2,1,4,0,3,0,1,0,4,4,3,5,4,3,0,2,1,0,4,3),
+(0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0),
+(0,3,0,5,0,4,0,2,1,4,4,2,4,1,4,2,4,2,4,3,3,3,4,3,3,3,3,1,4,2,3,3,3,1,4,4,1,1,1,4,3,3,2,0,2,4,3,2,0,3,3,0,3,1,1,0,0,0,3,3,0,4,2,2,3,4,0,4,0,3,0,4,4,5,3,4,4,0,3,0,0,1,4),
+(1,4,0,4,0,4,0,4,0,3,5,4,4,3,4,3,5,4,3,3,4,3,5,4,4,4,4,3,4,2,4,3,3,1,5,4,3,2,4,5,4,5,5,4,4,5,4,4,0,3,2,2,3,3,0,4,3,1,3,2,1,4,3,3,4,5,0,3,0,2,0,4,5,5,4,5,4,0,4,0,0,5,4),
+(0,5,0,5,0,4,0,3,0,4,4,3,4,3,3,3,4,0,4,4,4,3,4,3,4,3,3,1,4,2,4,3,4,0,5,4,1,4,5,4,4,5,3,2,4,3,4,3,2,4,1,3,3,3,2,3,2,0,4,3,3,4,3,3,3,4,0,4,0,3,0,4,5,4,4,4,3,0,4,1,0,1,3),
+(0,3,1,4,0,3,0,2,0,3,4,4,3,1,4,2,3,3,4,3,4,3,4,3,4,4,3,2,3,1,5,4,4,1,4,4,3,5,4,4,3,5,5,4,3,4,4,3,1,2,3,1,2,2,0,3,2,0,3,1,0,5,3,3,3,4,3,3,3,3,4,4,4,4,5,4,2,0,3,3,2,4,3),
+(0,2,0,3,0,1,0,1,0,0,3,2,0,0,2,0,1,0,2,1,3,3,3,1,2,3,1,0,1,0,4,2,1,1,3,3,0,4,3,3,1,4,3,3,0,3,3,2,0,0,0,0,1,0,0,2,0,0,0,0,0,4,1,0,2,3,2,2,2,1,3,3,3,4,4,3,2,0,3,1,0,3,3),
+(0,4,0,4,0,3,0,3,0,4,4,4,3,3,3,3,3,3,4,3,4,2,4,3,4,3,3,2,4,3,4,5,4,1,4,5,3,5,4,5,3,5,4,0,3,5,5,3,1,3,3,2,2,3,0,3,4,1,3,3,2,4,3,3,3,4,0,4,0,3,0,4,5,4,4,5,3,0,4,1,0,3,4),
+(0,2,0,3,0,3,0,0,0,2,2,2,1,0,1,0,0,0,3,0,3,0,3,0,1,3,1,0,3,1,3,3,3,1,3,3,3,0,1,3,1,3,4,0,0,3,1,1,0,3,2,0,0,0,0,1,3,0,1,0,0,3,3,2,0,3,0,0,0,0,0,3,4,3,4,3,3,0,3,0,0,2,3),
+(2,3,0,3,0,2,0,1,0,3,3,4,3,1,3,1,1,1,3,1,4,3,4,3,3,3,0,0,3,1,5,4,3,1,4,3,2,5,5,4,4,4,4,3,3,4,4,4,0,2,1,1,3,2,0,1,2,0,0,1,0,4,1,3,3,3,0,3,0,1,0,4,4,4,5,5,3,0,2,0,0,4,4),
+(0,2,0,1,0,3,1,3,0,2,3,3,3,0,3,1,0,0,3,0,3,2,3,1,3,2,1,1,0,0,4,2,1,0,2,3,1,4,3,2,0,4,4,3,1,3,1,3,0,1,0,0,1,0,0,0,1,0,0,0,0,4,1,1,1,2,0,3,0,0,0,3,4,2,4,3,2,0,1,0,0,3,3),
+(0,1,0,4,0,5,0,4,0,2,4,4,2,3,3,2,3,3,5,3,3,3,4,3,4,2,3,0,4,3,3,3,4,1,4,3,2,1,5,5,3,4,5,1,3,5,4,2,0,3,3,0,1,3,0,4,2,0,1,3,1,4,3,3,3,3,0,3,0,1,0,3,4,4,4,5,5,0,3,0,1,4,5),
+(0,2,0,3,0,3,0,0,0,2,3,1,3,0,4,0,1,1,3,0,3,4,3,2,3,1,0,3,3,2,3,1,3,0,2,3,0,2,1,4,1,2,2,0,0,3,3,0,0,2,0,0,0,1,0,0,0,0,2,2,0,3,2,1,3,3,0,2,0,2,0,0,3,3,1,2,4,0,3,0,2,2,3),
+(2,4,0,5,0,4,0,4,0,2,4,4,4,3,4,3,3,3,1,2,4,3,4,3,4,4,5,0,3,3,3,3,2,0,4,3,1,4,3,4,1,4,4,3,3,4,4,3,1,2,3,0,4,2,0,4,1,0,3,3,0,4,3,3,3,4,0,4,0,2,0,3,5,3,4,5,2,0,3,0,0,4,5),
+(0,3,0,4,0,1,0,1,0,1,3,2,2,1,3,0,3,0,2,0,2,0,3,0,2,0,0,0,1,0,1,1,0,0,3,1,0,0,0,4,0,3,1,0,2,1,3,0,0,0,0,0,0,3,0,0,0,0,0,0,0,4,2,2,3,1,0,3,0,0,0,1,4,4,4,3,0,0,4,0,0,1,4),
+(1,4,1,5,0,3,0,3,0,4,5,4,4,3,5,3,3,4,4,3,4,1,3,3,3,3,2,1,4,1,5,4,3,1,4,4,3,5,4,4,3,5,4,3,3,4,4,4,0,3,3,1,2,3,0,3,1,0,3,3,0,5,4,4,4,4,4,4,3,3,5,4,4,3,3,5,4,0,3,2,0,4,4),
+(0,2,0,3,0,1,0,0,0,1,3,3,3,2,4,1,3,0,3,1,3,0,2,2,1,1,0,0,2,0,4,3,1,0,4,3,0,4,4,4,1,4,3,1,1,3,3,1,0,2,0,0,1,3,0,0,0,0,2,0,0,4,3,2,4,3,5,4,3,3,3,4,3,3,4,3,3,0,2,1,0,3,3),
+(0,2,0,4,0,3,0,2,0,2,5,5,3,4,4,4,4,1,4,3,3,0,4,3,4,3,1,3,3,2,4,3,0,3,4,3,0,3,4,4,2,4,4,0,4,5,3,3,2,2,1,1,1,2,0,1,5,0,3,3,2,4,3,3,3,4,0,3,0,2,0,4,4,3,5,5,0,0,3,0,2,3,3),
+(0,3,0,4,0,3,0,1,0,3,4,3,3,1,3,3,3,0,3,1,3,0,4,3,3,1,1,0,3,0,3,3,0,0,4,4,0,1,5,4,3,3,5,0,3,3,4,3,0,2,0,1,1,1,0,1,3,0,1,2,1,3,3,2,3,3,0,3,0,1,0,1,3,3,4,4,1,0,1,2,2,1,3),
+(0,1,0,4,0,4,0,3,0,1,3,3,3,2,3,1,1,0,3,0,3,3,4,3,2,4,2,0,1,0,4,3,2,0,4,3,0,5,3,3,2,4,4,4,3,3,3,4,0,1,3,0,0,1,0,0,1,0,0,0,0,4,2,3,3,3,0,3,0,0,0,4,4,4,5,3,2,0,3,3,0,3,5),
+(0,2,0,3,0,0,0,3,0,1,3,0,2,0,0,0,1,0,3,1,1,3,3,0,0,3,0,0,3,0,2,3,1,0,3,1,0,3,3,2,0,4,2,2,0,2,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,2,1,2,0,1,0,1,0,0,0,1,3,1,2,0,0,0,1,0,0,1,4),
+(0,3,0,3,0,5,0,1,0,2,4,3,1,3,3,2,1,1,5,2,1,0,5,1,2,0,0,0,3,3,2,2,3,2,4,3,0,0,3,3,1,3,3,0,2,5,3,4,0,3,3,0,1,2,0,2,2,0,3,2,0,2,2,3,3,3,0,2,0,1,0,3,4,4,2,5,4,0,3,0,0,3,5),
+(0,3,0,3,0,3,0,1,0,3,3,3,3,0,3,0,2,0,2,1,1,0,2,0,1,0,0,0,2,1,0,0,1,0,3,2,0,0,3,3,1,2,3,1,0,3,3,0,0,1,0,0,0,0,0,2,0,0,0,0,0,2,3,1,2,3,0,3,0,1,0,3,2,1,0,4,3,0,1,1,0,3,3),
+(0,4,0,5,0,3,0,3,0,4,5,5,4,3,5,3,4,3,5,3,3,2,5,3,4,4,4,3,4,3,4,5,5,3,4,4,3,4,4,5,4,4,4,3,4,5,5,4,2,3,4,2,3,4,0,3,3,1,4,3,2,4,3,3,5,5,0,3,0,3,0,5,5,5,5,4,4,0,4,0,1,4,4),
+(0,4,0,4,0,3,0,3,0,3,5,4,4,2,3,2,5,1,3,2,5,1,4,2,3,2,3,3,4,3,3,3,3,2,5,4,1,3,3,5,3,4,4,0,4,4,3,1,1,3,1,0,2,3,0,2,3,0,3,0,0,4,3,1,3,4,0,3,0,2,0,4,4,4,3,4,5,0,4,0,0,3,4),
+(0,3,0,3,0,3,1,2,0,3,4,4,3,3,3,0,2,2,4,3,3,1,3,3,3,1,1,0,3,1,4,3,2,3,4,4,2,4,4,4,3,4,4,3,2,4,4,3,1,3,3,1,3,3,0,4,1,0,2,2,1,4,3,2,3,3,5,4,3,3,5,4,4,3,3,0,4,0,3,2,2,4,4),
+(0,2,0,1,0,0,0,0,0,1,2,1,3,0,0,0,0,0,2,0,1,2,1,0,0,1,0,0,0,0,3,0,0,1,0,1,1,3,1,0,0,0,1,1,0,1,1,0,0,0,0,0,2,0,0,0,0,0,0,0,0,1,1,2,2,0,3,4,0,0,0,1,1,0,0,1,0,0,0,0,0,1,1),
+(0,1,0,0,0,1,0,0,0,0,4,0,4,1,4,0,3,0,4,0,3,0,4,0,3,0,3,0,4,1,5,1,4,0,0,3,0,5,0,5,2,0,1,0,0,0,2,1,4,0,1,3,0,0,3,0,0,3,1,1,4,1,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0),
+(1,4,0,5,0,3,0,2,0,3,5,4,4,3,4,3,5,3,4,3,3,0,4,3,3,3,3,3,3,2,4,4,3,1,3,4,4,5,4,4,3,4,4,1,3,5,4,3,3,3,1,2,2,3,3,1,3,1,3,3,3,5,3,3,4,5,0,3,0,3,0,3,4,3,4,4,3,0,3,0,2,4,3),
+(0,1,0,4,0,0,0,0,0,1,4,0,4,1,4,2,4,0,3,0,1,0,1,0,0,0,0,0,2,0,3,1,1,1,0,3,0,0,0,1,2,1,0,0,1,1,1,1,0,1,0,0,0,1,0,0,3,0,0,0,0,3,2,0,2,2,0,1,0,0,0,2,3,2,3,3,0,0,0,0,2,1,0),
+(0,5,1,5,0,3,0,3,0,5,4,4,5,1,5,3,3,0,4,3,4,3,5,3,4,3,3,2,4,3,4,3,3,0,3,3,1,4,4,3,4,4,4,3,4,5,5,3,2,3,1,1,3,3,1,3,1,1,3,3,2,4,5,3,3,5,0,4,0,3,0,4,4,3,5,3,3,0,3,4,0,4,3),
+(0,5,0,5,0,3,0,2,0,4,4,3,5,2,4,3,3,3,4,4,4,3,5,3,5,3,3,1,4,0,4,3,3,0,3,3,0,4,4,4,4,5,4,3,3,5,5,3,2,3,1,2,3,2,0,1,0,0,3,2,2,4,4,3,1,5,0,4,0,3,0,4,3,1,3,2,1,0,3,3,0,3,3),
+(0,4,0,5,0,5,0,4,0,4,5,5,5,3,4,3,3,2,5,4,4,3,5,3,5,3,4,0,4,3,4,4,3,2,4,4,3,4,5,4,4,5,5,0,3,5,5,4,1,3,3,2,3,3,1,3,1,0,4,3,1,4,4,3,4,5,0,4,0,2,0,4,3,4,4,3,3,0,4,0,0,5,5),
+(0,4,0,4,0,5,0,1,1,3,3,4,4,3,4,1,3,0,5,1,3,0,3,1,3,1,1,0,3,0,3,3,4,0,4,3,0,4,4,4,3,4,4,0,3,5,4,1,0,3,0,0,2,3,0,3,1,0,3,1,0,3,2,1,3,5,0,3,0,1,0,3,2,3,3,4,4,0,2,2,0,4,4),
+(2,4,0,5,0,4,0,3,0,4,5,5,4,3,5,3,5,3,5,3,5,2,5,3,4,3,3,4,3,4,5,3,2,1,5,4,3,2,3,4,5,3,4,1,2,5,4,3,0,3,3,0,3,2,0,2,3,0,4,1,0,3,4,3,3,5,0,3,0,1,0,4,5,5,5,4,3,0,4,2,0,3,5),
+(0,5,0,4,0,4,0,2,0,5,4,3,4,3,4,3,3,3,4,3,4,2,5,3,5,3,4,1,4,3,4,4,4,0,3,5,0,4,4,4,4,5,3,1,3,4,5,3,3,3,3,3,3,3,0,2,2,0,3,3,2,4,3,3,3,5,3,4,1,3,3,5,3,2,0,0,0,0,4,3,1,3,3),
+(0,1,0,3,0,3,0,1,0,1,3,3,3,2,3,3,3,0,3,0,0,0,3,1,3,0,0,0,2,2,2,3,0,0,3,2,0,1,2,4,1,3,3,0,0,3,3,3,0,1,0,0,2,1,0,0,3,0,3,1,0,3,0,0,1,3,0,2,0,1,0,3,3,1,3,3,0,0,1,1,0,3,3),
+(0,2,0,3,0,2,1,4,0,2,2,3,1,1,3,1,1,0,2,0,3,1,2,3,1,3,0,0,1,0,4,3,2,3,3,3,1,4,2,3,3,3,3,1,0,3,1,4,0,1,1,0,1,2,0,1,1,0,1,1,0,3,1,3,2,2,0,1,0,0,0,2,3,3,3,1,0,0,0,0,0,2,3),
+(0,5,0,4,0,5,0,2,0,4,5,5,3,3,4,3,3,1,5,4,4,2,4,4,4,3,4,2,4,3,5,5,4,3,3,4,3,3,5,5,4,5,5,1,3,4,5,3,1,4,3,1,3,3,0,3,3,1,4,3,1,4,5,3,3,5,0,4,0,3,0,5,3,3,1,4,3,0,4,0,1,5,3),
+(0,5,0,5,0,4,0,2,0,4,4,3,4,3,3,3,3,3,5,4,4,4,4,4,4,5,3,3,5,2,4,4,4,3,4,4,3,3,4,4,5,5,3,3,4,3,4,3,3,4,3,3,3,3,1,2,2,1,4,3,3,5,4,4,3,4,0,4,0,3,0,4,4,4,4,4,1,0,4,2,0,2,4),
+(0,4,0,4,0,3,0,1,0,3,5,2,3,0,3,0,2,1,4,2,3,3,4,1,4,3,3,2,4,1,3,3,3,0,3,3,0,0,3,3,3,5,3,3,3,3,3,2,0,2,0,0,2,0,0,2,0,0,1,0,0,3,1,2,2,3,0,3,0,2,0,4,4,3,3,4,1,0,3,0,0,2,4),
+(0,0,0,4,0,0,0,0,0,0,1,0,1,0,2,0,0,0,0,0,1,0,2,0,1,0,0,0,0,0,3,1,3,0,3,2,0,0,0,1,0,3,2,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,4,0,2,0,0,0,0,0,0,2),
+(0,2,1,3,0,2,0,2,0,3,3,3,3,1,3,1,3,3,3,3,3,3,4,2,2,1,2,1,4,0,4,3,1,3,3,3,2,4,3,5,4,3,3,3,3,3,3,3,0,1,3,0,2,0,0,1,0,0,1,0,0,4,2,0,2,3,0,3,3,0,3,3,4,2,3,1,4,0,1,2,0,2,3),
+(0,3,0,3,0,1,0,3,0,2,3,3,3,0,3,1,2,0,3,3,2,3,3,2,3,2,3,1,3,0,4,3,2,0,3,3,1,4,3,3,2,3,4,3,1,3,3,1,1,0,1,1,0,1,0,1,0,1,0,0,0,4,1,1,0,3,0,3,1,0,2,3,3,3,3,3,1,0,0,2,0,3,3),
+(0,0,0,0,0,0,0,0,0,0,3,0,2,0,3,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,3,0,3,0,3,1,0,1,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,2,0,2,3,0,0,0,0,0,0,0,0,3),
+(0,2,0,3,1,3,0,3,0,2,3,3,3,1,3,1,3,1,3,1,3,3,3,1,3,0,2,3,1,1,4,3,3,2,3,3,1,2,2,4,1,3,3,0,1,4,2,3,0,1,3,0,3,0,0,1,3,0,2,0,0,3,3,2,1,3,0,3,0,2,0,3,4,4,4,3,1,0,3,0,0,3,3),
+(0,2,0,1,0,2,0,0,0,1,3,2,2,1,3,0,1,1,3,0,3,2,3,1,2,0,2,0,1,1,3,3,3,0,3,3,1,1,2,3,2,3,3,1,2,3,2,0,0,1,0,0,0,0,0,0,3,0,1,0,0,2,1,2,1,3,0,3,0,0,0,3,4,4,4,3,2,0,2,0,0,2,4),
+(0,0,0,1,0,1,0,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,1,1,1,0,0,0,0,0,0,0,0,0,2,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,1,3,1,0,0,0,0,0,0,0,3),
+(0,3,0,3,0,2,0,3,0,3,3,3,2,3,2,2,2,0,3,1,3,3,3,2,3,3,0,0,3,0,3,2,2,0,2,3,1,4,3,4,3,3,2,3,1,5,4,4,0,3,1,2,1,3,0,3,1,1,2,0,2,3,1,3,1,3,0,3,0,1,0,3,3,4,4,2,1,0,2,1,0,2,4),
+(0,1,0,3,0,1,0,2,0,1,4,2,5,1,4,0,2,0,2,1,3,1,4,0,2,1,0,0,2,1,4,1,1,0,3,3,0,5,1,3,2,3,3,1,0,3,2,3,0,1,0,0,0,0,0,0,1,0,0,0,0,4,0,1,0,3,0,2,0,1,0,3,3,3,4,3,3,0,0,0,0,2,3),
+(0,0,0,1,0,0,0,0,0,0,2,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,1,0,0,1,0,0,0,0,0,3),
+(0,1,0,3,0,4,0,3,0,2,4,3,1,0,3,2,2,1,3,1,2,2,3,1,1,1,2,1,3,0,1,2,0,1,3,2,1,3,0,5,5,1,0,0,1,3,2,1,0,3,0,0,1,0,0,0,0,0,3,4,0,1,1,1,3,2,0,2,0,1,0,2,3,3,1,2,3,0,1,0,1,0,4),
+(0,0,0,1,0,3,0,3,0,2,2,1,0,0,4,0,3,0,3,1,3,0,3,0,3,0,1,0,3,0,3,1,3,0,3,3,0,0,1,2,1,1,1,0,1,2,0,0,0,1,0,0,1,0,0,0,0,0,0,0,0,2,2,1,2,0,0,2,0,0,0,0,2,3,3,3,3,0,0,0,0,1,4),
+(0,0,0,3,0,3,0,0,0,0,3,1,1,0,3,0,1,0,2,0,1,0,0,0,0,0,0,0,1,0,3,0,2,0,2,3,0,0,2,2,3,1,2,0,0,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,2,0,0,0,0,2,3),
+(2,4,0,5,0,5,0,4,0,3,4,3,3,3,4,3,3,3,4,3,4,4,5,4,5,5,5,2,3,0,5,5,4,1,5,4,3,1,5,4,3,4,4,3,3,4,3,3,0,3,2,0,2,3,0,3,0,0,3,3,0,5,3,2,3,3,0,3,0,3,0,3,4,5,4,5,3,0,4,3,0,3,4),
+(0,3,0,3,0,3,0,3,0,3,3,4,3,2,3,2,3,0,4,3,3,3,3,3,3,3,3,0,3,2,4,3,3,1,3,4,3,4,4,4,3,4,4,3,2,4,4,1,0,2,0,0,1,1,0,2,0,0,3,1,0,5,3,2,1,3,0,3,0,1,2,4,3,2,4,3,3,0,3,2,0,4,4),
+(0,3,0,3,0,1,0,0,0,1,4,3,3,2,3,1,3,1,4,2,3,2,4,2,3,4,3,0,2,2,3,3,3,0,3,3,3,0,3,4,1,3,3,0,3,4,3,3,0,1,1,0,1,0,0,0,4,0,3,0,0,3,1,2,1,3,0,4,0,1,0,4,3,3,4,3,3,0,2,0,0,3,3),
+(0,3,0,4,0,1,0,3,0,3,4,3,3,0,3,3,3,1,3,1,3,3,4,3,3,3,0,0,3,1,5,3,3,1,3,3,2,5,4,3,3,4,5,3,2,5,3,4,0,1,0,0,0,0,0,2,0,0,1,1,0,4,2,2,1,3,0,3,0,2,0,4,4,3,5,3,2,0,1,1,0,3,4),
+(0,5,0,4,0,5,0,2,0,4,4,3,3,2,3,3,3,1,4,3,4,1,5,3,4,3,4,0,4,2,4,3,4,1,5,4,0,4,4,4,4,5,4,1,3,5,4,2,1,4,1,1,3,2,0,3,1,0,3,2,1,4,3,3,3,4,0,4,0,3,0,4,4,4,3,3,3,0,4,2,0,3,4),
+(1,4,0,4,0,3,0,1,0,3,3,3,1,1,3,3,2,2,3,3,1,0,3,2,2,1,2,0,3,1,2,1,2,0,3,2,0,2,2,3,3,4,3,0,3,3,1,2,0,1,1,3,1,2,0,0,3,0,1,1,0,3,2,2,3,3,0,3,0,0,0,2,3,3,4,3,3,0,1,0,0,1,4),
+(0,4,0,4,0,4,0,0,0,3,4,4,3,1,4,2,3,2,3,3,3,1,4,3,4,0,3,0,4,2,3,3,2,2,5,4,2,1,3,4,3,4,3,1,3,3,4,2,0,2,1,0,3,3,0,0,2,0,3,1,0,4,4,3,4,3,0,4,0,1,0,2,4,4,4,4,4,0,3,2,0,3,3),
+(0,0,0,1,0,4,0,0,0,0,0,0,1,1,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,1,0,3,2,0,0,1,0,0,0,1,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,2),
+(0,2,0,3,0,4,0,4,0,1,3,3,3,0,4,0,2,1,2,1,1,1,2,0,3,1,1,0,1,0,3,1,0,0,3,3,2,0,1,1,0,0,0,0,0,1,0,2,0,2,2,0,3,1,0,0,1,0,1,1,0,1,2,0,3,0,0,0,0,1,0,0,3,3,4,3,1,0,1,0,3,0,2),
+(0,0,0,3,0,5,0,0,0,0,1,0,2,0,3,1,0,1,3,0,0,0,2,0,0,0,1,0,0,0,1,1,0,0,4,0,0,0,2,3,0,1,4,1,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,1,0,0,0,0,0,0,0,2,0,0,3,0,0,0,0,0,3),
+(0,2,0,5,0,5,0,1,0,2,4,3,3,2,5,1,3,2,3,3,3,0,4,1,2,0,3,0,4,0,2,2,1,1,5,3,0,0,1,4,2,3,2,0,3,3,3,2,0,2,4,1,1,2,0,1,1,0,3,1,0,1,3,1,2,3,0,2,0,0,0,1,3,5,4,4,4,0,3,0,0,1,3),
+(0,4,0,5,0,4,0,4,0,4,5,4,3,3,4,3,3,3,4,3,4,4,5,3,4,5,4,2,4,2,3,4,3,1,4,4,1,3,5,4,4,5,5,4,4,5,5,5,2,3,3,1,4,3,1,3,3,0,3,3,1,4,3,4,4,4,0,3,0,4,0,3,3,4,4,5,0,0,4,3,0,4,5),
+(0,4,0,4,0,3,0,3,0,3,4,4,4,3,3,2,4,3,4,3,4,3,5,3,4,3,2,1,4,2,4,4,3,1,3,4,2,4,5,5,3,4,5,4,1,5,4,3,0,3,2,2,3,2,1,3,1,0,3,3,3,5,3,3,3,5,4,4,2,3,3,4,3,3,3,2,1,0,3,2,1,4,3),
+(0,4,0,5,0,4,0,3,0,3,5,5,3,2,4,3,4,0,5,4,4,1,4,4,4,3,3,3,4,3,5,5,2,3,3,4,1,2,5,5,3,5,5,2,3,5,5,4,0,3,2,0,3,3,1,1,5,1,4,1,0,4,3,2,3,5,0,4,0,3,0,5,4,3,4,3,0,0,4,1,0,4,4),
+(1,3,0,4,0,2,0,2,0,2,5,5,3,3,3,3,3,0,4,2,3,4,4,4,3,4,0,0,3,4,5,4,3,3,3,3,2,5,5,4,5,5,5,4,3,5,5,5,1,3,1,0,1,0,0,3,2,0,4,2,0,5,2,3,2,4,1,3,0,3,0,4,5,4,5,4,3,0,4,2,0,5,4),
+(0,3,0,4,0,5,0,3,0,3,4,4,3,2,3,2,3,3,3,3,3,2,4,3,3,2,2,0,3,3,3,3,3,1,3,3,3,0,4,4,3,4,4,1,1,4,4,2,0,3,1,0,1,1,0,4,1,0,2,3,1,3,3,1,3,4,0,3,0,1,0,3,1,3,0,0,1,0,2,0,0,4,4),
+(0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0),
+(0,3,0,3,0,2,0,3,0,1,5,4,3,3,3,1,4,2,1,2,3,4,4,2,4,4,5,0,3,1,4,3,4,0,4,3,3,3,2,3,2,5,3,4,3,2,2,3,0,0,3,0,2,1,0,1,2,0,0,0,0,2,1,1,3,1,0,2,0,4,0,3,4,4,4,5,2,0,2,0,0,1,3),
+(0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,1,1,1,0,0,1,1,0,0,0,4,2,1,1,0,1,0,3,2,0,0,3,1,1,1,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,1,0,0,0,2,0,0,0,1,4,0,4,2,1,0,0,0,0,0,1),
+(0,0,0,0,0,0,0,0,0,1,0,1,0,0,0,0,1,0,0,0,0,0,0,1,0,1,0,0,0,0,3,1,0,0,0,2,0,2,1,0,0,1,2,1,0,1,1,0,0,3,0,0,0,0,0,0,0,0,0,0,0,1,3,1,0,0,0,0,0,1,0,0,2,1,0,0,0,0,0,0,0,0,2),
+(0,4,0,4,0,4,0,3,0,4,4,3,4,2,4,3,2,0,4,4,4,3,5,3,5,3,3,2,4,2,4,3,4,3,1,4,0,2,3,4,4,4,3,3,3,4,4,4,3,4,1,3,4,3,2,1,2,1,3,3,3,4,4,3,3,5,0,4,0,3,0,4,3,3,3,2,1,0,3,0,0,3,3),
+(0,4,0,3,0,3,0,3,0,3,5,5,3,3,3,3,4,3,4,3,3,3,4,4,4,3,3,3,3,4,3,5,3,3,1,3,2,4,5,5,5,5,4,3,4,5,5,3,2,2,3,3,3,3,2,3,3,1,2,3,2,4,3,3,3,4,0,4,0,2,0,4,3,2,2,1,2,0,3,0,0,4,1),
+)
+
+class JapaneseContextAnalysis:
+    def __init__(self):
+        self.reset()
+
+    def reset(self):
+        self._mTotalRel = 0  # total sequence received
+        # category counters, each interger counts sequence in its category
+        self._mRelSample = [0] * NUM_OF_CATEGORY
+        # if last byte in current buffer is not the last byte of a character,
+        # we need to know how many bytes to skip in next buffer
+        self._mNeedToSkipCharNum = 0
+        self._mLastCharOrder = -1  # The order of previous char
+        # If this flag is set to True, detection is done and conclusion has
+        # been made
+        self._mDone = False
+
+    def feed(self, aBuf, aLen):
+        if self._mDone:
+            return
+
+        # The buffer we got is byte oriented, and a character may span in more than one
+        # buffers. In case the last one or two byte in last buffer is not
+        # complete, we record how many byte needed to complete that character
+        # and skip these bytes here.  We can choose to record those bytes as
+        # well and analyse the character once it is complete, but since a
+        # character will not make much difference, by simply skipping
+        # this character will simply our logic and improve performance.
+        i = self._mNeedToSkipCharNum
+        while i < aLen:
+            order, charLen = self.get_order(aBuf[i:i + 2])
+            i += charLen
+            if i > aLen:
+                self._mNeedToSkipCharNum = i - aLen
+                self._mLastCharOrder = -1
+            else:
+                if (order != -1) and (self._mLastCharOrder != -1):
+                    self._mTotalRel += 1
+                    if self._mTotalRel > MAX_REL_THRESHOLD:
+                        self._mDone = True
+                        break
+                    self._mRelSample[jp2CharContext[self._mLastCharOrder][order]] += 1
+                self._mLastCharOrder = order
+
+    def got_enough_data(self):
+        return self._mTotalRel > ENOUGH_REL_THRESHOLD
+
+    def get_confidence(self):
+        # This is just one way to calculate confidence. It works well for me.
+        if self._mTotalRel > MINIMUM_DATA_THRESHOLD:
+            return (self._mTotalRel - self._mRelSample[0]) / self._mTotalRel
+        else:
+            return DONT_KNOW
+
+    def get_order(self, aBuf):
+        return -1, 1
+
+class SJISContextAnalysis(JapaneseContextAnalysis):
+    def get_order(self, aBuf):
+        if not aBuf:
+            return -1, 1
+        # find out current char's byte length
+        first_char = wrap_ord(aBuf[0])
+        if ((0x81 <= first_char <= 0x9F) or (0xE0 <= first_char <= 0xFC)):
+            charLen = 2
+        else:
+            charLen = 1
+
+        # return its order if it is hiragana
+        if len(aBuf) > 1:
+            second_char = wrap_ord(aBuf[1])
+            if (first_char == 202) and (0x9F <= second_char <= 0xF1):
+                return second_char - 0x9F, charLen
+
+        return -1, charLen
+
+class EUCJPContextAnalysis(JapaneseContextAnalysis):
+    def get_order(self, aBuf):
+        if not aBuf:
+            return -1, 1
+        # find out current char's byte length
+        first_char = wrap_ord(aBuf[0])
+        if (first_char == 0x8E) or (0xA1 <= first_char <= 0xFE):
+            charLen = 2
+        elif first_char == 0x8F:
+            charLen = 3
+        else:
+            charLen = 1
+
+        # return its order if it is hiragana
+        if len(aBuf) > 1:
+            second_char = wrap_ord(aBuf[1])
+            if (first_char == 0xA4) and (0xA1 <= second_char <= 0xF3):
+                return second_char - 0xA1, charLen
+
+        return -1, charLen
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langbulgarianmodel.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langbulgarianmodel.py
new file mode 100644
index 0000000..e5788fc
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langbulgarianmodel.py
@@ -0,0 +1,229 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# 255: Control characters that usually does not exist in any text
+# 254: Carriage/Return
+# 253: symbol (punctuation) that does not belong to word
+# 252: 0 - 9
+
+# Character Mapping Table:
+# this table is modified base on win1251BulgarianCharToOrderMap, so
+# only number <64 is sure valid
+
+Latin5_BulgarianCharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253, 77, 90, 99,100, 72,109,107,101, 79,185, 81,102, 76, 94, 82,  # 40
+110,186,108, 91, 74,119, 84, 96,111,187,115,253,253,253,253,253,  # 50
+253, 65, 69, 70, 66, 63, 68,112,103, 92,194,104, 95, 86, 87, 71,  # 60
+116,195, 85, 93, 97,113,196,197,198,199,200,253,253,253,253,253,  # 70
+194,195,196,197,198,199,200,201,202,203,204,205,206,207,208,209,  # 80
+210,211,212,213,214,215,216,217,218,219,220,221,222,223,224,225,  # 90
+ 81,226,227,228,229,230,105,231,232,233,234,235,236, 45,237,238,  # a0
+ 31, 32, 35, 43, 37, 44, 55, 47, 40, 59, 33, 46, 38, 36, 41, 30,  # b0
+ 39, 28, 34, 51, 48, 49, 53, 50, 54, 57, 61,239, 67,240, 60, 56,  # c0
+  1, 18,  9, 20, 11,  3, 23, 15,  2, 26, 12, 10, 14,  6,  4, 13,  # d0
+  7,  8,  5, 19, 29, 25, 22, 21, 27, 24, 17, 75, 52,241, 42, 16,  # e0
+ 62,242,243,244, 58,245, 98,246,247,248,249,250,251, 91,252,253,  # f0
+)
+
+win1251BulgarianCharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253, 77, 90, 99,100, 72,109,107,101, 79,185, 81,102, 76, 94, 82,  # 40
+110,186,108, 91, 74,119, 84, 96,111,187,115,253,253,253,253,253,  # 50
+253, 65, 69, 70, 66, 63, 68,112,103, 92,194,104, 95, 86, 87, 71,  # 60
+116,195, 85, 93, 97,113,196,197,198,199,200,253,253,253,253,253,  # 70
+206,207,208,209,210,211,212,213,120,214,215,216,217,218,219,220,  # 80
+221, 78, 64, 83,121, 98,117,105,222,223,224,225,226,227,228,229,  # 90
+ 88,230,231,232,233,122, 89,106,234,235,236,237,238, 45,239,240,  # a0
+ 73, 80,118,114,241,242,243,244,245, 62, 58,246,247,248,249,250,  # b0
+ 31, 32, 35, 43, 37, 44, 55, 47, 40, 59, 33, 46, 38, 36, 41, 30,  # c0
+ 39, 28, 34, 51, 48, 49, 53, 50, 54, 57, 61,251, 67,252, 60, 56,  # d0
+  1, 18,  9, 20, 11,  3, 23, 15,  2, 26, 12, 10, 14,  6,  4, 13,  # e0
+  7,  8,  5, 19, 29, 25, 22, 21, 27, 24, 17, 75, 52,253, 42, 16,  # f0
+)
+
+# Model Table:
+# total sequences: 100%
+# first 512 sequences: 96.9392%
+# first 1024 sequences:3.0618%
+# rest  sequences:     0.2992%
+# negative sequences:  0.0020%
+BulgarianLangModel = (
+0,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,3,3,3,3,3,3,3,2,3,3,3,3,3,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,0,3,3,3,2,2,3,2,2,1,2,2,
+3,1,3,3,2,3,3,3,3,3,3,3,3,3,3,3,3,0,3,3,3,3,3,3,3,3,3,3,0,3,0,1,
+0,0,0,0,0,0,0,0,0,0,1,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,2,3,3,3,3,3,3,3,3,0,3,1,0,
+0,1,0,0,0,0,0,0,0,0,1,1,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+3,2,2,2,3,3,3,3,3,3,3,3,3,3,3,3,3,1,3,2,3,3,3,3,3,3,3,3,0,3,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,2,3,3,2,3,3,3,3,3,3,3,3,3,3,3,3,1,3,2,3,3,3,3,3,3,3,3,0,3,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,3,2,3,2,2,1,3,3,3,3,2,2,2,1,1,2,0,1,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,3,2,3,2,2,3,3,1,1,2,3,3,2,3,3,3,3,2,1,2,0,2,0,3,0,0,
+0,0,0,0,0,0,0,1,0,0,2,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,3,1,3,3,3,3,3,2,3,2,3,3,3,3,3,2,3,3,1,3,0,3,0,2,0,0,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,3,3,1,3,3,2,3,3,3,1,3,3,2,3,2,2,2,0,0,2,0,2,0,2,0,0,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,3,3,3,0,3,3,3,2,2,3,3,3,1,2,2,3,2,1,1,2,0,2,0,0,0,0,
+1,0,0,0,0,0,0,0,0,0,2,0,0,1,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,3,2,3,3,1,2,3,2,2,2,3,3,3,3,3,2,2,3,1,2,0,2,1,2,0,0,
+0,0,0,0,0,0,0,0,0,0,3,0,0,1,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,1,3,3,3,3,3,2,3,3,3,2,3,3,2,3,2,2,2,3,1,2,0,1,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,3,3,3,3,3,1,1,1,2,2,1,3,1,3,2,2,3,0,0,1,0,1,0,1,0,0,
+0,0,0,1,0,0,0,0,1,0,2,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,2,2,3,2,2,3,1,2,1,1,1,2,3,1,3,1,2,2,0,1,1,1,1,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,1,3,2,2,3,3,1,2,3,1,1,3,3,3,3,1,2,2,1,1,1,0,2,0,2,0,1,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,1,2,2,3,3,3,2,2,1,1,2,0,2,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,0,1,2,1,3,3,2,3,3,3,3,3,2,3,2,1,0,3,1,2,1,2,1,2,3,2,1,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,1,1,2,3,3,3,3,3,3,3,3,3,3,3,3,0,0,3,1,3,3,2,3,3,2,2,2,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,3,3,3,3,0,3,3,3,3,3,2,1,1,2,1,3,3,0,3,1,1,1,1,3,2,0,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,2,2,2,3,3,3,3,3,3,3,3,3,3,3,1,1,3,1,3,3,2,3,2,2,2,3,0,2,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,2,3,3,2,2,3,2,1,1,1,1,1,3,1,3,1,1,0,0,0,1,0,0,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,2,3,2,0,3,2,0,3,0,2,0,0,2,1,3,1,0,0,1,0,0,0,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,2,1,1,1,1,2,1,1,2,1,1,1,2,2,1,2,1,1,1,0,1,1,0,1,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,2,1,3,1,1,2,1,3,2,1,1,0,1,2,3,2,1,1,1,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,3,3,3,3,2,2,1,0,1,0,0,1,0,0,0,2,1,0,3,0,0,1,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,2,3,2,3,3,1,3,2,1,1,1,2,1,1,2,1,3,0,1,0,0,0,1,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,1,1,2,2,3,3,2,3,2,2,2,3,1,2,2,1,1,2,1,1,2,2,0,1,1,0,1,0,2,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,2,1,3,1,0,2,2,1,3,2,1,0,0,2,0,2,0,1,0,0,0,0,0,0,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,3,1,2,0,2,3,1,2,3,2,0,1,3,1,2,1,1,1,0,0,1,0,0,2,2,2,3,
+2,2,2,2,1,2,1,1,2,2,1,1,2,0,1,1,1,0,0,1,1,0,0,1,1,0,0,0,1,1,0,1,
+3,3,3,3,3,2,1,2,2,1,2,0,2,0,1,0,1,2,1,2,1,1,0,0,0,1,0,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,1,
+3,3,2,3,3,1,1,3,1,0,3,2,1,0,0,0,1,2,0,2,0,1,0,0,0,1,0,1,2,1,2,2,
+1,1,1,1,1,1,1,2,2,2,1,1,1,1,1,1,1,0,1,2,1,1,1,0,0,0,0,0,1,1,0,0,
+3,1,0,1,0,2,3,2,2,2,3,2,2,2,2,2,1,0,2,1,2,1,1,1,0,1,2,1,2,2,2,1,
+1,1,2,2,2,2,1,2,1,1,0,1,2,1,2,2,2,1,1,1,0,1,1,1,1,2,0,1,0,0,0,0,
+2,3,2,3,3,0,0,2,1,0,2,1,0,0,0,0,2,3,0,2,0,0,0,0,0,1,0,0,2,0,1,2,
+2,1,2,1,2,2,1,1,1,2,1,1,1,0,1,2,2,1,1,1,1,1,0,1,1,1,0,0,1,2,0,0,
+3,3,2,2,3,0,2,3,1,1,2,0,0,0,1,0,0,2,0,2,0,0,0,1,0,1,0,1,2,0,2,2,
+1,1,1,1,2,1,0,1,2,2,2,1,1,1,1,1,1,1,0,1,1,1,0,0,0,0,0,0,1,1,0,0,
+2,3,2,3,3,0,0,3,0,1,1,0,1,0,0,0,2,2,1,2,0,0,0,0,0,0,0,0,2,0,1,2,
+2,2,1,1,1,1,1,2,2,2,1,0,2,0,1,0,1,0,0,1,0,1,0,0,1,0,0,0,0,1,0,0,
+3,3,3,3,2,2,2,2,2,0,2,1,1,1,1,2,1,2,1,1,0,2,0,1,0,1,0,0,2,0,1,2,
+1,1,1,1,1,1,1,2,2,1,1,0,2,0,1,0,2,0,0,1,1,1,0,0,2,0,0,0,1,1,0,0,
+2,3,3,3,3,1,0,0,0,0,0,0,0,0,0,0,2,0,0,1,1,0,0,0,0,0,0,1,2,0,1,2,
+2,2,2,1,1,2,1,1,2,2,2,1,2,0,1,1,1,1,1,1,0,1,1,1,1,0,0,1,1,1,0,0,
+2,3,3,3,3,0,2,2,0,2,1,0,0,0,1,1,1,2,0,2,0,0,0,3,0,0,0,0,2,0,2,2,
+1,1,1,2,1,2,1,1,2,2,2,1,2,0,1,1,1,0,1,1,1,1,0,2,1,0,0,0,1,1,0,0,
+2,3,3,3,3,0,2,1,0,0,2,0,0,0,0,0,1,2,0,2,0,0,0,0,0,0,0,0,2,0,1,2,
+1,1,1,2,1,1,1,1,2,2,2,0,1,0,1,1,1,0,0,1,1,1,0,0,1,0,0,0,0,1,0,0,
+3,3,2,2,3,0,1,0,1,0,0,0,0,0,0,0,1,1,0,3,0,0,0,0,0,0,0,0,1,0,2,2,
+1,1,1,1,1,2,1,1,2,2,1,2,2,1,0,1,1,1,1,1,0,1,0,0,1,0,0,0,1,1,0,0,
+3,1,0,1,0,2,2,2,2,3,2,1,1,1,2,3,0,0,1,0,2,1,1,0,1,1,1,1,2,1,1,1,
+1,2,2,1,2,1,2,2,1,1,0,1,2,1,2,2,1,1,1,0,0,1,1,1,2,1,0,1,0,0,0,0,
+2,1,0,1,0,3,1,2,2,2,2,1,2,2,1,1,1,0,2,1,2,2,1,1,2,1,1,0,2,1,1,1,
+1,2,2,2,2,2,2,2,1,2,0,1,1,0,2,1,1,1,1,1,0,0,1,1,1,1,0,1,0,0,0,0,
+2,1,1,1,1,2,2,2,2,1,2,2,2,1,2,2,1,1,2,1,2,3,2,2,1,1,1,1,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,2,2,3,2,0,1,2,0,1,2,1,1,0,1,0,1,2,1,2,0,0,0,1,1,0,0,0,1,0,0,2,
+1,1,0,0,1,1,0,1,1,1,1,0,2,0,1,1,1,0,0,1,1,0,0,0,0,1,0,0,0,1,0,0,
+2,0,0,0,0,1,2,2,2,2,2,2,2,1,2,1,1,1,1,1,1,1,0,1,1,1,1,1,2,1,1,1,
+1,2,2,2,2,1,1,2,1,2,1,1,1,0,2,1,2,1,1,1,0,2,1,1,1,1,0,1,0,0,0,0,
+3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,1,0,
+1,1,0,1,0,1,1,1,1,1,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,2,2,3,2,0,0,0,0,1,0,0,0,0,0,0,1,1,0,2,0,0,0,0,0,0,0,0,1,0,1,2,
+1,1,1,1,1,1,0,0,2,2,2,2,2,0,1,1,0,1,1,1,1,1,0,0,1,0,0,0,1,1,0,1,
+2,3,1,2,1,0,1,1,0,2,2,2,0,0,1,0,0,1,1,1,1,0,0,0,0,0,0,0,1,0,1,2,
+1,1,1,1,2,1,1,1,1,1,1,1,1,0,1,1,0,1,0,1,0,1,0,0,1,0,0,0,0,1,0,0,
+2,2,2,2,2,0,0,2,0,0,2,0,0,0,0,0,0,1,0,1,0,0,0,0,0,0,0,0,2,0,2,2,
+1,1,1,1,1,0,0,1,2,1,1,0,1,0,1,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,
+1,2,2,2,2,0,0,2,0,1,1,0,0,0,1,0,0,2,0,2,0,0,0,0,0,0,0,0,0,0,1,1,
+0,0,0,1,1,1,1,1,1,1,1,1,1,0,1,0,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,
+1,2,2,3,2,0,0,1,0,0,1,0,0,0,0,0,0,1,0,2,0,0,0,1,0,0,0,0,0,0,0,2,
+1,1,0,0,1,0,0,0,1,1,0,0,1,0,1,1,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,
+2,1,2,2,2,1,2,1,2,2,1,1,2,1,1,1,0,1,1,1,1,2,0,1,0,1,1,1,1,0,1,1,
+1,1,2,1,1,1,1,1,1,0,0,1,2,1,1,1,1,1,1,0,0,1,1,1,0,0,0,0,0,0,0,0,
+1,0,0,1,3,1,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,2,2,2,1,0,0,1,0,2,0,0,0,0,0,1,1,1,0,1,0,0,0,0,0,0,0,0,2,0,0,1,
+0,2,0,1,0,0,1,1,2,0,1,0,1,0,1,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,
+1,2,2,2,2,0,1,1,0,2,1,0,1,1,1,0,0,1,0,2,0,1,0,0,0,0,0,0,0,0,0,1,
+0,1,0,0,1,0,0,0,1,1,0,0,1,0,0,1,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,
+2,2,2,2,2,0,0,1,0,0,0,1,0,1,0,0,0,1,0,1,0,0,0,0,0,0,0,0,0,0,0,1,
+0,1,0,1,1,1,0,0,1,1,1,0,1,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,
+2,0,1,0,0,1,2,1,1,1,1,1,1,2,2,1,0,0,1,0,1,0,0,0,0,1,1,1,1,0,0,0,
+1,1,2,1,1,1,1,0,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,2,1,2,1,0,0,1,0,0,0,0,0,0,0,0,1,1,0,1,0,0,0,0,0,0,0,0,0,0,0,1,
+0,0,0,0,0,0,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,1,2,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,0,0,0,
+0,1,1,0,1,1,1,0,0,1,0,0,1,0,1,0,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,
+1,0,1,0,0,1,1,1,1,1,1,1,1,1,1,1,0,0,1,0,2,0,0,2,0,1,0,0,1,0,0,1,
+1,1,0,0,1,1,0,1,0,0,0,1,0,0,1,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,1,0,
+1,1,1,1,1,1,1,2,0,0,0,0,0,0,2,1,0,1,1,0,0,1,1,1,0,1,0,0,0,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,1,0,1,1,0,1,1,1,1,1,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+)
+
+Latin5BulgarianModel = {
+  'charToOrderMap': Latin5_BulgarianCharToOrderMap,
+  'precedenceMatrix': BulgarianLangModel,
+  'mTypicalPositiveRatio': 0.969392,
+  'keepEnglishLetter': False,
+  'charsetName': "ISO-8859-5"
+}
+
+Win1251BulgarianModel = {
+  'charToOrderMap': win1251BulgarianCharToOrderMap,
+  'precedenceMatrix': BulgarianLangModel,
+  'mTypicalPositiveRatio': 0.969392,
+  'keepEnglishLetter': False,
+  'charsetName': "windows-1251"
+}
+
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langcyrillicmodel.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langcyrillicmodel.py
new file mode 100644
index 0000000..a86f54b
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langcyrillicmodel.py
@@ -0,0 +1,329 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# KOI8-R language model
+# Character Mapping Table:
+KOI8R_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253,142,143,144,145,146,147,148,149,150,151,152, 74,153, 75,154,  # 40
+155,156,157,158,159,160,161,162,163,164,165,253,253,253,253,253,  # 50
+253, 71,172, 66,173, 65,174, 76,175, 64,176,177, 77, 72,178, 69,  # 60
+ 67,179, 78, 73,180,181, 79,182,183,184,185,253,253,253,253,253,  # 70
+191,192,193,194,195,196,197,198,199,200,201,202,203,204,205,206,  # 80
+207,208,209,210,211,212,213,214,215,216,217,218,219,220,221,222,  # 90
+223,224,225, 68,226,227,228,229,230,231,232,233,234,235,236,237,  # a0
+238,239,240,241,242,243,244,245,246,247,248,249,250,251,252,253,  # b0
+ 27,  3, 21, 28, 13,  2, 39, 19, 26,  4, 23, 11,  8, 12,  5,  1,  # c0
+ 15, 16,  9,  7,  6, 14, 24, 10, 17, 18, 20, 25, 30, 29, 22, 54,  # d0
+ 59, 37, 44, 58, 41, 48, 53, 46, 55, 42, 60, 36, 49, 38, 31, 34,  # e0
+ 35, 43, 45, 32, 40, 52, 56, 33, 61, 62, 51, 57, 47, 63, 50, 70,  # f0
+)
+
+win1251_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253,142,143,144,145,146,147,148,149,150,151,152, 74,153, 75,154,  # 40
+155,156,157,158,159,160,161,162,163,164,165,253,253,253,253,253,  # 50
+253, 71,172, 66,173, 65,174, 76,175, 64,176,177, 77, 72,178, 69,  # 60
+ 67,179, 78, 73,180,181, 79,182,183,184,185,253,253,253,253,253,  # 70
+191,192,193,194,195,196,197,198,199,200,201,202,203,204,205,206,
+207,208,209,210,211,212,213,214,215,216,217,218,219,220,221,222,
+223,224,225,226,227,228,229,230,231,232,233,234,235,236,237,238,
+239,240,241,242,243,244,245,246, 68,247,248,249,250,251,252,253,
+ 37, 44, 33, 46, 41, 48, 56, 51, 42, 60, 36, 49, 38, 31, 34, 35,
+ 45, 32, 40, 52, 53, 55, 58, 50, 57, 63, 70, 62, 61, 47, 59, 43,
+  3, 21, 10, 19, 13,  2, 24, 20,  4, 23, 11,  8, 12,  5,  1, 15,
+  9,  7,  6, 14, 39, 26, 28, 22, 25, 29, 54, 18, 17, 30, 27, 16,
+)
+
+latin5_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253,142,143,144,145,146,147,148,149,150,151,152, 74,153, 75,154,  # 40
+155,156,157,158,159,160,161,162,163,164,165,253,253,253,253,253,  # 50
+253, 71,172, 66,173, 65,174, 76,175, 64,176,177, 77, 72,178, 69,  # 60
+ 67,179, 78, 73,180,181, 79,182,183,184,185,253,253,253,253,253,  # 70
+191,192,193,194,195,196,197,198,199,200,201,202,203,204,205,206,
+207,208,209,210,211,212,213,214,215,216,217,218,219,220,221,222,
+223,224,225,226,227,228,229,230,231,232,233,234,235,236,237,238,
+ 37, 44, 33, 46, 41, 48, 56, 51, 42, 60, 36, 49, 38, 31, 34, 35,
+ 45, 32, 40, 52, 53, 55, 58, 50, 57, 63, 70, 62, 61, 47, 59, 43,
+  3, 21, 10, 19, 13,  2, 24, 20,  4, 23, 11,  8, 12,  5,  1, 15,
+  9,  7,  6, 14, 39, 26, 28, 22, 25, 29, 54, 18, 17, 30, 27, 16,
+239, 68,240,241,242,243,244,245,246,247,248,249,250,251,252,255,
+)
+
+macCyrillic_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253,142,143,144,145,146,147,148,149,150,151,152, 74,153, 75,154,  # 40
+155,156,157,158,159,160,161,162,163,164,165,253,253,253,253,253,  # 50
+253, 71,172, 66,173, 65,174, 76,175, 64,176,177, 77, 72,178, 69,  # 60
+ 67,179, 78, 73,180,181, 79,182,183,184,185,253,253,253,253,253,  # 70
+ 37, 44, 33, 46, 41, 48, 56, 51, 42, 60, 36, 49, 38, 31, 34, 35,
+ 45, 32, 40, 52, 53, 55, 58, 50, 57, 63, 70, 62, 61, 47, 59, 43,
+191,192,193,194,195,196,197,198,199,200,201,202,203,204,205,206,
+207,208,209,210,211,212,213,214,215,216,217,218,219,220,221,222,
+223,224,225,226,227,228,229,230,231,232,233,234,235,236,237,238,
+239,240,241,242,243,244,245,246,247,248,249,250,251,252, 68, 16,
+  3, 21, 10, 19, 13,  2, 24, 20,  4, 23, 11,  8, 12,  5,  1, 15,
+  9,  7,  6, 14, 39, 26, 28, 22, 25, 29, 54, 18, 17, 30, 27,255,
+)
+
+IBM855_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253,142,143,144,145,146,147,148,149,150,151,152, 74,153, 75,154,  # 40
+155,156,157,158,159,160,161,162,163,164,165,253,253,253,253,253,  # 50
+253, 71,172, 66,173, 65,174, 76,175, 64,176,177, 77, 72,178, 69,  # 60
+ 67,179, 78, 73,180,181, 79,182,183,184,185,253,253,253,253,253,  # 70
+191,192,193,194, 68,195,196,197,198,199,200,201,202,203,204,205,
+206,207,208,209,210,211,212,213,214,215,216,217, 27, 59, 54, 70,
+  3, 37, 21, 44, 28, 58, 13, 41,  2, 48, 39, 53, 19, 46,218,219,
+220,221,222,223,224, 26, 55,  4, 42,225,226,227,228, 23, 60,229,
+230,231,232,233,234,235, 11, 36,236,237,238,239,240,241,242,243,
+  8, 49, 12, 38,  5, 31,  1, 34, 15,244,245,246,247, 35, 16,248,
+ 43,  9, 45,  7, 32,  6, 40, 14, 52, 24, 56, 10, 33, 17, 61,249,
+250, 18, 62, 20, 51, 25, 57, 30, 47, 29, 63, 22, 50,251,252,255,
+)
+
+IBM866_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253,142,143,144,145,146,147,148,149,150,151,152, 74,153, 75,154,  # 40
+155,156,157,158,159,160,161,162,163,164,165,253,253,253,253,253,  # 50
+253, 71,172, 66,173, 65,174, 76,175, 64,176,177, 77, 72,178, 69,  # 60
+ 67,179, 78, 73,180,181, 79,182,183,184,185,253,253,253,253,253,  # 70
+ 37, 44, 33, 46, 41, 48, 56, 51, 42, 60, 36, 49, 38, 31, 34, 35,
+ 45, 32, 40, 52, 53, 55, 58, 50, 57, 63, 70, 62, 61, 47, 59, 43,
+  3, 21, 10, 19, 13,  2, 24, 20,  4, 23, 11,  8, 12,  5,  1, 15,
+191,192,193,194,195,196,197,198,199,200,201,202,203,204,205,206,
+207,208,209,210,211,212,213,214,215,216,217,218,219,220,221,222,
+223,224,225,226,227,228,229,230,231,232,233,234,235,236,237,238,
+  9,  7,  6, 14, 39, 26, 28, 22, 25, 29, 54, 18, 17, 30, 27, 16,
+239, 68,240,241,242,243,244,245,246,247,248,249,250,251,252,255,
+)
+
+# Model Table:
+# total sequences: 100%
+# first 512 sequences: 97.6601%
+# first 1024 sequences: 2.3389%
+# rest  sequences:      0.1237%
+# negative sequences:   0.0009%
+RussianLangModel = (
+0,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,1,1,3,3,3,3,1,3,3,3,2,3,2,3,3,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,0,3,2,2,2,2,2,0,0,2,
+3,3,3,2,3,3,3,3,3,3,3,3,3,3,2,3,3,0,0,3,3,3,3,3,3,3,3,3,2,3,2,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,2,2,3,3,3,3,3,3,3,3,3,2,3,3,0,0,3,3,3,3,3,3,3,3,2,3,3,1,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,2,3,2,3,3,3,3,3,3,3,3,3,3,3,3,3,0,0,3,3,3,3,3,3,3,3,3,3,3,2,1,
+0,0,0,0,0,0,0,2,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,3,0,0,3,3,3,3,3,3,3,3,3,3,3,2,1,
+0,0,0,0,0,1,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,2,2,2,3,1,3,3,1,3,3,3,3,2,2,3,0,2,2,2,3,3,2,1,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,2,3,3,3,3,3,2,2,3,2,3,3,3,2,1,2,2,0,1,2,2,2,2,2,2,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,2,2,3,0,2,2,3,3,2,1,2,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,1,0,0,2,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,2,3,3,1,2,3,2,2,3,2,3,3,3,3,2,2,3,0,3,2,2,3,1,1,1,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,2,2,3,3,3,3,3,2,3,3,3,3,2,2,2,0,3,3,3,2,2,2,2,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,2,3,2,3,3,3,3,3,3,2,3,2,2,0,1,3,2,1,2,2,1,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,3,2,1,1,3,0,1,1,1,1,2,1,1,0,2,2,2,1,2,0,1,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,2,3,3,2,2,2,2,1,3,2,3,2,3,2,1,2,2,0,1,1,2,1,2,1,2,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,3,3,2,2,3,2,3,3,3,2,2,2,2,0,2,2,2,2,3,1,1,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,
+3,2,3,2,2,3,3,3,3,3,3,3,3,3,1,3,2,0,0,3,3,3,3,2,3,3,3,3,2,3,2,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,3,3,3,3,3,2,2,3,3,0,2,1,0,3,2,3,2,3,0,0,1,2,0,0,1,0,1,2,1,1,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,3,0,2,3,3,3,3,2,3,3,3,3,1,2,2,0,0,2,3,2,2,2,3,2,3,2,2,3,0,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,2,3,0,2,3,2,3,0,1,2,3,3,2,0,2,3,0,0,2,3,2,2,0,1,3,1,3,2,2,1,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,1,3,0,2,3,3,3,3,3,3,3,3,2,1,3,2,0,0,2,2,3,3,3,2,3,3,0,2,2,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,2,2,3,3,2,2,2,3,3,0,0,1,1,1,1,1,2,0,0,1,1,1,1,0,1,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,2,2,3,3,3,3,3,3,3,0,3,2,3,3,2,3,2,0,2,1,0,1,1,0,1,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,2,3,3,3,2,2,2,2,3,1,3,2,3,1,1,2,1,0,2,2,2,2,1,3,1,0,
+0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,
+2,2,3,3,3,3,3,1,2,2,1,3,1,0,3,0,0,3,0,0,0,1,1,0,1,2,1,0,0,0,0,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,2,2,1,1,3,3,3,2,2,1,2,2,3,1,1,2,0,0,2,2,1,3,0,0,2,1,1,2,1,1,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,2,3,3,3,3,1,2,2,2,1,2,1,3,3,1,1,2,1,2,1,2,2,0,2,0,0,1,1,0,1,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,3,3,3,3,3,2,1,3,2,2,3,2,0,3,2,0,3,0,1,0,1,1,0,0,1,1,1,1,0,1,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,2,3,3,3,2,2,2,3,3,1,2,1,2,1,0,1,0,1,1,0,1,0,0,2,1,1,1,0,1,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,
+3,1,1,2,1,2,3,3,2,2,1,2,2,3,0,2,1,0,0,2,2,3,2,1,2,2,2,2,2,3,1,0,
+0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,1,1,0,1,1,2,2,1,1,3,0,0,1,3,1,1,1,0,0,0,1,0,1,1,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,1,3,3,3,2,0,0,0,2,1,0,1,0,2,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,0,1,0,0,2,3,2,2,2,1,2,2,2,1,2,1,0,0,1,1,1,0,2,0,1,1,1,0,0,1,1,
+1,0,0,0,0,0,1,2,0,0,0,0,0,1,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,
+2,3,3,3,3,0,0,0,0,1,0,0,0,0,3,0,1,2,1,0,0,0,0,0,0,0,1,1,0,0,1,1,
+1,0,1,0,1,2,0,0,1,1,2,1,0,1,1,1,1,0,1,1,1,1,0,1,0,0,1,0,0,1,1,0,
+2,2,3,2,2,2,3,1,2,2,2,2,2,2,2,2,1,1,1,1,1,1,1,0,1,0,1,1,1,0,2,1,
+1,1,1,1,1,1,1,1,2,1,1,1,1,1,1,1,1,1,1,0,1,0,1,1,0,1,1,1,0,1,1,0,
+3,3,3,2,2,2,2,3,2,2,1,1,2,2,2,2,1,1,3,1,2,1,2,0,0,1,1,0,1,0,2,1,
+1,1,1,1,1,2,1,0,1,1,1,1,0,1,0,0,1,1,0,0,1,0,1,0,0,1,0,0,0,1,1,0,
+2,0,0,1,0,3,2,2,2,2,1,2,1,2,1,2,0,0,0,2,1,2,2,1,1,2,2,0,1,1,0,2,
+1,1,1,1,1,0,1,1,1,2,1,1,1,2,1,0,1,2,1,1,1,1,0,1,1,1,0,0,1,0,0,1,
+1,3,2,2,2,1,1,1,2,3,0,0,0,0,2,0,2,2,1,0,0,0,0,0,0,1,0,0,0,0,1,1,
+1,0,1,1,0,1,0,1,1,0,1,1,0,2,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,1,1,0,
+2,3,2,3,2,1,2,2,2,2,1,0,0,0,2,0,0,1,1,0,0,0,0,0,0,0,1,1,0,0,2,1,
+1,1,2,1,0,2,0,0,1,0,1,0,0,1,0,0,1,1,0,1,1,0,0,0,0,0,1,0,0,0,0,0,
+3,0,0,1,0,2,2,2,3,2,2,2,2,2,2,2,0,0,0,2,1,2,1,1,1,2,2,0,0,0,1,2,
+1,1,1,1,1,0,1,2,1,1,1,1,1,1,1,0,1,1,1,1,1,1,0,1,1,1,1,1,1,0,0,1,
+2,3,2,3,3,2,0,1,1,1,0,0,1,0,2,0,1,1,3,1,0,0,0,0,0,0,0,1,0,0,2,1,
+1,1,1,1,1,1,1,0,1,0,1,1,1,1,0,1,1,1,0,0,1,1,0,1,0,0,0,0,0,0,1,0,
+2,3,3,3,3,1,2,2,2,2,0,1,1,0,2,1,1,1,2,1,0,1,1,0,0,1,0,1,0,0,2,0,
+0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,3,3,3,2,0,0,1,1,2,2,1,0,0,2,0,1,1,3,0,0,1,0,0,0,0,0,1,0,1,2,1,
+1,1,2,0,1,1,1,0,1,0,1,1,0,1,0,1,1,1,1,0,1,0,0,0,0,0,0,1,0,1,1,0,
+1,3,2,3,2,1,0,0,2,2,2,0,1,0,2,0,1,1,1,0,1,0,0,0,3,0,1,1,0,0,2,1,
+1,1,1,0,1,1,0,0,0,0,1,1,0,1,0,0,2,1,1,0,1,0,0,0,1,0,1,0,0,1,1,0,
+3,1,2,1,1,2,2,2,2,2,2,1,2,2,1,1,0,0,0,2,2,2,0,0,0,1,2,1,0,1,0,1,
+2,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,2,1,1,1,0,1,0,1,1,0,1,1,1,0,0,1,
+3,0,0,0,0,2,0,1,1,1,1,1,1,1,0,1,0,0,0,1,1,1,0,1,0,1,1,0,0,1,0,1,
+1,1,0,0,1,0,0,0,1,0,1,1,0,0,1,0,1,0,1,0,0,0,0,1,0,0,0,1,0,0,0,1,
+1,3,3,2,2,0,0,0,2,2,0,0,0,1,2,0,1,1,2,0,0,0,0,0,0,0,0,1,0,0,2,1,
+0,1,1,0,0,1,1,0,0,0,1,1,0,1,1,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,1,0,
+2,3,2,3,2,0,0,0,0,1,1,0,0,0,2,0,2,0,2,0,0,0,0,0,1,0,0,1,0,0,1,1,
+1,1,2,0,1,2,1,0,1,1,2,1,1,1,1,1,2,1,1,0,1,0,0,1,1,1,1,1,0,1,1,0,
+1,3,2,2,2,1,0,0,2,2,1,0,1,2,2,0,0,1,0,0,0,0,0,0,0,0,0,1,0,0,1,1,
+0,0,1,1,0,1,1,0,0,1,1,0,1,1,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,1,0,2,3,1,2,2,2,2,2,2,1,1,0,0,0,1,0,1,0,2,1,1,1,0,0,0,0,1,
+1,1,0,1,1,0,1,1,1,1,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,0,0,0,
+2,0,2,0,0,1,0,3,2,1,2,1,2,2,0,1,0,0,0,2,1,0,0,2,1,1,1,1,0,2,0,2,
+2,1,1,1,1,1,1,1,1,1,1,1,1,2,1,0,1,1,1,1,0,0,0,1,1,1,1,0,1,0,0,1,
+1,2,2,2,2,1,0,0,1,0,0,0,0,0,2,0,1,1,1,1,0,0,0,0,1,0,1,2,0,0,2,0,
+1,0,1,1,1,2,1,0,1,0,1,1,0,0,1,0,1,1,1,0,1,0,0,0,1,0,0,1,0,1,1,0,
+2,1,2,2,2,0,3,0,1,1,0,0,0,0,2,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+0,0,0,1,1,1,0,0,1,0,1,0,0,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,1,0,0,
+1,2,2,3,2,2,0,0,1,1,2,0,1,2,1,0,1,0,1,0,0,1,0,0,0,0,0,0,0,0,0,1,
+0,1,1,0,0,1,1,0,0,1,1,0,0,1,1,0,1,1,0,0,1,0,0,0,0,0,0,0,0,1,1,0,
+2,2,1,1,2,1,2,2,2,2,2,1,2,2,0,1,0,0,0,1,2,2,2,1,2,1,1,1,1,1,2,1,
+1,1,1,1,1,1,1,1,1,1,0,0,1,1,1,0,1,1,1,0,0,0,0,1,1,1,0,1,1,0,0,1,
+1,2,2,2,2,0,1,0,2,2,0,0,0,0,2,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,2,0,
+0,0,1,0,0,1,0,0,0,0,1,0,1,1,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,
+0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,2,2,2,2,0,0,0,2,2,2,0,1,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,1,1,
+0,1,1,0,0,1,1,0,0,0,1,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,2,2,2,2,0,0,0,0,1,0,0,1,1,2,0,0,0,0,1,0,1,0,0,1,0,0,2,0,0,0,1,
+0,0,1,0,0,1,0,0,0,1,1,0,0,0,0,0,1,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,
+1,2,2,2,1,1,2,0,2,1,1,1,1,0,2,2,0,0,0,0,0,0,0,0,0,1,1,0,0,0,1,1,
+0,0,1,0,1,1,0,0,0,0,1,0,0,0,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,
+1,0,2,1,2,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,1,0,0,0,0,
+0,0,1,0,1,1,0,0,0,0,1,0,0,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,1,0,
+1,0,0,0,0,2,0,1,2,1,0,1,1,1,0,1,0,0,0,1,0,1,0,0,1,0,1,0,0,0,0,1,
+0,0,0,0,0,1,0,0,1,1,0,0,1,1,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,1,
+2,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+1,0,0,0,1,0,0,0,1,1,0,0,0,0,0,0,0,1,0,0,0,0,0,1,0,0,1,0,0,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+1,1,1,0,1,0,1,0,0,1,1,1,1,0,0,0,1,0,0,0,0,1,0,0,0,1,0,1,0,0,0,0,
+1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+1,1,0,1,1,0,1,0,1,0,0,0,0,1,1,0,1,1,0,0,0,0,0,1,0,1,1,0,1,0,0,0,
+0,1,1,1,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,1,0,0,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,
+)
+
+Koi8rModel = {
+  'charToOrderMap': KOI8R_CharToOrderMap,
+  'precedenceMatrix': RussianLangModel,
+  'mTypicalPositiveRatio': 0.976601,
+  'keepEnglishLetter': False,
+  'charsetName': "KOI8-R"
+}
+
+Win1251CyrillicModel = {
+  'charToOrderMap': win1251_CharToOrderMap,
+  'precedenceMatrix': RussianLangModel,
+  'mTypicalPositiveRatio': 0.976601,
+  'keepEnglishLetter': False,
+  'charsetName': "windows-1251"
+}
+
+Latin5CyrillicModel = {
+  'charToOrderMap': latin5_CharToOrderMap,
+  'precedenceMatrix': RussianLangModel,
+  'mTypicalPositiveRatio': 0.976601,
+  'keepEnglishLetter': False,
+  'charsetName': "ISO-8859-5"
+}
+
+MacCyrillicModel = {
+  'charToOrderMap': macCyrillic_CharToOrderMap,
+  'precedenceMatrix': RussianLangModel,
+  'mTypicalPositiveRatio': 0.976601,
+  'keepEnglishLetter': False,
+  'charsetName': "MacCyrillic"
+};
+
+Ibm866Model = {
+  'charToOrderMap': IBM866_CharToOrderMap,
+  'precedenceMatrix': RussianLangModel,
+  'mTypicalPositiveRatio': 0.976601,
+  'keepEnglishLetter': False,
+  'charsetName': "IBM866"
+}
+
+Ibm855Model = {
+  'charToOrderMap': IBM855_CharToOrderMap,
+  'precedenceMatrix': RussianLangModel,
+  'mTypicalPositiveRatio': 0.976601,
+  'keepEnglishLetter': False,
+  'charsetName': "IBM855"
+}
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langgreekmodel.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langgreekmodel.py
new file mode 100644
index 0000000..ddb5837
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langgreekmodel.py
@@ -0,0 +1,225 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# 255: Control characters that usually does not exist in any text
+# 254: Carriage/Return
+# 253: symbol (punctuation) that does not belong to word
+# 252: 0 - 9
+
+# Character Mapping Table:
+Latin7_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253, 82,100,104, 94, 98,101,116,102,111,187,117, 92, 88,113, 85,  # 40
+ 79,118,105, 83, 67,114,119, 95, 99,109,188,253,253,253,253,253,  # 50
+253, 72, 70, 80, 81, 60, 96, 93, 89, 68,120, 97, 77, 86, 69, 55,  # 60
+ 78,115, 65, 66, 58, 76,106,103, 87,107,112,253,253,253,253,253,  # 70
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 80
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 90
+253,233, 90,253,253,253,253,253,253,253,253,253,253, 74,253,253,  # a0
+253,253,253,253,247,248, 61, 36, 46, 71, 73,253, 54,253,108,123,  # b0
+110, 31, 51, 43, 41, 34, 91, 40, 52, 47, 44, 53, 38, 49, 59, 39,  # c0
+ 35, 48,250, 37, 33, 45, 56, 50, 84, 57,120,121, 17, 18, 22, 15,  # d0
+124,  1, 29, 20, 21,  3, 32, 13, 25,  5, 11, 16, 10,  6, 30,  4,  # e0
+  9,  8, 14,  7,  2, 12, 28, 23, 42, 24, 64, 75, 19, 26, 27,253,  # f0
+)
+
+win1253_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253, 82,100,104, 94, 98,101,116,102,111,187,117, 92, 88,113, 85,  # 40
+ 79,118,105, 83, 67,114,119, 95, 99,109,188,253,253,253,253,253,  # 50
+253, 72, 70, 80, 81, 60, 96, 93, 89, 68,120, 97, 77, 86, 69, 55,  # 60
+ 78,115, 65, 66, 58, 76,106,103, 87,107,112,253,253,253,253,253,  # 70
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 80
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 90
+253,233, 61,253,253,253,253,253,253,253,253,253,253, 74,253,253,  # a0
+253,253,253,253,247,253,253, 36, 46, 71, 73,253, 54,253,108,123,  # b0
+110, 31, 51, 43, 41, 34, 91, 40, 52, 47, 44, 53, 38, 49, 59, 39,  # c0
+ 35, 48,250, 37, 33, 45, 56, 50, 84, 57,120,121, 17, 18, 22, 15,  # d0
+124,  1, 29, 20, 21,  3, 32, 13, 25,  5, 11, 16, 10,  6, 30,  4,  # e0
+  9,  8, 14,  7,  2, 12, 28, 23, 42, 24, 64, 75, 19, 26, 27,253,  # f0
+)
+
+# Model Table:
+# total sequences: 100%
+# first 512 sequences: 98.2851%
+# first 1024 sequences:1.7001%
+# rest  sequences:     0.0359%
+# negative sequences:  0.0148%
+GreekLangModel = (
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,3,2,2,3,3,3,3,3,3,3,3,1,3,3,3,0,2,2,3,3,0,3,0,3,2,0,3,3,3,0,
+3,0,0,0,2,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,0,3,3,0,3,2,3,3,0,3,2,3,3,3,0,0,3,0,3,0,3,3,2,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,
+0,2,3,2,2,3,3,3,3,3,3,3,3,0,3,3,3,3,0,2,3,3,0,3,3,3,3,2,3,3,3,0,
+2,0,0,0,2,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,2,3,3,2,3,3,3,3,3,3,3,3,3,3,3,3,0,2,1,3,3,3,3,2,3,3,2,3,3,2,0,
+0,0,0,0,2,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,0,3,3,3,3,3,3,0,3,3,0,3,3,3,3,3,3,3,3,3,3,0,3,2,3,3,0,
+2,0,1,0,2,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,2,3,0,0,0,0,3,3,0,3,1,3,3,3,0,3,3,0,3,3,3,3,0,0,0,0,
+2,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,0,3,0,3,3,3,3,3,0,3,2,2,2,3,0,2,3,3,3,3,3,2,3,3,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,3,2,2,2,3,3,3,3,0,3,1,3,3,3,3,2,3,3,3,3,3,3,3,2,2,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,2,0,3,0,0,0,3,3,2,3,3,3,3,3,0,0,3,2,3,0,2,3,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,0,3,3,3,3,0,0,3,3,0,2,3,0,3,0,3,3,3,0,0,3,0,3,0,2,2,3,3,0,0,
+0,0,1,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,2,0,3,2,3,3,3,3,0,3,3,3,3,3,0,3,3,2,3,2,3,3,2,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,2,3,2,3,3,3,3,3,3,0,2,3,2,3,2,2,2,3,2,3,3,2,3,0,2,2,2,3,0,
+2,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,3,0,0,0,3,3,3,2,3,3,0,0,3,0,3,0,0,0,3,2,0,3,0,3,0,0,2,0,2,0,
+0,0,0,0,2,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,0,3,3,3,3,3,3,0,3,3,0,3,0,0,0,3,3,0,3,3,3,0,0,1,2,3,0,
+3,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,2,0,0,3,2,2,3,3,0,3,3,3,3,3,2,1,3,0,3,2,3,3,2,1,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,3,3,0,2,3,3,3,3,3,3,0,0,3,0,3,0,0,0,3,3,0,3,2,3,0,0,3,3,3,0,
+3,0,0,0,2,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,0,3,3,3,3,3,3,0,0,3,0,3,0,0,0,3,2,0,3,2,3,0,0,3,2,3,0,
+2,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,3,1,2,2,3,3,3,3,3,3,0,2,3,0,3,0,0,0,3,3,0,3,0,2,0,0,2,3,1,0,
+2,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,0,3,3,3,3,0,3,0,3,3,2,3,0,3,3,3,3,3,3,0,3,3,3,0,2,3,0,0,3,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,0,3,3,3,0,0,3,0,0,0,3,3,0,3,0,2,3,3,0,0,3,0,3,0,3,3,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,3,0,0,0,3,3,3,3,3,3,0,0,3,0,2,0,0,0,3,3,0,3,0,3,0,0,2,0,2,0,
+0,0,0,0,1,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,3,0,3,0,2,0,3,2,0,3,2,3,2,3,0,0,3,2,3,2,3,3,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,3,0,0,2,3,3,3,3,3,0,0,0,3,0,2,1,0,0,3,2,2,2,0,3,0,0,2,2,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,0,3,3,3,2,0,3,0,3,0,3,3,0,2,1,2,3,3,0,0,3,0,3,0,3,3,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,2,3,3,3,0,3,3,3,3,3,3,0,2,3,0,3,0,0,0,2,1,0,2,2,3,0,0,2,2,2,0,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,3,0,0,2,3,3,3,2,3,0,0,1,3,0,2,0,0,0,0,3,0,1,0,2,0,0,1,1,1,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,3,1,0,3,0,0,0,3,2,0,3,2,3,3,3,0,0,3,0,3,2,2,2,1,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,0,3,3,3,0,0,3,0,0,0,0,2,0,2,3,3,2,2,2,2,3,0,2,0,2,2,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,3,3,3,2,0,0,0,0,0,0,2,3,0,2,0,2,3,2,0,0,3,0,3,0,3,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,3,2,3,3,2,2,3,0,2,0,3,0,0,0,2,0,0,0,0,1,2,0,2,0,2,0,
+0,2,0,2,0,2,2,0,0,1,0,2,2,2,0,2,2,2,0,2,2,2,0,0,2,0,0,1,0,0,0,0,
+0,2,0,3,3,2,0,0,0,0,0,0,1,3,0,2,0,2,2,2,0,0,2,0,3,0,0,2,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,0,2,3,2,0,2,2,0,2,0,2,2,0,2,0,2,2,2,0,0,0,0,0,0,2,3,0,0,0,2,
+0,1,2,0,0,0,0,2,2,0,0,0,2,1,0,2,2,0,0,0,0,0,0,1,0,2,0,0,0,0,0,0,
+0,0,2,1,0,2,3,2,2,3,2,3,2,0,0,3,3,3,0,0,3,2,0,0,0,1,1,0,2,0,2,2,
+0,2,0,2,0,2,2,0,0,2,0,2,2,2,0,2,2,2,2,0,0,2,0,0,0,2,0,1,0,0,0,0,
+0,3,0,3,3,2,2,0,3,0,0,0,2,2,0,2,2,2,1,2,0,0,1,2,2,0,0,3,0,0,0,2,
+0,1,2,0,0,0,1,2,0,0,0,0,0,0,0,2,2,0,1,0,0,2,0,0,0,2,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,2,3,3,2,2,0,0,0,2,0,2,3,3,0,2,0,0,0,0,0,0,2,2,2,0,2,2,0,2,0,2,
+0,2,2,0,0,2,2,2,2,1,0,0,2,2,0,2,0,0,2,0,0,0,0,0,0,2,0,0,0,0,0,0,
+0,2,0,3,2,3,0,0,0,3,0,0,2,2,0,2,0,2,2,2,0,0,2,0,0,0,0,0,0,0,0,2,
+0,0,2,2,0,0,2,2,2,0,0,0,0,0,0,2,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,2,0,0,3,2,0,2,2,2,2,2,0,0,0,2,0,0,0,0,2,0,1,0,0,2,0,1,0,0,0,
+0,2,2,2,0,2,2,0,1,2,0,2,2,2,0,2,2,2,2,1,2,2,0,0,2,0,0,0,0,0,0,0,
+0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,
+0,2,0,2,0,2,2,0,0,0,0,1,2,1,0,0,2,2,0,0,2,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,3,2,3,0,0,2,0,0,0,2,2,0,2,0,0,0,1,0,0,2,0,2,0,2,2,0,0,0,0,
+0,0,2,0,0,0,0,2,2,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,
+0,2,2,3,2,2,0,0,0,0,0,0,1,3,0,2,0,2,2,0,0,0,1,0,2,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,2,0,2,0,3,2,0,2,0,0,0,0,0,0,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+0,0,2,0,0,0,0,1,1,0,0,2,1,2,0,2,2,0,1,0,0,1,0,0,0,2,0,0,0,0,0,0,
+0,3,0,2,2,2,0,0,2,0,0,0,2,0,0,0,2,3,0,2,0,0,0,0,0,0,2,2,0,0,0,2,
+0,1,2,0,0,0,1,2,2,1,0,0,0,2,0,0,2,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,2,1,2,0,2,2,0,2,0,0,2,0,0,0,0,1,2,1,0,2,1,0,0,0,0,0,0,0,0,0,0,
+0,0,2,0,0,0,3,1,2,2,0,2,0,0,0,0,2,0,0,0,2,0,0,3,0,0,0,0,2,2,2,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,2,1,0,2,0,1,2,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,1,0,0,0,0,0,0,2,
+0,2,2,0,0,2,2,2,2,2,0,1,2,0,0,0,2,2,0,1,0,2,0,0,2,2,0,0,0,0,0,0,
+0,0,0,0,1,0,0,0,0,0,0,0,3,0,0,2,0,0,0,0,0,0,0,0,2,0,2,0,0,0,0,2,
+0,1,2,0,0,0,0,2,2,1,0,1,0,1,0,2,2,2,1,0,0,0,0,0,0,1,0,0,0,0,0,0,
+0,2,0,1,2,0,0,0,0,0,0,0,0,0,0,2,0,0,2,2,0,0,0,0,1,0,0,0,0,0,0,2,
+0,2,2,0,0,0,0,2,2,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,2,0,0,2,0,0,0,
+0,2,2,2,2,0,0,0,3,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,2,0,0,0,0,0,0,1,
+0,0,2,0,0,0,0,1,2,0,0,0,0,0,0,2,2,1,1,0,0,0,0,0,0,1,0,0,0,0,0,0,
+0,2,0,2,2,2,0,0,2,0,0,0,0,0,0,0,2,2,2,0,0,0,2,0,0,0,0,0,0,0,0,2,
+0,0,1,0,0,0,0,2,1,0,0,0,0,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,
+0,3,0,2,0,0,0,0,0,0,0,0,2,0,0,0,0,0,2,0,0,0,0,0,0,0,2,0,0,0,0,2,
+0,0,2,0,0,0,0,2,2,0,0,0,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,2,0,2,2,1,0,0,0,0,0,0,2,0,0,2,0,2,2,2,0,0,0,0,0,0,2,0,0,0,0,2,
+0,0,2,0,0,2,0,2,2,0,0,0,0,2,0,2,0,0,0,0,0,2,0,0,0,2,0,0,0,0,0,0,
+0,0,3,0,0,0,2,2,0,2,2,0,0,0,0,0,2,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,2,0,0,0,0,0,
+0,2,2,2,2,2,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,1,
+0,0,0,0,0,0,0,2,1,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,2,2,0,0,0,0,0,2,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,
+0,2,0,0,0,2,0,0,0,0,0,1,0,0,0,0,2,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,1,0,2,0,0,0,
+0,2,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,1,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,1,0,0,2,0,2,0,0,0,
+0,0,0,0,0,0,0,0,2,1,0,0,0,0,0,0,2,0,0,0,1,2,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+)
+
+Latin7GreekModel = {
+  'charToOrderMap': Latin7_CharToOrderMap,
+  'precedenceMatrix': GreekLangModel,
+  'mTypicalPositiveRatio': 0.982851,
+  'keepEnglishLetter': False,
+  'charsetName': "ISO-8859-7"
+}
+
+Win1253GreekModel = {
+  'charToOrderMap': win1253_CharToOrderMap,
+  'precedenceMatrix': GreekLangModel,
+  'mTypicalPositiveRatio': 0.982851,
+  'keepEnglishLetter': False,
+  'charsetName': "windows-1253"
+}
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langhebrewmodel.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langhebrewmodel.py
new file mode 100644
index 0000000..75f2bc7
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langhebrewmodel.py
@@ -0,0 +1,201 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+#          Simon Montagu
+# Portions created by the Initial Developer are Copyright (C) 2005
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#   Shoshannah Forbes - original C code (?)
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# 255: Control characters that usually does not exist in any text
+# 254: Carriage/Return
+# 253: symbol (punctuation) that does not belong to word
+# 252: 0 - 9
+
+# Windows-1255 language model
+# Character Mapping Table:
+win1255_CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253, 69, 91, 79, 80, 92, 89, 97, 90, 68,111,112, 82, 73, 95, 85,  # 40
+ 78,121, 86, 71, 67,102,107, 84,114,103,115,253,253,253,253,253,  # 50
+253, 50, 74, 60, 61, 42, 76, 70, 64, 53,105, 93, 56, 65, 54, 49,  # 60
+ 66,110, 51, 43, 44, 63, 81, 77, 98, 75,108,253,253,253,253,253,  # 70
+124,202,203,204,205, 40, 58,206,207,208,209,210,211,212,213,214,
+215, 83, 52, 47, 46, 72, 32, 94,216,113,217,109,218,219,220,221,
+ 34,116,222,118,100,223,224,117,119,104,125,225,226, 87, 99,227,
+106,122,123,228, 55,229,230,101,231,232,120,233, 48, 39, 57,234,
+ 30, 59, 41, 88, 33, 37, 36, 31, 29, 35,235, 62, 28,236,126,237,
+238, 38, 45,239,240,241,242,243,127,244,245,246,247,248,249,250,
+  9,  8, 20, 16,  3,  2, 24, 14, 22,  1, 25, 15,  4, 11,  6, 23,
+ 12, 19, 13, 26, 18, 27, 21, 17,  7, 10,  5,251,252,128, 96,253,
+)
+
+# Model Table:
+# total sequences: 100%
+# first 512 sequences: 98.4004%
+# first 1024 sequences: 1.5981%
+# rest  sequences:      0.087%
+# negative sequences:   0.0015%
+HebrewLangModel = (
+0,3,3,3,3,3,3,3,3,3,3,2,3,3,3,3,3,3,3,3,3,3,3,2,3,2,1,2,0,1,0,0,
+3,0,3,1,0,0,1,3,2,0,1,1,2,0,2,2,2,1,1,1,1,2,1,1,1,2,0,0,2,2,0,1,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,2,2,2,
+1,2,1,2,1,2,0,0,2,0,0,0,0,0,1,0,1,0,0,0,0,0,0,1,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,2,2,
+1,2,1,3,1,1,0,0,2,0,0,0,1,0,1,0,1,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,1,0,1,2,2,1,3,
+1,2,1,1,2,2,0,0,2,2,0,0,0,0,1,0,1,0,0,0,1,0,0,0,0,0,0,1,0,1,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,3,2,2,2,2,3,2,
+1,2,1,2,2,2,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,3,2,3,2,2,3,2,2,2,1,2,2,2,2,
+1,2,1,1,2,2,0,1,2,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,0,2,2,2,2,2,
+0,2,0,2,2,2,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,0,2,2,2,
+0,2,1,2,2,2,0,0,2,1,0,0,0,0,1,0,1,0,0,0,0,0,0,2,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,2,3,3,3,3,3,3,3,3,3,3,3,3,3,2,1,2,3,2,2,2,
+1,2,1,2,2,2,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,1,0,0,0,0,0,1,1,0,
+3,3,3,3,3,3,3,3,3,2,3,3,3,2,3,3,3,3,3,3,3,3,3,3,3,3,3,1,0,2,0,2,
+0,2,1,2,2,2,0,0,1,2,0,0,0,0,1,0,1,0,0,0,0,0,0,1,0,0,0,2,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,2,3,2,2,3,2,1,2,1,1,1,
+0,1,1,1,1,1,3,0,1,0,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,1,1,0,1,1,0,0,1,0,0,1,0,0,0,0,
+0,0,1,0,0,0,0,0,2,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,2,2,2,2,2,2,
+0,2,0,1,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,2,3,3,3,2,1,2,3,3,2,3,3,3,3,2,3,2,1,2,0,2,1,2,
+0,2,0,2,2,2,0,0,1,2,0,0,0,0,1,0,1,0,0,0,0,0,0,0,0,0,0,1,0,0,1,0,
+3,3,3,3,3,3,3,3,3,2,3,3,3,1,2,2,3,3,2,3,2,3,2,2,3,1,2,2,0,2,2,2,
+0,2,1,2,2,2,0,0,1,2,0,0,0,0,1,0,0,0,0,0,1,0,0,1,0,0,0,1,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,3,3,2,3,3,2,2,2,3,3,3,3,1,3,2,2,2,
+0,2,0,1,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,2,3,3,3,2,3,2,2,2,1,2,2,0,2,2,2,2,
+0,2,0,2,2,2,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,2,3,3,3,1,3,2,3,3,2,3,3,2,2,1,2,2,2,2,2,2,
+0,2,1,2,1,2,0,0,1,0,0,0,0,0,1,0,0,0,0,0,1,0,0,1,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,2,3,2,3,3,2,3,3,3,3,2,3,2,3,3,3,3,3,2,2,2,2,2,2,2,1,
+0,2,0,1,2,1,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,2,1,2,3,3,3,3,3,3,3,2,3,2,3,2,1,2,3,0,2,1,2,2,
+0,2,1,1,2,1,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,2,0,
+3,3,3,3,3,3,3,3,3,2,3,3,3,3,2,1,3,1,2,2,2,1,2,3,3,1,2,1,2,2,2,2,
+0,1,1,1,1,1,0,0,0,0,0,0,0,0,1,0,0,0,0,0,1,0,0,2,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,0,2,3,3,3,1,3,3,3,1,2,2,2,2,1,1,2,2,2,2,2,2,
+0,2,0,1,1,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,2,3,3,3,2,2,3,3,3,2,1,2,3,2,3,2,2,2,2,1,2,1,1,1,2,2,
+0,2,1,1,1,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,1,0,0,0,1,0,0,0,0,0,
+1,0,1,0,0,0,0,0,2,0,0,0,0,0,1,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,2,3,3,2,3,1,2,2,2,2,3,2,3,1,1,2,2,1,2,2,1,1,0,2,2,2,2,
+0,1,0,1,2,2,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,1,0,
+3,0,0,1,1,0,1,0,0,1,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,2,2,0,
+0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,1,0,1,0,1,1,0,1,1,0,0,0,1,1,0,1,1,1,0,0,0,0,0,0,1,0,0,0,0,0,
+0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,0,0,1,1,0,1,0,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,
+3,2,2,1,2,2,2,2,2,2,2,1,2,2,1,2,2,1,1,1,1,1,1,1,1,2,1,1,0,3,3,3,
+0,3,0,2,2,2,2,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+2,2,2,3,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,2,2,1,2,2,2,1,1,1,2,0,1,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,2,2,2,2,2,2,2,2,2,2,1,2,2,2,2,2,2,2,2,2,2,2,0,2,2,0,0,0,0,0,0,
+0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,3,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,2,1,0,2,1,0,
+0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,1,1,1,1,1,1,1,1,1,1,0,0,1,1,1,1,0,1,1,1,1,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,
+0,3,1,1,2,2,2,2,2,1,2,2,2,1,1,2,2,2,2,2,2,2,1,2,2,1,0,1,1,1,1,0,
+0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,2,1,1,1,1,2,1,1,2,1,0,1,1,1,1,1,1,1,1,1,1,1,0,1,0,0,0,0,0,0,0,
+0,0,2,0,0,0,0,0,0,0,0,1,1,0,0,0,0,1,1,0,0,1,1,0,0,0,0,0,0,1,0,0,
+2,1,1,2,2,2,2,2,2,2,2,2,2,2,1,2,2,2,2,2,1,2,1,2,1,1,1,1,0,0,0,0,
+0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,2,1,2,2,2,2,2,2,2,2,2,2,1,2,1,2,1,1,2,1,1,1,2,1,2,1,2,0,1,0,1,
+0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,3,1,2,2,2,1,2,2,2,2,2,2,2,2,1,2,1,1,1,1,1,1,2,1,2,1,1,0,1,0,1,
+0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,1,2,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,2,2,
+0,2,0,1,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,0,0,0,1,0,0,0,0,0,0,0,0,0,0,1,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,1,1,1,1,1,1,1,0,1,1,0,1,0,0,1,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,2,0,1,1,1,0,1,0,0,0,1,1,0,1,1,0,0,0,0,0,1,1,0,0,
+0,1,1,1,2,1,2,2,2,0,2,0,2,0,1,1,2,1,1,1,1,2,1,0,1,1,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,1,0,0,0,0,0,1,0,1,2,2,0,1,0,0,1,1,2,2,1,2,0,2,0,0,0,1,2,0,1,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,2,0,2,1,2,0,2,0,0,1,1,1,1,1,1,0,1,0,0,0,1,0,0,1,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,1,0,0,0,0,0,1,0,2,1,1,0,1,0,0,1,1,1,2,2,0,0,1,0,0,0,1,0,0,1,
+1,1,2,1,0,1,1,1,0,1,0,1,1,1,1,0,0,0,1,0,1,0,0,0,0,0,0,0,0,2,2,1,
+0,2,0,1,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,1,0,0,1,0,1,1,1,1,0,0,0,0,0,1,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,1,1,1,1,1,1,1,1,2,1,0,1,1,1,1,1,1,1,1,1,1,1,0,1,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,1,1,1,0,0,0,0,1,1,1,0,1,1,0,1,0,0,0,1,1,0,1,
+2,0,1,0,1,0,1,0,0,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,1,0,1,1,1,0,1,0,0,1,1,2,1,1,2,0,1,0,0,0,1,1,0,1,
+1,0,0,1,0,0,1,0,0,0,1,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,1,0,1,1,2,0,1,0,0,0,0,2,1,1,2,0,2,0,0,0,1,1,0,1,
+1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,1,0,2,1,1,0,1,0,0,2,2,1,2,1,1,0,1,0,0,0,1,1,0,1,
+2,0,1,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,1,2,2,0,0,0,0,0,1,1,0,1,0,0,1,0,0,0,0,1,0,1,
+1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,1,2,2,0,0,0,0,2,1,1,1,0,2,1,1,0,0,0,2,1,0,1,
+1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,1,0,1,1,2,0,1,0,0,1,1,0,2,1,1,0,1,0,0,0,1,1,0,1,
+2,2,1,1,1,0,1,1,0,1,1,0,1,0,0,0,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,1,0,2,1,1,0,1,0,0,1,1,0,1,2,1,0,2,0,0,0,1,1,0,1,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,
+0,1,0,0,2,0,2,1,1,0,1,0,1,0,0,1,0,0,0,0,1,0,0,0,1,0,0,0,0,0,1,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,1,0,0,1,0,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,1,0,1,1,2,0,1,0,0,1,1,1,0,1,0,0,1,0,0,0,1,0,0,1,
+1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,0,0,0,0,0,1,0,1,1,0,0,1,0,0,2,1,1,1,1,1,0,1,0,0,0,0,1,0,1,
+0,1,1,1,2,1,1,1,1,0,1,1,1,1,1,1,1,1,1,1,1,1,0,1,1,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,1,2,1,0,0,0,0,0,1,1,1,1,1,0,1,0,0,0,1,1,0,0,
+)
+
+Win1255HebrewModel = {
+  'charToOrderMap': win1255_CharToOrderMap,
+  'precedenceMatrix': HebrewLangModel,
+  'mTypicalPositiveRatio': 0.984004,
+  'keepEnglishLetter': False,
+  'charsetName': "windows-1255"
+}
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langhungarianmodel.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langhungarianmodel.py
new file mode 100644
index 0000000..49d2f0f
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langhungarianmodel.py
@@ -0,0 +1,225 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# 255: Control characters that usually does not exist in any text
+# 254: Carriage/Return
+# 253: symbol (punctuation) that does not belong to word
+# 252: 0 - 9
+
+# Character Mapping Table:
+Latin2_HungarianCharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253, 28, 40, 54, 45, 32, 50, 49, 38, 39, 53, 36, 41, 34, 35, 47,
+ 46, 71, 43, 33, 37, 57, 48, 64, 68, 55, 52,253,253,253,253,253,
+253,  2, 18, 26, 17,  1, 27, 12, 20,  9, 22,  7,  6, 13,  4,  8,
+ 23, 67, 10,  5,  3, 21, 19, 65, 62, 16, 11,253,253,253,253,253,
+159,160,161,162,163,164,165,166,167,168,169,170,171,172,173,174,
+175,176,177,178,179,180,181,182,183,184,185,186,187,188,189,190,
+191,192,193,194,195,196,197, 75,198,199,200,201,202,203,204,205,
+ 79,206,207,208,209,210,211,212,213,214,215,216,217,218,219,220,
+221, 51, 81,222, 78,223,224,225,226, 44,227,228,229, 61,230,231,
+232,233,234, 58,235, 66, 59,236,237,238, 60, 69, 63,239,240,241,
+ 82, 14, 74,242, 70, 80,243, 72,244, 15, 83, 77, 84, 30, 76, 85,
+245,246,247, 25, 73, 42, 24,248,249,250, 31, 56, 29,251,252,253,
+)
+
+win1250HungarianCharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253, 28, 40, 54, 45, 32, 50, 49, 38, 39, 53, 36, 41, 34, 35, 47,
+ 46, 72, 43, 33, 37, 57, 48, 64, 68, 55, 52,253,253,253,253,253,
+253,  2, 18, 26, 17,  1, 27, 12, 20,  9, 22,  7,  6, 13,  4,  8,
+ 23, 67, 10,  5,  3, 21, 19, 65, 62, 16, 11,253,253,253,253,253,
+161,162,163,164,165,166,167,168,169,170,171,172,173,174,175,176,
+177,178,179,180, 78,181, 69,182,183,184,185,186,187,188,189,190,
+191,192,193,194,195,196,197, 76,198,199,200,201,202,203,204,205,
+ 81,206,207,208,209,210,211,212,213,214,215,216,217,218,219,220,
+221, 51, 83,222, 80,223,224,225,226, 44,227,228,229, 61,230,231,
+232,233,234, 58,235, 66, 59,236,237,238, 60, 70, 63,239,240,241,
+ 84, 14, 75,242, 71, 82,243, 73,244, 15, 85, 79, 86, 30, 77, 87,
+245,246,247, 25, 74, 42, 24,248,249,250, 31, 56, 29,251,252,253,
+)
+
+# Model Table:
+# total sequences: 100%
+# first 512 sequences: 94.7368%
+# first 1024 sequences:5.2623%
+# rest  sequences:     0.8894%
+# negative sequences:  0.0009%
+HungarianLangModel = (
+0,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,1,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,
+3,3,3,3,3,3,3,3,3,3,2,3,3,3,3,3,3,3,3,2,2,3,3,1,1,2,2,2,2,2,1,2,
+3,2,2,3,3,3,3,3,2,3,3,3,3,3,3,1,2,3,3,3,3,2,3,3,1,1,3,3,0,1,1,1,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,
+3,2,1,3,3,3,3,3,2,3,3,3,3,3,1,1,2,3,3,3,3,3,3,3,1,1,3,2,0,1,1,1,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,1,1,2,3,3,3,1,3,3,3,3,3,1,3,3,2,2,0,3,2,3,
+0,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,
+3,3,3,3,3,3,2,3,3,3,2,3,3,2,3,3,3,3,3,2,3,3,2,2,3,2,3,2,0,3,2,2,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,1,0,
+3,3,3,3,3,3,2,3,3,3,3,3,2,3,3,3,1,2,3,2,2,3,1,2,3,3,2,2,0,3,3,3,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,2,2,3,3,3,3,3,3,2,3,3,3,3,2,3,3,3,3,0,2,3,2,
+0,0,0,1,1,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,3,3,3,1,1,1,3,3,2,1,3,2,2,3,2,1,3,2,2,1,0,3,3,1,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,2,2,3,3,3,3,3,1,2,3,3,3,3,1,2,1,3,3,3,3,2,2,3,1,1,3,2,0,1,1,1,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,2,2,3,3,3,3,3,2,1,3,3,3,3,3,2,2,1,3,3,3,0,1,1,2,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,1,0,
+3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,3,2,3,3,3,2,3,3,2,3,3,3,2,0,3,2,3,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,1,0,
+3,3,3,3,3,3,2,3,3,3,2,3,2,3,3,3,1,3,2,2,2,3,1,1,3,3,1,1,0,3,3,2,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,2,3,3,3,2,3,2,3,3,3,2,3,3,3,3,3,1,2,3,2,2,0,2,2,2,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,3,3,2,2,2,3,1,3,3,2,2,1,3,3,3,1,1,3,1,2,3,2,3,2,2,2,1,0,2,2,2,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,
+3,1,1,3,3,3,3,3,1,2,3,3,3,3,1,2,1,3,3,3,2,2,3,2,1,0,3,2,0,1,1,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,1,1,3,3,3,3,3,1,2,3,3,3,3,1,1,0,3,3,3,3,0,2,3,0,0,2,1,0,1,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,2,2,3,3,2,2,2,2,3,3,0,1,2,3,2,3,2,2,3,2,1,2,0,2,2,2,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,
+3,3,3,3,3,3,1,2,3,3,3,2,1,2,3,3,2,2,2,3,2,3,3,1,3,3,1,1,0,2,3,2,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,3,3,1,2,2,2,2,3,3,3,1,1,1,3,3,1,1,3,1,1,3,2,1,2,3,1,1,0,2,2,2,
+0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,3,3,2,1,2,1,1,3,3,1,1,1,1,3,3,1,1,2,2,1,2,1,1,2,2,1,1,0,2,2,1,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,3,3,1,1,2,1,1,3,3,1,0,1,1,3,3,2,0,1,1,2,3,1,0,2,2,1,0,0,1,3,2,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,2,1,3,3,3,3,3,1,2,3,2,3,3,2,1,1,3,2,3,2,1,2,2,0,1,2,1,0,0,1,1,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,
+3,3,3,3,2,2,2,2,3,1,2,2,1,1,3,3,0,3,2,1,2,3,2,1,3,3,1,1,0,2,1,3,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,3,3,2,2,2,3,2,3,3,3,2,1,1,3,3,1,1,1,2,2,3,2,3,2,2,2,1,0,2,2,1,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+1,0,0,3,3,3,3,3,0,0,3,3,2,3,0,0,0,2,3,3,1,0,1,2,0,0,1,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,1,2,3,3,3,3,3,1,2,3,3,2,2,1,1,0,3,3,2,2,1,2,2,1,0,2,2,0,1,1,1,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,2,2,1,3,1,2,3,3,2,2,1,1,2,2,1,1,1,1,3,2,1,1,1,1,2,1,0,1,2,1,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,1,0,0,0,0,0,0,0,0,0,
+2,3,3,1,1,1,1,1,3,3,3,0,1,1,3,3,1,1,1,1,1,2,2,0,3,1,1,2,0,2,1,1,
+0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,
+3,1,0,1,2,1,2,2,0,1,2,3,1,2,0,0,0,2,1,1,1,1,1,2,0,0,1,1,0,0,0,0,
+1,2,1,2,2,2,1,2,1,2,0,2,0,2,2,1,1,2,1,1,2,1,1,1,0,1,0,0,0,1,1,0,
+1,1,1,2,3,2,3,3,0,1,2,2,3,1,0,1,0,2,1,2,2,0,1,1,0,0,1,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,3,3,2,2,1,0,0,3,2,3,2,0,0,0,1,1,3,0,0,1,1,0,0,2,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,1,1,2,2,3,3,1,0,1,3,2,3,1,1,1,0,1,1,1,1,1,3,1,0,0,2,2,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,1,1,1,2,2,2,1,0,1,2,3,3,2,0,0,0,2,1,1,1,2,1,1,1,0,1,1,1,0,0,0,
+1,2,2,2,2,2,1,1,1,2,0,2,1,1,1,1,1,2,1,1,1,1,1,1,0,1,1,1,0,0,1,1,
+3,2,2,1,0,0,1,1,2,2,0,3,0,1,2,1,1,0,0,1,1,1,0,1,1,1,1,0,2,1,1,1,
+2,2,1,1,1,2,1,2,1,1,1,1,1,1,1,2,1,1,1,2,3,1,1,1,1,1,1,1,1,1,0,1,
+2,3,3,0,1,0,0,0,3,3,1,0,0,1,2,2,1,0,0,0,0,2,0,0,1,1,1,0,2,1,1,1,
+2,1,1,1,1,1,1,2,1,1,0,1,1,0,1,1,1,0,1,2,1,1,0,1,1,1,1,1,1,1,0,1,
+2,3,3,0,1,0,0,0,2,2,0,0,0,0,1,2,2,0,0,0,0,1,0,0,1,1,0,0,2,0,1,0,
+2,1,1,1,1,2,1,1,1,1,1,1,1,2,1,1,1,1,1,1,1,1,1,2,0,1,1,1,1,1,0,1,
+3,2,2,0,1,0,1,0,2,3,2,0,0,1,2,2,1,0,0,1,1,1,0,0,2,1,0,1,2,2,1,1,
+2,1,1,1,1,1,1,2,1,1,1,1,1,1,0,2,1,0,1,1,0,1,1,1,0,1,1,2,1,1,0,1,
+2,2,2,0,0,1,0,0,2,2,1,1,0,0,2,1,1,0,0,0,1,2,0,0,2,1,0,0,2,1,1,1,
+2,1,1,1,1,2,1,2,1,1,1,2,2,1,1,2,1,1,1,2,1,1,1,1,1,1,1,1,1,1,0,1,
+1,2,3,0,0,0,1,0,3,2,1,0,0,1,2,1,1,0,0,0,0,2,1,0,1,1,0,0,2,1,2,1,
+1,1,0,0,0,1,0,1,1,1,1,1,2,0,0,1,0,0,0,2,0,0,1,1,1,1,1,1,1,1,0,1,
+3,0,0,2,1,2,2,1,0,0,2,1,2,2,0,0,0,2,1,1,1,0,1,1,0,0,1,1,2,0,0,0,
+1,2,1,2,2,1,1,2,1,2,0,1,1,1,1,1,1,1,1,1,2,1,1,0,0,1,1,1,1,0,0,1,
+1,3,2,0,0,0,1,0,2,2,2,0,0,0,2,2,1,0,0,0,0,3,1,1,1,1,0,0,2,1,1,1,
+2,1,0,1,1,1,0,1,1,1,1,1,1,1,0,2,1,0,0,1,0,1,1,0,1,1,1,1,1,1,0,1,
+2,3,2,0,0,0,1,0,2,2,0,0,0,0,2,1,1,0,0,0,0,2,1,0,1,1,0,0,2,1,1,0,
+2,1,1,1,1,2,1,2,1,2,0,1,1,1,0,2,1,1,1,2,1,1,1,1,0,1,1,1,1,1,0,1,
+3,1,1,2,2,2,3,2,1,1,2,2,1,1,0,1,0,2,2,1,1,1,1,1,0,0,1,1,0,1,1,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,2,2,0,0,0,0,0,2,2,0,0,0,0,2,2,1,0,0,0,1,1,0,0,1,2,0,0,2,1,1,1,
+2,2,1,1,1,2,1,2,1,1,0,1,1,1,1,2,1,1,1,2,1,1,1,1,0,1,2,1,1,1,0,1,
+1,0,0,1,2,3,2,1,0,0,2,0,1,1,0,0,0,1,1,1,1,0,1,1,0,0,1,0,0,0,0,0,
+1,2,1,2,1,2,1,1,1,2,0,2,1,1,1,0,1,2,0,0,1,1,1,0,0,0,0,0,0,0,0,0,
+2,3,2,0,0,0,0,0,1,1,2,1,0,0,1,1,1,0,0,0,0,2,0,0,1,1,0,0,2,1,1,1,
+2,1,1,1,1,1,1,2,1,0,1,1,1,1,0,2,1,1,1,1,1,1,0,1,0,1,1,1,1,1,0,1,
+1,2,2,0,1,1,1,0,2,2,2,0,0,0,3,2,1,0,0,0,1,1,0,0,1,1,0,1,1,1,0,0,
+1,1,0,1,1,1,1,1,1,1,1,2,1,1,1,1,1,1,1,2,1,1,1,0,0,1,1,1,0,1,0,1,
+2,1,0,2,1,1,2,2,1,1,2,1,1,1,0,0,0,1,1,0,1,1,1,1,0,0,1,1,1,0,0,0,
+1,2,2,2,2,2,1,1,1,2,0,2,1,1,1,1,1,1,1,1,1,1,1,1,0,1,1,0,0,0,1,0,
+1,2,3,0,0,0,1,0,2,2,0,0,0,0,2,2,0,0,0,0,0,1,0,0,1,0,0,0,2,0,1,0,
+2,1,1,1,1,1,0,2,0,0,0,1,2,1,1,1,1,0,1,2,0,1,0,1,0,1,1,1,0,1,0,1,
+2,2,2,0,0,0,1,0,2,1,2,0,0,0,1,1,2,0,0,0,0,1,0,0,1,1,0,0,2,1,0,1,
+2,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,2,0,1,1,1,1,1,0,1,
+1,2,2,0,0,0,1,0,2,2,2,0,0,0,1,1,0,0,0,0,0,1,1,0,2,0,0,1,1,1,0,1,
+1,0,1,1,1,1,1,1,0,1,1,1,1,0,0,1,0,0,1,1,0,1,0,1,1,1,1,1,0,0,0,1,
+1,0,0,1,0,1,2,1,0,0,1,1,1,2,0,0,0,1,1,0,1,0,1,1,0,0,1,0,0,0,0,0,
+0,2,1,2,1,1,1,1,1,2,0,2,0,1,1,0,1,2,1,0,1,1,1,0,0,0,0,0,0,1,0,0,
+2,1,1,0,1,2,0,0,1,1,1,0,0,0,1,1,0,0,0,0,0,1,0,0,1,0,0,0,2,1,0,1,
+2,2,1,1,1,1,1,2,1,1,0,1,1,1,1,2,1,1,1,2,1,1,0,1,0,1,1,1,1,1,0,1,
+1,2,2,0,0,0,0,0,1,1,0,0,0,0,2,1,0,0,0,0,0,2,0,0,2,2,0,0,2,0,0,1,
+2,1,1,1,1,1,1,1,0,1,1,0,1,1,0,1,0,0,0,1,1,1,1,0,0,1,1,1,1,0,0,1,
+1,1,2,0,0,3,1,0,2,1,1,1,0,0,1,1,1,0,0,0,1,1,0,0,0,1,0,0,1,0,1,0,
+1,2,1,0,1,1,1,2,1,1,0,1,1,1,1,1,0,0,0,1,1,1,1,1,0,1,0,0,0,1,0,0,
+2,1,1,0,0,0,0,0,1,0,0,0,0,0,0,0,0,1,0,1,0,0,0,1,0,0,0,0,2,0,0,0,
+2,1,1,1,1,1,1,1,1,1,0,1,1,1,1,1,1,1,1,1,2,1,1,0,0,1,1,1,1,1,0,1,
+2,1,1,1,2,1,1,1,0,1,1,2,1,0,0,0,0,1,1,1,1,0,1,0,0,0,0,1,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,1,0,1,1,1,1,1,0,0,1,1,2,1,0,0,0,1,1,0,0,0,1,1,0,0,1,0,1,0,0,0,
+1,2,1,1,1,1,1,1,1,1,0,1,0,1,1,1,1,1,1,0,1,1,1,0,0,0,0,0,0,1,0,0,
+2,0,0,0,1,1,1,1,0,0,1,1,0,0,0,0,0,1,1,1,2,0,0,1,0,0,1,0,1,0,0,0,
+0,1,1,1,1,1,1,1,1,2,0,1,1,1,1,0,1,1,1,0,1,1,1,0,0,0,0,0,0,0,0,0,
+1,0,0,1,1,1,1,1,0,0,2,1,0,1,0,0,0,1,0,1,0,0,0,0,0,0,1,0,0,0,0,0,
+0,1,1,1,1,1,1,0,1,1,0,1,0,1,1,0,1,1,0,0,1,1,1,0,0,0,0,0,0,0,0,0,
+1,0,0,1,1,1,0,0,0,0,1,0,2,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,
+0,1,1,1,1,1,0,0,1,1,0,1,0,1,0,0,1,1,1,0,1,1,1,0,0,0,0,0,0,0,0,0,
+0,0,0,1,0,0,0,0,0,0,1,1,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,1,1,1,0,1,0,0,1,1,0,1,0,1,1,0,1,1,1,0,1,1,1,0,0,0,0,0,0,0,0,0,
+2,1,1,1,1,1,1,1,1,1,1,0,0,1,1,1,0,0,1,0,0,1,0,1,0,1,1,1,0,0,1,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,0,1,1,1,1,0,0,0,1,1,1,0,0,0,0,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,
+0,1,1,1,1,1,1,0,1,1,0,1,0,1,0,0,1,1,0,0,1,1,0,0,0,0,0,0,0,0,0,0,
+)
+
+Latin2HungarianModel = {
+  'charToOrderMap': Latin2_HungarianCharToOrderMap,
+  'precedenceMatrix': HungarianLangModel,
+  'mTypicalPositiveRatio': 0.947368,
+  'keepEnglishLetter': True,
+  'charsetName': "ISO-8859-2"
+}
+
+Win1250HungarianModel = {
+  'charToOrderMap': win1250HungarianCharToOrderMap,
+  'precedenceMatrix': HungarianLangModel,
+  'mTypicalPositiveRatio': 0.947368,
+  'keepEnglishLetter': True,
+  'charsetName': "windows-1250"
+}
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langthaimodel.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langthaimodel.py
new file mode 100644
index 0000000..0508b1b
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/langthaimodel.py
@@ -0,0 +1,200 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Communicator client code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+# 255: Control characters that usually does not exist in any text
+# 254: Carriage/Return
+# 253: symbol (punctuation) that does not belong to word
+# 252: 0 - 9
+
+# The following result for thai was collected from a limited sample (1M).
+
+# Character Mapping Table:
+TIS620CharToOrderMap = (
+255,255,255,255,255,255,255,255,255,255,254,255,255,254,255,255,  # 00
+255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,  # 10
+253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,  # 20
+252,252,252,252,252,252,252,252,252,252,253,253,253,253,253,253,  # 30
+253,182,106,107,100,183,184,185,101, 94,186,187,108,109,110,111,  # 40
+188,189,190, 89, 95,112,113,191,192,193,194,253,253,253,253,253,  # 50
+253, 64, 72, 73,114, 74,115,116,102, 81,201,117, 90,103, 78, 82,  # 60
+ 96,202, 91, 79, 84,104,105, 97, 98, 92,203,253,253,253,253,253,  # 70
+209,210,211,212,213, 88,214,215,216,217,218,219,220,118,221,222,
+223,224, 99, 85, 83,225,226,227,228,229,230,231,232,233,234,235,
+236,  5, 30,237, 24,238, 75,  8, 26, 52, 34, 51,119, 47, 58, 57,
+ 49, 53, 55, 43, 20, 19, 44, 14, 48,  3, 17, 25, 39, 62, 31, 54,
+ 45,  9, 16,  2, 61, 15,239, 12, 42, 46, 18, 21, 76,  4, 66, 63,
+ 22, 10,  1, 36, 23, 13, 40, 27, 32, 35, 86,240,241,242,243,244,
+ 11, 28, 41, 29, 33,245, 50, 37,  6,  7, 67, 77, 38, 93,246,247,
+ 68, 56, 59, 65, 69, 60, 70, 80, 71, 87,248,249,250,251,252,253,
+)
+
+# Model Table:
+# total sequences: 100%
+# first 512 sequences: 92.6386%
+# first 1024 sequences:7.3177%
+# rest  sequences:     1.0230%
+# negative sequences:  0.0436%
+ThaiLangModel = (
+0,1,3,3,3,3,0,0,3,3,0,3,3,0,3,3,3,3,3,3,3,3,0,0,3,3,3,0,3,3,3,3,
+0,3,3,0,0,0,1,3,0,3,3,2,3,3,0,1,2,3,3,3,3,0,2,0,2,0,0,3,2,1,2,2,
+3,0,3,3,2,3,0,0,3,3,0,3,3,0,3,3,3,3,3,3,3,3,3,0,3,2,3,0,2,2,2,3,
+0,2,3,0,0,0,0,1,0,1,2,3,1,1,3,2,2,0,1,1,0,0,1,0,0,0,0,0,0,0,1,1,
+3,3,3,2,3,3,3,3,3,3,3,3,3,3,3,2,2,2,2,2,2,2,3,3,2,3,2,3,3,2,2,2,
+3,1,2,3,0,3,3,2,2,1,2,3,3,1,2,0,1,3,0,1,0,0,1,0,0,0,0,0,0,0,1,1,
+3,3,2,2,3,3,3,3,1,2,3,3,3,3,3,2,2,2,2,3,3,2,2,3,3,2,2,3,2,3,2,2,
+3,3,1,2,3,1,2,2,3,3,1,0,2,1,0,0,3,1,2,1,0,0,1,0,0,0,0,0,0,1,0,1,
+3,3,3,3,3,3,2,2,3,3,3,3,2,3,2,2,3,3,2,2,3,2,2,2,2,1,1,3,1,2,1,1,
+3,2,1,0,2,1,0,1,0,1,1,0,1,1,0,0,1,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,
+3,3,3,2,3,2,3,3,2,2,3,2,3,3,2,3,1,1,2,3,2,2,2,3,2,2,2,2,2,1,2,1,
+2,2,1,1,3,3,2,1,0,1,2,2,0,1,3,0,0,0,1,1,0,0,0,0,0,2,3,0,0,2,1,1,
+3,3,2,3,3,2,0,0,3,3,0,3,3,0,2,2,3,1,2,2,1,1,1,0,2,2,2,0,2,2,1,1,
+0,2,1,0,2,0,0,2,0,1,0,0,1,0,0,0,1,1,1,1,0,0,0,0,0,0,0,0,0,0,1,0,
+3,3,2,3,3,2,0,0,3,3,0,2,3,0,2,1,2,2,2,2,1,2,0,0,2,2,2,0,2,2,1,1,
+0,2,1,0,2,0,0,2,0,1,1,0,1,0,0,0,0,0,0,1,0,0,1,0,0,0,0,0,0,0,0,0,
+3,3,2,3,2,3,2,0,2,2,1,3,2,1,3,2,1,2,3,2,2,3,0,2,3,2,2,1,2,2,2,2,
+1,2,2,0,0,0,0,2,0,1,2,0,1,1,1,0,1,0,3,1,1,0,0,0,0,0,0,0,0,0,1,0,
+3,3,2,3,3,2,3,2,2,2,3,2,2,3,2,2,1,2,3,2,2,3,1,3,2,2,2,3,2,2,2,3,
+3,2,1,3,0,1,1,1,0,2,1,1,1,1,1,0,1,0,1,1,0,0,0,0,0,0,0,0,0,2,0,0,
+1,0,0,3,0,3,3,3,3,3,0,0,3,0,2,2,3,3,3,3,3,0,0,0,1,1,3,0,0,0,0,2,
+0,0,1,0,0,0,0,0,0,0,2,3,0,0,0,3,0,2,0,0,0,0,0,3,0,0,0,0,0,0,0,0,
+2,0,3,3,3,3,0,0,2,3,0,0,3,0,3,3,2,3,3,3,3,3,0,0,3,3,3,0,0,0,3,3,
+0,0,3,0,0,0,0,2,0,0,2,1,1,3,0,0,1,0,0,2,3,0,1,0,0,0,0,0,0,0,1,0,
+3,3,3,3,2,3,3,3,3,3,3,3,1,2,1,3,3,2,2,1,2,2,2,3,1,1,2,0,2,1,2,1,
+2,2,1,0,0,0,1,1,0,1,0,1,1,0,0,0,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,
+3,0,2,1,2,3,3,3,0,2,0,2,2,0,2,1,3,2,2,1,2,1,0,0,2,2,1,0,2,1,2,2,
+0,1,1,0,0,0,0,1,0,1,1,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,2,1,3,3,1,1,3,0,2,3,1,1,3,2,1,1,2,0,2,2,3,2,1,1,1,1,1,2,
+3,0,0,1,3,1,2,1,2,0,3,0,0,0,1,0,3,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,
+3,3,1,1,3,2,3,3,3,1,3,2,1,3,2,1,3,2,2,2,2,1,3,3,1,2,1,3,1,2,3,0,
+2,1,1,3,2,2,2,1,2,1,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,
+3,3,2,3,2,3,3,2,3,2,3,2,3,3,2,1,0,3,2,2,2,1,2,2,2,1,2,2,1,2,1,1,
+2,2,2,3,0,1,3,1,1,1,1,0,1,1,0,2,1,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,2,3,2,2,1,1,3,2,3,2,3,2,0,3,2,2,1,2,0,2,2,2,1,2,2,2,2,1,
+3,2,1,2,2,1,0,2,0,1,0,0,1,1,0,0,0,0,0,1,1,0,1,0,0,0,0,0,0,0,0,1,
+3,3,3,3,3,2,3,1,2,3,3,2,2,3,0,1,1,2,0,3,3,2,2,3,0,1,1,3,0,0,0,0,
+3,1,0,3,3,0,2,0,2,1,0,0,3,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,2,3,2,3,3,0,1,3,1,1,2,1,2,1,1,3,1,1,0,2,3,1,1,1,1,1,1,1,1,
+3,1,1,2,2,2,2,1,1,1,0,0,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+3,2,2,1,1,2,1,3,3,2,3,2,2,3,2,2,3,1,2,2,1,2,0,3,2,1,2,2,2,2,2,1,
+3,2,1,2,2,2,1,1,1,1,0,0,1,1,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,3,3,3,3,1,3,3,0,2,1,0,3,2,0,0,3,1,0,1,1,0,1,0,0,0,0,0,1,
+1,0,0,1,0,3,2,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,2,2,2,3,0,0,1,3,0,3,2,0,3,2,2,3,3,3,3,3,1,0,2,2,2,0,2,2,1,2,
+0,2,3,0,0,0,0,1,0,1,0,0,1,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+3,0,2,3,1,3,3,2,3,3,0,3,3,0,3,2,2,3,2,3,3,3,0,0,2,2,3,0,1,1,1,3,
+0,0,3,0,0,0,2,2,0,1,3,0,1,2,2,2,3,0,0,0,0,0,1,0,0,0,0,0,0,0,0,1,
+3,2,3,3,2,0,3,3,2,2,3,1,3,2,1,3,2,0,1,2,2,0,2,3,2,1,0,3,0,0,0,0,
+3,0,0,2,3,1,3,0,0,3,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,1,3,2,2,2,1,2,0,1,3,1,1,3,1,3,0,0,2,1,1,1,1,2,1,1,1,0,2,1,0,1,
+1,2,0,0,0,3,1,1,0,0,0,0,1,0,1,0,0,1,0,1,0,0,0,0,0,3,1,0,0,0,1,0,
+3,3,3,3,2,2,2,2,2,1,3,1,1,1,2,0,1,1,2,1,2,1,3,2,0,0,3,1,1,1,1,1,
+3,1,0,2,3,0,0,0,3,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,2,3,0,3,3,0,2,0,0,0,0,0,0,0,3,0,0,1,0,0,0,0,0,0,0,0,0,0,0,
+0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,2,3,1,3,0,0,1,2,0,0,2,0,3,3,2,3,3,3,2,3,0,0,2,2,2,0,0,0,2,2,
+0,0,1,0,0,0,0,3,0,0,0,0,2,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,
+0,0,0,3,0,2,0,0,0,0,0,0,0,0,0,0,1,2,3,1,3,3,0,0,1,0,3,0,0,0,0,0,
+0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,1,2,3,1,2,3,1,0,3,0,2,2,1,0,2,1,1,2,0,1,0,0,1,1,1,1,0,1,0,0,
+1,0,0,0,0,1,1,0,3,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,3,3,2,1,0,1,1,1,3,1,2,2,2,2,2,2,1,1,1,1,0,3,1,0,1,3,1,1,1,1,
+1,1,0,2,0,1,3,1,1,0,0,1,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,2,0,1,
+3,0,2,2,1,3,3,2,3,3,0,1,1,0,2,2,1,2,1,3,3,1,0,0,3,2,0,0,0,0,2,1,
+0,1,0,0,0,0,1,2,0,1,1,3,1,1,2,2,1,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,
+0,0,3,0,0,1,0,0,0,3,0,0,3,0,3,1,0,1,1,1,3,2,0,0,0,3,0,0,0,0,2,0,
+0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,2,0,0,0,0,0,0,0,0,0,
+3,3,1,3,2,1,3,3,1,2,2,0,1,2,1,0,1,2,0,0,0,0,0,3,0,0,0,3,0,0,0,0,
+3,0,0,1,1,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,1,2,0,3,3,3,2,2,0,1,1,0,1,3,0,0,0,2,2,0,0,0,0,3,1,0,1,0,0,0,
+0,0,0,0,0,0,0,0,0,1,0,1,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,2,3,1,2,0,0,2,1,0,3,1,0,1,2,0,1,1,1,1,3,0,0,3,1,1,0,2,2,1,1,
+0,2,0,0,0,0,0,1,0,1,0,0,1,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,0,3,1,2,0,0,2,2,0,1,2,0,1,0,1,3,1,2,1,0,0,0,2,0,3,0,0,0,1,0,
+0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,1,1,2,2,0,0,0,2,0,2,1,0,1,1,0,1,1,1,2,1,0,0,1,1,1,0,2,1,1,1,
+0,1,1,0,0,0,0,0,0,1,0,0,1,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,1,0,1,
+0,0,0,2,0,1,3,1,1,1,1,0,0,0,0,3,2,0,1,0,0,0,1,2,0,0,0,1,0,0,0,0,
+0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,3,3,3,3,1,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,0,2,3,2,2,0,0,0,1,0,0,0,0,2,3,2,1,2,2,3,0,0,0,2,3,1,0,0,0,1,1,
+0,0,1,0,0,0,0,0,0,0,1,0,0,1,0,0,0,0,0,1,1,0,1,0,0,0,0,0,0,0,0,0,
+3,3,2,2,0,1,0,0,0,0,2,0,2,0,1,0,0,0,1,1,0,0,0,2,1,0,1,0,1,1,0,0,
+0,1,0,2,0,0,1,0,3,0,1,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,1,0,0,1,0,0,0,0,0,1,1,2,0,0,0,0,1,0,0,1,3,1,0,0,0,0,1,1,0,0,
+0,1,0,0,0,0,3,0,0,0,0,0,0,3,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,
+3,3,1,1,1,1,2,3,0,0,2,1,1,1,1,1,0,2,1,1,0,0,0,2,1,0,1,2,1,1,0,1,
+2,1,0,3,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,3,1,0,0,0,0,0,0,0,3,0,0,0,3,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,1,
+0,0,0,2,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,3,2,0,0,0,0,0,0,1,2,1,0,1,1,0,2,0,0,1,0,0,2,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,2,0,0,0,1,3,0,1,0,0,0,2,0,0,0,0,0,0,0,1,2,0,0,0,0,0,
+3,3,0,0,1,1,2,0,0,1,2,1,0,1,1,1,0,1,1,0,0,2,1,1,0,1,0,0,1,1,1,0,
+0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,2,2,1,0,0,0,0,1,0,0,0,0,3,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,
+2,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,3,0,0,1,1,0,0,0,2,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+1,1,0,1,2,0,1,2,0,0,1,1,0,2,0,1,0,0,1,0,0,0,0,1,0,0,0,2,0,0,0,0,
+1,0,0,1,0,1,1,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,1,0,0,0,0,0,0,0,1,1,0,1,1,0,2,1,3,0,0,0,0,1,1,0,0,0,0,0,0,0,3,
+1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,0,1,0,1,0,0,2,0,0,2,0,0,1,1,2,0,0,1,1,0,0,0,1,0,0,0,1,1,0,0,0,
+1,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,
+1,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,1,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,1,1,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,0,0,0,0,2,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,1,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,1,3,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,1,0,0,0,0,
+1,0,0,0,0,0,0,0,0,1,0,0,0,0,2,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,1,1,0,0,2,1,0,0,1,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+)
+
+TIS620ThaiModel = {
+  'charToOrderMap': TIS620CharToOrderMap,
+  'precedenceMatrix': ThaiLangModel,
+  'mTypicalPositiveRatio': 0.926386,
+  'keepEnglishLetter': False,
+  'charsetName': "TIS-620"
+}
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/latin1prober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/latin1prober.py
new file mode 100644
index 0000000..ad695f5
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/latin1prober.py
@@ -0,0 +1,139 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 2001
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .charsetprober import CharSetProber
+from .constants import eNotMe
+from .compat import wrap_ord
+
+FREQ_CAT_NUM = 4
+
+UDF = 0  # undefined
+OTH = 1  # other
+ASC = 2  # ascii capital letter
+ASS = 3  # ascii small letter
+ACV = 4  # accent capital vowel
+ACO = 5  # accent capital other
+ASV = 6  # accent small vowel
+ASO = 7  # accent small other
+CLASS_NUM = 8  # total classes
+
+Latin1_CharToClass = (
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 00 - 07
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 08 - 0F
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 10 - 17
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 18 - 1F
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 20 - 27
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 28 - 2F
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 30 - 37
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 38 - 3F
+    OTH, ASC, ASC, ASC, ASC, ASC, ASC, ASC,   # 40 - 47
+    ASC, ASC, ASC, ASC, ASC, ASC, ASC, ASC,   # 48 - 4F
+    ASC, ASC, ASC, ASC, ASC, ASC, ASC, ASC,   # 50 - 57
+    ASC, ASC, ASC, OTH, OTH, OTH, OTH, OTH,   # 58 - 5F
+    OTH, ASS, ASS, ASS, ASS, ASS, ASS, ASS,   # 60 - 67
+    ASS, ASS, ASS, ASS, ASS, ASS, ASS, ASS,   # 68 - 6F
+    ASS, ASS, ASS, ASS, ASS, ASS, ASS, ASS,   # 70 - 77
+    ASS, ASS, ASS, OTH, OTH, OTH, OTH, OTH,   # 78 - 7F
+    OTH, UDF, OTH, ASO, OTH, OTH, OTH, OTH,   # 80 - 87
+    OTH, OTH, ACO, OTH, ACO, UDF, ACO, UDF,   # 88 - 8F
+    UDF, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # 90 - 97
+    OTH, OTH, ASO, OTH, ASO, UDF, ASO, ACO,   # 98 - 9F
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # A0 - A7
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # A8 - AF
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # B0 - B7
+    OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH,   # B8 - BF
+    ACV, ACV, ACV, ACV, ACV, ACV, ACO, ACO,   # C0 - C7
+    ACV, ACV, ACV, ACV, ACV, ACV, ACV, ACV,   # C8 - CF
+    ACO, ACO, ACV, ACV, ACV, ACV, ACV, OTH,   # D0 - D7
+    ACV, ACV, ACV, ACV, ACV, ACO, ACO, ACO,   # D8 - DF
+    ASV, ASV, ASV, ASV, ASV, ASV, ASO, ASO,   # E0 - E7
+    ASV, ASV, ASV, ASV, ASV, ASV, ASV, ASV,   # E8 - EF
+    ASO, ASO, ASV, ASV, ASV, ASV, ASV, OTH,   # F0 - F7
+    ASV, ASV, ASV, ASV, ASV, ASO, ASO, ASO,   # F8 - FF
+)
+
+# 0 : illegal
+# 1 : very unlikely
+# 2 : normal
+# 3 : very likely
+Latin1ClassModel = (
+    # UDF OTH ASC ASS ACV ACO ASV ASO
+    0,  0,  0,  0,  0,  0,  0,  0,  # UDF
+    0,  3,  3,  3,  3,  3,  3,  3,  # OTH
+    0,  3,  3,  3,  3,  3,  3,  3,  # ASC
+    0,  3,  3,  3,  1,  1,  3,  3,  # ASS
+    0,  3,  3,  3,  1,  2,  1,  2,  # ACV
+    0,  3,  3,  3,  3,  3,  3,  3,  # ACO
+    0,  3,  1,  3,  1,  1,  1,  3,  # ASV
+    0,  3,  1,  3,  1,  1,  3,  3,  # ASO
+)
+
+
+class Latin1Prober(CharSetProber):
+    def __init__(self):
+        CharSetProber.__init__(self)
+        self.reset()
+
+    def reset(self):
+        self._mLastCharClass = OTH
+        self._mFreqCounter = [0] * FREQ_CAT_NUM
+        CharSetProber.reset(self)
+
+    def get_charset_name(self):
+        return "windows-1252"
+
+    def feed(self, aBuf):
+        aBuf = self.filter_with_english_letters(aBuf)
+        for c in aBuf:
+            charClass = Latin1_CharToClass[wrap_ord(c)]
+            freq = Latin1ClassModel[(self._mLastCharClass * CLASS_NUM)
+                                    + charClass]
+            if freq == 0:
+                self._mState = eNotMe
+                break
+            self._mFreqCounter[freq] += 1
+            self._mLastCharClass = charClass
+
+        return self.get_state()
+
+    def get_confidence(self):
+        if self.get_state() == eNotMe:
+            return 0.01
+
+        total = sum(self._mFreqCounter)
+        if total < 0.01:
+            confidence = 0.0
+        else:
+            confidence = ((self._mFreqCounter[3] / total)
+                          - (self._mFreqCounter[1] * 20.0 / total))
+        if confidence < 0.0:
+            confidence = 0.0
+        # lower the confidence of latin1 so that other more accurate
+        # detector can take priority.
+        confidence = confidence * 0.5
+        return confidence
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcharsetprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcharsetprober.py
new file mode 100644
index 0000000..bb42f2f
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcharsetprober.py
@@ -0,0 +1,86 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 2001
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#   Proofpoint, Inc.
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+import sys
+from . import constants
+from .charsetprober import CharSetProber
+
+
+class MultiByteCharSetProber(CharSetProber):
+    def __init__(self):
+        CharSetProber.__init__(self)
+        self._mDistributionAnalyzer = None
+        self._mCodingSM = None
+        self._mLastChar = [0, 0]
+
+    def reset(self):
+        CharSetProber.reset(self)
+        if self._mCodingSM:
+            self._mCodingSM.reset()
+        if self._mDistributionAnalyzer:
+            self._mDistributionAnalyzer.reset()
+        self._mLastChar = [0, 0]
+
+    def get_charset_name(self):
+        pass
+
+    def feed(self, aBuf):
+        aLen = len(aBuf)
+        for i in range(0, aLen):
+            codingState = self._mCodingSM.next_state(aBuf[i])
+            if codingState == constants.eError:
+                if constants._debug:
+                    sys.stderr.write(self.get_charset_name()
+                                     + ' prober hit error at byte ' + str(i)
+                                     + '\n')
+                self._mState = constants.eNotMe
+                break
+            elif codingState == constants.eItsMe:
+                self._mState = constants.eFoundIt
+                break
+            elif codingState == constants.eStart:
+                charLen = self._mCodingSM.get_current_charlen()
+                if i == 0:
+                    self._mLastChar[1] = aBuf[0]
+                    self._mDistributionAnalyzer.feed(self._mLastChar, charLen)
+                else:
+                    self._mDistributionAnalyzer.feed(aBuf[i - 1:i + 1],
+                                                     charLen)
+
+        self._mLastChar[0] = aBuf[aLen - 1]
+
+        if self.get_state() == constants.eDetecting:
+            if (self._mDistributionAnalyzer.got_enough_data() and
+                    (self.get_confidence() > constants.SHORTCUT_THRESHOLD)):
+                self._mState = constants.eFoundIt
+
+        return self.get_state()
+
+    def get_confidence(self):
+        return self._mDistributionAnalyzer.get_confidence()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcsgroupprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcsgroupprober.py
new file mode 100644
index 0000000..03c9dcf
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcsgroupprober.py
@@ -0,0 +1,54 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 2001
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#   Proofpoint, Inc.
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .charsetgroupprober import CharSetGroupProber
+from .utf8prober import UTF8Prober
+from .sjisprober import SJISProber
+from .eucjpprober import EUCJPProber
+from .gb2312prober import GB2312Prober
+from .euckrprober import EUCKRProber
+from .cp949prober import CP949Prober
+from .big5prober import Big5Prober
+from .euctwprober import EUCTWProber
+
+
+class MBCSGroupProber(CharSetGroupProber):
+    def __init__(self):
+        CharSetGroupProber.__init__(self)
+        self._mProbers = [
+            UTF8Prober(),
+            SJISProber(),
+            EUCJPProber(),
+            GB2312Prober(),
+            EUCKRProber(),
+            CP949Prober(),
+            Big5Prober(),
+            EUCTWProber()
+        ]
+        self.reset()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcssm.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcssm.py
new file mode 100644
index 0000000..3f93cfb
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/mbcssm.py
@@ -0,0 +1,575 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .constants import eStart, eError, eItsMe
+
+# BIG5
+
+BIG5_cls = (
+    1,1,1,1,1,1,1,1,  # 00 - 07    #allow 0x00 as legal value
+    1,1,1,1,1,1,0,0,  # 08 - 0f
+    1,1,1,1,1,1,1,1,  # 10 - 17
+    1,1,1,0,1,1,1,1,  # 18 - 1f
+    1,1,1,1,1,1,1,1,  # 20 - 27
+    1,1,1,1,1,1,1,1,  # 28 - 2f
+    1,1,1,1,1,1,1,1,  # 30 - 37
+    1,1,1,1,1,1,1,1,  # 38 - 3f
+    2,2,2,2,2,2,2,2,  # 40 - 47
+    2,2,2,2,2,2,2,2,  # 48 - 4f
+    2,2,2,2,2,2,2,2,  # 50 - 57
+    2,2,2,2,2,2,2,2,  # 58 - 5f
+    2,2,2,2,2,2,2,2,  # 60 - 67
+    2,2,2,2,2,2,2,2,  # 68 - 6f
+    2,2,2,2,2,2,2,2,  # 70 - 77
+    2,2,2,2,2,2,2,1,  # 78 - 7f
+    4,4,4,4,4,4,4,4,  # 80 - 87
+    4,4,4,4,4,4,4,4,  # 88 - 8f
+    4,4,4,4,4,4,4,4,  # 90 - 97
+    4,4,4,4,4,4,4,4,  # 98 - 9f
+    4,3,3,3,3,3,3,3,  # a0 - a7
+    3,3,3,3,3,3,3,3,  # a8 - af
+    3,3,3,3,3,3,3,3,  # b0 - b7
+    3,3,3,3,3,3,3,3,  # b8 - bf
+    3,3,3,3,3,3,3,3,  # c0 - c7
+    3,3,3,3,3,3,3,3,  # c8 - cf
+    3,3,3,3,3,3,3,3,  # d0 - d7
+    3,3,3,3,3,3,3,3,  # d8 - df
+    3,3,3,3,3,3,3,3,  # e0 - e7
+    3,3,3,3,3,3,3,3,  # e8 - ef
+    3,3,3,3,3,3,3,3,  # f0 - f7
+    3,3,3,3,3,3,3,0  # f8 - ff
+)
+
+BIG5_st = (
+    eError,eStart,eStart,     3,eError,eError,eError,eError,#00-07
+    eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eError,#08-0f
+    eError,eStart,eStart,eStart,eStart,eStart,eStart,eStart#10-17
+)
+
+Big5CharLenTable = (0, 1, 1, 2, 0)
+
+Big5SMModel = {'classTable': BIG5_cls,
+               'classFactor': 5,
+               'stateTable': BIG5_st,
+               'charLenTable': Big5CharLenTable,
+               'name': 'Big5'}
+
+# CP949
+
+CP949_cls  = (
+    1,1,1,1,1,1,1,1, 1,1,1,1,1,1,0,0,  # 00 - 0f
+    1,1,1,1,1,1,1,1, 1,1,1,0,1,1,1,1,  # 10 - 1f
+    1,1,1,1,1,1,1,1, 1,1,1,1,1,1,1,1,  # 20 - 2f
+    1,1,1,1,1,1,1,1, 1,1,1,1,1,1,1,1,  # 30 - 3f
+    1,4,4,4,4,4,4,4, 4,4,4,4,4,4,4,4,  # 40 - 4f
+    4,4,5,5,5,5,5,5, 5,5,5,1,1,1,1,1,  # 50 - 5f
+    1,5,5,5,5,5,5,5, 5,5,5,5,5,5,5,5,  # 60 - 6f
+    5,5,5,5,5,5,5,5, 5,5,5,1,1,1,1,1,  # 70 - 7f
+    0,6,6,6,6,6,6,6, 6,6,6,6,6,6,6,6,  # 80 - 8f
+    6,6,6,6,6,6,6,6, 6,6,6,6,6,6,6,6,  # 90 - 9f
+    6,7,7,7,7,7,7,7, 7,7,7,7,7,8,8,8,  # a0 - af
+    7,7,7,7,7,7,7,7, 7,7,7,7,7,7,7,7,  # b0 - bf
+    7,7,7,7,7,7,9,2, 2,3,2,2,2,2,2,2,  # c0 - cf
+    2,2,2,2,2,2,2,2, 2,2,2,2,2,2,2,2,  # d0 - df
+    2,2,2,2,2,2,2,2, 2,2,2,2,2,2,2,2,  # e0 - ef
+    2,2,2,2,2,2,2,2, 2,2,2,2,2,2,2,0,  # f0 - ff
+)
+
+CP949_st = (
+#cls=    0      1      2      3      4      5      6      7      8      9  # previous state =
+    eError,eStart,     3,eError,eStart,eStart,     4,     5,eError,     6, # eStart
+    eError,eError,eError,eError,eError,eError,eError,eError,eError,eError, # eError
+    eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe, # eItsMe
+    eError,eError,eStart,eStart,eError,eError,eError,eStart,eStart,eStart, # 3
+    eError,eError,eStart,eStart,eStart,eStart,eStart,eStart,eStart,eStart, # 4
+    eError,eStart,eStart,eStart,eStart,eStart,eStart,eStart,eStart,eStart, # 5
+    eError,eStart,eStart,eStart,eStart,eError,eError,eStart,eStart,eStart, # 6
+)
+
+CP949CharLenTable = (0, 1, 2, 0, 1, 1, 2, 2, 0, 2)
+
+CP949SMModel = {'classTable': CP949_cls,
+                'classFactor': 10,
+                'stateTable': CP949_st,
+                'charLenTable': CP949CharLenTable,
+                'name': 'CP949'}
+
+# EUC-JP
+
+EUCJP_cls = (
+    4,4,4,4,4,4,4,4,  # 00 - 07
+    4,4,4,4,4,4,5,5,  # 08 - 0f
+    4,4,4,4,4,4,4,4,  # 10 - 17
+    4,4,4,5,4,4,4,4,  # 18 - 1f
+    4,4,4,4,4,4,4,4,  # 20 - 27
+    4,4,4,4,4,4,4,4,  # 28 - 2f
+    4,4,4,4,4,4,4,4,  # 30 - 37
+    4,4,4,4,4,4,4,4,  # 38 - 3f
+    4,4,4,4,4,4,4,4,  # 40 - 47
+    4,4,4,4,4,4,4,4,  # 48 - 4f
+    4,4,4,4,4,4,4,4,  # 50 - 57
+    4,4,4,4,4,4,4,4,  # 58 - 5f
+    4,4,4,4,4,4,4,4,  # 60 - 67
+    4,4,4,4,4,4,4,4,  # 68 - 6f
+    4,4,4,4,4,4,4,4,  # 70 - 77
+    4,4,4,4,4,4,4,4,  # 78 - 7f
+    5,5,5,5,5,5,5,5,  # 80 - 87
+    5,5,5,5,5,5,1,3,  # 88 - 8f
+    5,5,5,5,5,5,5,5,  # 90 - 97
+    5,5,5,5,5,5,5,5,  # 98 - 9f
+    5,2,2,2,2,2,2,2,  # a0 - a7
+    2,2,2,2,2,2,2,2,  # a8 - af
+    2,2,2,2,2,2,2,2,  # b0 - b7
+    2,2,2,2,2,2,2,2,  # b8 - bf
+    2,2,2,2,2,2,2,2,  # c0 - c7
+    2,2,2,2,2,2,2,2,  # c8 - cf
+    2,2,2,2,2,2,2,2,  # d0 - d7
+    2,2,2,2,2,2,2,2,  # d8 - df
+    0,0,0,0,0,0,0,0,  # e0 - e7
+    0,0,0,0,0,0,0,0,  # e8 - ef
+    0,0,0,0,0,0,0,0,  # f0 - f7
+    0,0,0,0,0,0,0,5  # f8 - ff
+)
+
+EUCJP_st = (
+          3,     4,     3,     5,eStart,eError,eError,eError,#00-07
+     eError,eError,eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,#08-0f
+     eItsMe,eItsMe,eStart,eError,eStart,eError,eError,eError,#10-17
+     eError,eError,eStart,eError,eError,eError,     3,eError,#18-1f
+          3,eError,eError,eError,eStart,eStart,eStart,eStart#20-27
+)
+
+EUCJPCharLenTable = (2, 2, 2, 3, 1, 0)
+
+EUCJPSMModel = {'classTable': EUCJP_cls,
+                'classFactor': 6,
+                'stateTable': EUCJP_st,
+                'charLenTable': EUCJPCharLenTable,
+                'name': 'EUC-JP'}
+
+# EUC-KR
+
+EUCKR_cls  = (
+    1,1,1,1,1,1,1,1,  # 00 - 07
+    1,1,1,1,1,1,0,0,  # 08 - 0f
+    1,1,1,1,1,1,1,1,  # 10 - 17
+    1,1,1,0,1,1,1,1,  # 18 - 1f
+    1,1,1,1,1,1,1,1,  # 20 - 27
+    1,1,1,1,1,1,1,1,  # 28 - 2f
+    1,1,1,1,1,1,1,1,  # 30 - 37
+    1,1,1,1,1,1,1,1,  # 38 - 3f
+    1,1,1,1,1,1,1,1,  # 40 - 47
+    1,1,1,1,1,1,1,1,  # 48 - 4f
+    1,1,1,1,1,1,1,1,  # 50 - 57
+    1,1,1,1,1,1,1,1,  # 58 - 5f
+    1,1,1,1,1,1,1,1,  # 60 - 67
+    1,1,1,1,1,1,1,1,  # 68 - 6f
+    1,1,1,1,1,1,1,1,  # 70 - 77
+    1,1,1,1,1,1,1,1,  # 78 - 7f
+    0,0,0,0,0,0,0,0,  # 80 - 87
+    0,0,0,0,0,0,0,0,  # 88 - 8f
+    0,0,0,0,0,0,0,0,  # 90 - 97
+    0,0,0,0,0,0,0,0,  # 98 - 9f
+    0,2,2,2,2,2,2,2,  # a0 - a7
+    2,2,2,2,2,3,3,3,  # a8 - af
+    2,2,2,2,2,2,2,2,  # b0 - b7
+    2,2,2,2,2,2,2,2,  # b8 - bf
+    2,2,2,2,2,2,2,2,  # c0 - c7
+    2,3,2,2,2,2,2,2,  # c8 - cf
+    2,2,2,2,2,2,2,2,  # d0 - d7
+    2,2,2,2,2,2,2,2,  # d8 - df
+    2,2,2,2,2,2,2,2,  # e0 - e7
+    2,2,2,2,2,2,2,2,  # e8 - ef
+    2,2,2,2,2,2,2,2,  # f0 - f7
+    2,2,2,2,2,2,2,0   # f8 - ff
+)
+
+EUCKR_st = (
+    eError,eStart,     3,eError,eError,eError,eError,eError,#00-07
+    eItsMe,eItsMe,eItsMe,eItsMe,eError,eError,eStart,eStart #08-0f
+)
+
+EUCKRCharLenTable = (0, 1, 2, 0)
+
+EUCKRSMModel = {'classTable': EUCKR_cls,
+                'classFactor': 4,
+                'stateTable': EUCKR_st,
+                'charLenTable': EUCKRCharLenTable,
+                'name': 'EUC-KR'}
+
+# EUC-TW
+
+EUCTW_cls = (
+    2,2,2,2,2,2,2,2,  # 00 - 07
+    2,2,2,2,2,2,0,0,  # 08 - 0f
+    2,2,2,2,2,2,2,2,  # 10 - 17
+    2,2,2,0,2,2,2,2,  # 18 - 1f
+    2,2,2,2,2,2,2,2,  # 20 - 27
+    2,2,2,2,2,2,2,2,  # 28 - 2f
+    2,2,2,2,2,2,2,2,  # 30 - 37
+    2,2,2,2,2,2,2,2,  # 38 - 3f
+    2,2,2,2,2,2,2,2,  # 40 - 47
+    2,2,2,2,2,2,2,2,  # 48 - 4f
+    2,2,2,2,2,2,2,2,  # 50 - 57
+    2,2,2,2,2,2,2,2,  # 58 - 5f
+    2,2,2,2,2,2,2,2,  # 60 - 67
+    2,2,2,2,2,2,2,2,  # 68 - 6f
+    2,2,2,2,2,2,2,2,  # 70 - 77
+    2,2,2,2,2,2,2,2,  # 78 - 7f
+    0,0,0,0,0,0,0,0,  # 80 - 87
+    0,0,0,0,0,0,6,0,  # 88 - 8f
+    0,0,0,0,0,0,0,0,  # 90 - 97
+    0,0,0,0,0,0,0,0,  # 98 - 9f
+    0,3,4,4,4,4,4,4,  # a0 - a7
+    5,5,1,1,1,1,1,1,  # a8 - af
+    1,1,1,1,1,1,1,1,  # b0 - b7
+    1,1,1,1,1,1,1,1,  # b8 - bf
+    1,1,3,1,3,3,3,3,  # c0 - c7
+    3,3,3,3,3,3,3,3,  # c8 - cf
+    3,3,3,3,3,3,3,3,  # d0 - d7
+    3,3,3,3,3,3,3,3,  # d8 - df
+    3,3,3,3,3,3,3,3,  # e0 - e7
+    3,3,3,3,3,3,3,3,  # e8 - ef
+    3,3,3,3,3,3,3,3,  # f0 - f7
+    3,3,3,3,3,3,3,0   # f8 - ff
+)
+
+EUCTW_st = (
+    eError,eError,eStart,     3,     3,     3,     4,eError,#00-07
+    eError,eError,eError,eError,eError,eError,eItsMe,eItsMe,#08-0f
+    eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eError,eStart,eError,#10-17
+    eStart,eStart,eStart,eError,eError,eError,eError,eError,#18-1f
+         5,eError,eError,eError,eStart,eError,eStart,eStart,#20-27
+    eStart,eError,eStart,eStart,eStart,eStart,eStart,eStart #28-2f
+)
+
+EUCTWCharLenTable = (0, 0, 1, 2, 2, 2, 3)
+
+EUCTWSMModel = {'classTable': EUCTW_cls,
+                'classFactor': 7,
+                'stateTable': EUCTW_st,
+                'charLenTable': EUCTWCharLenTable,
+                'name': 'x-euc-tw'}
+
+# GB2312
+
+GB2312_cls = (
+    1,1,1,1,1,1,1,1,  # 00 - 07
+    1,1,1,1,1,1,0,0,  # 08 - 0f
+    1,1,1,1,1,1,1,1,  # 10 - 17
+    1,1,1,0,1,1,1,1,  # 18 - 1f
+    1,1,1,1,1,1,1,1,  # 20 - 27
+    1,1,1,1,1,1,1,1,  # 28 - 2f
+    3,3,3,3,3,3,3,3,  # 30 - 37
+    3,3,1,1,1,1,1,1,  # 38 - 3f
+    2,2,2,2,2,2,2,2,  # 40 - 47
+    2,2,2,2,2,2,2,2,  # 48 - 4f
+    2,2,2,2,2,2,2,2,  # 50 - 57
+    2,2,2,2,2,2,2,2,  # 58 - 5f
+    2,2,2,2,2,2,2,2,  # 60 - 67
+    2,2,2,2,2,2,2,2,  # 68 - 6f
+    2,2,2,2,2,2,2,2,  # 70 - 77
+    2,2,2,2,2,2,2,4,  # 78 - 7f
+    5,6,6,6,6,6,6,6,  # 80 - 87
+    6,6,6,6,6,6,6,6,  # 88 - 8f
+    6,6,6,6,6,6,6,6,  # 90 - 97
+    6,6,6,6,6,6,6,6,  # 98 - 9f
+    6,6,6,6,6,6,6,6,  # a0 - a7
+    6,6,6,6,6,6,6,6,  # a8 - af
+    6,6,6,6,6,6,6,6,  # b0 - b7
+    6,6,6,6,6,6,6,6,  # b8 - bf
+    6,6,6,6,6,6,6,6,  # c0 - c7
+    6,6,6,6,6,6,6,6,  # c8 - cf
+    6,6,6,6,6,6,6,6,  # d0 - d7
+    6,6,6,6,6,6,6,6,  # d8 - df
+    6,6,6,6,6,6,6,6,  # e0 - e7
+    6,6,6,6,6,6,6,6,  # e8 - ef
+    6,6,6,6,6,6,6,6,  # f0 - f7
+    6,6,6,6,6,6,6,0   # f8 - ff
+)
+
+GB2312_st = (
+    eError,eStart,eStart,eStart,eStart,eStart,     3,eError,#00-07
+    eError,eError,eError,eError,eError,eError,eItsMe,eItsMe,#08-0f
+    eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eError,eError,eStart,#10-17
+         4,eError,eStart,eStart,eError,eError,eError,eError,#18-1f
+    eError,eError,     5,eError,eError,eError,eItsMe,eError,#20-27
+    eError,eError,eStart,eStart,eStart,eStart,eStart,eStart #28-2f
+)
+
+# To be accurate, the length of class 6 can be either 2 or 4.
+# But it is not necessary to discriminate between the two since
+# it is used for frequency analysis only, and we are validing
+# each code range there as well. So it is safe to set it to be
+# 2 here.
+GB2312CharLenTable = (0, 1, 1, 1, 1, 1, 2)
+
+GB2312SMModel = {'classTable': GB2312_cls,
+                  'classFactor': 7,
+                  'stateTable': GB2312_st,
+                  'charLenTable': GB2312CharLenTable,
+                  'name': 'GB2312'}
+
+# Shift_JIS
+
+SJIS_cls = (
+    1,1,1,1,1,1,1,1,  # 00 - 07
+    1,1,1,1,1,1,0,0,  # 08 - 0f
+    1,1,1,1,1,1,1,1,  # 10 - 17
+    1,1,1,0,1,1,1,1,  # 18 - 1f
+    1,1,1,1,1,1,1,1,  # 20 - 27
+    1,1,1,1,1,1,1,1,  # 28 - 2f
+    1,1,1,1,1,1,1,1,  # 30 - 37
+    1,1,1,1,1,1,1,1,  # 38 - 3f
+    2,2,2,2,2,2,2,2,  # 40 - 47
+    2,2,2,2,2,2,2,2,  # 48 - 4f
+    2,2,2,2,2,2,2,2,  # 50 - 57
+    2,2,2,2,2,2,2,2,  # 58 - 5f
+    2,2,2,2,2,2,2,2,  # 60 - 67
+    2,2,2,2,2,2,2,2,  # 68 - 6f
+    2,2,2,2,2,2,2,2,  # 70 - 77
+    2,2,2,2,2,2,2,1,  # 78 - 7f
+    3,3,3,3,3,3,3,3,  # 80 - 87
+    3,3,3,3,3,3,3,3,  # 88 - 8f
+    3,3,3,3,3,3,3,3,  # 90 - 97
+    3,3,3,3,3,3,3,3,  # 98 - 9f
+    #0xa0 is illegal in sjis encoding, but some pages does
+    #contain such byte. We need to be more error forgiven.
+    2,2,2,2,2,2,2,2,  # a0 - a7
+    2,2,2,2,2,2,2,2,  # a8 - af
+    2,2,2,2,2,2,2,2,  # b0 - b7
+    2,2,2,2,2,2,2,2,  # b8 - bf
+    2,2,2,2,2,2,2,2,  # c0 - c7
+    2,2,2,2,2,2,2,2,  # c8 - cf
+    2,2,2,2,2,2,2,2,  # d0 - d7
+    2,2,2,2,2,2,2,2,  # d8 - df
+    3,3,3,3,3,3,3,3,  # e0 - e7
+    3,3,3,3,3,4,4,4,  # e8 - ef
+    4,4,4,4,4,4,4,4,  # f0 - f7
+    4,4,4,4,4,0,0,0   # f8 - ff
+)
+
+
+SJIS_st = (
+    eError,eStart,eStart,     3,eError,eError,eError,eError,#00-07
+    eError,eError,eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,#08-0f
+    eItsMe,eItsMe,eError,eError,eStart,eStart,eStart,eStart #10-17
+)
+
+SJISCharLenTable = (0, 1, 1, 2, 0, 0)
+
+SJISSMModel = {'classTable': SJIS_cls,
+               'classFactor': 6,
+               'stateTable': SJIS_st,
+               'charLenTable': SJISCharLenTable,
+               'name': 'Shift_JIS'}
+
+# UCS2-BE
+
+UCS2BE_cls = (
+    0,0,0,0,0,0,0,0,  # 00 - 07
+    0,0,1,0,0,2,0,0,  # 08 - 0f
+    0,0,0,0,0,0,0,0,  # 10 - 17
+    0,0,0,3,0,0,0,0,  # 18 - 1f
+    0,0,0,0,0,0,0,0,  # 20 - 27
+    0,3,3,3,3,3,0,0,  # 28 - 2f
+    0,0,0,0,0,0,0,0,  # 30 - 37
+    0,0,0,0,0,0,0,0,  # 38 - 3f
+    0,0,0,0,0,0,0,0,  # 40 - 47
+    0,0,0,0,0,0,0,0,  # 48 - 4f
+    0,0,0,0,0,0,0,0,  # 50 - 57
+    0,0,0,0,0,0,0,0,  # 58 - 5f
+    0,0,0,0,0,0,0,0,  # 60 - 67
+    0,0,0,0,0,0,0,0,  # 68 - 6f
+    0,0,0,0,0,0,0,0,  # 70 - 77
+    0,0,0,0,0,0,0,0,  # 78 - 7f
+    0,0,0,0,0,0,0,0,  # 80 - 87
+    0,0,0,0,0,0,0,0,  # 88 - 8f
+    0,0,0,0,0,0,0,0,  # 90 - 97
+    0,0,0,0,0,0,0,0,  # 98 - 9f
+    0,0,0,0,0,0,0,0,  # a0 - a7
+    0,0,0,0,0,0,0,0,  # a8 - af
+    0,0,0,0,0,0,0,0,  # b0 - b7
+    0,0,0,0,0,0,0,0,  # b8 - bf
+    0,0,0,0,0,0,0,0,  # c0 - c7
+    0,0,0,0,0,0,0,0,  # c8 - cf
+    0,0,0,0,0,0,0,0,  # d0 - d7
+    0,0,0,0,0,0,0,0,  # d8 - df
+    0,0,0,0,0,0,0,0,  # e0 - e7
+    0,0,0,0,0,0,0,0,  # e8 - ef
+    0,0,0,0,0,0,0,0,  # f0 - f7
+    0,0,0,0,0,0,4,5   # f8 - ff
+)
+
+UCS2BE_st  = (
+          5,     7,     7,eError,     4,     3,eError,eError,#00-07
+     eError,eError,eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,#08-0f
+     eItsMe,eItsMe,     6,     6,     6,     6,eError,eError,#10-17
+          6,     6,     6,     6,     6,eItsMe,     6,     6,#18-1f
+          6,     6,     6,     6,     5,     7,     7,eError,#20-27
+          5,     8,     6,     6,eError,     6,     6,     6,#28-2f
+          6,     6,     6,     6,eError,eError,eStart,eStart #30-37
+)
+
+UCS2BECharLenTable = (2, 2, 2, 0, 2, 2)
+
+UCS2BESMModel = {'classTable': UCS2BE_cls,
+                 'classFactor': 6,
+                 'stateTable': UCS2BE_st,
+                 'charLenTable': UCS2BECharLenTable,
+                 'name': 'UTF-16BE'}
+
+# UCS2-LE
+
+UCS2LE_cls = (
+    0,0,0,0,0,0,0,0,  # 00 - 07
+    0,0,1,0,0,2,0,0,  # 08 - 0f
+    0,0,0,0,0,0,0,0,  # 10 - 17
+    0,0,0,3,0,0,0,0,  # 18 - 1f
+    0,0,0,0,0,0,0,0,  # 20 - 27
+    0,3,3,3,3,3,0,0,  # 28 - 2f
+    0,0,0,0,0,0,0,0,  # 30 - 37
+    0,0,0,0,0,0,0,0,  # 38 - 3f
+    0,0,0,0,0,0,0,0,  # 40 - 47
+    0,0,0,0,0,0,0,0,  # 48 - 4f
+    0,0,0,0,0,0,0,0,  # 50 - 57
+    0,0,0,0,0,0,0,0,  # 58 - 5f
+    0,0,0,0,0,0,0,0,  # 60 - 67
+    0,0,0,0,0,0,0,0,  # 68 - 6f
+    0,0,0,0,0,0,0,0,  # 70 - 77
+    0,0,0,0,0,0,0,0,  # 78 - 7f
+    0,0,0,0,0,0,0,0,  # 80 - 87
+    0,0,0,0,0,0,0,0,  # 88 - 8f
+    0,0,0,0,0,0,0,0,  # 90 - 97
+    0,0,0,0,0,0,0,0,  # 98 - 9f
+    0,0,0,0,0,0,0,0,  # a0 - a7
+    0,0,0,0,0,0,0,0,  # a8 - af
+    0,0,0,0,0,0,0,0,  # b0 - b7
+    0,0,0,0,0,0,0,0,  # b8 - bf
+    0,0,0,0,0,0,0,0,  # c0 - c7
+    0,0,0,0,0,0,0,0,  # c8 - cf
+    0,0,0,0,0,0,0,0,  # d0 - d7
+    0,0,0,0,0,0,0,0,  # d8 - df
+    0,0,0,0,0,0,0,0,  # e0 - e7
+    0,0,0,0,0,0,0,0,  # e8 - ef
+    0,0,0,0,0,0,0,0,  # f0 - f7
+    0,0,0,0,0,0,4,5   # f8 - ff
+)
+
+UCS2LE_st = (
+          6,     6,     7,     6,     4,     3,eError,eError,#00-07
+     eError,eError,eError,eError,eItsMe,eItsMe,eItsMe,eItsMe,#08-0f
+     eItsMe,eItsMe,     5,     5,     5,eError,eItsMe,eError,#10-17
+          5,     5,     5,eError,     5,eError,     6,     6,#18-1f
+          7,     6,     8,     8,     5,     5,     5,eError,#20-27
+          5,     5,     5,eError,eError,eError,     5,     5,#28-2f
+          5,     5,     5,eError,     5,eError,eStart,eStart #30-37
+)
+
+UCS2LECharLenTable = (2, 2, 2, 2, 2, 2)
+
+UCS2LESMModel = {'classTable': UCS2LE_cls,
+                 'classFactor': 6,
+                 'stateTable': UCS2LE_st,
+                 'charLenTable': UCS2LECharLenTable,
+                 'name': 'UTF-16LE'}
+
+# UTF-8
+
+UTF8_cls = (
+    1,1,1,1,1,1,1,1,  # 00 - 07  #allow 0x00 as a legal value
+    1,1,1,1,1,1,0,0,  # 08 - 0f
+    1,1,1,1,1,1,1,1,  # 10 - 17
+    1,1,1,0,1,1,1,1,  # 18 - 1f
+    1,1,1,1,1,1,1,1,  # 20 - 27
+    1,1,1,1,1,1,1,1,  # 28 - 2f
+    1,1,1,1,1,1,1,1,  # 30 - 37
+    1,1,1,1,1,1,1,1,  # 38 - 3f
+    1,1,1,1,1,1,1,1,  # 40 - 47
+    1,1,1,1,1,1,1,1,  # 48 - 4f
+    1,1,1,1,1,1,1,1,  # 50 - 57
+    1,1,1,1,1,1,1,1,  # 58 - 5f
+    1,1,1,1,1,1,1,1,  # 60 - 67
+    1,1,1,1,1,1,1,1,  # 68 - 6f
+    1,1,1,1,1,1,1,1,  # 70 - 77
+    1,1,1,1,1,1,1,1,  # 78 - 7f
+    2,2,2,2,3,3,3,3,  # 80 - 87
+    4,4,4,4,4,4,4,4,  # 88 - 8f
+    4,4,4,4,4,4,4,4,  # 90 - 97
+    4,4,4,4,4,4,4,4,  # 98 - 9f
+    5,5,5,5,5,5,5,5,  # a0 - a7
+    5,5,5,5,5,5,5,5,  # a8 - af
+    5,5,5,5,5,5,5,5,  # b0 - b7
+    5,5,5,5,5,5,5,5,  # b8 - bf
+    0,0,6,6,6,6,6,6,  # c0 - c7
+    6,6,6,6,6,6,6,6,  # c8 - cf
+    6,6,6,6,6,6,6,6,  # d0 - d7
+    6,6,6,6,6,6,6,6,  # d8 - df
+    7,8,8,8,8,8,8,8,  # e0 - e7
+    8,8,8,8,8,9,8,8,  # e8 - ef
+    10,11,11,11,11,11,11,11,  # f0 - f7
+    12,13,13,13,14,15,0,0    # f8 - ff
+)
+
+UTF8_st = (
+    eError,eStart,eError,eError,eError,eError,     12,   10,#00-07
+         9,     11,     8,     7,     6,     5,     4,    3,#08-0f
+    eError,eError,eError,eError,eError,eError,eError,eError,#10-17
+    eError,eError,eError,eError,eError,eError,eError,eError,#18-1f
+    eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,#20-27
+    eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,eItsMe,#28-2f
+    eError,eError,     5,     5,     5,     5,eError,eError,#30-37
+    eError,eError,eError,eError,eError,eError,eError,eError,#38-3f
+    eError,eError,eError,     5,     5,     5,eError,eError,#40-47
+    eError,eError,eError,eError,eError,eError,eError,eError,#48-4f
+    eError,eError,     7,     7,     7,     7,eError,eError,#50-57
+    eError,eError,eError,eError,eError,eError,eError,eError,#58-5f
+    eError,eError,eError,eError,     7,     7,eError,eError,#60-67
+    eError,eError,eError,eError,eError,eError,eError,eError,#68-6f
+    eError,eError,     9,     9,     9,     9,eError,eError,#70-77
+    eError,eError,eError,eError,eError,eError,eError,eError,#78-7f
+    eError,eError,eError,eError,eError,     9,eError,eError,#80-87
+    eError,eError,eError,eError,eError,eError,eError,eError,#88-8f
+    eError,eError,    12,    12,    12,    12,eError,eError,#90-97
+    eError,eError,eError,eError,eError,eError,eError,eError,#98-9f
+    eError,eError,eError,eError,eError,    12,eError,eError,#a0-a7
+    eError,eError,eError,eError,eError,eError,eError,eError,#a8-af
+    eError,eError,    12,    12,    12,eError,eError,eError,#b0-b7
+    eError,eError,eError,eError,eError,eError,eError,eError,#b8-bf
+    eError,eError,eStart,eStart,eStart,eStart,eError,eError,#c0-c7
+    eError,eError,eError,eError,eError,eError,eError,eError #c8-cf
+)
+
+UTF8CharLenTable = (0, 1, 0, 0, 0, 0, 2, 3, 3, 3, 4, 4, 5, 5, 6, 6)
+
+UTF8SMModel = {'classTable': UTF8_cls,
+               'classFactor': 16,
+               'stateTable': UTF8_st,
+               'charLenTable': UTF8CharLenTable,
+               'name': 'UTF-8'}
+
+# flake8: noqa
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sbcharsetprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sbcharsetprober.py
new file mode 100644
index 0000000..37291bd
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sbcharsetprober.py
@@ -0,0 +1,120 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 2001
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+import sys
+from . import constants
+from .charsetprober import CharSetProber
+from .compat import wrap_ord
+
+SAMPLE_SIZE = 64
+SB_ENOUGH_REL_THRESHOLD = 1024
+POSITIVE_SHORTCUT_THRESHOLD = 0.95
+NEGATIVE_SHORTCUT_THRESHOLD = 0.05
+SYMBOL_CAT_ORDER = 250
+NUMBER_OF_SEQ_CAT = 4
+POSITIVE_CAT = NUMBER_OF_SEQ_CAT - 1
+#NEGATIVE_CAT = 0
+
+
+class SingleByteCharSetProber(CharSetProber):
+    def __init__(self, model, reversed=False, nameProber=None):
+        CharSetProber.__init__(self)
+        self._mModel = model
+        # TRUE if we need to reverse every pair in the model lookup
+        self._mReversed = reversed
+        # Optional auxiliary prober for name decision
+        self._mNameProber = nameProber
+        self.reset()
+
+    def reset(self):
+        CharSetProber.reset(self)
+        # char order of last character
+        self._mLastOrder = 255
+        self._mSeqCounters = [0] * NUMBER_OF_SEQ_CAT
+        self._mTotalSeqs = 0
+        self._mTotalChar = 0
+        # characters that fall in our sampling range
+        self._mFreqChar = 0
+
+    def get_charset_name(self):
+        if self._mNameProber:
+            return self._mNameProber.get_charset_name()
+        else:
+            return self._mModel['charsetName']
+
+    def feed(self, aBuf):
+        if not self._mModel['keepEnglishLetter']:
+            aBuf = self.filter_without_english_letters(aBuf)
+        aLen = len(aBuf)
+        if not aLen:
+            return self.get_state()
+        for c in aBuf:
+            order = self._mModel['charToOrderMap'][wrap_ord(c)]
+            if order < SYMBOL_CAT_ORDER:
+                self._mTotalChar += 1
+            if order < SAMPLE_SIZE:
+                self._mFreqChar += 1
+                if self._mLastOrder < SAMPLE_SIZE:
+                    self._mTotalSeqs += 1
+                    if not self._mReversed:
+                        i = (self._mLastOrder * SAMPLE_SIZE) + order
+                        model = self._mModel['precedenceMatrix'][i]
+                    else:  # reverse the order of the letters in the lookup
+                        i = (order * SAMPLE_SIZE) + self._mLastOrder
+                        model = self._mModel['precedenceMatrix'][i]
+                    self._mSeqCounters[model] += 1
+            self._mLastOrder = order
+
+        if self.get_state() == constants.eDetecting:
+            if self._mTotalSeqs > SB_ENOUGH_REL_THRESHOLD:
+                cf = self.get_confidence()
+                if cf > POSITIVE_SHORTCUT_THRESHOLD:
+                    if constants._debug:
+                        sys.stderr.write('%s confidence = %s, we have a'
+                                         'winner\n' %
+                                         (self._mModel['charsetName'], cf))
+                    self._mState = constants.eFoundIt
+                elif cf < NEGATIVE_SHORTCUT_THRESHOLD:
+                    if constants._debug:
+                        sys.stderr.write('%s confidence = %s, below negative'
+                                         'shortcut threshhold %s\n' %
+                                         (self._mModel['charsetName'], cf,
+                                          NEGATIVE_SHORTCUT_THRESHOLD))
+                    self._mState = constants.eNotMe
+
+        return self.get_state()
+
+    def get_confidence(self):
+        r = 0.01
+        if self._mTotalSeqs > 0:
+            r = ((1.0 * self._mSeqCounters[POSITIVE_CAT]) / self._mTotalSeqs
+                 / self._mModel['mTypicalPositiveRatio'])
+            r = r * self._mFreqChar / self._mTotalChar
+            if r >= 1.0:
+                r = 0.99
+        return r
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sbcsgroupprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sbcsgroupprober.py
new file mode 100644
index 0000000..1b6196c
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sbcsgroupprober.py
@@ -0,0 +1,69 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 2001
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from .charsetgroupprober import CharSetGroupProber
+from .sbcharsetprober import SingleByteCharSetProber
+from .langcyrillicmodel import (Win1251CyrillicModel, Koi8rModel,
+                                Latin5CyrillicModel, MacCyrillicModel,
+                                Ibm866Model, Ibm855Model)
+from .langgreekmodel import Latin7GreekModel, Win1253GreekModel
+from .langbulgarianmodel import Latin5BulgarianModel, Win1251BulgarianModel
+from .langhungarianmodel import Latin2HungarianModel, Win1250HungarianModel
+from .langthaimodel import TIS620ThaiModel
+from .langhebrewmodel import Win1255HebrewModel
+from .hebrewprober import HebrewProber
+
+
+class SBCSGroupProber(CharSetGroupProber):
+    def __init__(self):
+        CharSetGroupProber.__init__(self)
+        self._mProbers = [
+            SingleByteCharSetProber(Win1251CyrillicModel),
+            SingleByteCharSetProber(Koi8rModel),
+            SingleByteCharSetProber(Latin5CyrillicModel),
+            SingleByteCharSetProber(MacCyrillicModel),
+            SingleByteCharSetProber(Ibm866Model),
+            SingleByteCharSetProber(Ibm855Model),
+            SingleByteCharSetProber(Latin7GreekModel),
+            SingleByteCharSetProber(Win1253GreekModel),
+            SingleByteCharSetProber(Latin5BulgarianModel),
+            SingleByteCharSetProber(Win1251BulgarianModel),
+            SingleByteCharSetProber(Latin2HungarianModel),
+            SingleByteCharSetProber(Win1250HungarianModel),
+            SingleByteCharSetProber(TIS620ThaiModel),
+        ]
+        hebrewProber = HebrewProber()
+        logicalHebrewProber = SingleByteCharSetProber(Win1255HebrewModel,
+                                                      False, hebrewProber)
+        visualHebrewProber = SingleByteCharSetProber(Win1255HebrewModel, True,
+                                                     hebrewProber)
+        hebrewProber.set_model_probers(logicalHebrewProber, visualHebrewProber)
+        self._mProbers.extend([hebrewProber, logicalHebrewProber,
+                               visualHebrewProber])
+
+        self.reset()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sjisprober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sjisprober.py
new file mode 100644
index 0000000..b173614
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/sjisprober.py
@@ -0,0 +1,91 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+import sys
+from .mbcharsetprober import MultiByteCharSetProber
+from .codingstatemachine import CodingStateMachine
+from .chardistribution import SJISDistributionAnalysis
+from .jpcntx import SJISContextAnalysis
+from .mbcssm import SJISSMModel
+from . import constants
+
+
+class SJISProber(MultiByteCharSetProber):
+    def __init__(self):
+        MultiByteCharSetProber.__init__(self)
+        self._mCodingSM = CodingStateMachine(SJISSMModel)
+        self._mDistributionAnalyzer = SJISDistributionAnalysis()
+        self._mContextAnalyzer = SJISContextAnalysis()
+        self.reset()
+
+    def reset(self):
+        MultiByteCharSetProber.reset(self)
+        self._mContextAnalyzer.reset()
+
+    def get_charset_name(self):
+        return "SHIFT_JIS"
+
+    def feed(self, aBuf):
+        aLen = len(aBuf)
+        for i in range(0, aLen):
+            codingState = self._mCodingSM.next_state(aBuf[i])
+            if codingState == constants.eError:
+                if constants._debug:
+                    sys.stderr.write(self.get_charset_name()
+                                     + ' prober hit error at byte ' + str(i)
+                                     + '\n')
+                self._mState = constants.eNotMe
+                break
+            elif codingState == constants.eItsMe:
+                self._mState = constants.eFoundIt
+                break
+            elif codingState == constants.eStart:
+                charLen = self._mCodingSM.get_current_charlen()
+                if i == 0:
+                    self._mLastChar[1] = aBuf[0]
+                    self._mContextAnalyzer.feed(self._mLastChar[2 - charLen:],
+                                                charLen)
+                    self._mDistributionAnalyzer.feed(self._mLastChar, charLen)
+                else:
+                    self._mContextAnalyzer.feed(aBuf[i + 1 - charLen:i + 3
+                                                     - charLen], charLen)
+                    self._mDistributionAnalyzer.feed(aBuf[i - 1:i + 1],
+                                                     charLen)
+
+        self._mLastChar[0] = aBuf[aLen - 1]
+
+        if self.get_state() == constants.eDetecting:
+            if (self._mContextAnalyzer.got_enough_data() and
+               (self.get_confidence() > constants.SHORTCUT_THRESHOLD)):
+                self._mState = constants.eFoundIt
+
+        return self.get_state()
+
+    def get_confidence(self):
+        contxtCf = self._mContextAnalyzer.get_confidence()
+        distribCf = self._mDistributionAnalyzer.get_confidence()
+        return max(contxtCf, distribCf)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/universaldetector.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/universaldetector.py
new file mode 100644
index 0000000..6307155
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/universaldetector.py
@@ -0,0 +1,172 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is Mozilla Universal charset detector code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 2001
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#   Shy Shalom - original C code
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from . import constants
+import sys
+import codecs
+from .latin1prober import Latin1Prober  # windows-1252
+from .mbcsgroupprober import MBCSGroupProber  # multi-byte character sets
+from .sbcsgroupprober import SBCSGroupProber  # single-byte character sets
+from .escprober import EscCharSetProber  # ISO-2122, etc.
+import re
+
+MINIMUM_THRESHOLD = 0.20
+ePureAscii = 0
+eEscAscii = 1
+eHighbyte = 2
+
+
+class UniversalDetector:
+    def __init__(self):
+        self._highBitDetector = re.compile(b'[\x80-\xFF]')
+        self._escDetector = re.compile(b'(\033|~{)')
+        self._mEscCharSetProber = None
+        self._mCharSetProbers = []
+        self.reset()
+
+    def reset(self):
+        self.result = {'encoding': None, 'confidence': 0.0}
+        self.done = False
+        self._mStart = True
+        self._mGotData = False
+        self._mInputState = ePureAscii
+        self._mLastChar = b''
+        if self._mEscCharSetProber:
+            self._mEscCharSetProber.reset()
+        for prober in self._mCharSetProbers:
+            prober.reset()
+
+    def feed(self, aBuf):
+        if self.done:
+            return
+
+        aLen = len(aBuf)
+        if not aLen:
+            return
+
+        if not self._mGotData:
+            # If the data starts with BOM, we know it is UTF
+            if aBuf[:3] == codecs.BOM:
+                # EF BB BF  UTF-8 with BOM
+                self.result = {'encoding': "UTF-8", 'confidence': 1.0}
+            elif aBuf[:4] == codecs.BOM_UTF32_LE:
+                # FF FE 00 00  UTF-32, little-endian BOM
+                self.result = {'encoding': "UTF-32LE", 'confidence': 1.0}
+            elif aBuf[:4] == codecs.BOM_UTF32_BE:
+                # 00 00 FE FF  UTF-32, big-endian BOM
+                self.result = {'encoding': "UTF-32BE", 'confidence': 1.0}
+            elif aBuf[:4] == b'\xFE\xFF\x00\x00':
+                # FE FF 00 00  UCS-4, unusual octet order BOM (3412)
+                self.result = {
+                    'encoding': "X-ISO-10646-UCS-4-3412",
+                    'confidence': 1.0
+                }
+            elif aBuf[:4] == b'\x00\x00\xFF\xFE':
+                # 00 00 FF FE  UCS-4, unusual octet order BOM (2143)
+                self.result = {
+                    'encoding': "X-ISO-10646-UCS-4-2143",
+                    'confidence': 1.0
+                }
+            elif aBuf[:2] == codecs.BOM_LE:
+                # FF FE  UTF-16, little endian BOM
+                self.result = {'encoding': "UTF-16LE", 'confidence': 1.0}
+            elif aBuf[:2] == codecs.BOM_BE:
+                # FE FF  UTF-16, big endian BOM
+                self.result = {'encoding': "UTF-16BE", 'confidence': 1.0}
+
+        self._mGotData = True
+        if self.result['encoding'] and (self.result['confidence'] > 0.0):
+            self.done = True
+            return
+
+        if self._mInputState == ePureAscii:
+            if self._highBitDetector.search(aBuf):
+                self._mInputState = eHighbyte
+            elif ((self._mInputState == ePureAscii) and
+                    self._escDetector.search(self._mLastChar + aBuf)):
+                self._mInputState = eEscAscii
+
+        self._mLastChar = aBuf[-1:]
+
+        if self._mInputState == eEscAscii:
+            if not self._mEscCharSetProber:
+                self._mEscCharSetProber = EscCharSetProber()
+            if self._mEscCharSetProber.feed(aBuf) == constants.eFoundIt:
+                self.result = {
+                    'encoding': self._mEscCharSetProber.get_charset_name(),
+                    'confidence': self._mEscCharSetProber.get_confidence()
+                }
+                self.done = True
+        elif self._mInputState == eHighbyte:
+            if not self._mCharSetProbers:
+                self._mCharSetProbers = [MBCSGroupProber(), SBCSGroupProber(),
+                                         Latin1Prober()]
+            for prober in self._mCharSetProbers:
+                if prober.feed(aBuf) == constants.eFoundIt:
+                    self.result = {'encoding': prober.get_charset_name(),
+                                   'confidence': prober.get_confidence()}
+                    self.done = True
+                    break
+
+    def close(self):
+        if self.done:
+            return
+        if not self._mGotData:
+            if constants._debug:
+                sys.stderr.write('no data received!\n')
+            return
+        self.done = True
+
+        if self._mInputState == ePureAscii:
+            self.result = {'encoding': 'ascii', 'confidence': 1.0}
+            return self.result
+
+        if self._mInputState == eHighbyte:
+            proberConfidence = None
+            maxProberConfidence = 0.0
+            maxProber = None
+            for prober in self._mCharSetProbers:
+                if not prober:
+                    continue
+                proberConfidence = prober.get_confidence()
+                if proberConfidence > maxProberConfidence:
+                    maxProberConfidence = proberConfidence
+                    maxProber = prober
+            if maxProber and (maxProberConfidence > MINIMUM_THRESHOLD):
+                self.result = {'encoding': maxProber.get_charset_name(),
+                               'confidence': maxProber.get_confidence()}
+                return self.result
+
+        if constants._debug:
+            sys.stderr.write('no probers hit minimum threshhold\n')
+            for prober in self._mCharSetProbers[0].mProbers:
+                if not prober:
+                    continue
+                sys.stderr.write('%s confidence = %s\n' %
+                                 (prober.get_charset_name(),
+                                  prober.get_confidence()))
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/utf8prober.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/utf8prober.py
new file mode 100644
index 0000000..1c0bb5d
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/charade/utf8prober.py
@@ -0,0 +1,76 @@
+######################## BEGIN LICENSE BLOCK ########################
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mark Pilgrim - port to Python
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
+# 02110-1301  USA
+######################### END LICENSE BLOCK #########################
+
+from . import constants
+from .charsetprober import CharSetProber
+from .codingstatemachine import CodingStateMachine
+from .mbcssm import UTF8SMModel
+
+ONE_CHAR_PROB = 0.5
+
+
+class UTF8Prober(CharSetProber):
+    def __init__(self):
+        CharSetProber.__init__(self)
+        self._mCodingSM = CodingStateMachine(UTF8SMModel)
+        self.reset()
+
+    def reset(self):
+        CharSetProber.reset(self)
+        self._mCodingSM.reset()
+        self._mNumOfMBChar = 0
+
+    def get_charset_name(self):
+        return "utf-8"
+
+    def feed(self, aBuf):
+        for c in aBuf:
+            codingState = self._mCodingSM.next_state(c)
+            if codingState == constants.eError:
+                self._mState = constants.eNotMe
+                break
+            elif codingState == constants.eItsMe:
+                self._mState = constants.eFoundIt
+                break
+            elif codingState == constants.eStart:
+                if self._mCodingSM.get_current_charlen() >= 2:
+                    self._mNumOfMBChar += 1
+
+        if self.get_state() == constants.eDetecting:
+            if self.get_confidence() > constants.SHORTCUT_THRESHOLD:
+                self._mState = constants.eFoundIt
+
+        return self.get_state()
+
+    def get_confidence(self):
+        unlike = 0.99
+        if self._mNumOfMBChar < 6:
+            for i in range(0, self._mNumOfMBChar):
+                unlike = unlike * ONE_CHAR_PROB
+            return 1.0 - unlike
+        else:
+            return unlike
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/__init__.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/__init__.py
new file mode 100644
index 0000000..73071f7
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/__init__.py
@@ -0,0 +1,58 @@
+# urllib3/__init__.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+"""
+urllib3 - Thread-safe connection pooling and re-using.
+"""
+
+__author__ = 'Andrey Petrov (andrey.petrov@shazow.net)'
+__license__ = 'MIT'
+__version__ = 'dev'
+
+
+from .connectionpool import (
+    HTTPConnectionPool,
+    HTTPSConnectionPool,
+    connection_from_url
+)
+
+from . import exceptions
+from .filepost import encode_multipart_formdata
+from .poolmanager import PoolManager, ProxyManager, proxy_from_url
+from .response import HTTPResponse
+from .util import make_headers, get_host, Timeout
+
+
+# Set default logging handler to avoid "No handler found" warnings.
+import logging
+try:  # Python 2.7+
+    from logging import NullHandler
+except ImportError:
+    class NullHandler(logging.Handler):
+        def emit(self, record):
+            pass
+
+logging.getLogger(__name__).addHandler(NullHandler())
+
+def add_stderr_logger(level=logging.DEBUG):
+    """
+    Helper for quickly adding a StreamHandler to the logger. Useful for
+    debugging.
+
+    Returns the handler after adding it.
+    """
+    # This method needs to be in this __init__.py to get the __name__ correct
+    # even if urllib3 is vendored within another package.
+    logger = logging.getLogger(__name__)
+    handler = logging.StreamHandler()
+    handler.setFormatter(logging.Formatter('%(asctime)s %(levelname)s %(message)s'))
+    logger.addHandler(handler)
+    logger.setLevel(level)
+    logger.debug('Added an stderr logging handler to logger: %s' % __name__)
+    return handler
+
+# ... Clean up.
+del NullHandler
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/_collections.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/_collections.py
new file mode 100644
index 0000000..282b8d5
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/_collections.py
@@ -0,0 +1,94 @@
+# urllib3/_collections.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+from collections import MutableMapping
+from threading import RLock
+
+try: # Python 2.7+
+    from collections import OrderedDict
+except ImportError:
+    from .packages.ordered_dict import OrderedDict
+
+
+__all__ = ['RecentlyUsedContainer']
+
+
+_Null = object()
+
+
+class RecentlyUsedContainer(MutableMapping):
+    """
+    Provides a thread-safe dict-like container which maintains up to
+    ``maxsize`` keys while throwing away the least-recently-used keys beyond
+    ``maxsize``.
+
+    :param maxsize:
+        Maximum number of recent elements to retain.
+
+    :param dispose_func:
+        Every time an item is evicted from the container,
+        ``dispose_func(value)`` is called.  Callback which will get called
+    """
+
+    ContainerCls = OrderedDict
+
+    def __init__(self, maxsize=10, dispose_func=None):
+        self._maxsize = maxsize
+        self.dispose_func = dispose_func
+
+        self._container = self.ContainerCls()
+        self.lock = RLock()
+
+    def __getitem__(self, key):
+        # Re-insert the item, moving it to the end of the eviction line.
+        with self.lock:
+            item = self._container.pop(key)
+            self._container[key] = item
+            return item
+
+    def __setitem__(self, key, value):
+        evicted_value = _Null
+        with self.lock:
+            # Possibly evict the existing value of 'key'
+            evicted_value = self._container.get(key, _Null)
+            self._container[key] = value
+
+            # If we didn't evict an existing value, we might have to evict the
+            # least recently used item from the beginning of the container.
+            if len(self._container) > self._maxsize:
+                _key, evicted_value = self._container.popitem(last=False)
+
+        if self.dispose_func and evicted_value is not _Null:
+            self.dispose_func(evicted_value)
+
+    def __delitem__(self, key):
+        with self.lock:
+            value = self._container.pop(key)
+
+        if self.dispose_func:
+            self.dispose_func(value)
+
+    def __len__(self):
+        with self.lock:
+            return len(self._container)
+
+    def __iter__(self):
+        raise NotImplementedError('Iteration over this class is unlikely to be threadsafe.')
+
+    def clear(self):
+        with self.lock:
+            # Copy pointers to all values, then wipe the mapping
+            # under Python 2, this copies the list of values twice :-|
+            values = list(self._container.values())
+            self._container.clear()
+
+        if self.dispose_func:
+            for value in values:
+                self.dispose_func(value)
+
+    def keys(self):
+        with self.lock:
+            return self._container.keys()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/connectionpool.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/connectionpool.py
new file mode 100644
index 0000000..691d4e2
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/connectionpool.py
@@ -0,0 +1,745 @@
+# urllib3/connectionpool.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+import errno
+import logging
+
+from socket import error as SocketError, timeout as SocketTimeout
+import socket
+
+try: # Python 3
+    from http.client import HTTPConnection, HTTPException
+    from http.client import HTTP_PORT, HTTPS_PORT
+except ImportError:
+    from httplib import HTTPConnection, HTTPException
+    from httplib import HTTP_PORT, HTTPS_PORT
+
+try: # Python 3
+    from queue import LifoQueue, Empty, Full
+except ImportError:
+    from Queue import LifoQueue, Empty, Full
+    import Queue as _  # Platform-specific: Windows
+
+
+try: # Compiled with SSL?
+    HTTPSConnection = object
+
+    class BaseSSLError(BaseException):
+        pass
+
+    ssl = None
+
+    try: # Python 3
+        from http.client import HTTPSConnection
+    except ImportError:
+        from httplib import HTTPSConnection
+
+    import ssl
+    BaseSSLError = ssl.SSLError
+
+except (ImportError, AttributeError): # Platform-specific: No SSL.
+    pass
+
+
+from .exceptions import (
+    ClosedPoolError,
+    ConnectTimeoutError,
+    EmptyPoolError,
+    HostChangedError,
+    MaxRetryError,
+    SSLError,
+    ReadTimeoutError,
+    ProxyError,
+)
+from .packages.ssl_match_hostname import CertificateError, match_hostname
+from .packages import six
+from .request import RequestMethods
+from .response import HTTPResponse
+from .util import (
+    assert_fingerprint,
+    get_host,
+    is_connection_dropped,
+    resolve_cert_reqs,
+    resolve_ssl_version,
+    ssl_wrap_socket,
+    Timeout,
+)
+
+xrange = six.moves.xrange
+
+log = logging.getLogger(__name__)
+
+_Default = object()
+
+port_by_scheme = {
+    'http': HTTP_PORT,
+    'https': HTTPS_PORT,
+}
+
+
+## Connection objects (extension of httplib)
+
+class VerifiedHTTPSConnection(HTTPSConnection):
+    """
+    Based on httplib.HTTPSConnection but wraps the socket with
+    SSL certification.
+    """
+    cert_reqs = None
+    ca_certs = None
+    ssl_version = None
+
+    def set_cert(self, key_file=None, cert_file=None,
+                 cert_reqs=None, ca_certs=None,
+                 assert_hostname=None, assert_fingerprint=None):
+
+        self.key_file = key_file
+        self.cert_file = cert_file
+        self.cert_reqs = cert_reqs
+        self.ca_certs = ca_certs
+        self.assert_hostname = assert_hostname
+        self.assert_fingerprint = assert_fingerprint
+
+    def connect(self):
+        # Add certificate verification
+        try:
+            sock = socket.create_connection(
+                address=(self.host, self.port),
+                timeout=self.timeout)
+        except SocketTimeout:
+                raise ConnectTimeoutError(
+                    self, "Connection to %s timed out. (connect timeout=%s)" %
+                    (self.host, self.timeout))
+
+        resolved_cert_reqs = resolve_cert_reqs(self.cert_reqs)
+        resolved_ssl_version = resolve_ssl_version(self.ssl_version)
+
+        if self._tunnel_host:
+            self.sock = sock
+            # Calls self._set_hostport(), so self.host is
+            # self._tunnel_host below.
+            self._tunnel()
+
+        # Wrap socket using verification with the root certs in
+        # trusted_root_certs
+        self.sock = ssl_wrap_socket(sock, self.key_file, self.cert_file,
+                                    cert_reqs=resolved_cert_reqs,
+                                    ca_certs=self.ca_certs,
+                                    server_hostname=self.host,
+                                    ssl_version=resolved_ssl_version)
+
+        if resolved_cert_reqs != ssl.CERT_NONE:
+            if self.assert_fingerprint:
+                assert_fingerprint(self.sock.getpeercert(binary_form=True),
+                                   self.assert_fingerprint)
+            elif self.assert_hostname is not False:
+                match_hostname(self.sock.getpeercert(),
+                               self.assert_hostname or self.host)
+
+
+## Pool objects
+
+class ConnectionPool(object):
+    """
+    Base class for all connection pools, such as
+    :class:`.HTTPConnectionPool` and :class:`.HTTPSConnectionPool`.
+    """
+
+    scheme = None
+    QueueCls = LifoQueue
+
+    def __init__(self, host, port=None):
+        # httplib doesn't like it when we include brackets in ipv6 addresses
+        host = host.strip('[]')
+
+        self.host = host
+        self.port = port
+
+    def __str__(self):
+        return '%s(host=%r, port=%r)' % (type(self).__name__,
+                                         self.host, self.port)
+
+# This is taken from http://hg.python.org/cpython/file/7aaba721ebc0/Lib/socket.py#l252
+_blocking_errnos = set([errno.EAGAIN, errno.EWOULDBLOCK])
+
+class HTTPConnectionPool(ConnectionPool, RequestMethods):
+    """
+    Thread-safe connection pool for one host.
+
+    :param host:
+        Host used for this HTTP Connection (e.g. "localhost"), passed into
+        :class:`httplib.HTTPConnection`.
+
+    :param port:
+        Port used for this HTTP Connection (None is equivalent to 80), passed
+        into :class:`httplib.HTTPConnection`.
+
+    :param strict:
+        Causes BadStatusLine to be raised if the status line can't be parsed
+        as a valid HTTP/1.0 or 1.1 status line, passed into
+        :class:`httplib.HTTPConnection`.
+
+        .. note::
+           Only works in Python 2. This parameter is ignored in Python 3.
+
+    :param timeout:
+        Socket timeout in seconds for each individual connection. This can
+        be a float or integer, which sets the timeout for the HTTP request,
+        or an instance of :class:`urllib3.util.Timeout` which gives you more
+        fine-grained control over request timeouts. After the constructor has
+        been parsed, this is always a `urllib3.util.Timeout` object.
+
+    :param maxsize:
+        Number of connections to save that can be reused. More than 1 is useful
+        in multithreaded situations. If ``block`` is set to false, more
+        connections will be created but they will not be saved once they've
+        been used.
+
+    :param block:
+        If set to True, no more than ``maxsize`` connections will be used at
+        a time. When no free connections are available, the call will block
+        until a connection has been released. This is a useful side effect for
+        particular multithreaded situations where one does not want to use more
+        than maxsize connections per host to prevent flooding.
+
+    :param headers:
+        Headers to include with all requests, unless other headers are given
+        explicitly.
+
+    :param _proxy:
+        Parsed proxy URL, should not be used directly, instead, see
+        :class:`urllib3.connectionpool.ProxyManager`"
+
+    :param _proxy_headers:
+        A dictionary with proxy headers, should not be used directly,
+        instead, see :class:`urllib3.connectionpool.ProxyManager`"
+    """
+
+    scheme = 'http'
+
+    def __init__(self, host, port=None, strict=False,
+                 timeout=Timeout.DEFAULT_TIMEOUT, maxsize=1, block=False,
+                 headers=None, _proxy=None, _proxy_headers=None):
+        ConnectionPool.__init__(self, host, port)
+        RequestMethods.__init__(self, headers)
+
+        self.strict = strict
+
+        # This is for backwards compatibility and can be removed once a timeout
+        # can only be set to a Timeout object
+        if not isinstance(timeout, Timeout):
+            timeout = Timeout.from_float(timeout)
+
+        self.timeout = timeout
+
+        self.pool = self.QueueCls(maxsize)
+        self.block = block
+
+        self.proxy = _proxy
+        self.proxy_headers = _proxy_headers or {}
+
+        # Fill the queue up so that doing get() on it will block properly
+        for _ in xrange(maxsize):
+            self.pool.put(None)
+
+        # These are mostly for testing and debugging purposes.
+        self.num_connections = 0
+        self.num_requests = 0
+
+    def _new_conn(self):
+        """
+        Return a fresh :class:`httplib.HTTPConnection`.
+        """
+        self.num_connections += 1
+        log.info("Starting new HTTP connection (%d): %s" %
+                 (self.num_connections, self.host))
+        extra_params = {}
+        if not six.PY3:  # Python 2
+            extra_params['strict'] = self.strict
+
+        return HTTPConnection(host=self.host, port=self.port,
+                              timeout=self.timeout.connect_timeout,
+                              **extra_params)
+
+
+    def _get_conn(self, timeout=None):
+        """
+        Get a connection. Will return a pooled connection if one is available.
+
+        If no connections are available and :prop:`.block` is ``False``, then a
+        fresh connection is returned.
+
+        :param timeout:
+            Seconds to wait before giving up and raising
+            :class:`urllib3.exceptions.EmptyPoolError` if the pool is empty and
+            :prop:`.block` is ``True``.
+        """
+        conn = None
+        try:
+            conn = self.pool.get(block=self.block, timeout=timeout)
+
+        except AttributeError: # self.pool is None
+            raise ClosedPoolError(self, "Pool is closed.")
+
+        except Empty:
+            if self.block:
+                raise EmptyPoolError(self,
+                                     "Pool reached maximum size and no more "
+                                     "connections are allowed.")
+            pass  # Oh well, we'll create a new connection then
+
+        # If this is a persistent connection, check if it got disconnected
+        if conn and is_connection_dropped(conn):
+            log.info("Resetting dropped connection: %s" % self.host)
+            conn.close()
+
+        return conn or self._new_conn()
+
+    def _put_conn(self, conn):
+        """
+        Put a connection back into the pool.
+
+        :param conn:
+            Connection object for the current host and port as returned by
+            :meth:`._new_conn` or :meth:`._get_conn`.
+
+        If the pool is already full, the connection is closed and discarded
+        because we exceeded maxsize. If connections are discarded frequently,
+        then maxsize should be increased.
+
+        If the pool is closed, then the connection will be closed and discarded.
+        """
+        try:
+            self.pool.put(conn, block=False)
+            return # Everything is dandy, done.
+        except AttributeError:
+            # self.pool is None.
+            pass
+        except Full:
+            # This should never happen if self.block == True
+            log.warning("HttpConnectionPool is full, discarding connection: %s"
+                        % self.host)
+
+        # Connection never got put back into the pool, close it.
+        if conn:
+            conn.close()
+
+    def _get_timeout(self, timeout):
+        """ Helper that always returns a :class:`urllib3.util.Timeout` """
+        if timeout is _Default:
+            return self.timeout.clone()
+
+        if isinstance(timeout, Timeout):
+            return timeout.clone()
+        else:
+            # User passed us an int/float. This is for backwards compatibility,
+            # can be removed later
+            return Timeout.from_float(timeout)
+
+    def _make_request(self, conn, method, url, timeout=_Default,
+                      **httplib_request_kw):
+        """
+        Perform a request on a given httplib connection object taken from our
+        pool.
+
+        :param conn:
+            a connection from one of our connection pools
+
+        :param timeout:
+            Socket timeout in seconds for the request. This can be a
+            float or integer, which will set the same timeout value for
+            the socket connect and the socket read, or an instance of
+            :class:`urllib3.util.Timeout`, which gives you more fine-grained
+            control over your timeouts.
+        """
+        self.num_requests += 1
+
+        timeout_obj = self._get_timeout(timeout)
+
+        try:
+            timeout_obj.start_connect()
+            conn.timeout = timeout_obj.connect_timeout
+            # conn.request() calls httplib.*.request, not the method in
+            # request.py. It also calls makefile (recv) on the socket
+            conn.request(method, url, **httplib_request_kw)
+        except SocketTimeout:
+            raise ConnectTimeoutError(
+                self, "Connection to %s timed out. (connect timeout=%s)" %
+                (self.host, timeout_obj.connect_timeout))
+
+        # Reset the timeout for the recv() on the socket
+        read_timeout = timeout_obj.read_timeout
+        log.debug("Setting read timeout to %s" % read_timeout)
+        # App Engine doesn't have a sock attr
+        if hasattr(conn, 'sock') and \
+            read_timeout is not None and \
+            read_timeout is not Timeout.DEFAULT_TIMEOUT:
+            # In Python 3 socket.py will catch EAGAIN and return None when you
+            # try and read into the file pointer created by http.client, which
+            # instead raises a BadStatusLine exception. Instead of catching
+            # the exception and assuming all BadStatusLine exceptions are read
+            # timeouts, check for a zero timeout before making the request.
+            if read_timeout == 0:
+                raise ReadTimeoutError(
+                    self, url,
+                    "Read timed out. (read timeout=%s)" % read_timeout)
+            conn.sock.settimeout(read_timeout)
+
+        # Receive the response from the server
+        try:
+            try: # Python 2.7+, use buffering of HTTP responses
+                httplib_response = conn.getresponse(buffering=True)
+            except TypeError: # Python 2.6 and older
+                httplib_response = conn.getresponse()
+        except SocketTimeout:
+            raise ReadTimeoutError(
+                self, url, "Read timed out. (read timeout=%s)" % read_timeout)
+
+        except SocketError as e: # Platform-specific: Python 2
+            # See the above comment about EAGAIN in Python 3. In Python 2 we
+            # have to specifically catch it and throw the timeout error
+            if e.errno in _blocking_errnos:
+                raise ReadTimeoutError(
+                    self, url,
+                    "Read timed out. (read timeout=%s)" % read_timeout)
+            raise
+
+
+        # AppEngine doesn't have a version attr.
+        http_version = getattr(conn, '_http_vsn_str', 'HTTP/?')
+        log.debug("\"%s %s %s\" %s %s" % (method, url, http_version,
+                                          httplib_response.status,
+                                          httplib_response.length))
+        return httplib_response
+
+    def close(self):
+        """
+        Close all pooled connections and disable the pool.
+        """
+        # Disable access to the pool
+        old_pool, self.pool = self.pool, None
+
+        try:
+            while True:
+                conn = old_pool.get(block=False)
+                if conn:
+                    conn.close()
+
+        except Empty:
+            pass # Done.
+
+    def is_same_host(self, url):
+        """
+        Check if the given ``url`` is a member of the same host as this
+        connection pool.
+        """
+        if url.startswith('/'):
+            return True
+
+        # TODO: Add optional support for socket.gethostbyname checking.
+        scheme, host, port = get_host(url)
+
+        if self.port and not port:
+            # Use explicit default port for comparison when none is given.
+            port = port_by_scheme.get(scheme)
+
+        return (scheme, host, port) == (self.scheme, self.host, self.port)
+
+    def urlopen(self, method, url, body=None, headers=None, retries=3,
+                redirect=True, assert_same_host=True, timeout=_Default,
+                pool_timeout=None, release_conn=None, **response_kw):
+        """
+        Get a connection from the pool and perform an HTTP request. This is the
+        lowest level call for making a request, so you'll need to specify all
+        the raw details.
+
+        .. note::
+
+           More commonly, it's appropriate to use a convenience method provided
+           by :class:`.RequestMethods`, such as :meth:`request`.
+
+        .. note::
+
+           `release_conn` will only behave as expected if
+           `preload_content=False` because we want to make
+           `preload_content=False` the default behaviour someday soon without
+           breaking backwards compatibility.
+
+        :param method:
+            HTTP request method (such as GET, POST, PUT, etc.)
+
+        :param body:
+            Data to send in the request body (useful for creating
+            POST requests, see HTTPConnectionPool.post_url for
+            more convenience).
+
+        :param headers:
+            Dictionary of custom headers to send, such as User-Agent,
+            If-None-Match, etc. If None, pool headers are used. If provided,
+            these headers completely replace any pool-specific headers.
+
+        :param retries:
+            Number of retries to allow before raising a MaxRetryError exception.
+
+        :param redirect:
+            If True, automatically handle redirects (status codes 301, 302,
+            303, 307, 308). Each redirect counts as a retry.
+
+        :param assert_same_host:
+            If ``True``, will make sure that the host of the pool requests is
+            consistent else will raise HostChangedError. When False, you can
+            use the pool on an HTTP proxy and request foreign hosts.
+
+        :param timeout:
+            If specified, overrides the default timeout for this one
+            request. It may be a float (in seconds) or an instance of
+            :class:`urllib3.util.Timeout`.
+
+        :param pool_timeout:
+            If set and the pool is set to block=True, then this method will
+            block for ``pool_timeout`` seconds and raise EmptyPoolError if no
+            connection is available within the time period.
+
+        :param release_conn:
+            If False, then the urlopen call will not release the connection
+            back into the pool once a response is received (but will release if
+            you read the entire contents of the response such as when
+            `preload_content=True`). This is useful if you're not preloading
+            the response's content immediately. You will need to call
+            ``r.release_conn()`` on the response ``r`` to return the connection
+            back into the pool. If None, it takes the value of
+            ``response_kw.get('preload_content', True)``.
+
+        :param \**response_kw:
+            Additional parameters are passed to
+            :meth:`urllib3.response.HTTPResponse.from_httplib`
+        """
+        if headers is None:
+            headers = self.headers
+
+        if retries < 0:
+            raise MaxRetryError(self, url)
+
+        if release_conn is None:
+            release_conn = response_kw.get('preload_content', True)
+
+        # Check host
+        if assert_same_host and not self.is_same_host(url):
+            raise HostChangedError(self, url, retries - 1)
+
+        conn = None
+
+        try:
+            # Request a connection from the queue
+            conn = self._get_conn(timeout=pool_timeout)
+
+            # Make the request on the httplib connection object
+            httplib_response = self._make_request(conn, method, url,
+                                                  timeout=timeout,
+                                                  body=body, headers=headers)
+
+            # If we're going to release the connection in ``finally:``, then
+            # the request doesn't need to know about the connection. Otherwise
+            # it will also try to release it and we'll have a double-release
+            # mess.
+            response_conn = not release_conn and conn
+
+            # Import httplib's response into our own wrapper object
+            response = HTTPResponse.from_httplib(httplib_response,
+                                                 pool=self,
+                                                 connection=response_conn,
+                                                 **response_kw)
+
+            # else:
+            #     The connection will be put back into the pool when
+            #     ``response.release_conn()`` is called (implicitly by
+            #     ``response.read()``)
+
+        except Empty:
+            # Timed out by queue
+            raise ReadTimeoutError(
+                self, url, "Read timed out, no pool connections are available.")
+
+        except SocketTimeout:
+            # Timed out by socket
+            raise ReadTimeoutError(self, url, "Read timed out.")
+
+        except BaseSSLError as e:
+            # SSL certificate error
+            if 'timed out' in str(e) or \
+               'did not complete (read)' in str(e): # Platform-specific: Python 2.6
+                raise ReadTimeoutError(self, url, "Read timed out.")
+            raise SSLError(e)
+
+        except CertificateError as e:
+            # Name mismatch
+            raise SSLError(e)
+
+        except (HTTPException, SocketError) as e:
+            if isinstance(e, SocketError) and self.proxy is not None:
+                raise ProxyError('Cannot connect to proxy. '
+                                 'Socket error: %s.' % e)
+
+            # Connection broken, discard. It will be replaced next _get_conn().
+            conn = None
+            # This is necessary so we can access e below
+            err = e
+
+            if retries == 0:
+                raise MaxRetryError(self, url, e)
+
+        finally:
+            if release_conn:
+                # Put the connection back to be reused. If the connection is
+                # expired then it will be None, which will get replaced with a
+                # fresh connection during _get_conn.
+                self._put_conn(conn)
+
+        if not conn:
+            # Try again
+            log.warn("Retrying (%d attempts remain) after connection "
+                     "broken by '%r': %s" % (retries, err, url))
+            return self.urlopen(method, url, body, headers, retries - 1,
+                                redirect, assert_same_host,
+                                timeout=timeout, pool_timeout=pool_timeout,
+                                release_conn=release_conn, **response_kw)
+
+        # Handle redirect?
+        redirect_location = redirect and response.get_redirect_location()
+        if redirect_location:
+            if response.status == 303:
+                method = 'GET'
+            log.info("Redirecting %s -> %s" % (url, redirect_location))
+            return self.urlopen(method, redirect_location, body, headers,
+                                retries - 1, redirect, assert_same_host,
+                                timeout=timeout, pool_timeout=pool_timeout,
+                                release_conn=release_conn, **response_kw)
+
+        return response
+
+
+class HTTPSConnectionPool(HTTPConnectionPool):
+    """
+    Same as :class:`.HTTPConnectionPool`, but HTTPS.
+
+    When Python is compiled with the :mod:`ssl` module, then
+    :class:`.VerifiedHTTPSConnection` is used, which *can* verify certificates,
+    instead of :class:`httplib.HTTPSConnection`.
+
+    :class:`.VerifiedHTTPSConnection` uses one of ``assert_fingerprint``,
+    ``assert_hostname`` and ``host`` in this order to verify connections.
+    If ``assert_hostname`` is False, no verification is done.
+
+    The ``key_file``, ``cert_file``, ``cert_reqs``, ``ca_certs`` and
+    ``ssl_version`` are only used if :mod:`ssl` is available and are fed into
+    :meth:`urllib3.util.ssl_wrap_socket` to upgrade the connection socket
+    into an SSL socket.
+    """
+
+    scheme = 'https'
+
+    def __init__(self, host, port=None,
+                 strict=False, timeout=None, maxsize=1,
+                 block=False, headers=None,
+                 _proxy=None, _proxy_headers=None,
+                 key_file=None, cert_file=None, cert_reqs=None,
+                 ca_certs=None, ssl_version=None,
+                 assert_hostname=None, assert_fingerprint=None):
+
+        HTTPConnectionPool.__init__(self, host, port, strict, timeout, maxsize,
+                                    block, headers, _proxy, _proxy_headers)
+        self.key_file = key_file
+        self.cert_file = cert_file
+        self.cert_reqs = cert_reqs
+        self.ca_certs = ca_certs
+        self.ssl_version = ssl_version
+        self.assert_hostname = assert_hostname
+        self.assert_fingerprint = assert_fingerprint
+
+    def _prepare_conn(self, connection):
+        """
+        Prepare the ``connection`` for :meth:`urllib3.util.ssl_wrap_socket`
+        and establish the tunnel if proxy is used.
+        """
+
+        if isinstance(connection, VerifiedHTTPSConnection):
+            connection.set_cert(key_file=self.key_file,
+                                cert_file=self.cert_file,
+                                cert_reqs=self.cert_reqs,
+                                ca_certs=self.ca_certs,
+                                assert_hostname=self.assert_hostname,
+                                assert_fingerprint=self.assert_fingerprint)
+            connection.ssl_version = self.ssl_version
+
+        if self.proxy is not None:
+            # Python 2.7+
+            try:
+                set_tunnel = connection.set_tunnel
+            except AttributeError:  # Platform-specific: Python 2.6
+                set_tunnel = connection._set_tunnel
+            set_tunnel(self.host, self.port, self.proxy_headers)
+            # Establish tunnel connection early, because otherwise httplib
+            # would improperly set Host: header to proxy's IP:port.
+            connection.connect()
+
+        return connection
+
+    def _new_conn(self):
+        """
+        Return a fresh :class:`httplib.HTTPSConnection`.
+        """
+        self.num_connections += 1
+        log.info("Starting new HTTPS connection (%d): %s"
+                 % (self.num_connections, self.host))
+
+        actual_host = self.host
+        actual_port = self.port
+        if self.proxy is not None:
+            actual_host = self.proxy.host
+            actual_port = self.proxy.port
+
+        if not ssl:  # Platform-specific: Python compiled without +ssl
+            if not HTTPSConnection or HTTPSConnection is object:
+                raise SSLError("Can't connect to HTTPS URL because the SSL "
+                               "module is not available.")
+            connection_class = HTTPSConnection
+        else:
+            connection_class = VerifiedHTTPSConnection
+
+        extra_params = {}
+        if not six.PY3:  # Python 2
+            extra_params['strict'] = self.strict
+        connection = connection_class(host=actual_host, port=actual_port,
+                                      timeout=self.timeout.connect_timeout,
+                                      **extra_params)
+
+        return self._prepare_conn(connection)
+
+
+def connection_from_url(url, **kw):
+    """
+    Given a url, return an :class:`.ConnectionPool` instance of its host.
+
+    This is a shortcut for not having to parse out the scheme, host, and port
+    of the url before creating an :class:`.ConnectionPool` instance.
+
+    :param url:
+        Absolute URL string that must include the scheme. Port is optional.
+
+    :param \**kw:
+        Passes additional parameters to the constructor of the appropriate
+        :class:`.ConnectionPool`. Useful for specifying things like
+        timeout, maxsize, headers, etc.
+
+    Example: ::
+
+        >>> conn = connection_from_url('http://google.com/')
+        >>> r = conn.request('GET', '/')
+    """
+    scheme, host, port = get_host(url)
+    if scheme == 'https':
+        return HTTPSConnectionPool(host, port=port, **kw)
+    else:
+        return HTTPConnectionPool(host, port=port, **kw)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/contrib/__init__.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/contrib/__init__.py
new file mode 100644
index 0000000..e69de29
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/contrib/ntlmpool.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/contrib/ntlmpool.py
new file mode 100644
index 0000000..b8cd933
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/contrib/ntlmpool.py
@@ -0,0 +1,120 @@
+# urllib3/contrib/ntlmpool.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+"""
+NTLM authenticating pool, contributed by erikcederstran
+
+Issue #10, see: http://code.google.com/p/urllib3/issues/detail?id=10
+"""
+
+try:
+    from http.client import HTTPSConnection
+except ImportError:
+    from httplib import HTTPSConnection
+from logging import getLogger
+from ntlm import ntlm
+
+from urllib3 import HTTPSConnectionPool
+
+
+log = getLogger(__name__)
+
+
+class NTLMConnectionPool(HTTPSConnectionPool):
+    """
+    Implements an NTLM authentication version of an urllib3 connection pool
+    """
+
+    scheme = 'https'
+
+    def __init__(self, user, pw, authurl, *args, **kwargs):
+        """
+        authurl is a random URL on the server that is protected by NTLM.
+        user is the Windows user, probably in the DOMAIN\\username format.
+        pw is the password for the user.
+        """
+        super(NTLMConnectionPool, self).__init__(*args, **kwargs)
+        self.authurl = authurl
+        self.rawuser = user
+        user_parts = user.split('\\', 1)
+        self.domain = user_parts[0].upper()
+        self.user = user_parts[1]
+        self.pw = pw
+
+    def _new_conn(self):
+        # Performs the NTLM handshake that secures the connection. The socket
+        # must be kept open while requests are performed.
+        self.num_connections += 1
+        log.debug('Starting NTLM HTTPS connection no. %d: https://%s%s' %
+                  (self.num_connections, self.host, self.authurl))
+
+        headers = {}
+        headers['Connection'] = 'Keep-Alive'
+        req_header = 'Authorization'
+        resp_header = 'www-authenticate'
+
+        conn = HTTPSConnection(host=self.host, port=self.port)
+
+        # Send negotiation message
+        headers[req_header] = (
+            'NTLM %s' % ntlm.create_NTLM_NEGOTIATE_MESSAGE(self.rawuser))
+        log.debug('Request headers: %s' % headers)
+        conn.request('GET', self.authurl, None, headers)
+        res = conn.getresponse()
+        reshdr = dict(res.getheaders())
+        log.debug('Response status: %s %s' % (res.status, res.reason))
+        log.debug('Response headers: %s' % reshdr)
+        log.debug('Response data: %s [...]' % res.read(100))
+
+        # Remove the reference to the socket, so that it can not be closed by
+        # the response object (we want to keep the socket open)
+        res.fp = None
+
+        # Server should respond with a challenge message
+        auth_header_values = reshdr[resp_header].split(', ')
+        auth_header_value = None
+        for s in auth_header_values:
+            if s[:5] == 'NTLM ':
+                auth_header_value = s[5:]
+        if auth_header_value is None:
+            raise Exception('Unexpected %s response header: %s' %
+                            (resp_header, reshdr[resp_header]))
+
+        # Send authentication message
+        ServerChallenge, NegotiateFlags = \
+            ntlm.parse_NTLM_CHALLENGE_MESSAGE(auth_header_value)
+        auth_msg = ntlm.create_NTLM_AUTHENTICATE_MESSAGE(ServerChallenge,
+                                                         self.user,
+                                                         self.domain,
+                                                         self.pw,
+                                                         NegotiateFlags)
+        headers[req_header] = 'NTLM %s' % auth_msg
+        log.debug('Request headers: %s' % headers)
+        conn.request('GET', self.authurl, None, headers)
+        res = conn.getresponse()
+        log.debug('Response status: %s %s' % (res.status, res.reason))
+        log.debug('Response headers: %s' % dict(res.getheaders()))
+        log.debug('Response data: %s [...]' % res.read()[:100])
+        if res.status != 200:
+            if res.status == 401:
+                raise Exception('Server rejected request: wrong '
+                                'username or password')
+            raise Exception('Wrong server response: %s %s' %
+                            (res.status, res.reason))
+
+        res.fp = None
+        log.debug('Connection established')
+        return conn
+
+    def urlopen(self, method, url, body=None, headers=None, retries=3,
+                redirect=True, assert_same_host=True):
+        if headers is None:
+            headers = {}
+        headers['Connection'] = 'Keep-Alive'
+        return super(NTLMConnectionPool, self).urlopen(method, url, body,
+                                                       headers, retries,
+                                                       redirect,
+                                                       assert_same_host)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/contrib/pyopenssl.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/contrib/pyopenssl.py
new file mode 100644
index 0000000..d43bcd6
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/contrib/pyopenssl.py
@@ -0,0 +1,344 @@
+'''SSL with SNI-support for Python 2.
+
+This needs the following packages installed:
+
+* pyOpenSSL (tested with 0.13)
+* ndg-httpsclient (tested with 0.3.2)
+* pyasn1 (tested with 0.1.6)
+
+To activate it call :func:`~urllib3.contrib.pyopenssl.inject_into_urllib3`.
+This can be done in a ``sitecustomize`` module, or at any other time before
+your application begins using ``urllib3``, like this::
+
+    try:
+        import urllib3.contrib.pyopenssl
+        urllib3.contrib.pyopenssl.inject_into_urllib3()
+    except ImportError:
+        pass
+
+Now you can use :mod:`urllib3` as you normally would, and it will support SNI
+when the required modules are installed.
+'''
+
+from ndg.httpsclient.ssl_peer_verification import SUBJ_ALT_NAME_SUPPORT
+from ndg.httpsclient.subj_alt_name import SubjectAltName
+import OpenSSL.SSL
+from pyasn1.codec.der import decoder as der_decoder
+from socket import _fileobject
+import ssl
+from cStringIO import StringIO
+
+from .. import connectionpool
+from .. import util
+
+__all__ = ['inject_into_urllib3', 'extract_from_urllib3']
+
+# SNI only *really* works if we can read the subjectAltName of certificates.
+HAS_SNI = SUBJ_ALT_NAME_SUPPORT
+
+# Map from urllib3 to PyOpenSSL compatible parameter-values.
+_openssl_versions = {
+    ssl.PROTOCOL_SSLv23: OpenSSL.SSL.SSLv23_METHOD,
+    ssl.PROTOCOL_SSLv3: OpenSSL.SSL.SSLv3_METHOD,
+    ssl.PROTOCOL_TLSv1: OpenSSL.SSL.TLSv1_METHOD,
+}
+_openssl_verify = {
+    ssl.CERT_NONE: OpenSSL.SSL.VERIFY_NONE,
+    ssl.CERT_OPTIONAL: OpenSSL.SSL.VERIFY_PEER,
+    ssl.CERT_REQUIRED: OpenSSL.SSL.VERIFY_PEER
+                       + OpenSSL.SSL.VERIFY_FAIL_IF_NO_PEER_CERT,
+}
+
+
+orig_util_HAS_SNI = util.HAS_SNI
+orig_connectionpool_ssl_wrap_socket = connectionpool.ssl_wrap_socket
+
+
+def inject_into_urllib3():
+    'Monkey-patch urllib3 with PyOpenSSL-backed SSL-support.'
+
+    connectionpool.ssl_wrap_socket = ssl_wrap_socket
+    util.HAS_SNI = HAS_SNI
+
+
+def extract_from_urllib3():
+    'Undo monkey-patching by :func:`inject_into_urllib3`.'
+
+    connectionpool.ssl_wrap_socket = orig_connectionpool_ssl_wrap_socket
+    util.HAS_SNI = orig_util_HAS_SNI
+
+
+### Note: This is a slightly bug-fixed version of same from ndg-httpsclient.
+def get_subj_alt_name(peer_cert):
+    # Search through extensions
+    dns_name = []
+    if not SUBJ_ALT_NAME_SUPPORT:
+        return dns_name
+
+    general_names = SubjectAltName()
+    for i in range(peer_cert.get_extension_count()):
+        ext = peer_cert.get_extension(i)
+        ext_name = ext.get_short_name()
+        if ext_name != 'subjectAltName':
+            continue
+
+        # PyOpenSSL returns extension data in ASN.1 encoded form
+        ext_dat = ext.get_data()
+        decoded_dat = der_decoder.decode(ext_dat,
+                                         asn1Spec=general_names)
+
+        for name in decoded_dat:
+            if not isinstance(name, SubjectAltName):
+                continue
+            for entry in range(len(name)):
+                component = name.getComponentByPosition(entry)
+                if component.getName() != 'dNSName':
+                    continue
+                dns_name.append(str(component.getComponent()))
+
+    return dns_name
+
+
+class fileobject(_fileobject):
+
+    def read(self, size=-1):
+        # Use max, disallow tiny reads in a loop as they are very inefficient.
+        # We never leave read() with any leftover data from a new recv() call
+        # in our internal buffer.
+        rbufsize = max(self._rbufsize, self.default_bufsize)
+        # Our use of StringIO rather than lists of string objects returned by
+        # recv() minimizes memory usage and fragmentation that occurs when
+        # rbufsize is large compared to the typical return value of recv().
+        buf = self._rbuf
+        buf.seek(0, 2)  # seek end
+        if size < 0:
+            # Read until EOF
+            self._rbuf = StringIO()  # reset _rbuf.  we consume it via buf.
+            while True:
+                try:
+                    data = self._sock.recv(rbufsize)
+                except OpenSSL.SSL.WantReadError:
+                    continue
+                if not data:
+                    break
+                buf.write(data)
+            return buf.getvalue()
+        else:
+            # Read until size bytes or EOF seen, whichever comes first
+            buf_len = buf.tell()
+            if buf_len >= size:
+                # Already have size bytes in our buffer?  Extract and return.
+                buf.seek(0)
+                rv = buf.read(size)
+                self._rbuf = StringIO()
+                self._rbuf.write(buf.read())
+                return rv
+
+            self._rbuf = StringIO()  # reset _rbuf.  we consume it via buf.
+            while True:
+                left = size - buf_len
+                # recv() will malloc the amount of memory given as its
+                # parameter even though it often returns much less data
+                # than that.  The returned data string is short lived
+                # as we copy it into a StringIO and free it.  This avoids
+                # fragmentation issues on many platforms.
+                try:
+                    data = self._sock.recv(left)
+                except OpenSSL.SSL.WantReadError:
+                    continue
+                if not data:
+                    break
+                n = len(data)
+                if n == size and not buf_len:
+                    # Shortcut.  Avoid buffer data copies when:
+                    # - We have no data in our buffer.
+                    # AND
+                    # - Our call to recv returned exactly the
+                    #   number of bytes we were asked to read.
+                    return data
+                if n == left:
+                    buf.write(data)
+                    del data  # explicit free
+                    break
+                assert n <= left, "recv(%d) returned %d bytes" % (left, n)
+                buf.write(data)
+                buf_len += n
+                del data  # explicit free
+                #assert buf_len == buf.tell()
+            return buf.getvalue()
+
+    def readline(self, size=-1):
+        buf = self._rbuf
+        buf.seek(0, 2)  # seek end
+        if buf.tell() > 0:
+            # check if we already have it in our buffer
+            buf.seek(0)
+            bline = buf.readline(size)
+            if bline.endswith('\n') or len(bline) == size:
+                self._rbuf = StringIO()
+                self._rbuf.write(buf.read())
+                return bline
+            del bline
+        if size < 0:
+            # Read until \n or EOF, whichever comes first
+            if self._rbufsize <= 1:
+                # Speed up unbuffered case
+                buf.seek(0)
+                buffers = [buf.read()]
+                self._rbuf = StringIO()  # reset _rbuf.  we consume it via buf.
+                data = None
+                recv = self._sock.recv
+                while True:
+                    try:
+                        while data != "\n":
+                            data = recv(1)
+                            if not data:
+                                break
+                            buffers.append(data)
+                    except OpenSSL.SSL.WantReadError:
+                        continue
+                    break
+                return "".join(buffers)
+
+            buf.seek(0, 2)  # seek end
+            self._rbuf = StringIO()  # reset _rbuf.  we consume it via buf.
+            while True:
+                try:
+                    data = self._sock.recv(self._rbufsize)
+                except OpenSSL.SSL.WantReadError:
+                    continue
+                if not data:
+                    break
+                nl = data.find('\n')
+                if nl >= 0:
+                    nl += 1
+                    buf.write(data[:nl])
+                    self._rbuf.write(data[nl:])
+                    del data
+                    break
+                buf.write(data)
+            return buf.getvalue()
+        else:
+            # Read until size bytes or \n or EOF seen, whichever comes first
+            buf.seek(0, 2)  # seek end
+            buf_len = buf.tell()
+            if buf_len >= size:
+                buf.seek(0)
+                rv = buf.read(size)
+                self._rbuf = StringIO()
+                self._rbuf.write(buf.read())
+                return rv
+            self._rbuf = StringIO()  # reset _rbuf.  we consume it via buf.
+            while True:
+                try:
+                    data = self._sock.recv(self._rbufsize)
+                except OpenSSL.SSL.WantReadError:
+                        continue
+                if not data:
+                    break
+                left = size - buf_len
+                # did we just receive a newline?
+                nl = data.find('\n', 0, left)
+                if nl >= 0:
+                    nl += 1
+                    # save the excess data to _rbuf
+                    self._rbuf.write(data[nl:])
+                    if buf_len:
+                        buf.write(data[:nl])
+                        break
+                    else:
+                        # Shortcut.  Avoid data copy through buf when returning
+                        # a substring of our first recv().
+                        return data[:nl]
+                n = len(data)
+                if n == size and not buf_len:
+                    # Shortcut.  Avoid data copy through buf when
+                    # returning exactly all of our first recv().
+                    return data
+                if n >= left:
+                    buf.write(data[:left])
+                    self._rbuf.write(data[left:])
+                    break
+                buf.write(data)
+                buf_len += n
+                #assert buf_len == buf.tell()
+            return buf.getvalue()
+
+
+class WrappedSocket(object):
+    '''API-compatibility wrapper for Python OpenSSL's Connection-class.'''
+
+    def __init__(self, connection, socket):
+        self.connection = connection
+        self.socket = socket
+
+    def fileno(self):
+        return self.socket.fileno()
+
+    def makefile(self, mode, bufsize=-1):
+        return fileobject(self.connection, mode, bufsize)
+
+    def settimeout(self, timeout):
+        return self.socket.settimeout(timeout)
+
+    def sendall(self, data):
+        return self.connection.sendall(data)
+
+    def close(self):
+        return self.connection.shutdown()
+
+    def getpeercert(self, binary_form=False):
+        x509 = self.connection.get_peer_certificate()
+
+        if not x509:
+            return x509
+
+        if binary_form:
+            return OpenSSL.crypto.dump_certificate(
+                OpenSSL.crypto.FILETYPE_ASN1,
+                x509)
+
+        return {
+            'subject': (
+                (('commonName', x509.get_subject().CN),),
+            ),
+            'subjectAltName': [
+                ('DNS', value)
+                for value in get_subj_alt_name(x509)
+            ]
+        }
+
+
+def _verify_callback(cnx, x509, err_no, err_depth, return_code):
+    return err_no == 0
+
+
+def ssl_wrap_socket(sock, keyfile=None, certfile=None, cert_reqs=None,
+                    ca_certs=None, server_hostname=None,
+                    ssl_version=None):
+    ctx = OpenSSL.SSL.Context(_openssl_versions[ssl_version])
+    if certfile:
+        ctx.use_certificate_file(certfile)
+    if keyfile:
+        ctx.use_privatekey_file(keyfile)
+    if cert_reqs != ssl.CERT_NONE:
+        ctx.set_verify(_openssl_verify[cert_reqs], _verify_callback)
+    if ca_certs:
+        try:
+            ctx.load_verify_locations(ca_certs, None)
+        except OpenSSL.SSL.Error as e:
+            raise ssl.SSLError('bad ca_certs: %r' % ca_certs, e)
+
+    cnx = OpenSSL.SSL.Connection(ctx, sock)
+    cnx.set_tlsext_host_name(server_hostname)
+    cnx.set_connect_state()
+    while True:
+        try:
+            cnx.do_handshake()
+        except OpenSSL.SSL.WantReadError:
+            continue
+        except OpenSSL.SSL.Error as e:
+            raise ssl.SSLError('bad handshake', e)
+        break
+
+    return WrappedSocket(cnx, sock)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/exceptions.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/exceptions.py
new file mode 100644
index 0000000..98ef9ab
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/exceptions.py
@@ -0,0 +1,121 @@
+# urllib3/exceptions.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+
+## Base Exceptions
+
+class HTTPError(Exception):
+    "Base exception used by this module."
+    pass
+
+
+class PoolError(HTTPError):
+    "Base exception for errors caused within a pool."
+    def __init__(self, pool, message):
+        self.pool = pool
+        HTTPError.__init__(self, "%s: %s" % (pool, message))
+
+    def __reduce__(self):
+        # For pickling purposes.
+        return self.__class__, (None, None)
+
+
+class RequestError(PoolError):
+    "Base exception for PoolErrors that have associated URLs."
+    def __init__(self, pool, url, message):
+        self.url = url
+        PoolError.__init__(self, pool, message)
+
+    def __reduce__(self):
+        # For pickling purposes.
+        return self.__class__, (None, self.url, None)
+
+
+class SSLError(HTTPError):
+    "Raised when SSL certificate fails in an HTTPS connection."
+    pass
+
+
+class ProxyError(HTTPError):
+    "Raised when the connection to a proxy fails."
+    pass
+
+
+class DecodeError(HTTPError):
+    "Raised when automatic decoding based on Content-Type fails."
+    pass
+
+
+## Leaf Exceptions
+
+class MaxRetryError(RequestError):
+    "Raised when the maximum number of retries is exceeded."
+
+    def __init__(self, pool, url, reason=None):
+        self.reason = reason
+
+        message = "Max retries exceeded with url: %s" % url
+        if reason:
+            message += " (Caused by %s: %s)" % (type(reason), reason)
+        else:
+            message += " (Caused by redirect)"
+
+        RequestError.__init__(self, pool, url, message)
+
+
+class HostChangedError(RequestError):
+    "Raised when an existing pool gets a request for a foreign host."
+
+    def __init__(self, pool, url, retries=3):
+        message = "Tried to open a foreign host with url: %s" % url
+        RequestError.__init__(self, pool, url, message)
+        self.retries = retries
+
+
+class TimeoutStateError(HTTPError):
+    """ Raised when passing an invalid state to a timeout """
+    pass
+
+
+class TimeoutError(HTTPError):
+    """ Raised when a socket timeout error occurs.
+
+    Catching this error will catch both :exc:`ReadTimeoutErrors
+    <ReadTimeoutError>` and :exc:`ConnectTimeoutErrors <ConnectTimeoutError>`.
+    """
+    pass
+
+
+class ReadTimeoutError(TimeoutError, RequestError):
+    "Raised when a socket timeout occurs while receiving data from a server"
+    pass
+
+
+# This timeout error does not have a URL attached and needs to inherit from the
+# base HTTPError
+class ConnectTimeoutError(TimeoutError):
+    "Raised when a socket timeout occurs while connecting to a server"
+    pass
+
+
+class EmptyPoolError(PoolError):
+    "Raised when a pool runs out of connections and no more are allowed."
+    pass
+
+
+class ClosedPoolError(PoolError):
+    "Raised when a request enters a pool after the pool has been closed."
+    pass
+
+
+class LocationParseError(ValueError, HTTPError):
+    "Raised when get_host or similar fails to parse the URL input."
+
+    def __init__(self, location):
+        message = "Failed to parse: %s" % location
+        HTTPError.__init__(self, message)
+
+        self.location = location
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/fields.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/fields.py
new file mode 100644
index 0000000..ed01765
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/fields.py
@@ -0,0 +1,177 @@
+# urllib3/fields.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+import email.utils
+import mimetypes
+
+from .packages import six
+
+
+def guess_content_type(filename, default='application/octet-stream'):
+    """
+    Guess the "Content-Type" of a file.
+
+    :param filename:
+        The filename to guess the "Content-Type" of using :mod:`mimetimes`.
+    :param default:
+        If no "Content-Type" can be guessed, default to `default`.
+    """
+    if filename:
+        return mimetypes.guess_type(filename)[0] or default
+    return default
+
+
+def format_header_param(name, value):
+    """
+    Helper function to format and quote a single header parameter.
+
+    Particularly useful for header parameters which might contain
+    non-ASCII values, like file names. This follows RFC 2231, as
+    suggested by RFC 2388 Section 4.4.
+
+    :param name:
+        The name of the parameter, a string expected to be ASCII only.
+    :param value:
+        The value of the parameter, provided as a unicode string.
+    """
+    if not any(ch in value for ch in '"\\\r\n'):
+        result = '%s="%s"' % (name, value)
+        try:
+            result.encode('ascii')
+        except UnicodeEncodeError:
+            pass
+        else:
+            return result
+    if not six.PY3:  # Python 2:
+        value = value.encode('utf-8')
+    value = email.utils.encode_rfc2231(value, 'utf-8')
+    value = '%s*=%s' % (name, value)
+    return value
+
+
+class RequestField(object):
+    """
+    A data container for request body parameters.
+
+    :param name:
+        The name of this request field.
+    :param data:
+        The data/value body.
+    :param filename:
+        An optional filename of the request field.
+    :param headers:
+        An optional dict-like object of headers to initially use for the field.
+    """
+    def __init__(self, name, data, filename=None, headers=None):
+        self._name = name
+        self._filename = filename
+        self.data = data
+        self.headers = {}
+        if headers:
+            self.headers = dict(headers)
+
+    @classmethod
+    def from_tuples(cls, fieldname, value):
+        """
+        A :class:`~urllib3.fields.RequestField` factory from old-style tuple parameters.
+
+        Supports constructing :class:`~urllib3.fields.RequestField` from parameter
+        of key/value strings AND key/filetuple. A filetuple is a (filename, data, MIME type)
+        tuple where the MIME type is optional. For example: ::
+
+            'foo': 'bar',
+            'fakefile': ('foofile.txt', 'contents of foofile'),
+            'realfile': ('barfile.txt', open('realfile').read()),
+            'typedfile': ('bazfile.bin', open('bazfile').read(), 'image/jpeg'),
+            'nonamefile': 'contents of nonamefile field',
+
+        Field names and filenames must be unicode.
+        """
+        if isinstance(value, tuple):
+            if len(value) == 3:
+                filename, data, content_type = value
+            else:
+                filename, data = value
+                content_type = guess_content_type(filename)
+        else:
+            filename = None
+            content_type = None
+            data = value
+
+        request_param = cls(fieldname, data, filename=filename)
+        request_param.make_multipart(content_type=content_type)
+
+        return request_param
+
+    def _render_part(self, name, value):
+        """
+        Overridable helper function to format a single header parameter.
+
+        :param name:
+            The name of the parameter, a string expected to be ASCII only.
+        :param value:
+            The value of the parameter, provided as a unicode string.
+        """
+        return format_header_param(name, value)
+
+    def _render_parts(self, header_parts):
+        """
+        Helper function to format and quote a single header.
+
+        Useful for single headers that are composed of multiple items. E.g.,
+        'Content-Disposition' fields.
+
+        :param header_parts:
+            A sequence of (k, v) typles or a :class:`dict` of (k, v) to format as
+            `k1="v1"; k2="v2"; ...`.
+        """
+        parts = []
+        iterable = header_parts
+        if isinstance(header_parts, dict):
+            iterable = header_parts.items()
+
+        for name, value in iterable:
+            if value:
+                parts.append(self._render_part(name, value))
+
+        return '; '.join(parts)
+
+    def render_headers(self):
+        """
+        Renders the headers for this request field.
+        """
+        lines = []
+
+        sort_keys = ['Content-Disposition', 'Content-Type', 'Content-Location']
+        for sort_key in sort_keys:
+            if self.headers.get(sort_key, False):
+                lines.append('%s: %s' % (sort_key, self.headers[sort_key]))
+
+        for header_name, header_value in self.headers.items():
+            if header_name not in sort_keys:
+                if header_value:
+                    lines.append('%s: %s' % (header_name, header_value))
+
+        lines.append('\r\n')
+        return '\r\n'.join(lines)
+
+    def make_multipart(self, content_disposition=None, content_type=None, content_location=None):
+        """
+        Makes this request field into a multipart request field.
+
+        This method overrides "Content-Disposition", "Content-Type" and
+        "Content-Location" headers to the request parameter.
+
+        :param content_type:
+            The 'Content-Type' of the request body.
+        :param content_location:
+            The 'Content-Location' of the request body.
+
+        """
+        self.headers['Content-Disposition'] = content_disposition or 'form-data'
+        self.headers['Content-Disposition'] += '; '.join(['', self._render_parts((('name', self._name), ('filename', self._filename)))])
+        self.headers['Content-Type'] = content_type
+        self.headers['Content-Location'] = content_location
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/filepost.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/filepost.py
new file mode 100644
index 0000000..4575582
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/filepost.py
@@ -0,0 +1,101 @@
+# urllib3/filepost.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+import codecs
+import mimetypes
+
+from uuid import uuid4
+from io import BytesIO
+
+from .packages import six
+from .packages.six import b
+from .fields import RequestField
+
+writer = codecs.lookup('utf-8')[3]
+
+
+def choose_boundary():
+    """
+    Our embarassingly-simple replacement for mimetools.choose_boundary.
+    """
+    return uuid4().hex
+
+
+def iter_field_objects(fields):
+    """
+    Iterate over fields.
+
+    Supports list of (k, v) tuples and dicts, and lists of
+    :class:`~urllib3.fields.RequestField`.
+
+    """
+    if isinstance(fields, dict):
+        i = six.iteritems(fields)
+    else:
+        i = iter(fields)
+
+    for field in i:
+      if isinstance(field, RequestField):
+        yield field
+      else:
+        yield RequestField.from_tuples(*field)
+
+
+def iter_fields(fields):
+    """
+    Iterate over fields.
+
+    .. deprecated ::
+
+      The addition of `~urllib3.fields.RequestField` makes this function
+      obsolete. Instead, use :func:`iter_field_objects`, which returns
+      `~urllib3.fields.RequestField` objects, instead.
+
+    Supports list of (k, v) tuples and dicts.
+
+    """
+    if isinstance(fields, dict):
+        return ((k, v) for k, v in six.iteritems(fields))
+
+    return ((k, v) for k, v in fields)
+
+
+def encode_multipart_formdata(fields, boundary=None):
+    """
+    Encode a dictionary of ``fields`` using the multipart/form-data MIME format.
+
+    :param fields:
+        Dictionary of fields or list of (key, :class:`~urllib3.fields.RequestField`).
+
+    :param boundary:
+        If not specified, then a random boundary will be generated using
+        :func:`mimetools.choose_boundary`.
+    """
+    body = BytesIO()
+    if boundary is None:
+        boundary = choose_boundary()
+
+    for field in iter_field_objects(fields):
+        body.write(b('--%s\r\n' % (boundary)))
+
+        writer(body).write(field.render_headers())
+        data = field.data
+
+        if isinstance(data, int):
+            data = str(data)  # Backwards compatibility
+
+        if isinstance(data, six.text_type):
+            writer(body).write(data)
+        else:
+            body.write(data)
+
+        body.write(b'\r\n')
+
+    body.write(b('--%s--\r\n' % (boundary)))
+
+    content_type = str('multipart/form-data; boundary=%s' % boundary)
+
+    return body.getvalue(), content_type
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/__init__.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/__init__.py
new file mode 100644
index 0000000..37e8351
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/__init__.py
@@ -0,0 +1,4 @@
+from __future__ import absolute_import
+
+from . import ssl_match_hostname
+
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/ordered_dict.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/ordered_dict.py
new file mode 100644
index 0000000..7f8ee15
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/ordered_dict.py
@@ -0,0 +1,260 @@
+# Backport of OrderedDict() class that runs on Python 2.4, 2.5, 2.6, 2.7 and pypy.
+# Passes Python2.7's test suite and incorporates all the latest updates.
+# Copyright 2009 Raymond Hettinger, released under the MIT License.
+# http://code.activestate.com/recipes/576693/
+
+try:
+    from thread import get_ident as _get_ident
+except ImportError:
+    from dummy_thread import get_ident as _get_ident
+
+try:
+    from _abcoll import KeysView, ValuesView, ItemsView
+except ImportError:
+    pass
+
+
+class OrderedDict(dict):
+    'Dictionary that remembers insertion order'
+    # An inherited dict maps keys to values.
+    # The inherited dict provides __getitem__, __len__, __contains__, and get.
+    # The remaining methods are order-aware.
+    # Big-O running times for all methods are the same as for regular dictionaries.
+
+    # The internal self.__map dictionary maps keys to links in a doubly linked list.
+    # The circular doubly linked list starts and ends with a sentinel element.
+    # The sentinel element never gets deleted (this simplifies the algorithm).
+    # Each link is stored as a list of length three:  [PREV, NEXT, KEY].
+
+    def __init__(self, *args, **kwds):
+        '''Initialize an ordered dictionary.  Signature is the same as for
+        regular dictionaries, but keyword arguments are not recommended
+        because their insertion order is arbitrary.
+
+        '''
+        if len(args) > 1:
+            raise TypeError('expected at most 1 arguments, got %d' % len(args))
+        try:
+            self.__root
+        except AttributeError:
+            self.__root = root = []                     # sentinel node
+            root[:] = [root, root, None]
+            self.__map = {}
+        self.__update(*args, **kwds)
+
+    def __setitem__(self, key, value, dict_setitem=dict.__setitem__):
+        'od.__setitem__(i, y) <==> od[i]=y'
+        # Setting a new item creates a new link which goes at the end of the linked
+        # list, and the inherited dictionary is updated with the new key/value pair.
+        if key not in self:
+            root = self.__root
+            last = root[0]
+            last[1] = root[0] = self.__map[key] = [last, root, key]
+        dict_setitem(self, key, value)
+
+    def __delitem__(self, key, dict_delitem=dict.__delitem__):
+        'od.__delitem__(y) <==> del od[y]'
+        # Deleting an existing item uses self.__map to find the link which is
+        # then removed by updating the links in the predecessor and successor nodes.
+        dict_delitem(self, key)
+        link_prev, link_next, key = self.__map.pop(key)
+        link_prev[1] = link_next
+        link_next[0] = link_prev
+
+    def __iter__(self):
+        'od.__iter__() <==> iter(od)'
+        root = self.__root
+        curr = root[1]
+        while curr is not root:
+            yield curr[2]
+            curr = curr[1]
+
+    def __reversed__(self):
+        'od.__reversed__() <==> reversed(od)'
+        root = self.__root
+        curr = root[0]
+        while curr is not root:
+            yield curr[2]
+            curr = curr[0]
+
+    def clear(self):
+        'od.clear() -> None.  Remove all items from od.'
+        try:
+            for node in self.__map.itervalues():
+                del node[:]
+            root = self.__root
+            root[:] = [root, root, None]
+            self.__map.clear()
+        except AttributeError:
+            pass
+        dict.clear(self)
+
+    def popitem(self, last=True):
+        '''od.popitem() -> (k, v), return and remove a (key, value) pair.
+        Pairs are returned in LIFO order if last is true or FIFO order if false.
+
+        '''
+        if not self:
+            raise KeyError('dictionary is empty')
+        root = self.__root
+        if last:
+            link = root[0]
+            link_prev = link[0]
+            link_prev[1] = root
+            root[0] = link_prev
+        else:
+            link = root[1]
+            link_next = link[1]
+            root[1] = link_next
+            link_next[0] = root
+        key = link[2]
+        del self.__map[key]
+        value = dict.pop(self, key)
+        return key, value
+
+    # -- the following methods do not depend on the internal structure --
+
+    def keys(self):
+        'od.keys() -> list of keys in od'
+        return list(self)
+
+    def values(self):
+        'od.values() -> list of values in od'
+        return [self[key] for key in self]
+
+    def items(self):
+        'od.items() -> list of (key, value) pairs in od'
+        return [(key, self[key]) for key in self]
+
+    def iterkeys(self):
+        'od.iterkeys() -> an iterator over the keys in od'
+        return iter(self)
+
+    def itervalues(self):
+        'od.itervalues -> an iterator over the values in od'
+        for k in self:
+            yield self[k]
+
+    def iteritems(self):
+        'od.iteritems -> an iterator over the (key, value) items in od'
+        for k in self:
+            yield (k, self[k])
+
+    def update(*args, **kwds):
+        '''od.update(E, **F) -> None.  Update od from dict/iterable E and F.
+
+        If E is a dict instance, does:           for k in E: od[k] = E[k]
+        If E has a .keys() method, does:         for k in E.keys(): od[k] = E[k]
+        Or if E is an iterable of items, does:   for k, v in E: od[k] = v
+        In either case, this is followed by:     for k, v in F.items(): od[k] = v
+
+        '''
+        if len(args) > 2:
+            raise TypeError('update() takes at most 2 positional '
+                            'arguments (%d given)' % (len(args),))
+        elif not args:
+            raise TypeError('update() takes at least 1 argument (0 given)')
+        self = args[0]
+        # Make progressively weaker assumptions about "other"
+        other = ()
+        if len(args) == 2:
+            other = args[1]
+        if isinstance(other, dict):
+            for key in other:
+                self[key] = other[key]
+        elif hasattr(other, 'keys'):
+            for key in other.keys():
+                self[key] = other[key]
+        else:
+            for key, value in other:
+                self[key] = value
+        for key, value in kwds.items():
+            self[key] = value
+
+    __update = update  # let subclasses override update without breaking __init__
+
+    __marker = object()
+
+    def pop(self, key, default=__marker):
+        '''od.pop(k[,d]) -> v, remove specified key and return the corresponding value.
+        If key is not found, d is returned if given, otherwise KeyError is raised.
+
+        '''
+        if key in self:
+            result = self[key]
+            del self[key]
+            return result
+        if default is self.__marker:
+            raise KeyError(key)
+        return default
+
+    def setdefault(self, key, default=None):
+        'od.setdefault(k[,d]) -> od.get(k,d), also set od[k]=d if k not in od'
+        if key in self:
+            return self[key]
+        self[key] = default
+        return default
+
+    def __repr__(self, _repr_running={}):
+        'od.__repr__() <==> repr(od)'
+        call_key = id(self), _get_ident()
+        if call_key in _repr_running:
+            return '...'
+        _repr_running[call_key] = 1
+        try:
+            if not self:
+                return '%s()' % (self.__class__.__name__,)
+            return '%s(%r)' % (self.__class__.__name__, self.items())
+        finally:
+            del _repr_running[call_key]
+
+    def __reduce__(self):
+        'Return state information for pickling'
+        items = [[k, self[k]] for k in self]
+        inst_dict = vars(self).copy()
+        for k in vars(OrderedDict()):
+            inst_dict.pop(k, None)
+        if inst_dict:
+            return (self.__class__, (items,), inst_dict)
+        return self.__class__, (items,)
+
+    def copy(self):
+        'od.copy() -> a shallow copy of od'
+        return self.__class__(self)
+
+    @classmethod
+    def fromkeys(cls, iterable, value=None):
+        '''OD.fromkeys(S[, v]) -> New ordered dictionary with keys from S
+        and values equal to v (which defaults to None).
+
+        '''
+        d = cls()
+        for key in iterable:
+            d[key] = value
+        return d
+
+    def __eq__(self, other):
+        '''od.__eq__(y) <==> od==y.  Comparison to another OD is order-sensitive
+        while comparison to a regular mapping is order-insensitive.
+
+        '''
+        if isinstance(other, OrderedDict):
+            return len(self)==len(other) and self.items() == other.items()
+        return dict.__eq__(self, other)
+
+    def __ne__(self, other):
+        return not self == other
+
+    # -- the following methods are only used in Python 2.7 --
+
+    def viewkeys(self):
+        "od.viewkeys() -> a set-like object providing a view on od's keys"
+        return KeysView(self)
+
+    def viewvalues(self):
+        "od.viewvalues() -> an object providing a view on od's values"
+        return ValuesView(self)
+
+    def viewitems(self):
+        "od.viewitems() -> a set-like object providing a view on od's items"
+        return ItemsView(self)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/six.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/six.py
new file mode 100644
index 0000000..27d8011
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/six.py
@@ -0,0 +1,385 @@
+"""Utilities for writing code that runs on Python 2 and 3"""
+
+#Copyright (c) 2010-2011 Benjamin Peterson
+
+#Permission is hereby granted, free of charge, to any person obtaining a copy of
+#this software and associated documentation files (the "Software"), to deal in
+#the Software without restriction, including without limitation the rights to
+#use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+#the Software, and to permit persons to whom the Software is furnished to do so,
+#subject to the following conditions:
+
+#The above copyright notice and this permission notice shall be included in all
+#copies or substantial portions of the Software.
+
+#THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+#IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+#FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+#COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+#IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+#CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+import operator
+import sys
+import types
+
+__author__ = "Benjamin Peterson <benjamin@python.org>"
+__version__ = "1.2.0"  # Revision 41c74fef2ded
+
+
+# True if we are running on Python 3.
+PY3 = sys.version_info[0] == 3
+
+if PY3:
+    string_types = str,
+    integer_types = int,
+    class_types = type,
+    text_type = str
+    binary_type = bytes
+
+    MAXSIZE = sys.maxsize
+else:
+    string_types = basestring,
+    integer_types = (int, long)
+    class_types = (type, types.ClassType)
+    text_type = unicode
+    binary_type = str
+
+    if sys.platform.startswith("java"):
+        # Jython always uses 32 bits.
+        MAXSIZE = int((1 << 31) - 1)
+    else:
+        # It's possible to have sizeof(long) != sizeof(Py_ssize_t).
+        class X(object):
+            def __len__(self):
+                return 1 << 31
+        try:
+            len(X())
+        except OverflowError:
+            # 32-bit
+            MAXSIZE = int((1 << 31) - 1)
+        else:
+            # 64-bit
+            MAXSIZE = int((1 << 63) - 1)
+            del X
+
+
+def _add_doc(func, doc):
+    """Add documentation to a function."""
+    func.__doc__ = doc
+
+
+def _import_module(name):
+    """Import module, returning the module after the last dot."""
+    __import__(name)
+    return sys.modules[name]
+
+
+class _LazyDescr(object):
+
+    def __init__(self, name):
+        self.name = name
+
+    def __get__(self, obj, tp):
+        result = self._resolve()
+        setattr(obj, self.name, result)
+        # This is a bit ugly, but it avoids running this again.
+        delattr(tp, self.name)
+        return result
+
+
+class MovedModule(_LazyDescr):
+
+    def __init__(self, name, old, new=None):
+        super(MovedModule, self).__init__(name)
+        if PY3:
+            if new is None:
+                new = name
+            self.mod = new
+        else:
+            self.mod = old
+
+    def _resolve(self):
+        return _import_module(self.mod)
+
+
+class MovedAttribute(_LazyDescr):
+
+    def __init__(self, name, old_mod, new_mod, old_attr=None, new_attr=None):
+        super(MovedAttribute, self).__init__(name)
+        if PY3:
+            if new_mod is None:
+                new_mod = name
+            self.mod = new_mod
+            if new_attr is None:
+                if old_attr is None:
+                    new_attr = name
+                else:
+                    new_attr = old_attr
+            self.attr = new_attr
+        else:
+            self.mod = old_mod
+            if old_attr is None:
+                old_attr = name
+            self.attr = old_attr
+
+    def _resolve(self):
+        module = _import_module(self.mod)
+        return getattr(module, self.attr)
+
+
+
+class _MovedItems(types.ModuleType):
+    """Lazy loading of moved objects"""
+
+
+_moved_attributes = [
+    MovedAttribute("cStringIO", "cStringIO", "io", "StringIO"),
+    MovedAttribute("filter", "itertools", "builtins", "ifilter", "filter"),
+    MovedAttribute("input", "__builtin__", "builtins", "raw_input", "input"),
+    MovedAttribute("map", "itertools", "builtins", "imap", "map"),
+    MovedAttribute("reload_module", "__builtin__", "imp", "reload"),
+    MovedAttribute("reduce", "__builtin__", "functools"),
+    MovedAttribute("StringIO", "StringIO", "io"),
+    MovedAttribute("xrange", "__builtin__", "builtins", "xrange", "range"),
+    MovedAttribute("zip", "itertools", "builtins", "izip", "zip"),
+
+    MovedModule("builtins", "__builtin__"),
+    MovedModule("configparser", "ConfigParser"),
+    MovedModule("copyreg", "copy_reg"),
+    MovedModule("http_cookiejar", "cookielib", "http.cookiejar"),
+    MovedModule("http_cookies", "Cookie", "http.cookies"),
+    MovedModule("html_entities", "htmlentitydefs", "html.entities"),
+    MovedModule("html_parser", "HTMLParser", "html.parser"),
+    MovedModule("http_client", "httplib", "http.client"),
+    MovedModule("BaseHTTPServer", "BaseHTTPServer", "http.server"),
+    MovedModule("CGIHTTPServer", "CGIHTTPServer", "http.server"),
+    MovedModule("SimpleHTTPServer", "SimpleHTTPServer", "http.server"),
+    MovedModule("cPickle", "cPickle", "pickle"),
+    MovedModule("queue", "Queue"),
+    MovedModule("reprlib", "repr"),
+    MovedModule("socketserver", "SocketServer"),
+    MovedModule("tkinter", "Tkinter"),
+    MovedModule("tkinter_dialog", "Dialog", "tkinter.dialog"),
+    MovedModule("tkinter_filedialog", "FileDialog", "tkinter.filedialog"),
+    MovedModule("tkinter_scrolledtext", "ScrolledText", "tkinter.scrolledtext"),
+    MovedModule("tkinter_simpledialog", "SimpleDialog", "tkinter.simpledialog"),
+    MovedModule("tkinter_tix", "Tix", "tkinter.tix"),
+    MovedModule("tkinter_constants", "Tkconstants", "tkinter.constants"),
+    MovedModule("tkinter_dnd", "Tkdnd", "tkinter.dnd"),
+    MovedModule("tkinter_colorchooser", "tkColorChooser",
+                "tkinter.colorchooser"),
+    MovedModule("tkinter_commondialog", "tkCommonDialog",
+                "tkinter.commondialog"),
+    MovedModule("tkinter_tkfiledialog", "tkFileDialog", "tkinter.filedialog"),
+    MovedModule("tkinter_font", "tkFont", "tkinter.font"),
+    MovedModule("tkinter_messagebox", "tkMessageBox", "tkinter.messagebox"),
+    MovedModule("tkinter_tksimpledialog", "tkSimpleDialog",
+                "tkinter.simpledialog"),
+    MovedModule("urllib_robotparser", "robotparser", "urllib.robotparser"),
+    MovedModule("winreg", "_winreg"),
+]
+for attr in _moved_attributes:
+    setattr(_MovedItems, attr.name, attr)
+del attr
+
+moves = sys.modules[__name__ + ".moves"] = _MovedItems("moves")
+
+
+def add_move(move):
+    """Add an item to six.moves."""
+    setattr(_MovedItems, move.name, move)
+
+
+def remove_move(name):
+    """Remove item from six.moves."""
+    try:
+        delattr(_MovedItems, name)
+    except AttributeError:
+        try:
+            del moves.__dict__[name]
+        except KeyError:
+            raise AttributeError("no such move, %r" % (name,))
+
+
+if PY3:
+    _meth_func = "__func__"
+    _meth_self = "__self__"
+
+    _func_code = "__code__"
+    _func_defaults = "__defaults__"
+
+    _iterkeys = "keys"
+    _itervalues = "values"
+    _iteritems = "items"
+else:
+    _meth_func = "im_func"
+    _meth_self = "im_self"
+
+    _func_code = "func_code"
+    _func_defaults = "func_defaults"
+
+    _iterkeys = "iterkeys"
+    _itervalues = "itervalues"
+    _iteritems = "iteritems"
+
+
+try:
+    advance_iterator = next
+except NameError:
+    def advance_iterator(it):
+        return it.next()
+next = advance_iterator
+
+
+if PY3:
+    def get_unbound_function(unbound):
+        return unbound
+
+    Iterator = object
+
+    def callable(obj):
+        return any("__call__" in klass.__dict__ for klass in type(obj).__mro__)
+else:
+    def get_unbound_function(unbound):
+        return unbound.im_func
+
+    class Iterator(object):
+
+        def next(self):
+            return type(self).__next__(self)
+
+    callable = callable
+_add_doc(get_unbound_function,
+         """Get the function out of a possibly unbound function""")
+
+
+get_method_function = operator.attrgetter(_meth_func)
+get_method_self = operator.attrgetter(_meth_self)
+get_function_code = operator.attrgetter(_func_code)
+get_function_defaults = operator.attrgetter(_func_defaults)
+
+
+def iterkeys(d):
+    """Return an iterator over the keys of a dictionary."""
+    return iter(getattr(d, _iterkeys)())
+
+def itervalues(d):
+    """Return an iterator over the values of a dictionary."""
+    return iter(getattr(d, _itervalues)())
+
+def iteritems(d):
+    """Return an iterator over the (key, value) pairs of a dictionary."""
+    return iter(getattr(d, _iteritems)())
+
+
+if PY3:
+    def b(s):
+        return s.encode("latin-1")
+    def u(s):
+        return s
+    if sys.version_info[1] <= 1:
+        def int2byte(i):
+            return bytes((i,))
+    else:
+        # This is about 2x faster than the implementation above on 3.2+
+        int2byte = operator.methodcaller("to_bytes", 1, "big")
+    import io
+    StringIO = io.StringIO
+    BytesIO = io.BytesIO
+else:
+    def b(s):
+        return s
+    def u(s):
+        return unicode(s, "unicode_escape")
+    int2byte = chr
+    import StringIO
+    StringIO = BytesIO = StringIO.StringIO
+_add_doc(b, """Byte literal""")
+_add_doc(u, """Text literal""")
+
+
+if PY3:
+    import builtins
+    exec_ = getattr(builtins, "exec")
+
+
+    def reraise(tp, value, tb=None):
+        if value.__traceback__ is not tb:
+            raise value.with_traceback(tb)
+        raise value
+
+
+    print_ = getattr(builtins, "print")
+    del builtins
+
+else:
+    def exec_(code, globs=None, locs=None):
+        """Execute code in a namespace."""
+        if globs is None:
+            frame = sys._getframe(1)
+            globs = frame.f_globals
+            if locs is None:
+                locs = frame.f_locals
+            del frame
+        elif locs is None:
+            locs = globs
+        exec("""exec code in globs, locs""")
+
+
+    exec_("""def reraise(tp, value, tb=None):
+    raise tp, value, tb
+""")
+
+
+    def print_(*args, **kwargs):
+        """The new-style print function."""
+        fp = kwargs.pop("file", sys.stdout)
+        if fp is None:
+            return
+        def write(data):
+            if not isinstance(data, basestring):
+                data = str(data)
+            fp.write(data)
+        want_unicode = False
+        sep = kwargs.pop("sep", None)
+        if sep is not None:
+            if isinstance(sep, unicode):
+                want_unicode = True
+            elif not isinstance(sep, str):
+                raise TypeError("sep must be None or a string")
+        end = kwargs.pop("end", None)
+        if end is not None:
+            if isinstance(end, unicode):
+                want_unicode = True
+            elif not isinstance(end, str):
+                raise TypeError("end must be None or a string")
+        if kwargs:
+            raise TypeError("invalid keyword arguments to print()")
+        if not want_unicode:
+            for arg in args:
+                if isinstance(arg, unicode):
+                    want_unicode = True
+                    break
+        if want_unicode:
+            newline = unicode("\n")
+            space = unicode(" ")
+        else:
+            newline = "\n"
+            space = " "
+        if sep is None:
+            sep = space
+        if end is None:
+            end = newline
+        for i, arg in enumerate(args):
+            if i:
+                write(sep)
+            write(arg)
+        write(end)
+
+_add_doc(reraise, """Reraise an exception.""")
+
+
+def with_metaclass(meta, base=object):
+    """Create a base class with a metaclass."""
+    return meta("NewBase", (base,), {})
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/ssl_match_hostname/__init__.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/ssl_match_hostname/__init__.py
new file mode 100644
index 0000000..2d61ac2
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/packages/ssl_match_hostname/__init__.py
@@ -0,0 +1,98 @@
+"""The match_hostname() function from Python 3.2, essential when using SSL."""
+
+import re
+
+__version__ = '3.2.2'
+
+class CertificateError(ValueError):
+    pass
+
+def _dnsname_match(dn, hostname, max_wildcards=1):
+    """Matching according to RFC 6125, section 6.4.3
+
+    http://tools.ietf.org/html/rfc6125#section-6.4.3
+    """
+    pats = []
+    if not dn:
+        return False
+
+    parts = dn.split(r'.')
+    leftmost = parts[0]
+
+    wildcards = leftmost.count('*')
+    if wildcards > max_wildcards:
+        # Issue #17980: avoid denials of service by refusing more
+        # than one wildcard per fragment.  A survery of established
+        # policy among SSL implementations showed it to be a
+        # reasonable choice.
+        raise CertificateError(
+            "too many wildcards in certificate DNS name: " + repr(dn))
+
+    # speed up common case w/o wildcards
+    if not wildcards:
+        return dn.lower() == hostname.lower()
+
+    # RFC 6125, section 6.4.3, subitem 1.
+    # The client SHOULD NOT attempt to match a presented identifier in which
+    # the wildcard character comprises a label other than the left-most label.
+    if leftmost == '*':
+        # When '*' is a fragment by itself, it matches a non-empty dotless
+        # fragment.
+        pats.append('[^.]+')
+    elif leftmost.startswith('xn--') or hostname.startswith('xn--'):
+        # RFC 6125, section 6.4.3, subitem 3.
+        # The client SHOULD NOT attempt to match a presented identifier
+        # where the wildcard character is embedded within an A-label or
+        # U-label of an internationalized domain name.
+        pats.append(re.escape(leftmost))
+    else:
+        # Otherwise, '*' matches any dotless string, e.g. www*
+        pats.append(re.escape(leftmost).replace(r'\*', '[^.]*'))
+
+    # add the remaining fragments, ignore any wildcards
+    for frag in parts[1:]:
+        pats.append(re.escape(frag))
+
+    pat = re.compile(r'\A' + r'\.'.join(pats) + r'\Z', re.IGNORECASE)
+    return pat.match(hostname)
+
+
+def match_hostname(cert, hostname):
+    """Verify that *cert* (in decoded format as returned by
+    SSLSocket.getpeercert()) matches the *hostname*.  RFC 2818 and RFC 6125
+    rules are followed, but IP addresses are not accepted for *hostname*.
+
+    CertificateError is raised on failure. On success, the function
+    returns nothing.
+    """
+    if not cert:
+        raise ValueError("empty or no certificate")
+    dnsnames = []
+    san = cert.get('subjectAltName', ())
+    for key, value in san:
+        if key == 'DNS':
+            if _dnsname_match(value, hostname):
+                return
+            dnsnames.append(value)
+    if not dnsnames:
+        # The subject is only checked when there is no dNSName entry
+        # in subjectAltName
+        for sub in cert.get('subject', ()):
+            for key, value in sub:
+                # XXX according to RFC 2818, the most specific Common Name
+                # must be used.
+                if key == 'commonName':
+                    if _dnsname_match(value, hostname):
+                        return
+                    dnsnames.append(value)
+    if len(dnsnames) > 1:
+        raise CertificateError("hostname %r "
+            "doesn't match either of %s"
+            % (hostname, ', '.join(map(repr, dnsnames))))
+    elif len(dnsnames) == 1:
+        raise CertificateError("hostname %r "
+            "doesn't match %r"
+            % (hostname, dnsnames[0]))
+    else:
+        raise CertificateError("no appropriate commonName or "
+            "subjectAltName fields were found")
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/poolmanager.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/poolmanager.py
new file mode 100644
index 0000000..e7f8667
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/poolmanager.py
@@ -0,0 +1,259 @@
+# urllib3/poolmanager.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+import logging
+
+try:  # Python 3
+    from urllib.parse import urljoin
+except ImportError:
+    from urlparse import urljoin
+
+from ._collections import RecentlyUsedContainer
+from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool
+from .connectionpool import port_by_scheme
+from .request import RequestMethods
+from .util import parse_url
+
+
+__all__ = ['PoolManager', 'ProxyManager', 'proxy_from_url']
+
+
+pool_classes_by_scheme = {
+    'http': HTTPConnectionPool,
+    'https': HTTPSConnectionPool,
+}
+
+log = logging.getLogger(__name__)
+
+SSL_KEYWORDS = ('key_file', 'cert_file', 'cert_reqs', 'ca_certs',
+                'ssl_version')
+
+
+class PoolManager(RequestMethods):
+    """
+    Allows for arbitrary requests while transparently keeping track of
+    necessary connection pools for you.
+
+    :param num_pools:
+        Number of connection pools to cache before discarding the least
+        recently used pool.
+
+    :param headers:
+        Headers to include with all requests, unless other headers are given
+        explicitly.
+
+    :param \**connection_pool_kw:
+        Additional parameters are used to create fresh
+        :class:`urllib3.connectionpool.ConnectionPool` instances.
+
+    Example: ::
+
+        >>> manager = PoolManager(num_pools=2)
+        >>> r = manager.request('GET', 'http://google.com/')
+        >>> r = manager.request('GET', 'http://google.com/mail')
+        >>> r = manager.request('GET', 'http://yahoo.com/')
+        >>> len(manager.pools)
+        2
+
+    """
+
+    proxy = None
+
+    def __init__(self, num_pools=10, headers=None, **connection_pool_kw):
+        RequestMethods.__init__(self, headers)
+        self.connection_pool_kw = connection_pool_kw
+        self.pools = RecentlyUsedContainer(num_pools,
+                                           dispose_func=lambda p: p.close())
+
+    def _new_pool(self, scheme, host, port):
+        """
+        Create a new :class:`ConnectionPool` based on host, port and scheme.
+
+        This method is used to actually create the connection pools handed out
+        by :meth:`connection_from_url` and companion methods. It is intended
+        to be overridden for customization.
+        """
+        pool_cls = pool_classes_by_scheme[scheme]
+        kwargs = self.connection_pool_kw
+        if scheme == 'http':
+            kwargs = self.connection_pool_kw.copy()
+            for kw in SSL_KEYWORDS:
+                kwargs.pop(kw, None)
+
+        return pool_cls(host, port, **kwargs)
+
+    def clear(self):
+        """
+        Empty our store of pools and direct them all to close.
+
+        This will not affect in-flight connections, but they will not be
+        re-used after completion.
+        """
+        self.pools.clear()
+
+    def connection_from_host(self, host, port=None, scheme='http'):
+        """
+        Get a :class:`ConnectionPool` based on the host, port, and scheme.
+
+        If ``port`` isn't given, it will be derived from the ``scheme`` using
+        ``urllib3.connectionpool.port_by_scheme``.
+        """
+
+        scheme = scheme or 'http'
+
+        port = port or port_by_scheme.get(scheme, 80)
+
+        pool_key = (scheme, host, port)
+
+        with self.pools.lock:
+            # If the scheme, host, or port doesn't match existing open
+            # connections, open a new ConnectionPool.
+            pool = self.pools.get(pool_key)
+            if pool:
+                return pool
+
+            # Make a fresh ConnectionPool of the desired type
+            pool = self._new_pool(scheme, host, port)
+            self.pools[pool_key] = pool
+        return pool
+
+    def connection_from_url(self, url):
+        """
+        Similar to :func:`urllib3.connectionpool.connection_from_url` but
+        doesn't pass any additional parameters to the
+        :class:`urllib3.connectionpool.ConnectionPool` constructor.
+
+        Additional parameters are taken from the :class:`.PoolManager`
+        constructor.
+        """
+        u = parse_url(url)
+        return self.connection_from_host(u.host, port=u.port, scheme=u.scheme)
+
+    def urlopen(self, method, url, redirect=True, **kw):
+        """
+        Same as :meth:`urllib3.connectionpool.HTTPConnectionPool.urlopen`
+        with custom cross-host redirect logic and only sends the request-uri
+        portion of the ``url``.
+
+        The given ``url`` parameter must be absolute, such that an appropriate
+        :class:`urllib3.connectionpool.ConnectionPool` can be chosen for it.
+        """
+        u = parse_url(url)
+        conn = self.connection_from_host(u.host, port=u.port, scheme=u.scheme)
+
+        kw['assert_same_host'] = False
+        kw['redirect'] = False
+        if 'headers' not in kw:
+            kw['headers'] = self.headers
+
+        if self.proxy is not None and u.scheme == "http":
+            response = conn.urlopen(method, url, **kw)
+        else:
+            response = conn.urlopen(method, u.request_uri, **kw)
+
+        redirect_location = redirect and response.get_redirect_location()
+        if not redirect_location:
+            return response
+
+        # Support relative URLs for redirecting.
+        redirect_location = urljoin(url, redirect_location)
+
+        # RFC 2616, Section 10.3.4
+        if response.status == 303:
+            method = 'GET'
+
+        log.info("Redirecting %s -> %s" % (url, redirect_location))
+        kw['retries'] = kw.get('retries', 3) - 1  # Persist retries countdown
+        kw['redirect'] = redirect
+        return self.urlopen(method, redirect_location, **kw)
+
+
+class ProxyManager(PoolManager):
+    """
+    Behaves just like :class:`PoolManager`, but sends all requests through
+    the defined proxy, using the CONNECT method for HTTPS URLs.
+
+    :param poxy_url:
+        The URL of the proxy to be used.
+
+    :param proxy_headers:
+        A dictionary contaning headers that will be sent to the proxy. In case
+        of HTTP they are being sent with each request, while in the
+        HTTPS/CONNECT case they are sent only once. Could be used for proxy
+        authentication.
+
+    Example:
+        >>> proxy = urllib3.ProxyManager('http://localhost:3128/')
+        >>> r1 = proxy.request('GET', 'http://google.com/')
+        >>> r2 = proxy.request('GET', 'http://httpbin.org/')
+        >>> len(proxy.pools)
+        1
+        >>> r3 = proxy.request('GET', 'https://httpbin.org/')
+        >>> r4 = proxy.request('GET', 'https://twitter.com/')
+        >>> len(proxy.pools)
+        3
+
+    """
+
+    def __init__(self, proxy_url, num_pools=10, headers=None,
+                 proxy_headers=None, **connection_pool_kw):
+
+        if isinstance(proxy_url, HTTPConnectionPool):
+            proxy_url = '%s://%s:%i' % (proxy_url.scheme, proxy_url.host,
+                                        proxy_url.port)
+        proxy = parse_url(proxy_url)
+        if not proxy.port:
+            port = port_by_scheme.get(proxy.scheme, 80)
+            proxy = proxy._replace(port=port)
+        self.proxy = proxy
+        self.proxy_headers = proxy_headers or {}
+        assert self.proxy.scheme in ("http", "https"), \
+            'Not supported proxy scheme %s' % self.proxy.scheme
+        connection_pool_kw['_proxy'] = self.proxy
+        connection_pool_kw['_proxy_headers'] = self.proxy_headers
+        super(ProxyManager, self).__init__(
+            num_pools, headers, **connection_pool_kw)
+
+    def connection_from_host(self, host, port=None, scheme='http'):
+        if scheme == "https":
+            return super(ProxyManager, self).connection_from_host(
+                host, port, scheme)
+
+        return super(ProxyManager, self).connection_from_host(
+            self.proxy.host, self.proxy.port, self.proxy.scheme)
+
+    def _set_proxy_headers(self, url, headers=None):
+        """
+        Sets headers needed by proxies: specifically, the Accept and Host
+        headers. Only sets headers not provided by the user.
+        """
+        headers_ = {'Accept': '*/*'}
+
+        netloc = parse_url(url).netloc
+        if netloc:
+            headers_['Host'] = netloc
+
+        if headers:
+            headers_.update(headers)
+        return headers_
+
+    def urlopen(self, method, url, redirect=True, **kw):
+        "Same as HTTP(S)ConnectionPool.urlopen, ``url`` must be absolute."
+        u = parse_url(url)
+
+        if u.scheme == "http":
+            # It's too late to set proxy headers on per-request basis for
+            # tunnelled HTTPS connections, should use
+            # constructor's proxy_headers instead.
+            kw['headers'] = self._set_proxy_headers(url, kw.get('headers',
+                                                                self.headers))
+            kw['headers'].update(self.proxy_headers)
+
+        return super(ProxyManager, self).urlopen(method, url, redirect, **kw)
+
+
+def proxy_from_url(url, **kw):
+    return ProxyManager(proxy_url=url, **kw)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/request.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/request.py
new file mode 100644
index 0000000..66a9a0e
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/request.py
@@ -0,0 +1,142 @@
+# urllib3/request.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+try:
+    from urllib.parse import urlencode
+except ImportError:
+    from urllib import urlencode
+
+from .filepost import encode_multipart_formdata
+
+
+__all__ = ['RequestMethods']
+
+
+class RequestMethods(object):
+    """
+    Convenience mixin for classes who implement a :meth:`urlopen` method, such
+    as :class:`~urllib3.connectionpool.HTTPConnectionPool` and
+    :class:`~urllib3.poolmanager.PoolManager`.
+
+    Provides behavior for making common types of HTTP request methods and
+    decides which type of request field encoding to use.
+
+    Specifically,
+
+    :meth:`.request_encode_url` is for sending requests whose fields are encoded
+    in the URL (such as GET, HEAD, DELETE).
+
+    :meth:`.request_encode_body` is for sending requests whose fields are
+    encoded in the *body* of the request using multipart or www-form-urlencoded
+    (such as for POST, PUT, PATCH).
+
+    :meth:`.request` is for making any kind of request, it will look up the
+    appropriate encoding format and use one of the above two methods to make
+    the request.
+
+    Initializer parameters:
+
+    :param headers:
+        Headers to include with all requests, unless other headers are given
+        explicitly.
+    """
+
+    _encode_url_methods = set(['DELETE', 'GET', 'HEAD', 'OPTIONS'])
+    _encode_body_methods = set(['PATCH', 'POST', 'PUT', 'TRACE'])
+
+    def __init__(self, headers=None):
+        self.headers = headers or {}
+
+    def urlopen(self, method, url, body=None, headers=None,
+                encode_multipart=True, multipart_boundary=None,
+                **kw): # Abstract
+        raise NotImplemented("Classes extending RequestMethods must implement "
+                             "their own ``urlopen`` method.")
+
+    def request(self, method, url, fields=None, headers=None, **urlopen_kw):
+        """
+        Make a request using :meth:`urlopen` with the appropriate encoding of
+        ``fields`` based on the ``method`` used.
+
+        This is a convenience method that requires the least amount of manual
+        effort. It can be used in most situations, while still having the option
+        to drop down to more specific methods when necessary, such as
+        :meth:`request_encode_url`, :meth:`request_encode_body`,
+        or even the lowest level :meth:`urlopen`.
+        """
+        method = method.upper()
+
+        if method in self._encode_url_methods:
+            return self.request_encode_url(method, url, fields=fields,
+                                            headers=headers,
+                                            **urlopen_kw)
+        else:
+            return self.request_encode_body(method, url, fields=fields,
+                                             headers=headers,
+                                             **urlopen_kw)
+
+    def request_encode_url(self, method, url, fields=None, **urlopen_kw):
+        """
+        Make a request using :meth:`urlopen` with the ``fields`` encoded in
+        the url. This is useful for request methods like GET, HEAD, DELETE, etc.
+        """
+        if fields:
+            url += '?' + urlencode(fields)
+        return self.urlopen(method, url, **urlopen_kw)
+
+    def request_encode_body(self, method, url, fields=None, headers=None,
+                            encode_multipart=True, multipart_boundary=None,
+                            **urlopen_kw):
+        """
+        Make a request using :meth:`urlopen` with the ``fields`` encoded in
+        the body. This is useful for request methods like POST, PUT, PATCH, etc.
+
+        When ``encode_multipart=True`` (default), then
+        :meth:`urllib3.filepost.encode_multipart_formdata` is used to encode the
+        payload with the appropriate content type. Otherwise
+        :meth:`urllib.urlencode` is used with the
+        'application/x-www-form-urlencoded' content type.
+
+        Multipart encoding must be used when posting files, and it's reasonably
+        safe to use it in other times too. However, it may break request signing,
+        such as with OAuth.
+
+        Supports an optional ``fields`` parameter of key/value strings AND
+        key/filetuple. A filetuple is a (filename, data, MIME type) tuple where
+        the MIME type is optional. For example: ::
+
+            fields = {
+                'foo': 'bar',
+                'fakefile': ('foofile.txt', 'contents of foofile'),
+                'realfile': ('barfile.txt', open('realfile').read()),
+                'typedfile': ('bazfile.bin', open('bazfile').read(),
+                              'image/jpeg'),
+                'nonamefile': 'contents of nonamefile field',
+            }
+
+        When uploading a file, providing a filename (the first parameter of the
+        tuple) is optional but recommended to best mimick behavior of browsers.
+
+        Note that if ``headers`` are supplied, the 'Content-Type' header will be
+        overwritten because it depends on the dynamic random boundary string
+        which is used to compose the body of the request. The random boundary
+        string can be explicitly set with the ``multipart_boundary`` parameter.
+        """
+        if encode_multipart:
+            body, content_type = encode_multipart_formdata(fields or {},
+                                    boundary=multipart_boundary)
+        else:
+            body, content_type = (urlencode(fields or {}),
+                                    'application/x-www-form-urlencoded')
+
+        if headers is None:
+            headers = self.headers
+
+        headers_ = {'Content-Type': content_type}
+        headers_.update(headers)
+
+        return self.urlopen(method, url, body=body, headers=headers_,
+                            **urlopen_kw)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/response.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/response.py
new file mode 100644
index 0000000..4efff5a
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/response.py
@@ -0,0 +1,301 @@
+# urllib3/response.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+
+import logging
+import zlib
+import io
+
+from .exceptions import DecodeError
+from .packages.six import string_types as basestring, binary_type
+from .util import is_fp_closed
+
+
+log = logging.getLogger(__name__)
+
+
+class DeflateDecoder(object):
+
+    def __init__(self):
+        self._first_try = True
+        self._data = binary_type()
+        self._obj = zlib.decompressobj()
+
+    def __getattr__(self, name):
+        return getattr(self._obj, name)
+
+    def decompress(self, data):
+        if not self._first_try:
+            return self._obj.decompress(data)
+
+        self._data += data
+        try:
+            return self._obj.decompress(data)
+        except zlib.error:
+            self._first_try = False
+            self._obj = zlib.decompressobj(-zlib.MAX_WBITS)
+            try:
+                return self.decompress(self._data)
+            finally:
+                self._data = None
+
+
+def _get_decoder(mode):
+    if mode == 'gzip':
+        return zlib.decompressobj(16 + zlib.MAX_WBITS)
+
+    return DeflateDecoder()
+
+
+class HTTPResponse(io.IOBase):
+    """
+    HTTP Response container.
+
+    Backwards-compatible to httplib's HTTPResponse but the response ``body`` is
+    loaded and decoded on-demand when the ``data`` property is accessed.
+
+    Extra parameters for behaviour not present in httplib.HTTPResponse:
+
+    :param preload_content:
+        If True, the response's body will be preloaded during construction.
+
+    :param decode_content:
+        If True, attempts to decode specific content-encoding's based on headers
+        (like 'gzip' and 'deflate') will be skipped and raw data will be used
+        instead.
+
+    :param original_response:
+        When this HTTPResponse wrapper is generated from an httplib.HTTPResponse
+        object, it's convenient to include the original for debug purposes. It's
+        otherwise unused.
+    """
+
+    CONTENT_DECODERS = ['gzip', 'deflate']
+    REDIRECT_STATUSES = [301, 302, 303, 307, 308]
+
+    def __init__(self, body='', headers=None, status=0, version=0, reason=None,
+                 strict=0, preload_content=True, decode_content=True,
+                 original_response=None, pool=None, connection=None):
+        self.headers = headers or {}
+        self.status = status
+        self.version = version
+        self.reason = reason
+        self.strict = strict
+        self.decode_content = decode_content
+
+        self._decoder = None
+        self._body = body if body and isinstance(body, basestring) else None
+        self._fp = None
+        self._original_response = original_response
+
+        self._pool = pool
+        self._connection = connection
+
+        if hasattr(body, 'read'):
+            self._fp = body
+
+        if preload_content and not self._body:
+            self._body = self.read(decode_content=decode_content)
+
+    def get_redirect_location(self):
+        """
+        Should we redirect and where to?
+
+        :returns: Truthy redirect location string if we got a redirect status
+            code and valid location. ``None`` if redirect status and no
+            location. ``False`` if not a redirect status code.
+        """
+        if self.status in self.REDIRECT_STATUSES:
+            return self.headers.get('location')
+
+        return False
+
+    def release_conn(self):
+        if not self._pool or not self._connection:
+            return
+
+        self._pool._put_conn(self._connection)
+        self._connection = None
+
+    @property
+    def data(self):
+        # For backwords-compat with earlier urllib3 0.4 and earlier.
+        if self._body:
+            return self._body
+
+        if self._fp:
+            return self.read(cache_content=True)
+
+    def read(self, amt=None, decode_content=None, cache_content=False):
+        """
+        Similar to :meth:`httplib.HTTPResponse.read`, but with two additional
+        parameters: ``decode_content`` and ``cache_content``.
+
+        :param amt:
+            How much of the content to read. If specified, caching is skipped
+            because it doesn't make sense to cache partial content as the full
+            response.
+
+        :param decode_content:
+            If True, will attempt to decode the body based on the
+            'content-encoding' header.
+
+        :param cache_content:
+            If True, will save the returned data such that the same result is
+            returned despite of the state of the underlying file object. This
+            is useful if you want the ``.data`` property to continue working
+            after having ``.read()`` the file object. (Overridden if ``amt`` is
+            set.)
+        """
+        # Note: content-encoding value should be case-insensitive, per RFC 2616
+        # Section 3.5
+        content_encoding = self.headers.get('content-encoding', '').lower()
+        if self._decoder is None:
+            if content_encoding in self.CONTENT_DECODERS:
+                self._decoder = _get_decoder(content_encoding)
+        if decode_content is None:
+            decode_content = self.decode_content
+
+        if self._fp is None:
+            return
+
+        flush_decoder = False
+
+        try:
+            if amt is None:
+                # cStringIO doesn't like amt=None
+                data = self._fp.read()
+                flush_decoder = True
+            else:
+                cache_content = False
+                data = self._fp.read(amt)
+                if amt != 0 and not data:  # Platform-specific: Buggy versions of Python.
+                    # Close the connection when no data is returned
+                    #
+                    # This is redundant to what httplib/http.client _should_
+                    # already do.  However, versions of python released before
+                    # December 15, 2012 (http://bugs.python.org/issue16298) do not
+                    # properly close the connection in all cases. There is no harm
+                    # in redundantly calling close.
+                    self._fp.close()
+                    flush_decoder = True
+
+            try:
+                if decode_content and self._decoder:
+                    data = self._decoder.decompress(data)
+            except (IOError, zlib.error) as e:
+                raise DecodeError(
+                    "Received response with content-encoding: %s, but "
+                    "failed to decode it." % content_encoding,
+                    e)
+
+            if flush_decoder and decode_content and self._decoder:
+                buf = self._decoder.decompress(binary_type())
+                data += buf + self._decoder.flush()
+
+            if cache_content:
+                self._body = data
+
+            return data
+
+        finally:
+            if self._original_response and self._original_response.isclosed():
+                self.release_conn()
+
+    def stream(self, amt=2**16, decode_content=None):
+        """
+        A generator wrapper for the read() method. A call will block until
+        ``amt`` bytes have been read from the connection or until the
+        connection is closed.
+
+        :param amt:
+            How much of the content to read. The generator will return up to
+            much data per iteration, but may return less. This is particularly
+            likely when using compressed data. However, the empty string will
+            never be returned.
+
+        :param decode_content:
+            If True, will attempt to decode the body based on the
+            'content-encoding' header.
+        """
+        while not is_fp_closed(self._fp):
+            data = self.read(amt=amt, decode_content=decode_content)
+
+            if data:
+                yield data
+
+
+    @classmethod
+    def from_httplib(ResponseCls, r, **response_kw):
+        """
+        Given an :class:`httplib.HTTPResponse` instance ``r``, return a
+        corresponding :class:`urllib3.response.HTTPResponse` object.
+
+        Remaining parameters are passed to the HTTPResponse constructor, along
+        with ``original_response=r``.
+        """
+
+        # Normalize headers between different versions of Python
+        headers = {}
+        for k, v in r.getheaders():
+            # Python 3: Header keys are returned capitalised
+            k = k.lower()
+
+            has_value = headers.get(k)
+            if has_value: # Python 3: Repeating header keys are unmerged.
+                v = ', '.join([has_value, v])
+
+            headers[k] = v
+
+        # HTTPResponse objects in Python 3 don't have a .strict attribute
+        strict = getattr(r, 'strict', 0)
+        return ResponseCls(body=r,
+                           headers=headers,
+                           status=r.status,
+                           version=r.version,
+                           reason=r.reason,
+                           strict=strict,
+                           original_response=r,
+                           **response_kw)
+
+    # Backwards-compatibility methods for httplib.HTTPResponse
+    def getheaders(self):
+        return self.headers
+
+    def getheader(self, name, default=None):
+        return self.headers.get(name, default)
+
+    # Overrides from io.IOBase
+    def close(self):
+        if not self.closed:
+            self._fp.close()
+
+    @property
+    def closed(self):
+        if self._fp is None:
+            return True
+        elif hasattr(self._fp, 'closed'):
+            return self._fp.closed
+        elif hasattr(self._fp, 'isclosed'):  # Python 2
+            return self._fp.isclosed()
+        else:
+            return True
+
+    def fileno(self):
+        if self._fp is None:
+            raise IOError("HTTPResponse has no file to get a fileno from")
+        elif hasattr(self._fp, "fileno"):
+            return self._fp.fileno()
+        else:
+            raise IOError("The file-like object  this HTTPResponse is wrapped "
+                          "around has no file descriptor")
+
+    def flush(self):
+        if self._fp is not None and hasattr(self._fp, 'flush'):
+            return self._fp.flush()
+
+    def readable(self):
+        return True
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/util.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/util.py
new file mode 100644
index 0000000..266c9ed
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/packages/urllib3/util.py
@@ -0,0 +1,626 @@
+# urllib3/util.py
+# Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt)
+#
+# This module is part of urllib3 and is released under
+# the MIT License: http://www.opensource.org/licenses/mit-license.php
+
+
+from base64 import b64encode
+from binascii import hexlify, unhexlify
+from collections import namedtuple
+from hashlib import md5, sha1
+from socket import error as SocketError, _GLOBAL_DEFAULT_TIMEOUT
+import time
+
+try:
+    from select import poll, POLLIN
+except ImportError:  # `poll` doesn't exist on OSX and other platforms
+    poll = False
+    try:
+        from select import select
+    except ImportError:  # `select` doesn't exist on AppEngine.
+        select = False
+
+try:  # Test for SSL features
+    SSLContext = None
+    HAS_SNI = False
+
+    import ssl
+    from ssl import wrap_socket, CERT_NONE, PROTOCOL_SSLv23
+    from ssl import SSLContext  # Modern SSL?
+    from ssl import HAS_SNI  # Has SNI?
+except ImportError:
+    pass
+
+from .packages import six
+from .exceptions import LocationParseError, SSLError, TimeoutStateError
+
+
+_Default = object()
+# The default timeout to use for socket connections. This is the attribute used
+# by httplib to define the default timeout
+
+
+def current_time():
+    """
+    Retrieve the current time, this function is mocked out in unit testing.
+    """
+    return time.time()
+
+
+class Timeout(object):
+    """
+    Utility object for storing timeout values.
+
+    Example usage:
+
+    .. code-block:: python
+
+        timeout = urllib3.util.Timeout(connect=2.0, read=7.0)
+        pool = HTTPConnectionPool('www.google.com', 80, timeout=timeout)
+        pool.request(...) # Etc, etc
+
+    :param connect:
+        The maximum amount of time to wait for a connection attempt to a server
+        to succeed. Omitting the parameter will default the connect timeout to
+        the system default, probably `the global default timeout in socket.py
+        <http://hg.python.org/cpython/file/603b4d593758/Lib/socket.py#l535>`_.
+        None will set an infinite timeout for connection attempts.
+
+    :type connect: integer, float, or None
+
+    :param read:
+        The maximum amount of time to wait between consecutive
+        read operations for a response from the server. Omitting
+        the parameter will default the read timeout to the system
+        default, probably `the global default timeout in socket.py
+        <http://hg.python.org/cpython/file/603b4d593758/Lib/socket.py#l535>`_.
+        None will set an infinite timeout.
+
+    :type read: integer, float, or None
+
+    :param total:
+        The maximum amount of time to wait for an HTTP request to connect and
+        return. This combines the connect and read timeouts into one. In the
+        event that both a connect timeout and a total are specified, or a read
+        timeout and a total are specified, the shorter timeout will be applied.
+
+        Defaults to None.
+
+
+    :type total: integer, float, or None
+
+    .. note::
+
+        Many factors can affect the total amount of time for urllib3 to return
+        an HTTP response. Specifically, Python's DNS resolver does not obey the
+        timeout specified on the socket. Other factors that can affect total
+        request time include high CPU load, high swap, the program running at a
+        low priority level, or other behaviors. The observed running time for
+        urllib3 to return a response may be greater than the value passed to
+        `total`.
+
+        In addition, the read and total timeouts only measure the time between
+        read operations on the socket connecting the client and the server, not
+        the total amount of time for the request to return a complete response.
+        As an example, you may want a request to return within 7 seconds or
+        fail, so you set the ``total`` timeout to 7 seconds. If the server
+        sends one byte to you every 5 seconds, the request will **not** trigger
+        time out. This case is admittedly rare.
+    """
+
+    #: A sentinel object representing the default timeout value
+    DEFAULT_TIMEOUT = _GLOBAL_DEFAULT_TIMEOUT
+
+    def __init__(self, connect=_Default, read=_Default, total=None):
+        self._connect = self._validate_timeout(connect, 'connect')
+        self._read = self._validate_timeout(read, 'read')
+        self.total = self._validate_timeout(total, 'total')
+        self._start_connect = None
+
+    def __str__(self):
+        return '%s(connect=%r, read=%r, total=%r)' % (
+            type(self).__name__, self._connect, self._read, self.total)
+
+
+    @classmethod
+    def _validate_timeout(cls, value, name):
+        """ Check that a timeout attribute is valid
+
+        :param value: The timeout value to validate
+        :param name: The name of the timeout attribute to validate. This is used
+            for clear error messages
+        :return: the value
+        :raises ValueError: if the type is not an integer or a float, or if it
+            is a numeric value less than zero
+        """
+        if value is _Default:
+            return cls.DEFAULT_TIMEOUT
+
+        if value is None or value is cls.DEFAULT_TIMEOUT:
+            return value
+
+        try:
+            float(value)
+        except (TypeError, ValueError):
+            raise ValueError("Timeout value %s was %s, but it must be an "
+                             "int or float." % (name, value))
+
+        try:
+            if value < 0:
+                raise ValueError("Attempted to set %s timeout to %s, but the "
+                                 "timeout cannot be set to a value less "
+                                 "than 0." % (name, value))
+        except TypeError: # Python 3
+            raise ValueError("Timeout value %s was %s, but it must be an "
+                             "int or float." % (name, value))
+
+        return value
+
+    @classmethod
+    def from_float(cls, timeout):
+        """ Create a new Timeout from a legacy timeout value.
+
+        The timeout value used by httplib.py sets the same timeout on the
+        connect(), and recv() socket requests. This creates a :class:`Timeout`
+        object that sets the individual timeouts to the ``timeout`` value passed
+        to this function.
+
+        :param timeout: The legacy timeout value
+        :type timeout: integer, float, sentinel default object, or None
+        :return: a Timeout object
+        :rtype: :class:`Timeout`
+        """
+        return Timeout(read=timeout, connect=timeout)
+
+    def clone(self):
+        """ Create a copy of the timeout object
+
+        Timeout properties are stored per-pool but each request needs a fresh
+        Timeout object to ensure each one has its own start/stop configured.
+
+        :return: a copy of the timeout object
+        :rtype: :class:`Timeout`
+        """
+        # We can't use copy.deepcopy because that will also create a new object
+        # for _GLOBAL_DEFAULT_TIMEOUT, which socket.py uses as a sentinel to
+        # detect the user default.
+        return Timeout(connect=self._connect, read=self._read,
+                       total=self.total)
+
+    def start_connect(self):
+        """ Start the timeout clock, used during a connect() attempt
+
+        :raises urllib3.exceptions.TimeoutStateError: if you attempt
+            to start a timer that has been started already.
+        """
+        if self._start_connect is not None:
+            raise TimeoutStateError("Timeout timer has already been started.")
+        self._start_connect = current_time()
+        return self._start_connect
+
+    def get_connect_duration(self):
+        """ Gets the time elapsed since the call to :meth:`start_connect`.
+
+        :return: the elapsed time
+        :rtype: float
+        :raises urllib3.exceptions.TimeoutStateError: if you attempt
+            to get duration for a timer that hasn't been started.
+        """
+        if self._start_connect is None:
+            raise TimeoutStateError("Can't get connect duration for timer "
+                                    "that has not started.")
+        return current_time() - self._start_connect
+
+    @property
+    def connect_timeout(self):
+        """ Get the value to use when setting a connection timeout.
+
+        This will be a positive float or integer, the value None
+        (never timeout), or the default system timeout.
+
+        :return: the connect timeout
+        :rtype: int, float, :attr:`Timeout.DEFAULT_TIMEOUT` or None
+        """
+        if self.total is None:
+            return self._connect
+
+        if self._connect is None or self._connect is self.DEFAULT_TIMEOUT:
+            return self.total
+
+        return min(self._connect, self.total)
+
+    @property
+    def read_timeout(self):
+        """ Get the value for the read timeout.
+
+        This assumes some time has elapsed in the connection timeout and
+        computes the read timeout appropriately.
+
+        If self.total is set, the read timeout is dependent on the amount of
+        time taken by the connect timeout. If the connection time has not been
+        established, a :exc:`~urllib3.exceptions.TimeoutStateError` will be
+        raised.
+
+        :return: the value to use for the read timeout
+        :rtype: int, float, :attr:`Timeout.DEFAULT_TIMEOUT` or None
+        :raises urllib3.exceptions.TimeoutStateError: If :meth:`start_connect`
+            has not yet been called on this object.
+        """
+        if (self.total is not None and
+            self.total is not self.DEFAULT_TIMEOUT and
+            self._read is not None and
+            self._read is not self.DEFAULT_TIMEOUT):
+            # in case the connect timeout has not yet been established.
+            if self._start_connect is None:
+                return self._read
+            return max(0, min(self.total - self.get_connect_duration(),
+                              self._read))
+        elif self.total is not None and self.total is not self.DEFAULT_TIMEOUT:
+            return max(0, self.total - self.get_connect_duration())
+        else:
+            return self._read
+
+
+class Url(namedtuple('Url', ['scheme', 'auth', 'host', 'port', 'path', 'query', 'fragment'])):
+    """
+    Datastructure for representing an HTTP URL. Used as a return value for
+    :func:`parse_url`.
+    """
+    slots = ()
+
+    def __new__(cls, scheme=None, auth=None, host=None, port=None, path=None, query=None, fragment=None):
+        return super(Url, cls).__new__(cls, scheme, auth, host, port, path, query, fragment)
+
+    @property
+    def hostname(self):
+        """For backwards-compatibility with urlparse. We're nice like that."""
+        return self.host
+
+    @property
+    def request_uri(self):
+        """Absolute path including the query string."""
+        uri = self.path or '/'
+
+        if self.query is not None:
+            uri += '?' + self.query
+
+        return uri
+
+    @property
+    def netloc(self):
+        """Network location including host and port"""
+        if self.port:
+            return '%s:%d' % (self.host, self.port)
+        return self.host
+
+
+def split_first(s, delims):
+    """
+    Given a string and an iterable of delimiters, split on the first found
+    delimiter. Return two split parts and the matched delimiter.
+
+    If not found, then the first part is the full input string.
+
+    Example: ::
+
+        >>> split_first('foo/bar?baz', '?/=')
+        ('foo', 'bar?baz', '/')
+        >>> split_first('foo/bar?baz', '123')
+        ('foo/bar?baz', '', None)
+
+    Scales linearly with number of delims. Not ideal for large number of delims.
+    """
+    min_idx = None
+    min_delim = None
+    for d in delims:
+        idx = s.find(d)
+        if idx < 0:
+            continue
+
+        if min_idx is None or idx < min_idx:
+            min_idx = idx
+            min_delim = d
+
+    if min_idx is None or min_idx < 0:
+        return s, '', None
+
+    return s[:min_idx], s[min_idx+1:], min_delim
+
+
+def parse_url(url):
+    """
+    Given a url, return a parsed :class:`.Url` namedtuple. Best-effort is
+    performed to parse incomplete urls. Fields not provided will be None.
+
+    Partly backwards-compatible with :mod:`urlparse`.
+
+    Example: ::
+
+        >>> parse_url('http://google.com/mail/')
+        Url(scheme='http', host='google.com', port=None, path='/', ...)
+        >>> parse_url('google.com:80')
+        Url(scheme=None, host='google.com', port=80, path=None, ...)
+        >>> parse_url('/foo?bar')
+        Url(scheme=None, host=None, port=None, path='/foo', query='bar', ...)
+    """
+
+    # While this code has overlap with stdlib's urlparse, it is much
+    # simplified for our needs and less annoying.
+    # Additionally, this implementations does silly things to be optimal
+    # on CPython.
+
+    scheme = None
+    auth = None
+    host = None
+    port = None
+    path = None
+    fragment = None
+    query = None
+
+    # Scheme
+    if '://' in url:
+        scheme, url = url.split('://', 1)
+
+    # Find the earliest Authority Terminator
+    # (http://tools.ietf.org/html/rfc3986#section-3.2)
+    url, path_, delim = split_first(url, ['/', '?', '#'])
+
+    if delim:
+        # Reassemble the path
+        path = delim + path_
+
+    # Auth
+    if '@' in url:
+        auth, url = url.split('@', 1)
+
+    # IPv6
+    if url and url[0] == '[':
+        host, url = url.split(']', 1)
+        host += ']'
+
+    # Port
+    if ':' in url:
+        _host, port = url.split(':', 1)
+
+        if not host:
+            host = _host
+
+        if not port.isdigit():
+            raise LocationParseError("Failed to parse: %s" % url)
+
+        port = int(port)
+
+    elif not host and url:
+        host = url
+
+    if not path:
+        return Url(scheme, auth, host, port, path, query, fragment)
+
+    # Fragment
+    if '#' in path:
+        path, fragment = path.split('#', 1)
+
+    # Query
+    if '?' in path:
+        path, query = path.split('?', 1)
+
+    return Url(scheme, auth, host, port, path, query, fragment)
+
+
+def get_host(url):
+    """
+    Deprecated. Use :func:`.parse_url` instead.
+    """
+    p = parse_url(url)
+    return p.scheme or 'http', p.hostname, p.port
+
+
+def make_headers(keep_alive=None, accept_encoding=None, user_agent=None,
+                 basic_auth=None):
+    """
+    Shortcuts for generating request headers.
+
+    :param keep_alive:
+        If ``True``, adds 'connection: keep-alive' header.
+
+    :param accept_encoding:
+        Can be a boolean, list, or string.
+        ``True`` translates to 'gzip,deflate'.
+        List will get joined by comma.
+        String will be used as provided.
+
+    :param user_agent:
+        String representing the user-agent you want, such as
+        "python-urllib3/0.6"
+
+    :param basic_auth:
+        Colon-separated username:password string for 'authorization: basic ...'
+        auth header.
+
+    Example: ::
+
+        >>> make_headers(keep_alive=True, user_agent="Batman/1.0")
+        {'connection': 'keep-alive', 'user-agent': 'Batman/1.0'}
+        >>> make_headers(accept_encoding=True)
+        {'accept-encoding': 'gzip,deflate'}
+    """
+    headers = {}
+    if accept_encoding:
+        if isinstance(accept_encoding, str):
+            pass
+        elif isinstance(accept_encoding, list):
+            accept_encoding = ','.join(accept_encoding)
+        else:
+            accept_encoding = 'gzip,deflate'
+        headers['accept-encoding'] = accept_encoding
+
+    if user_agent:
+        headers['user-agent'] = user_agent
+
+    if keep_alive:
+        headers['connection'] = 'keep-alive'
+
+    if basic_auth:
+        headers['authorization'] = 'Basic ' + \
+            b64encode(six.b(basic_auth)).decode('utf-8')
+
+    return headers
+
+
+def is_connection_dropped(conn):  # Platform-specific
+    """
+    Returns True if the connection is dropped and should be closed.
+
+    :param conn:
+        :class:`httplib.HTTPConnection` object.
+
+    Note: For platforms like AppEngine, this will always return ``False`` to
+    let the platform handle connection recycling transparently for us.
+    """
+    sock = getattr(conn, 'sock', False)
+    if not sock: # Platform-specific: AppEngine
+        return False
+
+    if not poll:
+        if not select: # Platform-specific: AppEngine
+            return False
+
+        try:
+            return select([sock], [], [], 0.0)[0]
+        except SocketError:
+            return True
+
+    # This version is better on platforms that support it.
+    p = poll()
+    p.register(sock, POLLIN)
+    for (fno, ev) in p.poll(0.0):
+        if fno == sock.fileno():
+            # Either data is buffered (bad), or the connection is dropped.
+            return True
+
+
+def resolve_cert_reqs(candidate):
+    """
+    Resolves the argument to a numeric constant, which can be passed to
+    the wrap_socket function/method from the ssl module.
+    Defaults to :data:`ssl.CERT_NONE`.
+    If given a string it is assumed to be the name of the constant in the
+    :mod:`ssl` module or its abbrevation.
+    (So you can specify `REQUIRED` instead of `CERT_REQUIRED`.
+    If it's neither `None` nor a string we assume it is already the numeric
+    constant which can directly be passed to wrap_socket.
+    """
+    if candidate is None:
+        return CERT_NONE
+
+    if isinstance(candidate, str):
+        res = getattr(ssl, candidate, None)
+        if res is None:
+            res = getattr(ssl, 'CERT_' + candidate)
+        return res
+
+    return candidate
+
+
+def resolve_ssl_version(candidate):
+    """
+    like resolve_cert_reqs
+    """
+    if candidate is None:
+        return PROTOCOL_SSLv23
+
+    if isinstance(candidate, str):
+        res = getattr(ssl, candidate, None)
+        if res is None:
+            res = getattr(ssl, 'PROTOCOL_' + candidate)
+        return res
+
+    return candidate
+
+
+def assert_fingerprint(cert, fingerprint):
+    """
+    Checks if given fingerprint matches the supplied certificate.
+
+    :param cert:
+        Certificate as bytes object.
+    :param fingerprint:
+        Fingerprint as string of hexdigits, can be interspersed by colons.
+    """
+
+    # Maps the length of a digest to a possible hash function producing
+    # this digest.
+    hashfunc_map = {
+        16: md5,
+        20: sha1
+    }
+
+    fingerprint = fingerprint.replace(':', '').lower()
+
+    digest_length, rest = divmod(len(fingerprint), 2)
+
+    if rest or digest_length not in hashfunc_map:
+        raise SSLError('Fingerprint is of invalid length.')
+
+    # We need encode() here for py32; works on py2 and p33.
+    fingerprint_bytes = unhexlify(fingerprint.encode())
+
+    hashfunc = hashfunc_map[digest_length]
+
+    cert_digest = hashfunc(cert).digest()
+
+    if not cert_digest == fingerprint_bytes:
+        raise SSLError('Fingerprints did not match. Expected "{0}", got "{1}".'
+                       .format(hexlify(fingerprint_bytes),
+                               hexlify(cert_digest)))
+
+def is_fp_closed(obj):
+    """
+    Checks whether a given file-like object is closed.
+
+    :param obj:
+        The file-like object to check.
+    """
+    if hasattr(obj, 'fp'):
+        # Object is a container for another file-like object that gets released
+        # on exhaustion (e.g. HTTPResponse)
+        return obj.fp is None
+
+    return obj.closed
+
+
+if SSLContext is not None:  # Python 3.2+
+    def ssl_wrap_socket(sock, keyfile=None, certfile=None, cert_reqs=None,
+                        ca_certs=None, server_hostname=None,
+                        ssl_version=None):
+        """
+        All arguments except `server_hostname` have the same meaning as for
+        :func:`ssl.wrap_socket`
+
+        :param server_hostname:
+            Hostname of the expected certificate
+        """
+        context = SSLContext(ssl_version)
+        context.verify_mode = cert_reqs
+        if ca_certs:
+            try:
+                context.load_verify_locations(ca_certs)
+            # Py32 raises IOError
+            # Py33 raises FileNotFoundError
+            except Exception as e:  # Reraise as SSLError
+                raise SSLError(e)
+        if certfile:
+            # FIXME: This block needs a test.
+            context.load_cert_chain(certfile, keyfile)
+        if HAS_SNI:  # Platform-specific: OpenSSL with enabled SNI
+            return context.wrap_socket(sock, server_hostname=server_hostname)
+        return context.wrap_socket(sock)
+
+else:  # Python 3.1 and earlier
+    def ssl_wrap_socket(sock, keyfile=None, certfile=None, cert_reqs=None,
+                        ca_certs=None, server_hostname=None,
+                        ssl_version=None):
+        return wrap_socket(sock, keyfile=keyfile, certfile=certfile,
+                           ca_certs=ca_certs, cert_reqs=cert_reqs,
+                           ssl_version=ssl_version)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/sessions.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/sessions.py
new file mode 100644
index 0000000..aa956d3
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/sessions.py
@@ -0,0 +1,527 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.session
+~~~~~~~~~~~~~~~~
+
+This module provides a Session object to manage and persist settings across
+requests (cookies, auth, proxies).
+
+"""
+import os
+from collections import Mapping
+from datetime import datetime
+
+from .compat import cookielib, OrderedDict, urljoin, urlparse
+from .cookies import cookiejar_from_dict, extract_cookies_to_jar, RequestsCookieJar
+from .models import Request, PreparedRequest
+from .hooks import default_hooks, dispatch_hook
+from .utils import to_key_val_list, default_headers
+from .exceptions import TooManyRedirects, InvalidSchema
+from .structures import CaseInsensitiveDict
+
+from .adapters import HTTPAdapter
+
+from .utils import requote_uri, get_environ_proxies, get_netrc_auth
+
+from .status_codes import codes
+REDIRECT_STATI = (
+    codes.moved, # 301
+    codes.found, # 302
+    codes.other, # 303
+    codes.temporary_moved, # 307
+)
+DEFAULT_REDIRECT_LIMIT = 30
+
+
+def merge_setting(request_setting, session_setting, dict_class=OrderedDict):
+    """
+    Determines appropriate setting for a given request, taking into account the
+    explicit setting on that request, and the setting in the session. If a
+    setting is a dictionary, they will be merged together using `dict_class`
+    """
+
+    if session_setting is None:
+        return request_setting
+
+    if request_setting is None:
+        return session_setting
+
+    # Bypass if not a dictionary (e.g. verify)
+    if not (
+            isinstance(session_setting, Mapping) and
+            isinstance(request_setting, Mapping)
+    ):
+        return request_setting
+
+    merged_setting = dict_class(to_key_val_list(session_setting))
+    merged_setting.update(to_key_val_list(request_setting))
+
+    # Remove keys that are set to None.
+    for (k, v) in request_setting.items():
+        if v is None:
+            del merged_setting[k]
+
+    return merged_setting
+
+
+class SessionRedirectMixin(object):
+    def resolve_redirects(self, resp, req, stream=False, timeout=None,
+                          verify=True, cert=None, proxies=None):
+        """Receives a Response. Returns a generator of Responses."""
+
+        i = 0
+
+        # ((resp.status_code is codes.see_other))
+        while (('location' in resp.headers and resp.status_code in REDIRECT_STATI)):
+            prepared_request = req.copy()
+
+            resp.content  # Consume socket so it can be released
+
+            if i >= self.max_redirects:
+                raise TooManyRedirects('Exceeded %s redirects.' % self.max_redirects)
+
+            # Release the connection back into the pool.
+            resp.close()
+
+            url = resp.headers['location']
+            method = req.method
+
+            # Handle redirection without scheme (see: RFC 1808 Section 4)
+            if url.startswith('//'):
+                parsed_rurl = urlparse(resp.url)
+                url = '%s:%s' % (parsed_rurl.scheme, url)
+
+            # The scheme should be lower case...
+            if '://' in url:
+                scheme, uri = url.split('://', 1)
+                url = '%s://%s' % (scheme.lower(), uri)
+
+            # Facilitate non-RFC2616-compliant 'location' headers
+            # (e.g. '/path/to/resource' instead of 'http://domain.tld/path/to/resource')
+            # Compliant with RFC3986, we percent encode the url.
+            if not urlparse(url).netloc:
+                url = urljoin(resp.url, requote_uri(url))
+            else:
+                url = requote_uri(url)
+
+            prepared_request.url = url
+
+            # http://www.w3.org/Protocols/rfc2616/rfc2616-sec10.html#sec10.3.4
+            if (resp.status_code == codes.see_other and
+                    method != 'HEAD'):
+                method = 'GET'
+
+            # Do what the browsers do, despite standards...
+            if (resp.status_code in (codes.moved, codes.found) and
+                    method not in ('GET', 'HEAD')):
+                method = 'GET'
+
+            prepared_request.method = method
+
+            # https://github.com/kennethreitz/requests/issues/1084
+            if resp.status_code not in (codes.temporary, codes.resume):
+                if 'Content-Length' in prepared_request.headers:
+                    del prepared_request.headers['Content-Length']
+
+                prepared_request.body = None
+
+            headers = prepared_request.headers
+            try:
+                del headers['Cookie']
+            except KeyError:
+                pass
+
+            prepared_request.prepare_cookies(self.cookies)
+
+            resp = self.send(
+                prepared_request,
+                stream=stream,
+                timeout=timeout,
+                verify=verify,
+                cert=cert,
+                proxies=proxies,
+                allow_redirects=False,
+            )
+
+            extract_cookies_to_jar(self.cookies, prepared_request, resp.raw)
+
+            i += 1
+            yield resp
+
+
+class Session(SessionRedirectMixin):
+    """A Requests session.
+
+    Provides cookie persistence, connection-pooling, and configuration.
+
+    Basic Usage::
+
+      >>> import requests
+      >>> s = requests.Session()
+      >>> s.get('http://httpbin.org/get')
+      200
+    """
+
+    __attrs__ = [
+        'headers', 'cookies', 'auth', 'timeout', 'proxies', 'hooks',
+        'params', 'verify', 'cert', 'prefetch', 'adapters', 'stream',
+        'trust_env', 'max_redirects']
+
+    def __init__(self):
+
+        #: A case-insensitive dictionary of headers to be sent on each
+        #: :class:`Request <Request>` sent from this
+        #: :class:`Session <Session>`.
+        self.headers = default_headers()
+
+        #: Default Authentication tuple or object to attach to
+        #: :class:`Request <Request>`.
+        self.auth = None
+
+        #: Dictionary mapping protocol to the URL of the proxy (e.g.
+        #: {'http': 'foo.bar:3128'}) to be used on each
+        #: :class:`Request <Request>`.
+        self.proxies = {}
+
+        #: Event-handling hooks.
+        self.hooks = default_hooks()
+
+        #: Dictionary of querystring data to attach to each
+        #: :class:`Request <Request>`. The dictionary values may be lists for
+        #: representing multivalued query parameters.
+        self.params = {}
+
+        #: Stream response content default.
+        self.stream = False
+
+        #: SSL Verification default.
+        self.verify = True
+
+        #: SSL certificate default.
+        self.cert = None
+
+        #: Maximum number of redirects allowed. If the request exceeds this
+        #: limit, a :class:`TooManyRedirects` exception is raised.
+        self.max_redirects = DEFAULT_REDIRECT_LIMIT
+
+        #: Should we trust the environment?
+        self.trust_env = True
+
+        #: A CookieJar containing all currently outstanding cookies set on this
+        #: session. By default it is a
+        #: :class:`RequestsCookieJar <requests.cookies.RequestsCookieJar>`, but
+        #: may be any other ``cookielib.CookieJar`` compatible object.
+        self.cookies = cookiejar_from_dict({})
+
+        # Default connection adapters.
+        self.adapters = OrderedDict()
+        self.mount('https://', HTTPAdapter())
+        self.mount('http://', HTTPAdapter())
+
+    def __enter__(self):
+        return self
+
+    def __exit__(self, *args):
+        self.close()
+
+    def prepare_request(self, request):
+        """Constructs a :class:`PreparedRequest <PreparedRequest>` for
+        transmission and returns it. The :class:`PreparedRequest` has settings
+        merged from the :class:`Request <Request>` instance and those of the
+        :class:`Session`.
+
+        :param request: :class:`Request` instance to prepare with this
+        session's settings.
+        """
+        cookies = request.cookies or {}
+
+        # Bootstrap CookieJar.
+        if not isinstance(cookies, cookielib.CookieJar):
+            cookies = cookiejar_from_dict(cookies)
+
+        # Merge with session cookies
+        merged_cookies = RequestsCookieJar()
+        merged_cookies.update(self.cookies)
+        merged_cookies.update(cookies)
+
+
+        # Set environment's basic authentication if not explicitly set.
+        auth = request.auth
+        if self.trust_env and not auth and not self.auth:
+            auth = get_netrc_auth(request.url)
+
+        p = PreparedRequest()
+        p.prepare(
+            method=request.method.upper(),
+            url=request.url,
+            files=request.files,
+            data=request.data,
+            headers=merge_setting(request.headers, self.headers, dict_class=CaseInsensitiveDict),
+            params=merge_setting(request.params, self.params),
+            auth=merge_setting(auth, self.auth),
+            cookies=merged_cookies,
+            hooks=merge_setting(request.hooks, self.hooks),
+        )
+        return p
+
+    def request(self, method, url,
+        params=None,
+        data=None,
+        headers=None,
+        cookies=None,
+        files=None,
+        auth=None,
+        timeout=None,
+        allow_redirects=True,
+        proxies=None,
+        hooks=None,
+        stream=None,
+        verify=None,
+        cert=None):
+        """Constructs a :class:`Request <Request>`, prepares it and sends it.
+        Returns :class:`Response <Response>` object.
+
+        :param method: method for the new :class:`Request` object.
+        :param url: URL for the new :class:`Request` object.
+        :param params: (optional) Dictionary or bytes to be sent in the query
+            string for the :class:`Request`.
+        :param data: (optional) Dictionary or bytes to send in the body of the
+            :class:`Request`.
+        :param headers: (optional) Dictionary of HTTP Headers to send with the
+            :class:`Request`.
+        :param cookies: (optional) Dict or CookieJar object to send with the
+            :class:`Request`.
+        :param files: (optional) Dictionary of 'filename': file-like-objects
+            for multipart encoding upload.
+        :param auth: (optional) Auth tuple or callable to enable
+            Basic/Digest/Custom HTTP Auth.
+        :param timeout: (optional) Float describing the timeout of the
+            request.
+        :param allow_redirects: (optional) Boolean. Set to True by default.
+        :param proxies: (optional) Dictionary mapping protocol to the URL of
+            the proxy.
+        :param stream: (optional) whether to immediately download the response
+            content. Defaults to ``False``.
+        :param verify: (optional) if ``True``, the SSL cert will be verified.
+            A CA_BUNDLE path can also be provided.
+        :param cert: (optional) if String, path to ssl client cert file (.pem).
+            If Tuple, ('cert', 'key') pair.
+        """
+        # Create the Request.
+        req = Request(
+            method = method.upper(),
+            url = url,
+            headers = headers,
+            files = files,
+            data = data or {},
+            params = params or {},
+            auth = auth,
+            cookies = cookies,
+            hooks = hooks,
+        )
+        prep = self.prepare_request(req)
+
+        proxies = proxies or {}
+
+        # Gather clues from the surrounding environment.
+        if self.trust_env:
+            # Set environment's proxies.
+            env_proxies = get_environ_proxies(url) or {}
+            for (k, v) in env_proxies.items():
+                proxies.setdefault(k, v)
+
+            # Look for configuration.
+            if not verify and verify is not False:
+                verify = os.environ.get('REQUESTS_CA_BUNDLE')
+
+            # Curl compatibility.
+            if not verify and verify is not False:
+                verify = os.environ.get('CURL_CA_BUNDLE')
+
+        # Merge all the kwargs.
+        proxies = merge_setting(proxies, self.proxies)
+        stream = merge_setting(stream, self.stream)
+        verify = merge_setting(verify, self.verify)
+        cert = merge_setting(cert, self.cert)
+
+        # Send the request.
+        send_kwargs = {
+            'stream': stream,
+            'timeout': timeout,
+            'verify': verify,
+            'cert': cert,
+            'proxies': proxies,
+            'allow_redirects': allow_redirects,
+        }
+        resp = self.send(prep, **send_kwargs)
+
+        return resp
+
+    def get(self, url, **kwargs):
+        """Sends a GET request. Returns :class:`Response` object.
+
+        :param url: URL for the new :class:`Request` object.
+        :param \*\*kwargs: Optional arguments that ``request`` takes.
+        """
+
+        kwargs.setdefault('allow_redirects', True)
+        return self.request('GET', url, **kwargs)
+
+    def options(self, url, **kwargs):
+        """Sends a OPTIONS request. Returns :class:`Response` object.
+
+        :param url: URL for the new :class:`Request` object.
+        :param \*\*kwargs: Optional arguments that ``request`` takes.
+        """
+
+        kwargs.setdefault('allow_redirects', True)
+        return self.request('OPTIONS', url, **kwargs)
+
+    def head(self, url, **kwargs):
+        """Sends a HEAD request. Returns :class:`Response` object.
+
+        :param url: URL for the new :class:`Request` object.
+        :param \*\*kwargs: Optional arguments that ``request`` takes.
+        """
+
+        kwargs.setdefault('allow_redirects', False)
+        return self.request('HEAD', url, **kwargs)
+
+    def post(self, url, data=None, **kwargs):
+        """Sends a POST request. Returns :class:`Response` object.
+
+        :param url: URL for the new :class:`Request` object.
+        :param data: (optional) Dictionary, bytes, or file-like object to send in the body of the :class:`Request`.
+        :param \*\*kwargs: Optional arguments that ``request`` takes.
+        """
+
+        return self.request('POST', url, data=data, **kwargs)
+
+    def put(self, url, data=None, **kwargs):
+        """Sends a PUT request. Returns :class:`Response` object.
+
+        :param url: URL for the new :class:`Request` object.
+        :param data: (optional) Dictionary, bytes, or file-like object to send in the body of the :class:`Request`.
+        :param \*\*kwargs: Optional arguments that ``request`` takes.
+        """
+
+        return self.request('PUT', url, data=data, **kwargs)
+
+    def patch(self, url, data=None, **kwargs):
+        """Sends a PATCH request. Returns :class:`Response` object.
+
+        :param url: URL for the new :class:`Request` object.
+        :param data: (optional) Dictionary, bytes, or file-like object to send in the body of the :class:`Request`.
+        :param \*\*kwargs: Optional arguments that ``request`` takes.
+        """
+
+        return self.request('PATCH', url,  data=data, **kwargs)
+
+    def delete(self, url, **kwargs):
+        """Sends a DELETE request. Returns :class:`Response` object.
+
+        :param url: URL for the new :class:`Request` object.
+        :param \*\*kwargs: Optional arguments that ``request`` takes.
+        """
+
+        return self.request('DELETE', url, **kwargs)
+
+    def send(self, request, **kwargs):
+        """Send a given PreparedRequest."""
+        # Set defaults that the hooks can utilize to ensure they always have
+        # the correct parameters to reproduce the previous request.
+        kwargs.setdefault('stream', self.stream)
+        kwargs.setdefault('verify', self.verify)
+        kwargs.setdefault('cert', self.cert)
+        kwargs.setdefault('proxies', self.proxies)
+
+        # It's possible that users might accidentally send a Request object.
+        # Guard against that specific failure case.
+        if not isinstance(request, PreparedRequest):
+            raise ValueError('You can only send PreparedRequests.')
+
+        # Set up variables needed for resolve_redirects and dispatching of
+        # hooks
+        allow_redirects = kwargs.pop('allow_redirects', True)
+        stream = kwargs.get('stream')
+        timeout = kwargs.get('timeout')
+        verify = kwargs.get('verify')
+        cert = kwargs.get('cert')
+        proxies = kwargs.get('proxies')
+        hooks = request.hooks
+
+        # Get the appropriate adapter to use
+        adapter = self.get_adapter(url=request.url)
+
+        # Start time (approximately) of the request
+        start = datetime.utcnow()
+        # Send the request
+        r = adapter.send(request, **kwargs)
+        # Total elapsed time of the request (approximately)
+        r.elapsed = datetime.utcnow() - start
+
+        # Response manipulation hooks
+        r = dispatch_hook('response', hooks, r, **kwargs)
+
+        # Persist cookies
+        if r.history:
+            # If the hooks create history then we want those cookies too
+            for resp in r.history:
+                extract_cookies_to_jar(self.cookies, resp.request, resp.raw)
+        extract_cookies_to_jar(self.cookies, request, r.raw)
+
+        # Redirect resolving generator.
+        gen = self.resolve_redirects(r, request, stream=stream,
+                                     timeout=timeout, verify=verify, cert=cert,
+                                     proxies=proxies)
+
+        # Resolve redirects if allowed.
+        history = [resp for resp in gen] if allow_redirects else []
+
+        # Shuffle things around if there's history.
+        if history:
+            # Insert the first (original) request at the start
+            history.insert(0, r)
+            # Get the last request made
+            r = history.pop()
+            r.history = tuple(history)
+
+        return r
+
+    def get_adapter(self, url):
+        """Returns the appropriate connnection adapter for the given URL."""
+        for (prefix, adapter) in self.adapters.items():
+
+            if url.lower().startswith(prefix):
+                return adapter
+
+        # Nothing matches :-/
+        raise InvalidSchema("No connection adapters were found for '%s'" % url)
+
+    def close(self):
+        """Closes all adapters and as such the session"""
+        for v in self.adapters.values():
+            v.close()
+
+    def mount(self, prefix, adapter):
+        """Registers a connection adapter to a prefix.
+
+        Adapters are sorted in descending order by key length."""
+        self.adapters[prefix] = adapter
+        keys_to_move = [k for k in self.adapters if len(k) < len(prefix)]
+        for key in keys_to_move:
+            self.adapters[key] = self.adapters.pop(key)
+
+    def __getstate__(self):
+        return dict((attr, getattr(self, attr, None)) for attr in self.__attrs__)
+
+    def __setstate__(self, state):
+        for attr, value in state.items():
+            setattr(self, attr, value)
+
+
+def session():
+    """Returns a :class:`Session` for context-management."""
+
+    return Session()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/status_codes.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/status_codes.py
new file mode 100644
index 0000000..ed7a866
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/status_codes.py
@@ -0,0 +1,88 @@
+# -*- coding: utf-8 -*-
+
+from .structures import LookupDict
+
+_codes = {
+
+    # Informational.
+    100: ('continue',),
+    101: ('switching_protocols',),
+    102: ('processing',),
+    103: ('checkpoint',),
+    122: ('uri_too_long', 'request_uri_too_long'),
+    200: ('ok', 'okay', 'all_ok', 'all_okay', 'all_good', '\\o/', '✓'),
+    201: ('created',),
+    202: ('accepted',),
+    203: ('non_authoritative_info', 'non_authoritative_information'),
+    204: ('no_content',),
+    205: ('reset_content', 'reset'),
+    206: ('partial_content', 'partial'),
+    207: ('multi_status', 'multiple_status', 'multi_stati', 'multiple_stati'),
+    208: ('already_reported',),
+    226: ('im_used',),
+
+    # Redirection.
+    300: ('multiple_choices',),
+    301: ('moved_permanently', 'moved', '\\o-'),
+    302: ('found',),
+    303: ('see_other', 'other'),
+    304: ('not_modified',),
+    305: ('use_proxy',),
+    306: ('switch_proxy',),
+    307: ('temporary_redirect', 'temporary_moved', 'temporary'),
+    308: ('resume_incomplete', 'resume'),
+
+    # Client Error.
+    400: ('bad_request', 'bad'),
+    401: ('unauthorized',),
+    402: ('payment_required', 'payment'),
+    403: ('forbidden',),
+    404: ('not_found', '-o-'),
+    405: ('method_not_allowed', 'not_allowed'),
+    406: ('not_acceptable',),
+    407: ('proxy_authentication_required', 'proxy_auth', 'proxy_authentication'),
+    408: ('request_timeout', 'timeout'),
+    409: ('conflict',),
+    410: ('gone',),
+    411: ('length_required',),
+    412: ('precondition_failed', 'precondition'),
+    413: ('request_entity_too_large',),
+    414: ('request_uri_too_large',),
+    415: ('unsupported_media_type', 'unsupported_media', 'media_type'),
+    416: ('requested_range_not_satisfiable', 'requested_range', 'range_not_satisfiable'),
+    417: ('expectation_failed',),
+    418: ('im_a_teapot', 'teapot', 'i_am_a_teapot'),
+    422: ('unprocessable_entity', 'unprocessable'),
+    423: ('locked',),
+    424: ('failed_dependency', 'dependency'),
+    425: ('unordered_collection', 'unordered'),
+    426: ('upgrade_required', 'upgrade'),
+    428: ('precondition_required', 'precondition'),
+    429: ('too_many_requests', 'too_many'),
+    431: ('header_fields_too_large', 'fields_too_large'),
+    444: ('no_response', 'none'),
+    449: ('retry_with', 'retry'),
+    450: ('blocked_by_windows_parental_controls', 'parental_controls'),
+    451: ('unavailable_for_legal_reasons', 'legal_reasons'),
+    499: ('client_closed_request',),
+
+    # Server Error.
+    500: ('internal_server_error', 'server_error', '/o\\', '✗'),
+    501: ('not_implemented',),
+    502: ('bad_gateway',),
+    503: ('service_unavailable', 'unavailable'),
+    504: ('gateway_timeout',),
+    505: ('http_version_not_supported', 'http_version'),
+    506: ('variant_also_negotiates',),
+    507: ('insufficient_storage',),
+    509: ('bandwidth_limit_exceeded', 'bandwidth'),
+    510: ('not_extended',),
+}
+
+codes = LookupDict(name='status_codes')
+
+for (code, titles) in list(_codes.items()):
+    for title in titles:
+        setattr(codes, title, code)
+        if not title.startswith('\\'):
+            setattr(codes, title.upper(), code)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/structures.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/structures.py
new file mode 100644
index 0000000..a175913
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/structures.py
@@ -0,0 +1,128 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.structures
+~~~~~~~~~~~~~~~~~~~
+
+Data structures that power Requests.
+
+"""
+
+import os
+import collections
+from itertools import islice
+
+
+class IteratorProxy(object):
+    """docstring for IteratorProxy"""
+    def __init__(self, i):
+        self.i = i
+        # self.i = chain.from_iterable(i)
+
+    def __iter__(self):
+        return self.i
+
+    def __len__(self):
+        if hasattr(self.i, '__len__'):
+            return len(self.i)
+        if hasattr(self.i, 'len'):
+            return self.i.len
+        if hasattr(self.i, 'fileno'):
+            return os.fstat(self.i.fileno()).st_size
+
+    def read(self, n):
+        return "".join(islice(self.i, None, n))
+
+
+class CaseInsensitiveDict(collections.MutableMapping):
+    """
+    A case-insensitive ``dict``-like object.
+
+    Implements all methods and operations of
+    ``collections.MutableMapping`` as well as dict's ``copy``. Also
+    provides ``lower_items``.
+
+    All keys are expected to be strings. The structure remembers the
+    case of the last key to be set, and ``iter(instance)``,
+    ``keys()``, ``items()``, ``iterkeys()``, and ``iteritems()``
+    will contain case-sensitive keys. However, querying and contains
+    testing is case insensitive:
+
+        cid = CaseInsensitiveDict()
+        cid['Accept'] = 'application/json'
+        cid['aCCEPT'] == 'application/json'  # True
+        list(cid) == ['Accept']  # True
+
+    For example, ``headers['content-encoding']`` will return the
+    value of a ``'Content-Encoding'`` response header, regardless
+    of how the header name was originally stored.
+
+    If the constructor, ``.update``, or equality comparison
+    operations are given keys that have equal ``.lower()``s, the
+    behavior is undefined.
+
+    """
+    def __init__(self, data=None, **kwargs):
+        self._store = dict()
+        if data is None:
+            data = {}
+        self.update(data, **kwargs)
+
+    def __setitem__(self, key, value):
+        # Use the lowercased key for lookups, but store the actual
+        # key alongside the value.
+        self._store[key.lower()] = (key, value)
+
+    def __getitem__(self, key):
+        return self._store[key.lower()][1]
+
+    def __delitem__(self, key):
+        del self._store[key.lower()]
+
+    def __iter__(self):
+        return (casedkey for casedkey, mappedvalue in self._store.values())
+
+    def __len__(self):
+        return len(self._store)
+
+    def lower_items(self):
+        """Like iteritems(), but with all lowercase keys."""
+        return (
+            (lowerkey, keyval[1])
+            for (lowerkey, keyval)
+            in self._store.items()
+        )
+
+    def __eq__(self, other):
+        if isinstance(other, collections.Mapping):
+            other = CaseInsensitiveDict(other)
+        else:
+            return NotImplemented
+        # Compare insensitively
+        return dict(self.lower_items()) == dict(other.lower_items())
+
+    # Copy is required
+    def copy(self):
+        return CaseInsensitiveDict(self._store.values())
+
+    def __repr__(self):
+        return '%s(%r)' % (self.__class__.__name__, dict(self.items()))
+
+
+class LookupDict(dict):
+    """Dictionary lookup object."""
+
+    def __init__(self, name=None):
+        self.name = name
+        super(LookupDict, self).__init__()
+
+    def __repr__(self):
+        return '<lookup \'%s\'>' % (self.name)
+
+    def __getitem__(self, key):
+        # We allow fall-through here, so values default to None
+
+        return self.__dict__.get(key, None)
+
+    def get(self, key, default=None):
+        return self.__dict__.get(key, default)
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/utils.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/utils.py
new file mode 100644
index 0000000..3ec6131
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/requests/utils.py
@@ -0,0 +1,571 @@
+# -*- coding: utf-8 -*-
+
+"""
+requests.utils
+~~~~~~~~~~~~~~
+
+This module provides utility functions that are used within Requests
+that are also useful for external consumption.
+
+"""
+
+import cgi
+import codecs
+import collections
+import os
+import platform
+import re
+import sys
+from netrc import netrc, NetrcParseError
+
+from . import __version__
+from . import certs
+from .compat import parse_http_list as _parse_list_header
+from .compat import (quote, urlparse, bytes, str, OrderedDict, urlunparse,
+                     is_py2, is_py3, builtin_str, getproxies, proxy_bypass)
+from .cookies import RequestsCookieJar, cookiejar_from_dict
+from .structures import CaseInsensitiveDict
+from .exceptions import MissingSchema, InvalidURL
+
+_hush_pyflakes = (RequestsCookieJar,)
+
+NETRC_FILES = ('.netrc', '_netrc')
+
+DEFAULT_CA_BUNDLE_PATH = certs.where()
+
+
+def dict_to_sequence(d):
+    """Returns an internal sequence dictionary update."""
+
+    if hasattr(d, 'items'):
+        d = d.items()
+
+    return d
+
+
+def super_len(o):
+    if hasattr(o, '__len__'):
+        return len(o)
+    if hasattr(o, 'len'):
+        return o.len
+    if hasattr(o, 'fileno'):
+        return os.fstat(o.fileno()).st_size
+
+
+def get_netrc_auth(url):
+    """Returns the Requests tuple auth for a given url from netrc."""
+
+    try:
+        locations = (os.path.expanduser('~/{0}'.format(f)) for f in NETRC_FILES)
+        netrc_path = None
+
+        for loc in locations:
+            if os.path.exists(loc) and not netrc_path:
+                netrc_path = loc
+
+        # Abort early if there isn't one.
+        if netrc_path is None:
+            return netrc_path
+
+        ri = urlparse(url)
+
+        # Strip port numbers from netloc
+        host = ri.netloc.split(':')[0]
+
+        try:
+            _netrc = netrc(netrc_path).authenticators(host)
+            if _netrc:
+                # Return with login / password
+                login_i = (0 if _netrc[0] else 1)
+                return (_netrc[login_i], _netrc[2])
+        except (NetrcParseError, IOError):
+            # If there was a parsing error or a permissions issue reading the file,
+            # we'll just skip netrc auth
+            pass
+
+    # AppEngine hackiness.
+    except (ImportError, AttributeError):
+        pass
+
+
+def guess_filename(obj):
+    """Tries to guess the filename of the given object."""
+    name = getattr(obj, 'name', None)
+    if name and name[0] != '<' and name[-1] != '>':
+        return os.path.basename(name)
+
+
+def from_key_val_list(value):
+    """Take an object and test to see if it can be represented as a
+    dictionary. Unless it can not be represented as such, return an
+    OrderedDict, e.g.,
+
+    ::
+
+        >>> from_key_val_list([('key', 'val')])
+        OrderedDict([('key', 'val')])
+        >>> from_key_val_list('string')
+        ValueError: need more than 1 value to unpack
+        >>> from_key_val_list({'key': 'val'})
+        OrderedDict([('key', 'val')])
+    """
+    if value is None:
+        return None
+
+    if isinstance(value, (str, bytes, bool, int)):
+        raise ValueError('cannot encode objects that are not 2-tuples')
+
+    return OrderedDict(value)
+
+
+def to_key_val_list(value):
+    """Take an object and test to see if it can be represented as a
+    dictionary. If it can be, return a list of tuples, e.g.,
+
+    ::
+
+        >>> to_key_val_list([('key', 'val')])
+        [('key', 'val')]
+        >>> to_key_val_list({'key': 'val'})
+        [('key', 'val')]
+        >>> to_key_val_list('string')
+        ValueError: cannot encode objects that are not 2-tuples.
+    """
+    if value is None:
+        return None
+
+    if isinstance(value, (str, bytes, bool, int)):
+        raise ValueError('cannot encode objects that are not 2-tuples')
+
+    if isinstance(value, collections.Mapping):
+        value = value.items()
+
+    return list(value)
+
+
+# From mitsuhiko/werkzeug (used with permission).
+def parse_list_header(value):
+    """Parse lists as described by RFC 2068 Section 2.
+
+    In particular, parse comma-separated lists where the elements of
+    the list may include quoted-strings.  A quoted-string could
+    contain a comma.  A non-quoted string could have quotes in the
+    middle.  Quotes are removed automatically after parsing.
+
+    It basically works like :func:`parse_set_header` just that items
+    may appear multiple times and case sensitivity is preserved.
+
+    The return value is a standard :class:`list`:
+
+    >>> parse_list_header('token, "quoted value"')
+    ['token', 'quoted value']
+
+    To create a header from the :class:`list` again, use the
+    :func:`dump_header` function.
+
+    :param value: a string with a list header.
+    :return: :class:`list`
+    """
+    result = []
+    for item in _parse_list_header(value):
+        if item[:1] == item[-1:] == '"':
+            item = unquote_header_value(item[1:-1])
+        result.append(item)
+    return result
+
+
+# From mitsuhiko/werkzeug (used with permission).
+def parse_dict_header(value):
+    """Parse lists of key, value pairs as described by RFC 2068 Section 2 and
+    convert them into a python dict:
+
+    >>> d = parse_dict_header('foo="is a fish", bar="as well"')
+    >>> type(d) is dict
+    True
+    >>> sorted(d.items())
+    [('bar', 'as well'), ('foo', 'is a fish')]
+
+    If there is no value for a key it will be `None`:
+
+    >>> parse_dict_header('key_without_value')
+    {'key_without_value': None}
+
+    To create a header from the :class:`dict` again, use the
+    :func:`dump_header` function.
+
+    :param value: a string with a dict header.
+    :return: :class:`dict`
+    """
+    result = {}
+    for item in _parse_list_header(value):
+        if '=' not in item:
+            result[item] = None
+            continue
+        name, value = item.split('=', 1)
+        if value[:1] == value[-1:] == '"':
+            value = unquote_header_value(value[1:-1])
+        result[name] = value
+    return result
+
+
+# From mitsuhiko/werkzeug (used with permission).
+def unquote_header_value(value, is_filename=False):
+    r"""Unquotes a header value.  (Reversal of :func:`quote_header_value`).
+    This does not use the real unquoting but what browsers are actually
+    using for quoting.
+
+    :param value: the header value to unquote.
+    """
+    if value and value[0] == value[-1] == '"':
+        # this is not the real unquoting, but fixing this so that the
+        # RFC is met will result in bugs with internet explorer and
+        # probably some other browsers as well.  IE for example is
+        # uploading files with "C:\foo\bar.txt" as filename
+        value = value[1:-1]
+
+        # if this is a filename and the starting characters look like
+        # a UNC path, then just return the value without quotes.  Using the
+        # replace sequence below on a UNC path has the effect of turning
+        # the leading double slash into a single slash and then
+        # _fix_ie_filename() doesn't work correctly.  See #458.
+        if not is_filename or value[:2] != '\\\\':
+            return value.replace('\\\\', '\\').replace('\\"', '"')
+    return value
+
+
+def dict_from_cookiejar(cj):
+    """Returns a key/value dictionary from a CookieJar.
+
+    :param cj: CookieJar object to extract cookies from.
+    """
+
+    cookie_dict = {}
+
+    for cookie in cj:
+        cookie_dict[cookie.name] = cookie.value
+
+    return cookie_dict
+
+
+def add_dict_to_cookiejar(cj, cookie_dict):
+    """Returns a CookieJar from a key/value dictionary.
+
+    :param cj: CookieJar to insert cookies into.
+    :param cookie_dict: Dict of key/values to insert into CookieJar.
+    """
+
+    cj2 = cookiejar_from_dict(cookie_dict)
+    cj.update(cj2)
+    return cj
+
+
+def get_encodings_from_content(content):
+    """Returns encodings from given content string.
+
+    :param content: bytestring to extract encodings from.
+    """
+
+    charset_re = re.compile(r'<meta.*?charset=["\']*(.+?)["\'>]', flags=re.I)
+    pragma_re = re.compile(r'<meta.*?content=["\']*;?charset=(.+?)["\'>]', flags=re.I)
+    xml_re = re.compile(r'^<\?xml.*?encoding=["\']*(.+?)["\'>]')
+
+    return (charset_re.findall(content) +
+            pragma_re.findall(content) +
+            xml_re.findall(content))
+
+
+def get_encoding_from_headers(headers):
+    """Returns encodings from given HTTP Header Dict.
+
+    :param headers: dictionary to extract encoding from.
+    """
+
+    content_type = headers.get('content-type')
+
+    if not content_type:
+        return None
+
+    content_type, params = cgi.parse_header(content_type)
+
+    if 'charset' in params:
+        return params['charset'].strip("'\"")
+
+    if 'text' in content_type:
+        return 'ISO-8859-1'
+
+
+def stream_decode_response_unicode(iterator, r):
+    """Stream decodes a iterator."""
+
+    if r.encoding is None:
+        for item in iterator:
+            yield item
+        return
+
+    decoder = codecs.getincrementaldecoder(r.encoding)(errors='replace')
+    for chunk in iterator:
+        rv = decoder.decode(chunk)
+        if rv:
+            yield rv
+    rv = decoder.decode(b'', final=True)
+    if rv:
+        yield rv
+
+
+def iter_slices(string, slice_length):
+    """Iterate over slices of a string."""
+    pos = 0
+    while pos < len(string):
+        yield string[pos:pos + slice_length]
+        pos += slice_length
+
+
+def get_unicode_from_response(r):
+    """Returns the requested content back in unicode.
+
+    :param r: Response object to get unicode content from.
+
+    Tried:
+
+    1. charset from content-type
+
+    2. every encodings from ``<meta ... charset=XXX>``
+
+    3. fall back and replace all unicode characters
+
+    """
+
+    tried_encodings = []
+
+    # Try charset from content-type
+    encoding = get_encoding_from_headers(r.headers)
+
+    if encoding:
+        try:
+            return str(r.content, encoding)
+        except UnicodeError:
+            tried_encodings.append(encoding)
+
+    # Fall back:
+    try:
+        return str(r.content, encoding, errors='replace')
+    except TypeError:
+        return r.content
+
+
+# The unreserved URI characters (RFC 3986)
+UNRESERVED_SET = frozenset(
+    "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz"
+    + "0123456789-._~")
+
+
+def unquote_unreserved(uri):
+    """Un-escape any percent-escape sequences in a URI that are unreserved
+    characters. This leaves all reserved, illegal and non-ASCII bytes encoded.
+    """
+    parts = uri.split('%')
+    for i in range(1, len(parts)):
+        h = parts[i][0:2]
+        if len(h) == 2 and h.isalnum():
+            try:
+                c = chr(int(h, 16))
+            except ValueError:
+                raise InvalidURL("Invalid percent-escape sequence: '%s'" % h)
+
+            if c in UNRESERVED_SET:
+                parts[i] = c + parts[i][2:]
+            else:
+                parts[i] = '%' + parts[i]
+        else:
+            parts[i] = '%' + parts[i]
+    return ''.join(parts)
+
+
+def requote_uri(uri):
+    """Re-quote the given URI.
+
+    This function passes the given URI through an unquote/quote cycle to
+    ensure that it is fully and consistently quoted.
+    """
+    # Unquote only the unreserved characters
+    # Then quote only illegal characters (do not quote reserved, unreserved,
+    # or '%')
+    return quote(unquote_unreserved(uri), safe="!#$%&'()*+,/:;=?@[]~")
+
+
+def get_environ_proxies(url):
+    """Return a dict of environment proxies."""
+
+    get_proxy = lambda k: os.environ.get(k) or os.environ.get(k.upper())
+
+    # First check whether no_proxy is defined. If it is, check that the URL
+    # we're getting isn't in the no_proxy list.
+    no_proxy = get_proxy('no_proxy')
+    netloc = urlparse(url).netloc
+
+    if no_proxy:
+        # We need to check whether we match here. We need to see if we match
+        # the end of the netloc, both with and without the port.
+        no_proxy = no_proxy.replace(' ', '').split(',')
+
+        for host in no_proxy:
+            if netloc.endswith(host) or netloc.split(':')[0].endswith(host):
+                # The URL does match something in no_proxy, so we don't want
+                # to apply the proxies on this URL.
+                return {}
+
+    # If the system proxy settings indicate that this URL should be bypassed,
+    # don't proxy.
+    if proxy_bypass(netloc):
+        return {}
+
+    # If we get here, we either didn't have no_proxy set or we're not going
+    # anywhere that no_proxy applies to, and the system settings don't require
+    # bypassing the proxy for the current URL.
+    return getproxies()
+
+
+def default_user_agent():
+    """Return a string representing the default user agent."""
+    _implementation = platform.python_implementation()
+
+    if _implementation == 'CPython':
+        _implementation_version = platform.python_version()
+    elif _implementation == 'PyPy':
+        _implementation_version = '%s.%s.%s' % (sys.pypy_version_info.major,
+                                                sys.pypy_version_info.minor,
+                                                sys.pypy_version_info.micro)
+        if sys.pypy_version_info.releaselevel != 'final':
+            _implementation_version = ''.join([_implementation_version, sys.pypy_version_info.releaselevel])
+    elif _implementation == 'Jython':
+        _implementation_version = platform.python_version()  # Complete Guess
+    elif _implementation == 'IronPython':
+        _implementation_version = platform.python_version()  # Complete Guess
+    else:
+        _implementation_version = 'Unknown'
+
+    try:
+        p_system = platform.system()
+        p_release = platform.release()
+    except IOError:
+        p_system = 'Unknown'
+        p_release = 'Unknown'
+
+    return " ".join(['python-requests/%s' % __version__,
+                     '%s/%s' % (_implementation, _implementation_version),
+                     '%s/%s' % (p_system, p_release)])
+
+
+def default_headers():
+    return CaseInsensitiveDict({
+        'User-Agent': default_user_agent(),
+        'Accept-Encoding': ', '.join(('gzip', 'deflate', 'compress')),
+        'Accept': '*/*'
+    })
+
+
+def parse_header_links(value):
+    """Return a dict of parsed link headers proxies.
+
+    i.e. Link: <http:/.../front.jpeg>; rel=front; type="image/jpeg",<http://.../back.jpeg>; rel=back;type="image/jpeg"
+
+    """
+
+    links = []
+
+    replace_chars = " '\""
+
+    for val in value.split(","):
+        try:
+            url, params = val.split(";", 1)
+        except ValueError:
+            url, params = val, ''
+
+        link = {}
+
+        link["url"] = url.strip("<> '\"")
+
+        for param in params.split(";"):
+            try:
+                key, value = param.split("=")
+            except ValueError:
+                break
+
+            link[key.strip(replace_chars)] = value.strip(replace_chars)
+
+        links.append(link)
+
+    return links
+
+
+# Null bytes; no need to recreate these on each call to guess_json_utf
+_null = '\x00'.encode('ascii')  # encoding to ASCII for Python 3
+_null2 = _null * 2
+_null3 = _null * 3
+
+
+def guess_json_utf(data):
+    # JSON always starts with two ASCII characters, so detection is as
+    # easy as counting the nulls and from their location and count
+    # determine the encoding. Also detect a BOM, if present.
+    sample = data[:4]
+    if sample in (codecs.BOM_UTF32_LE, codecs.BOM32_BE):
+        return 'utf-32'     # BOM included
+    if sample[:3] == codecs.BOM_UTF8:
+        return 'utf-8-sig'  # BOM included, MS style (discouraged)
+    if sample[:2] in (codecs.BOM_UTF16_LE, codecs.BOM_UTF16_BE):
+        return 'utf-16'     # BOM included
+    nullcount = sample.count(_null)
+    if nullcount == 0:
+        return 'utf-8'
+    if nullcount == 2:
+        if sample[::2] == _null2:   # 1st and 3rd are null
+            return 'utf-16-be'
+        if sample[1::2] == _null2:  # 2nd and 4th are null
+            return 'utf-16-le'
+        # Did not detect 2 valid UTF-16 ascii-range characters
+    if nullcount == 3:
+        if sample[:3] == _null3:
+            return 'utf-32-be'
+        if sample[1:] == _null3:
+            return 'utf-32-le'
+        # Did not detect a valid UTF-32 ascii-range character
+    return None
+
+
+def except_on_missing_scheme(url):
+    """Given a URL, raise a MissingSchema exception if the scheme is missing.
+    """
+    scheme, netloc, path, params, query, fragment = urlparse(url)
+
+    if not scheme:
+        raise MissingSchema('Proxy URLs must have explicit schemes.')
+
+
+def get_auth_from_url(url):
+    """Given a url with authentication components, extract them into a tuple of
+    username,password."""
+    if url:
+        parsed = urlparse(url)
+        return (parsed.username, parsed.password)
+    else:
+        return ('', '')
+
+
+def to_native_string(string, encoding='ascii'):
+    """
+    Given a string object, regardless of type, returns a representation of that
+    string in the native string type, encoding and decoding where necessary.
+    This assumes ASCII unless told otherwise.
+    """
+    out = None
+
+    if isinstance(string, builtin_str):
+        out = string
+    else:
+        if is_py2:
+            out = string.encode(encoding)
+        else:
+            out = string.decode(encoding)
+
+    return out
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/softimage.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/softimage.py
new file mode 100644
index 0000000..aa51ffd
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/softimage.py
@@ -0,0 +1,308 @@
+'''
+    Wrappers and helper classes to work with Softimage.
+'''
+from win32com.client import constants as const
+import win32com
+STR_CODEC = 'utf-8'
+xsi = win32com.client.Dispatch('XSI.Application')
+xsiui = win32com.client.Dispatch('XSI.UIToolkit')
+xsimath = win32com.client.Dispatch('XSI.Math')
+
+
+class SoftimageError(Exception):
+    def __init__(self, value):
+        self.value = value
+
+    def __repr__(self):
+        return 'SofimageError: {0}'.format(self.value)
+
+
+class Softimage(object):
+    @staticmethod
+    def get_objects(name):
+        xsifact = win32com.client.Dispatch('XSI.Factory')
+        collection = xsifact.CreateObject('XSI.Collection')
+        collection.items = name
+        if collection.Count > 0:
+            return list(collection)
+        return ()
+
+    @staticmethod
+    def get_object(name):
+        try:
+            return xsi.Dictionary.GetObject(name)
+        except win32com.client.pythoncom.com_error:
+            print 'COM ERROR'
+            return None
+
+    @staticmethod
+    def get_plugin_origin(plugin_name):
+        xsi = win32com.client.Dispatch('XSI.Application')
+        plugins = xsi.Plugins
+        for plugin in plugins:
+            if plugin.Name == plugin_name:
+                return plugin.OriginPath[:-20]
+
+    @staticmethod
+    def msg(message, msg_type=const.siMsgOkOnly, caption='Information'):
+        return xsiui.MsgBox(message, msg_type, caption)
+
+    @classmethod
+    def get_all_children(cls, root):
+        '''Recursively adds children to a list.'''
+        children = []
+        children.append(root)
+        if root.Children(0):
+            chldrn = list(root.Children)
+            for child in chldrn:
+                children.extend(cls.get_all_children(child))
+        return children
+
+    @staticmethod
+    def get_playcontrol():
+        return xsi.Dictionary.GetObject('PlayControl')
+
+
+class SIScene(object):
+    def get_playcontrol(self):
+        return xsi.Dictionary.GetObject('PlayControl')
+
+    def get_name(self):
+        return xsi.ActiveProject.ActiveScene.Name
+
+    def wirecol(self, r, g, b):
+        wr = int(round(r * 7)) << 1
+        wg = int(round(g * 7)) << 4
+        wb = int(round(b * 7)) << 7
+        return wr + wg + wb
+
+
+class SIModel(object):
+    def __init__(self, si_model):
+        self.si_model = si_model
+        self.geo = si_model.ActivePrimitive.GetGeometry2(0)
+
+    def get_geo(self, model):
+        if model:
+            return model.ActivePrimitive.GetGeometry2(0)
+        else:
+            return self.si_model.ActivePrimitive.GetGeometry2(0)
+
+    def get_uv_props(self):
+        cls = self.si_model.ActivePrimitive.GetGeometry2(0).Clusters
+        sample = cls.Filter('sample')
+        for cls in sample:
+            props = cls.Properties.Filter('uvspace')
+            if props.Count >= 1:
+                return props
+
+    def get_normal_props(self):
+        clusters = self.geo.Clusters.Filter('sample')
+        for cluster in clusters:
+            normal_clusters = cluster.Properties.Filter('normal')
+            if normal_clusters.Count >= 1:
+                return normal_clusters
+
+    def set_normals(self, index, normals):
+        prop = self.get_normal_props()[index]
+        prop.Elements.Array = normals
+
+    def get_envelope_props(self):
+        pnt_clusters = self.geo.Clusters.Filter('pnt')
+        for cluster in pnt_clusters:
+            properties = cluster.Properties
+            weight_props = properties.Filter('envweights')
+            if weight_props.Count >= 1:
+                return weight_props
+
+    def get_vertex_color_props(self):
+        cls = self.si_model.ActivePrimitive.GetGeometry2(0).Clusters
+        sample = cls.Filter('sample')
+        for cls in sample:
+            props = cls.Properties.Filter('vertexcolor')
+            if props.Count >= 1:
+                return props
+
+    def set_weights(self, index, weights):
+        prop = self.get_envelope_props()[index]
+        prop.Elements.Array = weights
+        return True
+
+    def set_uvs(self, index, uvs):
+        prop = self.get_uv_props()[index]
+        prop.Elements.Array = uvs
+        return True
+
+    def set_vertex_colors(self, index, colors):
+        prop = self.get_vertex_color_props()[index]
+        prop.Elements.Array = colors
+        return True
+
+    def get_vis(self, model):
+        vis = model.Properties.Filter('visibility')
+        prop = vis[0]
+        val = prop.viewvis.Value
+        if val:
+            return True
+        return False
+
+    def get_transform_quat(self, model):
+        transform = model.Kinematics.Local.Transform
+        quat = xsimath.CreateQuaternion()
+        transform.GetRotationQuaternion(quat)
+        sca = transform.SclX, transform.SclY, transform.SclZ
+        rot = quat.X, quat.Y, quat.Z, quat.W
+        tra = transform.PosX, transform.PosY, transform.PosZ
+        return tra, rot, sca
+
+    def is_uved(self):
+        sample_clusters = self.geo.Clusters.Filter('sample')
+        for cls in sample_clusters:
+            props = cls.Properties
+            uv_props = props.Filter('uvspace')
+            if uv_props.Count > 0:
+                return True
+
+    def is_colored(self):
+        sample_clusters = self.geo.Clusters.Filter('sample')
+        for cls in sample_clusters:
+            props = cls.Properties
+            vcol_props = props.Filter('vertexcolor')
+            if vcol_props.Count > 0:
+                return True
+
+    def is_weighted(self):
+        pnt_clusters = self.geo.Clusters.Filter('pnt')
+        for cluster in pnt_clusters:
+            properties = cluster.Properties
+            weight_props = properties.Filter('envweights')
+            if weight_props.Count > 0:
+                return True
+
+
+class SIMaterial(object):
+    def get_clip_source_name(self, clip):
+        src = clip.Source
+        filename = src.Parameters('FileName').Value
+        filename_list = filename.split('\\')
+        return filename_list[-1].encode(STR_CODEC)
+
+    def get_shader_color(self, shader, color):
+        col = shader.Parameters(color).Value
+        return col.Red, col.Green, col.Blue, col.Alpha
+
+
+class SIGeneral(object):
+    @staticmethod
+    def get_plugin_origin(plugin_name):
+        xsi = win32com.client.Dispatch('XSI.Application')
+        plugins = xsi.Plugins
+        for plugin in plugins:
+            if plugin.Name == plugin_name:
+                return plugin.OriginPath[:-20]
+
+    def get_objects_by_name(self, modelnames):
+        models = []
+        for name in modelnames:
+            xsifact = win32com.client.Dispatch('XSI.Factory')
+            collection = xsifact.CreateObject('XSI.Collection')
+            collection.items = name
+            models.append(collection(0))
+        return models
+
+    def msg(self, message, msg_type=const.siMsgOkOnly, plugin='XSIZETools'):
+        return xsiui.MsgBox(message, msg_type, plugin)
+
+    def get_obj_by_name(self, name):
+        xsifact = win32com.client.Dispatch('XSI.Factory')
+        collection = xsifact.CreateObject('XSI.Collection')
+        collection.items = name
+        if collection.count == 1:
+            return collection(0)
+
+    def check_existence(self, name):
+        xsifact = win32com.client.Dispatch('XSI.Factory')
+        collection = xsifact.CreateObject('XSI.Collection')
+        collection.items = name
+        return collection.Count
+
+    def get_main_material_name(self, obj):
+        if obj.Material:
+            return obj.Material.Name
+        return 'Scene_Material'
+
+    def get_all_children(self, root):
+        if root:
+            return self._get_all_children(root)
+        else:
+            return None
+
+    def _get_all_children(self, root):
+        '''Recursively adds children to a list.'''
+        children = []
+        children.append(root)
+        if root.Children(0):
+            chldrn = list(root.Children)
+            for child in chldrn:
+                children.extend(self.get_all_children(child))
+        return children
+
+    def unique_materials(self, obj_list):
+        materials = self.all_materials(obj_list)
+        unique = []
+        unique_names = []
+        for mat in materials:
+            if mat.Name not in unique_names:
+                unique.append(mat)
+                unique_names.append(mat.Name)
+        return unique
+
+    def all_materials(self, obj_list):
+        materials = []
+        for obj in obj_list:
+            # Non-polymsh objects sometimes dont have a
+            # material, so just ignore them.
+            if obj.Type != 'polymsh':
+                continue
+            geo = obj.ActivePrimitive.GetGeometry2(0)
+            if obj.Material:
+                materials.append(obj.Material)
+            else:
+                materials.append('Scene_Material')
+            for cls in geo.Clusters:
+                if cls.Material:
+                    materials.append(cls.Material)
+        return materials
+
+    def material_name_dict(self):
+        dict_ = {}
+        lib = self.xsi.ActiveProject.ActiveScene.MaterialLibraries[0]
+        for mat in lib.Items:
+            dict_[mat.Name] = mat
+        return dict_
+
+
+class SIProgressBar(object):
+    def __init__(self):
+        self.bar = xsiui.ProgressBar
+
+    def show(self):
+        self.bar.Visible = True
+
+    def hide(self):
+        self.bar.Visible = False
+
+    def set(self, maximum, capt, val=0, step=1):
+        self.bar.Value = val
+        if maximum:
+            self.bar.Maximum = maximum
+        else:
+            self.bar.Maximum = 1
+        self.bar.Caption = capt
+        self.bar.Step = step
+
+    def setc(self, capt):
+        self.bar.Caption = capt
+
+    def inc(self):
+        self.bar.Increment()
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Modules/utils.py b/src_research_readme/zero-edit-tool-python-base/Application/Modules/utils.py
new file mode 100644
index 0000000..d09a584
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Modules/utils.py
@@ -0,0 +1,51 @@
+'''
+    Misc utilities.
+'''
+
+def add_cloth_property(model):
+    import softimage
+    reload(softimage)
+    import win32com
+    from win32com.client import constants as const
+    ps = model.AddProperty('CustomProperty', False, 'ZECloth')
+    ps.AddParameter3('collisions', const.siString)
+    ps.AddParameter3('texture', const.siString)
+    ps.AddParameter3('fixedcluster', const.siString)
+    ps.AddParameter3('modelname', const.siString, model.Name)
+    lay = ps.PPGLayout
+    lay.SetAttribute(const.siUILogicFile, softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Application\\Logic\\cloth.py')
+    lay.Language = 'pythonscript'
+    arow = lay.AddRow
+    erow = lay.EndRow
+    agr = lay.AddGroup
+    egr = lay.EndGroup
+    item = lay.AddItem
+    button = lay.AddButton
+
+    agr('Texture')
+    item('texture', 'Texture')
+    egr()
+    agr('Collision')
+    item('collisions', 'Collisions')
+    arow()
+    # button('pick_coll', 'Pick Collisions')
+    button('add_coll', 'Add from Selection')
+    button('select_coll', 'Add to Selection')
+    button('remove_coll', 'Clear')
+    erow()
+    egr()
+    arow()
+    fixed_points_group = agr('Fixed Points', 1)
+    fixed_points_group.SetAttribute(const.siUIWidthPercentage, 20)
+    arow()
+    button('pick_fixed', 'Pick')
+    # button('add_fixed', 'Add Fixed Points')
+    button('remove_fixed', 'Clear')
+    erow()
+    egr()
+    remove_button = button('del_prop', 'Remove Cloth')
+    remove_button.SetAttribute(const.siUICY, 40)
+    remove_button.SetAttribute(const.siUIWidthPercentage, 80)
+    erow()
+
+    return ps
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Plugins/CGeoAccessorWrappers.32.dll b/src_research_readme/zero-edit-tool-python-base/Application/Plugins/CGeoAccessorWrappers.32.dll
new file mode 100644
index 0000000..b071937
Binary files /dev/null and b/src_research_readme/zero-edit-tool-python-base/Application/Plugins/CGeoAccessorWrappers.32.dll differ
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Plugins/CGeoAccessorWrappers.64.dll b/src_research_readme/zero-edit-tool-python-base/Application/Plugins/CGeoAccessorWrappers.64.dll
new file mode 100644
index 0000000..9a62cf0
Binary files /dev/null and b/src_research_readme/zero-edit-tool-python-base/Application/Plugins/CGeoAccessorWrappers.64.dll differ
diff --git a/src_research_readme/zero-edit-tool-python-base/Application/Plugins/XSIZETools.py b/src_research_readme/zero-edit-tool-python-base/Application/Plugins/XSIZETools.py
new file mode 100644
index 0000000..148464f
--- /dev/null
+++ b/src_research_readme/zero-edit-tool-python-base/Application/Plugins/XSIZETools.py
@@ -0,0 +1,912 @@
+'''
+    Definition of commands, menus and UI.
+'''
+import win32com.client
+from win32com.client import constants as const
+import sys
+import os
+from datetime import datetime
+tt = datetime.now
+
+xsi = Application
+uitk = XSIUIToolkit
+utils = XSIUtils
+
+ADDONPATH = xsi.InstallationPath(const.siUserAddonPath)
+
+OLD_VERSION_MSG = '''You are using an old version of XSIZETools ({0}.{1}.{2}), please update to the latest ({3}.{4}.{5}).
+Go to XSIZETools download page?'''
+
+UP_TO_DATE_MSG = '''Build up to date (local: {0}.{1}.{2}, remote: {3}.{4}.{5}).'''
+
+CHECK_VERSION_ERROR_MSG = 'Could not connect to github or timed out, version check not successful.'
+
+
+def add_to_path():
+    orig_path = get_origin()
+    corepath = os.path.join(orig_path, 'Application', 'Core')
+    if corepath not in sys.path:
+        sys.path.append(corepath)
+    modpath = os.path.join(orig_path, 'Application', 'Modules')
+    if modpath not in sys.path:
+        sys.path.append(modpath)
+
+
+def get_origin():
+    orig_path = ''
+    plugins = xsi.Plugins
+    for p in plugins:
+        if p.Name == 'XSIZETools':
+            orig_path = p.OriginPath[:-20]
+    return orig_path
+
+
+def check_version(quiet=False):
+    add_to_path()
+    import requests as req
+    import webbrowser
+    pb = uitk.ProgressBar
+    pb.Caption = 'Checking XSIZETools Version...'
+    pb.Visible = True
+    pb.Maximum = 1
+
+    origin = get_origin()
+    verdir = os.path.abspath(os.path.join(origin, 'xsizet.ver'))
+    with open(verdir, 'r') as fh:
+        local_major, local_minor, local_build = fh.readline().split('.')
+    try:
+        latest = req.get('http://raw.github.com/Schlechtwetterfront/xsizetools/master/xsizet.ver')
+    except (req.ConnectionError, req.Timeout):
+        if quiet:
+            pb.Visible = False
+            return
+        uitk.MsgBox(CHECK_VERSION_ERROR_MSG)
+        pb.Visible = False
+        return
+    major, minor, build = latest.text.split('.')
+    pb.Value = 1
+    if int(build) > int(local_build):
+        if uitk.MsgBox(OLD_VERSION_MSG.format(local_major, local_minor, local_build, major, minor, build), 4) == 6:
+            webbrowser.open('http://schlechtwetterfront.github.io/xsizetools/')
+    else:
+        if quiet:
+            pb.Visible = False
+            return
+        uitk.MsgBox(UP_TO_DATE_MSG.format(local_major, local_minor,
+                                          local_build, major, minor, build))
+    pb.Visible = False
+
+
+def XSILoadPlugin(in_reg):
+    in_reg.Author = 'Ande'
+    in_reg.Name = 'XSIZETools'
+    in_reg.Email = 'schlchtwtrfrnt@gmail.com'
+    in_reg.URL = 'http://schlechtwetterfront.github.io/xsizetools/'
+    in_reg.Major = 1
+    in_reg.Minor = 0
+
+    in_reg.RegisterMenu(const.siMenuMainTopLevelID, 'ZE Tools', False)
+    in_reg.RegisterCommand('XSIZETools', 'XSIZETools')
+    in_reg.RegisterCommand('ZETHelp', 'ZETHelp')
+    in_reg.RegisterCommand('ZETOpenWebsite', 'ZETOpenWebsite')
+    in_reg.RegisterCommand('MSHExport', 'MSHExport')
+    in_reg.RegisterCommand('MSHImport', 'MSHImport')
+    in_reg.RegisterCommand('MaterialEdit', 'MaterialEdit')
+    in_reg.RegisterCommand('ClothCreate', 'ClothCreate')
+    in_reg.RegisterCommand('EditCloth', 'EditCloth')
+    in_reg.RegisterCommand('OpenImportLog', 'OpenImportLog')
+    in_reg.RegisterCommand('OpenExportLog', 'OpenExportLog')
+    in_reg.RegisterCommand('MshJson', 'MshJson')
+    in_reg.RegisterCommand('ZETCheckVersion', 'ZETCheckVersion')
+
+    in_reg.RegisterEvent('ZEToolsStartupEvent', const.siOnStartup)
+    in_reg.RegisterTimerEvent('ZEToolsDelayedStartupEvent', 0, 1000)
+    eventtimer = xsi.EventInfos('ZEToolsDelayedStartupEvent')
+    eventtimer.Mute = True
+
+    add_to_path()
+    return True
+
+
+def XSIUnloadPlugin(in_reg):
+    return True
+
+
+def ZEToolsStartupEvent_OnEvent(in_ctxt):
+    evtimer = xsi.EventInfos('ZEToolsDelayedStartupEvent')
+    evtimer.Mute = False
+    return False
+
+
+def ZEToolsDelayedStartupEvent_OnEvent(in_ctxt):
+    from os.path import commonprefix
+    for p in xsi.Plugins:
+        if 'ZET' in p.Name:
+            if len(commonprefix((p.OriginPath, ADDONPATH))) < 15:
+                if uitk.MsgBox('''ZETools installed to the wrong directory.
+Current dir: {0}
+Should be: {1}
+Try to move ZETools to the right dir?'''.format(p.OriginPath, ADDONPATH), 4) == 6:
+                    import shutil
+                    srcpath = p.OriginPath.split('\\')
+                    srcpath = '\\'.join(srcpath[:-3])
+                    dstpath = ADDONPATH + '\\XSIZETools'
+                    shutil.copytree(srcpath, dstpath)
+                    shutil.rmtree(srcpath)
+                    uitk.MsgBox('''Moved dir to {0}.
+    ZETools should work now but it's advised to restart XSI.'''.format(dstpath))
+    return False
+
+
+def ZETools_Init(in_ctxt):
+    #define Menu
+    oMenu = in_ctxt.Source
+    oMenu.AddCommandItem('Scripts...', 'XSIZETools')
+    oMenu.AddCommandItem('Export .MSH...', 'MSHExport')
+    oMenu.AddCommandItem('Import .MSH...', 'MSHImport')
+    oMenu.AddCommandItem('Cloth...', 'EditCloth')
+    oMenu.AddCommandItem('Manage Materials...', 'MaterialEdit')
+    sub_menu2 = win32com.client.Dispatch(oMenu.AddItem('Misc Tools', const.siMenuItemSubmenu))
+    sub_menu2.AddCommandItem('MSH to TXT...', 'MshJson')
+    sub_menu2.AddCommandItem('Info...', 'ZETHelp')
+    sub_menu2.AddCommandItem('Help and Documentation', 'ZETOpenWebsite')
+    sub_menu2.AddCommandItem('Open Import Log', 'OpenImportLog')
+    sub_menu2.AddCommandItem('Open Export Log', 'OpenExportLog')
+    sub_menu2.AddCommandItem('Check Version', 'ZETCheckVersion')
+    return True
+
+
+def ZETOpenWebsite_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+
+    return True
+
+
+def ZETOpenWebsite_Execute():
+    import webbrowser
+    url = 'http://schlechtwetterfront.github.io/xsizetools/'
+    webbrowser.open_new_tab(url)
+    return True
+
+
+def ZETCheckVersion_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+    return True
+
+
+def ZETCheckVersion_Execute():
+    check_version()
+    return True
+
+
+def XSIZETools_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+
+    return True
+
+
+def XSIZETools_Execute():
+    add_to_path()
+    import softimage
+    reload(softimage)
+
+    ppgname = 'ZEScripts'  # custom property name
+    for x in xsi.ActiveSceneRoot.Properties:
+        if x.Name == ppgname:
+            xsi.DeleteObj(ppgname)
+
+    #create custom property
+    property_set = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, ppgname)
+
+    property_set.AddParameter3('addon_bone', const.siString, 1)
+    property_set.AddParameter3('addon_root_name', const.siString, 'AddonRoot')
+    property_set.AddParameter3('addon_is_shadowvolume', const.siBool, 0, '', '', 0)
+
+    property_set.AddParameter2('Logo', const.siString, '', None, None, None, None, const.siClassifUnknown, const.siPersistable)
+    layout = property_set.PPGLayout
+    layout.Clear()
+
+    layout.SetAttribute(const.siUILogicFile, softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Application\\Logic\\zetools.py')
+    layout.Language = 'pythonscript'
+
+    #layout.AddTab('Character Tools')
+
+    layout.AddGroup('Bone Tools', 1)
+    layout.AddButton('groupbones', 'Create Bone Group')
+    layout.EndGroup()
+
+    #layout.AddTab('Addon Tools')
+
+    layout.AddGroup('Addon Mesh Setup', 1)
+    layout.AddGroup('', 0)
+    name_control = layout.AddItem('addon_root_name', 'Addon Root Name')
+    name_control.SetAttribute('labelPercentage', 80)
+
+    bones = softimage.Softimage.get_objects('bone*')
+    # Create variants (display value/actual value).
+    if len(bones) > 0:
+        bone_variants = []
+        for bone in bones:
+            bone_variants.append(bone.Name)
+            bone_variants.append(bone.FullName)
+    else:
+        bone_variants = ('No bones found.', 1)
+    bone_control = layout.AddEnumControl('addon_bone', bone_variants, 'Addon Bone', const.siControlCombo)
+    bone_control.SetAttribute('labelPercentage', 80)
+    layout.EndGroup()
+    layout.AddRow()
+    layout.AddItem('addon_is_shadowvolume', 'Shadowvolume(sv_*)')
+    layout.AddButton('makeaddon', 'Create Hierarchy')
+    layout.AddButton('setmesh', 'Set As Addon Mesh')
+    layout.EndRow()
+    layout.EndGroup()
+
+    desk = xsi.Desktop.ActiveLayout
+    view = desk.CreateView('Property Panel', 'ZE Scripts')
+    view.BeginEdit()
+    view.Resize(400, 180)
+    view.SetAttributeValue('targetcontent', property_set.FullName)
+    view.EndEdit()
+    return True
+
+
+def ZETHelp_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+
+    return True
+
+
+def ZETHelp_Execute():
+    add_to_path()
+    import softimage
+    reload(softimage)
+    import zetcore
+    reload(zetcore)
+    #remove old custom property
+    for x in xsi.ActiveSceneRoot.Properties:
+        if x.Name == 'ZETH':
+            xsi.DeleteObj('ZETH')
+    currver = zetcore.get_current_version(softimage.Softimage.get_plugin_origin('XSIZETools') + '\\xsizet.ver')
+    pset = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'ZETH')
+    pset.AddParameter3('bitmap', const.siString)
+
+    lay = pset.PPGLayout
+    lay.SetAttribute(const.siUILogicFile, softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Application\\Logic\\misc.py')
+    lay.Language = 'pythonscript'
+
+    lay.AddGroup('XSIZETools', 1)
+    imagepath = softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Resources\\UI\\zetools_a2pandemic.bmp'
+    expbitmap = lay.AddEnumControl('bitmap', None, '', const.siControlBitmap)
+    expbitmap.SetAttribute(const.siUINoLabel, True)
+    expbitmap.SetAttribute(const.siUIFilePath, imagepath)
+    lay.AddRow()
+    lay.AddSpacer(90, 1)
+    lay.AddStaticText('Version {0}'.format('.'.join([str(item) for item in currver])))
+    lay.EndRow()
+    lay.AddRow()
+    lay.AddSpacer(60, 1)
+    lay.AddStaticText('Code Copyright (C) Benedikt Schatz')
+    lay.EndRow()
+    lay.AddRow()
+    lay.AddStaticText('      http://schlechtwetterfront.github.io/xsizetools/', 290)
+    lay.EndRow()
+    lay.EndGroup()
+    lay.AddGroup('Credits', 1)
+    lay.AddStaticText('Additional templates:' +
+                      '\n\tAceMastermind' +
+                      '\n\tDarthD.U.C.K.' +
+                      '\n\tFragMe!' +
+                      '\n\tpsych0fred')
+    lay.AddStaticText('Additional .msh research:' +
+                      '\n\tRileyman' +
+                      '\n\ttirpider' +
+                      '\n\tAceMastermind' +
+                      '\n\tFragMe!' +
+                      '\n\tRepSharpshooter')
+    lay.EndGroup()
+    lay.AddGroup('Help', 1)
+    lay.AddStaticText('For help, consult the XSIZETools homepage or' +
+                      '\npost a topic on gametoast.com.', 280)
+    lay.AddRow()
+    lay.AddStaticText('Website:', 80)
+    web = lay.AddButton('launch_website', 'Open Website in Browser')
+    web.SetAttribute(const.siUICX, 140)
+    lay.EndRow()
+    lay.AddRow()
+    lay.AddStaticText('Gametoast:', 80)
+    gt = lay.AddButton('launch_gt', 'Open GT in Browser')
+    gt.SetAttribute(const.siUICX, 140)
+    lay.EndRow()
+    lay.EndGroup()
+    lay.AddRow()
+    lay.AddStaticText('')
+    lay.AddButton('Close', 'Close')
+    lay.EndRow()
+
+    desk = xsi.Desktop.ActiveLayout
+    view = desk.CreateView('Property Panel', 'ZETools Info')
+    view.BeginEdit()
+    view.Resize(320, 540)
+    view.SetAttributeValue('targetcontent', pset.FullName)
+    view.EndEdit()
+
+    return True
+
+
+def MSHExport_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+    return True
+
+
+def MSHExport_Execute():
+    add_to_path()
+    import softimage
+    reload(softimage)
+    import zetcore
+    reload(zetcore)
+    for x in xsi.ActiveSceneRoot.Properties:
+        if x.Name == 'MSHExport':
+            xsi.DeleteObj('MSHExport')
+    settings = zetcore.load_settings('export')
+
+    pS = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'MSHExport')
+    pS.AddParameter3('path', const.siString, settings.get('path'))
+    pS.AddParameter3('expbit', const.siString, '')
+    pS.AddParameter3('overwrite', const.siBool, settings.get('overwrite'), '', '', 0, 0)
+    pS.AddParameter3('anim', const.siBool, settings.get('anim'), '', 0, 0, 0)  # last readonly
+    pS.AddParameter3('basepose', const.siBool, settings.get('basepose'), '', 0, 0)
+    pS.AddParameter3('rootname', const.siBool, settings.get('rootname'), '', 0, 0)
+    pS.AddParameter3('batch', const.siBool, settings.get('batch'), '', 0, 0)
+
+    pS.AddParameter3('show_finished_dialog', const.siBool, settings.get('show_finished_dialog'), '', '', 0, 0)
+
+    mLay = pS.PPGLayout
+    mLay.SetAttribute(const.siUILogicFile, softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Application\\Logic\\exporter.py')
+    mLay.Language = 'pythonscript'
+
+    mLay.AddGroup('Export MSH', 1)  # G0
+    mLay.AddRow()
+    ctrlgrp = mLay.AddGroup('', False)
+    ctrlgrp.SetAttribute(const.siUIWidthPercentage, 75)
+    mLay.AddRow()  # 6
+    mshPathI = mLay.AddItem('path', 'MSH File', const.siControlFilePath)
+    mshPathI.SetAttribute(const.siUINoLabel, 1)
+    mshPathI.SetAttribute(const.siUIFileFilter, 'MSH File (*.msh)|*.msh')
+    mshPathI.SetAttribute(const.siUIOpenFile, False)
+    mshPathI.SetAttribute(const.siUIFileMustExist, False)
+    mLay.EndRow()  # 6E
+
+    mLay.AddRow()  # 4
+
+    repgrp = mLay.AddGroup('Misc', 1)  # G2
+    repgrp.SetAttribute(const.siUIWidthPercentage, 30)
+    mLay.AddItem('overwrite', 'Auto-Overwrite')
+    mLay.AddItem('rootname', 'Use root model name for .msh filename')
+    mLay.AddItem('batch', 'Batch Export')
+    mLay.AddItem('show_finished_dialog', 'Show dialog on completion')
+    mLay.EndGroup()  # G2E
+
+    mLay.AddGroup('', 0)  # bbox and btns
+    mLay.AddGroup('Animation')  # G1
+    mLay.AddItem('anim', 'Export Animation')
+    mLay.AddItem('basepose', 'Current frame as Basepose')
+    mLay.EndGroup()  # G1E
+
+    mLay.AddRow()  # 0
+    mLay.AddGroup('', 0)  # G3
+    mLay.AddRow()  # 1
+    mLay.AddStaticText('')
+    csbtn = mLay.AddButton('check_sel', 'Check Sel')
+    csbtn.SetAttribute(const.siUICX, 80)
+    helpbtn = mLay.AddButton('help', 'Help')
+    helpbtn.SetAttribute(const.siUICX, 40)
+    mLay.EndRow()  # 1E
+    mLay.AddRow()  # 2
+    mLay.AddStaticText('')
+    storebtn = mLay.AddButton('store_flags', 'Store Flags')
+    storebtn.SetAttribute(const.siUICX, 80)
+    closebtn = mLay.AddButton('EClose', 'Close')
+    closebtn.SetAttribute(const.siUICX, 40)
+    mLay.EndRow()  # 2E
+    mLay.EndGroup()  # G3E
+    expgrp = mLay.AddGroup('', 0)  # G4
+    expgrp.SetAttribute(const.siUIWidthPercentage, 1)
+    mLay.AddRow()  # 3
+    exportbtn = mLay.AddButton('exportbutton', 'Export')
+    exportbtn.SetAttribute(const.siUICX, 75)
+    exportbtn.SetAttribute(const.siUICY, 45)
+    mLay.EndRow()  # 3E
+    mLay.EndGroup()  # G4E
+    mLay.EndRow()  # 0E
+    mLay.EndGroup()  # bbox and btn
+
+    mLay.EndRow()  # 4E
+    mLay.EndGroup()  # Controls
+    icongroup = mLay.AddGroup('', 0)
+    icongroup.SetAttribute('WidthPercentage', 1)
+    imagepath = softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Resources\\UI\\export_icon_zetools.bmp'
+    expbitmap = mLay.AddEnumControl('expbit', None, '', const.siControlBitmap)
+    expbitmap.SetAttribute(const.siUINoLabel, True)
+    expbitmap.SetAttribute(const.siUIFilePath, imagepath)
+    mLay.EndGroup()
+    mLay.EndRow()
+    mLay.EndGroup()  # G0E
+
+    desk = xsi.Desktop.ActiveLayout
+    view = desk.CreateView('Property Panel', 'MSH Export')
+    view.BeginEdit()
+    view.Resize(600, 200)
+    view.SetAttributeValue('targetcontent', pS.FullName)
+    view.EndEdit()
+    return True
+
+
+def MSHImport_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+    return True
+
+
+def MSHImport_Execute():
+    add_to_path()
+    import softimage
+    reload(softimage)
+    import zetcore
+    reload(zetcore)
+    for x in xsi.ActiveSceneRoot.Properties:
+        if x.Name == 'MSHImport':
+            xsi.DeleteObj('MSHImport')
+    settings = zetcore.load_settings('import')
+
+    pS = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'MSHImport')
+    pS.AddParameter3('path', const.siString, settings.get('path'))
+    tp = pS.AddParameter3('texpath', const.siString, settings.get('texpath'))
+    tp.SetCapabilityFlag(2, not settings.get('btexpath'))
+    pS.AddParameter3('btexpath', const.siBool, settings.get('btexpath'), '', '', 0, 0)
+    pS.AddParameter3('framerange', const.siBool, settings.get('framerange'), '', '', 0, 0)
+    pS.AddParameter3('applyonly', const.siBool, settings.get('applyonly'), '', '', 0, 0)
+    pS.AddParameter3('expbit', const.siString, '')
+    pS.AddParameter3('ignoreanim', const.siBool, settings.get('ignoreanim'), '', '', 0, 0)
+    pS.AddParameter3('log', const.siBool, settings.get('log'), '', '', 0, 0)
+    pS.AddParameter3('triangulate', const.siBool, settings.get('triangulate'), '', '', 0, 0)
+    pS.AddParameter3('ignoregeo', const.siBool, settings.get('ignoregeo'), '', '', 0, 0)
+    pS.AddParameter3('nullsize', const.siDouble, settings.get('nullsize'), 0.01, 5.0, 0, 0)
+    pS.AddParameter3('wirecol', const.siBool, settings.get('wirecol'), '', '', 0, 0)
+    pS.AddParameter3('hideeffs', const.siBool, settings.get('hideeffs'), '', '', 0, 0)
+    pS.AddParameter3('hideroots', const.siBool, settings.get('hideroots'), '', '', 0, 0)
+    pS.AddParameter3('weld', const.siBool, settings.get('weld'), '', '', 0, 0)
+
+    pS.AddParameter3('Rbone', const.siDouble, settings.get('Rbone'), 0.0, 1.0, 0, 0)
+    pS.AddParameter3('Gbone', const.siDouble, settings.get('Gbone'), 0.0, 1.0, 0, 0)
+    pS.AddParameter3('Bbone', const.siDouble, settings.get('Bbone'), 0.0, 1.0, 0, 0)
+
+    pS.AddParameter3('Rroot', const.siDouble, settings.get('Rroot'), 0.0, 1.0, 0, 0)
+    pS.AddParameter3('Groot', const.siDouble, settings.get('Groot'), 0.0, 1.0, 0, 0)
+    pS.AddParameter3('Broot', const.siDouble, settings.get('Broot'), 0.0, 1.0, 0, 0)
+
+    pS.AddParameter3('Reff', const.siDouble, settings.get('Reff'), 0.0, 1.0, 0, 0)
+    pS.AddParameter3('Geff', const.siDouble, settings.get('Geff'), 0.0, 1.0, 0, 0)
+    pS.AddParameter3('Beff', const.siDouble, settings.get('Beff'), 0.0, 1.0, 0, 0)
+
+    pS.AddParameter3('show_finished_dialog', const.siBool, settings.get('show_finished_dialog'), '', '', 0, 0)
+
+    mLay = pS.PPGLayout
+    mLay.SetAttribute(const.siUILogicFile, softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Application\\Logic\\importer.py')
+    mLay.Language = 'pythonscript'
+
+    mLay.AddTab('Import')
+    mLay.AddGroup('Import MSH', 1)  # G0
+    mLay.AddRow()
+    ctrlgrp = mLay.AddGroup('', False)
+    ctrlgrp.SetAttribute(const.siUIWidthPercentage, 75)
+    mLay.AddRow()  # 6
+    mshPathI = mLay.AddItem('path', 'MSH File', const.siControlFilePath)
+    mshPathI.SetAttribute(const.siUINoLabel, 1)
+    mshPathI.SetAttribute(const.siUIFileFilter, 'MSH File (*.msh)|*.msh')
+    mshPathI.SetAttribute(const.siUIOpenFile, True)
+    mshPathI.SetAttribute(const.siUIFileMustExist, True)
+    mLay.EndRow()  # 6E
+
+    mLay.AddRow()
+    btp = mLay.AddItem('btexpath', 'Texture Folder')
+    #btp.SetAttribute(const.siUINoLabel, 1)
+    btp.SetAttribute(const.siUIWidthPercentage, 1)
+    texPathI = mLay.AddItem('texpath', 'Texture Folder', const.siControlFolder)
+    texPathI.SetAttribute(const.siUINoLabel, 1)
+    texPathI.SetAttribute(const.siUIWidthPercentage, 55)
+    mLay.EndRow()
+
+    mLay.AddRow()  # 4
+
+    repgrp = mLay.AddGroup('Misc', 1)  # G2
+    repgrp.SetAttribute(const.siUIWidthPercentage, 35)
+    mLay.AddItem('framerange', 'Set Frame Range')
+    mLay.AddItem('applyonly', 'Apply animation to selected hierarchy')
+    mLay.Additem('nullsize', 'Null Display Size')
+    mLay.EndGroup()  # G2E
+
+    bboxg = mLay.AddGroup('', 0)  # bbox and btns
+    bboxg.SetAttribute(const.siUIWidthPercentage, 50)
+    mLay.AddGroup('Ignore')  # G1
+    mLay.Additem('ignoregeo', 'Ignore Geometry')
+    mLay.Additem('ignoreanim', 'Ignore Animation')
+    mLay.EndGroup()  # G1E
+
+    mLay.AddRow()  # 0
+    mLay.AddGroup('', 0)  # G3
+    mLay.AddRow()  # 1
+    mLay.AddStaticText('')
+    helpbtn = mLay.AddButton('help', 'Help')
+    helpbtn.SetAttribute(const.siUICX, 40)
+    mLay.EndRow()  # 1E
+    mLay.AddRow()  # 2
+    mLay.AddStaticText('')
+    storebtn = mLay.AddButton('store_flags', 'Store Flags')
+    storebtn.SetAttribute(const.siUICX, 80)
+    closebtn = mLay.AddButton('EClose', 'Close')
+    closebtn.SetAttribute(const.siUICX, 40)
+    mLay.EndRow()  # 2E
+    mLay.EndGroup()  # G3E
+    expgrp = mLay.AddGroup('', 0)  # G4
+    expgrp.SetAttribute(const.siUIWidthPercentage, 1)
+    mLay.AddRow()  # 3
+    exportbtn = mLay.AddButton('importbutton', 'Import')
+    exportbtn.SetAttribute(const.siUICX, 75)
+    exportbtn.SetAttribute(const.siUICY, 45)
+    mLay.EndRow()  # 3E
+    mLay.EndGroup()  # G4E
+    mLay.EndRow()  # 0E
+    mLay.EndGroup()  # bbox and btn
+
+    mLay.EndRow()  # 4E
+    mLay.EndGroup()  # Controls
+    icongroup = mLay.AddGroup('', 0)
+    icongroup.SetAttribute('WidthPercentage', 1)
+    imagepath = softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Resources\\UI\\import_icon_zetools.bmp'
+    expbitmap = mLay.AddEnumControl('expbit', None, '', const.siControlBitmap)
+    expbitmap.SetAttribute(const.siUINoLabel, True)
+    expbitmap.SetAttribute(const.siUIFilePath, imagepath)
+    mLay.EndGroup()
+    mLay.EndRow()
+    mLay.EndGroup()  # G0E
+
+    mLay.AddTab('Settings')
+    mLay.AddGroup('Settings')
+    mLay.AddRow()
+    mLay.AddGroup('Misc')
+    mLay.AddItem('hideroots', 'Hide Roots')
+    mLay.AddItem('hideeffs', 'Hide Effectors')
+    mLay.AddItem('weld', 'Weld Boundary Edges')
+    mLay.AddItem('log', 'Log MSH Unpack')
+    mLay.AddItem('triangulate', 'Triangulate')
+    mLay.AddItem('show_finished_dialog', 'Show dialog on completion')
+    mLay.EndGroup()
+
+    mLay.AddGroup('', 0)
+    mLay.AddGroup('Colors')
+    mLay.AddItem('wirecol', 'Color Nulls')
+    mLay.AddRow()
+    mLay.AddColor('Rbone', 'Bones', False)
+    mLay.AddSpacer(1, 0)
+    mLay.AddColor('Rroot', 'Roots', False)
+    mLay.AddSpacer(1, 0)
+    mLay.AddColor('Reff', 'Effs', False)
+    mLay.EndRow()
+    mLay.EndGroup()
+    mLay.AddRow()
+    mLay.AddStaticText('')
+    mLay.AddButton('EClose', 'Close')
+    mLay.EndRow()
+    mLay.EndGroup()
+    mLay.EndRow()
+    mLay.EndGroup()
+
+    desk = xsi.Desktop.ActiveLayout
+    view = desk.CreateView('Property Panel', 'MSH Import')
+    view.BeginEdit()
+    view.Resize(600, 240)
+    view.SetAttributeValue('targetcontent', pS.FullName)
+    view.EndEdit()
+    return True
+
+
+def OpenImportLog_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+    return True
+
+
+def OpenImportLog_Execute():
+    add_to_path()
+    import softimage
+    reload(softimage)
+    import webbrowser
+    import os.path as p
+    path = p.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'import_log.log')
+    if not p.isfile(path):
+        uitk.MsgBox('Cant find {0}. Maybe you didnt import anything yet?'.format(path))
+        return True
+    webbrowser.open(path)
+    return True
+
+
+def OpenExportLog_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+    return True
+
+
+def OpenExportLog_Execute():
+    add_to_path()
+    import softimage
+    reload(softimage)
+    import webbrowser
+    import os.path as p
+    path = p.join(softimage.Softimage.get_plugin_origin('XSIZETools'), 'export_log.log')
+    if not p.isfile(path):
+        uitk.MsgBox('Cant find {0}. Maybe you didnt export anything yet?'.format(path))
+        return True
+    webbrowser.open(path)
+    return True
+
+
+def MaterialEdit_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+
+    return True
+
+
+def MaterialEdit_Execute():
+    add_to_path()
+    import softimage
+    reload(softimage)
+    for x in xsi.ActiveSceneRoot.Properties:
+        if x.Name == 'MaterialEdit':
+            xsi.DeleteObj('MaterialEdit')
+    pset = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'MaterialEdit')
+    pset.AddParameter3('materials', const.siString)
+    pset.AddParameter3('mat_name', const.siString, 'Phong')
+    pset.AddParameter3('matbit', const.siString, '')
+    mlay = pset.PPGLayout
+    mlay.SetAttribute(const.siUILogicFile, softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Application\\Logic\\material_manager.py')
+    mlay.Language = 'pythonscript'
+
+    materials = get_scene_materials('variants')
+
+    mlay.AddGroup('Material Manager', 1)
+    mlay.AddRow()
+    box = mlay.AddGroup('', 0)
+    box.SetAttribute(const.siUIWidthPercentage, 50)
+    matname = mlay.AddItem('mat_name', '')
+    matname.SetAttribute(const.siUINoLabel, True)
+    listB = mlay.AddEnumControl('Materials', '', 'Materials', const.siControlListBox)
+    listB.SetAttribute('NoLabel', True)
+    listB.SetAttribute('MultiSelectionListBox', True)
+    listB.SetAttribute(const.siUICY, 350)
+    # listB.SetAttribute(const.siUICX, 150)
+    listB.UIItems = materials
+    mlay.EndGroup()
+    buttons_group = mlay.addGroup('', 0)
+    buttons_group.SetAttribute(const.siUIWidthPercentage, 20)
+    mlay.AddRow()
+    ctrl = mlay.AddGroup('', 0)
+    # ctrl.SetAttribute(const.siUIWidthPercentage, 20)
+    crebtn = mlay.AddButton('create_mat', 'Create')
+    crebtn.SetAttribute(const.siUICX, 55)
+    edibtn = mlay.AddButton('edit_mat', 'Edit')
+    edibtn.SetAttribute(const.siUICX, 55)
+    addbtn = mlay.AddButton('add_flags', 'ZEify')
+    addbtn.SetAttribute(const.siUICX, 55)
+    defbtn = mlay.AddButton('del_flags', 'De-ZEify')
+    defbtn.SetAttribute(const.siUICX, 55)
+    delbtn = mlay.AddButton('del_mat', 'Remove')
+    delbtn.SetAttribute(const.siUICX, 55)
+    mlay.AddSpacer(1, 45)
+    helbtn = mlay.AddButton('help_mat', 'Help')
+    helbtn.SetAttribute(const.siUICX, 55)
+    clobtn = mlay.AddButton('close_mat', 'Close')
+    clobtn.SetAttribute(const.siUICX, 55)
+    mlay.EndGroup()
+    bit = mlay.AddGroup('', 0)
+    # bit.SetAttribute(const.siUIWidthPercentage, 20)
+    astbtn = mlay.AddButton('assign_tex', 'Assign Tex')
+    astbtn.SetAttribute(const.siUICX, 65)
+    assbtn = mlay.AddButton('assign_mat', 'Assign')
+    assbtn.SetAttribute(const.siUICX, 65)
+    unabtn = mlay.AddButton('unassign_mat', 'Unassign')
+    unabtn.SetAttribute(const.siUICX, 65)
+    imagepath = softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Resources\\UI\\material_icon_zetools.bmp'
+    expbitmap = mlay.AddEnumControl('matbit', None, '', const.siControlBitmap)
+    expbitmap.SetAttribute(const.siUINoLabel, True)
+    expbitmap.SetAttribute(const.siUIFilePath, imagepath)
+    mlay.EndGroup()
+    mlay.EndRow()
+    mlay.EndGroup()
+    mlay.EndRow()
+    mlay.EndGroup()
+
+    desk = xsi.Desktop.ActiveLayout
+    view = desk.CreateView('Property Panel', 'Material Manager')
+    view.BeginEdit()
+    view.Resize(400, 450)
+
+    view.SetAttributeValue('targetcontent', pset.FullName)
+    view.EndEdit()
+
+
+def CLothCreate_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+    return True
+
+
+def ClothCreate_Execute():
+    add_to_path()
+    if not xsi.Selection(0):
+        uitk.MsgBox('No Model selected.')
+        return
+    prop = get_cloth_prop(xsi.Selection(0))
+    if prop:
+        if uitk.MsgBox('Already is cloth, delete the existing cloth and create a new one?', 4) == 6:
+            xsi.DeleteObj(prop)
+        else:
+            return
+    import utils
+    utils.add_cloth_property(xsi.Selection(0))
+    edit_prop(xsi.Selection(0))
+
+
+def EditCloth_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+    return True
+
+
+def EditCloth_Execute():
+    add_to_path()
+    if not xsi.Selection(0):
+        uitk.MsgBox('No Model selected.')
+        return
+    prop = get_cloth_prop(xsi.Selection(0))
+    if prop:
+        edit_prop(xsi.Selection(0))
+    else:
+        import utils
+        utils.add_cloth_property(xsi.Selection(0))
+        edit_prop(xsi.Selection(0))
+
+
+def MshJson_Init(in_ctxt):
+    oCmd = in_ctxt.Source
+    oCmd.Description = ''
+    oCmd.ReturnValue = True
+    return True
+
+
+def MshJson_Execute():
+    add_to_path()
+    import softimage
+    reload(softimage)
+    for x in xsi.ActiveSceneRoot.Properties:
+        if x.Name == 'MshText':
+            xsi.DeleteObj('MshText')
+
+    pS = xsi.ActiveSceneRoot.AddProperty('CustomProperty', False, 'MshText')
+    pS.AddParameter3('mshpath', const.siString, 'C:\\Users\\Administrator\\Documents\\')
+    pS.AddParameter3('txtpath', const.siString, 'C:\\Users\\Administrator\\Documents\\')
+    pS.AddParameter3('segmented', const.siBool, True, 0, 1, 0, 0)
+    pS.AddParameter3('dev', const.siBool, False, 0, 1, 0, 0)
+
+    mLay = pS.PPGLayout
+    mLay.SetAttribute(const.siUILogicFile, softimage.Softimage.get_plugin_origin('XSIZETools') + '\\Application\\Logic\\mshjson.py')
+    mLay.Language = 'pythonscript'
+
+    mLay.AddGroup('MSH Text', 1)
+
+    mshPathI = mLay.AddItem('mshpath', 'MSH File', const.siControlFilePath)
+    mshPathI.SetAttribute(const.siUINoLabel, 0)
+    mshPathI.SetAttribute(const.siUIFileFilter, 'MSH File (*.msh)|*.msh')
+    mshPathI.SetAttribute(const.siUIOpenFile, False)
+    mshPathI.SetAttribute(const.siUIFileMustExist, False)
+
+    txtPathI = mLay.AddItem('txtpath', 'TXT File', const.siControlFilePath)
+    txtPathI.SetAttribute(const.siUINoLabel, 0)
+    txtPathI.SetAttribute(const.siUIFileFilter, 'TXT File (*.txt)|*.txt')
+    txtPathI.SetAttribute(const.siUIOpenFile, False)
+    txtPathI.SetAttribute(const.siUIFileMustExist, False)
+
+    mLay.AddRow()
+    mLay.AddItem('segmented', 'Segmented')
+    mLay.AddItem('dev', 'DevMode')
+    mLay.AddButton('msh2txt', 'MSH to TXT')
+    mLay.AddButton('txt2msh', 'TXT to MSH')
+    mLay.EndRow()
+
+    mLay.EndGroup()
+
+    desk = xsi.Desktop.ActiveLayout
+    view = desk.CreateView('Property Panel', 'MSH to TXT')
+    view.BeginEdit()
+    view.Resize(400, 125)
+    view.SetAttributeValue('targetcontent', pS.FullName)
+    view.EndEdit()
+    return True
+
+#############################################################################################
+#############################################################################################
+
+
+def edit_prop(model):
+    prop = get_cloth_prop(model)
+    if prop:
+        xsi.InspectObj(prop, '', 'Edit Cloth', const.siLockAndForceNew)
+    else:
+        uitk.MsgBox('Model is no cloth.')
+
+
+def get_cloth_prop(model):
+    try:
+        if model:
+            for prop in model.Properties:
+                if 'ZECloth' in prop.Name:
+                    return prop
+    except:
+        return False
+
+
+def check_existence_bool(obj_name):
+    xsifact = win32com.client.Dispatch('XSI.Factory')
+    collection = xsifact.CreateObject('XSI.Collection')
+    collection.items = obj_name
+    if collection.Count == 1:
+        return True
+    return False
+
+
+def get_scene_materials(listtype='list'):
+    mats = []
+    matlibs = xsi.ActiveProject.ActiveScene.MaterialLibraries
+    for lib in matlibs:
+        for mat in lib.Items:
+            mats.append(mat)
+    if listtype == 'variants':
+        newmats = []
+        for index, mat in enumerate(mats):
+            name = [mat.Name]
+            prop = get_msh_material_property(mat)
+            usedby = mat.UsedBy
+            if usedby.Count > 0:
+                if prop:
+                    name.append(' - ZE | {0}'.format(usedby.Count))
+                else:
+                    name.append(' - {0}'.format(usedby.Count))
+            else:
+                if prop:
+                    name.append(' - ZE')
+            newmats.append(''.join(name))
+            newmats.append(mat.Name)
+        return newmats
+    return mats
+
+
+def get_msh_material_property(material):
+    for prop in material.Properties:
+        if 'ZeroEngine_Flags' in prop.Name:
+            return prop